Erlotinib Hydrochloride
(AAKJLRGGTJKAMG-UHFFFAOYSA-N)
Structure
- SMILES
- COCCOc1cc2c(ncnc2cc1OCCOC)Nc1cccc(c1)C#C
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE03
- Molecular Formula:
- C22H23N3O4
- Molecular Weight:
- 393.436
- Log P:
- 3.4781
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 74.73
- CAS Number(s):
- 183321-74-6
Synonym(s)
1.
Erlotinib Hydrochloride
2.
11C-erlotinib
3.
CP 358,774
4.
CP 358774
5.
CP-358,774
6.
CP-358774
7.
Erlotinib
8.
Erlotinib HCl
9.
N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine
10.
OSI-774
11.
Tarceva
12.
11C erlotinib
13.
358,774, CP
14.
358774, CP
15.
CP358,774
16.
CP358774
17.
HCl, Erlotinib
18.
Hydrochloride, Erlotinib
19.
OSI 774
20.
OSI774
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malignant neoplasm progression | FAERS: 443 | OFFSIDES US FAERS | |
| 2 | Malaise | FAERS: 218 | US FAERS | |
| 3 | Pneumonia | FAERS: 150 | SIDER US FAERS | |
| 4 | Asthenia | FAERS: 141 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 5 | Incorrect dose administered | FAERS: 141 | US FAERS | |
| 6 | Fatigue | FAERS: 128 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 7 | Respiratory Failure | FAERS: 118 | OFFSIDES US FAERS | |
| 8 | Nausea | FAERS: 113 | SIDER US FAERS | |
| 9 | Vomiting | FAERS: 111 | SIDER US FAERS | |
| 10 | Drug ineffective | FAERS: 95 | US FAERS | |
| 11 | Drug resistance | FAERS: 81 | US FAERS | |
| 12 | Dehydration | FAERS: 75 | OFFSIDES SIDER US FAERS | |
| 13 | Pain | FAERS: 73 | SIDER US FAERS | |
| 14 | Nasopharyngitis | FAERS: 68 | US FAERS | |
| 15 | General physical health deterioration | FAERS: 65 | US FAERS | |
| 16 | Weight decreased | FAERS: 54 | SIDER US FAERS | |
| 17 | Dry skin | FAERS: 53 | OFFSIDES SIDER US FAERS | |
| 18 | Dizziness | FAERS: 48 | SIDER US FAERS | |
| 19 | Cerebrovascular accident | FAERS: 46 | SIDER US FAERS | |
| 20 | Pruritus | FAERS: 42 | SIDER US FAERS | |
| 21 | Pulmonary Embolism | FAERS: 37 | US FAERS | |
| 22 | Abdominal Pain | FAERS: 36 | SIDER US FAERS | |
| 23 | Disease Progression | FAERS: 34 | OFFSIDES SIDER US FAERS | |
| 24 | Stomatitis | FAERS: 33 | SIDER US FAERS | |
| 25 | Acne | FAERS: 32 | OFFSIDES SIDER US FAERS | |
| 26 | Chest Pain | FAERS: 31 | SIDER US FAERS | |
| 27 | Alopecia | FAERS: 30 | OFFSIDES SIDER US FAERS | |
| 28 | Fracture | FAERS: 30 | US FAERS | |
| 29 | Infection | FAERS: 30 | SIDER US FAERS | |
| 30 | Myocardial Infarction | FAERS: 30 | SIDER US FAERS | |
| 31 | Dermatitis acneiform | FAERS: 27 | SIDER US FAERS | |
| 32 | Headache | FAERS: 27 | SIDER US FAERS | |
| 33 | Metastasis | FAERS: 27 | US FAERS | |
| 34 | Discomfort | FAERS: 26 | US FAERS | |
| 35 | Sepsis | FAERS: 24 | SIDER US FAERS | |
| 36 | Chest discomfort | FAERS: 23 | US FAERS | |
| 37 | Constipation | FAERS: 23 | SIDER US FAERS | |
| 38 | Erythema | FAERS: 23 | SIDER US FAERS | |
| 39 | Pneumothorax | FAERS: 23 | US FAERS | |
| 40 | Thrombosis | FAERS: 23 | US FAERS | |
| 41 | Skin Ulcer | FAERS: 22 | US FAERS | |
| 42 | Conjunctivitis | FAERS: 21 | SIDER US FAERS | |
| 43 | Visual Impairment | FAERS: 21 | US FAERS | |
| 44 | Aphasia | FAERS: 20 | US FAERS | |
| 45 | Blindness | FAERS: 20 | US FAERS | |
| 46 | Hypotension | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Neutropenia | FAERS: 20 | SIDER US FAERS | |
| 48 | Thrombocytopenia | FAERS: 20 | SIDER US FAERS | |
| 49 | Urinary tract infection | FAERS: 20 | US FAERS | |
| 50 | Atrial Fibrillation | FAERS: 19 | US FAERS | |
| 51 | Epistaxis | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 52 | Abasia | FAERS: 18 | US FAERS | |
| 53 | Cerebral Infarction | FAERS: 18 | US FAERS | |
| 54 | Dermatitis | FAERS: 18 | SIDER US FAERS | |
| 55 | Dyspepsia | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 56 | Intestinal Obstruction | FAERS: 18 | OFFSIDES US FAERS | |
| 57 | Pericardial effusion | FAERS: 18 | OFFSIDES US FAERS | |
| 58 | Hypophagia | FAERS: 16 | OFFSIDES US FAERS | |
| 59 | Pneumonitis | FAERS: 16 | US FAERS | |
| 60 | Acute respiratory failure | FAERS: 15 | OFFSIDES US FAERS | |
| 61 | Back Pain | FAERS: 15 | SIDER US FAERS | |
| 62 | Bone pain | FAERS: 15 | SIDER US FAERS | |
| 63 | Eye irritation | FAERS: 15 | US FAERS | |
| 64 | Inappropriate schedule of drug administration | FAERS: 15 | US FAERS | |
| 65 | Intentional product use issue | FAERS: 15 | US FAERS | |
| 66 | Leukopenia | FAERS: 15 | US FAERS | |
| 67 | Abdominal discomfort | FAERS: 13 | US FAERS | |
| 68 | Onychoclasis | FAERS: 13 | OFFSIDES US FAERS | |
| 69 | Overdose | FAERS: 13 | US FAERS | |
| 70 | Skin toxicity | FAERS: 13 | OFFSIDES US FAERS | |
| 71 | Ageusia | FAERS: 12 | US FAERS | |
| 72 | Arthralgia | FAERS: 12 | SIDER US FAERS | |
| 73 | Deep Vein Thrombosis | FAERS: 12 | SIDER US FAERS | |
| 74 | Drug dose omission | FAERS: 12 | US FAERS | |
| 75 | Metastatic Neoplasm | FAERS: 12 | US FAERS | |
| 76 | Syncope | FAERS: 12 | SIDER US FAERS | |
| 77 | Asthma | FAERS: 11 | US FAERS | |
| 78 | Cachexia | FAERS: 11 | US FAERS | |
| 79 | Cardiac Arrest | FAERS: 11 | US FAERS | |
| 80 | Hypoxia | FAERS: 11 | OFFSIDES US FAERS | |
| 81 | Lymphopenia | FAERS: 11 | US FAERS | |
| 82 | Memory impairment | FAERS: 11 | US FAERS | |
| 83 | Productive Cough | FAERS: 11 | OFFSIDES US FAERS | |
| 84 | Bedridden | FAERS: 10 | US FAERS | |
| 85 | EGFR gene mutation | FAERS: 10 | US FAERS | |
| 86 | Epilepsy | FAERS: 10 | US FAERS | |
| 87 | Performance status decreased | FAERS: 10 | US FAERS | |
| 88 | Pleuritic pain | FAERS: 10 | US FAERS | |
| 89 | Product use issue | FAERS: 10 | US FAERS | |
| 90 | Purpura | FAERS: 10 | US FAERS | |
| 91 | Radiation Pneumonitis | FAERS: 10 | US FAERS | |
| 92 | Toxicity to various agents | FAERS: 10 | US FAERS | |
| 93 | Transaminases increased | FAERS: 10 | US FAERS | |
| 94 | White blood cell count decreased | FAERS: 10 | US FAERS | |
| 95 | Acute kidney injury | FAERS: 9 | US FAERS | |
| 96 | Anxiety | FAERS: 9 | SIDER US FAERS | |
| 97 | Ascites | FAERS: 9 | US FAERS | |
| 98 | Cholelithiasis | FAERS: 9 | US FAERS | |
| 99 | Deafness | FAERS: 9 | US FAERS | |
| 100 | Embolism | FAERS: 9 | US FAERS | |
| 101 | Hydrocephalus | FAERS: 9 | US FAERS | |
| 102 | Hypersensitivity | FAERS: 9 | US FAERS | |
| 103 | Limb injury | FAERS: 9 | US FAERS | |
| 104 | Metastases to thorax | FAERS: 9 | US FAERS | |
| 105 | Motion Sickness | FAERS: 9 | US FAERS | |
| 106 | Pancreatic carcinoma | FAERS: 9 | SIDER US FAERS | |
| 107 | Septic Shock | FAERS: 9 | US FAERS | |
| 108 | Blood lactate dehydrogenase increased | FAERS: 8 | US FAERS | |
| 109 | Cholecystitis | FAERS: 8 | US FAERS | |
| 110 | Depressed Level of Consciousness | FAERS: 8 | US FAERS | |
| 111 | Eye Infection | FAERS: 8 | US FAERS | |
| 112 | Feeling abnormal | FAERS: 8 | US FAERS | |
| 113 | Growth of eyelashes | FAERS: 8 | OFFSIDES US FAERS | |
| 114 | Nephrolithiasis | FAERS: 8 | OFFSIDES US FAERS | |
| 115 | No adverse event | FAERS: 8 | US FAERS | |
| 116 | Pulmonary thrombosis | FAERS: 8 | US FAERS | |
| 117 | Respiratory distress | FAERS: 8 | US FAERS | |
| 118 | Skin reaction | FAERS: 8 | US FAERS | |
| 119 | Sudden death | FAERS: 8 | OFFSIDES US FAERS | |
| 120 | Tremor | FAERS: 8 | US FAERS | |
| 121 | Ulcer | FAERS: 8 | OFFSIDES US FAERS | |
| 122 | Aspartate Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 123 | Cataract | FAERS: 7 | US FAERS | |
| 124 | Cellulitis | FAERS: 7 | SIDER US FAERS | |
| 125 | Dysarthria | FAERS: 7 | US FAERS | |
| 126 | Febrile Neutropenia | FAERS: 7 | US FAERS | |
| 127 | Hydrothorax | FAERS: 7 | US FAERS | |
| 128 | Lymphadenopathy | FAERS: 7 | US FAERS | |
| 129 | Pulmonary Fibrosis | FAERS: 7 | SIDER US FAERS | |
| 130 | Shock | FAERS: 7 | SIDER US FAERS | |
| 131 | Somnolence | FAERS: 7 | US FAERS | |
| 132 | Swelling | FAERS: 7 | US FAERS | |
| 133 | Adenocarcinoma | FAERS: 6 | US FAERS | |
| 134 | Aphagia | FAERS: 6 | US FAERS | |
| 135 | Arthritis | FAERS: 6 | US FAERS | |
| 136 | Atelectasis | FAERS: 6 | US FAERS | |
| 137 | Blood albumin decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 138 | Blood alkaline phosphatase increased | FAERS: 6 | US FAERS | |
| 139 | Cardiac discomfort | FAERS: 6 | US FAERS | |
| 140 | Chills | FAERS: 6 | SIDER US FAERS | |
| 141 | Coronary Artery Disease | FAERS: 6 | US FAERS | |
| 142 | Dysgeusia | FAERS: 6 | OFFSIDES US FAERS | |
| 143 | Dysphonia | FAERS: 6 | US FAERS | |
| 144 | Eye pain | FAERS: 6 | OFFSIDES US FAERS | |
| 145 | Feeling Cold | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 146 | Influenza | FAERS: 6 | US FAERS | |
| 147 | Lethargy | FAERS: 6 | US FAERS | |
| 148 | Mental status changes | FAERS: 6 | OFFSIDES US FAERS | |
| 149 | Metastases to pelvis | FAERS: 6 | US FAERS | |
| 150 | Peripheral swelling | FAERS: 6 | US FAERS | |
| 151 | Rash erythematous | FAERS: 6 | US FAERS | |
| 152 | Respiratory arrest | FAERS: 6 | US FAERS | |
| 153 | Scab | FAERS: 6 | US FAERS | |
| 154 | Sputum retention | FAERS: 6 | US FAERS | |
| 155 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 156 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 157 | Adverse event | FAERS: 5 | US FAERS | |
| 158 | Amnesia | FAERS: 5 | US FAERS | |
| 159 | Asphyxia | FAERS: 5 | US FAERS | |
| 160 | Blood urine present | FAERS: 5 | OFFSIDES US FAERS | |
| 161 | Bronchitis | FAERS: 5 | US FAERS | |
| 162 | Cerebral Thrombosis | FAERS: 5 | US FAERS | |
| 163 | Colitis | FAERS: 5 | SIDER US FAERS | |
| 164 | Dementia | FAERS: 5 | US FAERS | |
| 165 | Disease recurrence | FAERS: 5 | US FAERS | |
| 166 | Eczema | FAERS: 5 | US FAERS | |
| 167 | Ileus | FAERS: 5 | SIDER US FAERS | |
| 168 | Inflammation | FAERS: 5 | SIDER US FAERS | |
| 169 | Lower respiratory tract infection | FAERS: 5 | US FAERS | |
| 170 | Malnutrition | FAERS: 5 | SIDER US FAERS | |
| 171 | Monoplegia | FAERS: 5 | US FAERS | |
| 172 | Musculoskeletal Pain | FAERS: 5 | SIDER US FAERS | |
| 173 | Myalgia | FAERS: 5 | SIDER US FAERS | |
| 174 | Neutrophil count decreased | FAERS: 5 | US FAERS | |
| 175 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 176 | Poor quality sleep | FAERS: 5 | US FAERS | |
| 177 | Retching | FAERS: 5 | US FAERS | |
| 178 | Rhinitis | FAERS: 5 | US FAERS | |
| 179 | Skin lesion | FAERS: 5 | OFFSIDES US FAERS | |
| 180 | Tachycardia | FAERS: 5 | US FAERS | |
| 181 | Tinnitus | FAERS: 5 | US FAERS | |
| 182 | Tumour haemorrhage | FAERS: 5 | US FAERS | |
| 183 | Unresponsive to stimuli | FAERS: 5 | US FAERS | |
| 184 | Urinary Incontinence | FAERS: 5 | US FAERS | |
| 185 | Urticaria | FAERS: 5 | US FAERS | |
| 186 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 187 | Alanine Aminotransferase Increased | FAERS: 4 | SIDER US FAERS | |
| 188 | Angioedema | FAERS: 4 | US FAERS | |
| 189 | Aphonia | FAERS: 4 | US FAERS | |
| 190 | Blood potassium decreased | FAERS: 4 | US FAERS | |
| 191 | Cardiac Tamponade | FAERS: 4 | US FAERS | |
| 192 | Delirium | FAERS: 4 | US FAERS | |
| 193 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 194 | Disease complication | FAERS: 4 | US FAERS | |
| 195 | Electrolyte imbalance | FAERS: 4 | US FAERS | |
| 196 | Erythema Multiforme | FAERS: 4 | SIDER US FAERS | |
| 197 | Failure to Thrive | FAERS: 4 | OFFSIDES US FAERS | |
| 198 | Flatulence | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 199 | Gastroenteritis | FAERS: 4 | US FAERS | |
| 200 | Gastrointestinal obstruction | FAERS: 4 | OFFSIDES US FAERS | |
| 201 | Gastrointestinal toxicity | FAERS: 4 | US FAERS | |
| 202 | Hepatomegaly | FAERS: 4 | US FAERS | |
| 203 | Hospice Care | FAERS: 4 | US FAERS | |
| 204 | Hypersomnia | FAERS: 4 | US FAERS | |
| 205 | Immobile | FAERS: 4 | US FAERS | |
| 206 | Intestinal Perforation | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 207 | Lip swelling | FAERS: 4 | US FAERS | |
| 208 | Macular degeneration | FAERS: 4 | US FAERS | |
| 209 | Medication Error | FAERS: 4 | US FAERS | |
| 210 | Metabolic acidosis | FAERS: 4 | US FAERS | |
| 211 | Neck Pain | FAERS: 4 | US FAERS | |
| 212 | Pain of skin | FAERS: 4 | US FAERS | |
| 213 | Palpitations | FAERS: 4 | US FAERS | |
| 214 | Pyogenic granuloma | FAERS: 4 | US FAERS | |
| 215 | Small cell lung cancer extensive stage | FAERS: 4 | US FAERS | |
| 216 | Sudden Cardiac Death | FAERS: 4 | OFFSIDES US FAERS | |
| 217 | Suspected counterfeit product | FAERS: 4 | US FAERS | |
| 218 | Trichomegaly | FAERS: 4 | US FAERS | |
| 219 | Unevaluable event | FAERS: 4 | US FAERS | |
| 220 | Venous Thrombosis | FAERS: 4 | US FAERS | |
| 221 | Viral upper respiratory tract infection | FAERS: 4 | US FAERS | |
| 222 | jaundice | FAERS: 4 | US FAERS | |
| 223 | Angina Pectoris | FAERS: 3 | US FAERS | |
| 224 | Blood count abnormal | FAERS: 3 | OFFSIDES US FAERS | |
| 225 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 226 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 227 | Carcinoembryonic antigen increased | FAERS: 3 | OFFSIDES US FAERS | |
| 228 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 229 | Cerebrovascular Insufficiency | FAERS: 3 | US FAERS | |
| 230 | Cholestasis | FAERS: 3 | US FAERS | |
| 231 | Compression fracture | FAERS: 3 | OFFSIDES US FAERS | |
| 232 | Cystitis | FAERS: 3 | US FAERS | |
| 233 | Drug toxicity | FAERS: 3 | US FAERS | |
| 234 | Dysuria | FAERS: 3 | US FAERS | |
| 235 | Eye inflammation | FAERS: 3 | OFFSIDES US FAERS | |
| 236 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 237 | Gastritis | FAERS: 3 | SIDER US FAERS | |
| 238 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 239 | Glaucoma | FAERS: 3 | US FAERS | |
| 240 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 241 | Incoherent | FAERS: 3 | US FAERS | |
| 242 | Lipase increased | FAERS: 3 | US FAERS | |
| 243 | Low birth weight baby | FAERS: 3 | US FAERS | |
| 244 | MYELODYSPLASTIC SYNDROME | FAERS: 3 | US FAERS | |
| 245 | Meningitis | FAERS: 3 | US FAERS | |
| 246 | Metastases to stomach | FAERS: 3 | US FAERS | |
| 247 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 248 | Nail Infection | FAERS: 3 | US FAERS | |
| 249 | Obstruction | FAERS: 3 | OFFSIDES US FAERS | |
| 250 | Onychalgia | FAERS: 3 | OFFSIDES US FAERS | |
| 251 | Osteoporosis | FAERS: 3 | US FAERS | |
| 252 | Pancytopenia | FAERS: 3 | US FAERS | |
| 253 | Pathological fracture | FAERS: 3 | US FAERS | |
| 254 | Periodontitis | FAERS: 3 | US FAERS | |
| 255 | Peritonitis | FAERS: 3 | US FAERS | |
| 256 | Protein total decreased | FAERS: 3 | US FAERS | |
| 257 | Pulmonary toxicity | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 258 | Radiation skin injury | FAERS: 3 | US FAERS | |
| 259 | Schizophrenia | FAERS: 3 | US FAERS | |
| 260 | Skin tightness | FAERS: 3 | US FAERS | |
| 261 | Superinfection bacterial | FAERS: 3 | US FAERS | |
| 262 | Terminal state | FAERS: 3 | US FAERS | |
| 263 | Uveitis | FAERS: 3 | SIDER US FAERS | |
| 264 | Vasculitis | FAERS: 3 | US FAERS | |
| 265 | Venous thrombosis limb | FAERS: 3 | US FAERS | |
| 266 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 267 | Wheezing | FAERS: 3 | US FAERS | |
| 268 | nervous system disorder | FAERS: 3 | SIDER US FAERS | |
| 269 | treatment failure | FAERS: 3 | OFFSIDES US FAERS | |
| 270 | Acquired gene mutation | FAERS: 2 | US FAERS | |
| 271 | Altered visual depth perception | FAERS: 2 | US FAERS | |
| 272 | Amylase increased | FAERS: 2 | US FAERS | |
| 273 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 274 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 275 | Aspartate aminotransferase abnormal | FAERS: 2 | US FAERS | |
| 276 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 277 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 278 | Blood bilirubin abnormal | FAERS: 2 | US FAERS | |
| 279 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 280 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 281 | Blood urea increased | FAERS: 2 | US FAERS | |
| 282 | Bone erosion | FAERS: 2 | US FAERS | |
| 283 | Bronchial secretion retention | FAERS: 2 | US FAERS | |
| 284 | Bronchiectasis | FAERS: 2 | US FAERS | |
| 285 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 286 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 287 | Cerebral atrophy | FAERS: 2 | OFFSIDES US FAERS | |
| 288 | Choking | FAERS: 2 | US FAERS | |
| 289 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 290 | Completed Suicide | FAERS: 2 | US FAERS | |
| 291 | Cytopenia | FAERS: 2 | US FAERS | |
| 292 | Drug administration error | FAERS: 2 | US FAERS | |
| 293 | Duodenal Ulcer | FAERS: 2 | US FAERS | |
| 294 | Duodenitis | FAERS: 2 | US FAERS | |
| 295 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 296 | Emotional disorder | FAERS: 2 | US FAERS | |
| 297 | Enteritis | FAERS: 2 | OFFSIDES US FAERS | |
| 298 | Exfoliative rash | FAERS: 2 | OFFSIDES US FAERS | |
| 299 | Eyelid irritation | FAERS: 2 | US FAERS | |
| 300 | Facial Pain | FAERS: 2 | US FAERS | |
| 301 | Flushing | FAERS: 2 | US FAERS | |
| 302 | Folliculitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 303 | Gait inability | FAERS: 2 | US FAERS | |
| 304 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 305 | Gastrointestinal perforation | FAERS: 2 | SIDER US FAERS | |
| 306 | Heat Stroke | FAERS: 2 | US FAERS | |
| 307 | Hepatitis C | FAERS: 2 | US FAERS | |
| 308 | Hepatitis | FAERS: 2 | SIDER US FAERS | |
| 309 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 310 | Hypertrichosis | FAERS: 2 | US FAERS | |
| 311 | Hypokinesia | FAERS: 2 | OFFSIDES US FAERS | |
| 312 | Increased upper airway secretion | FAERS: 2 | OFFSIDES US FAERS | |
| 313 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 314 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 315 | Jugular vein distension | FAERS: 2 | US FAERS | |
| 316 | Keratitis | FAERS: 2 | SIDER US FAERS | |
| 317 | Keratopathy | FAERS: 2 | US FAERS | |
| 318 | Liver Abscess | FAERS: 2 | US FAERS | |
| 319 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 320 | Lung Abscess | FAERS: 2 | US FAERS | |
| 321 | Lung cyst | FAERS: 2 | US FAERS | |
| 322 | Lymphocyte count increased | FAERS: 2 | US FAERS | |
| 323 | Macule | FAERS: 2 | US FAERS | |
| 324 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 325 | Mediastinal mass | FAERS: 2 | US FAERS | |
| 326 | Medical device complication | FAERS: 2 | US FAERS | |
| 327 | Metrorrhagia | FAERS: 2 | US FAERS | |
| 328 | Myringitis | FAERS: 2 | US FAERS | |
| 329 | Nail bed infection | FAERS: 2 | US FAERS | |
| 330 | Nasal pruritus | FAERS: 2 | US FAERS | |
| 331 | Necrosis | FAERS: 2 | US FAERS | |
| 332 | Nodule | FAERS: 2 | US FAERS | |
| 333 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 334 | Oral mucosal eruption | FAERS: 2 | US FAERS | |
| 335 | Oral pain | FAERS: 2 | US FAERS | |
| 336 | Pallor | FAERS: 2 | US FAERS | |
| 337 | Pancreatitis | FAERS: 2 | SIDER US FAERS | |
| 338 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 339 | Pericarditis | FAERS: 2 | US FAERS | |
| 340 | Phlebitis | FAERS: 2 | US FAERS | |
| 341 | Photophobia | FAERS: 2 | US FAERS | |
| 342 | Physical disability | FAERS: 2 | US FAERS | |
| 343 | Presyncope | FAERS: 2 | US FAERS | |
| 344 | Primary Biliary Cholangitis | FAERS: 2 | US FAERS | |
| 345 | Proteinuria | FAERS: 2 | SIDER US FAERS | |
| 346 | Pulmonary congestion | FAERS: 2 | OFFSIDES US FAERS | |
| 347 | Pulmonary hilar enlargement | FAERS: 2 | US FAERS | |
| 348 | Pulmonary pain | FAERS: 2 | US FAERS | |
| 349 | Punctate keratitis | FAERS: 2 | US FAERS | |
| 350 | Respiratory tract congestion | FAERS: 2 | US FAERS | |
| 351 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 352 | Retinal Degeneration | FAERS: 2 | US FAERS | |
| 353 | Retroperitoneal lymphadenopathy | FAERS: 2 | US FAERS | |
| 354 | Sciatica | FAERS: 2 | US FAERS | |
| 355 | Sinus headache | FAERS: 2 | OFFSIDES US FAERS | |
| 356 | Skin irritation | FAERS: 2 | US FAERS | |
| 357 | Soft Tissue Infection | FAERS: 2 | US FAERS | |
| 358 | Stress | FAERS: 2 | US FAERS | |
| 359 | Subileus | FAERS: 2 | US FAERS | |
| 360 | Sunburn | FAERS: 2 | US FAERS | |
| 361 | Superinfection | FAERS: 2 | US FAERS | |
| 362 | Therapeutic product ineffective | FAERS: 2 | US FAERS | |
| 363 | Therapy cessation | FAERS: 2 | US FAERS | |
| 364 | Therapy responder | FAERS: 2 | US FAERS | |
| 365 | Trichiasis | FAERS: 2 | US FAERS | |
| 366 | Urinary tract inflammation | FAERS: 2 | US FAERS | |
| 367 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 368 | Vertigo | FAERS: 2 | US FAERS | |
| 369 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 370 | effusion | FAERS: 2 | US FAERS | |
| 371 | Abdominal adhesions | FAERS: 1 | OFFSIDES US FAERS | |
| 372 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 373 | Accidental overdose | FAERS: 1 | US FAERS | |
| 374 | Acquired Immunodeficiency Syndrome | FAERS: 1 | US FAERS | |
| 375 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 376 | Adrenal mass | FAERS: 1 | US FAERS | |
| 377 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 378 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 379 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 380 | Alveolitis | FAERS: 1 | US FAERS | |
| 381 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 382 | Anastomotic Leak | FAERS: 1 | US FAERS | |
| 383 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 384 | Anorexia | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 385 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 1 | US FAERS | |
| 386 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 387 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 388 | Apathy | FAERS: 1 | US FAERS | |
| 389 | Apparent death | FAERS: 1 | US FAERS | |
| 390 | Appendicitis | FAERS: 1 | US FAERS | |
| 391 | Arthropod bite | FAERS: 1 | US FAERS | |
| 392 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 393 | Blepharitis | FAERS: 1 | OFFSIDES US FAERS | |
| 394 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 395 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 396 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 397 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 398 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 399 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 400 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 401 | Blood thyroid stimulating hormone increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 402 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 403 | Bone contusion | FAERS: 1 | US FAERS | |
| 404 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 405 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 406 | Brain scan abnormal | FAERS: 1 | US FAERS | |
| 407 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 408 | Bronchospasm | FAERS: 1 | US FAERS | |
| 409 | Butterfly rash | FAERS: 1 | US FAERS | |
| 410 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 411 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 412 | Campylobacter infection | FAERS: 1 | US FAERS | |
| 413 | Candidiasis | FAERS: 1 | US FAERS | |
| 414 | Cardiac infection | FAERS: 1 | US FAERS | |
| 415 | Cardiac neoplasm unspecified | FAERS: 1 | US FAERS | |
| 416 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 417 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 418 | Cataract operation | FAERS: 1 | US FAERS | |
| 419 | Catheter site infection | FAERS: 1 | US FAERS | |
| 420 | Cell Death | FAERS: 1 | US FAERS | |
| 421 | Change in sustained attention | FAERS: 1 | US FAERS | |
| 422 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 423 | Choroiditis | FAERS: 1 | US FAERS | |
| 424 | Clumsiness | FAERS: 1 | US FAERS | |
| 425 | Conjunctival ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 426 | Corneal epithelium defect | FAERS: 1 | US FAERS | |
| 427 | Cyst | FAERS: 1 | US FAERS | |
| 428 | Depressed mood | FAERS: 1 | US FAERS | |
| 429 | Diffuse alopecia | FAERS: 1 | US FAERS | |
| 430 | Disorientation | FAERS: 1 | US FAERS | |
| 431 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 432 | Drowning | FAERS: 1 | US FAERS | |
| 433 | Drug abuse | FAERS: 1 | US FAERS | |
| 434 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 435 | Dysgraphia | FAERS: 1 | US FAERS | |
| 436 | EGFR status assay | FAERS: 1 | US FAERS | |
| 437 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 438 | Ectropion | FAERS: 1 | US FAERS | |
| 439 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 440 | Enterococcus test positive | FAERS: 1 | US FAERS | |
| 441 | Entropion | FAERS: 1 | US FAERS | |
| 442 | Enuresis | FAERS: 1 | US FAERS | |
| 443 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 444 | Eosinophilia | FAERS: 1 | US FAERS | |
| 445 | Ependymoma | FAERS: 1 | US FAERS | |
| 446 | Episcleritis | FAERS: 1 | US FAERS | |
| 447 | Eructation | FAERS: 1 | US FAERS | |
| 448 | Erysipelas | FAERS: 1 | US FAERS | |
| 449 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 450 | Euthanasia | FAERS: 1 | US FAERS | |
| 451 | Exsanguination | FAERS: 1 | US FAERS | |
| 452 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 453 | Facial paralysis | FAERS: 1 | US FAERS | |
| 454 | Feeding tube user | FAERS: 1 | US FAERS | |
| 455 | Flank Pain | FAERS: 1 | US FAERS | |
| 456 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 457 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 458 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 459 | Gastric ileus | FAERS: 1 | US FAERS | |
| 460 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 461 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 462 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 463 | Gastrooesophageal cancer | FAERS: 1 | US FAERS | |
| 464 | Gene mutation identification test positive | FAERS: 1 | US FAERS | |
| 465 | General symptom | FAERS: 1 | US FAERS | |
| 466 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 467 | Genital erythema | FAERS: 1 | US FAERS | |
| 468 | Genital infection | FAERS: 1 | US FAERS | |
| 469 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 470 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 471 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 472 | Hemiparesis | FAERS: 1 | US FAERS | |
| 473 | Hemiplegia | FAERS: 1 | US FAERS | |
| 474 | Hepatic Vein Thrombosis | FAERS: 1 | US FAERS | |
| 475 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 476 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 477 | Hepatotoxicity | FAERS: 1 | SIDER US FAERS | |
| 478 | Hernia | FAERS: 1 | US FAERS | |
| 479 | Hilar lymphadenopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 480 | Hip surgery | FAERS: 1 | US FAERS | |
| 481 | Hyperventilation | FAERS: 1 | US FAERS | |
| 482 | Hypogeusia | FAERS: 1 | OFFSIDES US FAERS | |
| 483 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 484 | Hypoventilation | FAERS: 1 | US FAERS | |
| 485 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 486 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 487 | Impaired work ability | FAERS: 1 | US FAERS | |
| 488 | Incarcerated hernia | FAERS: 1 | US FAERS | |
| 489 | Incision site infection | FAERS: 1 | US FAERS | |
| 490 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 491 | Infected neoplasm | FAERS: 1 | US FAERS | |
| 492 | Intercostal neuralgia | FAERS: 1 | US FAERS | |
| 493 | Intestinal mucosal atrophy | FAERS: 1 | US FAERS | |
| 494 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 495 | Intussusception | FAERS: 1 | US FAERS | |
| 496 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 497 | Iris incarceration | FAERS: 1 | US FAERS | |
| 498 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 499 | Joint injury | FAERS: 1 | US FAERS | |
| 500 | Joint swelling | FAERS: 1 | US FAERS | |
| 501 | Keratorhexis | FAERS: 1 | US FAERS | |
| 502 | Klebsiella sepsis | FAERS: 1 | US FAERS | |
| 503 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 504 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 505 | Laceration | FAERS: 1 | US FAERS | |
| 506 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 507 | Leukocytosis | FAERS: 1 | US FAERS | |
| 508 | Lyme Disease | FAERS: 1 | US FAERS | |
| 509 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 510 | Lymphangioma | FAERS: 1 | US FAERS | |
| 511 | Lymphangiosis carcinomatosa | FAERS: 1 | OFFSIDES US FAERS | |
| 512 | Lymphangitis | FAERS: 1 | US FAERS | |
| 513 | Lymphocyte count decreased | FAERS: 1 | US FAERS | |
| 514 | Lymphoma | FAERS: 1 | US FAERS | |
| 515 | Malabsorption | FAERS: 1 | US FAERS | |
| 516 | Measles | FAERS: 1 | US FAERS | |
| 517 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 518 | Mental impairment | FAERS: 1 | US FAERS | |
| 519 | Metastases to gallbladder | FAERS: 1 | US FAERS | |
| 520 | Metastases to mouth | FAERS: 1 | US FAERS | |
| 521 | Metastases to muscle | FAERS: 1 | US FAERS | |
| 522 | Metastases to salivary gland | FAERS: 1 | US FAERS | |
| 523 | Miliaria | FAERS: 1 | US FAERS | |
| 524 | Multimorbidity | FAERS: 1 | US FAERS | |
| 525 | Muscle strain | FAERS: 1 | OFFSIDES US FAERS | |
| 526 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 527 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 528 | Myelitis | FAERS: 1 | US FAERS | |
| 529 | Myelodysplastic syndrome transformation | FAERS: 1 | US FAERS | |
| 530 | Myopia | FAERS: 1 | US FAERS | |
| 531 | Nasal discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 532 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 533 | Nasal mucosal erosion | FAERS: 1 | US FAERS | |
| 534 | Nephritis | FAERS: 1 | SIDER US FAERS | |
| 535 | Nerve injury | FAERS: 1 | US FAERS | |
| 536 | Neuralgia | FAERS: 1 | US FAERS | |
| 537 | Nocturia | FAERS: 1 | US FAERS | |
| 538 | Non-small cell lung cancer recurrent | FAERS: 1 | US FAERS | |
| 539 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 540 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 541 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 542 | Oncologic complication | FAERS: 1 | US FAERS | |
| 543 | Onychomycosis | FAERS: 1 | US FAERS | |
| 544 | Open globe injury | FAERS: 1 | US FAERS | |
| 545 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 546 | Oral toxicity | FAERS: 1 | US FAERS | |
| 547 | Oropharyngitis fungal | FAERS: 1 | US FAERS | |
| 548 | Osteitis | FAERS: 1 | US FAERS | |
| 549 | Osteolysis | FAERS: 1 | US FAERS | |
| 550 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 551 | Osteoradionecrosis | FAERS: 1 | US FAERS | |
| 552 | Ototoxicity | FAERS: 1 | US FAERS | |
| 553 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 554 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 555 | Paraplegia | FAERS: 1 | US FAERS | |
| 556 | Parapsoriasis | FAERS: 1 | US FAERS | |
| 557 | Paresis | FAERS: 1 | US FAERS | |
| 558 | Peptic Ulcer | FAERS: 1 | SIDER US FAERS | |
| 559 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 560 | Periarthritis | FAERS: 1 | US FAERS | |
| 561 | Peripheral paralysis | FAERS: 1 | US FAERS | |
| 562 | Pharyngitis | FAERS: 1 | US FAERS | |
| 563 | Physical assault | FAERS: 1 | US FAERS | |
| 564 | Physical product label issue | FAERS: 1 | US FAERS | |
| 565 | Pleurisy | FAERS: 1 | US FAERS | |
| 566 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 567 | Pneumoconiosis | FAERS: 1 | US FAERS | |
| 568 | Pneumocystis jiroveci pneumonia | FAERS: 1 | OFFSIDES US FAERS | |
| 569 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 570 | Polyuria | FAERS: 1 | US FAERS | |
| 571 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 572 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 573 | Post procedural complication | FAERS: 1 | US FAERS | |
| 574 | Post procedural pneumonia | FAERS: 1 | US FAERS | |
| 575 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 576 | Postoperative abscess | FAERS: 1 | US FAERS | |
| 577 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 578 | Procedural complication | FAERS: 1 | US FAERS | |
| 579 | Product counterfeit | FAERS: 1 | US FAERS | |
| 580 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 581 | Prostatic Adenoma | FAERS: 1 | US FAERS | |
| 582 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 583 | Psoriasis | FAERS: 1 | US FAERS | |
| 584 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 585 | Purulence | FAERS: 1 | US FAERS | |
| 586 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 587 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 588 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 589 | Radiation necrosis | FAERS: 1 | US FAERS | |
| 590 | Radiation sickness syndrome | FAERS: 1 | US FAERS | |
| 591 | Rales | FAERS: 1 | US FAERS | |
| 592 | Refractory cancer | FAERS: 1 | US FAERS | |
| 593 | Renal cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 594 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 595 | Senile dementia | FAERS: 1 | US FAERS | |
| 596 | Sensitive skin | FAERS: 1 | US FAERS | |
| 597 | Sinusitis | FAERS: 1 | US FAERS | |
| 598 | Skin necrosis | FAERS: 1 | US FAERS | |
| 599 | Spinal column injury | FAERS: 1 | US FAERS | |
| 600 | Sputum culture positive | FAERS: 1 | US FAERS | |
| 601 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 602 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 603 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 604 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 605 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 606 | Thermal burn | FAERS: 1 | US FAERS | |
| 607 | Throat irritation | FAERS: 1 | US FAERS | |
| 608 | Thrombocytosis | FAERS: 1 | US FAERS | |
| 609 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 610 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 611 | Tobacco user | FAERS: 1 | US FAERS | |
| 612 | Tongue blistering | FAERS: 1 | US FAERS | |
| 613 | Toothache | FAERS: 1 | US FAERS | |
| 614 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 615 | Tracheitis | FAERS: 1 | US FAERS | |
| 616 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 617 | Tuberculosis | FAERS: 1 | US FAERS | |
| 618 | Unable to afford prescribed medication | FAERS: 1 | US FAERS | |
| 619 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 620 | Urinary Retention | FAERS: 1 | US FAERS | |
| 621 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 622 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 623 | Vascular purpura | FAERS: 1 | US FAERS | |
| 624 | Vascular rupture | FAERS: 1 | US FAERS | |
| 625 | Vascular stenosis | FAERS: 1 | US FAERS | |
| 626 | Vitreous opacities | FAERS: 1 | US FAERS | |
| 627 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 628 | Vulvitis | FAERS: 1 | US FAERS | |
| 629 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 630 | Xerosis | FAERS: 1 | OFFSIDES US FAERS | |
| 631 | muscle injury | FAERS: 1 | US FAERS | |
| 632 | Abdominal sepsis | OFFSIDES | ||
| 633 | Acute Coronary Syndrome | SIDER | ||
| 634 | Agraphia | OFFSIDES | ||
| 635 | Alcohol withdrawal syndrome | OFFSIDES | ||
| 636 | Androgenetic Alopecia | OFFSIDES | ||
| 637 | Angiogram abnormal | OFFSIDES | ||
| 638 | Anticonvulsant drug level increased | OFFSIDES | ||
| 639 | Band neutrophil count increased | OFFSIDES | ||
| 640 | Biliary dilatation | OFFSIDES | ||
| 641 | Blood albumin abnormal | OFFSIDES | ||
| 642 | Blood albumin | OFFSIDES | ||
| 643 | Blood bilirubin unconjugated increased | OFFSIDES | ||
| 644 | Blood electrolytes abnormal | OFFSIDES | ||
| 645 | Blood phosphorus | OFFSIDES | ||
| 646 | Blood urea abnormal | OFFSIDES | ||
| 647 | Blurred vision | OFFSIDES | ||
| 648 | Bowel movement irregularity | OFFSIDES | ||
| 649 | Breast Cyst | OFFSIDES | ||
| 650 | Cardiac valve vegetation | OFFSIDES | ||
| 651 | Catheter site erythema | OFFSIDES | ||
| 652 | Catheter site phlebitis | OFFSIDES | ||
| 653 | Cell marker increased | OFFSIDES | ||
| 654 | Cheilitis | OFFSIDES | ||
| 655 | Choking sensation | OFFSIDES | ||
| 656 | Congenital hypertrichosis | OFFSIDES | ||
| 657 | Conjunctival deposit | OFFSIDES | ||
| 658 | Corneal Perforation | OFFSIDES SIDER | ||
| 659 | Corneal Ulcer | OFFSIDES | ||
| 660 | Corneal abscess | OFFSIDES | ||
| 661 | Diarrhea | OFFSIDES | ||
| 662 | Diverticulum | OFFSIDES | ||
| 663 | Drug therapy changed | OFFSIDES | ||
| 664 | Economic problem | OFFSIDES | ||
| 665 | Ejection Fraction Decreased | OFFSIDES | ||
| 666 | Embolic stroke | OFFSIDES | ||
| 667 | Empyema | OFFSIDES | ||
| 668 | Encephalomalacia | OFFSIDES | ||
| 669 | Enterovesical Fistula | OFFSIDES | ||
| 670 | Erosive gastritis | OFFSIDES | ||
| 671 | Eyelid pain | OFFSIDES | ||
| 672 | Feeding tube complication | OFFSIDES | ||
| 673 | Gastrointestinal inflammation | OFFSIDES | ||
| 674 | Gastrointestinal mucosal exfoliation | OFFSIDES | ||
| 675 | Gastrointestinal sounds abnormal | OFFSIDES | ||
| 676 | Gliosis | OFFSIDES | ||
| 677 | Granulocytosis | OFFSIDES | ||
| 678 | Heat Exhaustion | OFFSIDES | ||
| 679 | Hepatic cancer metastatic | SIDER | ||
| 680 | Hepatic impairment | SIDER | ||
| 681 | Hepatorenal Syndrome | SIDER | ||
| 682 | Hiccough | OFFSIDES | ||
| 683 | Hirsutism | SIDER | ||
| 684 | Hydropneumothorax | OFFSIDES | ||
| 685 | Hyperkinetic Heart Syndrome | OFFSIDES | ||
| 686 | Hyperpigmentation | OFFSIDES | ||
| 687 | Hyperreflexia | OFFSIDES | ||
| 688 | Infestation | OFFSIDES SIDER | ||
| 689 | Insulin Resistance | OFFSIDES | ||
| 690 | Intracranial Hypotension | OFFSIDES | ||
| 691 | Intraocular inflammation | OFFSIDES | ||
| 692 | Iridocyclitis | OFFSIDES | ||
| 693 | Iritis | OFFSIDES | ||
| 694 | Keratitis sicca | OFFSIDES | ||
| 695 | Keratoconjunctivitis Sicca | SIDER | ||
| 696 | Lung Injury | OFFSIDES | ||
| 697 | Lung consolidation | OFFSIDES | ||
| 698 | Malignant Hypertension | OFFSIDES | ||
| 699 | Mediastinitis | OFFSIDES | ||
| 700 | Myoclonic Epilepsy | OFFSIDES | ||
| 701 | Myopathy | SIDER | ||
| 702 | Nail bed tenderness | OFFSIDES | ||
| 703 | Nail changes | SIDER | ||
| 704 | Neuropathy | SIDER | ||
| 705 | Ocular Toxicity | OFFSIDES | ||
| 706 | Oculomucocutaneous syndrome | OFFSIDES | ||
| 707 | Ovarian adhesion | OFFSIDES | ||
| 708 | Papulopustular Rash | SIDER | ||
| 709 | Paroxysmal arrhythmia | OFFSIDES | ||
| 710 | Pertussis | OFFSIDES | ||
| 711 | Prealbumin decreased | OFFSIDES | ||
| 712 | Protein urine present | SIDER | ||
| 713 | Pseudomonal sepsis | OFFSIDES | ||
| 714 | Psychotic disorder due to a general medical condition | OFFSIDES | ||
| 715 | Radiation retinopathy | OFFSIDES | ||
| 716 | Renal Colic | OFFSIDES | ||
| 717 | Retinitis | OFFSIDES | ||
| 718 | Rhabdomyolysis | SIDER | ||
| 719 | Rheumatoid factor increased | OFFSIDES | ||
| 720 | Rhinorrhea | OFFSIDES | ||
| 721 | Rosacea | SIDER | ||
| 722 | Spinal haemangioma | OFFSIDES | ||
| 723 | Stevens-Johnson Syndrome | SIDER | ||
| 724 | Toxic Epidermal Necrolysis | SIDER | ||
| 725 | Tri-iodothyronine free decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 726 | Trichorrhexis | OFFSIDES | ||
| 727 | Umbilical hernia | OFFSIDES | ||
| 728 | Urobilin urine present | OFFSIDES | ||
| 729 | Vascular encephalopathy | OFFSIDES | ||
| 730 | Ventricular hypokinesia | OFFSIDES | ||
| 731 | Viral tracheitis | OFFSIDES | ||
| 732 | Vital functions abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 733 | Vitreous Detachment | OFFSIDES | ||
| 734 | Wound Complication | OFFSIDES | ||
| 735 | Wound evisceration | OFFSIDES | ||
| 736 | furuncle | OFFSIDES | ||
| 737 | prostatitis | OFFSIDES | ||
| 738 | pustule | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.