Canagliflozin
(XTNGUQKDFGDXSJ-ZXGKGEBGSA-N)
Structure
- SMILES
- OC[C@H]1O[C@@H](c2ccc(c(c2)Cc2ccc(s2)c2ccc(cc2)F)C)[C@@H]([C@H]([C@@H]1O)O)O
- Type(s)
- Approved
- ATC code(s)
- A10BD16; A10BK02
- Molecular Formula:
- C24H25FO5S
- Molecular Weight:
- 444.516
- Log P:
- 2.9683
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 4
- TPSA:
- 118.39
- CAS Number(s):
- 842133-18-0; 928672-86-0
Synonym(s)
1.
Canagliflozin
2.
1-(Glucopyranosyl)-4-methyl-3-(5-(4-fluorophenyl)-2-thienylmethyl)benzene - T777973
3.
Canagliflozin Hemihydrate
4.
Canagliflozin, Anhydrous
5.
Invokana
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Diabetic Ketoacidosis | FAERS: 1784 Canada Vigilance: 68 | Canada Vigilance US FAERS | |
| 2 | Osteomyelitis | FAERS: 1541 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 3 | Acute kidney injury | FAERS: 1084 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 4 | Gangrene | FAERS: 727 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Cellulitis | FAERS: 715 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 6 | Urinary tract infection | FAERS: 570 Canada Vigilance: 20 | Canada Vigilance SIDER US FAERS | |
| 7 | Diabetic Foot | FAERS: 562 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Diabetic foot infection | FAERS: 510 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Ketoacidosis | FAERS: 483 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 10 | Skin Ulcer | FAERS: 434 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Weight decreased | FAERS: 417 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Dehydration | FAERS: 291 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 13 | Sepsis | FAERS: 289 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 14 | Dizziness | FAERS: 288 Canada Vigilance: 11 | Canada Vigilance SIDER US FAERS | |
| 15 | Myocardial Infarction | FAERS: 286 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 16 | Amputation | FAERS: 279 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 17 | Adverse event | FAERS: 258 | US FAERS | |
| 18 | Cerebrovascular accident | FAERS: 249 | US FAERS | |
| 19 | Drug ineffective | FAERS: 245 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 20 | Genital infection fungal | FAERS: 203 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 21 | Blood glucose increased | FAERS: 196 | US FAERS | |
| 22 | Nausea | FAERS: 194 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 23 | Diabetic ulcer | FAERS: 179 | US FAERS | |
| 24 | Drug prescribing error | FAERS: 147 | US FAERS | |
| 25 | Metabolic acidosis | FAERS: 142 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Drug dose omission | FAERS: 141 | US FAERS | |
| 27 | Product use issue | FAERS: 132 | US FAERS | |
| 28 | Incorrect dose administered | FAERS: 122 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 29 | Pancreatitis | FAERS: 119 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 30 | Vomiting | FAERS: 107 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 31 | Headache | FAERS: 99 | US FAERS | |
| 32 | Fatigue | FAERS: 97 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 33 | Malaise | FAERS: 97 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 34 | Inappropriate schedule of drug administration | FAERS: 96 | US FAERS | |
| 35 | Urine output increased | FAERS: 95 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Back Pain | FAERS: 93 | US FAERS | |
| 37 | Blood creatinine increased | FAERS: 89 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 38 | Hypotension | FAERS: 84 Canada Vigilance: 7 | Canada Vigilance SIDER US FAERS | |
| 39 | Feeling abnormal | FAERS: 82 | US FAERS | |
| 40 | Extremity necrosis | FAERS: 77 | US FAERS | |
| 41 | Gas Gangrene | FAERS: 77 | US FAERS | |
| 42 | Dry gangrene | FAERS: 76 | US FAERS | |
| 43 | Urticaria | FAERS: 70 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 44 | Dysuria | FAERS: 68 | US FAERS | |
| 45 | Wrong technique in product usage process | FAERS: 67 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 46 | Asthenia | FAERS: 66 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 47 | Balanoposthitis | FAERS: 66 | US FAERS | |
| 48 | Nephrolithiasis | FAERS: 64 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 49 | Product use in unapproved indication | FAERS: 63 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 50 | Hypersensitivity | FAERS: 62 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 51 | Thirst | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 52 | Pain | FAERS: 60 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 53 | Pruritus | FAERS: 54 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 54 | Vulvovaginal mycotic infection | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 55 | Blood glucose decreased | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 56 | Pyelonephritis | FAERS: 53 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 57 | Unevaluable event | FAERS: 53 | US FAERS | |
| 58 | Diabetes mellitus inadequate control | FAERS: 51 | US FAERS | |
| 59 | Abdominal Pain | FAERS: 50 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 60 | Alopecia | FAERS: 47 | US FAERS | |
| 61 | Necrosis | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Polyuria | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 63 | Abdominal discomfort | FAERS: 45 | US FAERS | |
| 64 | Infection | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 65 | Constipation | FAERS: 43 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 66 | Septic Shock | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Blood urine present | FAERS: 41 | US FAERS | |
| 68 | Therapeutic response unexpected | FAERS: 36 | US FAERS | |
| 69 | Ulcer | FAERS: 36 | US FAERS | |
| 70 | Arthralgia | FAERS: 35 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 71 | Blood potassium increased | FAERS: 33 | SIDER US FAERS | |
| 72 | Cystitis | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 73 | Nocturia | FAERS: 33 | SIDER US FAERS | |
| 74 | Peripheral swelling | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 75 | Chest Pain | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Myalgia | FAERS: 32 | US FAERS | |
| 77 | Syncope | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 78 | Vulvovaginal pruritus | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 79 | Wrong technique in drug usage process | FAERS: 30 | US FAERS | |
| 80 | Palpitations | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 81 | Pneumonia | FAERS: 29 | US FAERS | |
| 82 | Acute respiratory failure | FAERS: 28 | US FAERS | |
| 83 | Flank Pain | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Tremor | FAERS: 26 | US FAERS | |
| 85 | Visual Impairment | FAERS: 26 | US FAERS | |
| 86 | Wound Infection | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Acute myocardial infarction | FAERS: 22 | US FAERS | |
| 88 | Erythema | FAERS: 22 | SIDER US FAERS | |
| 89 | Skin necrosis | FAERS: 22 | US FAERS | |
| 90 | Somnolence | FAERS: 22 | US FAERS | |
| 91 | Anxiety | FAERS: 21 | US FAERS | |
| 92 | Urinary Retention | FAERS: 21 | US FAERS | |
| 93 | Wound dehiscence | FAERS: 21 | US FAERS | |
| 94 | Renal pain | FAERS: 20 | US FAERS | |
| 95 | Abscess | FAERS: 19 | US FAERS | |
| 96 | Atrial Fibrillation | FAERS: 19 | US FAERS | |
| 97 | Blood triglycerides increased | FAERS: 19 | US FAERS | |
| 98 | Respiratory Failure | FAERS: 19 | US FAERS | |
| 99 | Urine ketone body present | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 100 | Acidosis | FAERS: 18 | US FAERS | |
| 101 | Blood glucose abnormal | FAERS: 18 | US FAERS | |
| 102 | Creatinine renal clearance increased | FAERS: 18 | US FAERS | |
| 103 | Euglycaemic diabetic ketoacidosis | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 104 | Genital rash | FAERS: 18 | US FAERS | |
| 105 | Lip swelling | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 106 | Urinary Incontinence | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | prostatitis | FAERS: 17 | US FAERS | |
| 108 | Blood glucose fluctuation | FAERS: 16 | US FAERS | |
| 109 | Erectile dysfunction | FAERS: 16 | US FAERS | |
| 110 | Genital infection | FAERS: 16 | US FAERS | |
| 111 | Hunger | FAERS: 16 | US FAERS | |
| 112 | Peripheral arterial occlusive disease | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Swelling | FAERS: 15 | US FAERS | |
| 114 | Thrombosis | FAERS: 15 | US FAERS | |
| 115 | Cardiac Arrest | FAERS: 14 | US FAERS | |
| 116 | Flatulence | FAERS: 14 | US FAERS | |
| 117 | Incontinence | FAERS: 14 | US FAERS | |
| 118 | Oral candidiasis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Tachycardia | FAERS: 14 | US FAERS | |
| 120 | Burning sensation | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Fracture | FAERS: 13 | SIDER US FAERS | |
| 122 | Lethargy | FAERS: 13 | US FAERS | |
| 123 | Therapy cessation | FAERS: 13 | US FAERS | |
| 124 | Blood urea increased | FAERS: 12 | SIDER US FAERS | |
| 125 | Glycosuria | FAERS: 12 Canada Vigilance: 1 | 28916336 | CTD Canada Vigilance US FAERS |
| 126 | Leukocytosis | FAERS: 12 | US FAERS | |
| 127 | Product dose omission | FAERS: 12 | US FAERS | |
| 128 | Intentional product misuse | FAERS: 11 | US FAERS | |
| 129 | Mental impairment | FAERS: 11 | US FAERS | |
| 130 | Staphylococcal osteomyelitis | FAERS: 11 | US FAERS | |
| 131 | Chromaturia | FAERS: 10 | US FAERS | |
| 132 | Deep Vein Thrombosis | FAERS: 10 | US FAERS | |
| 133 | Dysgeusia | FAERS: 10 | US FAERS | |
| 134 | Dyspepsia | FAERS: 10 | US FAERS | |
| 135 | Gout | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 136 | Hyperkeratosis | FAERS: 10 | US FAERS | |
| 137 | Medication Error | FAERS: 10 | US FAERS | |
| 138 | Microalbuminuria | FAERS: 10 | US FAERS | |
| 139 | Polydipsia | FAERS: 10 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 140 | Skin lesion | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 141 | Amnesia | FAERS: 9 | US FAERS | |
| 142 | Blood ketone body increased | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 143 | Chest discomfort | FAERS: 9 | US FAERS | |
| 144 | Chills | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Creatinine renal clearance decreased | FAERS: 9 | US FAERS | |
| 146 | Discomfort | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Drug dispensing error | FAERS: 9 | US FAERS | |
| 148 | Dry skin | FAERS: 9 | US FAERS | |
| 149 | Embolism | FAERS: 9 | US FAERS | |
| 150 | Feeling jittery | FAERS: 9 | US FAERS | |
| 151 | Influenza | FAERS: 9 | US FAERS | |
| 152 | Joint swelling | FAERS: 9 | US FAERS | |
| 153 | Limb injury | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Nasopharyngitis | FAERS: 9 | US FAERS | |
| 155 | Product packaging quantity issue | FAERS: 9 | US FAERS | |
| 156 | Rash erythematous | FAERS: 9 | SIDER US FAERS | |
| 157 | Rhabdomyolysis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Systemic Inflammatory Response Syndrome | FAERS: 9 | US FAERS | |
| 159 | Vertigo | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 160 | Abasia | FAERS: 8 | US FAERS | |
| 161 | Activities of daily living impaired | FAERS: 8 | US FAERS | |
| 162 | Angioedema | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 163 | Blood sodium decreased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Debridement | FAERS: 8 | US FAERS | |
| 165 | Flushing | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Hypophagia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Limb discomfort | FAERS: 8 | US FAERS | |
| 168 | Low density lipoprotein increased | FAERS: 8 | SIDER US FAERS | |
| 169 | Memory impairment | FAERS: 8 | US FAERS | |
| 170 | Neuropathic ulcer | FAERS: 8 | US FAERS | |
| 171 | Penile erythema | FAERS: 8 | US FAERS | |
| 172 | Renal tubular necrosis | FAERS: 8 | US FAERS | |
| 173 | Vulvovaginal discomfort | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Vulvovaginitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 175 | treatment failure | FAERS: 8 | US FAERS | |
| 176 | Arteriosclerosis | FAERS: 7 | US FAERS | |
| 177 | Bronchitis | FAERS: 7 | US FAERS | |
| 178 | Cold sweat | FAERS: 7 | US FAERS | |
| 179 | Device related infection | FAERS: 7 | US FAERS | |
| 180 | Diabetic neuropathic ulcer | FAERS: 7 | US FAERS | |
| 181 | Drug administration error | FAERS: 7 | US FAERS | |
| 182 | Gastritis | FAERS: 7 | US FAERS | |
| 183 | Gastroenteritis | FAERS: 7 | US FAERS | |
| 184 | Ketonuria | FAERS: 7 | US FAERS | |
| 185 | Nonspecific reaction | FAERS: 7 | US FAERS | |
| 186 | Overdose | FAERS: 7 | US FAERS | |
| 187 | Phimosis | FAERS: 7 | SIDER US FAERS | |
| 188 | Post procedural complication | FAERS: 7 | US FAERS | |
| 189 | Product quality issue | FAERS: 7 | US FAERS | |
| 190 | Protein urine present | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Proteinuria | FAERS: 7 | US FAERS | |
| 192 | Pulmonary Embolism | FAERS: 7 | US FAERS | |
| 193 | Soft tissue necrosis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Therapy change | FAERS: 7 | US FAERS | |
| 195 | Urinary tract infection fungal | FAERS: 7 | US FAERS | |
| 196 | nervous system disorder | FAERS: 7 | SIDER US FAERS | |
| 197 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 198 | Acne | FAERS: 6 | US FAERS | |
| 199 | Alanine Aminotransferase Increased | FAERS: 6 | US FAERS | |
| 200 | Asthma | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 201 | Blindness | FAERS: 6 | US FAERS | |
| 202 | Cataract | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Diabetic wound | FAERS: 6 | US FAERS | |
| 204 | Drug diversion | FAERS: 6 | US FAERS | |
| 205 | Electrolyte imbalance | FAERS: 6 | US FAERS | |
| 206 | Epistaxis | FAERS: 6 | US FAERS | |
| 207 | Escherichia infection | FAERS: 6 | US FAERS | |
| 208 | Extra dose administered | FAERS: 6 | US FAERS | |
| 209 | Hypersomnia | FAERS: 6 | US FAERS | |
| 210 | Lipase increased | FAERS: 6 | US FAERS | |
| 211 | Mental status changes | FAERS: 6 | US FAERS | |
| 212 | Nervousness | FAERS: 6 | US FAERS | |
| 213 | Oral fungal infection | FAERS: 6 | US FAERS | |
| 214 | Oropharyngeal pain | FAERS: 6 | US FAERS | |
| 215 | Penile Infection | FAERS: 6 | US FAERS | |
| 216 | Renal tubular acidosis | FAERS: 6 | US FAERS | |
| 217 | Stress | FAERS: 6 | US FAERS | |
| 218 | Tinnitus | FAERS: 6 | US FAERS | |
| 219 | Vaginal Discharge | FAERS: 6 | US FAERS | |
| 220 | Vulvitis | FAERS: 6 | SIDER US FAERS | |
| 221 | Wound necrosis | FAERS: 6 | US FAERS | |
| 222 | Bladder spasm | FAERS: 5 | US FAERS | |
| 223 | Blood cholesterol increased | FAERS: 5 | US FAERS | |
| 224 | Blood potassium decreased | FAERS: 5 | US FAERS | |
| 225 | Bone pain | FAERS: 5 | US FAERS | |
| 226 | Calcanectomy | FAERS: 5 | US FAERS | |
| 227 | Dermatitis | FAERS: 5 | SIDER US FAERS | |
| 228 | Diabetes Mellitus | FAERS: 5 | SIDER US FAERS | |
| 229 | Diabetic Nephropathy | FAERS: 5 | US FAERS | |
| 230 | Food craving | FAERS: 5 | US FAERS | |
| 231 | Gastrointestinal infection | FAERS: 5 | US FAERS | |
| 232 | General physical health deterioration | FAERS: 5 | US FAERS | |
| 233 | Ketosis | FAERS: 5 | US FAERS | |
| 234 | Osteoporosis | FAERS: 5 | US FAERS | |
| 235 | Pancreatic carcinoma | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 236 | Pelvic Pain | FAERS: 5 | US FAERS | |
| 237 | Perirectal abscess | FAERS: 5 | US FAERS | |
| 238 | Presyncope | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 239 | Product packaging issue | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 240 | Product prescribing error | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 241 | Soft Tissue Infection | FAERS: 5 | US FAERS | |
| 242 | Stomatitis | FAERS: 5 | US FAERS | |
| 243 | Vulvovaginal pain | FAERS: 5 | US FAERS | |
| 244 | Accidental exposure to product by child | FAERS: 4 | US FAERS | |
| 245 | Accidental overdose | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 246 | Amylase increased | FAERS: 4 | US FAERS | |
| 247 | Anger | FAERS: 4 | US FAERS | |
| 248 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 249 | Ankle Fracture | FAERS: 4 | US FAERS | |
| 250 | Arthritis | FAERS: 4 | US FAERS | |
| 251 | Aspartate Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 252 | Bacterial sepsis | FAERS: 4 | US FAERS | |
| 253 | Blood ketone body | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 254 | Bone density decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 255 | Carbon dioxide decreased | FAERS: 4 | US FAERS | |
| 256 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 257 | Choking | FAERS: 4 | US FAERS | |
| 258 | Dental caries | FAERS: 4 | US FAERS | |
| 259 | Disability | FAERS: 4 | US FAERS | |
| 260 | Eczema | FAERS: 4 | US FAERS | |
| 261 | Emotional distress | FAERS: 4 | US FAERS | |
| 262 | Eructation | FAERS: 4 | US FAERS | |
| 263 | Escherichia urinary tract infection | FAERS: 4 | US FAERS | |
| 264 | Fasciitis | FAERS: 4 | US FAERS | |
| 265 | Gastric Bypass | FAERS: 4 | US FAERS | |
| 266 | Genital burning sensation | FAERS: 4 | US FAERS | |
| 267 | Hepatitis | FAERS: 4 | US FAERS | |
| 268 | Hydronephrosis | FAERS: 4 | US FAERS | |
| 269 | Impaired gastric emptying | FAERS: 4 | US FAERS | |
| 270 | Impaired work ability | FAERS: 4 | US FAERS | |
| 271 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 272 | Lower respiratory tract infection | FAERS: 4 | US FAERS | |
| 273 | Middle insomnia | FAERS: 4 | US FAERS | |
| 274 | Multiple allergies | FAERS: 4 | US FAERS | |
| 275 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 276 | Myositis | FAERS: 4 | US FAERS | |
| 277 | Onychomycosis | FAERS: 4 | US FAERS | |
| 278 | Papule | FAERS: 4 | US FAERS | |
| 279 | Penile burning sensation | FAERS: 4 | US FAERS | |
| 280 | Penile swelling | FAERS: 4 | US FAERS | |
| 281 | Poor quality sleep | FAERS: 4 | US FAERS | |
| 282 | Post procedural infection | FAERS: 4 | US FAERS | |
| 283 | Product label issue | FAERS: 4 | US FAERS | |
| 284 | Throat irritation | FAERS: 4 | US FAERS | |
| 285 | Thrombocytopenia | FAERS: 4 | US FAERS | |
| 286 | Urine alcohol test positive | FAERS: 4 | US FAERS | |
| 287 | Urine flow decreased | FAERS: 4 | US FAERS | |
| 288 | Vulvovaginal dryness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 289 | furuncle | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 290 | Ageusia | FAERS: 3 | US FAERS | |
| 291 | Anal abscess | FAERS: 3 | US FAERS | |
| 292 | Arterial bypass operation | FAERS: 3 | US FAERS | |
| 293 | Arterial thrombosis | FAERS: 3 | US FAERS | |
| 294 | Arthropathy | FAERS: 3 | US FAERS | |
| 295 | Back disorder | FAERS: 3 | US FAERS | |
| 296 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 297 | Bladder discomfort | FAERS: 3 | US FAERS | |
| 298 | Bladder pain | FAERS: 3 | SIDER US FAERS | |
| 299 | Blood alcohol increased | FAERS: 3 | US FAERS | |
| 300 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 301 | Cerebral Thrombosis | FAERS: 3 | US FAERS | |
| 302 | Colitis | FAERS: 3 | US FAERS | |
| 303 | Cyst | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 304 | Depressed mood | FAERS: 3 | US FAERS | |
| 305 | Diabetic encephalopathy | FAERS: 3 | US FAERS | |
| 306 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 307 | Dysphonia | FAERS: 3 | US FAERS | |
| 308 | Ejection Fraction Decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 309 | Expired product administered | FAERS: 3 | US FAERS | |
| 310 | Eye irritation | FAERS: 3 | US FAERS | |
| 311 | Hyperosmolar state | FAERS: 3 | US FAERS | |
| 312 | Infective tenosynovitis | FAERS: 3 | US FAERS | |
| 313 | Inflammation | FAERS: 3 | US FAERS | |
| 314 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 315 | Joint injury | FAERS: 3 | US FAERS | |
| 316 | Lymphangitis | FAERS: 3 | US FAERS | |
| 317 | Menorrhagia | FAERS: 3 | US FAERS | |
| 318 | Mood swings | FAERS: 3 | US FAERS | |
| 319 | Muscle necrosis | FAERS: 3 | US FAERS | |
| 320 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 321 | Neck Pain | FAERS: 3 | US FAERS | |
| 322 | Neuralgia | FAERS: 3 | US FAERS | |
| 323 | Obesity | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 324 | Osteopenia | FAERS: 3 | US FAERS | |
| 325 | Pallor | FAERS: 3 | US FAERS | |
| 326 | Pathological fracture | FAERS: 3 | US FAERS | |
| 327 | Periarthritis | FAERS: 3 | US FAERS | |
| 328 | Perineal cellulitis | FAERS: 3 | US FAERS | |
| 329 | Peripheral artery thrombosis | FAERS: 3 | US FAERS | |
| 330 | Product commingling | FAERS: 3 | US FAERS | |
| 331 | Product physical issue | FAERS: 3 | US FAERS | |
| 332 | Product substitution issue | FAERS: 3 | US FAERS | |
| 333 | Product use complaint | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 334 | Psoriasis | FAERS: 3 | US FAERS | |
| 335 | Renal Cell Carcinoma | FAERS: 3 | US FAERS | |
| 336 | Renal abscess | FAERS: 3 | US FAERS | |
| 337 | Stevens-Johnson Syndrome | FAERS: 3 | US FAERS | |
| 338 | Subcutaneous Abscess | FAERS: 3 | US FAERS | |
| 339 | Tinea Pedis | FAERS: 3 | US FAERS | |
| 340 | Toe operation | FAERS: 3 | US FAERS | |
| 341 | Tooth Infection | FAERS: 3 | US FAERS | |
| 342 | Toothache | FAERS: 3 | US FAERS | |
| 343 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 344 | Upper-airway cough syndrome | FAERS: 3 | US FAERS | |
| 345 | Vasculitis | FAERS: 3 | US FAERS | |
| 346 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 347 | Vulvovaginal burning sensation | FAERS: 3 | US FAERS | |
| 348 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 349 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 350 | Acute prerenal failure | FAERS: 2 | US FAERS | |
| 351 | Agitation | FAERS: 2 | US FAERS | |
| 352 | Alanine aminotransferase decreased | FAERS: 2 | US FAERS | |
| 353 | Alcohol test false positive | FAERS: 2 | US FAERS | |
| 354 | Anion Gap | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 355 | Ankle deformity | FAERS: 2 | US FAERS | |
| 356 | Anosmia | FAERS: 2 | US FAERS | |
| 357 | Apparent death | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 358 | Appendicitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 359 | Aspartate aminotransferase decreased | FAERS: 2 | US FAERS | |
| 360 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 361 | Bedridden | FAERS: 2 | US FAERS | |
| 362 | Blood alkaline phosphatase increased | FAERS: 2 | US FAERS | |
| 363 | Blood blister | FAERS: 2 | US FAERS | |
| 364 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 365 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 366 | Blood magnesium increased | FAERS: 2 | US FAERS | |
| 367 | Blood pH decreased | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 368 | Blood parathyroid hormone increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 369 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 370 | Bradycardia | FAERS: 2 | US FAERS | |
| 371 | Breast tenderness | FAERS: 2 | US FAERS | |
| 372 | Candida sepsis | FAERS: 2 | US FAERS | |
| 373 | Cellulitis of male external genital organ | FAERS: 2 | US FAERS | |
| 374 | Cheilitis | FAERS: 2 | US FAERS | |
| 375 | Cholelithiasis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 376 | Chronic respiratory failure | FAERS: 2 | US FAERS | |
| 377 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 378 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 379 | Delirium | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 380 | Disorientation | FAERS: 2 | US FAERS | |
| 381 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 382 | Drug screen positive | FAERS: 2 | US FAERS | |
| 383 | Emphysematous pyelonephritis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 384 | Encephalitis | FAERS: 2 | US FAERS | |
| 385 | Enterococcal infection | FAERS: 2 | US FAERS | |
| 386 | Enuresis | FAERS: 2 | US FAERS | |
| 387 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 388 | Escherichia sepsis | FAERS: 2 | US FAERS | |
| 389 | Euphoric mood | FAERS: 2 | US FAERS | |
| 390 | Extremity contracture | FAERS: 2 | US FAERS | |
| 391 | Eye pain | FAERS: 2 | US FAERS | |
| 392 | Facial Pain | FAERS: 2 | US FAERS | |
| 393 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 2 | US FAERS | |
| 394 | Feeling Cold | FAERS: 2 | US FAERS | |
| 395 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 396 | Fungal test positive | FAERS: 2 | US FAERS | |
| 397 | Gamma-glutamyltransferase decreased | FAERS: 2 | US FAERS | |
| 398 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 399 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 400 | Genital discomfort | FAERS: 2 | US FAERS | |
| 401 | Genital pain | FAERS: 2 | US FAERS | |
| 402 | Genital swelling | FAERS: 2 | US FAERS | |
| 403 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 404 | Head discomfort | FAERS: 2 | US FAERS | |
| 405 | Hepatic Infection | FAERS: 2 | US FAERS | |
| 406 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 407 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 408 | Hyperphagia | FAERS: 2 | US FAERS | |
| 409 | Hypokinesia | FAERS: 2 | US FAERS | |
| 410 | Hysterectomy | FAERS: 2 | US FAERS | |
| 411 | Incoherent | FAERS: 2 | US FAERS | |
| 412 | Laceration | FAERS: 2 | US FAERS | |
| 413 | Laryngitis | FAERS: 2 | US FAERS | |
| 414 | Lesion excision | FAERS: 2 | US FAERS | |
| 415 | Low density lipoprotein abnormal | FAERS: 2 | US FAERS | |
| 416 | Macular degeneration | FAERS: 2 | US FAERS | |
| 417 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 418 | Malnutrition | FAERS: 2 | SIDER US FAERS | |
| 419 | Mouth swelling | FAERS: 2 | US FAERS | |
| 420 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 421 | Nail Infection | FAERS: 2 | US FAERS | |
| 422 | Nephritis | FAERS: 2 | US FAERS | |
| 423 | Nephrotic Syndrome | FAERS: 2 | US FAERS | |
| 424 | Oral pain | FAERS: 2 | US FAERS | |
| 425 | Photodermatosis | FAERS: 2 | US FAERS | |
| 426 | Poisoning | FAERS: 2 | US FAERS | |
| 427 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 428 | Procedural complication | FAERS: 2 | US FAERS | |
| 429 | Product administration error | FAERS: 2 | US FAERS | |
| 430 | Product container issue | FAERS: 2 | US FAERS | |
| 431 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 432 | Product lot number issue | FAERS: 2 | US FAERS | |
| 433 | Product storage error | FAERS: 2 | US FAERS | |
| 434 | Product tampering | FAERS: 2 | US FAERS | |
| 435 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 436 | Rash papulosquamous | FAERS: 2 | US FAERS | |
| 437 | Renal Colic | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 438 | Respiratory distress | FAERS: 2 | US FAERS | |
| 439 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 440 | Retinal Detachment | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 441 | Scrotal Infection | FAERS: 2 | US FAERS | |
| 442 | Sinusitis | FAERS: 2 | US FAERS | |
| 443 | Skin irritation | FAERS: 2 | US FAERS | |
| 444 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 445 | Staphylococcus test | FAERS: 2 | US FAERS | |
| 446 | Sudden death | FAERS: 2 | US FAERS | |
| 447 | Sunburn | FAERS: 2 | SIDER US FAERS | |
| 448 | Thrombocytosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 449 | Tinea cruris | FAERS: 2 | US FAERS | |
| 450 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 451 | Troponin | FAERS: 2 | US FAERS | |
| 452 | Urethritis | FAERS: 2 | US FAERS | |
| 453 | Urinary Tract Pain | FAERS: 2 | US FAERS | |
| 454 | Urine albumin/creatinine ratio increased | FAERS: 2 | US FAERS | |
| 455 | Urine calcium increased | FAERS: 2 | US FAERS | |
| 456 | Urine ketone body | FAERS: 2 | US FAERS | |
| 457 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 458 | Vascular rupture | FAERS: 2 | US FAERS | |
| 459 | Wheelchair user | FAERS: 2 | US FAERS | |
| 460 | Wound Complication | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 461 | colonoscopy | FAERS: 2 | US FAERS | |
| 462 | jaundice | FAERS: 2 | US FAERS | |
| 463 | skin abrasion | FAERS: 2 | US FAERS | |
| 464 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 465 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 466 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 467 | Activated partial thromboplastin time abnormal | FAERS: 1 | US FAERS | |
| 468 | Administration site plaque | FAERS: 1 | US FAERS | |
| 469 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 470 | Albuminuria | FAERS: 1 | US FAERS | |
| 471 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 472 | Alpha hydroxybutyrate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 473 | Amyloidosis | FAERS: 1 | US FAERS | |
| 474 | Anal candidiasis | FAERS: 1 | US FAERS | |
| 475 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 476 | Aneurysm | FAERS: 1 | US FAERS | |
| 477 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 478 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 479 | Antibiotic therapy | FAERS: 1 | US FAERS | |
| 480 | Anticoagulation drug level below therapeutic | FAERS: 1 | US FAERS | |
| 481 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 482 | Aphagia | FAERS: 1 | US FAERS | |
| 483 | Aphasia | FAERS: 1 | US FAERS | |
| 484 | Arthrodesis | FAERS: 1 | US FAERS | |
| 485 | Ascites | FAERS: 1 | US FAERS | |
| 486 | Asthenopia | FAERS: 1 | US FAERS | |
| 487 | Astigmatism | FAERS: 1 | US FAERS | |
| 488 | Asymptomatic bacteriuria | FAERS: 1 | US FAERS | |
| 489 | Bacterial Vaginosis | FAERS: 1 | US FAERS | |
| 490 | Bacterial test | FAERS: 1 | US FAERS | |
| 491 | Balanoposthitis infective | FAERS: 1 | US FAERS | |
| 492 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 493 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 494 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 495 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 496 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 497 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 498 | Blastomycosis | FAERS: 1 | US FAERS | |
| 499 | Blepharospasm | FAERS: 1 | US FAERS | |
| 500 | Blood Glucose | FAERS: 1 | US FAERS | |
| 501 | Blood Pressure | FAERS: 1 | US FAERS | |
| 502 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 503 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 504 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 505 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 506 | Blood glucose normal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 507 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 508 | Blood ketone body present | FAERS: 1 | US FAERS | |
| 509 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 510 | Blood osmolarity abnormal | FAERS: 1 | US FAERS | |
| 511 | Blood pH increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 512 | Blood pH normal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 513 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 514 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 515 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 516 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 517 | Blood testosterone abnormal | FAERS: 1 | US FAERS | |
| 518 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 519 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 520 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 521 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 522 | Body temperature fluctuation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 523 | Brain Death | FAERS: 1 | US FAERS | |
| 524 | Calciphylaxis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 525 | Carbon dioxide abnormal | FAERS: 1 | US FAERS | |
| 526 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 527 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 528 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 529 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 530 | Catheter placement | FAERS: 1 | US FAERS | |
| 531 | Cerebellar stroke | FAERS: 1 | US FAERS | |
| 532 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 533 | Cholecystitis | FAERS: 1 | US FAERS | |
| 534 | Cholelithotomy | FAERS: 1 | US FAERS | |
| 535 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 536 | Colectomy | FAERS: 1 | US FAERS | |
| 537 | Crystal urine present | FAERS: 1 | US FAERS | |
| 538 | Cyanosis | FAERS: 1 | US FAERS | |
| 539 | Dawn phenomenon | FAERS: 1 | US FAERS | |
| 540 | Deafness | FAERS: 1 | US FAERS | |
| 541 | Decreased insulin requirement | FAERS: 1 | US FAERS | |
| 542 | Dehiscence | FAERS: 1 | US FAERS | |
| 543 | Demyelination | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 544 | Device Failure | FAERS: 1 | US FAERS | |
| 545 | Diabetic arthropathy | FAERS: 1 | US FAERS | |
| 546 | Diabetic glaucoma | FAERS: 1 | US FAERS | |
| 547 | Diplegia | FAERS: 1 | US FAERS | |
| 548 | Diplopia | FAERS: 1 | US FAERS | |
| 549 | Disease complication | FAERS: 1 | US FAERS | |
| 550 | Disease recurrence | FAERS: 1 | US FAERS | |
| 551 | Diverticular perforation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 552 | Diverticulitis | FAERS: 1 | US FAERS | |
| 553 | Drowning | FAERS: 1 | US FAERS | |
| 554 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 555 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 556 | Drug level decreased | FAERS: 1 | US FAERS | |
| 557 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 558 | Duodenitis | FAERS: 1 | US FAERS | |
| 559 | Dyspareunia | FAERS: 1 | US FAERS | |
| 560 | Dysphemia | FAERS: 1 | US FAERS | |
| 561 | Ear discomfort | FAERS: 1 | US FAERS | |
| 562 | Economic problem | FAERS: 1 | US FAERS | |
| 563 | Emotional disorder | FAERS: 1 | US FAERS | |
| 564 | Emphysematous cystitis | FAERS: 1 | US FAERS | |
| 565 | Endocarditis | FAERS: 1 | US FAERS | |
| 566 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 567 | Eosinopenia | FAERS: 1 | US FAERS | |
| 568 | Eosinophilia | FAERS: 1 | US FAERS | |
| 569 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 570 | Epiglottitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 571 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 572 | Eschar | FAERS: 1 | US FAERS | |
| 573 | Escherichia pyelonephritis | FAERS: 1 | US FAERS | |
| 574 | Exposure via partner | FAERS: 1 | US FAERS | |
| 575 | Eye Infection | FAERS: 1 | US FAERS | |
| 576 | Facial paralysis | FAERS: 1 | US FAERS | |
| 577 | Fanconi Syndrome | FAERS: 1 | US FAERS | |
| 578 | Fluid overload | FAERS: 1 | US FAERS | |
| 579 | Folliculitis | FAERS: 1 | US FAERS | |
| 580 | Food Poisoning | FAERS: 1 | US FAERS | |
| 581 | Frustration | FAERS: 1 | US FAERS | |
| 582 | Fungal cystitis | FAERS: 1 | US FAERS | |
| 583 | Gastrectomy | FAERS: 1 | US FAERS | |
| 584 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 585 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 586 | Gastrointestinal viral infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 587 | Genital Herpes | FAERS: 1 | US FAERS | |
| 588 | Genital erythema | FAERS: 1 | US FAERS | |
| 589 | Genital tract inflammation | FAERS: 1 | US FAERS | |
| 590 | Glaucoma | FAERS: 1 | US FAERS | |
| 591 | Glossitis | FAERS: 1 | US FAERS | |
| 592 | Glucose urine absent | FAERS: 1 | US FAERS | |
| 593 | Granuloma | FAERS: 1 | US FAERS | |
| 594 | Haemoconcentration | FAERS: 1 | US FAERS | |
| 595 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 596 | Heat Stroke | FAERS: 1 | US FAERS | |
| 597 | Hemiparesis | FAERS: 1 | US FAERS | |
| 598 | Hepatitis A | FAERS: 1 | US FAERS | |
| 599 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 600 | Hip surgery | FAERS: 1 | US FAERS | |
| 601 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 602 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 603 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 604 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 605 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 606 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 607 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 608 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 609 | Infestation | FAERS: 1 | US FAERS | |
| 610 | Injection site bruising | FAERS: 1 | US FAERS | |
| 611 | Injection site erythema | FAERS: 1 | US FAERS | |
| 612 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 613 | Insulin C-peptide increased | FAERS: 1 | US FAERS | |
| 614 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 615 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 616 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 617 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 618 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 619 | Invasive Ductal Breast Carcinoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 620 | Iritis | FAERS: 1 | US FAERS | |
| 621 | Iron deficiency | FAERS: 1 | US FAERS | |
| 622 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 623 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 624 | Ketogenic Diet | FAERS: 1 | US FAERS | |
| 625 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 626 | Lack of satiety | FAERS: 1 | US FAERS | |
| 627 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 628 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 629 | Latent Autoimmune Diabetes in Adults | FAERS: 1 | US FAERS | |
| 630 | Leukopenia | FAERS: 1 | US FAERS | |
| 631 | Lichen Planus | FAERS: 1 | US FAERS | |
| 632 | Ligament rupture | FAERS: 1 | US FAERS | |
| 633 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 634 | Lipids abnormal | FAERS: 1 | US FAERS | |
| 635 | Lipoatrophy | FAERS: 1 | US FAERS | |
| 636 | Lisfranc fracture | FAERS: 1 | US FAERS | |
| 637 | Liver Abscess | FAERS: 1 | US FAERS | |
| 638 | Loose tooth | FAERS: 1 | US FAERS | |
| 639 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 640 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 641 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 642 | Lymphoma | FAERS: 1 | US FAERS | |
| 643 | Mastication disorder | FAERS: 1 | US FAERS | |
| 644 | Mastitis | FAERS: 1 | US FAERS | |
| 645 | May-Thurner Syndrome | FAERS: 1 | US FAERS | |
| 646 | Medical device implantation | FAERS: 1 | US FAERS | |
| 647 | Medical procedure | FAERS: 1 | US FAERS | |
| 648 | Medication residue present | FAERS: 1 | US FAERS | |
| 649 | Meningitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 650 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 651 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 652 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 653 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 654 | Muscle tightness | FAERS: 1 | US FAERS | |
| 655 | Myelitis | FAERS: 1 | US FAERS | |
| 656 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 657 | Necrotising myositis | FAERS: 1 | US FAERS | |
| 658 | Negative thoughts | FAERS: 1 | US FAERS | |
| 659 | Neuroma | FAERS: 1 | US FAERS | |
| 660 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 661 | Obesity surgery | FAERS: 1 | US FAERS | |
| 662 | Occult blood positive | FAERS: 1 | US FAERS | |
| 663 | Oligodipsia | FAERS: 1 | US FAERS | |
| 664 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 665 | Orchitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 666 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 667 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 668 | Osteotomy | FAERS: 1 | US FAERS | |
| 669 | Overweight | FAERS: 1 | US FAERS | |
| 670 | Pain of skin | FAERS: 1 | US FAERS | |
| 671 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 672 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 673 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 674 | Pancytopenia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 675 | Panniculitis | FAERS: 1 | US FAERS | |
| 676 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 677 | Pelvic Infection | FAERS: 1 | US FAERS | |
| 678 | Penile blister | FAERS: 1 | US FAERS | |
| 679 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 680 | Pericarditis | FAERS: 1 | US FAERS | |
| 681 | Perineal pain | FAERS: 1 | US FAERS | |
| 682 | Perineal ulceration | FAERS: 1 | US FAERS | |
| 683 | Peripheral artery occlusion | FAERS: 1 | US FAERS | |
| 684 | Peripheral artery stenosis | FAERS: 1 | US FAERS | |
| 685 | Personality Change | FAERS: 1 | US FAERS | |
| 686 | Pharyngitis | FAERS: 1 | US FAERS | |
| 687 | Photophobia | FAERS: 1 | US FAERS | |
| 688 | Polyarthritis | FAERS: 1 | US FAERS | |
| 689 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 690 | Post procedural cellulitis | FAERS: 1 | US FAERS | |
| 691 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 692 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 693 | Postoperative renal failure | FAERS: 1 | US FAERS | |
| 694 | Prerenal failure | FAERS: 1 | US FAERS | |
| 695 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 696 | Procedural nausea | FAERS: 1 | US FAERS | |
| 697 | Product availability issue | FAERS: 1 | US FAERS | |
| 698 | Product counterfeit | FAERS: 1 | US FAERS | |
| 699 | Product identification number issue | FAERS: 1 | US FAERS | |
| 700 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 701 | Prostatic Obstruction | FAERS: 1 | US FAERS | |
| 702 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 703 | Pulmonary Fibrosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 704 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 705 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 706 | Purulence | FAERS: 1 | US FAERS | |
| 707 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 708 | Rectal polyp | FAERS: 1 | US FAERS | |
| 709 | Renal cyst | FAERS: 1 | US FAERS | |
| 710 | Renal mass | FAERS: 1 | US FAERS | |
| 711 | Renal scan abnormal | FAERS: 1 | US FAERS | |
| 712 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 713 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 714 | Retching | FAERS: 1 | US FAERS | |
| 715 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 716 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 717 | Salt craving | FAERS: 1 | US FAERS | |
| 718 | Sarcoma | FAERS: 1 | US FAERS | |
| 719 | Scab | FAERS: 1 | US FAERS | |
| 720 | Schizophrenia | FAERS: 1 | US FAERS | |
| 721 | Screaming | FAERS: 1 | US FAERS | |
| 722 | Scrotal erythema | FAERS: 1 | US FAERS | |
| 723 | Septic necrosis | FAERS: 1 | US FAERS | |
| 724 | Shock symptom | FAERS: 1 | US FAERS | |
| 725 | Shock | FAERS: 1 | SIDER US FAERS | |
| 726 | Single functional kidney | FAERS: 1 | US FAERS | |
| 727 | Skeletal injury | FAERS: 1 | US FAERS | |
| 728 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 729 | Skin laceration | FAERS: 1 | US FAERS | |
| 730 | Skin tightness | FAERS: 1 | US FAERS | |
| 731 | Skin ulcer excision | FAERS: 1 | US FAERS | |
| 732 | Sluggishness | FAERS: 1 | US FAERS | |
| 733 | Soft tissue inflammation | FAERS: 1 | US FAERS | |
| 734 | Spermatic cord funiculitis | FAERS: 1 | US FAERS | |
| 735 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 736 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 737 | Splenomegaly | FAERS: 1 | US FAERS | |
| 738 | Starvation | FAERS: 1 | US FAERS | |
| 739 | Streptococcal urinary tract infection | FAERS: 1 | US FAERS | |
| 740 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 741 | Suicide attempt | FAERS: 1 | US FAERS | |
| 742 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 743 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 744 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 745 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 746 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 747 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 748 | Thermal burn | FAERS: 1 | US FAERS | |
| 749 | Throat cancer | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 750 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 751 | Tooth Loss | FAERS: 1 | US FAERS | |
| 752 | Transaminases increased | FAERS: 1 | US FAERS | |
| 753 | Transcription medication error | FAERS: 1 | US FAERS | |
| 754 | Traumatic renal injury | FAERS: 1 | US FAERS | |
| 755 | Unable to afford prescribed medication | FAERS: 1 | US FAERS | |
| 756 | Underweight | FAERS: 1 | US FAERS | |
| 757 | Ureteritis | FAERS: 1 | US FAERS | |
| 758 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 759 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 760 | Urinary tract infection enterococcal | FAERS: 1 | US FAERS | |
| 761 | Urinoma | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 762 | Vascular insufficiency | FAERS: 1 | US FAERS | |
| 763 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 764 | Venous stenosis | FAERS: 1 | US FAERS | |
| 765 | Vestibular Neuronitis | FAERS: 1 | US FAERS | |
| 766 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 767 | Vulvovaginal inflammation | FAERS: 1 | US FAERS | |
| 768 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 769 | Wound abscess | FAERS: 1 | US FAERS | |
| 770 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 771 | Wound sepsis | FAERS: 1 | US FAERS | |
| 772 | diagnostic procedure | FAERS: 1 | US FAERS | |
| 773 | Adrenal Gland Diseases | 28916336 | CTD | |
| 774 | Atrophic vulvovaginitis | Canada Vigilance: 1 | Canada Vigilance | |
| 775 | Blood phosphate increased | SIDER | ||
| 776 | Blood phosphorus increased | SIDER | ||
| 777 | Crying | Canada Vigilance: 1 | Canada Vigilance | |
| 778 | Diuresis | SIDER | ||
| 779 | Glucose low | SIDER | ||
| 780 | Hyperostosis | 25289773 28916336 | CTD | |
| 781 | Hyperplasia | 25289773 | CTD | |
| 782 | Leydig Cell Tumor | 25289773 25398756 28916336 | CTD | |
| 783 | Pheochromocytoma | CTD | ||
| 784 | Prurigo | SIDER | ||
| 785 | Serum potassium increased | SIDER | ||
| 786 | Swelling of eyelid | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.