Acyclovir
(MKUXAQIIEYXACX-UHFFFAOYSA-N)
Structure
- SMILES
- OCCOCn1cnc2c1nc(N)[nH]c2=O
- Type(s)
- Approved
- ATC code(s)
- D06BB03; D06BB53; J05AB01; S01AD03
- Molecular Formula:
- C8H11N5O3
- Molecular Weight:
- 225.205
- Log P:
- -0.7506
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 3
- TPSA:
- 119.05
- CAS Number(s):
- 59277-89-3; 141294-79-3
Synonym(s)
1.
Acyclovir
2.
Acycloguanosine
3.
9-((2-Hydroxyethoxy)methyl)guanine
4.
Aci-Sanorania
5.
Acic
6.
Aciclobeta
7.
Aciclostad
8.
Aciclovir
9.
Aciclovir Alonga
10.
Aciclovir-Sanorania
11.
Acifur
12.
Acipen Solutab
13.
Acivir
14.
Activir
15.
Acyclo-V
16.
Acyclovir Sodium
17.
Antiherpes Creme
18.
Avirax
19.
Cicloferon
20.
Clonorax
21.
Cusiviral
22.
Genvir
23.
Herpetad
24.
Herpofug
25.
Herpotern
26.
Herpoviric
27.
Isavir
28.
Laciken
29.
Mapox
30.
Maynar
31.
Milavir
32.
Opthavir
33.
Supraviran
34.
Viclovir
35.
Vipral
36.
Virax-Puren
37.
Virherpes
38.
Virmen
39.
Virolex
40.
Virupos
41.
Virzin
42.
Wellcome-248U
43.
Zoliparin
44.
Zovirax
45.
Zyclir
46.
aciclovir von ct
47.
Aci Sanorania
48.
Aciclovir Sanorania
49.
Acyclo V
50.
Alonga, Aciclovir
51.
Sodium, Acyclovir
52.
Solutab, Acipen
53.
Virax Puren
54.
ViraxPuren
55.
Wellcome 248U
56.
Wellcome248U
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 315 Canada Vigilance: 31 | Canada Vigilance US FAERS | |
| 2 | Acute kidney injury | FAERS: 126 Canada Vigilance: 62 |
1476483
1891032 1934676 2396095 2491533 3341668 3376977 4062110 7632529 7947045 8038467 8416680 8519942 10586837 10615548 11214960 15247861 16270145 16503907 16854507 16987286 17406046 18656262 18755125 20117065 20307148 20862348 | CTD Canada Vigilance US FAERS |
| 3 | Nausea | FAERS: 77 | 7571352 | CTD OFFSIDES SIDER US FAERS |
| 4 | Headache | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 5 | Vomiting | FAERS: 60 Canada Vigilance: 1 | 7571352 8322628 | CTD SIDER Canada Vigilance US FAERS |
| 6 | Pharmaceutical product complaint | FAERS: 57 | US FAERS | |
| 7 | Product quality issue | FAERS: 56 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 8 | Pruritus | FAERS: 55 | SIDER US FAERS | |
| 9 | Altered state of consciousness | FAERS: 48 | OFFSIDES SIDER US FAERS | |
| 10 | Dizziness | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 11 | Fatigue | FAERS: 44 Canada Vigilance: 2 | 3711686 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 12 | Erythema | FAERS: 41 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 13 | Somnolence | FAERS: 41 | SIDER US FAERS | |
| 14 | Malaise | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 15 | Agitation | FAERS: 38 | SIDER US FAERS | |
| 16 | Blood creatinine increased | FAERS: 38 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Delirium | FAERS: 37 | CTD SIDER US FAERS | |
| 18 | Depressed Level of Consciousness | FAERS: 37 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 19 | Disorientation | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Medication Error | FAERS: 36 | US FAERS | |
| 21 | Urticaria | FAERS: 34 | SIDER US FAERS | |
| 22 | Asthenia | FAERS: 33 | SIDER US FAERS | |
| 23 | Hypersensitivity | FAERS: 32 | SIDER US FAERS | |
| 24 | Overdose | FAERS: 32 | OFFSIDES US FAERS | |
| 25 | Restlessness | FAERS: 32 | US FAERS | |
| 26 | Pathogen resistance | FAERS: 31 | US FAERS | |
| 27 | Dysarthria | FAERS: 30 | 4062110 9496746 14658398 | CTD SIDER US FAERS |
| 28 | Mental status changes | FAERS: 30 | OFFSIDES US FAERS | |
| 29 | Pain | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 30 | Abdominal Pain | FAERS: 29 | SIDER US FAERS | |
| 31 | nervous system disorder | FAERS: 29 | SIDER US FAERS | |
| 32 | Product substitution issue | FAERS: 27 | US FAERS | |
| 33 | Tremor | FAERS: 27 | 8671884 | CTD SIDER US FAERS |
| 34 | Aphasia | FAERS: 26 | US FAERS | |
| 35 | Burning sensation | FAERS: 26 | US FAERS | |
| 36 | Drug resistance | FAERS: 24 | US FAERS | |
| 37 | treatment failure | FAERS: 24 | US FAERS | |
| 38 | Drug exposure during pregnancy | FAERS: 21 | US FAERS | |
| 39 | Extravasation | FAERS: 21 | US FAERS | |
| 40 | Toxicity to various agents | FAERS: 21 | US FAERS | |
| 41 | Alopecia | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 42 | Encephalitis | FAERS: 19 | 1476483 | CTD US FAERS |
| 43 | Epilepsy | FAERS: 19 | US FAERS | |
| 44 | Myoclonus | FAERS: 19 Canada Vigilance: 2 | 4062110 7571352 7973922 | CTD Canada Vigilance US FAERS |
| 45 | Eye pain | FAERS: 17 | OFFSIDES US FAERS | |
| 46 | Skin lesion | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 47 | Thrombocytopenia | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 48 | Accidental overdose | FAERS: 15 | US FAERS | |
| 49 | Application site irritation | FAERS: 15 | SIDER US FAERS | |
| 50 | Ataxia | FAERS: 15 Canada Vigilance: 2 | 7571352 | CTD SIDER Canada Vigilance US FAERS |
| 51 | Arthralgia | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 52 | Dehydration | FAERS: 14 | SIDER US FAERS | |
| 53 | Product solubility abnormal | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Respiratory Failure | FAERS: 14 | OFFSIDES US FAERS | |
| 55 | Abdominal discomfort | FAERS: 13 | SIDER US FAERS | |
| 56 | Application site pain | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 57 | Lethargy | FAERS: 13 | CTD SIDER US FAERS | |
| 58 | Maternal exposure during pregnancy | FAERS: 13 | US FAERS | |
| 59 | Memory impairment | FAERS: 13 | US FAERS | |
| 60 | No adverse event | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 61 | Oliguria | FAERS: 13 | US FAERS | |
| 62 | Product use issue | FAERS: 13 | US FAERS | |
| 63 | Renal tubular necrosis | FAERS: 13 | OFFSIDES US FAERS | |
| 64 | Anxiety | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 65 | Disseminated Intravascular Coagulation | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 66 | Drug level increased | FAERS: 12 | US FAERS | |
| 67 | Dyslalia | FAERS: 12 | OFFSIDES US FAERS | |
| 68 | Dysphonia | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 69 | Incorrect dose administered | FAERS: 12 | US FAERS | |
| 70 | Scab | FAERS: 12 | OFFSIDES US FAERS | |
| 71 | Visual Impairment | FAERS: 12 | US FAERS | |
| 72 | Back Pain | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Crystal nephropathy | FAERS: 11 | US FAERS | |
| 74 | Disease recurrence | FAERS: 11 | OFFSIDES US FAERS | |
| 75 | Drug administration error | FAERS: 11 | US FAERS | |
| 76 | Drug toxicity | FAERS: 11 | OFFSIDES US FAERS | |
| 77 | Hypotension | FAERS: 11 | 9865134 | CTD SIDER US FAERS |
| 78 | Incoherent | FAERS: 11 | US FAERS | |
| 79 | Incorrect route of drug administration | FAERS: 11 | US FAERS | |
| 80 | Lip swelling | FAERS: 11 | US FAERS | |
| 81 | Viral mutation identified | FAERS: 11 | US FAERS | |
| 82 | Alanine Aminotransferase Increased | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 83 | Amnesia | FAERS: 10 | US FAERS | |
| 84 | Aspartate Aminotransferase Increased | FAERS: 10 | SIDER US FAERS | |
| 85 | Blood urea increased | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 86 | Discomfort | FAERS: 10 | SIDER US FAERS | |
| 87 | Drug dispensing error | FAERS: 10 | US FAERS | |
| 88 | Infection | FAERS: 10 | OFFSIDES US FAERS | |
| 89 | Electroencephalogram abnormal | FAERS: 9 | US FAERS | |
| 90 | Feeling abnormal | FAERS: 9 | SIDER US FAERS | |
| 91 | Palpitations | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 92 | Pancreatitis | FAERS: 9 | US FAERS | |
| 93 | Psychiatric symptom | FAERS: 9 | US FAERS | |
| 94 | VIIth nerve paralysis | FAERS: 9 | US FAERS | |
| 95 | Anorexia | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 96 | Blood sodium decreased | FAERS: 8 | US FAERS | |
| 97 | Bronchospasm | FAERS: 8 | US FAERS | |
| 98 | Chest Pain | FAERS: 8 | SIDER US FAERS | |
| 99 | Diplopia | FAERS: 8 | US FAERS | |
| 100 | Expired drug administered | FAERS: 8 | US FAERS | |
| 101 | Injection site necrosis | FAERS: 8 | US FAERS | |
| 102 | Myalgia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 103 | Product use in unapproved indication | FAERS: 8 | US FAERS | |
| 104 | Rhabdomyolysis | FAERS: 8 | US FAERS | |
| 105 | Swelling | FAERS: 8 | US FAERS | |
| 106 | Therapeutic response unexpected | FAERS: 8 | US FAERS | |
| 107 | Vertigo | FAERS: 8 | SIDER US FAERS | |
| 108 | Angioedema | FAERS: 7 | SIDER US FAERS | |
| 109 | Anuria | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 110 | Application site erythema | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Blindness | FAERS: 7 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 112 | Cardiac Arrest | FAERS: 7 | US FAERS | |
| 113 | Chromaturia | FAERS: 7 | US FAERS | |
| 114 | Deafness | FAERS: 7 | US FAERS | |
| 115 | Drug effect incomplete | FAERS: 7 | US FAERS | |
| 116 | Genital Herpes | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Infusion Site Extravasation | FAERS: 7 | OFFSIDES US FAERS | |
| 118 | Metabolic acidosis | FAERS: 7 | OFFSIDES US FAERS | |
| 119 | Musculoskeletal stiffness | FAERS: 7 | OFFSIDES US FAERS | |
| 120 | Oropharyngeal pain | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 121 | Pancytopenia | FAERS: 7 | US FAERS | |
| 122 | Rash erythematous | FAERS: 7 | US FAERS | |
| 123 | Respiratory distress | FAERS: 7 | US FAERS | |
| 124 | Spina Bifida | FAERS: 7 | US FAERS | |
| 125 | Stevens-Johnson Syndrome | FAERS: 7 | 25811541 | CTD OFFSIDES SIDER US FAERS |
| 126 | Urinary Retention | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Wrong technique in product usage process | FAERS: 7 | US FAERS | |
| 128 | Blood creatine phosphokinase increased | FAERS: 6 | US FAERS | |
| 129 | Bradycardia | FAERS: 6 | 9865134 | CTD US FAERS |
| 130 | Bronchopneumonia | FAERS: 6 | US FAERS | |
| 131 | Cerebral atrophy | FAERS: 6 | US FAERS | |
| 132 | Chest discomfort | FAERS: 6 | US FAERS | |
| 133 | Diet refusal | FAERS: 6 | US FAERS | |
| 134 | Dry skin | FAERS: 6 | OFFSIDES US FAERS | |
| 135 | Dysgeusia | FAERS: 6 | SIDER US FAERS | |
| 136 | Expired product administered | FAERS: 6 | US FAERS | |
| 137 | Eye irritation | FAERS: 6 | US FAERS | |
| 138 | General physical health deterioration | FAERS: 6 | OFFSIDES US FAERS | |
| 139 | Graft dysfunction | FAERS: 6 | OFFSIDES US FAERS | |
| 140 | Injection site extravasation | FAERS: 6 | US FAERS | |
| 141 | Nervousness | FAERS: 6 | US FAERS | |
| 142 | Phlebitis | FAERS: 6 | SIDER US FAERS | |
| 143 | Proteinuria | FAERS: 6 Canada Vigilance: 1 | 8442906 | CTD Canada Vigilance US FAERS |
| 144 | Sepsis | FAERS: 6 | US FAERS | |
| 145 | Skin necrosis | FAERS: 6 | US FAERS | |
| 146 | Thirst | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 147 | Throat irritation | FAERS: 6 | US FAERS | |
| 148 | Transaminases increased | FAERS: 6 | US FAERS | |
| 149 | Unresponsive to stimuli | FAERS: 6 | OFFSIDES US FAERS | |
| 150 | Visual disturbance | FAERS: 6 | US FAERS | |
| 151 | Abasia | FAERS: 5 | US FAERS | |
| 152 | Accidental exposure | FAERS: 5 | US FAERS | |
| 153 | Ascites | FAERS: 5 | OFFSIDES US FAERS | |
| 154 | Asterixis | FAERS: 5 | US FAERS | |
| 155 | Bradykinesia | FAERS: 5 | US FAERS | |
| 156 | Bradyphrenia | FAERS: 5 | US FAERS | |
| 157 | Corneal lesion | FAERS: 5 | US FAERS | |
| 158 | Dermatitis | FAERS: 5 | SIDER US FAERS | |
| 159 | Drug prescribing error | FAERS: 5 | US FAERS | |
| 160 | Epistaxis | FAERS: 5 | OFFSIDES US FAERS | |
| 161 | Erythema Multiforme | FAERS: 5 | SIDER US FAERS | |
| 162 | Glaucoma | FAERS: 5 | US FAERS | |
| 163 | Hepatotoxicity | FAERS: 5 | OFFSIDES US FAERS | |
| 164 | Mouth swelling | FAERS: 5 | US FAERS | |
| 165 | Neuralgia | FAERS: 5 Canada Vigilance: 1 | 16682531 | CTD OFFSIDES Canada Vigilance US FAERS |
| 166 | Neutropenia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 167 | Nystagmus | FAERS: 5 | US FAERS | |
| 168 | Paresis | FAERS: 5 | US FAERS | |
| 169 | Peripheral swelling | FAERS: 5 | US FAERS | |
| 170 | Photophobia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 171 | Syncope | FAERS: 5 | US FAERS | |
| 172 | Vasculitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 173 | Wheezing | FAERS: 5 | US FAERS | |
| 174 | White blood cell count decreased | FAERS: 5 | US FAERS | |
| 175 | jaundice | FAERS: 5 | SIDER US FAERS | |
| 176 | Accidental exposure to product | FAERS: 4 | US FAERS | |
| 177 | Antiviral drug level above therapeutic | FAERS: 4 | US FAERS | |
| 178 | Application site reaction | FAERS: 4 | SIDER US FAERS | |
| 179 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 180 | Cheilitis | FAERS: 4 | US FAERS | |
| 181 | Choking | FAERS: 4 | US FAERS | |
| 182 | Corneal Opacity | FAERS: 4 | US FAERS | |
| 183 | Cytomegalovirus syndrome | FAERS: 4 | US FAERS | |
| 184 | Disease Progression | FAERS: 4 | OFFSIDES US FAERS | |
| 185 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 186 | Emotional disorder | FAERS: 4 | US FAERS | |
| 187 | Emotional distress | FAERS: 4 | OFFSIDES US FAERS | |
| 188 | Flank Pain | FAERS: 4 | US FAERS | |
| 189 | Gout | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 190 | Hallucinations, mixed | FAERS: 4 | SIDER US FAERS | |
| 191 | Hepatitis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 192 | Immune thrombocytopenic purpura | FAERS: 4 | US FAERS | |
| 193 | Incorrect drug administration duration | FAERS: 4 | US FAERS | |
| 194 | Incorrect drug dosage form administered | FAERS: 4 | US FAERS | |
| 195 | Injection site vesicles | FAERS: 4 | US FAERS | |
| 196 | Keratitis | FAERS: 4 | US FAERS | |
| 197 | Leukopenia | FAERS: 4 | 2741918 | CTD SIDER US FAERS |
| 198 | Macrocytosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 199 | Monoplegia | FAERS: 4 | US FAERS | |
| 200 | Nuchal Rigidity | FAERS: 4 | US FAERS | |
| 201 | Paranoia | FAERS: 4 | OFFSIDES US FAERS | |
| 202 | Pneumonia | FAERS: 4 | US FAERS | |
| 203 | Posterior reversible encephalopathy syndrome | FAERS: 4 | US FAERS | |
| 204 | Prescribed underdose | FAERS: 4 | US FAERS | |
| 205 | Product coating issue | FAERS: 4 | US FAERS | |
| 206 | Retinitis | FAERS: 4 | US FAERS | |
| 207 | Rhinitis | FAERS: 4 | US FAERS | |
| 208 | Sinus bradycardia | FAERS: 4 | US FAERS | |
| 209 | Skin irritation | FAERS: 4 | US FAERS | |
| 210 | Soliloquy | FAERS: 4 | US FAERS | |
| 211 | Status Epilepticus | FAERS: 4 | US FAERS | |
| 212 | Stomatitis | FAERS: 4 | US FAERS | |
| 213 | Tachycardia | FAERS: 4 | SIDER US FAERS | |
| 214 | Therapy cessation | FAERS: 4 | US FAERS | |
| 215 | Unevaluable event | FAERS: 4 | OFFSIDES US FAERS | |
| 216 | Urinary tract infection | FAERS: 4 | US FAERS | |
| 217 | Viral vasculitis | FAERS: 4 | US FAERS | |
| 218 | Weight decreased | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 219 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 220 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 221 | Anaphylactic shock | FAERS: 3 | SIDER US FAERS | |
| 222 | Anaphylactoid Reaction | FAERS: 3 | US FAERS | |
| 223 | Blister rupture | FAERS: 3 | US FAERS | |
| 224 | Blood creatine increased | FAERS: 3 | US FAERS | |
| 225 | Blood urine present | FAERS: 3 | US FAERS | |
| 226 | Cerebral ventricle dilatation | FAERS: 3 | US FAERS | |
| 227 | Constipation | FAERS: 3 | SIDER US FAERS | |
| 228 | Corneal epithelium disorder | FAERS: 3 | US FAERS | |
| 229 | Crying | FAERS: 3 | US FAERS | |
| 230 | Delusional disorder, persecutory type | FAERS: 3 | US FAERS | |
| 231 | Dementia | FAERS: 3 | US FAERS | |
| 232 | Depressed mood | FAERS: 3 | US FAERS | |
| 233 | Disability | FAERS: 3 | US FAERS | |
| 234 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 235 | Dysuria | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 236 | Elevated mood | FAERS: 3 | US FAERS | |
| 237 | Erysipelas | FAERS: 3 | US FAERS | |
| 238 | Exposure during breast feeding | FAERS: 3 | US FAERS | |
| 239 | Eye Infection | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 240 | Gait inability | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 241 | Gastrointestinal perforation | FAERS: 3 | US FAERS | |
| 242 | Genital burning sensation | FAERS: 3 | US FAERS | |
| 243 | Glasgow coma scale abnormal | FAERS: 3 | US FAERS | |
| 244 | Hemiparesis | FAERS: 3 | US FAERS | |
| 245 | Hepatitis B | FAERS: 3 | 6841304 | CTD OFFSIDES US FAERS |
| 246 | Hypersomnia | FAERS: 3 | US FAERS | |
| 247 | Hypophagia | FAERS: 3 | OFFSIDES US FAERS | |
| 248 | Incontinence | FAERS: 3 | US FAERS | |
| 249 | Intestinal Perforation | FAERS: 3 | US FAERS | |
| 250 | Leukocytosis | FAERS: 3 | SIDER US FAERS | |
| 251 | Lip erosion | FAERS: 3 | OFFSIDES US FAERS | |
| 252 | Live Birth | FAERS: 3 | US FAERS | |
| 253 | Meningitis herpes | FAERS: 3 | US FAERS | |
| 254 | Mydriasis | FAERS: 3 | US FAERS | |
| 255 | Nasal discomfort | FAERS: 3 | US FAERS | |
| 256 | Nasopharyngitis | FAERS: 3 | SIDER US FAERS | |
| 257 | Necrosis | FAERS: 3 | 15969948 21319040 | CTD SIDER US FAERS |
| 258 | Nerve injury | FAERS: 3 | US FAERS | |
| 259 | Obstructive nephropathy | FAERS: 3 | US FAERS | |
| 260 | Oral pain | FAERS: 3 | US FAERS | |
| 261 | Poisoning | FAERS: 3 | US FAERS | |
| 262 | Pregnancy | FAERS: 3 | US FAERS | |
| 263 | Product container issue | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 264 | Product physical issue | FAERS: 3 | US FAERS | |
| 265 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 266 | Product use complaint | FAERS: 3 | US FAERS | |
| 267 | Prothrombin time abnormal | FAERS: 3 | US FAERS | |
| 268 | Purulent discharge | FAERS: 3 | US FAERS | |
| 269 | Renal pain | FAERS: 3 | SIDER US FAERS | |
| 270 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 271 | Skin Erosion | FAERS: 3 | OFFSIDES US FAERS | |
| 272 | Therapeutic product cross-reactivity | FAERS: 3 | US FAERS | |
| 273 | Thrombophlebitis | FAERS: 3 | 3598154 | CTD US FAERS |
| 274 | Virus culture positive | FAERS: 3 | US FAERS | |
| 275 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 276 | Adverse event | FAERS: 2 | US FAERS | |
| 277 | Alanine aminotransferase abnormal | FAERS: 2 | US FAERS | |
| 278 | Application site pruritus | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 279 | Arthritis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 280 | Aspartate aminotransferase abnormal | FAERS: 2 | US FAERS | |
| 281 | Athetosis | FAERS: 2 | US FAERS | |
| 282 | Beta 2 microglobulin urine increased | FAERS: 2 | US FAERS | |
| 283 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 284 | Blood lactate dehydrogenase increased | FAERS: 2 | OFFSIDES US FAERS | |
| 285 | Blood potassium decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 286 | Bone marrow toxicity | FAERS: 2 | OFFSIDES US FAERS | |
| 287 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 288 | Cellulitis | FAERS: 2 | US FAERS | |
| 289 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 290 | Cerebrovascular accident | FAERS: 2 | US FAERS | |
| 291 | Cholestasis | FAERS: 2 | US FAERS | |
| 292 | Choreoathetosis | FAERS: 2 | US FAERS | |
| 293 | Cold sweat | FAERS: 2 | US FAERS | |
| 294 | Complications of transplant surgery | FAERS: 2 | US FAERS | |
| 295 | Corneal Scar | FAERS: 2 | US FAERS | |
| 296 | Corneal dystrophy | FAERS: 2 | US FAERS | |
| 297 | Crystalluria | FAERS: 2 | US FAERS | |
| 298 | Cystitis | FAERS: 2 | 2837588 | CTD US FAERS |
| 299 | Drug abuse | FAERS: 2 | US FAERS | |
| 300 | Drug dose omission | FAERS: 2 | US FAERS | |
| 301 | Drug level decreased | FAERS: 2 | US FAERS | |
| 302 | Dysphasia | FAERS: 2 | US FAERS | |
| 303 | Ear discomfort | FAERS: 2 | US FAERS | |
| 304 | Eczema | FAERS: 2 | SIDER US FAERS | |
| 305 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 306 | Encephalomalacia | FAERS: 2 | US FAERS | |
| 307 | Extra dose administered | FAERS: 2 | US FAERS | |
| 308 | Facial paralysis | FAERS: 2 | US FAERS | |
| 309 | Failure to Thrive | FAERS: 2 | OFFSIDES US FAERS | |
| 310 | Flatulence | FAERS: 2 | SIDER US FAERS | |
| 311 | Flushing | FAERS: 2 | US FAERS | |
| 312 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 313 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 314 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 315 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 316 | Hepatic necrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 317 | Hepatitis B surface antibody positive | FAERS: 2 | US FAERS | |
| 318 | Hepatitis B surface antigen positive | FAERS: 2 | US FAERS | |
| 319 | Herpes pharyngitis | FAERS: 2 | US FAERS | |
| 320 | Herpes simplex pneumonia | FAERS: 2 | US FAERS | |
| 321 | Hyperkinesia | FAERS: 2 | US FAERS | |
| 322 | Hypospadias | FAERS: 2 | US FAERS | |
| 323 | Impaired work ability | FAERS: 2 | US FAERS | |
| 324 | Impetigo | FAERS: 2 | US FAERS | |
| 325 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 326 | Infusion site necrosis | FAERS: 2 | US FAERS | |
| 327 | Injection site thrombosis | FAERS: 2 | US FAERS | |
| 328 | Iridocyclitis | FAERS: 2 | US FAERS | |
| 329 | Malignant Hypertension | FAERS: 2 | US FAERS | |
| 330 | Mechanical ventilation | FAERS: 2 | US FAERS | |
| 331 | Monoparesis | FAERS: 2 | US FAERS | |
| 332 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 333 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 334 | Neonatal disorder | FAERS: 2 | US FAERS | |
| 335 | Neonatal pneumonia | FAERS: 2 | US FAERS | |
| 336 | Neonatal respiratory failure | FAERS: 2 | US FAERS | |
| 337 | Neurological decompensation | FAERS: 2 | OFFSIDES US FAERS | |
| 338 | Neurosyphilis | FAERS: 2 | US FAERS | |
| 339 | Neutropenic sepsis | FAERS: 2 | OFFSIDES US FAERS | |
| 340 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 341 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 342 | Ophthalmoplegia | FAERS: 2 | US FAERS | |
| 343 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 344 | Personality Change | FAERS: 2 | US FAERS | |
| 345 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 346 | Pneumatosis intestinalis | FAERS: 2 | US FAERS | |
| 347 | Pneumothorax | FAERS: 2 | OFFSIDES US FAERS | |
| 348 | Presyncope | FAERS: 2 | US FAERS | |
| 349 | Product label issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 350 | Product physical consistency issue | FAERS: 2 | US FAERS | |
| 351 | Product preparation error | FAERS: 2 | US FAERS | |
| 352 | Prothrombin level decreased | FAERS: 2 | US FAERS | |
| 353 | Punctate keratitis | FAERS: 2 | SIDER US FAERS | |
| 354 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 355 | Quadriplegia | FAERS: 2 | US FAERS | |
| 356 | Refusal of treatment by relative | FAERS: 2 | US FAERS | |
| 357 | Renal failure neonatal | FAERS: 2 | US FAERS | |
| 358 | Renal tubular disorder | FAERS: 2 | US FAERS | |
| 359 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 360 | Septic Shock | FAERS: 2 | OFFSIDES US FAERS | |
| 361 | Serum Sickness | FAERS: 2 | US FAERS | |
| 362 | Shock | FAERS: 2 | US FAERS | |
| 363 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 364 | Sinusitis | FAERS: 2 | OFFSIDES US FAERS | |
| 365 | Skin reaction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 366 | Sneezing | FAERS: 2 | US FAERS | |
| 367 | Soft tissue necrosis | FAERS: 2 | US FAERS | |
| 368 | Staring | FAERS: 2 | US FAERS | |
| 369 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 370 | Thrombosis | FAERS: 2 | US FAERS | |
| 371 | Tinnitus | FAERS: 2 | OFFSIDES US FAERS | |
| 372 | Toxic Epidermal Necrolysis | FAERS: 2 | SIDER US FAERS | |
| 373 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 374 | 2',5'-oligoadenylate synthetase test decreased | FAERS: 1 | US FAERS | |
| 375 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 376 | Acanthamoeba Infection | FAERS: 1 | US FAERS | |
| 377 | Acidosis | FAERS: 1 | US FAERS | |
| 378 | Administration site extravasation | FAERS: 1 | US FAERS | |
| 379 | Agnosia | FAERS: 1 | US FAERS | |
| 380 | Albuminuria | FAERS: 1 | US FAERS | |
| 381 | Anal Ulcer | FAERS: 1 | US FAERS | |
| 382 | Anger | FAERS: 1 | US FAERS | |
| 383 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 384 | Anhedonia | FAERS: 1 | OFFSIDES US FAERS | |
| 385 | Anti-thyroid antibody positive | FAERS: 1 | US FAERS | |
| 386 | Apathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 387 | Aphonia | FAERS: 1 | US FAERS | |
| 388 | Application site dryness | FAERS: 1 | US FAERS | |
| 389 | Application site erosion | FAERS: 1 | US FAERS | |
| 390 | Application site exfoliation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 391 | Application site inflammation | FAERS: 1 | US FAERS | |
| 392 | Application site laceration | FAERS: 1 | US FAERS | |
| 393 | Application site scar | FAERS: 1 | US FAERS | |
| 394 | Application site swelling | FAERS: 1 | US FAERS | |
| 395 | Aspergillosis | FAERS: 1 | US FAERS | |
| 396 | Asthenopia | FAERS: 1 | US FAERS | |
| 397 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 398 | Auricular swelling | FAERS: 1 | US FAERS | |
| 399 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 400 | Biopsy skin abnormal | FAERS: 1 | US FAERS | |
| 401 | Bladder pain | FAERS: 1 | US FAERS | |
| 402 | Blood alkaline phosphatase increased | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 403 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 404 | Blood fibrinogen decreased | FAERS: 1 | US FAERS | |
| 405 | Bone pain | FAERS: 1 | OFFSIDES US FAERS | |
| 406 | Brucellosis | FAERS: 1 | US FAERS | |
| 407 | Bullous impetigo | FAERS: 1 | US FAERS | |
| 408 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 409 | Candida test positive | FAERS: 1 | US FAERS | |
| 410 | Candidiasis | FAERS: 1 | US FAERS | |
| 411 | Catheter site erythema | FAERS: 1 | US FAERS | |
| 412 | Catheter site necrosis | FAERS: 1 | US FAERS | |
| 413 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 414 | Chills | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 415 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 416 | Clonus | FAERS: 1 | US FAERS | |
| 417 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 418 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 419 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 420 | Conjunctivitis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 421 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 422 | Corneal Perforation | FAERS: 1 | US FAERS | |
| 423 | Cotard's syndrome | FAERS: 1 | US FAERS | |
| 424 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 425 | Crystal urine present | FAERS: 1 | US FAERS | |
| 426 | Culture urine positive | FAERS: 1 | US FAERS | |
| 427 | Cyanopsia | FAERS: 1 | US FAERS | |
| 428 | Cytomegalovirus chorioretinitis | FAERS: 1 | US FAERS | |
| 429 | Cytomegalovirus gastroenteritis | FAERS: 1 | US FAERS | |
| 430 | Cytomegalovirus hepatitis | FAERS: 1 | US FAERS | |
| 431 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 432 | Device Failure | FAERS: 1 | US FAERS | |
| 433 | Device ineffective | FAERS: 1 | US FAERS | |
| 434 | Device related infection | FAERS: 1 | US FAERS | |
| 435 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 436 | Dialysis device insertion | FAERS: 1 | US FAERS | |
| 437 | Dreamy state | FAERS: 1 | US FAERS | |
| 438 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 439 | Drug dose titration not performed | FAERS: 1 | US FAERS | |
| 440 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 441 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 442 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 443 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 444 | Drug monitoring procedure not performed | FAERS: 1 | US FAERS | |
| 445 | Dysentery | FAERS: 1 | US FAERS | |
| 446 | Dyspepsia | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 447 | Ecchymosis | FAERS: 1 | US FAERS | |
| 448 | Enterocolitis | FAERS: 1 | US FAERS | |
| 449 | Eschar | FAERS: 1 | US FAERS | |
| 450 | Eye inflammation | FAERS: 1 | US FAERS | |
| 451 | Eyeball avulsion | FAERS: 1 | US FAERS | |
| 452 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 453 | Eyelid pain | FAERS: 1 | US FAERS | |
| 454 | Fasciitis | FAERS: 1 | US FAERS | |
| 455 | Febrile Neutropenia | FAERS: 1 | OFFSIDES US FAERS | |
| 456 | Feeling Cold | FAERS: 1 | US FAERS | |
| 457 | Feeling jittery | FAERS: 1 | US FAERS | |
| 458 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 459 | Fibrosis | FAERS: 1 | US FAERS | |
| 460 | Fluid overload | FAERS: 1 | OFFSIDES US FAERS | |
| 461 | Gastric mucosa erythema | FAERS: 1 | US FAERS | |
| 462 | Gastritis | FAERS: 1 | US FAERS | |
| 463 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 464 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 465 | Gaze palsy | FAERS: 1 | US FAERS | |
| 466 | Gene Mutation | FAERS: 1 | US FAERS | |
| 467 | General symptom | FAERS: 1 | US FAERS | |
| 468 | Genital discomfort | FAERS: 1 | US FAERS | |
| 469 | Genital rash | FAERS: 1 | US FAERS | |
| 470 | Glossitis | FAERS: 1 | US FAERS | |
| 471 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 472 | Glycosuria | FAERS: 1 | 8442906 | CTD US FAERS |
| 473 | Graft versus host disease in lung | FAERS: 1 | US FAERS | |
| 474 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 475 | Hemiplegia | FAERS: 1 | US FAERS | |
| 476 | Hepatosplenomegaly | FAERS: 1 | OFFSIDES US FAERS | |
| 477 | Herpes Zoster Oticus | FAERS: 1 | 19278487 | CTD US FAERS |
| 478 | Herpes simplex DNA test positive | FAERS: 1 | US FAERS | |
| 479 | Herpes simplex serology positive | FAERS: 1 | US FAERS | |
| 480 | Herpes zoster meningomyelitis | FAERS: 1 | US FAERS | |
| 481 | Histiocytosis haematophagic | FAERS: 1 | OFFSIDES US FAERS | |
| 482 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 483 | Hypercreatininaemia | FAERS: 1 | US FAERS | |
| 484 | Hyperreflexia | FAERS: 1 | OFFSIDES US FAERS | |
| 485 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 486 | Hyperventilation | FAERS: 1 | US FAERS | |
| 487 | Hypomania | FAERS: 1 | US FAERS | |
| 488 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 489 | Immobile | FAERS: 1 | US FAERS | |
| 490 | Immune reconstitution syndrome | FAERS: 1 | US FAERS | |
| 491 | Impatience | FAERS: 1 | US FAERS | |
| 492 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 493 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 494 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 495 | Infection reactivation | FAERS: 1 | US FAERS | |
| 496 | Inflammation | FAERS: 1 | SIDER US FAERS | |
| 497 | Influenza | FAERS: 1 | US FAERS | |
| 498 | Infusion site erosion | FAERS: 1 | US FAERS | |
| 499 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 500 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 501 | Injection site pain | FAERS: 1 | US FAERS | |
| 502 | Injection site phlebitis | FAERS: 1 | SIDER US FAERS | |
| 503 | Instillation site vesicles | FAERS: 1 | US FAERS | |
| 504 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 505 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 506 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 507 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 508 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 509 | Irregular breathing | FAERS: 1 | US FAERS | |
| 510 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 511 | JC virus infection | FAERS: 1 | US FAERS | |
| 512 | Joint stiffness | FAERS: 1 | US FAERS | |
| 513 | Joint swelling | FAERS: 1 | US FAERS | |
| 514 | Leukocytoclastic vasculitis | FAERS: 1 | SIDER US FAERS | |
| 515 | Leukostasis | FAERS: 1 | US FAERS | |
| 516 | Locked-In Syndrome | FAERS: 1 | US FAERS | |
| 517 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 518 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 519 | Lumbar puncture abnormal | FAERS: 1 | US FAERS | |
| 520 | Lung consolidation | FAERS: 1 | OFFSIDES US FAERS | |
| 521 | Lymphadenopathy | FAERS: 1 | SIDER US FAERS | |
| 522 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 523 | Lymphocyte percentage increased | FAERS: 1 | US FAERS | |
| 524 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 525 | Lymphopenia | FAERS: 1 | US FAERS | |
| 526 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 527 | Measles | FAERS: 1 | US FAERS | |
| 528 | Medication crystals in urine present | FAERS: 1 | US FAERS | |
| 529 | Medication residue present | FAERS: 1 | US FAERS | |
| 530 | Meningitis | FAERS: 1 | US FAERS | |
| 531 | Mental impairment | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 532 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 533 | Moaning | FAERS: 1 | US FAERS | |
| 534 | Mood swings | FAERS: 1 | US FAERS | |
| 535 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 536 | Multiple allergies | FAERS: 1 | US FAERS | |
| 537 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 538 | Musculoskeletal chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 539 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 540 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 541 | Myopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 542 | Myopia | FAERS: 1 | US FAERS | |
| 543 | Myositis | FAERS: 1 | US FAERS | |
| 544 | Neonatal hypotension | FAERS: 1 | US FAERS | |
| 545 | Neonatal infection | FAERS: 1 | US FAERS | |
| 546 | Neonatal mucocutaneous herpes simplex | FAERS: 1 | US FAERS | |
| 547 | Nephritic syndrome | FAERS: 1 | US FAERS | |
| 548 | Nephrolithiasis | FAERS: 1 | OFFSIDES US FAERS | |
| 549 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 550 | Neutrophil percentage decreased | FAERS: 1 | US FAERS | |
| 551 | Oculomucocutaneous syndrome | FAERS: 1 | US FAERS | |
| 552 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 553 | Oropharyngeal discomfort | FAERS: 1 | SIDER US FAERS | |
| 554 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 555 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 556 | Oxygen saturation abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 557 | PO2 decreased | FAERS: 1 | US FAERS | |
| 558 | Pain of skin | FAERS: 1 | OFFSIDES US FAERS | |
| 559 | Pallor | FAERS: 1 | OFFSIDES US FAERS | |
| 560 | Penile erythema | FAERS: 1 | US FAERS | |
| 561 | Pericardial effusion | FAERS: 1 | OFFSIDES US FAERS | |
| 562 | Periostosis | FAERS: 1 | US FAERS | |
| 563 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 564 | Petechiae | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 565 | Pleocytosis | FAERS: 1 | US FAERS | |
| 566 | Pneumonia herpes viral | FAERS: 1 | US FAERS | |
| 567 | Polyhydramnios | FAERS: 1 | US FAERS | |
| 568 | Polymyositis | FAERS: 1 | US FAERS | |
| 569 | Polyuria | FAERS: 1 | 14675048 | CTD US FAERS |
| 570 | Poriomania | FAERS: 1 | US FAERS | |
| 571 | Post procedural complication | FAERS: 1 | OFFSIDES US FAERS | |
| 572 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 573 | Procedural complication | FAERS: 1 | US FAERS | |
| 574 | Product adhesion issue | FAERS: 1 | US FAERS | |
| 575 | Product commingling | FAERS: 1 | US FAERS | |
| 576 | Product contamination | FAERS: 1 | US FAERS | |
| 577 | Product contamination physical | FAERS: 1 | US FAERS | |
| 578 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 579 | Product dispensing error | FAERS: 1 | US FAERS | |
| 580 | Product formulation issue | FAERS: 1 | US FAERS | |
| 581 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 582 | Product size issue | FAERS: 1 | US FAERS | |
| 583 | Product storage error | FAERS: 1 | US FAERS | |
| 584 | Product substitution | FAERS: 1 | US FAERS | |
| 585 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 586 | Prostatic pain | FAERS: 1 | US FAERS | |
| 587 | Protein urine present | FAERS: 1 | US FAERS | |
| 588 | Psychotic symptom | FAERS: 1 | US FAERS | |
| 589 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 590 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 591 | Purpura | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 592 | Purulence | FAERS: 1 | US FAERS | |
| 593 | Radiculopathy | FAERS: 1 | US FAERS | |
| 594 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 595 | Renal Colic | FAERS: 1 | US FAERS | |
| 596 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 597 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 598 | Retinal infiltrates | FAERS: 1 | US FAERS | |
| 599 | Retinal scar | FAERS: 1 | US FAERS | |
| 600 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 601 | Rhegmatogenous retinal detachment | FAERS: 1 | US FAERS | |
| 602 | Schizophrenia | FAERS: 1 | US FAERS | |
| 603 | Scleroderma | FAERS: 1 | OFFSIDES US FAERS | |
| 604 | Sensation of blood flow | FAERS: 1 | US FAERS | |
| 605 | Sensory level abnormal | FAERS: 1 | US FAERS | |
| 606 | Skeleton dysplasia | FAERS: 1 | US FAERS | |
| 607 | Skin laceration | FAERS: 1 | US FAERS | |
| 608 | Specific gravity urine decreased | FAERS: 1 | US FAERS | |
| 609 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 610 | Splenomegaly | FAERS: 1 | US FAERS | |
| 611 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 612 | Sterile pyuria | FAERS: 1 | US FAERS | |
| 613 | Stillbirth | FAERS: 1 | US FAERS | |
| 614 | Stress | FAERS: 1 | US FAERS | |
| 615 | Stupor | FAERS: 1 | 2396095 7973922 12799156 | CTD SIDER US FAERS |
| 616 | Sunburn | FAERS: 1 | US FAERS | |
| 617 | Synovial fluid white blood cells positive | FAERS: 1 | US FAERS | |
| 618 | Syphilis | FAERS: 1 | US FAERS | |
| 619 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 620 | Tension | FAERS: 1 | US FAERS | |
| 621 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 622 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 623 | Thermal burn | FAERS: 1 | US FAERS | |
| 624 | Thrombocytopenic purpura | FAERS: 1 | SIDER US FAERS | |
| 625 | Thrombocytosis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 626 | Tongue eruption | FAERS: 1 | US FAERS | |
| 627 | Tooth Loss | FAERS: 1 | US FAERS | |
| 628 | Traumatic lumbar puncture | FAERS: 1 | US FAERS | |
| 629 | Urine leukocyte esterase positive | FAERS: 1 | US FAERS | |
| 630 | Urine output increased | FAERS: 1 | US FAERS | |
| 631 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 632 | Varicella Zoster Virus Infection | FAERS: 1 | US FAERS | |
| 633 | Vascular access site occlusion | FAERS: 1 | US FAERS | |
| 634 | Vascular encephalopathy | FAERS: 1 | US FAERS | |
| 635 | Venous thrombosis limb | FAERS: 1 | OFFSIDES US FAERS | |
| 636 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 637 | Vulvar erosion | FAERS: 1 | US FAERS | |
| 638 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 639 | Wheelchair user | FAERS: 1 | US FAERS | |
| 640 | Xanthopsia | FAERS: 1 | US FAERS | |
| 641 | skin abrasion | FAERS: 1 | US FAERS | |
| 642 | AIDS-Related Opportunistic Infections | 9707315 | CTD | |
| 643 | Abnormal vision | OFFSIDES | ||
| 644 | Abscess | OFFSIDES | ||
| 645 | Accelerated hair loss | SIDER | ||
| 646 | Ache | SIDER | ||
| 647 | Acid reflux | OFFSIDES | ||
| 648 | Acquired Immunodeficiency Syndrome | 2964805 | CTD | |
| 649 | Actinic keratosis | OFFSIDES | ||
| 650 | Actinomycosis | OFFSIDES | ||
| 651 | Activities of daily living impaired | OFFSIDES | ||
| 652 | Acute graft versus host disease in intestine | OFFSIDES | ||
| 653 | Acute graft versus host disease in liver | OFFSIDES | ||
| 654 | Acute psychosis | OFFSIDES | ||
| 655 | Acute respiratory failure | OFFSIDES | ||
| 656 | Acute sinusitis | OFFSIDES | ||
| 657 | Acute vestibular syndrome | OFFSIDES | ||
| 658 | Adenocarcinoma | OFFSIDES | ||
| 659 | Adenoma | OFFSIDES | ||
| 660 | Allergic pharyngitis | OFFSIDES | ||
| 661 | Alveolitis | OFFSIDES | ||
| 662 | Anemia, Megaloblastic | 6130274 | CTD | |
| 663 | Antithrombin III decreased | OFFSIDES | ||
| 664 | Aortic bruit | OFFSIDES | ||
| 665 | Aphthous Stomatitis | OFFSIDES SIDER | ||
| 666 | Application site warmth | Canada Vigilance: 1 | Canada Vigilance | |
| 667 | Arteriosclerosis | OFFSIDES | ||
| 668 | Arteriovenous fistula thrombosis | OFFSIDES | ||
| 669 | Arthropathy | OFFSIDES | ||
| 670 | Aseptic Meningitis | OFFSIDES | ||
| 671 | Atelectasis | OFFSIDES | ||
| 672 | Atrial Flutter | OFFSIDES | ||
| 673 | Atrial bigeminy | OFFSIDES | ||
| 674 | Atrial tachycardia | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 675 | Auditory and visual hallucinations | SIDER | ||
| 676 | Aura | OFFSIDES | ||
| 677 | Autoimmune hepatitis | OFFSIDES | ||
| 678 | Bacterial Infections | 12669766 | CTD | |
| 679 | Band neutrophil percentage decreased | OFFSIDES | ||
| 680 | Basal cell carcinoma | OFFSIDES | ||
| 681 | Bile duct necrosis | OFFSIDES | ||
| 682 | Biliary Dyskinesia | OFFSIDES | ||
| 683 | Biliary cancer metastatic | OFFSIDES | ||
| 684 | Biopsy bone marrow abnormal | OFFSIDES | ||
| 685 | Biopsy endometrium abnormal | OFFSIDES | ||
| 686 | Bipolar Disorder | 7969690 | CTD | |
| 687 | Bladder Diverticulum | OFFSIDES | ||
| 688 | Blepharitis | SIDER | ||
| 689 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 690 | Blood Glucose | OFFSIDES | ||
| 691 | Blood albumin decreased | OFFSIDES | ||
| 692 | Blood and lymphatic system disorders | SIDER | ||
| 693 | Blood chloride decreased | OFFSIDES | ||
| 694 | Blood cholesterol | OFFSIDES | ||
| 695 | Blood magnesium increased | OFFSIDES | ||
| 696 | Blood sodium increased | OFFSIDES | ||
| 697 | Blood sodium | OFFSIDES | ||
| 698 | Blood uric acid | OFFSIDES | ||
| 699 | Bone lesion | OFFSIDES | ||
| 700 | Bone marrow depression | OFFSIDES | ||
| 701 | Breast Cyst | OFFSIDES | ||
| 702 | Bronchiolitis | OFFSIDES | ||
| 703 | Bronchitis | OFFSIDES | ||
| 704 | Bronchoalveolar Lavage | OFFSIDES | ||
| 705 | Bronchoalveolar lavage abnormal | OFFSIDES | ||
| 706 | Calciphylaxis | OFFSIDES | ||
| 707 | Cancer Pain | OFFSIDES | ||
| 708 | Cardiac Tamponade | OFFSIDES SIDER | ||
| 709 | Cardiovascular insufficiency | OFFSIDES | ||
| 710 | Carotidynia | OFFSIDES | ||
| 711 | Cataract operation | OFFSIDES | ||
| 712 | Central Nervous System Infection | OFFSIDES | ||
| 713 | Cerebral cyst | OFFSIDES | ||
| 714 | Chemical and Drug Induced Liver Injury | 11214960 24085192 | CTD | |
| 715 | Choking sensation | OFFSIDES | ||
| 716 | Cholangiolitis | OFFSIDES | ||
| 717 | Chorea | 2843139 | CTD | |
| 718 | Choroidal Detachment | OFFSIDES | ||
| 719 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 720 | Chronic sinusitis | OFFSIDES | ||
| 721 | Clostridium colitis | OFFSIDES | ||
| 722 | Clostridium difficile colitis | OFFSIDES | ||
| 723 | Compression fracture | OFFSIDES | ||
| 724 | Confusion |
2396095
4062110 7571352 7973922 8038467 8228796 8322628 8559507 8671884 8810856 8825003 9496746 11908272 12799156 14658398 15247861 16854507 | CTD | |
| 725 | Creatinine increased | SIDER | ||
| 726 | Cytomegalovirus Infections | 2837588 3030175 7947045 | CTD | |
| 727 | Cytomegalovirus antibody positive | OFFSIDES | ||
| 728 | Cytomegalovirus test positive | OFFSIDES | ||
| 729 | Debridement | OFFSIDES | ||
| 730 | Demyelination | OFFSIDES | ||
| 731 | Dental Fistula | OFFSIDES | ||
| 732 | Dental caries | OFFSIDES | ||
| 733 | Depressive disorder | 3371192 3711686 | CTD | |
| 734 | Diarrhea | OFFSIDES | ||
| 735 | Diffuse Large B-Cell Lymphoma | OFFSIDES | ||
| 736 | Dilatation intrahepatic duct acquired | OFFSIDES | ||
| 737 | Distress gastrointestinal | SIDER | ||
| 738 | Diverticulitis | OFFSIDES | ||
| 739 | Diverticulosis | OFFSIDES | ||
| 740 | Endocarditis | OFFSIDES | ||
| 741 | Endodontic procedure | OFFSIDES | ||
| 742 | Enterococcal infection | OFFSIDES | ||
| 743 | Enterocutaneous Fistula | OFFSIDES | ||
| 744 | Episcleritis | OFFSIDES | ||
| 745 | Epstein-Barr virus antibody positive | OFFSIDES | ||
| 746 | Epstein-Barr virus associated lymphoproliferative disorder | OFFSIDES | ||
| 747 | Escherichia infection | OFFSIDES | ||
| 748 | Escherichia urinary tract infection | OFFSIDES | ||
| 749 | Eye laser surgery | OFFSIDES | ||
| 750 | Facial Nerve Diseases | 19278487 | CTD | |
| 751 | Febrile infection | OFFSIDES | ||
| 752 | Folliculitis | OFFSIDES | ||
| 753 | Foreign body trauma | OFFSIDES | ||
| 754 | Fungus serology test positive | OFFSIDES | ||
| 755 | Genital erosion | OFFSIDES | ||
| 756 | Gingival Hypertrophy | OFFSIDES | ||
| 757 | Globulinuria | OFFSIDES | ||
| 758 | Goiter | OFFSIDES | ||
| 759 | Granuloma | OFFSIDES | ||
| 760 | Growth failure | Canada Vigilance: 1 | Canada Vigilance | |
| 761 | Haematotoxicity | OFFSIDES | ||
| 762 | Hallucinations | CTD | ||
| 763 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 764 | Hepatitis C | OFFSIDES | ||
| 765 | Herpes NOS | SIDER | ||
| 766 | Herpes Zoster Ophthalmicus | 14606623 | CTD | |
| 767 | Herpesviridae Infections | 2729341 3711686 | CTD | |
| 768 | Hiccough | OFFSIDES | ||
| 769 | Hydronephrosis | OFFSIDES | ||
| 770 | Hypertrophy of tongue papillae | OFFSIDES | ||
| 771 | Hypophosphatemia | 8456495 14675048 | CTD | |
| 772 | Hypoxia | OFFSIDES | ||
| 773 | Immunosuppression | OFFSIDES | ||
| 774 | Instillation site pain | SIDER | ||
| 775 | Intention tremor | OFFSIDES | ||
| 776 | Intervertebral disc disorder | OFFSIDES | ||
| 777 | Keratitis sicca | OFFSIDES | ||
| 778 | Keratomileusis | OFFSIDES | ||
| 779 | Kidney Diseases | 11532999 | CTD | |
| 780 | Kidney Failure, Chronic | 14606623 16138435 | CTD | |
| 781 | Kidney Failure | OFFSIDES | ||
| 782 | Klebsiella sepsis | OFFSIDES | ||
| 783 | Large intestine perforation | OFFSIDES | ||
| 784 | Leukoencephalopathy | OFFSIDES | ||
| 785 | Leukopenia neonatal | OFFSIDES | ||
| 786 | Life expectancy shortened | OFFSIDES | ||
| 787 | Lightheadedness | SIDER | ||
| 788 | Limb operation | OFFSIDES | ||
| 789 | Lipase | OFFSIDES | ||
| 790 | Liver transplant rejection | OFFSIDES | ||
| 791 | Loose tooth | OFFSIDES | ||
| 792 | Lower respiratory tract infection fungal | OFFSIDES | ||
| 793 | Lung hyperinflation | OFFSIDES | ||
| 794 | Lung infection pseudomonal | OFFSIDES | ||
| 795 | Lymphoma | OFFSIDES | ||
| 796 | Mastication disorder | OFFSIDES | ||
| 797 | Memory Disorders | 7571352 17651180 | CTD | |
| 798 | Meningoencephalitis | 1476483 10615548 16854507 | CTD | |
| 799 | Metrorrhagia | Canada Vigilance: 1 | Canada Vigilance | |
| 800 | Mucosal erosion | OFFSIDES | ||
| 801 | Multiple Myeloma | OFFSIDES | ||
| 802 | Muscle strain | OFFSIDES | ||
| 803 | Mycobacterium avium complex immune restoration disease | OFFSIDES | ||
| 804 | Myelodysplasia | OFFSIDES | ||
| 805 | Nephritis, Interstitial | 2080005 3376977 | CTD | |
| 806 | Neural Tube Defects | 1810578 | CTD | |
| 807 | Neurobehavioral Manifestations | 8213806 | CTD | |
| 808 | Neurologic Manifestations | CTD | ||
| 809 | Neurologic reaction | SIDER | ||
| 810 | Neurotoxicity Syndromes | CTD | ||
| 811 | Nocturia | OFFSIDES | ||
| 812 | Oral infection | OFFSIDES | ||
| 813 | Oropharyngeal spasm | OFFSIDES | ||
| 814 | Osteolysis | OFFSIDES | ||
| 815 | Osteomyelitis | OFFSIDES | ||
| 816 | Osteopenia | OFFSIDES | ||
| 817 | Pars Planitis | SIDER | ||
| 818 | Pelvic abscess | OFFSIDES | ||
| 819 | Periodontitis | OFFSIDES | ||
| 820 | Physical disability | OFFSIDES | ||
| 821 | Plasmacytoma | OFFSIDES | ||
| 822 | Platelet count abnormal | OFFSIDES | ||
| 823 | Pneumococcal sepsis | OFFSIDES | ||
| 824 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 825 | Portal Vein Thrombosis | OFFSIDES | ||
| 826 | Portal vein stenosis | OFFSIDES | ||
| 827 | Posterior Leukoencephalopathy Syndrome | 16107379 | CTD | |
| 828 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 829 | Productive Cough | OFFSIDES | ||
| 830 | Pseudomonal sepsis | OFFSIDES | ||
| 831 | Psychomotor Agitation | 8228796 | CTD | |
| 832 | Pulmonary Infarction | OFFSIDES | ||
| 833 | Pulmonary congestion | OFFSIDES | ||
| 834 | Purpura Fulminans | SIDER | ||
| 835 | Quality of life decreased | OFFSIDES | ||
| 836 | Radicular pain | OFFSIDES | ||
| 837 | Renal Insufficiency | CTD | ||
| 838 | Respiratory tract infection fungal | OFFSIDES | ||
| 839 | Retinal Necrosis Syndrome, Acute | 17406046 19278487 | CTD | |
| 840 | Retinal infarction | OFFSIDES | ||
| 841 | Seizures | 8038467 14658398 19589454 | CTD | |
| 842 | Shoulder Pain | OFFSIDES | ||
| 843 | Sinus polyp | OFFSIDES | ||
| 844 | Skin Diseases, Vesiculobullous | 3510331 | CTD | |
| 845 | Sleep Initiation and Maintenance Disorders | 8825003 | CTD | |
| 846 | Soft Tissue Infection | OFFSIDES | ||
| 847 | Soft tissue inflammation | OFFSIDES | ||
| 848 | Splenectomy | OFFSIDES | ||
| 849 | Splenic abscess | OFFSIDES | ||
| 850 | Squamous cell carcinoma of skin | OFFSIDES | ||
| 851 | Stem cell transplant | OFFSIDES | ||
| 852 | Superficial punctate keratopathy | SIDER | ||
| 853 | Synovial Cyst | OFFSIDES | ||
| 854 | Tension Headache | OFFSIDES | ||
| 855 | Tooth Extraction | OFFSIDES | ||
| 856 | Toxoplasmosis | OFFSIDES | ||
| 857 | Tracheobronchitis viral | OFFSIDES | ||
| 858 | Tracheobronchitis | OFFSIDES | ||
| 859 | Transfusion Reaction | OFFSIDES | ||
| 860 | Umbilical hernia | OFFSIDES | ||
| 861 | Urolithiasis | 11895069 | CTD | |
| 862 | Uveitis | SIDER | ||
| 863 | Vascular calcification | OFFSIDES | ||
| 864 | Viral DNA test positive | OFFSIDES | ||
| 865 | Viral pharyngitis | OFFSIDES | ||
| 866 | Weight Gain | OFFSIDES | ||
| 867 | West Nile viral infection | OFFSIDES | ||
| 868 | Wound Complication | OFFSIDES | ||
| 869 | Wound dehiscence | OFFSIDES | ||
| 870 | prostatitis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.