Lansoprazole
(MJIHNNLFOKEZEW-UHFFFAOYSA-N)
Structure
- SMILES
- O=S(c1nc2c([nH]1)cccc2)Cc1nccc(c1C)OCC(F)(F)F
- Type(s)
- Approved; Investigational
- ATC code(s)
- A02BC03; A02BC53; A02BD02; A02BD03; A02BD07; A02BD09; A02BD10
- Molecular Formula:
- C16H14F3N3O2S
- Molecular Weight:
- 369.361
- Log P:
- 4.3809
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 87.08
- CAS Number(s):
- 103577-45-3
Synonym(s)
1.
Lansoprazole
2.
Lansoprazoles
3.
2-(((3-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridyl)methyl)sulfinyl)benzimidazole
4.
AG 1749
5.
AG-1749
6.
Agopton
7.
Bamalite
8.
Lansol
9.
Lansoprazol
10.
Lansoprazole Sodium
11.
Lanzor
12.
Monolitum
13.
Ogast
14.
Ogastro
15.
Opiren
16.
Prevacid
17.
Prezal
18.
Pro Ulco
19.
Promeco
20.
Takepron
21.
Ulpax
22.
Zoton
23.
AG1749
24.
Sodium, Lansoprazole
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Acute kidney injury | FAERS: 1351 | 19814645 | CTD US FAERS |
| 2 | Hyperchlorhydria | FAERS: 567 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Rebound effect | FAERS: 350 | US FAERS | |
| 4 | Drug ineffective | FAERS: 196 Canada Vigilance: 120 | Canada Vigilance US FAERS | |
| 5 | No adverse event | FAERS: 170 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Incorrect drug administration duration | FAERS: 138 | US FAERS | |
| 7 | Vomiting | FAERS: 100 Canada Vigilance: 11 | 9570263 11012560 12464168 | CTD SIDER Canada Vigilance US FAERS |
| 8 | Nausea | FAERS: 96 Canada Vigilance: 25 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 9 | Proteinuria | FAERS: 92 | US FAERS | |
| 10 | Product substitution issue | FAERS: 90 Canada Vigilance: 70 | Canada Vigilance US FAERS | |
| 11 | Urticaria | FAERS: 88 Canada Vigilance: 7 | 12464168 | CTD SIDER Canada Vigilance US FAERS |
| 12 | Nephrolithiasis | FAERS: 83 | OFFSIDES SIDER US FAERS | |
| 13 | Hypersensitivity | FAERS: 79 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 14 | Diabetic Nephropathy | FAERS: 74 | US FAERS | |
| 15 | Wrong technique in product usage process | FAERS: 73 | US FAERS | |
| 16 | Malaise | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 17 | Pruritus | FAERS: 70 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 18 | hypertensive nephropathy | FAERS: 70 | US FAERS | |
| 19 | Dyspepsia | FAERS: 63 Canada Vigilance: 16 | 9545163 15468341 22180759 | CTD SIDER Canada Vigilance US FAERS |
| 20 | Dizziness | FAERS: 60 Canada Vigilance: 6 | 11994030 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 21 | Drug prescribing error | FAERS: 57 | US FAERS | |
| 22 | Fatigue | FAERS: 56 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 23 | Rebound acid hypersecretion | FAERS: 56 | US FAERS | |
| 24 | Abdominal Pain | FAERS: 51 Canada Vigilance: 12 | 9317068 11012560 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 25 | Renal cyst | FAERS: 50 | US FAERS | |
| 26 | Erythema | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 27 | Blood creatinine increased | FAERS: 41 | SIDER US FAERS | |
| 28 | Drug administered to patient of inappropriate age | FAERS: 41 | US FAERS | |
| 29 | Asthenia | FAERS: 40 Canada Vigilance: 4 | 9042987 | CTD SIDER Canada Vigilance US FAERS |
| 30 | Incorrect dose administered | FAERS: 40 | US FAERS | |
| 31 | Nephrosclerosis | FAERS: 40 | US FAERS | |
| 32 | Hypotension | FAERS: 38 | 12464168 | CTD SIDER US FAERS |
| 33 | Pain | FAERS: 37 Canada Vigilance: 1 | 9570263 | CTD SIDER Canada Vigilance US FAERS |
| 34 | Headache | FAERS: 36 Canada Vigilance: 6 | 9042987 9354197 11012560 | CTD SIDER Canada Vigilance US FAERS |
| 35 | Inappropriate schedule of drug administration | FAERS: 36 | US FAERS | |
| 36 | Product use issue | FAERS: 36 | US FAERS | |
| 37 | Angioedema | FAERS: 35 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 38 | Chest Pain | FAERS: 35 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 39 | Therapeutic response unexpected | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Feeling abnormal | FAERS: 32 | SIDER US FAERS | |
| 41 | Dysuria | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 42 | Palpitations | FAERS: 28 | SIDER US FAERS | |
| 43 | Nocturia | FAERS: 26 | US FAERS | |
| 44 | Overdose | FAERS: 26 | US FAERS | |
| 45 | Tremor | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 46 | Weight decreased | FAERS: 25 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 47 | Abdominal discomfort | FAERS: 24 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 48 | Anxiety | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 49 | Adverse event | FAERS: 23 | US FAERS | |
| 50 | Drug ineffective for unapproved indication | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Prescribed overdose | FAERS: 23 | US FAERS | |
| 52 | Renal Artery Stenosis | FAERS: 23 | OFFSIDES US FAERS | |
| 53 | Product quality issue | FAERS: 22 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 54 | Anaphylactic shock | FAERS: 21 | SIDER US FAERS | |
| 55 | Flatulence | FAERS: 21 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 56 | Nephrotic Syndrome | FAERS: 20 | US FAERS | |
| 57 | Dysgeusia | FAERS: 19 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 58 | Hydronephrosis | FAERS: 18 | OFFSIDES US FAERS | |
| 59 | Sepsis | FAERS: 18 | US FAERS | |
| 60 | Somnolence | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 61 | Urinary tract infection | FAERS: 18 | SIDER US FAERS | |
| 62 | Myocardial Infarction | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 63 | Nephrectomy | FAERS: 17 | US FAERS | |
| 64 | Syncope | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 65 | Arthralgia | FAERS: 16 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 66 | Glomerulonephritis | FAERS: 16 | US FAERS | |
| 67 | Medication Error | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 68 | Presyncope | FAERS: 15 | US FAERS | |
| 69 | Vertigo | FAERS: 15 | SIDER US FAERS | |
| 70 | Constipation | FAERS: 14 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 71 | Eructation | FAERS: 14 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 72 | Incorrect product administration duration | FAERS: 14 | US FAERS | |
| 73 | Myalgia | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 74 | Pneumonia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 75 | Blood urea increased | FAERS: 13 | SIDER US FAERS | |
| 76 | Disease recurrence | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 77 | Drug Dependence | FAERS: 13 | US FAERS | |
| 78 | Toxic Epidermal Necrolysis | FAERS: 13 | SIDER US FAERS | |
| 79 | Urinary Incontinence | FAERS: 13 | US FAERS | |
| 80 | Alanine Aminotransferase Increased | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 81 | Chills | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 82 | Diplopia | FAERS: 12 | SIDER US FAERS | |
| 83 | Osteoporosis | FAERS: 12 | US FAERS | |
| 84 | Pyelonephritis | FAERS: 12 | OFFSIDES US FAERS | |
| 85 | Atrial Fibrillation | FAERS: 11 | US FAERS | |
| 86 | Blood magnesium decreased | FAERS: 11 | US FAERS | |
| 87 | Nephritis | FAERS: 11 | US FAERS | |
| 88 | Protein-losing gastroenteropathy | FAERS: 11 | US FAERS | |
| 89 | Renal mass | FAERS: 11 | US FAERS | |
| 90 | Rhabdomyolysis | FAERS: 11 | US FAERS | |
| 91 | Stevens-Johnson Syndrome | FAERS: 11 | 25811541 | CTD SIDER US FAERS |
| 92 | Visual Impairment | FAERS: 11 | SIDER US FAERS | |
| 93 | Allergy test positive | FAERS: 10 | US FAERS | |
| 94 | Cerebrovascular accident | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 95 | Coronary Artery Disease | FAERS: 10 | US FAERS | |
| 96 | Drug exposure during pregnancy | FAERS: 10 | US FAERS | |
| 97 | Pharmaceutical product complaint | FAERS: 10 | US FAERS | |
| 98 | Thrombocytopenia | FAERS: 10 | SIDER US FAERS | |
| 99 | Urinary Retention | FAERS: 10 | SIDER US FAERS | |
| 100 | Dehydration | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 101 | Device occlusion | FAERS: 9 | US FAERS | |
| 102 | Dystonia | FAERS: 9 | US FAERS | |
| 103 | Lethargy | FAERS: 9 | OFFSIDES US FAERS | |
| 104 | Polyuria | FAERS: 9 | SIDER US FAERS | |
| 105 | Rash erythematous | FAERS: 9 | US FAERS | |
| 106 | Renal tubular necrosis | FAERS: 9 | US FAERS | |
| 107 | Wrong technique in drug usage process | FAERS: 9 | OFFSIDES US FAERS | |
| 108 | Accidental exposure to product by child | FAERS: 8 | US FAERS | |
| 109 | Activities of daily living impaired | FAERS: 8 | US FAERS | |
| 110 | Back Pain | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 111 | Expired product administered | FAERS: 8 | US FAERS | |
| 112 | Flushing | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Lip swelling | FAERS: 8 | US FAERS | |
| 114 | Oropharyngeal pain | FAERS: 8 | SIDER US FAERS | |
| 115 | Peripheral swelling | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 116 | Product use in unapproved indication | FAERS: 8 | US FAERS | |
| 117 | Regurgitation | FAERS: 8 | US FAERS | |
| 118 | Sinusitis | FAERS: 8 | SIDER US FAERS | |
| 119 | Tachycardia | FAERS: 8 | SIDER US FAERS | |
| 120 | Throat irritation | FAERS: 8 | US FAERS | |
| 121 | Urine phosphorus decreased | FAERS: 8 | US FAERS | |
| 122 | Alopecia | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 123 | Blood potassium decreased | FAERS: 7 | US FAERS | |
| 124 | Cardiac Arrest | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Eczema | FAERS: 7 | US FAERS | |
| 126 | Hypocalciuria | FAERS: 7 | US FAERS | |
| 127 | Incorrect route of drug administration | FAERS: 7 | US FAERS | |
| 128 | Mood swings | FAERS: 7 | SIDER US FAERS | |
| 129 | Pregnancy | FAERS: 7 | US FAERS | |
| 130 | Urinary tract obstruction | FAERS: 7 | US FAERS | |
| 131 | Urine potassium decreased | FAERS: 7 | US FAERS | |
| 132 | Vitamin D Deficiency | FAERS: 7 | US FAERS | |
| 133 | Agitation | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 134 | Agranulocytosis | FAERS: 6 | SIDER US FAERS | |
| 135 | Asthma | FAERS: 6 Canada Vigilance: 1 | 16778364 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 136 | Cataract | FAERS: 6 | SIDER US FAERS | |
| 137 | Chromaturia | FAERS: 6 | US FAERS | |
| 138 | Clostridium difficile colitis | FAERS: 6 | US FAERS | |
| 139 | Clostridium difficile infection | FAERS: 6 | US FAERS | |
| 140 | Cystitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Dermatitis | FAERS: 6 | SIDER US FAERS | |
| 142 | Diabetes Mellitus | FAERS: 6 | SIDER US FAERS | |
| 143 | Discomfort | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 144 | Disseminated Intravascular Coagulation | FAERS: 6 | US FAERS | |
| 145 | Drug dispensing error | FAERS: 6 | US FAERS | |
| 146 | Feeling Cold | FAERS: 6 | US FAERS | |
| 147 | Gastrointestinal Pain | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 148 | Intercepted drug prescribing error | FAERS: 6 | US FAERS | |
| 149 | Metabolic acidosis | FAERS: 6 | US FAERS | |
| 150 | Musculoskeletal Pain | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 151 | Nephrocalcinosis | FAERS: 6 | US FAERS | |
| 152 | Ocular icterus | FAERS: 6 | US FAERS | |
| 153 | Oliguria | FAERS: 6 | US FAERS | |
| 154 | Polyneuropathy | FAERS: 6 | US FAERS | |
| 155 | Renal hypertension | FAERS: 6 | US FAERS | |
| 156 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 157 | Respiratory arrest | FAERS: 6 | US FAERS | |
| 158 | Skin reaction | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 159 | jaundice | FAERS: 6 | SIDER US FAERS | |
| 160 | treatment failure | FAERS: 6 | US FAERS | |
| 161 | Abasia | FAERS: 5 | OFFSIDES US FAERS | |
| 162 | Ankle Fracture | FAERS: 5 | US FAERS | |
| 163 | Arthritis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 164 | Autoimmune hepatitis | FAERS: 5 | US FAERS | |
| 165 | Blood urine present | FAERS: 5 | US FAERS | |
| 166 | Bone pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Calcium deficiency | FAERS: 5 | US FAERS | |
| 168 | Carpal Tunnel Syndrome | FAERS: 5 | US FAERS | |
| 169 | Chest discomfort | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 170 | Cholestasis | FAERS: 5 | US FAERS | |
| 171 | Colitis | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 172 | Crying | FAERS: 5 | US FAERS | |
| 173 | Deafness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 174 | Dementia | FAERS: 5 | SIDER US FAERS | |
| 175 | Diverticulitis | FAERS: 5 | US FAERS | |
| 176 | Eye pain | FAERS: 5 | SIDER US FAERS | |
| 177 | Gastritis | FAERS: 5 Canada Vigilance: 7 | 9354197 | CTD SIDER Canada Vigilance US FAERS |
| 178 | Gastrointestinal perforation | FAERS: 5 | US FAERS | |
| 179 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 180 | Intrinsic Factor Deficiency | FAERS: 5 | US FAERS | |
| 181 | Lupus Nephritis | FAERS: 5 | US FAERS | |
| 182 | Microalbuminuria | FAERS: 5 | US FAERS | |
| 183 | Nonspecific reaction | FAERS: 5 | US FAERS | |
| 184 | Panic Disorder | FAERS: 5 | US FAERS | |
| 185 | Paranoia | FAERS: 5 | US FAERS | |
| 186 | Psoriasis | FAERS: 5 | OFFSIDES US FAERS | |
| 187 | Renal pain | FAERS: 5 | SIDER US FAERS | |
| 188 | Single functional kidney | FAERS: 5 | US FAERS | |
| 189 | Tetany | FAERS: 5 | 12160379 | CTD US FAERS |
| 190 | Tinnitus | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 191 | Ulcer | FAERS: 5 | 12353402 18639776 | CTD SIDER US FAERS |
| 192 | Wheezing | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 193 | Aphagia | FAERS: 4 | US FAERS | |
| 194 | Blood sodium increased | FAERS: 4 | US FAERS | |
| 195 | Bronchitis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 196 | Choking sensation | FAERS: 4 | US FAERS | |
| 197 | Cholelithiasis | FAERS: 4 | SIDER US FAERS | |
| 198 | Deep Vein Thrombosis | FAERS: 4 | SIDER US FAERS | |
| 199 | Delirium | FAERS: 4 | US FAERS | |
| 200 | Disorientation | FAERS: 4 | US FAERS | |
| 201 | Dysentery | FAERS: 4 | US FAERS | |
| 202 | Epilepsy | FAERS: 4 | US FAERS | |
| 203 | Epistaxis | FAERS: 4 | SIDER US FAERS | |
| 204 | Fracture | FAERS: 4 | SIDER US FAERS | |
| 205 | Gastric ulcer | FAERS: 4 | US FAERS | |
| 206 | Hepatic necrosis | FAERS: 4 | US FAERS | |
| 207 | Hyperparathyroidism | FAERS: 4 | US FAERS | |
| 208 | Hypoxia | FAERS: 4 | US FAERS | |
| 209 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 210 | Injury asphyxiation | FAERS: 4 | US FAERS | |
| 211 | Intentional product misuse | FAERS: 4 | US FAERS | |
| 212 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 213 | Leukopenia | FAERS: 4 | SIDER US FAERS | |
| 214 | Lupus-like syndrome | FAERS: 4 | US FAERS | |
| 215 | Middle insomnia | FAERS: 4 | US FAERS | |
| 216 | Neck Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 217 | Ocular Hypertension | FAERS: 4 | US FAERS | |
| 218 | Papulopustular Rosacea | FAERS: 4 | US FAERS | |
| 219 | Poor peripheral circulation | FAERS: 4 | US FAERS | |
| 220 | Product label issue | FAERS: 4 | US FAERS | |
| 221 | Rash papulosquamous | FAERS: 4 | US FAERS | |
| 222 | Renal Colic | FAERS: 4 | US FAERS | |
| 223 | Swelling | FAERS: 4 | US FAERS | |
| 224 | Toothache | FAERS: 4 | US FAERS | |
| 225 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 226 | Albuminuria | FAERS: 3 | SIDER US FAERS | |
| 227 | Angina Pectoris | FAERS: 3 | SIDER US FAERS | |
| 228 | Anuria | FAERS: 3 | US FAERS | |
| 229 | Arteriosclerosis | FAERS: 3 | US FAERS | |
| 230 | Blood alkaline phosphatase increased | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 231 | Blood gastrin increased | FAERS: 3 | SIDER US FAERS | |
| 232 | Blood glucose increased | FAERS: 3 | SIDER US FAERS | |
| 233 | Bradycardia | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 234 | Burning sensation | FAERS: 3 | US FAERS | |
| 235 | Cerebral Infarction | FAERS: 3 | SIDER US FAERS | |
| 236 | Cholecystitis | FAERS: 3 | US FAERS | |
| 237 | Chronic disease | FAERS: 3 | US FAERS | |
| 238 | Congenital cystic kidney disease | FAERS: 3 | US FAERS | |
| 239 | Device dependence | FAERS: 3 | US FAERS | |
| 240 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 241 | Dry skin | FAERS: 3 | SIDER US FAERS | |
| 242 | Duodenal Ulcer | FAERS: 3 | CTD US FAERS | |
| 243 | Ejection Fraction Decreased | FAERS: 3 | US FAERS | |
| 244 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 245 | Erythema Multiforme | FAERS: 3 | SIDER US FAERS | |
| 246 | Food Allergy | FAERS: 3 | US FAERS | |
| 247 | Gastroenteritis | FAERS: 3 | SIDER US FAERS | |
| 248 | Gastrointestinal ulcer | FAERS: 3 | US FAERS | |
| 249 | Glaucoma | FAERS: 3 | SIDER US FAERS | |
| 250 | Gout | FAERS: 3 | SIDER US FAERS | |
| 251 | Hepatic congestion | FAERS: 3 | US FAERS | |
| 252 | Hypophagia | FAERS: 3 | US FAERS | |
| 253 | Impaired quality of life | FAERS: 3 | US FAERS | |
| 254 | Joint stiffness | FAERS: 3 | US FAERS | |
| 255 | Large intestine perforation | FAERS: 3 | US FAERS | |
| 256 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 257 | Nasopharyngitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 258 | Nephritic syndrome | FAERS: 3 | US FAERS | |
| 259 | Nervousness | FAERS: 3 | SIDER US FAERS | |
| 260 | Obstructive nephropathy | FAERS: 3 | US FAERS | |
| 261 | Pancytopenia | FAERS: 3 | SIDER US FAERS | |
| 262 | Product formulation issue | FAERS: 3 | US FAERS | |
| 263 | Product use complaint | FAERS: 3 | US FAERS | |
| 264 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 265 | Pyelocaliectasis | FAERS: 3 | US FAERS | |
| 266 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 267 | Respiratory distress | FAERS: 3 | US FAERS | |
| 268 | Scab | FAERS: 3 | US FAERS | |
| 269 | Skin lesion | FAERS: 3 | SIDER US FAERS | |
| 270 | Stress | FAERS: 3 | US FAERS | |
| 271 | Therapeutic response changed | FAERS: 3 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 272 | Therapy non-responder | FAERS: 3 | OFFSIDES US FAERS | |
| 273 | Throat cancer | FAERS: 3 | US FAERS | |
| 274 | Unevaluable event | FAERS: 3 | US FAERS | |
| 275 | Ureterolithiasis | FAERS: 3 | US FAERS | |
| 276 | Urge Incontinence | FAERS: 3 | US FAERS | |
| 277 | Ventricular Fibrillation | FAERS: 3 | OFFSIDES US FAERS | |
| 278 | Ventricular hypokinesia | FAERS: 3 | US FAERS | |
| 279 | Visual disturbance | FAERS: 3 | US FAERS | |
| 280 | Acne | FAERS: 2 | US FAERS | |
| 281 | Acquired cystic kidney disease | FAERS: 2 | US FAERS | |
| 282 | Acute myocardial infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 283 | Alcohol withdrawal syndrome | FAERS: 2 | US FAERS | |
| 284 | Anaphylactoid Reaction | FAERS: 2 | SIDER US FAERS | |
| 285 | Anorexia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 286 | Apathy | FAERS: 2 | SIDER US FAERS | |
| 287 | Aphasia | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 288 | Aphonia | FAERS: 2 | US FAERS | |
| 289 | Apparent death | FAERS: 2 | US FAERS | |
| 290 | Ascites | FAERS: 2 | US FAERS | |
| 291 | Aspartate Aminotransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 292 | Bacteria stool identified | FAERS: 2 | OFFSIDES US FAERS | |
| 293 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 294 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 295 | Blood magnesium increased | FAERS: 2 | US FAERS | |
| 296 | CREST Syndrome | FAERS: 2 | US FAERS | |
| 297 | Capsule issue | FAERS: 2 | US FAERS | |
| 298 | Capsule physical issue | FAERS: 2 | US FAERS | |
| 299 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 300 | Choking | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 301 | Cholangitis | FAERS: 2 | US FAERS | |
| 302 | Cholestatic liver injury | FAERS: 2 | US FAERS | |
| 303 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 304 | Cyanosis | FAERS: 2 | US FAERS | |
| 305 | Depressed Level of Consciousness | FAERS: 2 | OFFSIDES US FAERS | |
| 306 | Disability | FAERS: 2 | US FAERS | |
| 307 | Documented hypersensitivity to administered product | FAERS: 2 | US FAERS | |
| 308 | Drooling | FAERS: 2 | US FAERS | |
| 309 | Drug effective for unapproved indication | FAERS: 2 | US FAERS | |
| 310 | Dysphonia | FAERS: 2 | SIDER US FAERS | |
| 311 | Early satiety | FAERS: 2 | US FAERS | |
| 312 | Educational problem | FAERS: 2 | US FAERS | |
| 313 | Emotional distress | FAERS: 2 | OFFSIDES US FAERS | |
| 314 | Endoscopy abnormal | FAERS: 2 | US FAERS | |
| 315 | Erectile dysfunction | FAERS: 2 | SIDER US FAERS | |
| 316 | Food Poisoning | FAERS: 2 | US FAERS | |
| 317 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 318 | Gastrectomy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 319 | Gastric pH increased | FAERS: 2 | US FAERS | |
| 320 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 321 | Gastrointestinal dysplasia | FAERS: 2 | US FAERS | |
| 322 | Henoch-Schonlein purpura nephritis | FAERS: 2 | US FAERS | |
| 323 | Hepatitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 324 | Hernia | FAERS: 2 | OFFSIDES US FAERS | |
| 325 | Hypersomnia | FAERS: 2 | US FAERS | |
| 326 | Impaired gastric emptying | FAERS: 2 | SIDER US FAERS | |
| 327 | Incontinence | FAERS: 2 | US FAERS | |
| 328 | Infantile spitting up | FAERS: 2 | US FAERS | |
| 329 | Influenza | FAERS: 2 | SIDER US FAERS | |
| 330 | Intercapillary glomerulosclerosis | FAERS: 2 | US FAERS | |
| 331 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 332 | Irritable Bowel Syndrome | FAERS: 2 | SIDER US FAERS | |
| 333 | Joint swelling | FAERS: 2 | US FAERS | |
| 334 | Laceration | FAERS: 2 | US FAERS | |
| 335 | Lactose Intolerance | FAERS: 2 | US FAERS | |
| 336 | Leukocytoclastic vasculitis | FAERS: 2 | SIDER US FAERS | |
| 337 | Limb discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 338 | Live Birth | FAERS: 2 | US FAERS | |
| 339 | Lymphocytic infiltration | FAERS: 2 | US FAERS | |
| 340 | Lymphoma | FAERS: 2 | US FAERS | |
| 341 | Magnesium Deficiency | FAERS: 2 | US FAERS | |
| 342 | Marasmus | FAERS: 2 | US FAERS | |
| 343 | Medication residue | FAERS: 2 | US FAERS | |
| 344 | Memory impairment | FAERS: 2 | SIDER US FAERS | |
| 345 | Mental impairment | FAERS: 2 | US FAERS | |
| 346 | Nerve injury | FAERS: 2 | US FAERS | |
| 347 | Nystagmus | FAERS: 2 | US FAERS | |
| 348 | Occult blood positive | FAERS: 2 | SIDER US FAERS | |
| 349 | Oral candidiasis | FAERS: 2 | SIDER US FAERS | |
| 350 | Pallor | FAERS: 2 | US FAERS | |
| 351 | Palmar erythema | FAERS: 2 | US FAERS | |
| 352 | Perforated ulcer | FAERS: 2 | US FAERS | |
| 353 | Peritonitis | FAERS: 2 | US FAERS | |
| 354 | Pneumonitis | FAERS: 2 | US FAERS | |
| 355 | Post procedural complication | FAERS: 2 | US FAERS | |
| 356 | Prerenal failure | FAERS: 2 | US FAERS | |
| 357 | Product physical issue | FAERS: 2 | US FAERS | |
| 358 | Product storage error | FAERS: 2 | US FAERS | |
| 359 | Productive Cough | FAERS: 2 | US FAERS | |
| 360 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 361 | Pyuria | FAERS: 2 | US FAERS | |
| 362 | Quadriplegia | FAERS: 2 | US FAERS | |
| 363 | Recalled product administered | FAERS: 2 | US FAERS | |
| 364 | Respiratory tract congestion | FAERS: 2 | SIDER US FAERS | |
| 365 | Restlessness | FAERS: 2 | US FAERS | |
| 366 | Retching | FAERS: 2 | SIDER US FAERS | |
| 367 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 368 | Rickets | FAERS: 2 | US FAERS | |
| 369 | Schizophrenia | FAERS: 2 | OFFSIDES US FAERS | |
| 370 | Screaming | FAERS: 2 | US FAERS | |
| 371 | Septic Shock | FAERS: 2 | US FAERS | |
| 372 | Small intestine carcinoma | FAERS: 2 | US FAERS | |
| 373 | Sneezing | FAERS: 2 | US FAERS | |
| 374 | Splenomegaly | FAERS: 2 | US FAERS | |
| 375 | Stomatitis | FAERS: 2 | SIDER US FAERS | |
| 376 | Sudden infant death syndrome | FAERS: 2 | US FAERS | |
| 377 | Surfactant protein increased | FAERS: 2 | US FAERS | |
| 378 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 379 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 380 | Uveitis | FAERS: 2 | US FAERS | |
| 381 | Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 382 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 383 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 384 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 385 | Abdominal tenderness | FAERS: 1 | SIDER US FAERS | |
| 386 | Abscess | FAERS: 1 | US FAERS | |
| 387 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 388 | Accidental overdose | FAERS: 1 | US FAERS | |
| 389 | Amyloidosis | FAERS: 1 | US FAERS | |
| 390 | Aneurysm | FAERS: 1 | US FAERS | |
| 391 | Anger | FAERS: 1 | US FAERS | |
| 392 | Angiomyolipoma | FAERS: 1 | US FAERS | |
| 393 | Anorectal discomfort | FAERS: 1 | SIDER US FAERS | |
| 394 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 395 | Appendicitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 396 | Arteriovenous fistula site complication | FAERS: 1 | US FAERS | |
| 397 | Atelectasis | FAERS: 1 | US FAERS | |
| 398 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 399 | Balanitis | FAERS: 1 | US FAERS | |
| 400 | Benign gastric polyp | FAERS: 1 | US FAERS | |
| 401 | Biopsy bile duct abnormal | FAERS: 1 | US FAERS | |
| 402 | Biopsy colon abnormal | FAERS: 1 | US FAERS | |
| 403 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 404 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 405 | Blindness | FAERS: 1 | US FAERS | |
| 406 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 407 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 408 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 409 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 410 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 411 | Blood homocysteine abnormal | FAERS: 1 | US FAERS | |
| 412 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 413 | Blood parathyroid hormone decreased | FAERS: 1 | US FAERS | |
| 414 | Blood potassium increased | FAERS: 1 | SIDER US FAERS | |
| 415 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 416 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 417 | Blood triglycerides increased | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 419 | Bone marrow depression | FAERS: 1 | OFFSIDES US FAERS | |
| 420 | Breech Presentation | FAERS: 1 | US FAERS | |
| 421 | Bruxism | FAERS: 1 | US FAERS | |
| 422 | Cachexia | FAERS: 1 | US FAERS | |
| 423 | Carcinogenicity | FAERS: 1 | US FAERS | |
| 424 | Cataract operation | FAERS: 1 | US FAERS | |
| 425 | Cell marker increased | FAERS: 1 | US FAERS | |
| 426 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 427 | Cholecystostomy | FAERS: 1 | US FAERS | |
| 428 | Chromatopsia | FAERS: 1 | US FAERS | |
| 429 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 430 | Cold sweat | FAERS: 1 | US FAERS | |
| 431 | Completed Suicide | FAERS: 1 | US FAERS | |
| 432 | Complication associated with device | FAERS: 1 | US FAERS | |
| 433 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 434 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 435 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 436 | Culture urine positive | FAERS: 1 | US FAERS | |
| 437 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 438 | Death of relative | FAERS: 1 | US FAERS | |
| 439 | Delusional disorder, persecutory type | FAERS: 1 | US FAERS | |
| 440 | Dental discomfort | FAERS: 1 | US FAERS | |
| 441 | Dependence | FAERS: 1 | US FAERS | |
| 442 | Developmental Coordination Disorder | FAERS: 1 | US FAERS | |
| 443 | Device leakage | FAERS: 1 | US FAERS | |
| 444 | Diabetic end stage renal disease | FAERS: 1 | US FAERS | |
| 445 | Dialysis related complication | FAERS: 1 | US FAERS | |
| 446 | Diplegia | FAERS: 1 | US FAERS | |
| 447 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 448 | Drug abuser | FAERS: 1 | US FAERS | |
| 449 | Drug abuse | FAERS: 1 | US FAERS | |
| 450 | Drug administration error | FAERS: 1 | US FAERS | |
| 451 | Drug chemical incompatibility | FAERS: 1 | US FAERS | |
| 452 | Drug dose omission | FAERS: 1 | US FAERS | |
| 453 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 454 | Drug effect variable | FAERS: 1 | US FAERS | |
| 455 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 456 | Dysarthria | FAERS: 1 | US FAERS | |
| 457 | Dysgraphia | FAERS: 1 | US FAERS | |
| 458 | Ear discomfort | FAERS: 1 | US FAERS | |
| 459 | Economic problem | FAERS: 1 | US FAERS | |
| 460 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 461 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 462 | Enterocolitis | FAERS: 1 | US FAERS | |
| 463 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 464 | Epiglottitis | FAERS: 1 | US FAERS | |
| 465 | Euphoric mood | FAERS: 1 | US FAERS | |
| 466 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 467 | Extra dose administered | FAERS: 1 | US FAERS | |
| 468 | Facial Pain | FAERS: 1 | US FAERS | |
| 469 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 470 | Febrile Neutropenia | FAERS: 1 | OFFSIDES US FAERS | |
| 471 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 472 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 473 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 474 | Fibrosis | FAERS: 1 | US FAERS | |
| 475 | Flight of ideas | FAERS: 1 | US FAERS | |
| 476 | Folliculitis | FAERS: 1 | SIDER US FAERS | |
| 477 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 478 | Fungal pharyngitis | FAERS: 1 | US FAERS | |
| 479 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 480 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 481 | Gastrooesophageal heterotopia | FAERS: 1 | US FAERS | |
| 482 | Genital discomfort | FAERS: 1 | US FAERS | |
| 483 | Glycosuria | FAERS: 1 | SIDER US FAERS | |
| 484 | Granulomatous liver disease | FAERS: 1 | US FAERS | |
| 485 | Hallucinations, mixed | FAERS: 1 | OFFSIDES US FAERS | |
| 486 | Head discomfort | FAERS: 1 | US FAERS | |
| 487 | Hemiplegia | FAERS: 1 | SIDER US FAERS | |
| 488 | Hepatomegaly | FAERS: 1 | SIDER US FAERS | |
| 489 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 490 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 491 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 492 | Hyperventilation | FAERS: 1 | SIDER US FAERS | |
| 493 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 494 | Hypomania | FAERS: 1 | US FAERS | |
| 495 | Hypoparathyroidism | FAERS: 1 | US FAERS | |
| 496 | Hypoplastic Left Heart Syndrome | FAERS: 1 | US FAERS | |
| 497 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 498 | Hypothyroidism | FAERS: 1 | SIDER US FAERS | |
| 499 | Ileus | FAERS: 1 | US FAERS | |
| 500 | Impaired work ability | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 501 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 502 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 503 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 504 | Infection | FAERS: 1 | SIDER US FAERS | |
| 505 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 506 | Inflammation | FAERS: 1 | SIDER US FAERS | |
| 507 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 508 | Infusion site rash | FAERS: 1 | US FAERS | |
| 509 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 510 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 511 | Intervertebral Disc Degeneration | FAERS: 1 | OFFSIDES US FAERS | |
| 512 | Intestinal gangrene | FAERS: 1 | US FAERS | |
| 513 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 514 | Iron deficiency | FAERS: 1 | US FAERS | |
| 515 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 516 | Kounis Syndrome | FAERS: 1 | US FAERS | |
| 517 | Laryngeal discomfort | FAERS: 1 | US FAERS | |
| 518 | Lichen Planus | FAERS: 1 | US FAERS | |
| 519 | Limb operation | FAERS: 1 | US FAERS | |
| 520 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 521 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 522 | Malabsorption | FAERS: 1 | US FAERS | |
| 523 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 524 | Medical device complication | FAERS: 1 | US FAERS | |
| 525 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 526 | Milk Allergy | FAERS: 1 | US FAERS | |
| 527 | Mitochondrial cytopathy | FAERS: 1 | US FAERS | |
| 528 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 529 | Multiple allergies | FAERS: 1 | US FAERS | |
| 530 | Muscle enzyme increased | FAERS: 1 | US FAERS | |
| 531 | Muscle strain | FAERS: 1 | US FAERS | |
| 532 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 533 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 534 | Musculoskeletal stiffness | FAERS: 1 | SIDER US FAERS | |
| 535 | Neuralgia | FAERS: 1 | US FAERS | |
| 536 | Neutropenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 537 | Night sweats | FAERS: 1 | US FAERS | |
| 538 | No adverse effect | FAERS: 1 | US FAERS | |
| 539 | Oculomucocutaneous syndrome | FAERS: 1 | US FAERS | |
| 540 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 541 | Oral pain | FAERS: 1 | SIDER US FAERS | |
| 542 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 543 | Oropharyngeal swelling | FAERS: 1 | OFFSIDES US FAERS | |
| 544 | Osteodystrophy | FAERS: 1 | US FAERS | |
| 545 | Osteopenia | FAERS: 1 | US FAERS | |
| 546 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 547 | Pancreatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 548 | Pelvic Pain | FAERS: 1 | SIDER US FAERS | |
| 549 | Pelvic kidney | FAERS: 1 | US FAERS | |
| 550 | Peptic Ulcer | FAERS: 1 | CTD US FAERS | |
| 551 | Periarthritis | FAERS: 1 | US FAERS | |
| 552 | Personality Change | FAERS: 1 | US FAERS | |
| 553 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 554 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 555 | Photophobia | FAERS: 1 | SIDER US FAERS | |
| 556 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 557 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 558 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 559 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 560 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 561 | Pressure of speech | FAERS: 1 | US FAERS | |
| 562 | Procedural complication | FAERS: 1 | US FAERS | |
| 563 | Procedural intestinal perforation | FAERS: 1 | US FAERS | |
| 564 | Product administration error | FAERS: 1 | US FAERS | |
| 565 | Product complaint | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 566 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 567 | Product container issue | FAERS: 1 | US FAERS | |
| 568 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 569 | Product lot number issue | FAERS: 1 | US FAERS | |
| 570 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 571 | Product prescribing error | FAERS: 1 | US FAERS | |
| 572 | Product size issue | FAERS: 1 | US FAERS | |
| 573 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 574 | Product supply issue | FAERS: 1 | US FAERS | |
| 575 | Product tampering | FAERS: 1 | US FAERS | |
| 576 | Protein total decreased | FAERS: 1 | US FAERS | |
| 577 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 578 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 579 | Purpura | FAERS: 1 | SIDER US FAERS | |
| 580 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 581 | Reaction to excipient | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 582 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 583 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 584 | Restless Legs Syndrome | FAERS: 1 | SIDER US FAERS | |
| 585 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 586 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 587 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 588 | Serum Sickness | FAERS: 1 | US FAERS | |
| 589 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 590 | Skin Erosion | FAERS: 1 | US FAERS | |
| 591 | Skin test positive | FAERS: 1 | US FAERS | |
| 592 | Sleep Talking | FAERS: 1 | US FAERS | |
| 593 | Somatic symptom disorder | FAERS: 1 | US FAERS | |
| 594 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 595 | Splenic Infarction | FAERS: 1 | US FAERS | |
| 596 | Stillbirth | FAERS: 1 | US FAERS | |
| 597 | Subacute combined cord degeneration | FAERS: 1 | US FAERS | |
| 598 | Suicide attempt | FAERS: 1 | US FAERS | |
| 599 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 600 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 601 | Therapeutic product cross-reactivity | FAERS: 1 | US FAERS | |
| 602 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 603 | Therapy change | FAERS: 1 | US FAERS | |
| 604 | Tongue discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 605 | Tongue erythema | FAERS: 1 | US FAERS | |
| 606 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 607 | Torticollis | FAERS: 1 | US FAERS | |
| 608 | Torus fracture | FAERS: 1 | US FAERS | |
| 609 | Transplant | FAERS: 1 | US FAERS | |
| 610 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 611 | Ulnar tunnel syndrome | FAERS: 1 | US FAERS | |
| 612 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 613 | Urethritis | FAERS: 1 | US FAERS | |
| 614 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 615 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 616 | Vasculitis | FAERS: 1 | US FAERS | |
| 617 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 618 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 619 | Walking aid user | FAERS: 1 | US FAERS | |
| 620 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 621 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 622 | pH urine increased | FAERS: 1 | US FAERS | |
| 623 | Abnormal bowel sounds | SIDER | ||
| 624 | Abnormal platelets | SIDER | ||
| 625 | Abnormal vision | SIDER | ||
| 626 | Acid reflux | OFFSIDES | ||
| 627 | Acute Coronary Syndrome | SIDER | ||
| 628 | Adenocarcinoma | OFFSIDES | ||
| 629 | Ageusia | SIDER | ||
| 630 | Albumin globulin ratio abnormal | SIDER | ||
| 631 | Amblyopia | SIDER | ||
| 632 | Amnesia | SIDER | ||
| 633 | Anal abscess | OFFSIDES | ||
| 634 | Anal discomfort | SIDER | ||
| 635 | Anemia, Hemolytic | 8997127 | CTD | |
| 636 | Anemia | 12507665 | CTD | |
| 637 | Arthropathy | SIDER | ||
| 638 | Arthropod bite | OFFSIDES | ||
| 639 | Aspiration Pneumonia | OFFSIDES | ||
| 640 | Avitaminosis | SIDER | ||
| 641 | Barrett Esophagus | 9042987 | CTD | |
| 642 | Basal Ganglia Diseases | 15037850 | CTD | |
| 643 | Bedridden | OFFSIDES | ||
| 644 | Biliary Colic | SIDER | ||
| 645 | Biopsy bone abnormal | OFFSIDES | ||
| 646 | Bladder pain | Canada Vigilance: 1 | Canada Vigilance | |
| 647 | Blepharitis | SIDER | ||
| 648 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 649 | Blood Glucose | OFFSIDES | ||
| 650 | Blood and lymphatic system disorders | SIDER | ||
| 651 | Blood chloride increased | OFFSIDES | ||
| 652 | Blood electrolytes decreased | SIDER | ||
| 653 | Blood glucose fluctuation | OFFSIDES | ||
| 654 | Blood lactate dehydrogenase increased | OFFSIDES SIDER | ||
| 655 | Blood sodium | OFFSIDES | ||
| 656 | Bone lesion | Canada Vigilance: 1 | Canada Vigilance | |
| 657 | Bone scan abnormal | OFFSIDES | ||
| 658 | Breast cancer recurrent | OFFSIDES | ||
| 659 | Breast tenderness | SIDER | ||
| 660 | Breathing-related sleep disorder | OFFSIDES | ||
| 661 | Bronchiectasis | OFFSIDES | ||
| 662 | Bronchopulmonary Dysplasia | OFFSIDES | ||
| 663 | Bursitis | SIDER | ||
| 664 | Carcinoma | SIDER | ||
| 665 | Cardiac Tamponade | 18615373 | CTD OFFSIDES | |
| 666 | Cardiovascular Diseases | 18378022 | CTD | |
| 667 | Catheter related complication | OFFSIDES | ||
| 668 | Cellulitis | OFFSIDES | ||
| 669 | Cerebral Thrombosis | Canada Vigilance: 1 | Canada Vigilance | |
| 670 | Chemical and Drug Induced Liver Injury | 9280798 28412091 | CTD | |
| 671 | Chronic left ventricular failure | OFFSIDES | ||
| 672 | Colon adenoma | OFFSIDES | ||
| 673 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 674 | Conjunctivitis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 675 | Cramps of lower extremities | SIDER | ||
| 676 | Creatinine increased | SIDER | ||
| 677 | Crystal urine present | SIDER | ||
| 678 | Cystic Fibrosis | 9641739 | CTD | |
| 679 | Decreased immune responsiveness | Canada Vigilance: 1 | Canada Vigilance | |
| 680 | Dental caries | OFFSIDES | ||
| 681 | Device Failure | OFFSIDES | ||
| 682 | Diabetes | OFFSIDES | ||
| 683 | Diarrhea | CTD OFFSIDES | ||
| 684 | Diastolic dysfunction | OFFSIDES | ||
| 685 | Disturbance in sexual arousal | SIDER | ||
| 686 | Drug withdrawal headache | OFFSIDES | ||
| 687 | Duodenitis | OFFSIDES SIDER | ||
| 688 | Dyschezia | SIDER | ||
| 689 | Dyspareunia | SIDER | ||
| 690 | Ear and labyrinth disorders | SIDER | ||
| 691 | Ear discharge | OFFSIDES | ||
| 692 | Edema | 11341670 12464168 29339218 | CTD | |
| 693 | Electrolytes NOS decreased | SIDER | ||
| 694 | Emotional disorder | Canada Vigilance: 2 | Canada Vigilance | |
| 695 | Enlargement abdomen | SIDER | ||
| 696 | Enteritis | 16328016 | CTD SIDER | |
| 697 | Eosinophilia-Myalgia Syndrome | 9496405 | CTD | |
| 698 | Eosinophilia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 699 | Eosinophilic Pneumonia | OFFSIDES | ||
| 700 | Epigastric discomfort | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 701 | Escherichia urinary tract infection | OFFSIDES | ||
| 702 | Esophageal Diseases | 16440542 22122999 | CTD | |
| 703 | Esophageal Stenosis | OFFSIDES | ||
| 704 | Esophagitis | CTD | ||
| 705 | Eye irritation | SIDER | ||
| 706 | Fixed eruption | SIDER | ||
| 707 | Flat affect | SIDER | ||
| 708 | Fluid overload | OFFSIDES | ||
| 709 | Foaming at mouth | Canada Vigilance: 1 | Canada Vigilance | |
| 710 | Fundic gland polyp | SIDER | ||
| 711 | Gait inability | Canada Vigilance: 1 | Canada Vigilance | |
| 712 | Gastroenteritis helicobacter | OFFSIDES | ||
| 713 | Gastrointestinal Diseases | 10353594 10692753 12729842 | CTD | |
| 714 | Gastrointestinal Hemorrhage | 9017686 9017687 | CTD | |
| 715 | Gastrointestinal candidiasis | SIDER | ||
| 716 | Gastrointestinal hypermotility | SIDER | ||
| 717 | Gastrointestinal sounds abnormal | SIDER | ||
| 718 | Genital pain | OFFSIDES | ||
| 719 | Global Amnesia | OFFSIDES | ||
| 720 | Glossitis | OFFSIDES SIDER | ||
| 721 | Goiter | OFFSIDES | ||
| 722 | Hallucinations | 9570263 | CTD | |
| 723 | Heartburn | 11419818 15468341 | CTD | |
| 724 | Heat Exhaustion | OFFSIDES | ||
| 725 | Helicobacter Infections | CTD | ||
| 726 | Hemothorax | 18615373 | CTD | |
| 727 | Hepatitis C | OFFSIDES | ||
| 728 | Hepatotoxicity | SIDER | ||
| 729 | Hoarseness | SIDER | ||
| 730 | Hostility | SIDER | ||
| 731 | Hunger | SIDER | ||
| 732 | Hydrocephalus | OFFSIDES | ||
| 733 | Hyperemia | 29339218 | CTD | |
| 734 | Hyperkeratosis | OFFSIDES | ||
| 735 | Hyperkinesia | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 736 | Hyperplasia | 12729842 | CTD | |
| 737 | Hypoglycemia | 12507665 | CTD | |
| 738 | Immunology test abnormal | OFFSIDES | ||
| 739 | Impatience | Canada Vigilance: 1 | Canada Vigilance | |
| 740 | Infestation | SIDER | ||
| 741 | Injection Site Reaction | SIDER | ||
| 742 | Injection site pain | SIDER | ||
| 743 | Intestinal Obstruction | OFFSIDES | ||
| 744 | Joint sprain | OFFSIDES SIDER | ||
| 745 | Kidney Diseases | 28412091 | CTD | |
| 746 | Lactic dehydrogenase activity increased | SIDER | ||
| 747 | Laryngeal Diseases | 16440542 | CTD | |
| 748 | Laryngeal neoplasm | SIDER | ||
| 749 | Laryngopharyngeal Reflux | 15995512 16845517 | CTD | |
| 750 | Laryngospasm | Canada Vigilance: 1 | Canada Vigilance | |
| 751 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 752 | Leukopenia neonatal | OFFSIDES | ||
| 753 | Leukorrhea | SIDER | ||
| 754 | Leydig Cell Tumor | 7589908 | CTD | |
| 755 | Lipase | OFFSIDES | ||
| 756 | Lung infection pseudomonal | OFFSIDES | ||
| 757 | Lymphadenopathy | SIDER | ||
| 758 | Lymphocyte count increased | Canada Vigilance: 1 | Canada Vigilance | |
| 759 | Malignant Hypertension | OFFSIDES | ||
| 760 | Malnutrition | SIDER | ||
| 761 | Mastectomy | OFFSIDES | ||
| 762 | Mastoiditis | OFFSIDES | ||
| 763 | Menorrhagia | SIDER | ||
| 764 | Metaplasia | SIDER | ||
| 765 | Migraine Disorders | 11994030 | CTD | |
| 766 | Multiple Myeloma | OFFSIDES | ||
| 767 | Muscle Weakness | 16758264 | CTD | |
| 768 | Myoclonus | 15037850 | CTD | |
| 769 | Myositis | SIDER | ||
| 770 | Neck stiffness | SIDER | ||
| 771 | Nephritis, Interstitial | 15004262 19204634 19682153 | CTD | |
| 772 | Nervous tension | OFFSIDES | ||
| 773 | Neuropathy | SIDER | ||
| 774 | Nodule | SIDER | ||
| 775 | Nuchal Rigidity | SIDER | ||
| 776 | Optic Neuritis | SIDER | ||
| 777 | Oropharyngeal discomfort | SIDER | ||
| 778 | Otitis Media | SIDER | ||
| 779 | Oxygen saturation abnormal | OFFSIDES | ||
| 780 | Paresthesia | 15468341 | CTD | |
| 781 | Pathological fracture | Canada Vigilance: 1 | Canada Vigilance | |
| 782 | Peptic Ulcer Hemorrhage | 11421865 | CTD | |
| 783 | Petechiae | SIDER | ||
| 784 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 785 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 786 | Postoperative Hemorrhage | 18615373 | CTD | |
| 787 | Pre-Eclampsia | OFFSIDES | ||
| 788 | Pregnancy on contraceptive | OFFSIDES | ||
| 789 | Presbyopia | OFFSIDES | ||
| 790 | Proctitis | SIDER | ||
| 791 | Proctocolitis | SIDER | ||
| 792 | Psychoses, Substance-Induced | 11841141 | CTD | |
| 793 | Pulmonary Fibrosis | SIDER | ||
| 794 | Rectal tenesmus | SIDER | ||
| 795 | Reflux gastritis | Canada Vigilance: 1 | Canada Vigilance | |
| 796 | Retinal Degeneration | SIDER | ||
| 797 | Retinopathy of Prematurity | OFFSIDES | ||
| 798 | Rheumatoid factor increased | OFFSIDES | ||
| 799 | Rhinitis | SIDER | ||
| 800 | Scotoma | SIDER | ||
| 801 | Shock | SIDER | ||
| 802 | Sinoatrial Block | OFFSIDES | ||
| 803 | Sjogren's Syndrome | OFFSIDES | ||
| 804 | Skin carcinoma | SIDER | ||
| 805 | Sluggishness | Canada Vigilance: 1 | Canada Vigilance | |
| 806 | Soft Tissue Injuries | OFFSIDES | ||
| 807 | Sore mouth | SIDER | ||
| 808 | Spinal column stenosis | OFFSIDES | ||
| 809 | Spondylitis | OFFSIDES | ||
| 810 | Steatorrhea | 9641739 | CTD | |
| 811 | Stomach Diseases | 12438555 15996031 | CTD | |
| 812 | Stridor | SIDER | ||
| 813 | Sunburn | SIDER | ||
| 814 | Superficial Thrombophlebitis | OFFSIDES | ||
| 815 | Sweating | SIDER | ||
| 816 | Synovitis | SIDER | ||
| 817 | Taste Disorders | 9317068 9398876 9570263 | CTD | |
| 818 | Temporal Arteritis | OFFSIDES | ||
| 819 | Tension Headache | Canada Vigilance: 1 | Canada Vigilance | |
| 820 | Tension | SIDER | ||
| 821 | Therapeutic product effect decreased | Canada Vigilance: 2 | Canada Vigilance | |
| 822 | Thirst | SIDER | ||
| 823 | Thrombocytosis | SIDER | ||
| 824 | Tonsillitis | SIDER | ||
| 825 | Trigeminal Neuralgia | SIDER | ||
| 826 | Ulcerative stomatitis | SIDER | ||
| 827 | Urine output increased | SIDER | ||
| 828 | Vaginal Discharge | SIDER | ||
| 829 | Vascular purpura | SIDER | ||
| 830 | Vasodilation procedure | SIDER | ||
| 831 | Vasodilation | SIDER | ||
| 832 | Wound Infection | OFFSIDES | ||
| 833 | anaphylaxis | 12464168 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.