Gefitinib
(XGALLCVXEZPNRQ-UHFFFAOYSA-N)
Structure
- SMILES
- COc1cc2ncnc(c2cc1OCCCN1CCOCC1)Nc1ccc(c(c1)Cl)F
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE02
- Molecular Formula:
- C22H24ClFN4O3
- Molecular Weight:
- 446.902
- Log P:
- 4.2865
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 68.74
- CAS Number(s):
- 184475-35-2
Synonym(s)
1.
Gefitinib
2.
Iressa
3.
N-(3-Chloro-4-fluorophenyl)-7-methoxy-6-(3-(4-morpholinyl)propoxy)-4-quinazolinamide
4.
ZD 1839
5.
ZD1839
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malignant neoplasm progression | FAERS: 292 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Disease Progression | FAERS: 202 Canada Vigilance: 8 | Canada Vigilance OFFSIDES US FAERS | |
| 3 | Pneumonia | FAERS: 127 Canada Vigilance: 1 | 20646869 | CTD SIDER Canada Vigilance US FAERS |
| 4 | Drug resistance | FAERS: 90 | US FAERS | |
| 5 | Nausea | FAERS: 66 | SIDER US FAERS | |
| 6 | Respiratory Failure | FAERS: 61 | OFFSIDES SIDER US FAERS | |
| 7 | Dry skin | FAERS: 59 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Vomiting | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Drug ineffective | FAERS: 50 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 10 | Alopecia | FAERS: 42 | OFFSIDES SIDER US FAERS | |
| 11 | Asthenia | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 12 | Fatigue | FAERS: 37 | SIDER US FAERS | |
| 13 | Pruritus | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 14 | Weight decreased | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 15 | Alanine Aminotransferase Increased | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 16 | Malaise | FAERS: 31 | SIDER US FAERS | |
| 17 | Pneumonitis | FAERS: 30 | US FAERS | |
| 18 | Headache | FAERS: 29 | US FAERS | |
| 19 | Acne | FAERS: 28 | OFFSIDES SIDER US FAERS | |
| 20 | Anorexia | FAERS: 28 | OFFSIDES SIDER US FAERS | |
| 21 | Aspartate Aminotransferase Increased | FAERS: 27 | SIDER US FAERS | |
| 22 | Dizziness | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Dermatitis acneiform | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Thrombocytopenia | FAERS: 26 | 15196742 | CTD SIDER US FAERS |
| 25 | Pain | FAERS: 24 | SIDER US FAERS | |
| 26 | Dehydration | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 27 | Stomatitis | FAERS: 22 | SIDER US FAERS | |
| 28 | White blood cell count decreased | FAERS: 22 | US FAERS | |
| 29 | Skin Ulcer | FAERS: 21 | US FAERS | |
| 30 | Blood creatinine increased | FAERS: 19 | OFFSIDES US FAERS | |
| 31 | Myocardial Infarction | FAERS: 19 | US FAERS | |
| 32 | Transaminases increased | FAERS: 18 | US FAERS | |
| 33 | Cerebral Infarction | FAERS: 17 | US FAERS | |
| 34 | Dyspepsia | FAERS: 17 | US FAERS | |
| 35 | General physical health deterioration | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 36 | Metastasis | FAERS: 17 | US FAERS | |
| 37 | Sepsis | FAERS: 17 | US FAERS | |
| 38 | Acute respiratory failure | FAERS: 16 | OFFSIDES US FAERS | |
| 39 | Dementia | FAERS: 16 | US FAERS | |
| 40 | Epistaxis | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 41 | Hepatotoxicity | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Hypoxia | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 43 | Pneumothorax | FAERS: 16 | OFFSIDES US FAERS | |
| 44 | Pulmonary Embolism | FAERS: 16 | US FAERS | |
| 45 | Urinary tract infection | FAERS: 16 | US FAERS | |
| 46 | Cerebrovascular accident | FAERS: 15 | US FAERS | |
| 47 | Back Pain | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Constipation | FAERS: 14 | SIDER US FAERS | |
| 49 | Infection | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 50 | Abdominal Pain | FAERS: 13 | SIDER US FAERS | |
| 51 | Productive Cough | FAERS: 13 | OFFSIDES US FAERS | |
| 52 | Amnesia | FAERS: 12 | US FAERS | |
| 53 | Cellulitis | FAERS: 12 | US FAERS | |
| 54 | Feeling abnormal | FAERS: 12 | US FAERS | |
| 55 | Pericardial effusion | FAERS: 12 | OFFSIDES US FAERS | |
| 56 | Pneumatosis intestinalis | FAERS: 12 | US FAERS | |
| 57 | Chest discomfort | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Ileus | FAERS: 11 | US FAERS | |
| 59 | Leukopenia | FAERS: 11 | 15196742 | CTD US FAERS |
| 60 | Nasopharyngitis | FAERS: 11 | US FAERS | |
| 61 | Purpura | FAERS: 11 | US FAERS | |
| 62 | Xeroderma | FAERS: 11 | US FAERS | |
| 63 | Atrial Fibrillation | FAERS: 10 | SIDER US FAERS | |
| 64 | Blood alkaline phosphatase increased | FAERS: 10 | OFFSIDES US FAERS | |
| 65 | Cardiac Arrest | FAERS: 10 | US FAERS | |
| 66 | Chills | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Dysgeusia | FAERS: 10 | US FAERS | |
| 68 | Erythema | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Folliculitis | FAERS: 10 | OFFSIDES US FAERS | |
| 70 | Gastric ulcer | FAERS: 10 | SIDER US FAERS | |
| 71 | Lymphangiosis carcinomatosa | FAERS: 10 | OFFSIDES US FAERS | |
| 72 | Malignant transformation | FAERS: 10 | US FAERS | |
| 73 | jaundice | FAERS: 10 | US FAERS | |
| 74 | Cystitis | FAERS: 9 | SIDER US FAERS | |
| 75 | Dysuria | FAERS: 9 | US FAERS | |
| 76 | Epilepsy | FAERS: 9 | US FAERS | |
| 77 | Peritonitis | FAERS: 9 | US FAERS | |
| 78 | Recall phenomenon | FAERS: 9 | OFFSIDES US FAERS | |
| 79 | Somnolence | FAERS: 9 | US FAERS | |
| 80 | Therapeutic response unexpected | FAERS: 9 | OFFSIDES US FAERS | |
| 81 | Ascites | FAERS: 8 | US FAERS | |
| 82 | Deep Vein Thrombosis | FAERS: 8 | US FAERS | |
| 83 | Disseminated Intravascular Coagulation | FAERS: 8 | OFFSIDES US FAERS | |
| 84 | Pancytopenia | FAERS: 8 | US FAERS | |
| 85 | Chest Pain | FAERS: 7 | US FAERS | |
| 86 | Deafness | FAERS: 7 | US FAERS | |
| 87 | Depressed Level of Consciousness | FAERS: 7 | OFFSIDES US FAERS | |
| 88 | Drug dose omission | FAERS: 7 | US FAERS | |
| 89 | EGFR gene mutation | FAERS: 7 | US FAERS | |
| 90 | Eczema | FAERS: 7 | US FAERS | |
| 91 | Eye pain | FAERS: 7 | SIDER US FAERS | |
| 92 | Hepatitis | FAERS: 7 | SIDER US FAERS | |
| 93 | Hypotension | FAERS: 7 | SIDER US FAERS | |
| 94 | Intestinal Obstruction | FAERS: 7 | OFFSIDES US FAERS | |
| 95 | Large intestine perforation | FAERS: 7 | US FAERS | |
| 96 | Pain of skin | FAERS: 7 | US FAERS | |
| 97 | Psoriasis | FAERS: 7 | US FAERS | |
| 98 | Respiratory distress | FAERS: 7 | US FAERS | |
| 99 | Aphasia | FAERS: 6 | US FAERS | |
| 100 | Arthralgia | FAERS: 6 | US FAERS | |
| 101 | Cytolytic hepatitis | FAERS: 6 | US FAERS | |
| 102 | Dermatitis | FAERS: 6 | 15196742 | CTD SIDER US FAERS |
| 103 | Enterocolitis | FAERS: 6 | OFFSIDES US FAERS | |
| 104 | Escherichia infection | FAERS: 6 | OFFSIDES US FAERS | |
| 105 | Fracture | FAERS: 6 | US FAERS | |
| 106 | Gamma-Glutamyltransferase Increased | FAERS: 6 | OFFSIDES US FAERS | |
| 107 | Inflammation | FAERS: 6 | 21743808 | CTD US FAERS |
| 108 | Onychoclasis | FAERS: 6 | OFFSIDES US FAERS | |
| 109 | Product use issue | FAERS: 6 | US FAERS | |
| 110 | Thrombosis | FAERS: 6 | US FAERS | |
| 111 | Tremor | FAERS: 6 | US FAERS | |
| 112 | Vasculitis | FAERS: 6 | US FAERS | |
| 113 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 114 | Acquired gene mutation | FAERS: 5 | US FAERS | |
| 115 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 116 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 117 | Blindness | FAERS: 5 | US FAERS | |
| 118 | Blood urine present | FAERS: 5 | US FAERS | |
| 119 | Burning sensation | FAERS: 5 | US FAERS | |
| 120 | Carcinoembryonic antigen increased | FAERS: 5 | OFFSIDES US FAERS | |
| 121 | Demyelination | FAERS: 5 | US FAERS | |
| 122 | Disease recurrence | FAERS: 5 | US FAERS | |
| 123 | Drug toxicity | FAERS: 5 | US FAERS | |
| 124 | Hydrocephalus | FAERS: 5 | US FAERS | |
| 125 | Lethargy | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Leukoencephalopathy | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 127 | Lung Injury | FAERS: 5 | 19803472 20935109 | CTD OFFSIDES US FAERS |
| 128 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 129 | Memory impairment | FAERS: 5 | US FAERS | |
| 130 | Meningitis | FAERS: 5 | US FAERS | |
| 131 | Myalgia | FAERS: 5 | US FAERS | |
| 132 | Neuropathy | FAERS: 5 | US FAERS | |
| 133 | Neutropenia | FAERS: 5 | 15196742 | CTD US FAERS |
| 134 | No adverse event | FAERS: 5 | US FAERS | |
| 135 | Nodule | FAERS: 5 | OFFSIDES US FAERS | |
| 136 | Overdose | FAERS: 5 | US FAERS | |
| 137 | Skin reaction | FAERS: 5 | US FAERS | |
| 138 | Skin toxicity | FAERS: 5 | OFFSIDES US FAERS | |
| 139 | Squamous cell carcinoma | FAERS: 5 | US FAERS | |
| 140 | Therapy cessation | FAERS: 5 | US FAERS | |
| 141 | Tumour haemorrhage | FAERS: 5 | US FAERS | |
| 142 | Vertigo | FAERS: 5 | US FAERS | |
| 143 | Wheezing | FAERS: 5 | US FAERS | |
| 144 | Accidental overdose | FAERS: 4 | US FAERS | |
| 145 | Agitation | FAERS: 4 | US FAERS | |
| 146 | Atelectasis | FAERS: 4 | OFFSIDES US FAERS | |
| 147 | Blood lactate dehydrogenase increased | FAERS: 4 | OFFSIDES US FAERS | |
| 148 | Bone pain | FAERS: 4 | US FAERS | |
| 149 | Bronchitis | FAERS: 4 | US FAERS | |
| 150 | Cerebral atrophy | FAERS: 4 | US FAERS | |
| 151 | Cholestasis | FAERS: 4 | US FAERS | |
| 152 | Chromaturia | FAERS: 4 | US FAERS | |
| 153 | Delirium | FAERS: 4 | US FAERS | |
| 154 | Diffuse alveolar damage | FAERS: 4 | OFFSIDES US FAERS | |
| 155 | Dysarthria | FAERS: 4 | US FAERS | |
| 156 | Dysphonia | FAERS: 4 | US FAERS | |
| 157 | Epidermal necrosis | FAERS: 4 | OFFSIDES US FAERS | |
| 158 | Expired drug administered | FAERS: 4 | US FAERS | |
| 159 | Flatulence | FAERS: 4 | US FAERS | |
| 160 | Flushing | FAERS: 4 | US FAERS | |
| 161 | Hordeolum | FAERS: 4 | OFFSIDES US FAERS | |
| 162 | Hyperkeratosis | FAERS: 4 | US FAERS | |
| 163 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 164 | Nail Infection | FAERS: 4 | OFFSIDES US FAERS | |
| 165 | Nephrotic Syndrome | FAERS: 4 | US FAERS | |
| 166 | Neutrophil count decreased | FAERS: 4 | US FAERS | |
| 167 | Oral candidiasis | FAERS: 4 | US FAERS | |
| 168 | Palpitations | FAERS: 4 | US FAERS | |
| 169 | Pneumocystis jiroveci pneumonia | FAERS: 4 | OFFSIDES US FAERS | |
| 170 | Portal Vein Thrombosis | FAERS: 4 | US FAERS | |
| 171 | Pulmonary Fibrosis | FAERS: 4 Canada Vigilance: 2 | 18424623 | CTD Canada Vigilance US FAERS |
| 172 | Pulmonary congestion | FAERS: 4 | US FAERS | |
| 173 | Restlessness | FAERS: 4 | US FAERS | |
| 174 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 175 | Rhinitis | FAERS: 4 | US FAERS | |
| 176 | Shock | FAERS: 4 | SIDER US FAERS | |
| 177 | Sinusitis | FAERS: 4 | US FAERS | |
| 178 | Skin necrosis | FAERS: 4 | US FAERS | |
| 179 | Squamous cell carcinoma of lung | FAERS: 4 | US FAERS | |
| 180 | Sudden death | FAERS: 4 | US FAERS | |
| 181 | Swelling | FAERS: 4 | US FAERS | |
| 182 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 183 | Ventricular Fibrillation | FAERS: 4 | US FAERS | |
| 184 | treatment failure | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Abasia | FAERS: 3 | US FAERS | |
| 186 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 187 | Acute kidney injury | FAERS: 3 | US FAERS | |
| 188 | Adenocarcinoma | FAERS: 3 | 15596048 20204295 | CTD US FAERS |
| 189 | Anxiety | FAERS: 3 | US FAERS | |
| 190 | Bladder pain | FAERS: 3 | SIDER US FAERS | |
| 191 | Blood albumin decreased | FAERS: 3 | US FAERS | |
| 192 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 193 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 194 | Blood urea increased | FAERS: 3 | OFFSIDES US FAERS | |
| 195 | Cardiomegaly | FAERS: 3 | 27084042 | CTD US FAERS |
| 196 | Cell marker increased | FAERS: 3 | US FAERS | |
| 197 | Central nervous system lesion | FAERS: 3 | US FAERS | |
| 198 | Colitis | FAERS: 3 | US FAERS | |
| 199 | Conjunctivitis | FAERS: 3 | SIDER US FAERS | |
| 200 | Diverticular perforation | FAERS: 3 | US FAERS | |
| 201 | Drug Tolerance | FAERS: 3 | US FAERS | |
| 202 | Drug exposure during pregnancy | FAERS: 3 | US FAERS | |
| 203 | Duodenal Ulcer | FAERS: 3 | US FAERS | |
| 204 | Dyspareunia | FAERS: 3 | US FAERS | |
| 205 | Erysipelas | FAERS: 3 | US FAERS | |
| 206 | Eye Infection | FAERS: 3 | US FAERS | |
| 207 | Eye irritation | FAERS: 3 | US FAERS | |
| 208 | Genital injury | FAERS: 3 | US FAERS | |
| 209 | Glossitis | FAERS: 3 | OFFSIDES US FAERS | |
| 210 | Granuloma | FAERS: 3 | US FAERS | |
| 211 | Hemiplegia | FAERS: 3 | US FAERS | |
| 212 | Hypersensitivity | FAERS: 3 | SIDER US FAERS | |
| 213 | Hypotrichosis | FAERS: 3 | US FAERS | |
| 214 | Impetigo | FAERS: 3 | OFFSIDES US FAERS | |
| 215 | Incontinence | FAERS: 3 | US FAERS | |
| 216 | Infectious pleural effusion | FAERS: 3 | US FAERS | |
| 217 | Intestinal Perforation | FAERS: 3 | US FAERS | |
| 218 | Leukocytosis | FAERS: 3 | US FAERS | |
| 219 | Lobar Pneumonia | FAERS: 3 | US FAERS | |
| 220 | Lung Abscess | FAERS: 3 | US FAERS | |
| 221 | Lymphoma | FAERS: 3 | US FAERS | |
| 222 | Medication Error | FAERS: 3 | US FAERS | |
| 223 | Metastases to adrenals | FAERS: 3 | OFFSIDES US FAERS | |
| 224 | Metastatic Neoplasm | FAERS: 3 | US FAERS | |
| 225 | Night sweats | FAERS: 3 | US FAERS | |
| 226 | Optic Neuritis | FAERS: 3 | US FAERS | |
| 227 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 228 | Personality Change | FAERS: 3 | US FAERS | |
| 229 | Petechiae | FAERS: 3 | US FAERS | |
| 230 | Polyneuropathy | FAERS: 3 | US FAERS | |
| 231 | Postrenal failure | FAERS: 3 | OFFSIDES US FAERS | |
| 232 | Purulent discharge | FAERS: 3 | US FAERS | |
| 233 | Retinal exudates | FAERS: 3 | OFFSIDES US FAERS | |
| 234 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 235 | Schizophrenia | FAERS: 3 | US FAERS | |
| 236 | Skin irritation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 237 | Skin lesion | FAERS: 3 | US FAERS | |
| 238 | Syncope | FAERS: 3 | US FAERS | |
| 239 | Tachycardia | FAERS: 3 | US FAERS | |
| 240 | Toxic Epidermal Necrolysis | FAERS: 3 | SIDER US FAERS | |
| 241 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 242 | Vaginal Discharge | FAERS: 3 | US FAERS | |
| 243 | Vulvovaginal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 244 | Wound dehiscence | FAERS: 3 | US FAERS | |
| 245 | Abscess | FAERS: 2 | US FAERS | |
| 246 | Acute Lung Injury | FAERS: 2 | US FAERS | |
| 247 | Acute prerenal failure | FAERS: 2 | OFFSIDES US FAERS | |
| 248 | Ageusia | FAERS: 2 | US FAERS | |
| 249 | Ammonia increased | FAERS: 2 | US FAERS | |
| 250 | Amylase increased | FAERS: 2 | US FAERS | |
| 251 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 252 | Aphonia | FAERS: 2 | US FAERS | |
| 253 | Atrophic vulvovaginitis | FAERS: 2 | US FAERS | |
| 254 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 255 | Bone marrow depression | FAERS: 2 | US FAERS | |
| 256 | Bradycardia | FAERS: 2 | US FAERS | |
| 257 | Cancer Pain | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 258 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 259 | Cardiac Tamponade | FAERS: 2 | US FAERS | |
| 260 | Cataract | FAERS: 2 | US FAERS | |
| 261 | Cholangitis | FAERS: 2 | US FAERS | |
| 262 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 263 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 264 | Corneal Ulcer | FAERS: 2 | US FAERS | |
| 265 | Creutzfeldt-Jakob disease | FAERS: 2 | OFFSIDES US FAERS | |
| 266 | Cyanosis | FAERS: 2 | US FAERS | |
| 267 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 268 | Diplopia | FAERS: 2 | US FAERS | |
| 269 | Discomfort | FAERS: 2 | US FAERS | |
| 270 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 271 | Ear congestion | FAERS: 2 | US FAERS | |
| 272 | Epididymitis | FAERS: 2 | US FAERS | |
| 273 | Erosive Duodenitis | FAERS: 2 | US FAERS | |
| 274 | Facial Pain | FAERS: 2 | US FAERS | |
| 275 | Febrile Neutropenia | FAERS: 2 | SIDER US FAERS | |
| 276 | Gas Gangrene | FAERS: 2 | OFFSIDES US FAERS | |
| 277 | Gastritis | FAERS: 2 | US FAERS | |
| 278 | Gastrointestinal perforation | FAERS: 2 | SIDER US FAERS | |
| 279 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 280 | Gingivitis | FAERS: 2 | US FAERS | |
| 281 | Glaucoma | FAERS: 2 | US FAERS | |
| 282 | Gout | FAERS: 2 | US FAERS | |
| 283 | Hemiparesis | FAERS: 2 | US FAERS | |
| 284 | Hirsutism | FAERS: 2 | US FAERS | |
| 285 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 286 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 287 | Hypokinesia | FAERS: 2 | US FAERS | |
| 288 | Hypophagia | FAERS: 2 | US FAERS | |
| 289 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 290 | Increased upper airway secretion | FAERS: 2 | OFFSIDES US FAERS | |
| 291 | Influenza | FAERS: 2 | US FAERS | |
| 292 | Iritis | FAERS: 2 | US FAERS | |
| 293 | Jejunal Stenosis | FAERS: 2 | OFFSIDES US FAERS | |
| 294 | Joint injury | FAERS: 2 | US FAERS | |
| 295 | Keratitis | FAERS: 2 | SIDER US FAERS | |
| 296 | Keratoconjunctivitis Sicca | FAERS: 2 | US FAERS | |
| 297 | Limb injury | FAERS: 2 | US FAERS | |
| 298 | Lung consolidation | FAERS: 2 | OFFSIDES US FAERS | |
| 299 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 300 | Mental status changes | FAERS: 2 | US FAERS | |
| 301 | Multiple Myeloma | FAERS: 2 | US FAERS | |
| 302 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 303 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 304 | Nasal discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 305 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 306 | Neuralgia | FAERS: 2 | US FAERS | |
| 307 | Oral pain | FAERS: 2 | SIDER US FAERS | |
| 308 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 309 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 310 | Pancreatic Insufficiency | FAERS: 2 | OFFSIDES US FAERS | |
| 311 | Pancreatitis | FAERS: 2 | SIDER US FAERS | |
| 312 | Performance status decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 313 | Pericarditis | FAERS: 2 | US FAERS | |
| 314 | Pleural Mesothelioma | FAERS: 2 | OFFSIDES US FAERS | |
| 315 | Pleurisy | FAERS: 2 | US FAERS | |
| 316 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 317 | Product dose omission | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 318 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 319 | Propionibacterium infection | FAERS: 2 | US FAERS | |
| 320 | Radiation Pneumonitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 321 | Rash erythematous | FAERS: 2 | US FAERS | |
| 322 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 323 | Retinitis | FAERS: 2 | OFFSIDES US FAERS | |
| 324 | Senile dementia | FAERS: 2 | US FAERS | |
| 325 | Terminal state | FAERS: 2 | US FAERS | |
| 326 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 327 | Tooth Infection | FAERS: 2 | US FAERS | |
| 328 | Urinary Retention | FAERS: 2 | US FAERS | |
| 329 | Urticaria | FAERS: 2 | SIDER US FAERS | |
| 330 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 331 | Visual Impairment | FAERS: 2 | US FAERS | |
| 332 | Visual disturbance | FAERS: 2 | US FAERS | |
| 333 | pseudomembranous colitis | FAERS: 2 | US FAERS | |
| 334 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 335 | Accidental exposure to product packaging | FAERS: 1 | US FAERS | |
| 336 | Accidental exposure | FAERS: 1 | US FAERS | |
| 337 | Accidental needle stick | FAERS: 1 | US FAERS | |
| 338 | Activated partial thromboplastin time shortened | FAERS: 1 | US FAERS | |
| 339 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 340 | Adverse event | FAERS: 1 | US FAERS | |
| 341 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 342 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 343 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 344 | Anuria | FAERS: 1 | US FAERS | |
| 345 | Aortic valve sclerosis | FAERS: 1 | US FAERS | |
| 346 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 347 | Apathy | FAERS: 1 | US FAERS | |
| 348 | Apparent death | FAERS: 1 | US FAERS | |
| 349 | Appendicitis | FAERS: 1 | US FAERS | |
| 350 | Arterial fibrosis | FAERS: 1 | US FAERS | |
| 351 | Arthritis | FAERS: 1 | US FAERS | |
| 352 | Asthenopia | FAERS: 1 | US FAERS | |
| 353 | Asthma | FAERS: 1 | US FAERS | |
| 354 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 355 | BK virus infection | FAERS: 1 | US FAERS | |
| 356 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 357 | Bedridden | FAERS: 1 | US FAERS | |
| 358 | Bicytopenia | FAERS: 1 | US FAERS | |
| 359 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 360 | Biopsy stomach abnormal | FAERS: 1 | US FAERS | |
| 361 | Blepharitis | FAERS: 1 | SIDER US FAERS | |
| 362 | Blood beta-D-glucan increased | FAERS: 1 | OFFSIDES US FAERS | |
| 363 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 364 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 365 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 366 | Blood potassium increased | FAERS: 1 | OFFSIDES US FAERS | |
| 367 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 368 | Bone lesion | FAERS: 1 | US FAERS | |
| 369 | Brain Abscess | FAERS: 1 | US FAERS | |
| 370 | Bronchial Fistula | FAERS: 1 | US FAERS | |
| 371 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 372 | Bulbar palsy | FAERS: 1 | US FAERS | |
| 373 | Bullous lung disease | FAERS: 1 | US FAERS | |
| 374 | Cachexia | FAERS: 1 | US FAERS | |
| 375 | Carcinoma | FAERS: 1 | OFFSIDES US FAERS | |
| 376 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 377 | Catheter site erythema | FAERS: 1 | US FAERS | |
| 378 | Catheter site pain | FAERS: 1 | US FAERS | |
| 379 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 380 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 381 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 382 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 383 | Cerebrosclerosis | FAERS: 1 | US FAERS | |
| 384 | Cheilitis | FAERS: 1 | US FAERS | |
| 385 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 386 | Clumsiness | FAERS: 1 | US FAERS | |
| 387 | Colectomy | FAERS: 1 | US FAERS | |
| 388 | Completed Suicide | FAERS: 1 | US FAERS | |
| 389 | Congenital diaphragmatic hernia | FAERS: 1 | US FAERS | |
| 390 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 391 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 392 | Culture positive | FAERS: 1 | OFFSIDES US FAERS | |
| 393 | Culture urine positive | FAERS: 1 | US FAERS | |
| 394 | Cytomegalovirus antigen positive | FAERS: 1 | US FAERS | |
| 395 | Cytomegalovirus gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 396 | Decorticate posture | FAERS: 1 | US FAERS | |
| 397 | Depressed mood | FAERS: 1 | US FAERS | |
| 398 | Device related infection | FAERS: 1 | US FAERS | |
| 399 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 400 | Dilatation intrahepatic duct acquired | FAERS: 1 | US FAERS | |
| 401 | Diplegia | FAERS: 1 | US FAERS | |
| 402 | Drowning | FAERS: 1 | US FAERS | |
| 403 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 404 | Duodenal perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 405 | Dysentery | FAERS: 1 | US FAERS | |
| 406 | Dysphasia | FAERS: 1 | US FAERS | |
| 407 | Ecchymosis | FAERS: 1 | US FAERS | |
| 408 | Electrocardiogram R on T phenomenon | FAERS: 1 | US FAERS | |
| 409 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 410 | Embolic cerebral infarction | FAERS: 1 | US FAERS | |
| 411 | Embolic stroke | FAERS: 1 | US FAERS | |
| 412 | Embolism | FAERS: 1 | US FAERS | |
| 413 | Emotional disorder | FAERS: 1 | US FAERS | |
| 414 | Empyema | FAERS: 1 | OFFSIDES US FAERS | |
| 415 | Encephalitis | FAERS: 1 | US FAERS | |
| 416 | Endocarditis | FAERS: 1 | US FAERS | |
| 417 | Eosinophilic Pneumonia | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 419 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 420 | Excoriation | FAERS: 1 | US FAERS | |
| 421 | Extravasation | FAERS: 1 | US FAERS | |
| 422 | Eye Burns | FAERS: 1 | US FAERS | |
| 423 | Eyelid irritation | FAERS: 1 | OFFSIDES US FAERS | |
| 424 | Eyelid pain | FAERS: 1 | OFFSIDES US FAERS | |
| 425 | Eyelid rash | FAERS: 1 | US FAERS | |
| 426 | Feeling Cold | FAERS: 1 | US FAERS | |
| 427 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 428 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 429 | Flank Pain | FAERS: 1 | US FAERS | |
| 430 | Fluid overload | FAERS: 1 | US FAERS | |
| 431 | Food Poisoning | FAERS: 1 | OFFSIDES US FAERS | |
| 432 | Fungal rash | FAERS: 1 | US FAERS | |
| 433 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 434 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 435 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 436 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 437 | Gastrointestinal motility disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 438 | Gastrointestinal toxicity | FAERS: 1 | US FAERS | |
| 439 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 440 | General nutrition disorder | FAERS: 1 | US FAERS | |
| 441 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 442 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 443 | Growth of eyelashes | FAERS: 1 | US FAERS | |
| 444 | Hair growth rate abnormal | FAERS: 1 | US FAERS | |
| 445 | Head discomfort | FAERS: 1 | US FAERS | |
| 446 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 447 | Hepatitis B surface antibody positive | FAERS: 1 | US FAERS | |
| 448 | Hepatitis B | FAERS: 1 | US FAERS | |
| 449 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 450 | Hoarseness | FAERS: 1 | US FAERS | |
| 451 | Hydrometra | FAERS: 1 | US FAERS | |
| 452 | Hydrothorax | FAERS: 1 | US FAERS | |
| 453 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 454 | Hypersomnia | FAERS: 1 | US FAERS | |
| 455 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 456 | Hypothalamic pituitary adrenal axis suppression | FAERS: 1 | US FAERS | |
| 457 | Implant site abscess | FAERS: 1 | US FAERS | |
| 458 | Incoherent | FAERS: 1 | US FAERS | |
| 459 | Increased bronchial secretion | FAERS: 1 | OFFSIDES US FAERS | |
| 460 | Infarction | FAERS: 1 | US FAERS | |
| 461 | Infective spondylitis | FAERS: 1 | US FAERS | |
| 462 | Infertility | FAERS: 1 | US FAERS | |
| 463 | Injury asphyxiation | FAERS: 1 | US FAERS | |
| 464 | Insurance issue | FAERS: 1 | US FAERS | |
| 465 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 466 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 467 | Intracranial mass | FAERS: 1 | US FAERS | |
| 468 | Intubation | FAERS: 1 | US FAERS | |
| 469 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 470 | Joint swelling | FAERS: 1 | US FAERS | |
| 471 | Laceration | FAERS: 1 | US FAERS | |
| 472 | Lichen Planus | FAERS: 1 | US FAERS | |
| 473 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 474 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 475 | Lymphangitis | FAERS: 1 | OFFSIDES US FAERS | |
| 476 | Lymphopenia | FAERS: 1 | US FAERS | |
| 477 | Macular degeneration | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 478 | Malignant neoplasm of choroid | FAERS: 1 | US FAERS | |
| 479 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 480 | Mental impairment | FAERS: 1 | US FAERS | |
| 481 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 482 | Metastases to muscle | FAERS: 1 | US FAERS | |
| 483 | Monoplegia | FAERS: 1 | US FAERS | |
| 484 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 485 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 486 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 487 | Mycobacterium tuberculosis complex test positive | FAERS: 1 | US FAERS | |
| 488 | Myocarditis | FAERS: 1 | US FAERS | |
| 489 | Nail bed tenderness | FAERS: 1 | US FAERS | |
| 490 | Nail discomfort | FAERS: 1 | US FAERS | |
| 491 | Nail toxicity | FAERS: 1 | US FAERS | |
| 492 | Nasal mucosal erosion | FAERS: 1 | US FAERS | |
| 493 | Neck Pain | FAERS: 1 | US FAERS | |
| 494 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 495 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 496 | Neuropathic pain | FAERS: 1 | US FAERS | |
| 497 | No adverse effect | FAERS: 1 | US FAERS | |
| 498 | Non-small cell lung cancer recurrent | FAERS: 1 | OFFSIDES US FAERS | |
| 499 | Obstruction | FAERS: 1 | US FAERS | |
| 500 | Occult blood positive | FAERS: 1 | US FAERS | |
| 501 | Onychomycosis | FAERS: 1 | US FAERS | |
| 502 | Open wound | FAERS: 1 | US FAERS | |
| 503 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 504 | Otitis Media | FAERS: 1 | US FAERS | |
| 505 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 506 | Paraneoplastic Cerebellar Degeneration | FAERS: 1 | OFFSIDES US FAERS | |
| 507 | Paraneoplastic pleural effusion | FAERS: 1 | US FAERS | |
| 508 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 509 | Pathological fracture | FAERS: 1 | US FAERS | |
| 510 | Peptic ulcer perforation, obstructive | FAERS: 1 | US FAERS | |
| 511 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 512 | Perianal abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 513 | Pericarditis malignant | FAERS: 1 | US FAERS | |
| 514 | Perineal pain | FAERS: 1 | US FAERS | |
| 515 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 516 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 517 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 518 | Polymerase Chain Reaction | FAERS: 1 | US FAERS | |
| 519 | Polymyositis | FAERS: 1 | US FAERS | |
| 520 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 521 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 522 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 523 | Presyncope | FAERS: 1 | US FAERS | |
| 524 | Primary Effusion Lymphoma | FAERS: 1 | US FAERS | |
| 525 | Procedural complication | FAERS: 1 | US FAERS | |
| 526 | Product quality issue | FAERS: 1 | US FAERS | |
| 527 | Product substitution issue | FAERS: 1 | US FAERS | |
| 528 | Prostate ablation | FAERS: 1 | US FAERS | |
| 529 | Proteinuria | FAERS: 1 | SIDER US FAERS | |
| 530 | Pulmonary radiation injury | FAERS: 1 | OFFSIDES US FAERS | |
| 531 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 532 | Pulmonary toxicity | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 533 | Pulmonary vasculitis | FAERS: 1 | US FAERS | |
| 534 | Pyoderma | FAERS: 1 | US FAERS | |
| 535 | Radiation necrosis | FAERS: 1 | US FAERS | |
| 536 | Rales | FAERS: 1 | OFFSIDES US FAERS | |
| 537 | Rash scaly | FAERS: 1 | US FAERS | |
| 538 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 539 | Retinal toxicity | FAERS: 1 | US FAERS | |
| 540 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 541 | Rhabdomyosarcoma | FAERS: 1 | US FAERS | |
| 542 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 543 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 544 | Rosacea | FAERS: 1 | US FAERS | |
| 545 | Scan abdomen abnormal | FAERS: 1 | US FAERS | |
| 546 | Scotoma | FAERS: 1 | US FAERS | |
| 547 | Screaming | FAERS: 1 | US FAERS | |
| 548 | Secondary hypothyroidism | FAERS: 1 | US FAERS | |
| 549 | Septic Shock | FAERS: 1 | US FAERS | |
| 550 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 551 | Sinus operation | FAERS: 1 | US FAERS | |
| 552 | Skin Erosion | FAERS: 1 | OFFSIDES US FAERS | |
| 553 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 554 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 555 | Small Intestinal Stenosis | FAERS: 1 | US FAERS | |
| 556 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 557 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 558 | Sputum culture positive | FAERS: 1 | OFFSIDES US FAERS | |
| 559 | Staring | FAERS: 1 | US FAERS | |
| 560 | Steroid withdrawal syndrome | FAERS: 1 | US FAERS | |
| 561 | Stevens-Johnson Syndrome | FAERS: 1 | 25811541 | CTD SIDER US FAERS |
| 562 | Stool analysis abnormal | FAERS: 1 | US FAERS | |
| 563 | Stress | FAERS: 1 | US FAERS | |
| 564 | Stridor | FAERS: 1 | US FAERS | |
| 565 | Subcorneal pustular dermatosis | FAERS: 1 | US FAERS | |
| 566 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 567 | Subileus | FAERS: 1 | OFFSIDES US FAERS | |
| 568 | Suicide attempt | FAERS: 1 | US FAERS | |
| 569 | Supraventricular tachycardia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 570 | Surfactant protein increased | FAERS: 1 | US FAERS | |
| 571 | Synovitis | FAERS: 1 | US FAERS | |
| 572 | Tension Headache | FAERS: 1 | US FAERS | |
| 573 | Tetany | FAERS: 1 | US FAERS | |
| 574 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 575 | Therapy non-responder | FAERS: 1 | OFFSIDES US FAERS | |
| 576 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 577 | Throat cancer | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 578 | Throat irritation | FAERS: 1 | US FAERS | |
| 579 | Thrombophlebitis | FAERS: 1 | SIDER US FAERS | |
| 580 | Tongue erythema | FAERS: 1 | US FAERS | |
| 581 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 582 | Toothache | FAERS: 1 | US FAERS | |
| 583 | Torticollis | FAERS: 1 | US FAERS | |
| 584 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 585 | Transmission of drug via semen | FAERS: 1 | US FAERS | |
| 586 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 587 | Ulcer | FAERS: 1 | SIDER US FAERS | |
| 588 | Underweight | FAERS: 1 | US FAERS | |
| 589 | Unevaluable event | FAERS: 1 | US FAERS | |
| 590 | Ureteric compression | FAERS: 1 | US FAERS | |
| 591 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 592 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 593 | Uterine inflammation | FAERS: 1 | US FAERS | |
| 594 | Vaginal burning sensation | FAERS: 1 | US FAERS | |
| 595 | Vaginal pain | FAERS: 1 | US FAERS | |
| 596 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 597 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 598 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 599 | Vulvitis | FAERS: 1 | US FAERS | |
| 600 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 601 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 602 | Xerosis | FAERS: 1 | US FAERS | |
| 603 | furuncle | FAERS: 1 | US FAERS | |
| 604 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 605 | Abdominal rigidity | OFFSIDES | ||
| 606 | Acne Vulgaris | 17166623 | CTD | |
| 607 | Allergy test positive | OFFSIDES | ||
| 608 | Alveolitis | OFFSIDES SIDER | ||
| 609 | Amblyopia | SIDER | ||
| 610 | Anemia | 15196742 | CTD | |
| 611 | Angioedema | SIDER | ||
| 612 | Antibody test abnormal | OFFSIDES | ||
| 613 | Aspiration Pneumonia | OFFSIDES | ||
| 614 | Autonomic neuropathy | OFFSIDES | ||
| 615 | Bacteria sputum identified | OFFSIDES | ||
| 616 | Bacteria stool identified | OFFSIDES | ||
| 617 | Bladder constriction | OFFSIDES | ||
| 618 | Bladder tamponade | OFFSIDES | ||
| 619 | Blood and lymphatic system disorders | SIDER | ||
| 620 | Blood cholinesterase abnormal | OFFSIDES | ||
| 621 | Blood gases abnormal | OFFSIDES | ||
| 622 | Brain Hypoxia | OFFSIDES | ||
| 623 | Bronchiectasis | OFFSIDES | ||
| 624 | Bronchopneumonia | OFFSIDES | ||
| 625 | Bullous conditions | SIDER | ||
| 626 | Bullous impetigo | OFFSIDES | ||
| 627 | Candida pneumonia | OFFSIDES | ||
| 628 | Carcinoma, Transitional Cell | 16813948 | CTD | |
| 629 | Cardiotoxicity | 27084042 | CTD | |
| 630 | Cerebellar infarction | OFFSIDES | ||
| 631 | Chemical and Drug Induced Liver Injury | 19803472 23956101 | CTD | |
| 632 | Chemical cystitis | OFFSIDES | ||
| 633 | Choking sensation | OFFSIDES | ||
| 634 | Colitis erosive | OFFSIDES | ||
| 635 | Colonic Neoplasms | 23523951 | CTD | |
| 636 | Colorectal Neoplasms | 14639003 17594712 | CTD | |
| 637 | Concomitant disease aggravated | OFFSIDES | ||
| 638 | Conjunctival deposit | OFFSIDES | ||
| 639 | Conjunctival ulcer | OFFSIDES | ||
| 640 | Contracted bladder | OFFSIDES | ||
| 641 | Corneal erosion | SIDER | ||
| 642 | Dental Plaque | OFFSIDES | ||
| 643 | Diabetes Insipidus | OFFSIDES | ||
| 644 | Diarrhea | 15196742 | CTD OFFSIDES | |
| 645 | Dissociation | Canada Vigilance: 1 | Canada Vigilance | |
| 646 | Drug Eruptions | 20846305 | CTD | |
| 647 | Dyspnoea exacerbated | OFFSIDES | ||
| 648 | Erythema Multiforme | SIDER | ||
| 649 | Eye Redness | SIDER | ||
| 650 | Feeding tube complication | OFFSIDES | ||
| 651 | Feeling Sick | SIDER | ||
| 652 | Foot Dermatoses | 16939960 | CTD | |
| 653 | Gastric mucosal lesion | OFFSIDES | ||
| 654 | Gastrointestinal mucosal disorder | OFFSIDES | ||
| 655 | Gastrointestinal ulcer perforation | OFFSIDES | ||
| 656 | Glioblastoma | 18771084 | CTD | |
| 657 | Glossopharyngeal Nerve Disorder | OFFSIDES | ||
| 658 | Hand Dermatoses | 16939960 | CTD | |
| 659 | Head and Neck Neoplasms | 21768327 | CTD | |
| 660 | Hepatitis A positive | OFFSIDES | ||
| 661 | Hepatitis B positive | OFFSIDES | ||
| 662 | Hiccough | OFFSIDES | ||
| 663 | Hydropneumothorax | OFFSIDES | ||
| 664 | Ileal ulcer | OFFSIDES | ||
| 665 | Impaired self-care | OFFSIDES | ||
| 666 | Implant site erosion | OFFSIDES | ||
| 667 | Infected epidermal cyst | OFFSIDES | ||
| 668 | Infestation | SIDER | ||
| 669 | Kaolin cephalin clotting time prolonged | OFFSIDES | ||
| 670 | Keratitis sicca | OFFSIDES | ||
| 671 | Lip swelling | SIDER | ||
| 672 | Lung Diseases, Interstitial | 14501391 19653137 20686337 | CTD | |
| 673 | Lung Neoplasms | CTD | ||
| 674 | Lung adenocarcinoma recurrent | OFFSIDES | ||
| 675 | Lung squamous cell carcinoma recurrent | OFFSIDES | ||
| 676 | Lymphocytosis | OFFSIDES | ||
| 677 | Malignant neoplasm of spinal cord | OFFSIDES | ||
| 678 | Mammary Neoplasms, Experimental | 18375820 | CTD | |
| 679 | Markedly reduced dietary intake | OFFSIDES | ||
| 680 | Meningeal Carcinomatosis | 16824645 | CTD | |
| 681 | Mesenteric vascular insufficiency | OFFSIDES | ||
| 682 | Mesothelioma | 21787763 | CTD | |
| 683 | Myelitis | OFFSIDES | ||
| 684 | Myelodysplasia | OFFSIDES | ||
| 685 | Myringitis | OFFSIDES | ||
| 686 | Necrolysis epidermal | SIDER | ||
| 687 | Neoplasm Invasiveness | 18844224 23127547 | CTD | |
| 688 | Neoplasm Metastasis | 20404966 23061908 | CTD | |
| 689 | Neoplasms | 16800173 | CTD | |
| 690 | Nettle rash | SIDER | ||
| 691 | Oral mucosal petechiae | OFFSIDES | ||
| 692 | PCO2 decreased | OFFSIDES | ||
| 693 | PCO2 increased | OFFSIDES | ||
| 694 | PO2 decreased | OFFSIDES | ||
| 695 | Pemphigus | OFFSIDES | ||
| 696 | Pharyngeal fistula | OFFSIDES | ||
| 697 | Pleurodesis | OFFSIDES | ||
| 698 | Post procedural nausea | OFFSIDES | ||
| 699 | Procedural hypertension | OFFSIDES | ||
| 700 | Proctitis | OFFSIDES | ||
| 701 | Prostatic Neoplasms | CTD | ||
| 702 | Protein urine present | SIDER | ||
| 703 | Radiation skin injury | OFFSIDES | ||
| 704 | Recurrence | 25605917 | CTD | |
| 705 | Refusal of treatment by relative | OFFSIDES | ||
| 706 | Renal tubular acidosis | OFFSIDES | ||
| 707 | Retinal Vasculitis | OFFSIDES | ||
| 708 | Secretion discharge | OFFSIDES | ||
| 709 | Sinus Arrhythmia | SIDER | ||
| 710 | Skin Neoplasms | 23523951 | CTD | |
| 711 | Skin Wrinkling | OFFSIDES | ||
| 712 | Sore mouth | SIDER | ||
| 713 | Sputum retention | OFFSIDES | ||
| 714 | Stenotrophomonas infection | OFFSIDES | ||
| 715 | Superior Vena Cava Syndrome | OFFSIDES | ||
| 716 | Urine ketone body present | OFFSIDES | ||
| 717 | Urogram abnormal | OFFSIDES | ||
| 718 | Vena cava injury | OFFSIDES | ||
| 719 | Vesiculobullous rash | SIDER | ||
| 720 | Wound infection pseudomonas | OFFSIDES | ||
| 721 | Zinc deficiency | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.