Raloxifene Hydrochloride
(BKXVVCILCIUCLG-UHFFFAOYSA-N)
Structure
- SMILES
- Oc1ccc2c(c1)sc(c2C(=O)c1ccc(cc1)OCCN1CCCCC1)c1ccc(cc1)O.Cl
- Molecular Formula:
- C28H28ClNO4S
- Molecular Weight:
- 510.044
- Log P:
- 6.8151
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 3
- TPSA:
- 98.24
- CAS Number(s):
- 82640-04-8
Synonym(s)
1.
Raloxifene Hydrochloride
2.
Raloxifene
3.
Evista
4.
Keoxifene
5.
Keoxifene Hydrochloride
6.
LY 139481
7.
LY 156758
8.
LY-139481
9.
LY-156758
10.
Raloxifene HCl
11.
LY139481
12.
LY156758
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pain | FAERS: 233 | 25299349 | CTD US FAERS |
| 2 | Pulmonary Embolism | FAERS: 191 Canada Vigilance: 1 | 11755578 18278183 | CTD Canada Vigilance US FAERS |
| 3 | Deep Vein Thrombosis | FAERS: 188 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 4 | Thrombosis | FAERS: 141 Canada Vigilance: 1 | 18758128 | CTD Canada Vigilance US FAERS |
| 5 | Bone density decreased | FAERS: 140 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Cerebrovascular accident | FAERS: 127 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Arthralgia | FAERS: 122 | US FAERS | |
| 8 | Arthritis | FAERS: 109 | US FAERS | |
| 9 | Drug ineffective | FAERS: 103 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 10 | Fracture | FAERS: 98 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Back Pain | FAERS: 80 | US FAERS | |
| 12 | Dizziness | FAERS: 67 | US FAERS | |
| 13 | Limb injury | FAERS: 60 | US FAERS | |
| 14 | Alopecia | FAERS: 59 | US FAERS | |
| 15 | Osteoporosis | FAERS: 59 | CTD US FAERS | |
| 16 | Nausea | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Malaise | FAERS: 50 | US FAERS | |
| 18 | Cerebral Infarction | FAERS: 49 | US FAERS | |
| 19 | Myocardial Infarction | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 20 | Feeling abnormal | FAERS: 47 | US FAERS | |
| 21 | Headache | FAERS: 47 | US FAERS | |
| 22 | Peripheral swelling | FAERS: 47 | US FAERS | |
| 23 | Fatigue | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Asthenia | FAERS: 43 | US FAERS | |
| 25 | Uterine Cancer | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Joint swelling | FAERS: 41 | US FAERS | |
| 27 | Myalgia | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Cataract | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Palpitations | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Bone pain | FAERS: 31 | US FAERS | |
| 31 | Anxiety | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 32 | Musculoskeletal stiffness | FAERS: 30 | US FAERS | |
| 33 | Chest Pain | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 34 | Retinal Vein Occlusion | FAERS: 28 | US FAERS | |
| 35 | Ankle Fracture | FAERS: 27 | US FAERS | |
| 36 | Intentional product misuse | FAERS: 25 | US FAERS | |
| 37 | Abdominal discomfort | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Vomiting | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 39 | Constipation | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Dyspepsia | FAERS: 22 | US FAERS | |
| 41 | Adverse event | FAERS: 20 | US FAERS | |
| 42 | Burning sensation | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 43 | Musculoskeletal Pain | FAERS: 20 | US FAERS | |
| 44 | Night sweats | FAERS: 20 | US FAERS | |
| 45 | Pruritus | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Discomfort | FAERS: 19 | US FAERS | |
| 47 | Hypersensitivity | FAERS: 19 | US FAERS | |
| 48 | Weight decreased | FAERS: 19 | US FAERS | |
| 49 | Aspartate Aminotransferase Increased | FAERS: 18 | US FAERS | |
| 50 | Drug dose omission | FAERS: 18 | US FAERS | |
| 51 | Embolism | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Macular degeneration | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Osteopenia | FAERS: 18 | US FAERS | |
| 54 | Retinal vascular thrombosis | FAERS: 18 | US FAERS | |
| 55 | Visual Impairment | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | Compression fracture | FAERS: 17 | US FAERS | |
| 57 | Erythema | FAERS: 17 | US FAERS | |
| 58 | Neck Pain | FAERS: 17 | US FAERS | |
| 59 | Pulmonary thrombosis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Visual disturbance | FAERS: 17 | US FAERS | |
| 61 | Alanine Aminotransferase Increased | FAERS: 16 | US FAERS | |
| 62 | Blindness | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Endometrial Hyperplasia | FAERS: 16 | US FAERS | |
| 64 | Muscle Cramp | FAERS: 16 | 16197663 | CTD US FAERS |
| 65 | Vaginal Discharge | FAERS: 16 | US FAERS | |
| 66 | Vulvovaginal dryness | FAERS: 16 | US FAERS | |
| 67 | Activities of daily living impaired | FAERS: 15 | US FAERS | |
| 68 | Breast cancer recurrent | FAERS: 15 | US FAERS | |
| 69 | Limb discomfort | FAERS: 15 | US FAERS | |
| 70 | Pneumonia | FAERS: 15 | US FAERS | |
| 71 | Urticaria | FAERS: 15 | US FAERS | |
| 72 | Uterine Polyp | FAERS: 15 | US FAERS | |
| 73 | Atrial Fibrillation | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Flatulence | FAERS: 14 | US FAERS | |
| 75 | Nasopharyngitis | FAERS: 14 | US FAERS | |
| 76 | Abdominal Pain | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Blood triglycerides increased | FAERS: 13 | US FAERS | |
| 78 | Breast tenderness | FAERS: 13 | US FAERS | |
| 79 | Lymphoma | FAERS: 13 | US FAERS | |
| 80 | Osteonecrosis of Jaw | FAERS: 13 | US FAERS | |
| 81 | Chest discomfort | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Influenza | FAERS: 12 | US FAERS | |
| 83 | Tremor | FAERS: 12 | US FAERS | |
| 84 | Arthropathy | FAERS: 11 | US FAERS | |
| 85 | Diabetes Mellitus | FAERS: 11 | 11475503 | CTD US FAERS |
| 86 | Memory impairment | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Oropharyngeal pain | FAERS: 11 | US FAERS | |
| 88 | Stress | FAERS: 11 | US FAERS | |
| 89 | Abasia | FAERS: 10 | US FAERS | |
| 90 | Amnesia | FAERS: 10 | US FAERS | |
| 91 | Blood cholesterol increased | FAERS: 10 | US FAERS | |
| 92 | Chills | FAERS: 10 | US FAERS | |
| 93 | Depressed mood | FAERS: 10 | US FAERS | |
| 94 | Metrorrhagia | FAERS: 10 | US FAERS | |
| 95 | Phlebitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Sinusitis | FAERS: 10 | US FAERS | |
| 97 | Swelling | FAERS: 10 | US FAERS | |
| 98 | Tinnitus | FAERS: 10 | US FAERS | |
| 99 | Accidental overdose | FAERS: 9 | US FAERS | |
| 100 | Breast cancer stage III | FAERS: 9 | US FAERS | |
| 101 | Diverticulitis | FAERS: 9 | US FAERS | |
| 102 | Glaucoma | FAERS: 9 | US FAERS | |
| 103 | Hemiparesis | FAERS: 9 | US FAERS | |
| 104 | Inappropriate schedule of drug administration | FAERS: 9 | US FAERS | |
| 105 | Joint injury | FAERS: 9 | US FAERS | |
| 106 | Joint stiffness | FAERS: 9 | US FAERS | |
| 107 | Nephrolithiasis | FAERS: 9 | US FAERS | |
| 108 | Venous Thrombosis | FAERS: 9 Canada Vigilance: 2 | 15577136 18278183 | CTD Canada Vigilance US FAERS |
| 109 | Vitreous floaters | FAERS: 9 | US FAERS | |
| 110 | Angina Pectoris | FAERS: 8 | US FAERS | |
| 111 | Back disorder | FAERS: 8 | US FAERS | |
| 112 | Bone density abnormal | FAERS: 8 | US FAERS | |
| 113 | Bronchitis | FAERS: 8 | US FAERS | |
| 114 | Carpal Tunnel Syndrome | FAERS: 8 | US FAERS | |
| 115 | Drug withdrawal syndrome | FAERS: 8 | US FAERS | |
| 116 | Gamma-Glutamyltransferase Increased | FAERS: 8 | US FAERS | |
| 117 | Meningioma | FAERS: 8 | US FAERS | |
| 118 | Mood swings | FAERS: 8 | US FAERS | |
| 119 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 120 | Throat irritation | FAERS: 8 | US FAERS | |
| 121 | Toothache | FAERS: 8 | US FAERS | |
| 122 | Deafness | FAERS: 7 | US FAERS | |
| 123 | Diplopia | FAERS: 7 | US FAERS | |
| 124 | Flushing | FAERS: 7 | US FAERS | |
| 125 | Medication Error | FAERS: 7 | US FAERS | |
| 126 | No adverse event | FAERS: 7 | US FAERS | |
| 127 | Portal Vein Thrombosis | FAERS: 7 | US FAERS | |
| 128 | Post procedural complication | FAERS: 7 | US FAERS | |
| 129 | Product substitution issue | FAERS: 7 | US FAERS | |
| 130 | Vertigo | FAERS: 7 | US FAERS | |
| 131 | jaundice | FAERS: 7 | US FAERS | |
| 132 | Asthma | FAERS: 6 | US FAERS | |
| 133 | Bedridden | FAERS: 6 | US FAERS | |
| 134 | Blood cholesterol abnormal | FAERS: 6 | US FAERS | |
| 135 | Carotid Artery Thrombosis | FAERS: 6 | US FAERS | |
| 136 | Dehydration | FAERS: 6 | US FAERS | |
| 137 | Dementia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 138 | Drug dispensing error | FAERS: 6 | US FAERS | |
| 139 | Dry skin | FAERS: 6 | US FAERS | |
| 140 | Endometrial cancer stage III | FAERS: 6 | US FAERS | |
| 141 | Eye pain | FAERS: 6 | US FAERS | |
| 142 | Fibromyalgia | FAERS: 6 | US FAERS | |
| 143 | Inflammation | FAERS: 6 | US FAERS | |
| 144 | Intentional drug misuse | FAERS: 6 | US FAERS | |
| 145 | Multiple Sclerosis | FAERS: 6 | US FAERS | |
| 146 | Pancreatic carcinoma | FAERS: 6 | US FAERS | |
| 147 | Peripheral embolism | FAERS: 6 | US FAERS | |
| 148 | Product quality issue | FAERS: 6 | US FAERS | |
| 149 | Pulmonary Infarction | FAERS: 6 | US FAERS | |
| 150 | Restless Legs Syndrome | FAERS: 6 | US FAERS | |
| 151 | Retinal vascular occlusion | FAERS: 6 | US FAERS | |
| 152 | Thirst | FAERS: 6 | US FAERS | |
| 153 | Thoracic vertebral fracture | FAERS: 6 | US FAERS | |
| 154 | Urinary tract infection | FAERS: 6 | US FAERS | |
| 155 | Acne | FAERS: 5 | US FAERS | |
| 156 | Aneurysm | FAERS: 5 | US FAERS | |
| 157 | Anorexia | FAERS: 5 | US FAERS | |
| 158 | Aortic Aneurysm | FAERS: 5 | US FAERS | |
| 159 | Aphasia | FAERS: 5 | US FAERS | |
| 160 | Blood alkaline phosphatase increased | FAERS: 5 | US FAERS | |
| 161 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 162 | Blood pressure fluctuation | FAERS: 5 | US FAERS | |
| 163 | Cataract operation | FAERS: 5 | US FAERS | |
| 164 | Cerebral Thrombosis | FAERS: 5 | US FAERS | |
| 165 | Coronary Artery Disease | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Disability | FAERS: 5 | US FAERS | |
| 167 | Endometrial cancer stage II | FAERS: 5 | US FAERS | |
| 168 | Erythema Nodosum | FAERS: 5 | US FAERS | |
| 169 | Gastric Bypass | FAERS: 5 | US FAERS | |
| 170 | Gastric ulcer | FAERS: 5 | US FAERS | |
| 171 | Hepatitis | FAERS: 5 | US FAERS | |
| 172 | Hypotension | FAERS: 5 | US FAERS | |
| 173 | Immobile | FAERS: 5 | US FAERS | |
| 174 | Infection | FAERS: 5 | US FAERS | |
| 175 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 176 | Menorrhagia | FAERS: 5 | US FAERS | |
| 177 | Muscle tightness | FAERS: 5 | US FAERS | |
| 178 | Nerve injury | FAERS: 5 | US FAERS | |
| 179 | Nervousness | FAERS: 5 | US FAERS | |
| 180 | No adverse effect | FAERS: 5 | US FAERS | |
| 181 | Oral pain | FAERS: 5 | US FAERS | |
| 182 | Pancytopenia | FAERS: 5 | US FAERS | |
| 183 | Pneumonitis | FAERS: 5 | US FAERS | |
| 184 | Somnolence | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Syncope | FAERS: 5 | US FAERS | |
| 186 | Tachycardia | FAERS: 5 | US FAERS | |
| 187 | Thrombophlebitis | FAERS: 5 | US FAERS | |
| 188 | Tooth Infection | FAERS: 5 | US FAERS | |
| 189 | Unevaluable event | FAERS: 5 | US FAERS | |
| 190 | Venous thrombosis limb | FAERS: 5 | US FAERS | |
| 191 | Arteriosclerosis | FAERS: 4 | US FAERS | |
| 192 | Bone scan abnormal | FAERS: 4 | US FAERS | |
| 193 | Breast Microcalcification | FAERS: 4 | US FAERS | |
| 194 | Crying | FAERS: 4 | US FAERS | |
| 195 | Cystitis | FAERS: 4 | US FAERS | |
| 196 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 197 | Dysgeusia | FAERS: 4 | US FAERS | |
| 198 | Dysphonia | FAERS: 4 | US FAERS | |
| 199 | Endometrial hypertrophy | FAERS: 4 | US FAERS | |
| 200 | Endometriosis | FAERS: 4 | US FAERS | |
| 201 | Epistaxis | FAERS: 4 | US FAERS | |
| 202 | Formication | FAERS: 4 | US FAERS | |
| 203 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 204 | Impaired work ability | FAERS: 4 | US FAERS | |
| 205 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 206 | Irritable Bowel Syndrome | FAERS: 4 | US FAERS | |
| 207 | Lactose Intolerance | FAERS: 4 | US FAERS | |
| 208 | Multiple Myeloma | FAERS: 4 | 16497877 | CTD US FAERS |
| 209 | Onychoclasis | FAERS: 4 | US FAERS | |
| 210 | Osteomyelitis | FAERS: 4 | US FAERS | |
| 211 | Overdose | FAERS: 4 | US FAERS | |
| 212 | Pancreatitis | FAERS: 4 | US FAERS | |
| 213 | Polymyalgia Rheumatica | FAERS: 4 | US FAERS | |
| 214 | Tooth Extraction | FAERS: 4 | US FAERS | |
| 215 | Tooth Loss | FAERS: 4 | US FAERS | |
| 216 | Urinary Retention | FAERS: 4 | US FAERS | |
| 217 | Ventricular Fibrillation | FAERS: 4 | US FAERS | |
| 218 | Wheezing | FAERS: 4 | US FAERS | |
| 219 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 220 | Adenocarcinoma | FAERS: 3 | US FAERS | |
| 221 | Agitation | FAERS: 3 | US FAERS | |
| 222 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 223 | Angle Closure Glaucoma | FAERS: 3 | US FAERS | |
| 224 | Aphonia | FAERS: 3 | US FAERS | |
| 225 | Basal cell carcinoma | FAERS: 3 | US FAERS | |
| 226 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 227 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 228 | Blood parathyroid hormone increased | FAERS: 3 | US FAERS | |
| 229 | Brain Contusion | FAERS: 3 | US FAERS | |
| 230 | Breast cancer stage II | FAERS: 3 | US FAERS | |
| 231 | Breast discomfort | FAERS: 3 | US FAERS | |
| 232 | Bursitis | FAERS: 3 | US FAERS | |
| 233 | Cervical dysplasia | FAERS: 3 | US FAERS | |
| 234 | Cervix carcinoma | FAERS: 3 | US FAERS | |
| 235 | Choking | FAERS: 3 | US FAERS | |
| 236 | Dental caries | FAERS: 3 | US FAERS | |
| 237 | Disease recurrence | FAERS: 3 | US FAERS | |
| 238 | Dysarthria | FAERS: 3 | US FAERS | |
| 239 | Ecchymosis | FAERS: 3 | US FAERS | |
| 240 | Endodontic procedure | FAERS: 3 | US FAERS | |
| 241 | Eructation | FAERS: 3 | US FAERS | |
| 242 | Eye irritation | FAERS: 3 | US FAERS | |
| 243 | Facial Pain | FAERS: 3 | US FAERS | |
| 244 | Feeling Cold | FAERS: 3 | US FAERS | |
| 245 | Feeling jittery | FAERS: 3 | US FAERS | |
| 246 | Frustration | FAERS: 3 | US FAERS | |
| 247 | Gastritis | FAERS: 3 | US FAERS | |
| 248 | Gingival Recession | FAERS: 3 | US FAERS | |
| 249 | Head discomfort | FAERS: 3 | US FAERS | |
| 250 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 251 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 252 | Joint adhesion | FAERS: 3 | US FAERS | |
| 253 | Low density lipoprotein increased | FAERS: 3 | US FAERS | |
| 254 | MYELODYSPLASTIC SYNDROME | FAERS: 3 | US FAERS | |
| 255 | Metastasis | FAERS: 3 | US FAERS | |
| 256 | Musculoskeletal discomfort | FAERS: 3 | US FAERS | |
| 257 | Nonspecific reaction | FAERS: 3 | US FAERS | |
| 258 | Obesity | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 259 | Pathological fracture | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 261 | Precancerous cells present | FAERS: 3 | US FAERS | |
| 262 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 263 | Sciatica | FAERS: 3 | US FAERS | |
| 264 | Sneezing | FAERS: 3 | US FAERS | |
| 265 | Spinal column stenosis | FAERS: 3 | US FAERS | |
| 266 | Stomatitis | FAERS: 3 | US FAERS | |
| 267 | Supraventricular tachycardia | FAERS: 3 | US FAERS | |
| 268 | Transaminases increased | FAERS: 3 | US FAERS | |
| 269 | Trichorrhexis | FAERS: 3 | US FAERS | |
| 270 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 271 | Vitreous Detachment | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 272 | kyphosis | FAERS: 3 | US FAERS | |
| 273 | Abdominal strangulated hernia | FAERS: 2 | US FAERS | |
| 274 | Allergy to chemicals | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 275 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 276 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 277 | Anger | FAERS: 2 | US FAERS | |
| 278 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 2 | US FAERS | |
| 279 | Antiphospholipid antibodies positive | FAERS: 2 | US FAERS | |
| 280 | Arterial thrombosis | FAERS: 2 | US FAERS | |
| 281 | Asthenopia | FAERS: 2 | US FAERS | |
| 282 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 283 | Atrial thrombosis | FAERS: 2 | US FAERS | |
| 284 | Bladder Neoplasm | FAERS: 2 | US FAERS | |
| 285 | Blood cholinesterase increased | FAERS: 2 | US FAERS | |
| 286 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 287 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 288 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 289 | Blood urine present | FAERS: 2 | US FAERS | |
| 290 | Body fat disorder | FAERS: 2 | US FAERS | |
| 291 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 292 | Breast hyperplasia | FAERS: 2 | US FAERS | |
| 293 | Carotid artery aneurysm | FAERS: 2 | US FAERS | |
| 294 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 295 | Colitis | FAERS: 2 | US FAERS | |
| 296 | Counterfeit drug administered | FAERS: 2 | US FAERS | |
| 297 | Cyst | FAERS: 2 | US FAERS | |
| 298 | Death of spouse | FAERS: 2 | US FAERS | |
| 299 | Dermatitis | FAERS: 2 | US FAERS | |
| 300 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 301 | Drug administration error | FAERS: 2 | US FAERS | |
| 302 | Dysuria | FAERS: 2 | US FAERS | |
| 303 | Economic problem | FAERS: 2 | US FAERS | |
| 304 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 305 | Emotional disorder | FAERS: 2 | US FAERS | |
| 306 | Emotional distress | FAERS: 2 | US FAERS | |
| 307 | Endometrial disorder | FAERS: 2 | US FAERS | |
| 308 | Enterocolitis | FAERS: 2 | US FAERS | |
| 309 | Epilepsy | FAERS: 2 | US FAERS | |
| 310 | Erythropsia | FAERS: 2 | US FAERS | |
| 311 | Expired product administered | FAERS: 2 | US FAERS | |
| 312 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 313 | Fibroadenoma of breast | FAERS: 2 | US FAERS | |
| 314 | Flank Pain | FAERS: 2 | US FAERS | |
| 315 | Gammopathy | FAERS: 2 | US FAERS | |
| 316 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 317 | Gingival Hypertrophy | FAERS: 2 | US FAERS | |
| 318 | Gingivitis | FAERS: 2 | US FAERS | |
| 319 | Global Amnesia | FAERS: 2 | US FAERS | |
| 320 | Gluten sensitivity | FAERS: 2 | US FAERS | |
| 321 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 322 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 323 | Hip surgery | FAERS: 2 | US FAERS | |
| 324 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 325 | Hunger | FAERS: 2 | US FAERS | |
| 326 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 327 | Hyperplasia | FAERS: 2 | US FAERS | |
| 328 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 329 | Inappropriate affect | FAERS: 2 | US FAERS | |
| 330 | Incisional hernia | FAERS: 2 | US FAERS | |
| 331 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 332 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 333 | Infarction | FAERS: 2 | US FAERS | |
| 334 | Initial insomnia | FAERS: 2 | US FAERS | |
| 335 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 336 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 337 | Laryngitis | FAERS: 2 | US FAERS | |
| 338 | Limb crushing injury | FAERS: 2 | US FAERS | |
| 339 | Limb operation | FAERS: 2 | US FAERS | |
| 340 | Lip swelling | FAERS: 2 | US FAERS | |
| 341 | Lipase increased | FAERS: 2 | US FAERS | |
| 342 | Liposarcoma recurrent | FAERS: 2 | US FAERS | |
| 343 | Medication residue present | FAERS: 2 | US FAERS | |
| 344 | Mental impairment | FAERS: 2 | US FAERS | |
| 345 | Middle insomnia | FAERS: 2 | US FAERS | |
| 346 | Mucinous endometrial carcinoma | FAERS: 2 | US FAERS | |
| 347 | Muscle strain | FAERS: 2 | US FAERS | |
| 348 | Myopia | FAERS: 2 | US FAERS | |
| 349 | Nipple pain | FAERS: 2 | US FAERS | |
| 350 | Ocular vascular disorder | FAERS: 2 | US FAERS | |
| 351 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 352 | Osteitis Deformans | FAERS: 2 | US FAERS | |
| 353 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 354 | Peripheral venous disease | FAERS: 2 | US FAERS | |
| 355 | Pleurisy | FAERS: 2 | US FAERS | |
| 356 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 357 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 358 | Presyncope | FAERS: 2 | US FAERS | |
| 359 | Productive Cough | FAERS: 2 | US FAERS | |
| 360 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 361 | Purpura | FAERS: 2 | 15770314 | CTD US FAERS |
| 362 | Rectocele | FAERS: 2 | US FAERS | |
| 363 | Rectosigmoid cancer | FAERS: 2 | US FAERS | |
| 364 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 365 | Retinal aneurysm | FAERS: 2 | US FAERS | |
| 366 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 367 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 368 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 369 | Scab | FAERS: 2 | US FAERS | |
| 370 | Scotoma | FAERS: 2 | US FAERS | |
| 371 | Screaming | FAERS: 2 | US FAERS | |
| 372 | Sight disability | FAERS: 2 | US FAERS | |
| 373 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 374 | Skin tightness | FAERS: 2 | US FAERS | |
| 375 | Sleep disorder due to a general medical condition | FAERS: 2 | US FAERS | |
| 376 | Spinal fusion surgery | FAERS: 2 | US FAERS | |
| 377 | Stress at work | FAERS: 2 | US FAERS | |
| 378 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 379 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 380 | Thyroiditis | FAERS: 2 | US FAERS | |
| 381 | Upper respiratory tract congestion | FAERS: 2 | US FAERS | |
| 382 | Uterine Prolapse | FAERS: 2 | 12861143 | CTD US FAERS |
| 383 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 384 | Vasculitis | FAERS: 2 | US FAERS | |
| 385 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 386 | Vulvovaginal pain | FAERS: 2 | US FAERS | |
| 387 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 388 | Walking aid user | FAERS: 2 | US FAERS | |
| 389 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 390 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 391 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 392 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 393 | Acromegaly | FAERS: 1 | US FAERS | |
| 394 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 395 | Amaurosis | FAERS: 1 | US FAERS | |
| 396 | Anti-thyroid antibody positive | FAERS: 1 | US FAERS | |
| 397 | Arthrodesis | FAERS: 1 | US FAERS | |
| 398 | Ascites | FAERS: 1 | US FAERS | |
| 399 | Astigmatism | FAERS: 1 | US FAERS | |
| 400 | Atelectasis | FAERS: 1 | US FAERS | |
| 401 | Atherosclerosis | FAERS: 1 | US FAERS | |
| 402 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 403 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 404 | Atypical fracture | FAERS: 1 | US FAERS | |
| 405 | Basilar artery occlusion | FAERS: 1 | US FAERS | |
| 406 | Bed rest | FAERS: 1 | US FAERS | |
| 407 | Behavioural and psychiatric symptoms of dementia | FAERS: 1 | US FAERS | |
| 408 | Bereavement | FAERS: 1 | US FAERS | |
| 409 | Biopsy breast abnormal | FAERS: 1 | US FAERS | |
| 410 | Biopsy breast normal | FAERS: 1 | US FAERS | |
| 411 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 412 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 413 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 414 | Blood cholesterol | FAERS: 1 | US FAERS | |
| 415 | Blood cholinesterase abnormal | FAERS: 1 | US FAERS | |
| 416 | Blood follicle stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 417 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 418 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 419 | Blood growth hormone abnormal | FAERS: 1 | US FAERS | |
| 420 | Blood prolactin decreased | FAERS: 1 | US FAERS | |
| 421 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 422 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 423 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 424 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 425 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 426 | Body Height | FAERS: 1 | US FAERS | |
| 427 | Bone density increased | FAERS: 1 | US FAERS | |
| 428 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 429 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 430 | Breast Cyst | FAERS: 1 | US FAERS | |
| 431 | Breast infection | FAERS: 1 | US FAERS | |
| 432 | Breast necrosis | FAERS: 1 | US FAERS | |
| 433 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 434 | Bronchospasm | FAERS: 1 | US FAERS | |
| 435 | CREST Syndrome | FAERS: 1 | US FAERS | |
| 436 | Carbohydrate antigen 15-3 increased | FAERS: 1 | US FAERS | |
| 437 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 438 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 439 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 440 | Cardiac pacemaker evaluation | FAERS: 1 | US FAERS | |
| 441 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 442 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 443 | Cellulitis | FAERS: 1 | US FAERS | |
| 444 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 445 | Chloasma | FAERS: 1 | US FAERS | |
| 446 | Choking sensation | FAERS: 1 | US FAERS | |
| 447 | Chondrosarcoma | FAERS: 1 | US FAERS | |
| 448 | Chromaturia | FAERS: 1 | US FAERS | |
| 449 | Chronic pigmented purpura | FAERS: 1 | US FAERS | |
| 450 | Clumsiness | FAERS: 1 | US FAERS | |
| 451 | Coagulation time abnormal | FAERS: 1 | US FAERS | |
| 452 | Cold sweat | FAERS: 1 | US FAERS | |
| 453 | Colectomy | FAERS: 1 | US FAERS | |
| 454 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 455 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 456 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 457 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 458 | Cyanosis | FAERS: 1 | US FAERS | |
| 459 | Cystocele | FAERS: 1 | US FAERS | |
| 460 | Cytology abnormal | FAERS: 1 | US FAERS | |
| 461 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 462 | Deformity | FAERS: 1 | US FAERS | |
| 463 | Dental Fistula | FAERS: 1 | US FAERS | |
| 464 | Deoxypyridinoline urine increased | FAERS: 1 | US FAERS | |
| 465 | Device related infection | FAERS: 1 | US FAERS | |
| 466 | Disease Progression | FAERS: 1 | US FAERS | |
| 467 | Diverticulum | FAERS: 1 | US FAERS | |
| 468 | Drug abuse | FAERS: 1 | US FAERS | |
| 469 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 470 | Drug toxicity | FAERS: 1 | US FAERS | |
| 471 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 472 | Dyspareunia | FAERS: 1 | US FAERS | |
| 473 | Dystonia | FAERS: 1 | US FAERS | |
| 474 | Eczema | FAERS: 1 | US FAERS | |
| 475 | Embolic stroke | FAERS: 1 | US FAERS | |
| 476 | Endometrial adenocarcinoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 477 | Endometrial sarcoma | FAERS: 1 | US FAERS | |
| 478 | Endometrial thickening | FAERS: 1 | US FAERS | |
| 479 | Enteritis | FAERS: 1 | US FAERS | |
| 480 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 481 | Epidermal growth factor receptor increased | FAERS: 1 | US FAERS | |
| 482 | Essential Tremor | FAERS: 1 | US FAERS | |
| 483 | Extra dose administered | FAERS: 1 | US FAERS | |
| 484 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 485 | Eye operation complication | FAERS: 1 | US FAERS | |
| 486 | Facial Neuralgia | FAERS: 1 | US FAERS | |
| 487 | False positive investigation result | FAERS: 1 | US FAERS | |
| 488 | Food Allergy | FAERS: 1 | US FAERS | |
| 489 | Food craving | FAERS: 1 | US FAERS | |
| 490 | Foreign body trauma | FAERS: 1 | US FAERS | |
| 491 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 492 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 493 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 494 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 495 | Gastrostomy | FAERS: 1 | US FAERS | |
| 496 | Genital discharge | FAERS: 1 | US FAERS | |
| 497 | Genital discomfort | FAERS: 1 | US FAERS | |
| 498 | Glossitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 499 | Gout | FAERS: 1 | US FAERS | |
| 500 | Granuloma | FAERS: 1 | US FAERS | |
| 501 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 502 | Hemiplegia | FAERS: 1 | US FAERS | |
| 503 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 504 | Hepatitis A | FAERS: 1 | US FAERS | |
| 505 | Hepatitis B | FAERS: 1 | US FAERS | |
| 506 | Hepatitis C | FAERS: 1 | US FAERS | |
| 507 | Hirsutism | FAERS: 1 | US FAERS | |
| 508 | Homans' sign | FAERS: 1 | US FAERS | |
| 509 | Hordeolum | FAERS: 1 | US FAERS | |
| 510 | Hydrometra | FAERS: 1 | US FAERS | |
| 511 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 512 | Hypersomnia | FAERS: 1 | US FAERS | |
| 513 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 514 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 515 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 516 | Hypervitaminosis | FAERS: 1 | US FAERS | |
| 517 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 518 | Hypochondriasis | FAERS: 1 | US FAERS | |
| 519 | Hypokinesia | FAERS: 1 | US FAERS | |
| 520 | Hypophagia | FAERS: 1 | US FAERS | |
| 521 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 522 | Hypoxia | FAERS: 1 | US FAERS | |
| 523 | Hysterectomy | FAERS: 1 | US FAERS | |
| 524 | Ileus | FAERS: 1 | US FAERS | |
| 525 | Illogical thinking | FAERS: 1 | US FAERS | |
| 526 | Immunosuppression | FAERS: 1 | US FAERS | |
| 527 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 528 | Implant site infection | FAERS: 1 | US FAERS | |
| 529 | Implant site swelling | FAERS: 1 | US FAERS | |
| 530 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 531 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 532 | Intercepted product selection error | FAERS: 1 | US FAERS | |
| 533 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 534 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 535 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 536 | Intraductal papilloma of breast | FAERS: 1 | US FAERS | |
| 537 | Intraocular pressure test | FAERS: 1 | US FAERS | |
| 538 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 539 | Invasive papillary breast carcinoma | FAERS: 1 | US FAERS | |
| 540 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 541 | Leukopenia | FAERS: 1 | US FAERS | |
| 542 | Life expectancy shortened | FAERS: 1 | US FAERS | |
| 543 | Ligament injury | FAERS: 1 | US FAERS | |
| 544 | Ligament rupture | FAERS: 1 | US FAERS | |
| 545 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 546 | Limb fracture | FAERS: 1 | US FAERS | |
| 547 | Lip sloughing | FAERS: 1 | US FAERS | |
| 548 | Lipoma | FAERS: 1 | US FAERS | |
| 549 | Living in residential institution | FAERS: 1 | US FAERS | |
| 550 | Lymphangioleiomyomatosis | FAERS: 1 | US FAERS | |
| 551 | Malabsorption | FAERS: 1 | US FAERS | |
| 552 | Malignant melanoma stage IV | FAERS: 1 | US FAERS | |
| 553 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 554 | Malignant ovarian cyst | FAERS: 1 | US FAERS | |
| 555 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 556 | Mammary duct ectasia | FAERS: 1 | US FAERS | |
| 557 | Mastectomy | FAERS: 1 | US FAERS | |
| 558 | Mastication disorder | FAERS: 1 | US FAERS | |
| 559 | Mastitis | FAERS: 1 | US FAERS | |
| 560 | Medical device pain | FAERS: 1 | US FAERS | |
| 561 | Medical device removal | FAERS: 1 | US FAERS | |
| 562 | Medication residue | FAERS: 1 | US FAERS | |
| 563 | Meniscus injury | FAERS: 1 | US FAERS | |
| 564 | Menopause | FAERS: 1 | US FAERS | |
| 565 | Metastases to abdominal cavity | FAERS: 1 | US FAERS | |
| 566 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 567 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 568 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 569 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 570 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 571 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 572 | Necrosis | FAERS: 1 | US FAERS | |
| 573 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 574 | Neuralgia | FAERS: 1 | US FAERS | |
| 575 | Neutropenia | FAERS: 1 | US FAERS | |
| 576 | No adverse reaction | FAERS: 1 | US FAERS | |
| 577 | Nocturia | FAERS: 1 | US FAERS | |
| 578 | Nodule | FAERS: 1 | US FAERS | |
| 579 | Obstruction | FAERS: 1 | US FAERS | |
| 580 | Onychalgia | FAERS: 1 | US FAERS | |
| 581 | Onychomycosis | FAERS: 1 | US FAERS | |
| 582 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 583 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 584 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 585 | Orthosis user | FAERS: 1 | US FAERS | |
| 586 | Osteomalacia | FAERS: 1 | US FAERS | |
| 587 | Osteosclerosis | FAERS: 1 | US FAERS | |
| 588 | Ovarian enlargement | FAERS: 1 | US FAERS | |
| 589 | Overweight | FAERS: 1 | US FAERS | |
| 590 | Pancreatectomy | FAERS: 1 | US FAERS | |
| 591 | Papilloma | FAERS: 1 | US FAERS | |
| 592 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 593 | Paroxysmal arrhythmia | FAERS: 1 | US FAERS | |
| 594 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 595 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 596 | Pelvic prolapse | FAERS: 1 | US FAERS | |
| 597 | Periodontal operation | FAERS: 1 | US FAERS | |
| 598 | Periodontitis | FAERS: 1 | US FAERS | |
| 599 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 600 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 601 | Personality Change | FAERS: 1 | US FAERS | |
| 602 | Pertussis | FAERS: 1 | US FAERS | |
| 603 | Pharyngitis | FAERS: 1 | US FAERS | |
| 604 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 605 | Plastic surgery to the face | FAERS: 1 | US FAERS | |
| 606 | Plateletcrit decreased | FAERS: 1 | US FAERS | |
| 607 | Pneumothorax | FAERS: 1 | US FAERS | |
| 608 | Polyarthritis | FAERS: 1 | US FAERS | |
| 609 | Poor dental condition | FAERS: 1 | US FAERS | |
| 610 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 611 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 612 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 613 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 614 | Product label issue | FAERS: 1 | US FAERS | |
| 615 | Product use issue | FAERS: 1 | US FAERS | |
| 616 | Progesterone receptor assay negative | FAERS: 1 | US FAERS | |
| 617 | Progressive supranuclear palsy | FAERS: 1 | US FAERS | |
| 618 | Protein S Deficiency | FAERS: 1 | US FAERS | |
| 619 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 620 | Pseudophakia | FAERS: 1 | US FAERS | |
| 621 | Pulmonary artery stenosis | FAERS: 1 | US FAERS | |
| 622 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 623 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 624 | Radiation skin injury | FAERS: 1 | US FAERS | |
| 625 | Rash erythematous | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 626 | Rectal discharge | FAERS: 1 | US FAERS | |
| 627 | Reflex Sympathetic Dystrophy | FAERS: 1 | US FAERS | |
| 628 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 629 | Reflux laryngitis | FAERS: 1 | US FAERS | |
| 630 | Regurgitation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 631 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 632 | Renal cyst | FAERS: 1 | US FAERS | |
| 633 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 634 | Retching | FAERS: 1 | US FAERS | |
| 635 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 636 | Retinal artery embolism | FAERS: 1 | US FAERS | |
| 637 | Retinal cyst | FAERS: 1 | US FAERS | |
| 638 | Retinal exudates | FAERS: 1 | US FAERS | |
| 639 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 640 | Rheumatoid factor increased | FAERS: 1 | US FAERS | |
| 641 | Rhinitis | FAERS: 1 | US FAERS | |
| 642 | Saliva altered | FAERS: 1 | US FAERS | |
| 643 | Salivary gland adenoma | FAERS: 1 | US FAERS | |
| 644 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 645 | Sarcoma | FAERS: 1 | US FAERS | |
| 646 | Self-induced vomiting | FAERS: 1 | US FAERS | |
| 647 | Sepsis | FAERS: 1 | US FAERS | |
| 648 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 649 | Sexual activity increased | FAERS: 1 | US FAERS | |
| 650 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 651 | Sigmoiditis | FAERS: 1 | US FAERS | |
| 652 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 653 | Sinus operation | FAERS: 1 | US FAERS | |
| 654 | Sinus polyp | FAERS: 1 | US FAERS | |
| 655 | Skeletal injury | FAERS: 1 | US FAERS | |
| 656 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 657 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 658 | Skin irritation | FAERS: 1 | US FAERS | |
| 659 | Skin lesion | FAERS: 1 | US FAERS | |
| 660 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 661 | Sluggishness | FAERS: 1 | US FAERS | |
| 662 | Solar lentigo | FAERS: 1 | US FAERS | |
| 663 | Specific gravity urine abnormal | FAERS: 1 | US FAERS | |
| 664 | Spinal column injury | FAERS: 1 | US FAERS | |
| 665 | Spinal fusion acquired | FAERS: 1 | US FAERS | |
| 666 | Splenectomy | FAERS: 1 | US FAERS | |
| 667 | Splenomegaly | FAERS: 1 | US FAERS | |
| 668 | Spondylitis | FAERS: 1 | US FAERS | |
| 669 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 670 | Steroid therapy | FAERS: 1 | US FAERS | |
| 671 | Suicide attempt | FAERS: 1 | US FAERS | |
| 672 | Sunburn | FAERS: 1 | US FAERS | |
| 673 | Sweating fever | FAERS: 1 | US FAERS | |
| 674 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 675 | Synovitis | FAERS: 1 | US FAERS | |
| 676 | Tarsal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 677 | Temperature difference of extremities | FAERS: 1 | US FAERS | |
| 678 | Tension Headache | FAERS: 1 | US FAERS | |
| 679 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 680 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 681 | Thermal burn | FAERS: 1 | US FAERS | |
| 682 | Thromboangiitis Obliterans | FAERS: 1 | US FAERS | |
| 683 | Thromboembolic stroke | FAERS: 1 | US FAERS | |
| 684 | Thrombotic cerebral infarction | FAERS: 1 | US FAERS | |
| 685 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 686 | Toe operation | FAERS: 1 | US FAERS | |
| 687 | Tongue eruption | FAERS: 1 | US FAERS | |
| 688 | Tooth Resorption | FAERS: 1 | US FAERS | |
| 689 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 690 | Traumatic fracture | FAERS: 1 | US FAERS | |
| 691 | Trismus | FAERS: 1 | US FAERS | |
| 692 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 693 | Ultrasound ovary abnormal | FAERS: 1 | US FAERS | |
| 694 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 695 | Urine leukocyte esterase positive | FAERS: 1 | US FAERS | |
| 696 | Uterine Perforation | FAERS: 1 | US FAERS | |
| 697 | Vascular calcification | FAERS: 1 | US FAERS | |
| 698 | Venous stasis | FAERS: 1 | US FAERS | |
| 699 | Venous stenosis | FAERS: 1 | US FAERS | |
| 700 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 701 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 702 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 703 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 704 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 705 | effusion | FAERS: 1 | US FAERS | |
| 706 | muscle injury | FAERS: 1 | US FAERS | |
| 707 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 708 | Abnormalities, Drug-Induced | 29458080 | CTD | |
| 709 | Albuminuria | 17308373 17451421 | CTD | |
| 710 | Brain Injuries | 16580743 | CTD | |
| 711 | Calcinosis | 21335463 | CTD | |
| 712 | Carcinoma, Transitional Cell | 17572228 | CTD | |
| 713 | Cardiovascular Diseases | 15577136 15775269 | CTD | |
| 714 | Chemical and Drug Induced Liver Injury | 9820309 17473493 | CTD | |
| 715 | Cognition Disorders | 15800139 | CTD | |
| 716 | Edema | 15860553 | CTD | |
| 717 | Endometrial Neoplasms | 20404000 21341743 | CTD | |
| 718 | Heart Diseases | 11110106 | CTD | |
| 719 | Metaplasia | 27395752 | CTD | |
| 720 | Mixed Tumor, Mullerian | 15863610 | CTD | |
| 721 | Myxoma | 16343187 | CTD | |
| 722 | Non-alcoholic Fatty Liver Disease | 17473493 | CTD | |
| 723 | Osteoporosis, Postmenopausal |
11475503
15231013 15458908 15579764 15758505 16167916 16197663 16804122 17439652 17473493 17823083 17893378 25299349 | CTD | |
| 724 | Osteoporotic Fractures | 17439652 | CTD | |
| 725 | Ovarian Diseases | 27395752 | CTD | |
| 726 | Prostatic Neoplasms | 15731164 16220300 16536755 | CTD | |
| 727 | Salpingitis | 27395752 | CTD | |
| 728 | Spinal Fractures | 11475503 | CTD | |
| 729 | Thromboembolism | CTD | ||
| 730 | Tibial Fractures | 19048282 | CTD | |
| 731 | Venous Thromboembolism | CTD | ||
| 732 | Vulvar Neoplasms | 16343187 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.