Atorvastatin
(XUKUURHRXDUEBC-KAYWLYCHSA-N)
Structure
- SMILES
- O[C@@H](C[C@H](CC(=O)O)O)CCn1c(C(C)C)c(c(c1c1ccc(cc1)F)c1ccccc1)C(=O)Nc1ccccc1
- Type(s)
- Approved
- ATC code(s)
- C10AA05; C10BA05; C10BX03; C10BX06; C10BX08; C10BX11; C10BX12; C10BX15
- Molecular Formula:
- C33H35FN2O5
- Molecular Weight:
- 558.640
- Log P:
- 6.3866
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 4
- TPSA:
- 111.79
- CAS Number(s):
- 110862-48-1; 134523-00-5; 134523-03-8
Synonym(s)
1.
Atorvastatin
2.
(3R,5R)-7-(2-(4-Fluorophenyl)-5-isopropyl-3-phenyl-4-(phenylcarbamoyl)-1H-pyrrol-1-yl)-3,5-dihydroxyheptanoic acid
3.
Atorvastatin Calcium
4.
Atorvastatin Calcium Anhydrous
5.
Atorvastatin Calcium Hydrate
6.
Atorvastatin Calcium Trihydrate
7.
Atorvastatin, Calcium Salt
8.
CI 981
9.
CI-981
10.
Lipitor
11.
Liptonorm
12.
CI981
External Link(s)
| MeSH | D000069059 |
| PubChem Compound | 60823 |
| BindingDB | 22164 |
| ChEBI | 39548 |
| CHEMBL | CHEMBL1487 |
| DrugBank | DB01076 |
| DrugCentral | 257 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 2949 |
| KEGG | cpd:C06834 dr:D07474 |
| Therapeutic Target Database | D01QIN |
| ZINC | 3920719 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myalgia | FAERS: 308 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 2 | Rhabdomyolysis | FAERS: 157 Canada Vigilance: 4 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 3 | Product substitution issue | FAERS: 140 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Arthralgia | FAERS: 102 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 5 | Fatigue | FAERS: 100 | OFFSIDES SIDER US FAERS | |
| 6 | Asthenia | FAERS: 85 Canada Vigilance: 2 | 20155993 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 7 | Nausea | FAERS: 80 Canada Vigilance: 5 | 20155993 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 8 | Blood creatine phosphokinase increased | FAERS: 76 | OFFSIDES SIDER US FAERS | |
| 9 | Malaise | FAERS: 70 | SIDER US FAERS | |
| 10 | Dizziness | FAERS: 69 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 11 | Headache | FAERS: 63 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 12 | Pain | FAERS: 59 | CTD OFFSIDES SIDER US FAERS | |
| 13 | Myopathy | FAERS: 54 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 14 | Vomiting | FAERS: 53 | SIDER US FAERS | |
| 15 | Product quality issue | FAERS: 52 | US FAERS | |
| 16 | Abdominal Pain | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Chest Pain | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 18 | Pruritus | FAERS: 43 Canada Vigilance: 1 | 11177350 | CTD SIDER Canada Vigilance US FAERS |
| 19 | Back Pain | FAERS: 42 | SIDER US FAERS | |
| 20 | Myositis | FAERS: 40 | 12528328 | CTD SIDER US FAERS |
| 21 | Autoimmune hepatitis | FAERS: 36 | US FAERS | |
| 22 | Acute kidney injury | FAERS: 34 | 11959068 12243603 16780456 | CTD US FAERS |
| 23 | Drug ineffective | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Alopecia | FAERS: 33 | SIDER US FAERS | |
| 25 | Amnesia | FAERS: 31 | SIDER US FAERS | |
| 26 | Anxiety | FAERS: 31 | OFFSIDES US FAERS | |
| 27 | Alanine Aminotransferase Increased | FAERS: 29 | SIDER US FAERS | |
| 28 | Visual Impairment | FAERS: 29 | US FAERS | |
| 29 | Aspartate Aminotransferase Increased | FAERS: 28 | SIDER US FAERS | |
| 30 | Necrotising myositis | FAERS: 28 Canada Vigilance: 25 | Canada Vigilance US FAERS | |
| 31 | Polymyositis | FAERS: 27 Canada Vigilance: 5 | 15199734 24593216 | CTD Canada Vigilance US FAERS |
| 32 | Feeling abnormal | FAERS: 26 | SIDER US FAERS | |
| 33 | Chromaturia | FAERS: 25 | US FAERS | |
| 34 | Memory impairment | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Palpitations | FAERS: 25 | SIDER US FAERS | |
| 36 | Constipation | FAERS: 24 | SIDER US FAERS | |
| 37 | Weight decreased | FAERS: 24 | US FAERS | |
| 38 | Abdominal discomfort | FAERS: 23 | SIDER US FAERS | |
| 39 | Transaminases increased | FAERS: 21 | SIDER US FAERS | |
| 40 | Bone pain | FAERS: 20 | US FAERS | |
| 41 | Joint swelling | FAERS: 20 | SIDER US FAERS | |
| 42 | Musculoskeletal Pain | FAERS: 19 | SIDER US FAERS | |
| 43 | Dysphonia | FAERS: 18 | US FAERS | |
| 44 | Hypersensitivity | FAERS: 18 | SIDER US FAERS | |
| 45 | Dermatomyositis | FAERS: 17 | US FAERS | |
| 46 | Erectile dysfunction | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 47 | Respiratory Failure | FAERS: 17 | OFFSIDES US FAERS | |
| 48 | Abasia | FAERS: 16 | US FAERS | |
| 49 | Blood cholesterol increased | FAERS: 16 | US FAERS | |
| 50 | Dyspepsia | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 51 | Epistaxis | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 52 | Muscle necrosis | FAERS: 16 | US FAERS | |
| 53 | Product contamination physical | FAERS: 16 | US FAERS | |
| 54 | Activities of daily living impaired | FAERS: 15 | US FAERS | |
| 55 | Burning sensation | FAERS: 15 | US FAERS | |
| 56 | Chest discomfort | FAERS: 15 | US FAERS | |
| 57 | Deafness | FAERS: 15 | SIDER US FAERS | |
| 58 | jaundice | FAERS: 15 | 11177350 20155993 | CTD US FAERS |
| 59 | Angioedema | FAERS: 14 | SIDER US FAERS | |
| 60 | Cholestasis | FAERS: 14 | 10448788 16393626 20155993 | CTD SIDER US FAERS |
| 61 | Thrombocytopenia | FAERS: 14 | SIDER US FAERS | |
| 62 | Blood alkaline phosphatase increased | FAERS: 13 | OFFSIDES US FAERS | |
| 63 | Flatulence | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 64 | Product taste abnormal | FAERS: 13 | US FAERS | |
| 65 | Urticaria | FAERS: 13 | SIDER US FAERS | |
| 66 | Erythema | FAERS: 12 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 67 | Lethargy | FAERS: 12 | OFFSIDES US FAERS | |
| 68 | Rash erythematous | FAERS: 12 | US FAERS | |
| 69 | Drug exposure during pregnancy | FAERS: 11 | US FAERS | |
| 70 | Myocardial Infarction | FAERS: 11 | 16567950 24593216 | CTD US FAERS |
| 71 | Oropharyngeal pain | FAERS: 11 | US FAERS | |
| 72 | Tremor | FAERS: 11 | US FAERS | |
| 73 | Vertigo | FAERS: 11 | US FAERS | |
| 74 | Adverse event | FAERS: 10 | OFFSIDES US FAERS | |
| 75 | Angina Pectoris | FAERS: 10 | US FAERS | |
| 76 | Arthritis | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 77 | Blood glucose increased | FAERS: 10 | US FAERS | |
| 78 | Discomfort | FAERS: 10 | SIDER US FAERS | |
| 79 | Eructation | FAERS: 10 | SIDER US FAERS | |
| 80 | Mental impairment | FAERS: 10 | US FAERS | |
| 81 | Neck Pain | FAERS: 10 | SIDER US FAERS | |
| 82 | Pneumonia | FAERS: 10 | SIDER US FAERS | |
| 83 | Psoriasis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Tinnitus | FAERS: 10 | SIDER US FAERS | |
| 85 | Atrial Fibrillation | FAERS: 9 | US FAERS | |
| 86 | Hepatotoxicity | FAERS: 9 | US FAERS | |
| 87 | Personality Change | FAERS: 9 | US FAERS | |
| 88 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 89 | Dry skin | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 90 | Dysgeusia | FAERS: 8 | SIDER US FAERS | |
| 91 | Gout | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 92 | Hepatitis | FAERS: 8 | 12243603 | CTD OFFSIDES SIDER US FAERS |
| 93 | Muscle Fatigue | FAERS: 8 | SIDER US FAERS | |
| 94 | Myosclerosis | FAERS: 8 | US FAERS | |
| 95 | Peripheral swelling | FAERS: 8 | US FAERS | |
| 96 | Polyneuropathy | FAERS: 8 | OFFSIDES US FAERS | |
| 97 | Renal tubular necrosis | FAERS: 8 | OFFSIDES US FAERS | |
| 98 | Unevaluable event | FAERS: 8 | US FAERS | |
| 99 | Acute myocardial infarction | FAERS: 7 | OFFSIDES US FAERS | |
| 100 | Choking | FAERS: 7 | US FAERS | |
| 101 | Dementia | FAERS: 7 | US FAERS | |
| 102 | Feeling Cold | FAERS: 7 | US FAERS | |
| 103 | Low density lipoprotein increased | FAERS: 7 | US FAERS | |
| 104 | Myasthenia Gravis | FAERS: 7 | US FAERS | |
| 105 | Neuralgia | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 106 | Pemphigus | FAERS: 7 | US FAERS | |
| 107 | Polymyalgia Rheumatica | FAERS: 7 | US FAERS | |
| 108 | Pulmonary Fibrosis | FAERS: 7 | 24161914 | CTD US FAERS |
| 109 | Septic Shock | FAERS: 7 | US FAERS | |
| 110 | Tachycardia | FAERS: 7 | 15363994 | CTD US FAERS |
| 111 | Wheezing | FAERS: 7 | US FAERS | |
| 112 | Bulbar palsy | FAERS: 6 | US FAERS | |
| 113 | Depressed mood | FAERS: 6 | US FAERS | |
| 114 | Disorientation | FAERS: 6 | US FAERS | |
| 115 | Gamma-Glutamyltransferase Increased | FAERS: 6 | US FAERS | |
| 116 | Impaired work ability | FAERS: 6 | US FAERS | |
| 117 | Ligament pain | FAERS: 6 | US FAERS | |
| 118 | Malignant neoplasm progression | FAERS: 6 | US FAERS | |
| 119 | Muscle tightness | FAERS: 6 | OFFSIDES US FAERS | |
| 120 | No adverse event | FAERS: 6 | US FAERS | |
| 121 | Pain of skin | FAERS: 6 | OFFSIDES US FAERS | |
| 122 | Skin discomfort | FAERS: 6 | US FAERS | |
| 123 | Skin tightness | FAERS: 6 | OFFSIDES US FAERS | |
| 124 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 125 | Blood lactate dehydrogenase increased | FAERS: 5 | US FAERS | |
| 126 | Blood urine present | FAERS: 5 | US FAERS | |
| 127 | Cachexia | FAERS: 5 | US FAERS | |
| 128 | Cardiac Death | FAERS: 5 | US FAERS | |
| 129 | Cataract | FAERS: 5 | US FAERS | |
| 130 | Completed Suicide | FAERS: 5 | US FAERS | |
| 131 | Diplopia | FAERS: 5 | US FAERS | |
| 132 | Extranodal marginal zone B-cell lymphoma (MALT type) | FAERS: 5 | US FAERS | |
| 133 | Fibromyalgia | FAERS: 5 | OFFSIDES US FAERS | |
| 134 | Gait inability | FAERS: 5 | US FAERS | |
| 135 | Gastrointestinal Pain | FAERS: 5 | SIDER US FAERS | |
| 136 | Genital swelling | FAERS: 5 | US FAERS | |
| 137 | Lupus-like syndrome | FAERS: 5 | US FAERS | |
| 138 | Mixed liver injury | FAERS: 5 | US FAERS | |
| 139 | Musculoskeletal discomfort | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 140 | Musculoskeletal stiffness | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 141 | Necrosis | FAERS: 5 | CTD US FAERS | |
| 142 | Pancreatitis | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 143 | Pleurisy | FAERS: 5 | US FAERS | |
| 144 | Renal pain | FAERS: 5 | US FAERS | |
| 145 | Swelling | FAERS: 5 | US FAERS | |
| 146 | Syncope | FAERS: 5 | SIDER US FAERS | |
| 147 | muscle injury | FAERS: 5 | US FAERS | |
| 148 | Anger | FAERS: 4 | US FAERS | |
| 149 | Blood creatinine increased | FAERS: 4 | OFFSIDES US FAERS | |
| 150 | Blood urea increased | FAERS: 4 | OFFSIDES US FAERS | |
| 151 | Cardiac discomfort | FAERS: 4 | US FAERS | |
| 152 | Cellulitis | FAERS: 4 | US FAERS | |
| 153 | Circumstance or information capable of leading to medication error | FAERS: 4 | US FAERS | |
| 154 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 155 | Disease Progression | FAERS: 4 | US FAERS | |
| 156 | Diverticulitis | FAERS: 4 | OFFSIDES US FAERS | |
| 157 | Flank Pain | FAERS: 4 | OFFSIDES US FAERS | |
| 158 | Hypertransaminasaemia | FAERS: 4 | US FAERS | |
| 159 | Incontinence | FAERS: 4 | US FAERS | |
| 160 | Inflammation | FAERS: 4 | CTD US FAERS | |
| 161 | Joint stiffness | FAERS: 4 | US FAERS | |
| 162 | Limb discomfort | FAERS: 4 | US FAERS | |
| 163 | Loss of personal independence in daily activities | FAERS: 4 | US FAERS | |
| 164 | Macroglossia | FAERS: 4 | US FAERS | |
| 165 | Middle insomnia | FAERS: 4 | US FAERS | |
| 166 | Musculoskeletal chest pain | FAERS: 4 | OFFSIDES US FAERS | |
| 167 | Myoglobin blood increased | FAERS: 4 | OFFSIDES US FAERS | |
| 168 | Nervousness | FAERS: 4 | US FAERS | |
| 169 | Overweight | FAERS: 4 | US FAERS | |
| 170 | Paresis | FAERS: 4 | US FAERS | |
| 171 | Periarthritis | FAERS: 4 | US FAERS | |
| 172 | Product commingling | FAERS: 4 | US FAERS | |
| 173 | Product use complaint | FAERS: 4 | US FAERS | |
| 174 | Psychological Trauma | FAERS: 4 | US FAERS | |
| 175 | Quadriparesis | FAERS: 4 | US FAERS | |
| 176 | Respiratory muscle weakness | FAERS: 4 | US FAERS | |
| 177 | Skin irritation | FAERS: 4 | US FAERS | |
| 178 | Stenosis | FAERS: 4 | US FAERS | |
| 179 | Transient aphasia | FAERS: 4 | US FAERS | |
| 180 | Urinary Incontinence | FAERS: 4 | SIDER US FAERS | |
| 181 | Urinary tract infection | FAERS: 4 | SIDER US FAERS | |
| 182 | Agitation | FAERS: 3 | SIDER US FAERS | |
| 183 | Anuria | FAERS: 3 | US FAERS | |
| 184 | Aphagia | FAERS: 3 | US FAERS | |
| 185 | Apparent death | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 186 | Blindness | FAERS: 3 | US FAERS | |
| 187 | Blood creatine phosphokinase MB increased | FAERS: 3 | US FAERS | |
| 188 | Blood triglycerides increased | FAERS: 3 | OFFSIDES US FAERS | |
| 189 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 190 | Chills | FAERS: 3 | US FAERS | |
| 191 | Cholestatic liver injury | FAERS: 3 | US FAERS | |
| 192 | Contraindicated product administered | FAERS: 3 | US FAERS | |
| 193 | Dehydration | FAERS: 3 | OFFSIDES US FAERS | |
| 194 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 195 | Depression suicidal | FAERS: 3 | US FAERS | |
| 196 | Dermatitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 197 | Dissociation | FAERS: 3 | US FAERS | |
| 198 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 199 | Drug dose omission | FAERS: 3 | US FAERS | |
| 200 | Epilepsy | FAERS: 3 | US FAERS | |
| 201 | Eye pain | FAERS: 3 | US FAERS | |
| 202 | Gastritis | FAERS: 3 | SIDER US FAERS | |
| 203 | Hepatitis B | FAERS: 3 | US FAERS | |
| 204 | Immobile | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 205 | Incorrect dose administered | FAERS: 3 | US FAERS | |
| 206 | Lip swelling | FAERS: 3 | US FAERS | |
| 207 | Mastitis | FAERS: 3 | US FAERS | |
| 208 | Monoparesis | FAERS: 3 | US FAERS | |
| 209 | Muscle enzyme increased | FAERS: 3 | US FAERS | |
| 210 | Muscle strain | FAERS: 3 | US FAERS | |
| 211 | Myoglobinuria | FAERS: 3 | SIDER US FAERS | |
| 212 | Nodular rash | FAERS: 3 | US FAERS | |
| 213 | Orchitis | FAERS: 3 | US FAERS | |
| 214 | Osteopenia | FAERS: 3 | OFFSIDES US FAERS | |
| 215 | Paramnesia | FAERS: 3 | US FAERS | |
| 216 | Peripheral nerve palsy | FAERS: 3 | US FAERS | |
| 217 | Photophobia | FAERS: 3 | US FAERS | |
| 218 | Product contamination | FAERS: 3 | US FAERS | |
| 219 | Product counterfeit | FAERS: 3 | US FAERS | |
| 220 | Product label issue | FAERS: 3 | US FAERS | |
| 221 | Sepsis | FAERS: 3 | US FAERS | |
| 222 | Sluggishness | FAERS: 3 | US FAERS | |
| 223 | Somnambulism | FAERS: 3 | US FAERS | |
| 224 | Somnolence | FAERS: 3 | SIDER US FAERS | |
| 225 | Urinary Retention | FAERS: 3 | SIDER US FAERS | |
| 226 | Uveitis | FAERS: 3 | US FAERS | |
| 227 | Vasculitis | FAERS: 3 | US FAERS | |
| 228 | Wrong technique in drug usage process | FAERS: 3 | US FAERS | |
| 229 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 230 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 231 | Antibody test positive | FAERS: 2 | US FAERS | |
| 232 | Apathy | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 233 | Aphasia | FAERS: 2 | US FAERS | |
| 234 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 235 | Arthropathy | FAERS: 2 | OFFSIDES US FAERS | |
| 236 | Asthenopia | FAERS: 2 | US FAERS | |
| 237 | Biliary Colic | FAERS: 2 | SIDER US FAERS | |
| 238 | Blood calcitonin increased | FAERS: 2 | US FAERS | |
| 239 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 240 | Blood creatine phosphokinase abnormal | FAERS: 2 | US FAERS | |
| 241 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 242 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 243 | Bursitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 244 | Carcinoembryonic antigen increased | FAERS: 2 | US FAERS | |
| 245 | Carcinoma | FAERS: 2 | US FAERS | |
| 246 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 247 | Colitis | FAERS: 2 | SIDER US FAERS | |
| 248 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 249 | Delirium | FAERS: 2 | US FAERS | |
| 250 | Diverticulum | FAERS: 2 | OFFSIDES US FAERS | |
| 251 | Drug exposure before pregnancy | FAERS: 2 | US FAERS | |
| 252 | Early satiety | FAERS: 2 | US FAERS | |
| 253 | Excoriation | FAERS: 2 | OFFSIDES US FAERS | |
| 254 | Exposure via partner | FAERS: 2 | US FAERS | |
| 255 | Extra dose administered | FAERS: 2 | US FAERS | |
| 256 | Fascial rupture | FAERS: 2 | US FAERS | |
| 257 | Flushing | FAERS: 2 | US FAERS | |
| 258 | Fungating wound | FAERS: 2 | US FAERS | |
| 259 | Head discomfort | FAERS: 2 | US FAERS | |
| 260 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 261 | Hypoventilation | FAERS: 2 | US FAERS | |
| 262 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 263 | Influenza | FAERS: 2 | SIDER US FAERS | |
| 264 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 265 | Leukopenia | FAERS: 2 | US FAERS | |
| 266 | Lymphomatoid Papulosis | FAERS: 2 | US FAERS | |
| 267 | Medication Error | FAERS: 2 | US FAERS | |
| 268 | Mental status changes | FAERS: 2 | OFFSIDES US FAERS | |
| 269 | Nephritis | FAERS: 2 | SIDER US FAERS | |
| 270 | Nephrolithiasis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 271 | Night sweats | FAERS: 2 | US FAERS | |
| 272 | Nocturia | FAERS: 2 | SIDER US FAERS | |
| 273 | Papule | FAERS: 2 | US FAERS | |
| 274 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 275 | Polyuria | FAERS: 2 | OFFSIDES US FAERS | |
| 276 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 277 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 278 | Product packaging issue | FAERS: 2 | US FAERS | |
| 279 | Product physical issue | FAERS: 2 | US FAERS | |
| 280 | Product prescribing error | FAERS: 2 | US FAERS | |
| 281 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 282 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 283 | Respiratory Depression | FAERS: 2 | US FAERS | |
| 284 | Respiratory distress | FAERS: 2 | US FAERS | |
| 285 | Retching | FAERS: 2 | US FAERS | |
| 286 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 287 | Sciatica | FAERS: 2 | US FAERS | |
| 288 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 289 | Sinus bradycardia | FAERS: 2 | OFFSIDES US FAERS | |
| 290 | Sinusitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 291 | Skin lesion | FAERS: 2 | OFFSIDES US FAERS | |
| 292 | Skin reaction | FAERS: 2 | US FAERS | |
| 293 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 294 | Therapy cessation | FAERS: 2 | US FAERS | |
| 295 | Thirst | FAERS: 2 | US FAERS | |
| 296 | Throat irritation | FAERS: 2 | US FAERS | |
| 297 | Thrombocytopenic purpura | FAERS: 2 | US FAERS | |
| 298 | Thyroid cancer metastatic | FAERS: 2 | US FAERS | |
| 299 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 300 | Violence-related symptom | FAERS: 2 | US FAERS | |
| 301 | Wheelchair user | FAERS: 2 | US FAERS | |
| 302 | Acquired macroglossia | FAERS: 1 | US FAERS | |
| 303 | Acute Coronary Syndrome | FAERS: 1 | 15300960 18440347 | CTD US FAERS |
| 304 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 305 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 306 | Aldolase increased | FAERS: 1 | OFFSIDES US FAERS | |
| 307 | Amylase increased | FAERS: 1 | US FAERS | |
| 308 | Anal Fistula | FAERS: 1 | US FAERS | |
| 309 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 310 | Angioplasty | FAERS: 1 | US FAERS | |
| 311 | Anosmia | FAERS: 1 | US FAERS | |
| 312 | Antiacetylcholine receptor antibody positive | FAERS: 1 | US FAERS | |
| 313 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 314 | Asphyxia | FAERS: 1 | US FAERS | |
| 315 | Asthma | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 316 | Ataxia | FAERS: 1 | 20331937 | CTD US FAERS |
| 317 | Atelectasis | FAERS: 1 | OFFSIDES US FAERS | |
| 318 | Atherosclerosis | FAERS: 1 | 9690910 23337345 | CTD OFFSIDES US FAERS |
| 319 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 320 | Biopsy liver abnormal | FAERS: 1 | US FAERS | |
| 321 | Biopsy lymph gland abnormal | FAERS: 1 | US FAERS | |
| 322 | Blepharospasm | FAERS: 1 | US FAERS | |
| 323 | Blood 25-hydroxycholecalciferol decreased | FAERS: 1 | US FAERS | |
| 324 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 325 | Blood cholesterol abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 326 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 327 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 328 | Blood glucose decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 329 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 330 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 331 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 332 | Blood magnesium decreased | FAERS: 1 | SIDER US FAERS | |
| 333 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 334 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 335 | Bradycardia | FAERS: 1 | US FAERS | |
| 336 | Bronchitis | FAERS: 1 | SIDER US FAERS | |
| 337 | Capsular warning syndrome | FAERS: 1 | US FAERS | |
| 338 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 339 | Cardiomegaly | FAERS: 1 | 18360054 19136528 | CTD US FAERS |
| 340 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 341 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 342 | Cholangiolitis | FAERS: 1 | OFFSIDES US FAERS | |
| 343 | Cholangitis | FAERS: 1 | 20155993 | CTD US FAERS |
| 344 | Cholelithiasis | FAERS: 1 | 11177350 | CTD US FAERS |
| 345 | Chorea | FAERS: 1 | US FAERS | |
| 346 | Cleft Palate | FAERS: 1 | US FAERS | |
| 347 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 348 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 349 | Critical Illness | FAERS: 1 | US FAERS | |
| 350 | Cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 351 | Diplegia | FAERS: 1 | US FAERS | |
| 352 | Disease recurrence | FAERS: 1 | US FAERS | |
| 353 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 354 | Drug administration error | FAERS: 1 | US FAERS | |
| 355 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 356 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 357 | Drug level decreased | FAERS: 1 | US FAERS | |
| 358 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 359 | Drug specific antibody present | FAERS: 1 | US FAERS | |
| 360 | Dysarthria | FAERS: 1 | 15596782 | CTD US FAERS |
| 361 | Dysuria | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 362 | Ear discomfort | FAERS: 1 | US FAERS | |
| 363 | Economic problem | FAERS: 1 | US FAERS | |
| 364 | Eczema | FAERS: 1 | SIDER US FAERS | |
| 365 | Emotional disorder | FAERS: 1 | US FAERS | |
| 366 | Enterobacter pneumonia | FAERS: 1 | US FAERS | |
| 367 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 368 | Epstein-Barr virus antibody positive | FAERS: 1 | US FAERS | |
| 369 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 370 | Expired drug administered | FAERS: 1 | US FAERS | |
| 371 | Expired product administered | FAERS: 1 | US FAERS | |
| 372 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 373 | False positive investigation result | FAERS: 1 | US FAERS | |
| 374 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 375 | Fluid overload | FAERS: 1 | OFFSIDES US FAERS | |
| 376 | Full blood count increased | FAERS: 1 | US FAERS | |
| 377 | Gastric mucosa erythema | FAERS: 1 | US FAERS | |
| 378 | Glaucoma | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 379 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 380 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 381 | Hemiparesis | FAERS: 1 | US FAERS | |
| 382 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 383 | Hepatitis A antibody positive | FAERS: 1 | US FAERS | |
| 384 | Hepatomegaly | FAERS: 1 | 30273964 | CTD US FAERS |
| 385 | Hilar lymphadenopathy | FAERS: 1 | US FAERS | |
| 386 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 387 | Hyperacusis | FAERS: 1 | US FAERS | |
| 388 | Hypercreatinaemia | FAERS: 1 | US FAERS | |
| 389 | Hypokinesia | FAERS: 1 | US FAERS | |
| 390 | Hypotension | FAERS: 1 | 11676178 15363994 | CTD US FAERS |
| 391 | Hysterectomy | FAERS: 1 | US FAERS | |
| 392 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 393 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 394 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 395 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 396 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 397 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 398 | Infarction | FAERS: 1 | US FAERS | |
| 399 | Infection | FAERS: 1 | SIDER US FAERS | |
| 400 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 401 | Iron Overload | FAERS: 1 | US FAERS | |
| 402 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 403 | Joint injury | FAERS: 1 | US FAERS | |
| 404 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 405 | Leukocytosis | FAERS: 1 | US FAERS | |
| 406 | Libido disorder | FAERS: 1 | US FAERS | |
| 407 | Lichen Planus | FAERS: 1 | US FAERS | |
| 408 | Lip erosion | FAERS: 1 | OFFSIDES US FAERS | |
| 409 | Lipase increased | FAERS: 1 | US FAERS | |
| 410 | Lipids abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 411 | Lipoma | FAERS: 1 | US FAERS | |
| 412 | Live Birth | FAERS: 1 | US FAERS | |
| 413 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 414 | Low density lipoprotein abnormal | FAERS: 1 | US FAERS | |
| 415 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 416 | Mastication disorder | FAERS: 1 | US FAERS | |
| 417 | Medication residue present | FAERS: 1 | US FAERS | |
| 418 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 419 | Mood swings | FAERS: 1 | SIDER US FAERS | |
| 420 | Mouth swelling | FAERS: 1 | US FAERS | |
| 421 | Multiple Myeloma | FAERS: 1 | OFFSIDES US FAERS | |
| 422 | Multiple allergies | FAERS: 1 | US FAERS | |
| 423 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 424 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 425 | Nasopharyngitis | FAERS: 1 | SIDER US FAERS | |
| 426 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 427 | Nodule | FAERS: 1 | OFFSIDES US FAERS | |
| 428 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 429 | Nuchal Rigidity | FAERS: 1 | SIDER US FAERS | |
| 430 | Obstruction | FAERS: 1 | US FAERS | |
| 431 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 432 | Ocular icterus | FAERS: 1 | US FAERS | |
| 433 | Oliguria | FAERS: 1 | US FAERS | |
| 434 | Onychoclasis | FAERS: 1 | US FAERS | |
| 435 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 436 | Overlap syndrome | FAERS: 1 | US FAERS | |
| 437 | Pallor | FAERS: 1 | US FAERS | |
| 438 | Paranoia | FAERS: 1 | US FAERS | |
| 439 | Parapsoriasis | FAERS: 1 | US FAERS | |
| 440 | Parotitis | FAERS: 1 | US FAERS | |
| 441 | Petechiae | FAERS: 1 | SIDER US FAERS | |
| 442 | Physical assault | FAERS: 1 | US FAERS | |
| 443 | Pneumonitis | FAERS: 1 | US FAERS | |
| 444 | Poisoning | FAERS: 1 | US FAERS | |
| 445 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 446 | Post procedural complication | FAERS: 1 | US FAERS | |
| 447 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 448 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 449 | Presyncope | FAERS: 1 | US FAERS | |
| 450 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 451 | Product container seal issue | FAERS: 1 | US FAERS | |
| 452 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 453 | Product dispensing error | FAERS: 1 | US FAERS | |
| 454 | Product formulation issue | FAERS: 1 | US FAERS | |
| 455 | Product lot number issue | FAERS: 1 | US FAERS | |
| 456 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 457 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 458 | Product shape issue | FAERS: 1 | US FAERS | |
| 459 | Product size issue | FAERS: 1 | US FAERS | |
| 460 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 461 | Product tampering | FAERS: 1 | US FAERS | |
| 462 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 463 | Productive Cough | FAERS: 1 | US FAERS | |
| 464 | Protein urine present | FAERS: 1 | US FAERS | |
| 465 | Proteinuria | FAERS: 1 | 21150335 | CTD US FAERS |
| 466 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 467 | Purpura | FAERS: 1 | US FAERS | |
| 468 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 469 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 470 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 471 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 472 | Rhinitis | FAERS: 1 | SIDER US FAERS | |
| 473 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 474 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 475 | Scleroderma | FAERS: 1 | US FAERS | |
| 476 | Serum Sickness | FAERS: 1 | US FAERS | |
| 477 | Shock | FAERS: 1 | SIDER US FAERS | |
| 478 | Sicca Syndrome | FAERS: 1 | US FAERS | |
| 479 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 480 | Skin Erosion | FAERS: 1 | US FAERS | |
| 481 | Skin Ulcer | FAERS: 1 | SIDER US FAERS | |
| 482 | Skin hypertrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 483 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 484 | Snoring | FAERS: 1 | OFFSIDES US FAERS | |
| 485 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 486 | Spina Bifida | FAERS: 1 | US FAERS | |
| 487 | Stevens-Johnson Syndrome | FAERS: 1 | 25811541 | CTD SIDER US FAERS |
| 488 | Stomatitis | FAERS: 1 | SIDER US FAERS | |
| 489 | Stress | FAERS: 1 | OFFSIDES US FAERS | |
| 490 | Talipes | FAERS: 1 | US FAERS | |
| 491 | Tension | FAERS: 1 | US FAERS | |
| 492 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 493 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 494 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 495 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 496 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 497 | Tobacco user | FAERS: 1 | OFFSIDES US FAERS | |
| 498 | Toothache | FAERS: 1 | US FAERS | |
| 499 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 500 | Ulcer | FAERS: 1 | US FAERS | |
| 501 | VIIth nerve paralysis | FAERS: 1 | SIDER US FAERS | |
| 502 | Venous occlusion | FAERS: 1 | US FAERS | |
| 503 | Ventricular Fibrillation | FAERS: 1 | OFFSIDES US FAERS | |
| 504 | Viral myositis | FAERS: 1 | US FAERS | |
| 505 | treatment failure | FAERS: 1 | US FAERS | |
| 506 | Abdominal rigidity | OFFSIDES | ||
| 507 | Abnormal ejaculation | SIDER | ||
| 508 | Abnormal vision | OFFSIDES | ||
| 509 | Acid reflux | OFFSIDES | ||
| 510 | Actinomycosis | OFFSIDES | ||
| 511 | Acute otitis media | OFFSIDES | ||
| 512 | Acute psychosis | OFFSIDES | ||
| 513 | Adenocarcinoma | OFFSIDES | ||
| 514 | Ageusia | SIDER | ||
| 515 | Alcohol problem | OFFSIDES | ||
| 516 | Amblyopia | SIDER | ||
| 517 | Amphetamines | OFFSIDES | ||
| 518 | Amyloidosis | OFFSIDES | ||
| 519 | Anemia | 20946910 | CTD | |
| 520 | Anhedonia | OFFSIDES | ||
| 521 | Anhidrosis | OFFSIDES | ||
| 522 | Anorectal discomfort | SIDER | ||
| 523 | Anorexia | OFFSIDES SIDER | ||
| 524 | Anti-Neutrophil Cytoplasmic Antibody-Associated Vasculitis | 18839266 | CTD | |
| 525 | Anti-erythropoietin antibody positive | OFFSIDES | ||
| 526 | Aortic Aneurysm, Abdominal | 19935899 | CTD | |
| 527 | Aortic Diseases | 20694523 | CTD | |
| 528 | Aphonia | OFFSIDES | ||
| 529 | Aspiration Pneumonia | OFFSIDES | ||
| 530 | Asterixis | OFFSIDES | ||
| 531 | Atrial tachycardia | OFFSIDES | ||
| 532 | Atrioventricular Block | 12773066 | CTD | |
| 533 | Atrophic vulvovaginitis | OFFSIDES | ||
| 534 | Basal cell carcinoma | OFFSIDES | ||
| 535 | Benign neoplasm of thyroid gland | OFFSIDES | ||
| 536 | Bipolar Disorder | OFFSIDES | ||
| 537 | Bladder pain | SIDER | ||
| 538 | Blood Glucose | OFFSIDES | ||
| 539 | Blood and lymphatic system disorders | SIDER | ||
| 540 | Blood cholesterol | OFFSIDES | ||
| 541 | Blood parathyroid hormone decreased | OFFSIDES | ||
| 542 | Blood pressure fluctuation | OFFSIDES | ||
| 543 | Blood pressure inadequately controlled | OFFSIDES | ||
| 544 | Blood sodium | OFFSIDES | ||
| 545 | Bone erosion | OFFSIDES | ||
| 546 | Bone fragmentation | OFFSIDES | ||
| 547 | Bone lesion | OFFSIDES | ||
| 548 | Brain Injuries | 17521631 | CTD | |
| 549 | Bullous lung disease | OFFSIDES | ||
| 550 | Calcinosis | OFFSIDES | ||
| 551 | Cardioactive drug level | OFFSIDES | ||
| 552 | Cardiovascular Diseases | 16259526 | CTD | |
| 553 | Cataract operation | OFFSIDES | ||
| 554 | Cerebral Hemorrhage | 15166393 15255259 | CTD | |
| 555 | Cerebral atrophy | OFFSIDES | ||
| 556 | Cheilitis | SIDER | ||
| 557 | Chemical and Drug Induced Liver Injury | CTD | ||
| 558 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 559 | Congenital heart disease | OFFSIDES | ||
| 560 | Congenital tracheomalacia | OFFSIDES | ||
| 561 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 562 | Conjunctival deposit | OFFSIDES | ||
| 563 | Coronary Artery Disease | CTD | ||
| 564 | Cramps of lower extremities | SIDER | ||
| 565 | Creatine Phosphokinase Increased | SIDER | ||
| 566 | Cyst aspiration | OFFSIDES | ||
| 567 | Cystitis | 18468659 | CTD SIDER | |
| 568 | Cystocele | OFFSIDES | ||
| 569 | Dental discomfort | OFFSIDES | ||
| 570 | Dental prosthesis placement | OFFSIDES | ||
| 571 | Depressive disorder | 12954916 | CTD | |
| 572 | Dextrocardia | OFFSIDES | ||
| 573 | Diabetes | OFFSIDES | ||
| 574 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 575 | Diabetic Nephropathy | OFFSIDES | ||
| 576 | Diabetic Retinopathy | 16973667 | CTD | |
| 577 | Disseminated Intravascular Coagulation | 16780456 | CTD | |
| 578 | Disturbance in sexual arousal | SIDER | ||
| 579 | Duodenal Ulcer | SIDER | ||
| 580 | Dyslipidemias | CTD | ||
| 581 | Dyspnea | 24593216 | CTD | |
| 582 | Ear and labyrinth disorders | SIDER | ||
| 583 | Ecchymosis | SIDER | ||
| 584 | Ejection Fraction Decreased | OFFSIDES | ||
| 585 | Electrocardiogram ST-T segment abnormal | OFFSIDES | ||
| 586 | Emotional distress | OFFSIDES | ||
| 587 | Endodontic procedure | OFFSIDES | ||
| 588 | Enteritis | SIDER | ||
| 589 | Eosinophilia | 11177350 | CTD | |
| 590 | Epicondylitis | OFFSIDES | ||
| 591 | Epididymitis | SIDER | ||
| 592 | Essential Hypertension | OFFSIDES | ||
| 593 | Eye laser surgery | OFFSIDES | ||
| 594 | Facial Neuralgia | OFFSIDES | ||
| 595 | Facial paralysis | SIDER | ||
| 596 | Factor XI Deficiency | OFFSIDES | ||
| 597 | Failure to Thrive | OFFSIDES | ||
| 598 | Fibrosis | 17589825 21570962 | CTD | |
| 599 | Fluid replacement | OFFSIDES | ||
| 600 | Gastric ulcer | SIDER | ||
| 601 | Gastroenteritis | OFFSIDES SIDER | ||
| 602 | Gastrointestinal inflammation | OFFSIDES | ||
| 603 | Gingival graft | OFFSIDES | ||
| 604 | Glasgow coma scale | OFFSIDES | ||
| 605 | Globulinuria | OFFSIDES | ||
| 606 | Glossitis | SIDER | ||
| 607 | Grip strength | OFFSIDES | ||
| 608 | Hay fever | OFFSIDES | ||
| 609 | Heart failure | 16360360 | CTD | |
| 610 | Hematuria | 18468659 | CTD | |
| 611 | Hemolytic-Uremic Syndrome | 16780456 | CTD | |
| 612 | Hernia | OFFSIDES | ||
| 613 | Hiccough | OFFSIDES | ||
| 614 | Hip surgery | OFFSIDES | ||
| 615 | Hypercholesterolemia | CTD | ||
| 616 | Hyperglycemia | 26616219 28266800 30657622 | CTD | |
| 617 | Hyperkinesia | SIDER | ||
| 618 | Hyperlipoproteinemias | 12633795 12842237 19240310 | CTD | |
| 619 | Hypertriglyceridemia | 12633795 15304625 21122807 | CTD | |
| 620 | Hypertrophy | 17575010 | CTD | |
| 621 | Hypolipoproteinemias | 19240310 | CTD | |
| 622 | Infestation | SIDER | ||
| 623 | Intercapillary glomerulosclerosis | OFFSIDES | ||
| 624 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 625 | JC virus infection | OFFSIDES | ||
| 626 | Kidney Diseases | 15831368 | CTD | |
| 627 | Kidney Failure | OFFSIDES | ||
| 628 | Laceration | OFFSIDES | ||
| 629 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 630 | Left atrial dilatation | OFFSIDES | ||
| 631 | Leukoaraiosis | OFFSIDES | ||
| 632 | Leukoencephalopathy | OFFSIDES | ||
| 633 | Life expectancy shortened | OFFSIDES | ||
| 634 | Limb injury | OFFSIDES | ||
| 635 | Limb operation | OFFSIDES | ||
| 636 | Liver Cirrhosis, Experimental | 17347453 | CTD | |
| 637 | Liver Failure, Acute | 12765306 | CTD | |
| 638 | Loose tooth | OFFSIDES | ||
| 639 | Lumbar radiculopathy | OFFSIDES | ||
| 640 | Lymphadenopathy | SIDER | ||
| 641 | Lymphedema | OFFSIDES | ||
| 642 | Malnutrition | SIDER | ||
| 643 | Mastectomy | OFFSIDES | ||
| 644 | Maxillofacial operation | OFFSIDES | ||
| 645 | Memory Loss | SIDER | ||
| 646 | Metastatic Neoplasm | OFFSIDES | ||
| 647 | Metrorrhagia | SIDER | ||
| 648 | Mg reduced | SIDER | ||
| 649 | Migraine Disorders | 19733216 | CTD | |
| 650 | Mitochondrial Myopathies | 12353945 16218940 | CTD | |
| 651 | Motor Disorders | 27345130 | CTD | |
| 652 | Muscle Weakness | 12353945 24593216 30511338 | CTD OFFSIDES | |
| 653 | Myocardial Reperfusion Injury | 15837263 | CTD | |
| 654 | Myoglobin urine present | SIDER | ||
| 655 | Neck stiffness | SIDER | ||
| 656 | Neoplasms | 20876807 | CTD | |
| 657 | Nephritic syndrome | OFFSIDES | ||
| 658 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 659 | Nephrotic Syndrome | 19348381 | CTD | |
| 660 | Neurogenic Inflammation | 20816828 | CTD | |
| 661 | Non-cardiac chest pain | OFFSIDES | ||
| 662 | Occult blood positive | OFFSIDES | ||
| 663 | Open wound | OFFSIDES | ||
| 664 | Oral Cavity Fistula | OFFSIDES | ||
| 665 | Oral mucosa atrophy | OFFSIDES | ||
| 666 | Osteoporosis | OFFSIDES | ||
| 667 | Panic Disorder | OFFSIDES | ||
| 668 | Periodontal infection | OFFSIDES | ||
| 669 | Periodontal operation | OFFSIDES | ||
| 670 | Periodontitis | OFFSIDES | ||
| 671 | Peripheral Nervous System Diseases | 9671841 | CTD | |
| 672 | Pharyngitis | SIDER | ||
| 673 | Pharyngolaryngeal Pain | SIDER | ||
| 674 | Phlebitis | SIDER | ||
| 675 | Photosensitivity Disorders | 24593216 | CTD | |
| 676 | Plasmacytosis | OFFSIDES | ||
| 677 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 678 | Postoperative ileus | OFFSIDES | ||
| 679 | Primary sequestrum | OFFSIDES | ||
| 680 | Progesterone receptor assay | OFFSIDES | ||
| 681 | Pulmonary sepsis | OFFSIDES | ||
| 682 | Purulent discharge | OFFSIDES | ||
| 683 | Pyelonephritis | OFFSIDES | ||
| 684 | Rectal polyp | OFFSIDES | ||
| 685 | Rectal tenesmus | SIDER | ||
| 686 | Rectocele | OFFSIDES | ||
| 687 | Renal cyst | OFFSIDES | ||
| 688 | Renal lipomatosis | OFFSIDES | ||
| 689 | Renal tubular disorder | OFFSIDES | ||
| 690 | Schizoaffective Disorder | OFFSIDES | ||
| 691 | Seizures | 19526287 | CTD | |
| 692 | Sequestrectomy | OFFSIDES | ||
| 693 | Situs Inversus | OFFSIDES | ||
| 694 | Skin Induration | OFFSIDES | ||
| 695 | Skin neoplasm excision | OFFSIDES | ||
| 696 | Soft tissue inflammation | OFFSIDES | ||
| 697 | Spinal Cord Injuries | 19429019 | CTD | |
| 698 | Spinal fusion surgery | OFFSIDES | ||
| 699 | Spondylolisthesis | OFFSIDES | ||
| 700 | Squamous cell carcinoma of skin | OFFSIDES | ||
| 701 | Stem cell transplant | OFFSIDES | ||
| 702 | Stent occlusion | OFFSIDES | ||
| 703 | Sweating | SIDER | ||
| 704 | Tenosynovitis | SIDER | ||
| 705 | Testicular Diseases | 17200428 | CTD | |
| 706 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 707 | Thrombosis | 12490971 16689755 | CTD | |
| 708 | Tooth Extraction | OFFSIDES | ||
| 709 | Tooth Loss | OFFSIDES | ||
| 710 | Torticollis | SIDER | ||
| 711 | Toxic Epidermal Necrolysis | SIDER | ||
| 712 | Transfusion Reaction | OFFSIDES | ||
| 713 | Ulcerative stomatitis | SIDER | ||
| 714 | Ureteral obstruction | 17222681 | CTD | |
| 715 | Urine leukocyte esterase | OFFSIDES | ||
| 716 | Uterine Cancer | OFFSIDES | ||
| 717 | Vascular Diseases | 18951979 19943121 | CTD | |
| 718 | Venous Insufficiency | OFFSIDES | ||
| 719 | Venous angioma of brain | OFFSIDES | ||
| 720 | Viral upper respiratory tract infection | OFFSIDES | ||
| 721 | Visual disturbance | OFFSIDES | ||
| 722 | Vitamin A Deficiency | OFFSIDES | ||
| 723 | Vitamin D abnormal | OFFSIDES | ||
| 724 | Weight Gain | OFFSIDES | ||
| 725 | Wound dehiscence | OFFSIDES | ||
| 726 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120141
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.