gemcitabine
(OKKDEIYWILRZIA-OSZBKLCCSA-N)
Structure
- SMILES
- OC[C@H]1O[C@H](C([C@@H]1O)(F)F)n1ccc(nc1=O)N.Cl
- Molecular Formula:
- C9H12ClF2N3O4
- Molecular Weight:
- 299.659
- Log P:
- 0.0946
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 4
- TPSA:
- 110.6
- CAS Number(s):
- 12211-03-9; 122111-03-9
Synonym(s)
1.
gemcitabine
2.
2',2'-DFDC
3.
2',2'-difluoro-2'-deoxycytidine
4.
2',2'-difluorodeoxycytidine
5.
2'-deoxy-2',2''-difluorocytidine-5'-O-monophosphate
6.
2'-deoxy-2'-difluorocytidine
7.
Gemzar
8.
LY 188011
9.
LY-188011
10.
dFdCyd
11.
gemcitabine hydrochloride
12.
gemcitabine, (D-threo-pentafuranosyl)-isomer
13.
gemcitabine, (alpha-D-threo-pentofuranosyl)-isomer
14.
gemcitabine, (beta-D-threo-pentafuranosyl)-isomer
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malignant neoplasm progression | FAERS: 300 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Nausea | FAERS: 99 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Ascites | FAERS: 85 | US FAERS | |
| 4 | Thrombocytopenia | FAERS: 84 | US FAERS | |
| 5 | Pneumonia | FAERS: 81 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Asthenia | FAERS: 66 | US FAERS | |
| 7 | Vomiting | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Sepsis | FAERS: 64 | US FAERS | |
| 9 | Cerebral Infarction | FAERS: 59 | US FAERS | |
| 10 | Abdominal Pain | FAERS: 57 | US FAERS | |
| 11 | Neutropenia | FAERS: 57 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 12 | Fatigue | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Cholangitis | FAERS: 47 | US FAERS | |
| 14 | Disease Progression | FAERS: 47 | US FAERS | |
| 15 | Neutrophil count decreased | FAERS: 46 | US FAERS | |
| 16 | Capillary Leak Syndrome | FAERS: 43 | US FAERS | |
| 17 | General physical health deterioration | FAERS: 43 | US FAERS | |
| 18 | Haematotoxicity | FAERS: 43 | US FAERS | |
| 19 | Malaise | FAERS: 43 | US FAERS | |
| 20 | Erythema | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Pain | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Adverse event | FAERS: 41 | US FAERS | |
| 23 | White blood cell count decreased | FAERS: 41 | US FAERS | |
| 24 | Hospice Care | FAERS: 40 | US FAERS | |
| 25 | Pancytopenia | FAERS: 40 | US FAERS | |
| 26 | Pneumonitis | FAERS: 40 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 27 | Pulmonary Embolism | FAERS: 39 | US FAERS | |
| 28 | Respiratory Failure | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Dehydration | FAERS: 33 | US FAERS | |
| 30 | Disseminated Intravascular Coagulation | FAERS: 33 | US FAERS | |
| 31 | Myocardial Infarction | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Hypoxia | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Leukopenia | FAERS: 32 | US FAERS | |
| 34 | Blood creatinine increased | FAERS: 31 | US FAERS | |
| 35 | Pulmonary toxicity | FAERS: 31 | US FAERS | |
| 36 | Chest Pain | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Pericardial effusion | FAERS: 29 | US FAERS | |
| 38 | Chills | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Septic Shock | FAERS: 26 | US FAERS | |
| 40 | Headache | FAERS: 25 | US FAERS | |
| 41 | Hypotension | FAERS: 25 | US FAERS | |
| 42 | Acute kidney injury | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Deep Vein Thrombosis | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Dizziness | FAERS: 23 | US FAERS | |
| 45 | Urinary tract infection | FAERS: 23 | US FAERS | |
| 46 | Myositis | FAERS: 22 | US FAERS | |
| 47 | Weight decreased | FAERS: 22 | US FAERS | |
| 48 | jaundice | FAERS: 22 | US FAERS | |
| 49 | Blood lactate dehydrogenase increased | FAERS: 21 | US FAERS | |
| 50 | Aspartate Aminotransferase Increased | FAERS: 20 | US FAERS | |
| 51 | Blood albumin decreased | FAERS: 20 | US FAERS | |
| 52 | Drug ineffective | FAERS: 19 | US FAERS | |
| 53 | Infection | FAERS: 19 | US FAERS | |
| 54 | Nephrotic Syndrome | FAERS: 19 | US FAERS | |
| 55 | Thrombosis | FAERS: 19 | US FAERS | |
| 56 | Febrile Neutropenia | FAERS: 18 | US FAERS | |
| 57 | Failure to Thrive | FAERS: 17 | US FAERS | |
| 58 | Recall phenomenon | FAERS: 17 | US FAERS | |
| 59 | Drug toxicity | FAERS: 16 | US FAERS | |
| 60 | Liver Abscess | FAERS: 16 | US FAERS | |
| 61 | Malignant ascites | FAERS: 16 | US FAERS | |
| 62 | Pancreatic carcinoma | FAERS: 16 | US FAERS | |
| 63 | Alanine Aminotransferase Increased | FAERS: 15 | US FAERS | |
| 64 | Pulmonary Hypertension | FAERS: 15 | US FAERS | |
| 65 | Toxicity to various agents | FAERS: 15 | US FAERS | |
| 66 | Pulmonary Fibrosis | FAERS: 14 | US FAERS | |
| 67 | Respiratory distress | FAERS: 14 | US FAERS | |
| 68 | Shock | FAERS: 14 | US FAERS | |
| 69 | Atrial Fibrillation | FAERS: 13 | US FAERS | |
| 70 | Cholestasis | FAERS: 13 | US FAERS | |
| 71 | Constipation | FAERS: 13 | US FAERS | |
| 72 | Depressed Level of Consciousness | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Skin Ulcer | FAERS: 13 | US FAERS | |
| 74 | Transaminases increased | FAERS: 13 | US FAERS | |
| 75 | Blood alkaline phosphatase increased | FAERS: 12 | US FAERS | |
| 76 | Blood urea increased | FAERS: 12 | US FAERS | |
| 77 | Cellulitis | FAERS: 12 | US FAERS | |
| 78 | Disorientation | FAERS: 12 | US FAERS | |
| 79 | Gastrointestinal toxicity | FAERS: 12 | US FAERS | |
| 80 | Granulocyte count decreased | FAERS: 12 | US FAERS | |
| 81 | Hypersensitivity | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 82 | Inflammation | FAERS: 12 | US FAERS | |
| 83 | Intestinal Obstruction | FAERS: 12 | US FAERS | |
| 84 | Peritonitis | FAERS: 12 | US FAERS | |
| 85 | Pruritus | FAERS: 12 | US FAERS | |
| 86 | Skin necrosis | FAERS: 12 | US FAERS | |
| 87 | Trousseau's syndrome | FAERS: 12 | US FAERS | |
| 88 | Vasculitis | FAERS: 12 | US FAERS | |
| 89 | Acute respiratory failure | FAERS: 11 | US FAERS | |
| 90 | Anorexia | FAERS: 11 | US FAERS | |
| 91 | Back Pain | FAERS: 11 | US FAERS | |
| 92 | Blood glucose increased | FAERS: 11 | US FAERS | |
| 93 | Livedo Reticularis | FAERS: 11 | US FAERS | |
| 94 | Pancreatitis | FAERS: 11 | US FAERS | |
| 95 | Tachycardia | FAERS: 11 | US FAERS | |
| 96 | Alveolitis | FAERS: 10 | US FAERS | |
| 97 | Enterocolitis | FAERS: 10 | US FAERS | |
| 98 | Injection site pain | FAERS: 10 | US FAERS | |
| 99 | Leukocytoclastic vasculitis | FAERS: 10 | US FAERS | |
| 100 | Performance status decreased | FAERS: 10 | US FAERS | |
| 101 | Peripheral swelling | FAERS: 10 | US FAERS | |
| 102 | Thrombocytosis | FAERS: 10 | US FAERS | |
| 103 | Cardiomegaly | FAERS: 9 | US FAERS | |
| 104 | Cerebrovascular accident | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Fluid overload | FAERS: 9 | US FAERS | |
| 106 | Gamma-Glutamyltransferase Increased | FAERS: 9 | US FAERS | |
| 107 | Pneumocystis jiroveci pneumonia | FAERS: 9 | US FAERS | |
| 108 | Pseudocellulitis | FAERS: 9 | US FAERS | |
| 109 | Purpura | FAERS: 9 | US FAERS | |
| 110 | Rhabdomyolysis | FAERS: 9 | US FAERS | |
| 111 | Sinus Tachycardia | FAERS: 9 | US FAERS | |
| 112 | Syncope | FAERS: 9 | US FAERS | |
| 113 | Blood count abnormal | FAERS: 8 | US FAERS | |
| 114 | Cardiotoxicity | FAERS: 8 | US FAERS | |
| 115 | Chest discomfort | FAERS: 8 | US FAERS | |
| 116 | Colitis | FAERS: 8 | US FAERS | |
| 117 | Embolism | FAERS: 8 | US FAERS | |
| 118 | Gastric ulcer | FAERS: 8 | US FAERS | |
| 119 | Haptoglobin Decreased | FAERS: 8 | US FAERS | |
| 120 | Hepatic Encephalopathy | FAERS: 8 | US FAERS | |
| 121 | Hepatotoxicity | FAERS: 8 | US FAERS | |
| 122 | Mental status changes | FAERS: 8 | US FAERS | |
| 123 | Metastasis | FAERS: 8 | US FAERS | |
| 124 | Myalgia | FAERS: 8 | US FAERS | |
| 125 | Petechiae | FAERS: 8 | US FAERS | |
| 126 | Presyncope | FAERS: 8 | US FAERS | |
| 127 | Rash erythematous | FAERS: 8 | US FAERS | |
| 128 | Therapy non-responder | FAERS: 8 | US FAERS | |
| 129 | Toxic Epidermal Necrolysis | FAERS: 8 | US FAERS | |
| 130 | Abasia | FAERS: 7 | US FAERS | |
| 131 | Accidental exposure to product | FAERS: 7 | US FAERS | |
| 132 | Acute myocardial infarction | FAERS: 7 | US FAERS | |
| 133 | Alopecia | FAERS: 7 | US FAERS | |
| 134 | Atelectasis | FAERS: 7 | US FAERS | |
| 135 | Blood potassium decreased | FAERS: 7 | US FAERS | |
| 136 | Cardiac Arrest | FAERS: 7 | US FAERS | |
| 137 | Cerebral artery occlusion | FAERS: 7 | US FAERS | |
| 138 | Cholecystitis | FAERS: 7 | US FAERS | |
| 139 | Cyanosis | FAERS: 7 | US FAERS | |
| 140 | Extremity necrosis | FAERS: 7 | US FAERS | |
| 141 | Hypertensive crisis | FAERS: 7 | US FAERS | |
| 142 | Ileus | FAERS: 7 | US FAERS | |
| 143 | Infusion site pain | FAERS: 7 | US FAERS | |
| 144 | Intestinal Perforation | FAERS: 7 | US FAERS | |
| 145 | Leukoencephalopathy | FAERS: 7 | US FAERS | |
| 146 | Lymphopenia | FAERS: 7 | US FAERS | |
| 147 | Necrosis | FAERS: 7 | US FAERS | |
| 148 | Red blood cell schistocytes present | FAERS: 7 | US FAERS | |
| 149 | Renal tubular necrosis | FAERS: 7 | US FAERS | |
| 150 | Swelling | FAERS: 7 | US FAERS | |
| 151 | Ulcer | FAERS: 7 | US FAERS | |
| 152 | Carbohydrate antigen 19-9 increased | FAERS: 6 | US FAERS | |
| 153 | Cytolytic hepatitis | FAERS: 6 | US FAERS | |
| 154 | Deafness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 155 | Dysgeusia | FAERS: 6 | US FAERS | |
| 156 | Dysuria | FAERS: 6 | US FAERS | |
| 157 | Erysipelas | FAERS: 6 | US FAERS | |
| 158 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 159 | Hepatitis | FAERS: 6 | US FAERS | |
| 160 | Lethargy | FAERS: 6 | US FAERS | |
| 161 | Leukocytosis | FAERS: 6 | US FAERS | |
| 162 | PO2 decreased | FAERS: 6 | US FAERS | |
| 163 | Rales | FAERS: 6 | US FAERS | |
| 164 | Right ventricular failure | FAERS: 6 | US FAERS | |
| 165 | Subcutaneous Emphysema | FAERS: 6 | US FAERS | |
| 166 | Thrombophlebitis | FAERS: 6 | US FAERS | |
| 167 | Urinary Retention | FAERS: 6 | US FAERS | |
| 168 | Urticaria | FAERS: 6 | US FAERS | |
| 169 | Abdominal discomfort | FAERS: 5 | US FAERS | |
| 170 | Anuria | FAERS: 5 | US FAERS | |
| 171 | Blindness | FAERS: 5 | US FAERS | |
| 172 | Blood creatine phosphokinase increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Blood potassium increased | FAERS: 5 | US FAERS | |
| 174 | Bone pain | FAERS: 5 | US FAERS | |
| 175 | Candidiasis | FAERS: 5 | US FAERS | |
| 176 | Cardiac Tamponade | FAERS: 5 | US FAERS | |
| 177 | Disease recurrence | FAERS: 5 | US FAERS | |
| 178 | Ejection Fraction Decreased | FAERS: 5 | US FAERS | |
| 179 | Epistaxis | FAERS: 5 | US FAERS | |
| 180 | Fibrin D dimer increased | FAERS: 5 | US FAERS | |
| 181 | Gastrointestinal perforation | FAERS: 5 | US FAERS | |
| 182 | Gout | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Hepatic necrosis | FAERS: 5 | US FAERS | |
| 184 | Hyperpyrexia | FAERS: 5 | US FAERS | |
| 185 | Hypophagia | FAERS: 5 | US FAERS | |
| 186 | Injection Site Reaction | FAERS: 5 | US FAERS | |
| 187 | Injection site irritation | FAERS: 5 | US FAERS | |
| 188 | Lymphangiosis carcinomatosa | FAERS: 5 | US FAERS | |
| 189 | Malnutrition | FAERS: 5 | US FAERS | |
| 190 | Myoglobin blood increased | FAERS: 5 | US FAERS | |
| 191 | Neutropenic sepsis | FAERS: 5 | US FAERS | |
| 192 | No adverse event | FAERS: 5 | US FAERS | |
| 193 | Nodule | FAERS: 5 | US FAERS | |
| 194 | Phlebitis | FAERS: 5 | US FAERS | |
| 195 | Pneumothorax | FAERS: 5 | US FAERS | |
| 196 | Posterior reversible encephalopathy syndrome | FAERS: 5 | US FAERS | |
| 197 | Proteinuria | FAERS: 5 | US FAERS | |
| 198 | Somnolence | FAERS: 5 | US FAERS | |
| 199 | Stomatitis | FAERS: 5 | US FAERS | |
| 200 | Supraventricular tachycardia | FAERS: 5 | US FAERS | |
| 201 | Troponin increased | FAERS: 5 | US FAERS | |
| 202 | Abdominal Infection | FAERS: 4 | US FAERS | |
| 203 | Acute Coronary Syndrome | FAERS: 4 | US FAERS | |
| 204 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 205 | Arthralgia | FAERS: 4 | US FAERS | |
| 206 | Atrial Flutter | FAERS: 4 | US FAERS | |
| 207 | Blood sodium decreased | FAERS: 4 | US FAERS | |
| 208 | Bone marrow toxicity | FAERS: 4 | US FAERS | |
| 209 | Bronchospasm | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 210 | Catheter sepsis | FAERS: 4 | US FAERS | |
| 211 | Clostridium difficile colitis | FAERS: 4 | US FAERS | |
| 212 | Delirium | FAERS: 4 | US FAERS | |
| 213 | Dermatitis | FAERS: 4 | US FAERS | |
| 214 | Device occlusion | FAERS: 4 | US FAERS | |
| 215 | Electrocardiogram abnormal | FAERS: 4 | US FAERS | |
| 216 | Endocarditis | FAERS: 4 | US FAERS | |
| 217 | Erythema Multiforme | FAERS: 4 | US FAERS | |
| 218 | Escherichia infection | FAERS: 4 | US FAERS | |
| 219 | Feeling Cold | FAERS: 4 | US FAERS | |
| 220 | Fracture | FAERS: 4 | US FAERS | |
| 221 | Hepatorenal Syndrome | FAERS: 4 | US FAERS | |
| 222 | Histiocytosis haematophagic | FAERS: 4 | US FAERS | |
| 223 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 224 | Lung consolidation | FAERS: 4 | US FAERS | |
| 225 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 226 | Memory impairment | FAERS: 4 | US FAERS | |
| 227 | Meningitis | FAERS: 4 | US FAERS | |
| 228 | Metabolic acidosis | FAERS: 4 | US FAERS | |
| 229 | Metastases to stomach | FAERS: 4 | US FAERS | |
| 230 | Obstruction | FAERS: 4 | US FAERS | |
| 231 | Palpitations | FAERS: 4 | US FAERS | |
| 232 | Pericarditis | FAERS: 4 | US FAERS | |
| 233 | Polyneuropathy | FAERS: 4 | US FAERS | |
| 234 | Actinomycosis | FAERS: 3 | US FAERS | |
| 235 | Agitation | FAERS: 3 | US FAERS | |
| 236 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 237 | Alcohol poisoning | FAERS: 3 | US FAERS | |
| 238 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 239 | Asthma | FAERS: 3 | US FAERS | |
| 240 | Bacterial sepsis | FAERS: 3 | US FAERS | |
| 241 | Biliary tract infection | FAERS: 3 | US FAERS | |
| 242 | Blood urine present | FAERS: 3 | US FAERS | |
| 243 | Bone marrow depression | FAERS: 3 | US FAERS | |
| 244 | Bronchitis | FAERS: 3 | US FAERS | |
| 245 | Bronchopneumonia | FAERS: 3 | US FAERS | |
| 246 | Cachexia | FAERS: 3 | US FAERS | |
| 247 | Carcinoembryonic antigen increased | FAERS: 3 | US FAERS | |
| 248 | Cardiac dysfunction | FAERS: 3 | US FAERS | |
| 249 | Cell marker increased | FAERS: 3 | US FAERS | |
| 250 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 251 | Creatinine renal clearance increased | FAERS: 3 | US FAERS | |
| 252 | Device related infection | FAERS: 3 | US FAERS | |
| 253 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 254 | Diffuse alveolar damage | FAERS: 3 | US FAERS | |
| 255 | Drooling | FAERS: 3 | US FAERS | |
| 256 | Drug resistance | FAERS: 3 | US FAERS | |
| 257 | Dyslalia | FAERS: 3 | US FAERS | |
| 258 | Enterococcus test positive | FAERS: 3 | US FAERS | |
| 259 | Eosinophilia | FAERS: 3 | US FAERS | |
| 260 | Epilepsy | FAERS: 3 | US FAERS | |
| 261 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 262 | Flushing | FAERS: 3 | US FAERS | |
| 263 | Gangrene | FAERS: 3 | US FAERS | |
| 264 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 265 | Glomerulonephritis | FAERS: 3 | US FAERS | |
| 266 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 267 | Hypertensive emergency | FAERS: 3 | US FAERS | |
| 268 | Hypotrichosis | FAERS: 3 | US FAERS | |
| 269 | Idiopathic Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 270 | Incontinence | FAERS: 3 | US FAERS | |
| 271 | Infectious peritonitis | FAERS: 3 | US FAERS | |
| 272 | Influenza | FAERS: 3 | US FAERS | |
| 273 | Infusion Site Extravasation | FAERS: 3 | US FAERS | |
| 274 | Injection site phlebitis | FAERS: 3 | US FAERS | |
| 275 | Intermittent Claudication | FAERS: 3 | US FAERS | |
| 276 | Large intestine perforation | FAERS: 3 | US FAERS | |
| 277 | Lung Injury | FAERS: 3 | US FAERS | |
| 278 | MYELODYSPLASTIC SYNDROME | FAERS: 3 | US FAERS | |
| 279 | Medication Error | FAERS: 3 | US FAERS | |
| 280 | Muscle necrosis | FAERS: 3 | US FAERS | |
| 281 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 282 | Myocarditis | FAERS: 3 | US FAERS | |
| 283 | Neck Pain | FAERS: 3 | US FAERS | |
| 284 | Oral pain | FAERS: 3 | US FAERS | |
| 285 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 286 | Pancreatic carcinoma recurrent | FAERS: 3 | US FAERS | |
| 287 | Peripheral arterial occlusive disease | FAERS: 3 | US FAERS | |
| 288 | Polymyositis | FAERS: 3 | US FAERS | |
| 289 | Portal vein stenosis | FAERS: 3 | US FAERS | |
| 290 | Procedural complication | FAERS: 3 | US FAERS | |
| 291 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 292 | Protein total decreased | FAERS: 3 | US FAERS | |
| 293 | Pseudocyst | FAERS: 3 | US FAERS | |
| 294 | Pyelonephritis | FAERS: 3 | US FAERS | |
| 295 | Refusal of treatment by relative | FAERS: 3 | US FAERS | |
| 296 | Renal Colic | FAERS: 3 | US FAERS | |
| 297 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 298 | Skin toxicity | FAERS: 3 | US FAERS | |
| 299 | Sudden death | FAERS: 3 | US FAERS | |
| 300 | Systemic Inflammatory Response Syndrome | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 301 | Systemic mycosis | FAERS: 3 | US FAERS | |
| 302 | Thrombocytopenic purpura | FAERS: 3 | US FAERS | |
| 303 | Urine ketone body present | FAERS: 3 | US FAERS | |
| 304 | Vascular calcification | FAERS: 3 | US FAERS | |
| 305 | Vascular insufficiency | FAERS: 3 | US FAERS | |
| 306 | Vascular pseudoaneurysm ruptured | FAERS: 3 | US FAERS | |
| 307 | Vertigo | FAERS: 3 | US FAERS | |
| 308 | Visual Impairment | FAERS: 3 | US FAERS | |
| 309 | Visual disturbance | FAERS: 3 | US FAERS | |
| 310 | effusion | FAERS: 3 | US FAERS | |
| 311 | Acute left ventricular failure | FAERS: 2 | US FAERS | |
| 312 | Allodynia | FAERS: 2 | US FAERS | |
| 313 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 314 | Alternaria infection | FAERS: 2 | US FAERS | |
| 315 | Anastomotic Leak | FAERS: 2 | US FAERS | |
| 316 | Anastomotic ulcer | FAERS: 2 | US FAERS | |
| 317 | Anger | FAERS: 2 | US FAERS | |
| 318 | Angioedema | FAERS: 2 | US FAERS | |
| 319 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 320 | Anxiety | FAERS: 2 | US FAERS | |
| 321 | Arteriosclerosis Obliterans | FAERS: 2 | US FAERS | |
| 322 | Arthritis | FAERS: 2 | US FAERS | |
| 323 | Arthropathy | FAERS: 2 | US FAERS | |
| 324 | Ascites infection | FAERS: 2 | US FAERS | |
| 325 | Ataxia | FAERS: 2 | US FAERS | |
| 326 | Athetosis | FAERS: 2 | US FAERS | |
| 327 | Bacteria urine identified | FAERS: 2 | US FAERS | |
| 328 | Bladder spasm | FAERS: 2 | US FAERS | |
| 329 | Blood cholinesterase decreased | FAERS: 2 | US FAERS | |
| 330 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 331 | Blood creatinine decreased | FAERS: 2 | US FAERS | |
| 332 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 333 | Brain natriuretic peptide increased | FAERS: 2 | US FAERS | |
| 334 | Bronchial Fistula | FAERS: 2 | US FAERS | |
| 335 | Burning sensation | FAERS: 2 | US FAERS | |
| 336 | Cerebral artery stenosis | FAERS: 2 | US FAERS | |
| 337 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 338 | Culture urine positive | FAERS: 2 | US FAERS | |
| 339 | Cystitis | FAERS: 2 | US FAERS | |
| 340 | Cystoprostatectomy | FAERS: 2 | US FAERS | |
| 341 | Dementia | FAERS: 2 | US FAERS | |
| 342 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 343 | Duodenal Ulcer | FAERS: 2 | US FAERS | |
| 344 | Dysarthria | FAERS: 2 | US FAERS | |
| 345 | Dysphonia | FAERS: 2 | US FAERS | |
| 346 | Echocardiogram abnormal | FAERS: 2 | US FAERS | |
| 347 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 348 | Enteritis | FAERS: 2 | US FAERS | |
| 349 | Epstein-Barr virus test positive | FAERS: 2 | US FAERS | |
| 350 | Erythrosis | FAERS: 2 | US FAERS | |
| 351 | Escherichia urinary tract infection | FAERS: 2 | US FAERS | |
| 352 | Flank Pain | FAERS: 2 | US FAERS | |
| 353 | Flatulence | FAERS: 2 | US FAERS | |
| 354 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 355 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 356 | Granuloma | FAERS: 2 | US FAERS | |
| 357 | Hemiparesis | FAERS: 2 | US FAERS | |
| 358 | Hemiplegia | FAERS: 2 | US FAERS | |
| 359 | Hepatectomy | FAERS: 2 | US FAERS | |
| 360 | Hepatitis B | FAERS: 2 | US FAERS | |
| 361 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 362 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 363 | Hypoaesthesia facial | FAERS: 2 | US FAERS | |
| 364 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 365 | Infarction | FAERS: 2 | US FAERS | |
| 366 | Infusion site discomfort | FAERS: 2 | US FAERS | |
| 367 | Injection site erythema | FAERS: 2 | US FAERS | |
| 368 | Injection site hypersensitivity | FAERS: 2 | US FAERS | |
| 369 | Joint swelling | FAERS: 2 | US FAERS | |
| 370 | Laryngitis | FAERS: 2 | US FAERS | |
| 371 | Lip swelling | FAERS: 2 | US FAERS | |
| 372 | Lividity | FAERS: 2 | US FAERS | |
| 373 | Lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 374 | Malignant Hypertension | FAERS: 2 | US FAERS | |
| 375 | Mastitis | FAERS: 2 | US FAERS | |
| 376 | Mixed liver injury | FAERS: 2 | US FAERS | |
| 377 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 378 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 379 | Nephritis | FAERS: 2 | US FAERS | |
| 380 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 381 | Occult blood positive | FAERS: 2 | US FAERS | |
| 382 | Oliguria | FAERS: 2 | US FAERS | |
| 383 | Overdose | FAERS: 2 | US FAERS | |
| 384 | Pancreatic enlargement | FAERS: 2 | US FAERS | |
| 385 | Paraparesis | FAERS: 2 | US FAERS | |
| 386 | Paraplegia | FAERS: 2 | US FAERS | |
| 387 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 388 | Product use issue | FAERS: 2 | US FAERS | |
| 389 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 390 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 391 | Purulent discharge | FAERS: 2 | US FAERS | |
| 392 | Quadriplegia | FAERS: 2 | US FAERS | |
| 393 | Radiation interaction | FAERS: 2 | US FAERS | |
| 394 | Radiation skin injury | FAERS: 2 | US FAERS | |
| 395 | Renal Artery Stenosis | FAERS: 2 | US FAERS | |
| 396 | Restlessness | FAERS: 2 | US FAERS | |
| 397 | Retinal exudates | FAERS: 2 | US FAERS | |
| 398 | Retinal pigment epitheliopathy | FAERS: 2 | US FAERS | |
| 399 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 400 | Scleroderma | FAERS: 2 | US FAERS | |
| 401 | Secretion discharge | FAERS: 2 | US FAERS | |
| 402 | Sensorimotor disorder | FAERS: 2 | US FAERS | |
| 403 | Serositis | FAERS: 2 | US FAERS | |
| 404 | Skin irritation | FAERS: 2 | US FAERS | |
| 405 | Skin laceration | FAERS: 2 | US FAERS | |
| 406 | Splenic abscess | FAERS: 2 | US FAERS | |
| 407 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 408 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 409 | Stridor | FAERS: 2 | US FAERS | |
| 410 | Thrombosis in device | FAERS: 2 | US FAERS | |
| 411 | Tremor | FAERS: 2 | US FAERS | |
| 412 | Unevaluable event | FAERS: 2 | US FAERS | |
| 413 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 414 | Vaccination site ulcer | FAERS: 2 | US FAERS | |
| 415 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 416 | Venous thrombosis limb | FAERS: 2 | US FAERS | |
| 417 | nervous system disorder | FAERS: 2 | US FAERS | |
| 418 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 419 | Abscess | FAERS: 1 | US FAERS | |
| 420 | Acrodermatitis | FAERS: 1 | US FAERS | |
| 421 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 422 | Ageusia | FAERS: 1 | US FAERS | |
| 423 | Alveolar lung disease | FAERS: 1 | US FAERS | |
| 424 | Amaurosis | FAERS: 1 | US FAERS | |
| 425 | Ammonia increased | FAERS: 1 | US FAERS | |
| 426 | Amnesia | FAERS: 1 | US FAERS | |
| 427 | Amputation | FAERS: 1 | US FAERS | |
| 428 | Anal Fistula | FAERS: 1 | US FAERS | |
| 429 | Anisocytosis | FAERS: 1 | US FAERS | |
| 430 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 431 | Anti-platelet antibody positive | FAERS: 1 | US FAERS | |
| 432 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 433 | Appendicitis | FAERS: 1 | US FAERS | |
| 434 | Application site dryness | FAERS: 1 | US FAERS | |
| 435 | Application site erythema | FAERS: 1 | US FAERS | |
| 436 | Application site irritation | FAERS: 1 | US FAERS | |
| 437 | Application site pain | FAERS: 1 | US FAERS | |
| 438 | Application site scab | FAERS: 1 | US FAERS | |
| 439 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 440 | Arteriogram abnormal | FAERS: 1 | US FAERS | |
| 441 | Asphyxia | FAERS: 1 | US FAERS | |
| 442 | Atrial hypertrophy | FAERS: 1 | US FAERS | |
| 443 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 444 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 445 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 446 | Axillary vein thrombosis | FAERS: 1 | US FAERS | |
| 447 | Bacteria blood identified | FAERS: 1 | US FAERS | |
| 448 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 449 | Bedridden | FAERS: 1 | US FAERS | |
| 450 | Bile duct cancer recurrent | FAERS: 1 | US FAERS | |
| 451 | Biliary Fistula | FAERS: 1 | US FAERS | |
| 452 | Biloma | FAERS: 1 | US FAERS | |
| 453 | Biopsy kidney abnormal | FAERS: 1 | US FAERS | |
| 454 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 455 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 456 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 457 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 458 | Blood gases abnormal | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 459 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 460 | Blood insulin abnormal | FAERS: 1 | US FAERS | |
| 461 | Blood lactate dehydrogenase | FAERS: 1 | US FAERS | |
| 462 | Blood lactate dehydrogenase abnormal | FAERS: 1 | US FAERS | |
| 463 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 464 | Blood pH increased | FAERS: 1 | US FAERS | |
| 465 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 466 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 467 | Body fat disorder | FAERS: 1 | US FAERS | |
| 468 | Bone density decreased | FAERS: 1 | US FAERS | |
| 469 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 470 | Bradycardia | FAERS: 1 | US FAERS | |
| 471 | Bradykinesia | FAERS: 1 | US FAERS | |
| 472 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 473 | Bronchopleural Fistula | FAERS: 1 | US FAERS | |
| 474 | Bursitis | FAERS: 1 | US FAERS | |
| 475 | Cancer Pain | FAERS: 1 | US FAERS | |
| 476 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 477 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 478 | Carotid Artery Thrombosis | FAERS: 1 | US FAERS | |
| 479 | Cataract | FAERS: 1 | US FAERS | |
| 480 | Catheter related complication | FAERS: 1 | US FAERS | |
| 481 | Catheter site discharge | FAERS: 1 | US FAERS | |
| 482 | Catheter site erythema | FAERS: 1 | US FAERS | |
| 483 | Catheter site infection | FAERS: 1 | US FAERS | |
| 484 | Cell Death | FAERS: 1 | US FAERS | |
| 485 | Central line infection | FAERS: 1 | US FAERS | |
| 486 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 487 | Chemotherapy | FAERS: 1 | US FAERS | |
| 488 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 489 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 490 | Cholelithiasis obstructive | FAERS: 1 | US FAERS | |
| 491 | Chromaturia | FAERS: 1 | US FAERS | |
| 492 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 493 | Completed Suicide | FAERS: 1 | US FAERS | |
| 494 | Compression fracture | FAERS: 1 | US FAERS | |
| 495 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 496 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 497 | Crying | FAERS: 1 | US FAERS | |
| 498 | Cryoglobulins absent | FAERS: 1 | US FAERS | |
| 499 | Culture positive | FAERS: 1 | US FAERS | |
| 500 | Cyst | FAERS: 1 | US FAERS | |
| 501 | Cytokine Release Syndrome | FAERS: 1 | US FAERS | |
| 502 | Cytopenia | FAERS: 1 | US FAERS | |
| 503 | Demyelination | FAERS: 1 | US FAERS | |
| 504 | Dermo-hypodermitis | FAERS: 1 | US FAERS | |
| 505 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 506 | Diverticulitis | FAERS: 1 | US FAERS | |
| 507 | Diverticulum | FAERS: 1 | US FAERS | |
| 508 | Drug administration error | FAERS: 1 | US FAERS | |
| 509 | Drug dose omission | FAERS: 1 | US FAERS | |
| 510 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 511 | Dry gangrene | FAERS: 1 | US FAERS | |
| 512 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 513 | Duodenitis | FAERS: 1 | US FAERS | |
| 514 | Dyspepsia | FAERS: 1 | US FAERS | |
| 515 | Dystonia | FAERS: 1 | US FAERS | |
| 516 | Echography abnormal | FAERS: 1 | US FAERS | |
| 517 | Eczema | FAERS: 1 | US FAERS | |
| 518 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 519 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 520 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 521 | Empyema | FAERS: 1 | US FAERS | |
| 522 | Enterobacter test positive | FAERS: 1 | US FAERS | |
| 523 | Enterococcal sepsis | FAERS: 1 | US FAERS | |
| 524 | Enterocutaneous Fistula | FAERS: 1 | US FAERS | |
| 525 | Erosive Duodenitis | FAERS: 1 | US FAERS | |
| 526 | Eructation | FAERS: 1 | US FAERS | |
| 527 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 528 | Excitability | FAERS: 1 | US FAERS | |
| 529 | Exophthalmos | FAERS: 1 | US FAERS | |
| 530 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 1 | US FAERS | |
| 531 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 532 | Fasciitis | FAERS: 1 | US FAERS | |
| 533 | Fat necrosis | FAERS: 1 | US FAERS | |
| 534 | Febrile bone marrow aplasia | FAERS: 1 | US FAERS | |
| 535 | Fungus urine test positive | FAERS: 1 | US FAERS | |
| 536 | Gastric Antral Vascular Ectasia | FAERS: 1 | US FAERS | |
| 537 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 538 | Gastric outlet obstruction | FAERS: 1 | US FAERS | |
| 539 | Gastritis | FAERS: 1 | US FAERS | |
| 540 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 541 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 542 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 543 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 544 | Gingival erythema | FAERS: 1 | US FAERS | |
| 545 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 546 | Haptoglobin increased | FAERS: 1 | US FAERS | |
| 547 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 548 | Hepatic Infarction | FAERS: 1 | US FAERS | |
| 549 | Hepatic artery thrombosis | FAERS: 1 | US FAERS | |
| 550 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 551 | Hepatitis B DNA increased | FAERS: 1 | US FAERS | |
| 552 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 553 | Hypercapnia | FAERS: 1 | US FAERS | |
| 554 | Hypertensive Encephalopathy | FAERS: 1 | US FAERS | |
| 555 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 556 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 557 | Hypogeusia | FAERS: 1 | US FAERS | |
| 558 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 559 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 560 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 561 | Ileal ulcer perforation | FAERS: 1 | US FAERS | |
| 562 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 563 | Immunosuppression | FAERS: 1 | US FAERS | |
| 564 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 565 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 566 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 567 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 568 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 569 | Infection in an immunocompromised host | FAERS: 1 | US FAERS | |
| 570 | Inflammatory marker increased | FAERS: 1 | US FAERS | |
| 571 | Influenza virus test positive | FAERS: 1 | US FAERS | |
| 572 | Infusion site burning | FAERS: 1 | US FAERS | |
| 573 | Infusion site irritation | FAERS: 1 | US FAERS | |
| 574 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 575 | Infusion site streaking | FAERS: 1 | US FAERS | |
| 576 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 577 | Injection site vasculitis | FAERS: 1 | US FAERS | |
| 578 | Jejunal ulcer perforation | FAERS: 1 | US FAERS | |
| 579 | Joint stiffness | FAERS: 1 | US FAERS | |
| 580 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 581 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 582 | Laceration | FAERS: 1 | US FAERS | |
| 583 | Laryngospasm | FAERS: 1 | US FAERS | |
| 584 | Liver scan abnormal | FAERS: 1 | US FAERS | |
| 585 | Lung Abscess | FAERS: 1 | US FAERS | |
| 586 | Lung infection pseudomonal | FAERS: 1 | US FAERS | |
| 587 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 588 | Lymphangitis | FAERS: 1 | US FAERS | |
| 589 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 590 | Lymphoma | FAERS: 1 | US FAERS | |
| 591 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 592 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 593 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 594 | Mesenteric Panniculitis | FAERS: 1 | US FAERS | |
| 595 | Mesenteric artery stenosis | FAERS: 1 | US FAERS | |
| 596 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 597 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 598 | Miller Fisher Syndrome | FAERS: 1 | US FAERS | |
| 599 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 600 | Monocytosis | FAERS: 1 | US FAERS | |
| 601 | Mucosal exfoliation | FAERS: 1 | US FAERS | |
| 602 | Muscle tightness | FAERS: 1 | US FAERS | |
| 603 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 604 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 605 | Mutism | FAERS: 1 | US FAERS | |
| 606 | Myoclonus | FAERS: 1 | US FAERS | |
| 607 | Myoglobinuria | FAERS: 1 | US FAERS | |
| 608 | Myopathy | FAERS: 1 | US FAERS | |
| 609 | Myotonic Dystrophy | FAERS: 1 | US FAERS | |
| 610 | Nail discomfort | FAERS: 1 | US FAERS | |
| 611 | Neisseria infection | FAERS: 1 | US FAERS | |
| 612 | Nephrogenic Fibrosing Dermopathy | FAERS: 1 | US FAERS | |
| 613 | Nervousness | FAERS: 1 | US FAERS | |
| 614 | Neuralgia | FAERS: 1 | US FAERS | |
| 615 | Neuritis | FAERS: 1 | US FAERS | |
| 616 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 617 | Neuropathy | FAERS: 1 | US FAERS | |
| 618 | Neutrophil count abnormal | FAERS: 1 | US FAERS | |
| 619 | No adverse effect | FAERS: 1 | US FAERS | |
| 620 | Nodular regenerative hyperplasia | FAERS: 1 | US FAERS | |
| 621 | Obesity | FAERS: 1 | US FAERS | |
| 622 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 623 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 624 | Osteitis | FAERS: 1 | US FAERS | |
| 625 | Ototoxicity | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 626 | Ovarian failure | FAERS: 1 | US FAERS | |
| 627 | Pancreatic Fistula | FAERS: 1 | US FAERS | |
| 628 | Pancreatic Insufficiency | FAERS: 1 | US FAERS | |
| 629 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 630 | Paracentesis | FAERS: 1 | US FAERS | |
| 631 | Parathyroid hormone-related protein increased | FAERS: 1 | US FAERS | |
| 632 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 633 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 634 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 635 | Peritoneal perforation | FAERS: 1 | US FAERS | |
| 636 | Pharyngitis | FAERS: 1 | US FAERS | |
| 637 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 638 | Photophobia | FAERS: 1 | US FAERS | |
| 639 | Plague | FAERS: 1 | US FAERS | |
| 640 | Pleurisy | FAERS: 1 | US FAERS | |
| 641 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 642 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 643 | Pneumobilia | FAERS: 1 | US FAERS | |
| 644 | Pneumoconiosis | FAERS: 1 | US FAERS | |
| 645 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 646 | Polyarteritis Nodosa | FAERS: 1 | US FAERS | |
| 647 | Polyuria | FAERS: 1 | US FAERS | |
| 648 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 649 | Post procedural bile leak | FAERS: 1 | US FAERS | |
| 650 | Post procedural complication | FAERS: 1 | US FAERS | |
| 651 | Product quality issue | FAERS: 1 | US FAERS | |
| 652 | Product substitution issue | FAERS: 1 | US FAERS | |
| 653 | Productive Cough | FAERS: 1 | US FAERS | |
| 654 | Prolonged expiration | FAERS: 1 | US FAERS | |
| 655 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 656 | Pseudocirrhosis | FAERS: 1 | US FAERS | |
| 657 | Pseudosepsis | FAERS: 1 | US FAERS | |
| 658 | Pseudovasculitis | FAERS: 1 | US FAERS | |
| 659 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 660 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 661 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 662 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 663 | Radiation Pneumonitis | FAERS: 1 | US FAERS | |
| 664 | Radiation injury | FAERS: 1 | US FAERS | |
| 665 | Radiation necrosis | FAERS: 1 | US FAERS | |
| 666 | Refractory cancer | FAERS: 1 | US FAERS | |
| 667 | Regurgitation | FAERS: 1 | US FAERS | |
| 668 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 669 | Renal vasculitis | FAERS: 1 | US FAERS | |
| 670 | Respiratory syncytial virus test positive | FAERS: 1 | US FAERS | |
| 671 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 672 | Retching | FAERS: 1 | US FAERS | |
| 673 | Reticulocyte count increased | FAERS: 1 | US FAERS | |
| 674 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 675 | Rhinitis | FAERS: 1 | US FAERS | |
| 676 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 677 | Scan gallium abnormal | FAERS: 1 | US FAERS | |
| 678 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 679 | Shunt malfunction | FAERS: 1 | US FAERS | |
| 680 | Skin lesion | FAERS: 1 | US FAERS | |
| 681 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 682 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 683 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 684 | Splenomegaly | FAERS: 1 | US FAERS | |
| 685 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 686 | Stasis dermatitis | FAERS: 1 | US FAERS | |
| 687 | Stent occlusion | FAERS: 1 | US FAERS | |
| 688 | Streptococcus test positive | FAERS: 1 | US FAERS | |
| 689 | Stress | FAERS: 1 | US FAERS | |
| 690 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 691 | Subileus | FAERS: 1 | US FAERS | |
| 692 | Supraventricular tachyarrhythmia | FAERS: 1 | US FAERS | |
| 693 | Surfactant protein increased | FAERS: 1 | US FAERS | |
| 694 | Surgical failure | FAERS: 1 | US FAERS | |
| 695 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 696 | Tension | FAERS: 1 | US FAERS | |
| 697 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 698 | Therapy change | FAERS: 1 | US FAERS | |
| 699 | Throat irritation | FAERS: 1 | US FAERS | |
| 700 | Tinnitus | FAERS: 1 | US FAERS | |
| 701 | Troponin I increased | FAERS: 1 | US FAERS | |
| 702 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 703 | Ultrasound abdomen abnormal | FAERS: 1 | US FAERS | |
| 704 | Ultrasound liver abnormal | FAERS: 1 | US FAERS | |
| 705 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 706 | Ureteric cancer metastatic | FAERS: 1 | US FAERS | |
| 707 | Ureterolithiasis | FAERS: 1 | US FAERS | |
| 708 | Urethral Obstruction | FAERS: 1 | US FAERS | |
| 709 | Urinary tract infection enterococcal | FAERS: 1 | US FAERS | |
| 710 | Urine output increased | FAERS: 1 | US FAERS | |
| 711 | Venoocclusive disease | FAERS: 1 | US FAERS | |
| 712 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 713 | Verbigeration | FAERS: 1 | US FAERS | |
| 714 | Vitiligo | FAERS: 1 | US FAERS | |
| 715 | Wheezing | FAERS: 1 | US FAERS | |
| 716 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 717 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 718 | skin abrasion | FAERS: 1 | US FAERS | |
| 719 | treatment failure | FAERS: 1 | US FAERS | |
| 720 | Ecchymosis | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.