Methylprednisolone Acetate
(PLBHSZGDDKCEHR-LFYFAGGJSA-N)
Structure
- SMILES
- CC(=O)OCC(=O)[C@@]1(O)CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)C
- Molecular Formula:
- C24H32O6
- Molecular Weight:
- 416.507
- Log P:
- 2.3744
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 100.9
- CAS Number(s):
- 53-36-1
Synonym(s)
1.
Methylprednisolone Acetate
2.
Acetyl-Methylprednisolone
3.
Depo-Medrol
4.
Depo-Medrone
5.
Methylprednisolone Acetate, (11beta,16alpha)-isomer
6.
Methylprednisolone Acetate, (11beta,16beta)-isomer
7.
Methylprednisolone-21-acetate
8.
Acetyl Methylprednisolone
9.
Depo Medrol
10.
Depo Medrone
11.
Methylprednisolone 21 acetate
External Link(s)
| MeSH | D000077555 |
| PubChem Compound | 5877 |
| BindingDB | 233194 |
| ChEBI | 6889 |
| CHEMBL | CHEMBL1364144 |
| DrugCentral | 1770 |
| KEGG | cpd:C08179 dr:D00979 |
| ZINC | 118912449 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pain | FAERS: 78 Canada Vigilance: 5 | 1772484 17101836 | CTD OFFSIDES Canada Vigilance US FAERS |
| 2 | Headache | FAERS: 75 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 3 | Anxiety | FAERS: 58 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 4 | Incorrect route of drug administration | FAERS: 50 | OFFSIDES US FAERS | |
| 5 | Nausea | FAERS: 49 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 6 | Drug ineffective | FAERS: 43 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 7 | Arachnoiditis | FAERS: 37 Canada Vigilance: 1 | 1257435 1772484 4740461 | CTD OFFSIDES Canada Vigilance US FAERS |
| 8 | Malaise | FAERS: 35 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 9 | Hypersensitivity | FAERS: 29 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 10 | Product contamination | FAERS: 29 | US FAERS | |
| 11 | Injection site pain | FAERS: 28 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 12 | Fatigue | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 13 | Dizziness | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 14 | Injection site abscess | FAERS: 26 | US FAERS | |
| 15 | Back Pain | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Feeling abnormal | FAERS: 24 | OFFSIDES US FAERS | |
| 17 | Arthralgia | FAERS: 23 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 18 | Meningitis | FAERS: 23 | 4740461 | CTD US FAERS |
| 19 | Product quality issue | FAERS: 23 | US FAERS | |
| 20 | Product use issue | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Pruritus | FAERS: 23 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 22 | Urticaria | FAERS: 23 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 23 | Musculoskeletal stiffness | FAERS: 22 | OFFSIDES US FAERS | |
| 24 | Infection | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 25 | Vomiting | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 26 | Abasia | FAERS: 18 | OFFSIDES US FAERS | |
| 27 | Asthenia | FAERS: 18 | OFFSIDES US FAERS | |
| 28 | Burning sensation | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 29 | Erythema | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 30 | Medication Error | FAERS: 16 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 31 | Injection site infection | FAERS: 15 | OFFSIDES US FAERS | |
| 32 | Wrong drug administered | FAERS: 15 | OFFSIDES US FAERS | |
| 33 | Atrial Fibrillation | FAERS: 14 | US FAERS | |
| 34 | Neck Pain | FAERS: 14 | US FAERS | |
| 35 | Weight decreased | FAERS: 14 | US FAERS | |
| 36 | Anaphylactic shock | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Product use in unapproved indication | FAERS: 13 | US FAERS | |
| 38 | Joint swelling | FAERS: 12 | US FAERS | |
| 39 | Tremor | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Urinary Incontinence | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Blood glucose increased | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Chest Pain | FAERS: 11 | OFFSIDES US FAERS | |
| 43 | Drug administration error | FAERS: 11 | OFFSIDES US FAERS | |
| 44 | Flushing | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 45 | Abscess | FAERS: 10 | OFFSIDES US FAERS | |
| 46 | Injection Site Reaction | FAERS: 10 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 47 | Injection site necrosis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Neuralgia | FAERS: 10 | US FAERS | |
| 49 | No adverse event | FAERS: 10 | US FAERS | |
| 50 | Osteomyelitis | FAERS: 10 | OFFSIDES US FAERS | |
| 51 | Post procedural complication | FAERS: 10 | OFFSIDES US FAERS | |
| 52 | Chest discomfort | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Swelling | FAERS: 9 | US FAERS | |
| 54 | Alopecia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 55 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 56 | Discomfort | FAERS: 8 | US FAERS | |
| 57 | Formication | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 58 | Injection site erythema | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Memory impairment | FAERS: 8 | US FAERS | |
| 60 | Nerve injury | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Palpitations | FAERS: 8 | US FAERS | |
| 62 | Abdominal Pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Chills | FAERS: 7 Canada Vigilance: 1 | 578589 | CTD Canada Vigilance US FAERS |
| 64 | Drug dispensing error | FAERS: 7 | OFFSIDES US FAERS | |
| 65 | Myalgia | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 66 | Peripheral swelling | FAERS: 7 | US FAERS | |
| 67 | Poor quality drug administered | FAERS: 7 | US FAERS | |
| 68 | Product contamination microbial | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Sepsis | FAERS: 7 | US FAERS | |
| 70 | Tinnitus | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Activities of daily living impaired | FAERS: 6 | OFFSIDES US FAERS | |
| 72 | Amnesia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Bradycardia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Cold sweat | FAERS: 6 | US FAERS | |
| 75 | General physical health deterioration | FAERS: 6 | OFFSIDES US FAERS | |
| 76 | Impaired work ability | FAERS: 6 | OFFSIDES US FAERS | |
| 77 | Limb discomfort | FAERS: 6 | US FAERS | |
| 78 | Lip swelling | FAERS: 6 | US FAERS | |
| 79 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 80 | Syncope | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 81 | Thrombosis | FAERS: 6 | US FAERS | |
| 82 | Vertigo | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Angina Pectoris | FAERS: 5 | US FAERS | |
| 84 | Bowel movement irregularity | FAERS: 5 | US FAERS | |
| 85 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 86 | Conjunctival ulcer | FAERS: 5 | US FAERS | |
| 87 | Eye pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 88 | Hepatitis | FAERS: 5 | OFFSIDES US FAERS | |
| 89 | Impaired driving ability | FAERS: 5 | US FAERS | |
| 90 | Injection site bruising | FAERS: 5 | US FAERS | |
| 91 | Injection site inflammation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Lethargy | FAERS: 5 | US FAERS | |
| 93 | Musculoskeletal Pain | FAERS: 5 | OFFSIDES US FAERS | |
| 94 | Psoas Abscess | FAERS: 5 | US FAERS | |
| 95 | Pulmonary Embolism | FAERS: 5 | US FAERS | |
| 96 | Rash erythematous | FAERS: 5 | US FAERS | |
| 97 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 98 | Antinuclear antibody increased | FAERS: 4 | OFFSIDES US FAERS | |
| 99 | Arthritis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 100 | Arthropathy | FAERS: 4 | OFFSIDES US FAERS | |
| 101 | Cellulitis | FAERS: 4 | OFFSIDES US FAERS | |
| 102 | Completed Suicide | FAERS: 4 | US FAERS | |
| 103 | Constipation | FAERS: 4 | US FAERS | |
| 104 | Dysuria | FAERS: 4 | OFFSIDES US FAERS | |
| 105 | Eczema | FAERS: 4 | OFFSIDES US FAERS | |
| 106 | Gout | FAERS: 4 | US FAERS | |
| 107 | Lipoatrophy | FAERS: 4 | US FAERS | |
| 108 | Monoplegia | FAERS: 4 | OFFSIDES US FAERS | |
| 109 | Ocular discomfort | FAERS: 4 | US FAERS | |
| 110 | Photophobia | FAERS: 4 | US FAERS | |
| 111 | Product lot number issue | FAERS: 4 | US FAERS | |
| 112 | Rheumatoid Arthritis | FAERS: 4 | US FAERS | |
| 113 | Skin Ulcer | FAERS: 4 | US FAERS | |
| 114 | Somnolence | FAERS: 4 | US FAERS | |
| 115 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 116 | Agitation | FAERS: 3 | US FAERS | |
| 117 | Bladder dysfunction | FAERS: 3 | US FAERS | |
| 118 | Bone pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Bronchitis | FAERS: 3 | OFFSIDES US FAERS | |
| 120 | Bronchospasm | FAERS: 3 | US FAERS | |
| 121 | Cataract | FAERS: 3 | OFFSIDES US FAERS | |
| 122 | Circumstance or information capable of leading to medication error | FAERS: 3 | OFFSIDES US FAERS | |
| 123 | Crying | FAERS: 3 | US FAERS | |
| 124 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 125 | Dysarthria | FAERS: 3 | US FAERS | |
| 126 | Dysgeusia | FAERS: 3 | US FAERS | |
| 127 | Expired product administered | FAERS: 3 | US FAERS | |
| 128 | Feeling jittery | FAERS: 3 | US FAERS | |
| 129 | Hypotension | FAERS: 3 | US FAERS | |
| 130 | Iatrogenic injury | FAERS: 3 | OFFSIDES US FAERS | |
| 131 | Increased steroid activity | FAERS: 3 | US FAERS | |
| 132 | Inflammation | FAERS: 3 | US FAERS | |
| 133 | Injection site atrophy | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 134 | Injection site extravasation | FAERS: 3 | US FAERS | |
| 135 | Liquid product physical issue | FAERS: 3 | US FAERS | |
| 136 | Macular degeneration | FAERS: 3 | US FAERS | |
| 137 | Myopathy | FAERS: 3 | US FAERS | |
| 138 | Necrosis | FAERS: 3 | US FAERS | |
| 139 | Nervousness | FAERS: 3 | US FAERS | |
| 140 | Osteopenia | FAERS: 3 | OFFSIDES US FAERS | |
| 141 | Paranoia | FAERS: 3 | OFFSIDES US FAERS | |
| 142 | Pneumonia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Product identification number issue | FAERS: 3 | US FAERS | |
| 144 | Purpura | FAERS: 3 | US FAERS | |
| 145 | Restlessness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 146 | Shock | FAERS: 3 | US FAERS | |
| 147 | Skin texture abnormal | FAERS: 3 | US FAERS | |
| 148 | Sneezing | FAERS: 3 | US FAERS | |
| 149 | Soft Tissue Infection | FAERS: 3 | US FAERS | |
| 150 | Tachycardia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Tooth Extraction | FAERS: 3 | OFFSIDES US FAERS | |
| 152 | Visual Impairment | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 153 | Visual disturbance | FAERS: 3 | OFFSIDES US FAERS | |
| 154 | Vulvovaginal pain | FAERS: 3 | OFFSIDES US FAERS | |
| 155 | Walking aid user | FAERS: 3 | OFFSIDES US FAERS | |
| 156 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 157 | jaundice | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Abdominal discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 159 | Acute psychosis | FAERS: 2 | US FAERS | |
| 160 | Adverse event | FAERS: 2 | US FAERS | |
| 161 | Anuria | FAERS: 2 | US FAERS | |
| 162 | Asthma | FAERS: 2 | US FAERS | |
| 163 | Autoimmune hepatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 164 | Blindness | FAERS: 2 Canada Vigilance: 1 | 758896 4422330 10654762 | CTD Canada Vigilance US FAERS |
| 165 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 166 | Blood pressure immeasurable | FAERS: 2 | OFFSIDES US FAERS | |
| 167 | Cartilage injury | FAERS: 2 | US FAERS | |
| 168 | Cauda Equina Syndrome | FAERS: 2 | US FAERS | |
| 169 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 170 | Cerebral Thrombosis | FAERS: 2 | OFFSIDES US FAERS | |
| 171 | Delirium | FAERS: 2 | US FAERS | |
| 172 | Drug Dependence | FAERS: 2 | US FAERS | |
| 173 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 174 | Dyspepsia | FAERS: 2 | US FAERS | |
| 175 | Ecchymosis | FAERS: 2 | US FAERS | |
| 176 | Erectile dysfunction | FAERS: 2 | 1772484 | CTD US FAERS |
| 177 | Exophthalmos | FAERS: 2 | US FAERS | |
| 178 | Hepatic necrosis | FAERS: 2 | US FAERS | |
| 179 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 180 | Histiocytosis haematophagic | FAERS: 2 | OFFSIDES US FAERS | |
| 181 | Hormone level abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 182 | Human herpesvirus 8 infection | FAERS: 2 | OFFSIDES US FAERS | |
| 183 | Hydrocephalus | FAERS: 2 | OFFSIDES US FAERS | |
| 184 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 185 | Hypophagia | FAERS: 2 | OFFSIDES US FAERS | |
| 186 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 187 | Incorrect route of product administration | FAERS: 2 | US FAERS | |
| 188 | Injection site irritation | FAERS: 2 | OFFSIDES US FAERS | |
| 189 | Joint Instability | FAERS: 2 | US FAERS | |
| 190 | Lentigo | FAERS: 2 | US FAERS | |
| 191 | Lymphangitis | FAERS: 2 | US FAERS | |
| 192 | Meniscus injury | FAERS: 2 | US FAERS | |
| 193 | Mental status changes | FAERS: 2 | OFFSIDES US FAERS | |
| 194 | Middle insomnia | FAERS: 2 | US FAERS | |
| 195 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 196 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 197 | Muscle tightness | FAERS: 2 | OFFSIDES US FAERS | |
| 198 | Nerve root injury | FAERS: 2 | OFFSIDES US FAERS | |
| 199 | Night sweats | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Ocular sarcoidosis | FAERS: 2 | US FAERS | |
| 201 | Onychomycosis | FAERS: 2 | US FAERS | |
| 202 | Oropharyngeal pain | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 203 | Osteoporosis | FAERS: 2 | OFFSIDES US FAERS | |
| 204 | Overdose | FAERS: 2 | US FAERS | |
| 205 | Pallor | FAERS: 2 | US FAERS | |
| 206 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 207 | Quadriplegia | FAERS: 2 | US FAERS | |
| 208 | Radiculopathy | FAERS: 2 | 9794061 | CTD US FAERS |
| 209 | Reaction to preservatives | FAERS: 2 | US FAERS | |
| 210 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 211 | Sciatica | FAERS: 2 | 6071628 | CTD US FAERS |
| 212 | Septic arthritis staphylococcal | FAERS: 2 | US FAERS | |
| 213 | Skin Papilloma | FAERS: 2 | US FAERS | |
| 214 | Skin irritation | FAERS: 2 | US FAERS | |
| 215 | Stomatitis | FAERS: 2 | US FAERS | |
| 216 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 217 | Suicide attempt | FAERS: 2 | US FAERS | |
| 218 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 219 | Transmission of an infectious agent via product | FAERS: 2 | US FAERS | |
| 220 | Unevaluable event | FAERS: 2 | OFFSIDES US FAERS | |
| 221 | Urethral intrinsic sphincter deficiency | FAERS: 2 | US FAERS | |
| 222 | Urinary Retention | FAERS: 2 | US FAERS | |
| 223 | Vasospasm | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 224 | Vulvovaginal discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 225 | Xerophthalmia | FAERS: 2 | US FAERS | |
| 226 | nervous system disorder | FAERS: 2 | US FAERS | |
| 227 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 228 | Accidental exposure | FAERS: 1 | US FAERS | |
| 229 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 230 | Acute myocardial infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 231 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 232 | Anal discomfort | FAERS: 1 | US FAERS | |
| 233 | Anger | FAERS: 1 | US FAERS | |
| 234 | Angioedema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 235 | Anorexia | FAERS: 1 | US FAERS | |
| 236 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 237 | Aphasia | FAERS: 1 | US FAERS | |
| 238 | Aphonia | FAERS: 1 | US FAERS | |
| 239 | Apparent death | FAERS: 1 | US FAERS | |
| 240 | Application site pain | FAERS: 1 | US FAERS | |
| 241 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 242 | Aspergillus test positive | FAERS: 1 | US FAERS | |
| 243 | Ataxia | FAERS: 1 | US FAERS | |
| 244 | Auricular swelling | FAERS: 1 | US FAERS | |
| 245 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 246 | B-lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 247 | Bacillus infection | FAERS: 1 | US FAERS | |
| 248 | Back disorder | FAERS: 1 | US FAERS | |
| 249 | Bedridden | FAERS: 1 | US FAERS | |
| 250 | Biopsy liver abnormal | FAERS: 1 | US FAERS | |
| 251 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 252 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 253 | Blood glucose decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 254 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 255 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 256 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 257 | Blood urine present | FAERS: 1 | US FAERS | |
| 258 | Body surface area decreased | FAERS: 1 | US FAERS | |
| 259 | Bone density decreased | FAERS: 1 | US FAERS | |
| 260 | Bone erosion | FAERS: 1 | US FAERS | |
| 261 | Brain Death | FAERS: 1 | OFFSIDES US FAERS | |
| 262 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 263 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 264 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 265 | Cartilage atrophy | FAERS: 1 | US FAERS | |
| 266 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 267 | Cerebellar artery thrombosis | FAERS: 1 | US FAERS | |
| 268 | Cerebellar infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 269 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 270 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 271 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 272 | Critical illness myopathy | FAERS: 1 | US FAERS | |
| 273 | Cystitis | FAERS: 1 | US FAERS | |
| 274 | Deformity | FAERS: 1 | US FAERS | |
| 275 | Dehydration | FAERS: 1 | US FAERS | |
| 276 | Depressed mood | FAERS: 1 | US FAERS | |
| 277 | Device computer issue | FAERS: 1 | US FAERS | |
| 278 | Device occlusion | FAERS: 1 | US FAERS | |
| 279 | Device related infection | FAERS: 1 | OFFSIDES US FAERS | |
| 280 | Device use error | FAERS: 1 | US FAERS | |
| 281 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 282 | Diplopia | FAERS: 1 | OFFSIDES US FAERS | |
| 283 | Disability | FAERS: 1 | US FAERS | |
| 284 | Disorientation | FAERS: 1 | US FAERS | |
| 285 | Diverticulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 286 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 287 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 288 | Drug clearance decreased | FAERS: 1 | US FAERS | |
| 289 | Drug dose omission | FAERS: 1 | US FAERS | |
| 290 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 291 | Drug label confusion | FAERS: 1 | US FAERS | |
| 292 | Drug toxicity | FAERS: 1 | US FAERS | |
| 293 | Dry skin | FAERS: 1 | OFFSIDES US FAERS | |
| 294 | Duodenal Ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 295 | Dysgraphia | FAERS: 1 | US FAERS | |
| 296 | Ear discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 297 | Embolism | FAERS: 1 | 758896 5507712 | CTD OFFSIDES US FAERS |
| 298 | Emotional disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 299 | Emotional distress | FAERS: 1 | OFFSIDES US FAERS | |
| 300 | Encephalitis | FAERS: 1 | OFFSIDES US FAERS | |
| 301 | Endocarditis | FAERS: 1 | US FAERS | |
| 302 | Epidural lipomatosis | FAERS: 1 | OFFSIDES US FAERS | |
| 303 | Erythromelalgia | FAERS: 1 | US FAERS | |
| 304 | Euphoric mood | FAERS: 1 | US FAERS | |
| 305 | Excoriation | FAERS: 1 | US FAERS | |
| 306 | Eye irritation | FAERS: 1 | US FAERS | |
| 307 | Facial Pain | FAERS: 1 | US FAERS | |
| 308 | Fascial rupture | FAERS: 1 | US FAERS | |
| 309 | Feeling Cold | FAERS: 1 | US FAERS | |
| 310 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 311 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 312 | Fibromyalgia | FAERS: 1 | OFFSIDES US FAERS | |
| 313 | Fibrosis | FAERS: 1 | US FAERS | |
| 314 | Frustration | FAERS: 1 | US FAERS | |
| 315 | Gait inability | FAERS: 1 | US FAERS | |
| 316 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 317 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 318 | Gastritis | FAERS: 1 | US FAERS | |
| 319 | Head discomfort | FAERS: 1 | US FAERS | |
| 320 | Histoplasmosis | FAERS: 1 | OFFSIDES US FAERS | |
| 321 | Humoral immune defect | FAERS: 1 | US FAERS | |
| 322 | Hunger | FAERS: 1 | US FAERS | |
| 323 | Hypersomnia | FAERS: 1 | US FAERS | |
| 324 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 325 | Hypertrophic Cardiomyopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 326 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 327 | Hysterectomy | FAERS: 1 | US FAERS | |
| 328 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 329 | Ileus | FAERS: 1 | US FAERS | |
| 330 | Immunosuppression | FAERS: 1 | US FAERS | |
| 331 | Impaired self-care | FAERS: 1 | US FAERS | |
| 332 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 333 | Incoherent | FAERS: 1 | US FAERS | |
| 334 | Incorrect dose administered by device | FAERS: 1 | US FAERS | |
| 335 | Injection site cellulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 336 | Injection site discharge | FAERS: 1 | US FAERS | |
| 337 | Injection site discomfort | FAERS: 1 | US FAERS | |
| 338 | Injection site mass | FAERS: 1 | US FAERS | |
| 339 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 340 | Injection site warmth | FAERS: 1 | US FAERS | |
| 341 | Injection | FAERS: 1 | US FAERS | |
| 342 | Injury associated with device | FAERS: 1 | US FAERS | |
| 343 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 344 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 345 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 346 | Intervertebral Disc Degeneration | FAERS: 1 | OFFSIDES US FAERS | |
| 347 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 348 | Joint injury | FAERS: 1 | US FAERS | |
| 349 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 350 | Lipase increased | FAERS: 1 | US FAERS | |
| 351 | Lipodystrophy acquired | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 352 | Lipoma | FAERS: 1 | US FAERS | |
| 353 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 354 | Mental impairment | FAERS: 1 | US FAERS | |
| 355 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 356 | Mood swings | FAERS: 1 | US FAERS | |
| 357 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 358 | Multiple Chemical Sensitivity | FAERS: 1 | US FAERS | |
| 359 | Multiple Sclerosis | FAERS: 1 | OFFSIDES US FAERS | |
| 360 | Muscle tone disorder | FAERS: 1 | US FAERS | |
| 361 | Musculoskeletal discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 362 | Myoclonus | FAERS: 1 | US FAERS | |
| 363 | Negative thoughts | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 364 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 365 | Neuritis | FAERS: 1 | US FAERS | |
| 366 | Neuropathy | FAERS: 1 | US FAERS | |
| 367 | Nipple inflammation | FAERS: 1 | US FAERS | |
| 368 | Nodule | FAERS: 1 | OFFSIDES US FAERS | |
| 369 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 370 | Onychoclasis | FAERS: 1 | US FAERS | |
| 371 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 372 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 373 | Oral discharge | FAERS: 1 | OFFSIDES US FAERS | |
| 374 | Oral pruritus | FAERS: 1 | US FAERS | |
| 375 | Osteosclerosis | FAERS: 1 | US FAERS | |
| 376 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 377 | Pancreatitis | FAERS: 1 | US FAERS | |
| 378 | Panic Disorder | FAERS: 1 | US FAERS | |
| 379 | Paraplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 380 | Penile swelling | FAERS: 1 | US FAERS | |
| 381 | Pericarditis | FAERS: 1 | OFFSIDES US FAERS | |
| 382 | Perineal pain | FAERS: 1 | US FAERS | |
| 383 | Personality Change | FAERS: 1 | OFFSIDES US FAERS | |
| 384 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 385 | Phonophobia | FAERS: 1 | US FAERS | |
| 386 | Poisoning | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 387 | Poor peripheral circulation | FAERS: 1 | OFFSIDES US FAERS | |
| 388 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 389 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 390 | Postoperative infection | FAERS: 1 | OFFSIDES US FAERS | |
| 391 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 392 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 393 | Product administered at inappropriate site | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 394 | Product administration error | FAERS: 1 | US FAERS | |
| 395 | Product formulation issue | FAERS: 1 | US FAERS | |
| 396 | Product label issue | FAERS: 1 | US FAERS | |
| 397 | Pyopneumothorax | FAERS: 1 | US FAERS | |
| 398 | Quality of life decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 399 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 400 | Recalled product administered | FAERS: 1 | US FAERS | |
| 401 | Respiratory Failure | FAERS: 1 | OFFSIDES US FAERS | |
| 402 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 403 | Respiratory distress | FAERS: 1 | US FAERS | |
| 404 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 405 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 406 | Retinal toxicity | FAERS: 1 | US FAERS | |
| 407 | Rhinitis | FAERS: 1 | 758896 | CTD OFFSIDES US FAERS |
| 408 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 409 | Scleroderma renal crisis | FAERS: 1 | US FAERS | |
| 410 | Screaming | FAERS: 1 | US FAERS | |
| 411 | Sensitive skin | FAERS: 1 | US FAERS | |
| 412 | Septic Shock | FAERS: 1 | US FAERS | |
| 413 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 414 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 415 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 416 | Skin Induration | FAERS: 1 | US FAERS | |
| 417 | Skin lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Skin reaction | FAERS: 1 | US FAERS | |
| 419 | Soft tissue atrophy | FAERS: 1 | US FAERS | |
| 420 | Spinal column stenosis | FAERS: 1 | OFFSIDES US FAERS | |
| 421 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 422 | Stress | FAERS: 1 | US FAERS | |
| 423 | Strongyloidiasis | FAERS: 1 | US FAERS | |
| 424 | Sudden death | FAERS: 1 | US FAERS | |
| 425 | Sunburn | FAERS: 1 | US FAERS | |
| 426 | Surgical failure | FAERS: 1 | US FAERS | |
| 427 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 428 | Synovitis | FAERS: 1 | US FAERS | |
| 429 | Syringe issue | FAERS: 1 | US FAERS | |
| 430 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 431 | Tendon necrosis | FAERS: 1 | US FAERS | |
| 432 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 433 | Tetany | FAERS: 1 | US FAERS | |
| 434 | Thirst | FAERS: 1 | US FAERS | |
| 435 | Throat irritation | FAERS: 1 | US FAERS | |
| 436 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 437 | Tooth Avulsion | FAERS: 1 | US FAERS | |
| 438 | Torticollis | FAERS: 1 | US FAERS | |
| 439 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 440 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 441 | Ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 442 | Urethritis | FAERS: 1 | US FAERS | |
| 443 | Urine ketone body present | FAERS: 1 | OFFSIDES US FAERS | |
| 444 | VIIth nerve paralysis | FAERS: 1 | OFFSIDES US FAERS | |
| 445 | Varicella Zoster Virus Infection | FAERS: 1 | US FAERS | |
| 446 | Vasculitis | FAERS: 1 | US FAERS | |
| 447 | Vessel perforation | FAERS: 1 | US FAERS | |
| 448 | Wheezing | FAERS: 1 | US FAERS | |
| 449 | Wound Complication | FAERS: 1 | US FAERS | |
| 450 | fibroma | FAERS: 1 | US FAERS | |
| 451 | Abscess soft tissue | OFFSIDES | ||
| 452 | Abuse | OFFSIDES | ||
| 453 | Acid reflux | OFFSIDES | ||
| 454 | Acne | OFFSIDES | ||
| 455 | Acute bronchitis | OFFSIDES | ||
| 456 | Adenocarcinoma | OFFSIDES | ||
| 457 | Adenoma | OFFSIDES | ||
| 458 | Ageusia | OFFSIDES | ||
| 459 | Agraphia | OFFSIDES | ||
| 460 | Alcohol abuse | OFFSIDES | ||
| 461 | Alcohol consumption | OFFSIDES | ||
| 462 | Amenorrhea | OFFSIDES | ||
| 463 | Ammonia increased | OFFSIDES | ||
| 464 | Amputation | OFFSIDES | ||
| 465 | Analgesia | OFFSIDES | ||
| 466 | Anaphylactoid Reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 467 | Angle Closure Glaucoma | OFFSIDES | ||
| 468 | Anhedonia | OFFSIDES | ||
| 469 | Anhidrosis | OFFSIDES | ||
| 470 | Ankle Fracture | OFFSIDES | ||
| 471 | Antimicrobial susceptibility test resistant | OFFSIDES | ||
| 472 | Aortic bypass | OFFSIDES | ||
| 473 | Apathy | OFFSIDES | ||
| 474 | Arteriosclerosis | OFFSIDES | ||
| 475 | Arthrodesis | OFFSIDES | ||
| 476 | Arthroscopy | OFFSIDES | ||
| 477 | Aspergillosis | OFFSIDES | ||
| 478 | Asthenopia | OFFSIDES | ||
| 479 | Astigmatism | OFFSIDES | ||
| 480 | Atelectasis | OFFSIDES | ||
| 481 | Atrial tachycardia | OFFSIDES | ||
| 482 | Atrioventricular Block | OFFSIDES | ||
| 483 | Atrophic vulvovaginitis | OFFSIDES | ||
| 484 | Axonal neuropathy | OFFSIDES | ||
| 485 | Bacterial disease carrier | OFFSIDES | ||
| 486 | Basal cell carcinoma | OFFSIDES | ||
| 487 | Benign neoplasm of thyroid gland | OFFSIDES | ||
| 488 | Biopsy bone marrow abnormal | OFFSIDES | ||
| 489 | Biopsy breast abnormal | OFFSIDES | ||
| 490 | Blepharoptosis | OFFSIDES | ||
| 491 | Blood Glucose | OFFSIDES | ||
| 492 | Blood bilirubin unconjugated increased | OFFSIDES | ||
| 493 | Blood cholesterol | OFFSIDES | ||
| 494 | Blood cortisol decreased | OFFSIDES | ||
| 495 | Blood cortisol increased | OFFSIDES | ||
| 496 | Blood fibrinogen | OFFSIDES | ||
| 497 | Blood lactate dehydrogenase increased | OFFSIDES | ||
| 498 | Blood osmolarity decreased | OFFSIDES | ||
| 499 | Blood parathyroid hormone increased | OFFSIDES | ||
| 500 | Blood prolactin increased | OFFSIDES | ||
| 501 | Blood uric acid | OFFSIDES | ||
| 502 | Blurred vision | OFFSIDES | ||
| 503 | Bone abscess | OFFSIDES | ||
| 504 | Bone marrow necrosis | OFFSIDES | ||
| 505 | Breast Cyst | OFFSIDES | ||
| 506 | Breast Microcalcification | OFFSIDES | ||
| 507 | Breast cancer stage II | OFFSIDES | ||
| 508 | Breast cosmetic surgery | OFFSIDES | ||
| 509 | Breast hyperplasia | OFFSIDES | ||
| 510 | Breast necrosis | OFFSIDES | ||
| 511 | Bronchiectasis | OFFSIDES | ||
| 512 | Bronchopleural Fistula | OFFSIDES | ||
| 513 | Bronchoscopy abnormal | OFFSIDES | ||
| 514 | Bursitis | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 515 | Candida sepsis | OFFSIDES | ||
| 516 | Cardiac Tamponade | OFFSIDES | ||
| 517 | Cardioactive drug level increased | OFFSIDES | ||
| 518 | Cataract operation | OFFSIDES | ||
| 519 | Causalgia | OFFSIDES | ||
| 520 | Cerebral arteritis | OFFSIDES | ||
| 521 | Cerebral atrophy | OFFSIDES | ||
| 522 | Choking sensation | OFFSIDES | ||
| 523 | Cholecystitis | OFFSIDES | ||
| 524 | Chondromalacia | OFFSIDES | ||
| 525 | Choroid Diseases | 12055481 | CTD | |
| 526 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 527 | Chronic left ventricular failure | OFFSIDES | ||
| 528 | Cicatrix | 10654762 | CTD | |
| 529 | Clostridium difficile toxin test positive | OFFSIDES | ||
| 530 | Clubbing | OFFSIDES | ||
| 531 | Colon adenoma | OFFSIDES | ||
| 532 | Compression fracture | OFFSIDES | ||
| 533 | Compulsive shopping | OFFSIDES | ||
| 534 | Confabulation | OFFSIDES | ||
| 535 | Confusion | 578589 | CTD | |
| 536 | Congenital pyelocaliectasis | OFFSIDES | ||
| 537 | Conjunctival deposit | OFFSIDES | ||
| 538 | Contact Dermatitis | OFFSIDES | ||
| 539 | Corneal dystrophy | OFFSIDES | ||
| 540 | Coronary angioplasty | OFFSIDES | ||
| 541 | Culture positive | OFFSIDES | ||
| 542 | Cushing Syndrome | 11004305 | CTD | |
| 543 | Cyst aspiration | OFFSIDES | ||
| 544 | Cyst | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 545 | Cytolytic hepatitis | OFFSIDES | ||
| 546 | Cytomegalovirus chorioretinitis | OFFSIDES | ||
| 547 | Deafness | OFFSIDES | ||
| 548 | Debridement | OFFSIDES | ||
| 549 | Demyelination | OFFSIDES | ||
| 550 | Dental caries | OFFSIDES | ||
| 551 | Dental discomfort | OFFSIDES | ||
| 552 | Denture wearer | OFFSIDES | ||
| 553 | Depression suicidal | OFFSIDES | ||
| 554 | Diabetes | OFFSIDES | ||
| 555 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 556 | Diabetic Nephropathy | OFFSIDES | ||
| 557 | Diarrhea | OFFSIDES | ||
| 558 | Disseminated Intravascular Coagulation | OFFSIDES | ||
| 559 | Diverticulosis | OFFSIDES | ||
| 560 | Diverticulum | OFFSIDES | ||
| 561 | Drug withdrawal headache | OFFSIDES | ||
| 562 | Dyspareunia | OFFSIDES | ||
| 563 | Ear congestion | OFFSIDES | ||
| 564 | Early satiety | OFFSIDES | ||
| 565 | Economic problem | OFFSIDES | ||
| 566 | Empyema | OFFSIDES | ||
| 567 | Endodontic procedure | OFFSIDES | ||
| 568 | Endometrial disorder | OFFSIDES | ||
| 569 | Endometrial hypertrophy | OFFSIDES | ||
| 570 | Engraftment syndrome | OFFSIDES | ||
| 571 | Epicondylitis | OFFSIDES | ||
| 572 | Erythema marginatum | OFFSIDES | ||
| 573 | Eye laser surgery | OFFSIDES | ||
| 574 | Eyelid margin crusting | OFFSIDES | ||
| 575 | Factor VIII Deficiency | OFFSIDES | ||
| 576 | Failure to Thrive | OFFSIDES | ||
| 577 | Fasciitis, Plantar | 14525843 | CTD | |
| 578 | Fat necrosis | OFFSIDES | ||
| 579 | Febrile bone marrow aplasia | OFFSIDES | ||
| 580 | Fever | 578589 | CTD | |
| 581 | Fibroadenoma of breast | OFFSIDES | ||
| 582 | Filariasis | OFFSIDES | ||
| 583 | Flank Pain | OFFSIDES | ||
| 584 | Folliculitis | OFFSIDES | ||
| 585 | Food Poisoning | OFFSIDES | ||
| 586 | Foot Dermatoses | 3155925 | CTD | |
| 587 | Gastric Bypass | OFFSIDES | ||
| 588 | Gastric ulcer | OFFSIDES | ||
| 589 | Gastrointestinal infection | OFFSIDES | ||
| 590 | Gastrointestinal motility disorder | OFFSIDES | ||
| 591 | Gastrointestinal toxicity | OFFSIDES | ||
| 592 | Globulinuria | OFFSIDES | ||
| 593 | Glomerulonephritis | OFFSIDES | ||
| 594 | Graft infection | OFFSIDES | ||
| 595 | Granuloma | 13129887 | CTD OFFSIDES | |
| 596 | Hallucinations, mixed | OFFSIDES | ||
| 597 | Hand Dermatoses | 3155925 | CTD | |
| 598 | Haptoglobin Decreased | OFFSIDES | ||
| 599 | Heart-lung transplant rejection | OFFSIDES | ||
| 600 | Hemangioma | 12055481 | CTD | |
| 601 | Hemiparesis | OFFSIDES | ||
| 602 | Hiccough | OFFSIDES | ||
| 603 | High density lipoprotein increased | OFFSIDES | ||
| 604 | Hilar lymphadenopathy | OFFSIDES | ||
| 605 | Hydronephrosis | OFFSIDES | ||
| 606 | Hydropneumothorax | OFFSIDES | ||
| 607 | Hyperosmolar state | OFFSIDES | ||
| 608 | Hyperparathyroidism | OFFSIDES | ||
| 609 | Hypertensive heart disease | OFFSIDES | ||
| 610 | Hypertrichosis | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 611 | Hypogeusia | OFFSIDES | ||
| 612 | Hysterosalpingo-oophorectomy | OFFSIDES | ||
| 613 | Immunosuppressant drug level decreased | OFFSIDES | ||
| 614 | Incontinence | OFFSIDES | ||
| 615 | Induration | OFFSIDES | ||
| 616 | Infected cyst | OFFSIDES | ||
| 617 | Infection in an immunocompromised host | OFFSIDES | ||
| 618 | Infusion site mobility decreased | OFFSIDES | ||
| 619 | Intertrigo | OFFSIDES | ||
| 620 | Intervertebral disc compression | OFFSIDES | ||
| 621 | Intervertebral disc disorder | OFFSIDES | ||
| 622 | Intracranial Aneurysm | OFFSIDES | ||
| 623 | Intracranial Hypotension | OFFSIDES | ||
| 624 | Iridectomy | OFFSIDES | ||
| 625 | Iridocyclitis | OFFSIDES | ||
| 626 | Joint Range of Motion Decreased | OFFSIDES | ||
| 627 | Joint sprain | OFFSIDES | ||
| 628 | Large intestine perforation | OFFSIDES | ||
| 629 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 630 | Left atrial dilatation | OFFSIDES | ||
| 631 | Leukocytosis | Canada Vigilance: 1 | Canada Vigilance | |
| 632 | Leukopenia neonatal | OFFSIDES | ||
| 633 | Limb injury | OFFSIDES | ||
| 634 | Limb operation | OFFSIDES | ||
| 635 | Lipomatosis | 1771466 10414580 | CTD | |
| 636 | Low Back Pain | 10414580 | CTD | |
| 637 | Lumbar radiculopathy | OFFSIDES | ||
| 638 | Lung hyperinflation | OFFSIDES | ||
| 639 | Lung squamous cell carcinoma stage II | OFFSIDES | ||
| 640 | Lymph node cancer metastatic | OFFSIDES | ||
| 641 | Lymphedema | OFFSIDES | ||
| 642 | Lymphocytosis | OFFSIDES | ||
| 643 | Macrocytosis | OFFSIDES | ||
| 644 | Mastectomy | OFFSIDES | ||
| 645 | Mastication disorder | OFFSIDES | ||
| 646 | Mastoiditis | OFFSIDES | ||
| 647 | Mechanical ventilation | OFFSIDES | ||
| 648 | Meningioma | OFFSIDES | ||
| 649 | Meningism | 1862897 | CTD | |
| 650 | Meniscus removal | OFFSIDES | ||
| 651 | Metaplasia | OFFSIDES | ||
| 652 | Modified radical mastectomy | OFFSIDES | ||
| 653 | Mole excision | OFFSIDES | ||
| 654 | Monocytosis | OFFSIDES | ||
| 655 | Multiple Myeloma | OFFSIDES | ||
| 656 | Muscle Weakness | OFFSIDES | ||
| 657 | Muscle flap operation | OFFSIDES | ||
| 658 | Musculoskeletal chest pain | OFFSIDES | ||
| 659 | Myelitis | OFFSIDES | ||
| 660 | Myelocytosis | OFFSIDES | ||
| 661 | Myelodysplasia | OFFSIDES | ||
| 662 | Nephrolithiasis | OFFSIDES | ||
| 663 | Neuroma | OFFSIDES | ||
| 664 | Neutrophil count abnormal | OFFSIDES | ||
| 665 | Non-cardiac chest pain | OFFSIDES | ||
| 666 | Non-small cell lung cancer recurrent | OFFSIDES | ||
| 667 | Nystagmus | OFFSIDES | ||
| 668 | Open reduction of fracture | OFFSIDES | ||
| 669 | Open wound | OFFSIDES | ||
| 670 | Osteolysis | OFFSIDES | ||
| 671 | Osteoradionecrosis | OFFSIDES | ||
| 672 | PROTHROMBIN TIME | OFFSIDES | ||
| 673 | Paranasal sinus hypersecretion | OFFSIDES | ||
| 674 | Parathyroidectomy | OFFSIDES | ||
| 675 | Paresthesia | 3155925 | CTD | |
| 676 | Pelvic fluid collection | OFFSIDES | ||
| 677 | Peptic Ulcer Perforation | OFFSIDES | ||
| 678 | Peritoneal Dialysis | OFFSIDES | ||
| 679 | Peritonitis | OFFSIDES | ||
| 680 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 681 | Phlebitis | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 682 | Plasmacytoma | OFFSIDES | ||
| 683 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 684 | Pneumothorax | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 685 | Polycystic Kidney Diseases | 3945365 8724899 | CTD | |
| 686 | Polymyositis | OFFSIDES | ||
| 687 | Polyneuropathy | OFFSIDES | ||
| 688 | Polyuria | OFFSIDES | ||
| 689 | Poor quality sleep | OFFSIDES | ||
| 690 | Positron emission tomogram abnormal | OFFSIDES | ||
| 691 | Post procedural bile leak | OFFSIDES | ||
| 692 | Post procedural fistula | OFFSIDES | ||
| 693 | Posterior Capsulotomy | OFFSIDES | ||
| 694 | Postmenopausal bleeding | OFFSIDES | ||
| 695 | Postoperative abscess | OFFSIDES | ||
| 696 | Presbyopia | OFFSIDES | ||
| 697 | Productive Cough | OFFSIDES | ||
| 698 | Progesterone receptor assay | OFFSIDES | ||
| 699 | Proteinuria | Canada Vigilance: 1 | Canada Vigilance | |
| 700 | Psoriasis | OFFSIDES | ||
| 701 | Pulmonary Hypertension | OFFSIDES | ||
| 702 | Pulmonary Infarction | OFFSIDES | ||
| 703 | Pulmonary thrombosis | OFFSIDES | ||
| 704 | Pyelonephritis | OFFSIDES | ||
| 705 | Pyoderma Gangrenosum | OFFSIDES | ||
| 706 | Radiation associated pain | OFFSIDES | ||
| 707 | Radiation skin injury | OFFSIDES | ||
| 708 | Radicular pain | OFFSIDES | ||
| 709 | Rales | OFFSIDES | ||
| 710 | Rectal polyp | OFFSIDES | ||
| 711 | Retinal Artery Occlusion | 733189 12055481 | CTD | |
| 712 | Retinal Diseases | 10654762 | CTD | |
| 713 | Sclerosis | 13129887 | CTD | |
| 714 | Scotoma | 758896 | CTD | |
| 715 | Sensorimotor disorder | OFFSIDES | ||
| 716 | Septoplasty | OFFSIDES | ||
| 717 | Sequestrectomy | OFFSIDES | ||
| 718 | Seroma | OFFSIDES | ||
| 719 | Sinus bradycardia | OFFSIDES | ||
| 720 | Sinus operation | OFFSIDES | ||
| 721 | Sinusitis | OFFSIDES | ||
| 722 | Skin laceration | OFFSIDES | ||
| 723 | Skin necrosis | OFFSIDES | ||
| 724 | Small Intestinal Stenosis | OFFSIDES | ||
| 725 | Soft Tissue Injuries | OFFSIDES | ||
| 726 | Spinal Cord Diseases | 1771466 | CTD | |
| 727 | Spinal Cord Injuries | 9794061 | CTD | |
| 728 | Spinal Stenosis | 10414580 | CTD | |
| 729 | Spondylolisthesis | OFFSIDES | ||
| 730 | Stem cell transplant | OFFSIDES | ||
| 731 | Sudden Cardiac Death | OFFSIDES | ||
| 732 | Supraventricular tachycardia | OFFSIDES | ||
| 733 | Synovial Cyst | OFFSIDES | ||
| 734 | T-Cell Lymphoma | OFFSIDES | ||
| 735 | Tendinitis | OFFSIDES | ||
| 736 | Therapeutic procedure | OFFSIDES | ||
| 737 | Therapeutic product effect incomplete | Canada Vigilance: 3 | Canada Vigilance | |
| 738 | Thoracotomy | OFFSIDES | ||
| 739 | Thyroid gland scan abnormal | OFFSIDES | ||
| 740 | Tinea Pedis | OFFSIDES | ||
| 741 | Tinea | OFFSIDES | ||
| 742 | Tobacco user | OFFSIDES | ||
| 743 | Tooth Loss | OFFSIDES | ||
| 744 | Tracheobronchitis | OFFSIDES | ||
| 745 | Trigeminal Nerve Disorder | OFFSIDES | ||
| 746 | Tryptase increased | OFFSIDES | ||
| 747 | Tuberculosis, Meningeal | 6071628 | CTD | |
| 748 | Ulnar Neuritis | OFFSIDES | ||
| 749 | Ultrasound scan abnormal | OFFSIDES | ||
| 750 | Uveitis, Posterior | 11004305 | CTD | |
| 751 | Vascular calcification | OFFSIDES | ||
| 752 | Vertebroplasty | OFFSIDES | ||
| 753 | Vision Disorders | 3964629 | CTD | |
| 754 | Vitrectomy | OFFSIDES | ||
| 755 | Vitreous Detachment | OFFSIDES | ||
| 756 | Vocal Cord Paralysis | OFFSIDES | ||
| 757 | Weight Gain | OFFSIDES | ||
| 758 | Wheelchair user | OFFSIDES | ||
| 759 | Withdrawal of life support | OFFSIDES | ||
| 760 | Wound dehiscence | OFFSIDES | ||
| 761 | Wound infection pseudomonas | OFFSIDES | ||
| 762 | Wound infection staphylococcal | OFFSIDES | ||
| 763 | Wound necrosis | OFFSIDES | ||
| 764 | effusion | OFFSIDES | ||
| 765 | treatment failure | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.