Triamcinolone Acetonide
(YNDXUCZADRHECN-JNQJZLCISA-N)
Structure
- SMILES
- OCC(=O)[C@@]12OC(O[C@@H]1C[C@@H]1[C@]2(C)C[C@H](O)[C@]2([C@H]1CCC1=CC(=O)C=C[C@]21C)F)(C)C
- Molecular Formula:
- C24H31FO6
- Molecular Weight:
- 434.498
- Log P:
- 2.4188
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 93.06
- CAS Number(s):
- 76-25-5
Synonym(s)
1.
Triamcinolone Acetonide
2.
Azmacort
3.
Cinonide
4.
Kenacort A
5.
Kenalog
6.
Kenalog 40
7.
Tricort-40
8.
Acetonide, Triamcinolone
9.
Tricort 40
10.
Tricort40
External Link(s)
| MeSH | D014222 |
| PubChem Compound | 6436 |
| BindingDB | 50248362 |
| ChEBI | 71418 |
| CHEMBL | CHEMBL1504 |
| DrugCentral | 2726 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 2867 |
| KEGG | cpd:C08183 dr:D00983 |
| ZINC | 3875481 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 252 Canada Vigilance: 18 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Injection site atrophy | FAERS: 189 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Product use issue | FAERS: 123 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Injection Site Reaction | FAERS: 122 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Endophthalmitis | FAERS: 118 | US FAERS | |
| 6 | Injection site pain | FAERS: 103 | US FAERS | |
| 7 | Pain | FAERS: 92 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 8 | Product use in unapproved indication | FAERS: 90 | US FAERS | |
| 9 | Headache | FAERS: 81 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 10 | Product storage error | FAERS: 81 | US FAERS | |
| 11 | Incorrect product storage | FAERS: 78 | US FAERS | |
| 12 | Dizziness | FAERS: 77 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 13 | Hypersensitivity | FAERS: 64 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Pruritus | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Anxiety | FAERS: 59 | OFFSIDES US FAERS | |
| 16 | Arthralgia | FAERS: 57 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Eye inflammation | FAERS: 46 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 18 | Nausea | FAERS: 45 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 19 | Incorrect route of drug administration | FAERS: 44 | US FAERS | |
| 20 | Erythema | FAERS: 42 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 21 | Visual Impairment | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Fatigue | FAERS: 39 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 23 | Product quality issue | FAERS: 39 | US FAERS | |
| 24 | Adverse event | FAERS: 38 | US FAERS | |
| 25 | Blindness | FAERS: 38 | US FAERS | |
| 26 | Asthenia | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 27 | Palpitations | FAERS: 36 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 28 | Expired product administered | FAERS: 35 | US FAERS | |
| 29 | Flushing | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Weight decreased | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Burning sensation | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 32 | Retinal Artery Occlusion | FAERS: 33 | US FAERS | |
| 33 | Blood glucose increased | FAERS: 32 | US FAERS | |
| 34 | Drug administration error | FAERS: 32 | US FAERS | |
| 35 | Retinal Detachment | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Malaise | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Urticaria | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 38 | Cataract | FAERS: 29 | OFFSIDES US FAERS | |
| 39 | Menorrhagia | FAERS: 28 | US FAERS | |
| 40 | Back Pain | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Infection | FAERS: 26 | US FAERS | |
| 42 | Medication Error | FAERS: 25 | US FAERS | |
| 43 | Swelling | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Vomiting | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Intentional product use issue | FAERS: 24 | US FAERS | |
| 46 | Non-infectious endophthalmitis | FAERS: 24 | US FAERS | |
| 47 | Product contamination | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Glaucoma | FAERS: 23 | 20172078 | CTD US FAERS |
| 49 | Epistaxis | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 50 | Alopecia | FAERS: 21 | US FAERS | |
| 51 | Circumstance or information capable of leading to medication error | FAERS: 21 | OFFSIDES US FAERS | |
| 52 | Eye Infection | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Feeling abnormal | FAERS: 20 | OFFSIDES US FAERS | |
| 54 | Lipoatrophy | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Mood swings | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Tremor | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Cytomegalovirus chorioretinitis | FAERS: 18 | US FAERS | |
| 58 | Joint swelling | FAERS: 17 | US FAERS | |
| 59 | Application site pain | FAERS: 16 | US FAERS | |
| 60 | Inflammation | FAERS: 16 | US FAERS | |
| 61 | Musculoskeletal Pain | FAERS: 16 | OFFSIDES US FAERS | |
| 62 | Ocular Hypertension | FAERS: 16 | 20172078 | CTD US FAERS |
| 63 | Chest Pain | FAERS: 15 | OFFSIDES US FAERS | |
| 64 | Eye pain | FAERS: 15 | US FAERS | |
| 65 | Injection site scar | FAERS: 15 | US FAERS | |
| 66 | Myalgia | FAERS: 15 | US FAERS | |
| 67 | Overdose | FAERS: 15 | US FAERS | |
| 68 | Retinal pigment epithelial tear | FAERS: 15 | US FAERS | |
| 69 | Transmission of an infectious agent via a medicinal product | FAERS: 15 | US FAERS | |
| 70 | Agitation | FAERS: 14 | US FAERS | |
| 71 | Arthropathy | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 72 | Nasopharyngitis | FAERS: 14 | US FAERS | |
| 73 | Neck Pain | FAERS: 14 | US FAERS | |
| 74 | Asthma | FAERS: 13 | 10071519 10806605 | CTD OFFSIDES US FAERS |
| 75 | Injection site inflammation | FAERS: 13 | US FAERS | |
| 76 | Night sweats | FAERS: 13 | US FAERS | |
| 77 | Post procedural complication | FAERS: 12 | US FAERS | |
| 78 | Tinnitus | FAERS: 12 | OFFSIDES US FAERS | |
| 79 | Chest discomfort | FAERS: 11 | US FAERS | |
| 80 | Deformity | FAERS: 11 | US FAERS | |
| 81 | Injection site bruising | FAERS: 11 | US FAERS | |
| 82 | Syncope | FAERS: 11 | US FAERS | |
| 83 | Throat irritation | FAERS: 11 | US FAERS | |
| 84 | Unevaluable event | FAERS: 11 | US FAERS | |
| 85 | Accidental exposure to product | FAERS: 10 | US FAERS | |
| 86 | Diplopia | FAERS: 10 | US FAERS | |
| 87 | Hypopyon | FAERS: 10 | US FAERS | |
| 88 | Injection site infection | FAERS: 10 | US FAERS | |
| 89 | Injection site necrosis | FAERS: 10 | US FAERS | |
| 90 | Sciatica | FAERS: 10 | US FAERS | |
| 91 | Vertigo | FAERS: 10 | US FAERS | |
| 92 | Vitreous opacities | FAERS: 10 | US FAERS | |
| 93 | Abdominal Pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 94 | Abscess | FAERS: 9 | OFFSIDES US FAERS | |
| 95 | Intestinal Perforation | FAERS: 9 | US FAERS | |
| 96 | Musculoskeletal stiffness | FAERS: 9 | OFFSIDES US FAERS | |
| 97 | Oropharyngeal pain | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 98 | Pharmaceutical product complaint | FAERS: 9 | US FAERS | |
| 99 | Retinal artery embolism | FAERS: 9 | US FAERS | |
| 100 | Acne | FAERS: 8 | OFFSIDES US FAERS | |
| 101 | Ageusia | FAERS: 8 | OFFSIDES US FAERS | |
| 102 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 103 | Drug dose omission | FAERS: 8 | US FAERS | |
| 104 | Facial Pain | FAERS: 8 | US FAERS | |
| 105 | Hypotension | FAERS: 8 | US FAERS | |
| 106 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 107 | Infective scleritis | FAERS: 8 | US FAERS | |
| 108 | Metrorrhagia | FAERS: 8 | US FAERS | |
| 109 | Product packaging issue | FAERS: 8 | US FAERS | |
| 110 | Sinusitis | FAERS: 8 | OFFSIDES US FAERS | |
| 111 | Wrong technique in product usage process | FAERS: 8 | US FAERS | |
| 112 | treatment failure | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Abdominal discomfort | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 114 | Anosmia | FAERS: 7 | US FAERS | |
| 115 | Calcinosis | FAERS: 7 | US FAERS | |
| 116 | Dry skin | FAERS: 7 | OFFSIDES US FAERS | |
| 117 | Dysgeusia | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 118 | Embolism | FAERS: 7 | OFFSIDES US FAERS | |
| 119 | Incorrect dose administered | FAERS: 7 | OFFSIDES US FAERS | |
| 120 | Injection site erythema | FAERS: 7 | US FAERS | |
| 121 | Maternal exposure during pregnancy | FAERS: 7 | US FAERS | |
| 122 | No adverse event | FAERS: 7 | US FAERS | |
| 123 | Restlessness | FAERS: 7 | US FAERS | |
| 124 | Sepsis | FAERS: 7 | US FAERS | |
| 125 | Skin Induration | FAERS: 7 | US FAERS | |
| 126 | Skin Ulcer | FAERS: 7 | US FAERS | |
| 127 | Tachycardia | FAERS: 7 | US FAERS | |
| 128 | Amnesia | FAERS: 6 | OFFSIDES US FAERS | |
| 129 | Anaphylactic shock | FAERS: 6 | US FAERS | |
| 130 | Cellulitis | FAERS: 6 | OFFSIDES US FAERS | |
| 131 | Constipation | FAERS: 6 | US FAERS | |
| 132 | Drug ineffective for unapproved indication | FAERS: 6 | US FAERS | |
| 133 | Dyspepsia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 134 | Eczema | FAERS: 6 | OFFSIDES US FAERS | |
| 135 | Hypothalamic pituitary adrenal axis suppression | FAERS: 6 | US FAERS | |
| 136 | Incorrect route of product administration | FAERS: 6 | US FAERS | |
| 137 | Incorrect storage of drug | FAERS: 6 | US FAERS | |
| 138 | Injection site indentation | FAERS: 6 | US FAERS | |
| 139 | Meningitis | FAERS: 6 | US FAERS | |
| 140 | Poor quality drug administered | FAERS: 6 | US FAERS | |
| 141 | Pseudoendophthalmitis | FAERS: 6 | US FAERS | |
| 142 | Suspected product contamination | FAERS: 6 | US FAERS | |
| 143 | Thirst | FAERS: 6 | US FAERS | |
| 144 | Uveitis | FAERS: 6 | 19403113 20172078 | CTD US FAERS |
| 145 | Visual disturbance | FAERS: 6 | US FAERS | |
| 146 | Abasia | FAERS: 5 | US FAERS | |
| 147 | Application site erythema | FAERS: 5 | US FAERS | |
| 148 | Blood cortisol increased | FAERS: 5 | US FAERS | |
| 149 | Blood potassium decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 150 | Chills | FAERS: 5 | US FAERS | |
| 151 | Conjunctival ulcer | FAERS: 5 | US FAERS | |
| 152 | Dehydration | FAERS: 5 | OFFSIDES US FAERS | |
| 153 | Diabetes Mellitus | FAERS: 5 | US FAERS | |
| 154 | Discomfort | FAERS: 5 | US FAERS | |
| 155 | Disease recurrence | FAERS: 5 | US FAERS | |
| 156 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 157 | Drug effect incomplete | FAERS: 5 | US FAERS | |
| 158 | Dysphonia | FAERS: 5 | US FAERS | |
| 159 | Eye irritation | FAERS: 5 | US FAERS | |
| 160 | Feeling jittery | FAERS: 5 | US FAERS | |
| 161 | Injection site abscess | FAERS: 5 | US FAERS | |
| 162 | Injection site extravasation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 163 | Injection site irritation | FAERS: 5 | US FAERS | |
| 164 | Nasal discomfort | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 165 | Necrosis | FAERS: 5 | US FAERS | |
| 166 | Nerve injury | FAERS: 5 | US FAERS | |
| 167 | Neuralgia | FAERS: 5 | US FAERS | |
| 168 | Neuritis | FAERS: 5 | US FAERS | |
| 169 | Peripheral swelling | FAERS: 5 | US FAERS | |
| 170 | Pneumonia | FAERS: 5 | US FAERS | |
| 171 | Pseudomeningocele | FAERS: 5 | US FAERS | |
| 172 | Retinal Degeneration | FAERS: 5 | US FAERS | |
| 173 | Retinal Vasculitis | FAERS: 5 | US FAERS | |
| 174 | Retinal pigment epitheliopathy | FAERS: 5 | US FAERS | |
| 175 | Scleritis | FAERS: 5 | US FAERS | |
| 176 | Steroid withdrawal syndrome | FAERS: 5 | US FAERS | |
| 177 | Syphilis | FAERS: 5 | US FAERS | |
| 178 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 179 | Toxicity to various agents | FAERS: 5 | US FAERS | |
| 180 | Urinary Incontinence | FAERS: 5 | US FAERS | |
| 181 | Vitritis | FAERS: 5 | US FAERS | |
| 182 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 183 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 184 | Amblyopia | FAERS: 4 | US FAERS | |
| 185 | Arachnoiditis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 186 | Cold sweat | FAERS: 4 | US FAERS | |
| 187 | Crying | FAERS: 4 | US FAERS | |
| 188 | Cystitis | FAERS: 4 | US FAERS | |
| 189 | Disorientation | FAERS: 4 | US FAERS | |
| 190 | Emotional disorder | FAERS: 4 | US FAERS | |
| 191 | Erectile dysfunction | FAERS: 4 | US FAERS | |
| 192 | Extra dose administered | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | Eyeball rupture | FAERS: 4 | US FAERS | |
| 194 | Fat necrosis | FAERS: 4 | US FAERS | |
| 195 | Hormone level abnormal | FAERS: 4 | US FAERS | |
| 196 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 197 | Injection site mass | FAERS: 4 | US FAERS | |
| 198 | Kounis Syndrome | FAERS: 4 | US FAERS | |
| 199 | Ligament rupture | FAERS: 4 | US FAERS | |
| 200 | Macular fibrosis | FAERS: 4 | US FAERS | |
| 201 | Nervousness | FAERS: 4 | US FAERS | |
| 202 | Pain of skin | FAERS: 4 | OFFSIDES US FAERS | |
| 203 | Prescribed overdose | FAERS: 4 | OFFSIDES US FAERS | |
| 204 | Presyncope | FAERS: 4 | US FAERS | |
| 205 | Product physical consistency issue | FAERS: 4 | US FAERS | |
| 206 | Product substitution issue | FAERS: 4 | US FAERS | |
| 207 | Purpura | FAERS: 4 | US FAERS | |
| 208 | Rash erythematous | FAERS: 4 | US FAERS | |
| 209 | Respiratory distress | FAERS: 4 | US FAERS | |
| 210 | Retinitis | FAERS: 4 | US FAERS | |
| 211 | Thrombosis | FAERS: 4 | US FAERS | |
| 212 | Toothache | FAERS: 4 | US FAERS | |
| 213 | Vitreous floaters | FAERS: 4 | US FAERS | |
| 214 | nervous system disorder | FAERS: 4 | US FAERS | |
| 215 | Anorexia | FAERS: 3 | OFFSIDES US FAERS | |
| 216 | Anterior chamber inflammation | FAERS: 3 | US FAERS | |
| 217 | Application site pruritus | FAERS: 3 | OFFSIDES US FAERS | |
| 218 | Blood cortisol decreased | FAERS: 3 | US FAERS | |
| 219 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 220 | Bradycardia | FAERS: 3 | OFFSIDES US FAERS | |
| 221 | Breast Feeding | FAERS: 3 | US FAERS | |
| 222 | Bronchitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 223 | Bursitis | FAERS: 3 | OFFSIDES US FAERS | |
| 224 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 225 | Drug Dependence | FAERS: 3 | US FAERS | |
| 226 | Drug administered at inappropriate site | FAERS: 3 | US FAERS | |
| 227 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 228 | Drug withdrawal syndrome | FAERS: 3 | US FAERS | |
| 229 | Emotional distress | FAERS: 3 | OFFSIDES US FAERS | |
| 230 | Epicondylitis | FAERS: 3 | US FAERS | |
| 231 | Expired drug administered | FAERS: 3 | US FAERS | |
| 232 | Extremity necrosis | FAERS: 3 | US FAERS | |
| 233 | Eye infection intraocular | FAERS: 3 | US FAERS | |
| 234 | Eye infection syphilitic | FAERS: 3 | US FAERS | |
| 235 | Facial wasting | FAERS: 3 | US FAERS | |
| 236 | Genital swelling | FAERS: 3 | US FAERS | |
| 237 | Head discomfort | FAERS: 3 | US FAERS | |
| 238 | Hepatomegaly | FAERS: 3 | 29222744 | CTD US FAERS |
| 239 | Hypereosinophilic syndrome | FAERS: 3 | US FAERS | |
| 240 | Hyperkeratosis | FAERS: 3 | US FAERS | |
| 241 | Hypertrichosis | FAERS: 3 | US FAERS | |
| 242 | Impaired driving ability | FAERS: 3 | OFFSIDES US FAERS | |
| 243 | Influenza | FAERS: 3 | US FAERS | |
| 244 | Injection site fibrosis | FAERS: 3 | US FAERS | |
| 245 | Injection site scab | FAERS: 3 | US FAERS | |
| 246 | Joint stiffness | FAERS: 3 | US FAERS | |
| 247 | Lip swelling | FAERS: 3 | US FAERS | |
| 248 | Mydriasis | FAERS: 3 | US FAERS | |
| 249 | Myocardial Infarction | FAERS: 3 | US FAERS | |
| 250 | Optic Neuritis | FAERS: 3 | US FAERS | |
| 251 | Osteoporosis | FAERS: 3 | US FAERS | |
| 252 | Pallor | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 253 | Panophthalmitis | FAERS: 3 | US FAERS | |
| 254 | Paraplegia | FAERS: 3 | OFFSIDES US FAERS | |
| 255 | Photophobia | FAERS: 3 | US FAERS | |
| 256 | Product expiration date issue | FAERS: 3 | US FAERS | |
| 257 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 258 | Rebound effect | FAERS: 3 | US FAERS | |
| 259 | Renal pain | FAERS: 3 | US FAERS | |
| 260 | Retinal scar | FAERS: 3 | US FAERS | |
| 261 | Rhinalgia | FAERS: 3 | US FAERS | |
| 262 | Scab | FAERS: 3 | US FAERS | |
| 263 | Scedosporium infection | FAERS: 3 | US FAERS | |
| 264 | Skin Erosion | FAERS: 3 | US FAERS | |
| 265 | Skin reaction | FAERS: 3 | US FAERS | |
| 266 | Somnolence | FAERS: 3 | US FAERS | |
| 267 | Spondylitis | FAERS: 3 | US FAERS | |
| 268 | Strabismus | FAERS: 3 | US FAERS | |
| 269 | Stress | FAERS: 3 | OFFSIDES US FAERS | |
| 270 | Suspected transmission of an infectious agent via product | FAERS: 3 | US FAERS | |
| 271 | Temperature intolerance | FAERS: 3 | US FAERS | |
| 272 | Toxoplasmosis | FAERS: 3 | US FAERS | |
| 273 | Vascular fragility | FAERS: 3 | US FAERS | |
| 274 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 275 | Acarodermatitis | FAERS: 2 | US FAERS | |
| 276 | Accidental exposure | FAERS: 2 | US FAERS | |
| 277 | Angioedema | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 278 | Anterior chamber crystallisation | FAERS: 2 | US FAERS | |
| 279 | Aphonia | FAERS: 2 | OFFSIDES US FAERS | |
| 280 | Application site burn | FAERS: 2 | US FAERS | |
| 281 | Application site exfoliation | FAERS: 2 | US FAERS | |
| 282 | Application site scar | FAERS: 2 | US FAERS | |
| 283 | Application site swelling | FAERS: 2 | US FAERS | |
| 284 | Arthritis | FAERS: 2 | OFFSIDES US FAERS | |
| 285 | Ascites | FAERS: 2 | US FAERS | |
| 286 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 287 | Autonomic nervous system imbalance | FAERS: 2 | US FAERS | |
| 288 | Back disorder | FAERS: 2 | US FAERS | |
| 289 | Bladder wall calcification | FAERS: 2 | US FAERS | |
| 290 | Blood blister | FAERS: 2 | US FAERS | |
| 291 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 292 | Bone pain | FAERS: 2 | US FAERS | |
| 293 | Candidiasis | FAERS: 2 | US FAERS | |
| 294 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 295 | Cerebellar infarction | FAERS: 2 | US FAERS | |
| 296 | Choking | FAERS: 2 | OFFSIDES US FAERS | |
| 297 | Choroidal Detachment | FAERS: 2 | US FAERS | |
| 298 | Conjunctival bleb | FAERS: 2 | US FAERS | |
| 299 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 300 | Cubital Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 301 | Cutaneous nocardiosis | FAERS: 2 | US FAERS | |
| 302 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 303 | Deafness | FAERS: 2 | OFFSIDES US FAERS | |
| 304 | Dehydroepiandrosterone increased | FAERS: 2 | US FAERS | |
| 305 | Depressed mood | FAERS: 2 | OFFSIDES US FAERS | |
| 306 | Dermatitis | FAERS: 2 | US FAERS | |
| 307 | Detachment of retinal pigment epithelium | FAERS: 2 | US FAERS | |
| 308 | Disability | FAERS: 2 | US FAERS | |
| 309 | Disease Progression | FAERS: 2 | US FAERS | |
| 310 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 311 | Drug exposure via breast milk | FAERS: 2 | US FAERS | |
| 312 | Ecchymosis | FAERS: 2 | US FAERS | |
| 313 | Exophthalmos | FAERS: 2 | US FAERS | |
| 314 | Feeling Cold | FAERS: 2 | US FAERS | |
| 315 | Frustration | FAERS: 2 | US FAERS | |
| 316 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 317 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 318 | Granuloma | FAERS: 2 | 7206733 13129887 | CTD US FAERS |
| 319 | Growth retardation | FAERS: 2 | US FAERS | |
| 320 | Hepatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 321 | Hyperphagia | FAERS: 2 | US FAERS | |
| 322 | Hyperventilation | FAERS: 2 | US FAERS | |
| 323 | Hypohidrosis | FAERS: 2 | US FAERS | |
| 324 | Impaired self-care | FAERS: 2 | US FAERS | |
| 325 | Impaired work ability | FAERS: 2 | US FAERS | |
| 326 | Injection site discomfort | FAERS: 2 | US FAERS | |
| 327 | Injection site nerve damage | FAERS: 2 | US FAERS | |
| 328 | Injection site pruritus | FAERS: 2 | US FAERS | |
| 329 | Injection site ulcer | FAERS: 2 | US FAERS | |
| 330 | Iritis | FAERS: 2 | US FAERS | |
| 331 | Laceration | FAERS: 2 | US FAERS | |
| 332 | Lethargy | FAERS: 2 | OFFSIDES US FAERS | |
| 333 | Leukocytosis | FAERS: 2 | US FAERS | |
| 334 | Lichen Planus | FAERS: 2 | US FAERS | |
| 335 | Lichen striatus | FAERS: 2 | US FAERS | |
| 336 | Ligament injury | FAERS: 2 | US FAERS | |
| 337 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 338 | Macular degeneration | FAERS: 2 | US FAERS | |
| 339 | Memory impairment | FAERS: 2 | US FAERS | |
| 340 | Metabolic alkalosis | FAERS: 2 | US FAERS | |
| 341 | Monoplegia | FAERS: 2 | US FAERS | |
| 342 | Muscle tightness | FAERS: 2 | US FAERS | |
| 343 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 344 | Myopathy | FAERS: 2 | US FAERS | |
| 345 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 346 | Optic Atrophy | FAERS: 2 | US FAERS | |
| 347 | Oral pain | FAERS: 2 | US FAERS | |
| 348 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 349 | Peptic Ulcer | FAERS: 2 | US FAERS | |
| 350 | Periarthritis | FAERS: 2 | US FAERS | |
| 351 | Pharyngitis | FAERS: 2 | US FAERS | |
| 352 | Pharyngolaryngeal Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 353 | Pregnancy | FAERS: 2 | US FAERS | |
| 354 | Product deposit | FAERS: 2 | US FAERS | |
| 355 | Product label confusion | FAERS: 2 | US FAERS | |
| 356 | Product leakage | FAERS: 2 | US FAERS | |
| 357 | Product packaging confusion | FAERS: 2 | US FAERS | |
| 358 | Psoas Abscess | FAERS: 2 | US FAERS | |
| 359 | Psoriasis | FAERS: 2 | US FAERS | |
| 360 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 361 | Respiratory tract irritation | FAERS: 2 | US FAERS | |
| 362 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 363 | Retinal infarction | FAERS: 2 | US FAERS | |
| 364 | Retinal thickening | FAERS: 2 | US FAERS | |
| 365 | Retinal vascular occlusion | FAERS: 2 | US FAERS | |
| 366 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 367 | Skin irritation | FAERS: 2 | US FAERS | |
| 368 | Sneezing | FAERS: 2 | US FAERS | |
| 369 | Soft Tissue Infection | FAERS: 2 | US FAERS | |
| 370 | Soft tissue atrophy | FAERS: 2 | US FAERS | |
| 371 | Synovial Cyst | FAERS: 2 | US FAERS | |
| 372 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 373 | Temperature regulation disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 374 | Thalamic infarction | FAERS: 2 | US FAERS | |
| 375 | Therapeutic product effect decreased | FAERS: 2 | US FAERS | |
| 376 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 377 | Thermal burn | FAERS: 2 | US FAERS | |
| 378 | Tooth Loss | FAERS: 2 | US FAERS | |
| 379 | Total lung capacity abnormal | FAERS: 2 | US FAERS | |
| 380 | Toxic anterior segment syndrome | FAERS: 2 | US FAERS | |
| 381 | Ulcer | FAERS: 2 | US FAERS | |
| 382 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 383 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 384 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 385 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 386 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 387 | Abscess fungal | FAERS: 1 | US FAERS | |
| 388 | Acanthamoeba Infection | FAERS: 1 | US FAERS | |
| 389 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 390 | Accidental overdose | FAERS: 1 | US FAERS | |
| 391 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 392 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 393 | Alternaria infection | FAERS: 1 | US FAERS | |
| 394 | Aneurysm | FAERS: 1 | US FAERS | |
| 395 | Anger | FAERS: 1 | US FAERS | |
| 396 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 397 | Anterior chamber collapse | FAERS: 1 | US FAERS | |
| 398 | Aphagia | FAERS: 1 | US FAERS | |
| 399 | Aphasia | FAERS: 1 | US FAERS | |
| 400 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 401 | Apparent death | FAERS: 1 | US FAERS | |
| 402 | Application site atrophy | FAERS: 1 | US FAERS | |
| 403 | Application site discharge | FAERS: 1 | US FAERS | |
| 404 | Application site discomfort | FAERS: 1 | US FAERS | |
| 405 | Application site hypersensitivity | FAERS: 1 | US FAERS | |
| 406 | Application site irritation | FAERS: 1 | US FAERS | |
| 407 | Application site nodule | FAERS: 1 | US FAERS | |
| 408 | Application site rash | FAERS: 1 | US FAERS | |
| 409 | Application site reaction | FAERS: 1 | OFFSIDES US FAERS | |
| 410 | Application site urticaria | FAERS: 1 | US FAERS | |
| 411 | Application site vesicles | FAERS: 1 | OFFSIDES US FAERS | |
| 412 | Arthrotomy | FAERS: 1 | US FAERS | |
| 413 | Artificial crown procedure | FAERS: 1 | US FAERS | |
| 414 | Aspergillosis | FAERS: 1 | OFFSIDES US FAERS | |
| 415 | Ataxia | FAERS: 1 | US FAERS | |
| 416 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 417 | Atypical mycobacterium test positive | FAERS: 1 | US FAERS | |
| 418 | Bedridden | FAERS: 1 | US FAERS | |
| 419 | Blood Corticotrophin Decreased | FAERS: 1 | US FAERS | |
| 420 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 421 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 422 | Blood pressure fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 423 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 424 | Bone Tuberculosis | FAERS: 1 | US FAERS | |
| 425 | Bone erosion | FAERS: 1 | US FAERS | |
| 426 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 427 | Carbohydrate intolerance | FAERS: 1 | US FAERS | |
| 428 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 429 | Cardiac valve replacement complication | FAERS: 1 | US FAERS | |
| 430 | Cataract operation | FAERS: 1 | US FAERS | |
| 431 | Cell Death | FAERS: 1 | US FAERS | |
| 432 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 433 | Chondrectomy | FAERS: 1 | US FAERS | |
| 434 | Chronic idiopathic pain syndrome | FAERS: 1 | US FAERS | |
| 435 | Complications of transplant surgery | FAERS: 1 | US FAERS | |
| 436 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 437 | Corneal erosion | FAERS: 1 | US FAERS | |
| 438 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 439 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 440 | Craniectomy | FAERS: 1 | US FAERS | |
| 441 | Culture wound positive | FAERS: 1 | US FAERS | |
| 442 | Cutaneous contour deformity | FAERS: 1 | US FAERS | |
| 443 | Cyanosis | FAERS: 1 | OFFSIDES US FAERS | |
| 444 | Cyst | FAERS: 1 | US FAERS | |
| 445 | Deposit eye | FAERS: 1 | US FAERS | |
| 446 | Depressed Level of Consciousness | FAERS: 1 | OFFSIDES US FAERS | |
| 447 | Device Failure | FAERS: 1 | US FAERS | |
| 448 | Device defective | FAERS: 1 | US FAERS | |
| 449 | Device dislocation | FAERS: 1 | US FAERS | |
| 450 | Device malfunction | FAERS: 1 | US FAERS | |
| 451 | Device material opacification | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 452 | Device related infection | FAERS: 1 | US FAERS | |
| 453 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 454 | Dissociation | FAERS: 1 | US FAERS | |
| 455 | Diverticulitis | FAERS: 1 | US FAERS | |
| 456 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 457 | Drug delivery system malfunction | FAERS: 1 | US FAERS | |
| 458 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 459 | Drug label confusion | FAERS: 1 | US FAERS | |
| 460 | Drug resistance | FAERS: 1 | US FAERS | |
| 461 | Drug screen positive | FAERS: 1 | US FAERS | |
| 462 | Drug toxicity | FAERS: 1 | US FAERS | |
| 463 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 464 | Dural tear | FAERS: 1 | US FAERS | |
| 465 | Dysarthria | FAERS: 1 | US FAERS | |
| 466 | Dysentery | FAERS: 1 | US FAERS | |
| 467 | Dysphemia | FAERS: 1 | US FAERS | |
| 468 | Dystrophic calcification | FAERS: 1 | US FAERS | |
| 469 | Dysuria | FAERS: 1 | OFFSIDES US FAERS | |
| 470 | Ear congestion | FAERS: 1 | US FAERS | |
| 471 | Economic problem | FAERS: 1 | US FAERS | |
| 472 | Elbow deformity | FAERS: 1 | US FAERS | |
| 473 | Electrolyte depletion | FAERS: 1 | US FAERS | |
| 474 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 475 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 476 | Endometrial Hyperplasia | FAERS: 1 | US FAERS | |
| 477 | Endometrial hypertrophy | FAERS: 1 | US FAERS | |
| 478 | Enuresis | FAERS: 1 | US FAERS | |
| 479 | Epidermal necrosis | FAERS: 1 | US FAERS | |
| 480 | Epidural lipomatosis | FAERS: 1 | US FAERS | |
| 481 | Eructation | FAERS: 1 | US FAERS | |
| 482 | Erysipelas | FAERS: 1 | US FAERS | |
| 483 | Erythrodermic psoriasis | FAERS: 1 | US FAERS | |
| 484 | Excoriation | FAERS: 1 | OFFSIDES US FAERS | |
| 485 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 486 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 487 | Exposure via inhalation | FAERS: 1 | US FAERS | |
| 488 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 489 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 490 | Fascial hernia | FAERS: 1 | US FAERS | |
| 491 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 492 | Fibrosis | FAERS: 1 | US FAERS | |
| 493 | Flatulence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 494 | Folliculitis | FAERS: 1 | US FAERS | |
| 495 | Food craving | FAERS: 1 | US FAERS | |
| 496 | Fungal test positive | FAERS: 1 | US FAERS | |
| 497 | Fungus serology test positive | FAERS: 1 | US FAERS | |
| 498 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 499 | Gastritis | FAERS: 1 | US FAERS | |
| 500 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 501 | Genital discomfort | FAERS: 1 | US FAERS | |
| 502 | Genital pain | FAERS: 1 | US FAERS | |
| 503 | Glossitis | FAERS: 1 | OFFSIDES US FAERS | |
| 504 | Hunger | FAERS: 1 | US FAERS | |
| 505 | Hydronephrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 506 | Hyperacusis | FAERS: 1 | US FAERS | |
| 507 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 508 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 509 | Hypervigilance | FAERS: 1 | US FAERS | |
| 510 | Hypogeusia | FAERS: 1 | US FAERS | |
| 511 | Hypogonadism | FAERS: 1 | US FAERS | |
| 512 | Hypophagia | FAERS: 1 | US FAERS | |
| 513 | Hypoxia | FAERS: 1 | US FAERS | |
| 514 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 515 | Immediate post-injection reaction | FAERS: 1 | US FAERS | |
| 516 | Immobile | FAERS: 1 | US FAERS | |
| 517 | Immunosuppression | FAERS: 1 | US FAERS | |
| 518 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 519 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 520 | Incision site infection | FAERS: 1 | US FAERS | |
| 521 | Incontinence | FAERS: 1 | OFFSIDES US FAERS | |
| 522 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 523 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 524 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 525 | Increased upper airway secretion | FAERS: 1 | OFFSIDES US FAERS | |
| 526 | Infarction | FAERS: 1 | US FAERS | |
| 527 | Initial insomnia | FAERS: 1 | US FAERS | |
| 528 | Injection related reaction | FAERS: 1 | US FAERS | |
| 529 | Injection site dryness | FAERS: 1 | US FAERS | |
| 530 | Injection site injury | FAERS: 1 | US FAERS | |
| 531 | Injection site macule | FAERS: 1 | US FAERS | |
| 532 | Injection site nodule | FAERS: 1 | US FAERS | |
| 533 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 534 | Injection site warmth | FAERS: 1 | US FAERS | |
| 535 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 536 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 537 | Intraocular pressure fluctuation | FAERS: 1 | US FAERS | |
| 538 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 539 | Iridocele | FAERS: 1 | US FAERS | |
| 540 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 541 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 542 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 543 | Joint injury | FAERS: 1 | OFFSIDES US FAERS | |
| 544 | Joint warmth | FAERS: 1 | US FAERS | |
| 545 | Keratopathy | FAERS: 1 | US FAERS | |
| 546 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 547 | Laryngitis | FAERS: 1 | US FAERS | |
| 548 | Laryngospasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 549 | Lens dislocation | FAERS: 1 | US FAERS | |
| 550 | Lenticular injury | FAERS: 1 | US FAERS | |
| 551 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 552 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 553 | Lipoma | FAERS: 1 | US FAERS | |
| 554 | Live Birth | FAERS: 1 | US FAERS | |
| 555 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 556 | Lymphoma | FAERS: 1 | US FAERS | |
| 557 | Macular detachment | FAERS: 1 | US FAERS | |
| 558 | Malabsorption | FAERS: 1 | US FAERS | |
| 559 | Malnutrition | FAERS: 1 | US FAERS | |
| 560 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 561 | Medication residue | FAERS: 1 | US FAERS | |
| 562 | Medication residue present | FAERS: 1 | US FAERS | |
| 563 | Melanoma recurrent | FAERS: 1 | US FAERS | |
| 564 | Menopause | FAERS: 1 | US FAERS | |
| 565 | Mental status changes | FAERS: 1 | US FAERS | |
| 566 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 567 | Metastases to muscle | FAERS: 1 | US FAERS | |
| 568 | Microembolism | FAERS: 1 | US FAERS | |
| 569 | Miliaria | FAERS: 1 | US FAERS | |
| 570 | Mouth swelling | FAERS: 1 | US FAERS | |
| 571 | Mucosal atrophy | FAERS: 1 | US FAERS | |
| 572 | Multiple allergies | FAERS: 1 | OFFSIDES US FAERS | |
| 573 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 574 | Muscle Fatigue | FAERS: 1 | OFFSIDES US FAERS | |
| 575 | Musculoskeletal Deformity | FAERS: 1 | US FAERS | |
| 576 | Myositis | FAERS: 1 | US FAERS | |
| 577 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 578 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 579 | No adverse reaction | FAERS: 1 | US FAERS | |
| 580 | Nocturia | FAERS: 1 | OFFSIDES US FAERS | |
| 581 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 582 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 583 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 584 | Ocular vasculitis | FAERS: 1 | US FAERS | |
| 585 | Ophthalmoplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 586 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 587 | Optic nerve cupping | FAERS: 1 | US FAERS | |
| 588 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 589 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 590 | Osteotomy | FAERS: 1 | US FAERS | |
| 591 | Otitis Externa | FAERS: 1 | US FAERS | |
| 592 | Pancreatitis | FAERS: 1 | US FAERS | |
| 593 | Pathological fracture | FAERS: 1 | US FAERS | |
| 594 | Peptostreptococcus infection | FAERS: 1 | US FAERS | |
| 595 | Periorbital Infection | FAERS: 1 | US FAERS | |
| 596 | Peripheral nerve lesion | FAERS: 1 | US FAERS | |
| 597 | Periphlebitis | FAERS: 1 | US FAERS | |
| 598 | Peritonitis | FAERS: 1 | US FAERS | |
| 599 | Personality Change | FAERS: 1 | US FAERS | |
| 600 | Petechiae | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 601 | Pilonidal Cyst | FAERS: 1 | US FAERS | |
| 602 | Pleurisy | FAERS: 1 | US FAERS | |
| 603 | Pneumocephalus | FAERS: 1 | US FAERS | |
| 604 | Pneumonitis | FAERS: 1 | US FAERS | |
| 605 | Poisoning | FAERS: 1 | US FAERS | |
| 606 | Polydipsia | FAERS: 1 | US FAERS | |
| 607 | Polyuria | FAERS: 1 | US FAERS | |
| 608 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 609 | Post procedural stroke | FAERS: 1 | US FAERS | |
| 610 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 611 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 612 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 613 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 614 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 615 | Procedural complication | FAERS: 1 | US FAERS | |
| 616 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 617 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 618 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 619 | Product dispensing error | FAERS: 1 | US FAERS | |
| 620 | Product dose omission | FAERS: 1 | US FAERS | |
| 621 | Product label issue | FAERS: 1 | US FAERS | |
| 622 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 623 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 624 | Product supply issue | FAERS: 1 | US FAERS | |
| 625 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 626 | Product use complaint | FAERS: 1 | US FAERS | |
| 627 | Productive Cough | FAERS: 1 | OFFSIDES US FAERS | |
| 628 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 629 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 630 | Pulmonary Hypertension | FAERS: 1 | OFFSIDES US FAERS | |
| 631 | Punctate keratitis | FAERS: 1 | US FAERS | |
| 632 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 633 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 634 | Regurgitation | FAERS: 1 | US FAERS | |
| 635 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 636 | Retinal depigmentation | FAERS: 1 | US FAERS | |
| 637 | Retinopexy | FAERS: 1 | US FAERS | |
| 638 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 639 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 640 | Schizophrenia | FAERS: 1 | US FAERS | |
| 641 | Scleral thinning | FAERS: 1 | US FAERS | |
| 642 | Scleroderma renal crisis | FAERS: 1 | US FAERS | |
| 643 | Sinus headache | FAERS: 1 | US FAERS | |
| 644 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 645 | Skeletal injury | FAERS: 1 | OFFSIDES US FAERS | |
| 646 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 647 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 648 | Skin indentation | FAERS: 1 | US FAERS | |
| 649 | Skin lesion | FAERS: 1 | US FAERS | |
| 650 | Sluggishness | FAERS: 1 | US FAERS | |
| 651 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 652 | Soft tissue swelling | FAERS: 1 | US FAERS | |
| 653 | Solar dermatitis | FAERS: 1 | US FAERS | |
| 654 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 655 | Staphylococcal abscess | FAERS: 1 | US FAERS | |
| 656 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 657 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 658 | Stomatitis | FAERS: 1 | US FAERS | |
| 659 | Sunburn | FAERS: 1 | US FAERS | |
| 660 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 661 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 662 | Synovitis | FAERS: 1 | OFFSIDES US FAERS | |
| 663 | Syringomyelia | FAERS: 1 | US FAERS | |
| 664 | Systemic bacterial infection | FAERS: 1 | US FAERS | |
| 665 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 666 | Tension Headache | FAERS: 1 | US FAERS | |
| 667 | Therapeutic product effect delayed | FAERS: 1 | US FAERS | |
| 668 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 669 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 670 | Throat clearing | FAERS: 1 | US FAERS | |
| 671 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 672 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 673 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 674 | Transmission of an infectious agent via product | FAERS: 1 | US FAERS | |
| 675 | Traumatic renal injury | FAERS: 1 | US FAERS | |
| 676 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 677 | Troponin increased | FAERS: 1 | OFFSIDES US FAERS | |
| 678 | Tuberculosis | FAERS: 1 | US FAERS | |
| 679 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 680 | Ulnocarpal abutment syndrome | FAERS: 1 | US FAERS | |
| 681 | Urinary Retention | FAERS: 1 | US FAERS | |
| 682 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 683 | Urine output increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 684 | Urine protein, quantitative | FAERS: 1 | US FAERS | |
| 685 | Uterine spasm | FAERS: 1 | US FAERS | |
| 686 | Uveal prolapse | FAERS: 1 | US FAERS | |
| 687 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 688 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 689 | Ventricular drainage | FAERS: 1 | US FAERS | |
| 690 | Vitrectomy | FAERS: 1 | US FAERS | |
| 691 | Vitreous injury | FAERS: 1 | US FAERS | |
| 692 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 693 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 694 | Vulvovaginal rash | FAERS: 1 | US FAERS | |
| 695 | Walking aid user | FAERS: 1 | US FAERS | |
| 696 | Wheezing | FAERS: 1 | US FAERS | |
| 697 | Wound Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 698 | carbuncle | FAERS: 1 | US FAERS | |
| 699 | muscle injury | FAERS: 1 | OFFSIDES US FAERS | |
| 700 | Abdominal rigidity | OFFSIDES | ||
| 701 | Abdominal wall infection | OFFSIDES | ||
| 702 | Abnormalities, Drug-Induced | 3193449 7166596 | CTD | |
| 703 | Abuse | OFFSIDES | ||
| 704 | Acid reflux | OFFSIDES | ||
| 705 | Actinic keratosis | OFFSIDES | ||
| 706 | Acute bronchitis | OFFSIDES | ||
| 707 | Acute sinusitis | OFFSIDES | ||
| 708 | Adenitis | OFFSIDES | ||
| 709 | Agoraphobia | OFFSIDES | ||
| 710 | Alcohol abuse | OFFSIDES | ||
| 711 | Alveolar Soft Part Sarcoma | OFFSIDES | ||
| 712 | Alveoloplasty | OFFSIDES | ||
| 713 | Anhidrosis | OFFSIDES | ||
| 714 | Anticoagulation drug level below therapeutic | OFFSIDES | ||
| 715 | Antinuclear antibody increased | OFFSIDES | ||
| 716 | Aortic Aneurysm | OFFSIDES | ||
| 717 | Apathy | OFFSIDES | ||
| 718 | Apnea | OFFSIDES | ||
| 719 | Arterial thrombosis | OFFSIDES | ||
| 720 | Arteriosclerosis | OFFSIDES | ||
| 721 | Arthroscopy | OFFSIDES | ||
| 722 | Atelectasis | OFFSIDES | ||
| 723 | Aura | OFFSIDES | ||
| 724 | Autoimmune hepatitis | OFFSIDES | ||
| 725 | Bacillus test positive | Canada Vigilance: 1 | Canada Vigilance | |
| 726 | Biopsy breast abnormal | OFFSIDES | ||
| 727 | Biopsy | OFFSIDES | ||
| 728 | Bipolar Disorder | OFFSIDES | ||
| 729 | Blood Glucose | OFFSIDES | ||
| 730 | Blood amylase increased | OFFSIDES | ||
| 731 | Blood cholesterol abnormal | OFFSIDES | ||
| 732 | Blood cholesterol | OFFSIDES | ||
| 733 | Blood triglycerides increased | OFFSIDES | ||
| 734 | Blood urine present | OFFSIDES | ||
| 735 | Blurred vision | OFFSIDES | ||
| 736 | Bone fistula | OFFSIDES | ||
| 737 | Bone lesion | OFFSIDES | ||
| 738 | Borderline Personality Disorder | OFFSIDES | ||
| 739 | Bruxism | OFFSIDES | ||
| 740 | Carcinoembryonic antigen increased | OFFSIDES | ||
| 741 | Cardiac enzymes increased | OFFSIDES | ||
| 742 | Catheter related complication | OFFSIDES | ||
| 743 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 744 | Cholelithiasis obstructive | OFFSIDES | ||
| 745 | Choroidal Neovascularization | 16767378 | CTD | |
| 746 | Chromaturia | OFFSIDES | ||
| 747 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 748 | Cirrhosis | OFFSIDES | ||
| 749 | Claustrophobia | OFFSIDES | ||
| 750 | Colitis | OFFSIDES | ||
| 751 | Confabulation | OFFSIDES | ||
| 752 | Contact Dermatitis | OFFSIDES | ||
| 753 | Craniofacial Abnormalities | 7166596 | CTD | |
| 754 | Deafness Neurosensory | OFFSIDES | ||
| 755 | Decreased Libido | OFFSIDES | ||
| 756 | Demyelination | OFFSIDES | ||
| 757 | Dependence | OFFSIDES | ||
| 758 | Dependent Personality Disorder | OFFSIDES | ||
| 759 | Dermatitis, Allergic Contact | 2530056 8449700 | CTD | |
| 760 | Dermatomyositis | OFFSIDES | ||
| 761 | Diabetes | OFFSIDES | ||
| 762 | Diabetic Retinopathy | CTD | ||
| 763 | Diarrhea | OFFSIDES | ||
| 764 | Diastolic dysfunction | OFFSIDES | ||
| 765 | Diffuse alveolar damage | OFFSIDES | ||
| 766 | Diverticulum | OFFSIDES | ||
| 767 | Drowsiness | OFFSIDES | ||
| 768 | Drug withdrawal headache | OFFSIDES | ||
| 769 | Dysmenorrhea | OFFSIDES | ||
| 770 | Edema | 7206733 | CTD | |
| 771 | Ejection Fraction Decreased | OFFSIDES | ||
| 772 | Electrocardiogram poor R-wave progression | OFFSIDES | ||
| 773 | Electromechanical dissociation | OFFSIDES | ||
| 774 | Encephalocele | 3193449 | CTD | |
| 775 | Enterococcal sepsis | OFFSIDES | ||
| 776 | Enterococcus test positive | Canada Vigilance: 1 | Canada Vigilance | |
| 777 | Enzyme abnormality | OFFSIDES | ||
| 778 | Escherichia test positive | Canada Vigilance: 1 | Canada Vigilance | |
| 779 | Fatty Liver | OFFSIDES | ||
| 780 | Feeding problem in child | OFFSIDES | ||
| 781 | Fibromyalgia | OFFSIDES | ||
| 782 | Floppy iris syndrome | OFFSIDES | ||
| 783 | Fluid overload | OFFSIDES | ||
| 784 | Formication | OFFSIDES | ||
| 785 | Gambling | OFFSIDES | ||
| 786 | Ganglioneuroblastoma | OFFSIDES | ||
| 787 | Gangrene | OFFSIDES | ||
| 788 | Gastric ulcer | OFFSIDES | ||
| 789 | Gastroenteritis | OFFSIDES | ||
| 790 | Gastrointestinal Hemorrhage | 29222744 | CTD | |
| 791 | Goiter | OFFSIDES | ||
| 792 | Gout | OFFSIDES | ||
| 793 | Granulocytosis | OFFSIDES | ||
| 794 | Hepatic congestion | OFFSIDES | ||
| 795 | Hepatitis C | OFFSIDES | ||
| 796 | Hiccough | OFFSIDES | ||
| 797 | Hypersomnia | Canada Vigilance: 1 | Canada Vigilance | |
| 798 | Hypertensive heart disease | OFFSIDES | ||
| 799 | Hypothalamo-pituitary disorder | Canada Vigilance: 1 | Canada Vigilance | |
| 800 | Iliac artery stenosis | OFFSIDES | ||
| 801 | Incorrect product administration duration | Canada Vigilance: 1 | Canada Vigilance | |
| 802 | Infection reactivation | Canada Vigilance: 1 | Canada Vigilance | |
| 803 | Injection site cellulitis | OFFSIDES | ||
| 804 | Intentional drug misuse | OFFSIDES | ||
| 805 | Intervertebral disc disorder | OFFSIDES | ||
| 806 | Joint sprain | OFFSIDES | ||
| 807 | Kidney Failure | OFFSIDES | ||
| 808 | Latent Tuberculosis | OFFSIDES | ||
| 809 | Leukopenia neonatal | OFFSIDES | ||
| 810 | Leukoplakia | OFFSIDES | ||
| 811 | Life expectancy shortened | OFFSIDES | ||
| 812 | Limb injury | OFFSIDES | ||
| 813 | Liver Neoplasms, Experimental | 1411124 | CTD | |
| 814 | Liver carcinoma ruptured | OFFSIDES | ||
| 815 | Loose tooth | OFFSIDES | ||
| 816 | Lower respiratory tract infection viral | OFFSIDES | ||
| 817 | Lymphocyte count decreased | OFFSIDES | ||
| 818 | Malignant neoplasm progression | OFFSIDES | ||
| 819 | Massage | OFFSIDES | ||
| 820 | Mastectomy | OFFSIDES | ||
| 821 | Megacolon | OFFSIDES | ||
| 822 | Meningocele | 3193449 | CTD | |
| 823 | Metabolic acidosis | OFFSIDES | ||
| 824 | Metastatic Renal Cell Carcinoma | OFFSIDES | ||
| 825 | Middle insomnia | OFFSIDES | ||
| 826 | Monoclonal immunoglobulin present | OFFSIDES | ||
| 827 | Muscle Weakness | OFFSIDES | ||
| 828 | Musculoskeletal discomfort | OFFSIDES | ||
| 829 | Nephrolithiasis | OFFSIDES | ||
| 830 | Nerve Block | OFFSIDES | ||
| 831 | Nervous tension | OFFSIDES | ||
| 832 | Ocular icterus | OFFSIDES | ||
| 833 | Oral infection | OFFSIDES | ||
| 834 | Oropharyngeal plaque | Canada Vigilance: 1 | Canada Vigilance | |
| 835 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 836 | Polymyalgia Rheumatica | OFFSIDES | ||
| 837 | Postmenopausal bleeding | OFFSIDES | ||
| 838 | Prenatal Exposure Delayed Effects | 7166596 | CTD | |
| 839 | Product complaint | Canada Vigilance: 2 | Canada Vigilance | |
| 840 | Pseudocyst | OFFSIDES | ||
| 841 | Pulmonary congestion | OFFSIDES | ||
| 842 | Purulent discharge | Canada Vigilance: 1 | Canada Vigilance | |
| 843 | Pyeloplasty | OFFSIDES | ||
| 844 | QRS axis abnormal | OFFSIDES | ||
| 845 | Rales | OFFSIDES | ||
| 846 | Rectal Stenosis | OFFSIDES | ||
| 847 | Rectal polyp | OFFSIDES | ||
| 848 | Respiratory Failure | OFFSIDES | ||
| 849 | Retinal Neovascularization | 15290890 | CTD | |
| 850 | Rheumatoid factor increased | OFFSIDES | ||
| 851 | Rhinitis, Vasomotor | 113742 | CTD | |
| 852 | Sclerosis | 13129887 | CTD | |
| 853 | Sebaceous adenoma | OFFSIDES | ||
| 854 | Secretion discharge | OFFSIDES | ||
| 855 | Septic Shock | OFFSIDES | ||
| 856 | Sinus bradycardia | OFFSIDES | ||
| 857 | Skin neoplasm excision | OFFSIDES | ||
| 858 | Sleep Talking | OFFSIDES | ||
| 859 | Smoker | OFFSIDES | ||
| 860 | Staring | OFFSIDES | ||
| 861 | Stevens-Johnson Syndrome | OFFSIDES | ||
| 862 | Subcutaneous Abscess | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 863 | Subcutaneous nodule | OFFSIDES | ||
| 864 | Submandibular mass | OFFSIDES | ||
| 865 | Sudden Cardiac Death | OFFSIDES | ||
| 866 | Sudden death | OFFSIDES | ||
| 867 | Superficial Thrombophlebitis | OFFSIDES | ||
| 868 | Telangiectasis | 952530 | CTD | |
| 869 | Tendinitis | OFFSIDES | ||
| 870 | Therapy regimen changed | OFFSIDES | ||
| 871 | Thrombophlebitis | OFFSIDES | ||
| 872 | Tooth Infection | OFFSIDES | ||
| 873 | Transfusion Reaction | OFFSIDES | ||
| 874 | Uterine Polyp | OFFSIDES | ||
| 875 | Venous thrombosis limb | OFFSIDES | ||
| 876 | Vertebrobasilar Insufficiency | OFFSIDES | ||
| 877 | Vestibular Neuronitis | OFFSIDES | ||
| 878 | Violence-related symptom | OFFSIDES | ||
| 879 | Weight Gain | OFFSIDES | ||
| 880 | Wound dehiscence | Canada Vigilance: 1 | Canada Vigilance | |
| 881 | Yawning | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.