Alprazolam
(VREFGVBLTWBCJP-UHFFFAOYSA-N)
Structure
- SMILES
- Clc1ccc2c(c1)C(=NCc1n2c(C)nn1)c1ccccc1
- Type(s)
- Approved; Illicit; Investigational
- ATC code(s)
- N05BA12
- Molecular Formula:
- C17H13ClN4
- Molecular Weight:
- 308.765
- Log P:
- 3.0157
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 43.07
- CAS Number(s):
- 28981-97-7; 51339-48-1
Synonym(s)
1.
Alprazolam
2.
Alprazolan
3.
Alprox
4.
Apo-Alpraz
5.
Cassadan
6.
D-65MT
7.
Esparon
8.
Kalma
9.
Novo-Alprazol
10.
Nu-Alpraz
11.
Ralozam
12.
Tafil
13.
Trankimazin
14.
U-31,889
15.
Xanax
16.
Apo Alpraz
17.
D65MT
18.
Novo Alprazol
19.
Nu Alpraz
20.
U31,889
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 1065 Canada Vigilance: 9 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Drug abuse | FAERS: 435 | US FAERS | |
| 3 | Anxiety | FAERS: 398 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Overdose | FAERS: 353 | OFFSIDES US FAERS | |
| 5 | Drug Dependence | FAERS: 308 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 6 | Somnolence | FAERS: 290 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 7 | Sopor | FAERS: 284 | US FAERS | |
| 8 | Feeling abnormal | FAERS: 260 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Malaise | FAERS: 242 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 10 | Suicide attempt | FAERS: 238 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Headache | FAERS: 222 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 12 | Accidental overdose | FAERS: 204 | US FAERS | |
| 13 | Dizziness | FAERS: 188 Canada Vigilance: 4 | 2307974 2873131 18635690 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 14 | Completed Suicide | FAERS: 165 | SIDER US FAERS | |
| 15 | Drug withdrawal syndrome | FAERS: 161 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 16 | Toxicity to various agents | FAERS: 159 | US FAERS | |
| 17 | Tremor | FAERS: 157 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 18 | Nausea | FAERS: 156 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Fatigue | FAERS: 106 Canada Vigilance: 1 | 3358644 18635690 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 20 | Intentional product misuse | FAERS: 105 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Product substitution issue | FAERS: 99 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 22 | Product quality issue | FAERS: 98 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Amnesia | FAERS: 91 Canada Vigilance: 5 | 3358644 9467187 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 24 | Cardiac Arrest | FAERS: 91 | US FAERS | |
| 25 | Pain | FAERS: 91 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 26 | Palpitations | FAERS: 91 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 27 | Vomiting | FAERS: 89 | SIDER US FAERS | |
| 28 | Nervousness | FAERS: 86 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 29 | Respiratory arrest | FAERS: 85 | US FAERS | |
| 30 | Agitation | FAERS: 80 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 31 | Medication Error | FAERS: 80 | US FAERS | |
| 32 | Asthenia | FAERS: 78 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 33 | Intentional self-injury | FAERS: 77 | US FAERS | |
| 34 | Pharmaceutical product complaint | FAERS: 74 | OFFSIDES US FAERS | |
| 35 | Drug ineffective for unapproved indication | FAERS: 70 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Memory impairment | FAERS: 69 | SIDER US FAERS | |
| 37 | Weight decreased | FAERS: 63 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 38 | Drug effect incomplete | FAERS: 60 | US FAERS | |
| 39 | Therapeutic response unexpected | FAERS: 57 | US FAERS | |
| 40 | Depressed Level of Consciousness | FAERS: 55 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 41 | Abdominal discomfort | FAERS: 52 | OFFSIDES SIDER US FAERS | |
| 42 | Anger | FAERS: 52 | OFFSIDES SIDER US FAERS | |
| 43 | Product taste abnormal | FAERS: 52 | US FAERS | |
| 44 | Crying | FAERS: 50 | US FAERS | |
| 45 | Hypersensitivity | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 46 | Incorrect dose administered | FAERS: 48 | OFFSIDES US FAERS | |
| 47 | Chest Pain | FAERS: 47 | OFFSIDES SIDER US FAERS | |
| 48 | Dysgeusia | FAERS: 45 | US FAERS | |
| 49 | Pruritus | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 50 | Poisoning | FAERS: 42 | US FAERS | |
| 51 | Product use issue | FAERS: 42 | US FAERS | |
| 52 | Tachycardia | FAERS: 42 | 2307974 10389047 | CTD SIDER US FAERS |
| 53 | Visual Impairment | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | nervous system disorder | FAERS: 42 | SIDER US FAERS | |
| 55 | Hypotension | FAERS: 41 | 10389047 | CTD SIDER US FAERS |
| 56 | Intentional product use issue | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Drug exposure during pregnancy | FAERS: 40 | US FAERS | |
| 58 | Vertigo | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 59 | Dependence | FAERS: 39 | OFFSIDES US FAERS | |
| 60 | Myocardial Infarction | FAERS: 39 Canada Vigilance: 1 | 3224354 | CTD Canada Vigilance US FAERS |
| 61 | Stress | FAERS: 39 | OFFSIDES US FAERS | |
| 62 | Cerebrovascular accident | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Drug Tolerance | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 64 | Delirium | FAERS: 36 | CTD US FAERS | |
| 65 | Dysarthria | FAERS: 36 | SIDER US FAERS | |
| 66 | Disorientation | FAERS: 35 | SIDER US FAERS | |
| 67 | Drug dispensing error | FAERS: 35 | US FAERS | |
| 68 | Activities of daily living impaired | FAERS: 34 | OFFSIDES US FAERS | |
| 69 | Altered state of consciousness | FAERS: 34 | SIDER US FAERS | |
| 70 | Pre-existing condition improved | FAERS: 34 | US FAERS | |
| 71 | Product use in unapproved indication | FAERS: 34 | US FAERS | |
| 72 | Dyspepsia | FAERS: 33 | OFFSIDES SIDER US FAERS | |
| 73 | Therapeutic response unexpected with drug substitution | FAERS: 33 | US FAERS | |
| 74 | Paranoia | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 75 | Tinnitus | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 76 | Urticaria | FAERS: 32 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 77 | Impaired work ability | FAERS: 30 | OFFSIDES US FAERS | |
| 78 | Panic Disorder | FAERS: 30 |
1993639
2107764 2187213 2307974 2651489 2764184 2785123 2869702 3286686 3348461 3358644 3578580 3628823 3826428 7932278 9617514 11207340 11841142 12583929 | CTD SIDER US FAERS |
| 79 | Emotional disorder | FAERS: 29 | US FAERS | |
| 80 | Suspected counterfeit product | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Myalgia | FAERS: 28 | SIDER US FAERS | |
| 82 | Depressed mood | FAERS: 27 | OFFSIDES SIDER US FAERS | |
| 83 | Restlessness | FAERS: 27 | US FAERS | |
| 84 | Bradyphrenia | FAERS: 26 | SIDER US FAERS | |
| 85 | Drug screen positive | FAERS: 26 | US FAERS | |
| 86 | Impaired driving ability | FAERS: 26 | US FAERS | |
| 87 | Arthralgia | FAERS: 25 | SIDER US FAERS | |
| 88 | Constipation | FAERS: 25 | SIDER US FAERS | |
| 89 | Intentional drug misuse | FAERS: 25 | US FAERS | |
| 90 | Product physical issue | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 91 | Abasia | FAERS: 22 | US FAERS | |
| 92 | Abdominal Pain | FAERS: 22 | SIDER US FAERS | |
| 93 | Diabetes Mellitus | FAERS: 22 | US FAERS | |
| 94 | Feeling jittery | FAERS: 22 | SIDER US FAERS | |
| 95 | Lethargy | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 96 | Mental status changes | FAERS: 22 | OFFSIDES US FAERS | |
| 97 | Back Pain | FAERS: 20 | SIDER US FAERS | |
| 98 | Burning sensation | FAERS: 20 | US FAERS | |
| 99 | Hypersomnia | FAERS: 20 | SIDER US FAERS | |
| 100 | Catatonia | FAERS: 19 | US FAERS | |
| 101 | Drug abuser | FAERS: 19 | US FAERS | |
| 102 | Wrong technique in product usage process | FAERS: 19 | US FAERS | |
| 103 | Alcohol abuse | FAERS: 18 | US FAERS | |
| 104 | Drug dose omission | FAERS: 18 | US FAERS | |
| 105 | Fibromyalgia | FAERS: 18 | US FAERS | |
| 106 | Poor quality drug administered | FAERS: 18 | US FAERS | |
| 107 | Bedridden | FAERS: 17 | US FAERS | |
| 108 | Drug prescribing error | FAERS: 17 | US FAERS | |
| 109 | Glaucoma | FAERS: 17 | OFFSIDES US FAERS | |
| 110 | Loss of personal independence in daily activities | FAERS: 17 | US FAERS | |
| 111 | Irritable Bowel Syndrome | FAERS: 16 | US FAERS | |
| 112 | Personality Change | FAERS: 16 | US FAERS | |
| 113 | Post-Traumatic Stress Disorder | FAERS: 16 | US FAERS | |
| 114 | Prescription drug used without a prescription | FAERS: 16 | US FAERS | |
| 115 | Urinary Retention | FAERS: 16 | SIDER US FAERS | |
| 116 | Bradycardia | FAERS: 15 | 10464538 | CTD OFFSIDES US FAERS |
| 117 | Bradykinesia | FAERS: 15 | US FAERS | |
| 118 | Chest discomfort | FAERS: 15 | SIDER US FAERS | |
| 119 | Drug toxicity | FAERS: 15 | US FAERS | |
| 120 | Erythema | FAERS: 15 | OFFSIDES US FAERS | |
| 121 | Mental impairment | FAERS: 15 | US FAERS | |
| 122 | Poor quality sleep | FAERS: 15 | US FAERS | |
| 123 | Reaction to drug excipients | FAERS: 15 | US FAERS | |
| 124 | Syncope | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 125 | Unevaluable event | FAERS: 15 | US FAERS | |
| 126 | Cataract | FAERS: 14 | OFFSIDES US FAERS | |
| 127 | Middle insomnia | FAERS: 14 | OFFSIDES US FAERS | |
| 128 | Pneumonia | FAERS: 14 | US FAERS | |
| 129 | Throat irritation | FAERS: 14 | US FAERS | |
| 130 | Adverse event | FAERS: 13 | US FAERS | |
| 131 | Agoraphobia | FAERS: 13 | 2651489 3358644 | CTD US FAERS |
| 132 | Alopecia | FAERS: 13 | US FAERS | |
| 133 | Anaphylactic shock | FAERS: 13 | US FAERS | |
| 134 | Ataxia | FAERS: 13 | 3358644 7802851 | CTD SIDER US FAERS |
| 135 | Dehydration | FAERS: 13 | OFFSIDES US FAERS | |
| 136 | Inappropriate schedule of drug administration | FAERS: 13 | US FAERS | |
| 137 | Mood swings | FAERS: 13 | SIDER US FAERS | |
| 138 | Musculoskeletal stiffness | FAERS: 13 | OFFSIDES SIDER US FAERS | |
| 139 | Mydriasis | FAERS: 13 | SIDER US FAERS | |
| 140 | Obsessive-Compulsive Disorder | FAERS: 13 | US FAERS | |
| 141 | Poor quality product administered | FAERS: 13 | US FAERS | |
| 142 | Respiratory Depression | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Swelling | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Alcohol interaction | FAERS: 12 | US FAERS | |
| 145 | Atrial Fibrillation | FAERS: 12 | 10389047 | CTD US FAERS |
| 146 | Blood glucose increased | FAERS: 12 | US FAERS | |
| 147 | Dementia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Discomfort | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 149 | Epilepsy | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 150 | Eye pain | FAERS: 12 | US FAERS | |
| 151 | Photophobia | FAERS: 12 | SIDER US FAERS | |
| 152 | Blood cholesterol increased | FAERS: 11 | US FAERS | |
| 153 | Dysgraphia | FAERS: 11 | US FAERS | |
| 154 | Erectile dysfunction | FAERS: 11 | US FAERS | |
| 155 | Feeling Cold | FAERS: 11 | US FAERS | |
| 156 | Infection | FAERS: 11 | SIDER US FAERS | |
| 157 | Angina Pectoris | FAERS: 10 | US FAERS | |
| 158 | Arthritis | FAERS: 10 | OFFSIDES US FAERS | |
| 159 | Arthropathy | FAERS: 10 | OFFSIDES US FAERS | |
| 160 | Drug administration error | FAERS: 10 | US FAERS | |
| 161 | Euphoric mood | FAERS: 10 | SIDER US FAERS | |
| 162 | Exposure via ingestion | FAERS: 10 | US FAERS | |
| 163 | General physical health deterioration | FAERS: 10 | OFFSIDES US FAERS | |
| 164 | Muscle tightness | FAERS: 10 | US FAERS | |
| 165 | Nerve injury | FAERS: 10 | US FAERS | |
| 166 | Neuralgia | FAERS: 10 | OFFSIDES US FAERS | |
| 167 | Product shape issue | FAERS: 10 | US FAERS | |
| 168 | Product solubility abnormal | FAERS: 10 | US FAERS | |
| 169 | Sluggishness | FAERS: 10 | SIDER US FAERS | |
| 170 | Temperature intolerance | FAERS: 10 | US FAERS | |
| 171 | Thirst | FAERS: 10 | SIDER US FAERS | |
| 172 | Urinary Incontinence | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 173 | Victim of chemical submission | FAERS: 10 | US FAERS | |
| 174 | Accidental exposure to product | FAERS: 9 | US FAERS | |
| 175 | Alcohol poisoning | FAERS: 9 | US FAERS | |
| 176 | Asthma | FAERS: 9 | OFFSIDES US FAERS | |
| 177 | Back disorder | FAERS: 9 | US FAERS | |
| 178 | Blood creatine phosphokinase increased | FAERS: 9 | US FAERS | |
| 179 | Diplopia | FAERS: 9 | SIDER US FAERS | |
| 180 | Emotional distress | FAERS: 9 | OFFSIDES US FAERS | |
| 181 | Epistaxis | FAERS: 9 | SIDER US FAERS | |
| 182 | Hyperventilation | FAERS: 9 | SIDER US FAERS | |
| 183 | Hypokinesia | FAERS: 9 | US FAERS | |
| 184 | Pulmonary Embolism | FAERS: 9 | US FAERS | |
| 185 | Slow speech | FAERS: 9 | US FAERS | |
| 186 | Thrombosis | FAERS: 9 | US FAERS | |
| 187 | Apathy | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 188 | Apparent death | FAERS: 8 | US FAERS | |
| 189 | Bipolar Disorder | FAERS: 8 Canada Vigilance: 1 | CTD OFFSIDES Canada Vigilance US FAERS | |
| 190 | Blood potassium decreased | FAERS: 8 | OFFSIDES US FAERS | |
| 191 | Cold sweat | FAERS: 8 | SIDER US FAERS | |
| 192 | Counterfeit product administered | FAERS: 8 | US FAERS | |
| 193 | Deafness | FAERS: 8 | OFFSIDES US FAERS | |
| 194 | Drug effect delayed | FAERS: 8 | US FAERS | |
| 195 | Drug screen negative | FAERS: 8 | US FAERS | |
| 196 | Drug withdrawal convulsions | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 197 | Expired product administered | FAERS: 8 | US FAERS | |
| 198 | Homicide | FAERS: 8 | US FAERS | |
| 199 | Hostility | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 200 | Influenza | FAERS: 8 | SIDER US FAERS | |
| 201 | Life expectancy shortened | FAERS: 8 | US FAERS | |
| 202 | Maternal exposure during pregnancy | FAERS: 8 | US FAERS | |
| 203 | Neck Pain | FAERS: 8 | US FAERS | |
| 204 | Negative thoughts | FAERS: 8 | US FAERS | |
| 205 | No adverse event | FAERS: 8 | US FAERS | |
| 206 | Paramnesia | FAERS: 8 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 207 | Physical assault | FAERS: 8 | OFFSIDES US FAERS | |
| 208 | Psychiatric symptom | FAERS: 8 | OFFSIDES US FAERS | |
| 209 | Respiratory distress | FAERS: 8 | US FAERS | |
| 210 | Restless Legs Syndrome | FAERS: 8 | US FAERS | |
| 211 | Snoring | FAERS: 8 | US FAERS | |
| 212 | Wrong technique in drug usage process | FAERS: 8 | OFFSIDES US FAERS | |
| 213 | Accidental exposure to product by child | FAERS: 7 | US FAERS | |
| 214 | Bronchitis | FAERS: 7 | OFFSIDES US FAERS | |
| 215 | Bruxism | FAERS: 7 | US FAERS | |
| 216 | Chills | FAERS: 7 | SIDER US FAERS | |
| 217 | Choking | FAERS: 7 | US FAERS | |
| 218 | Circumstance or information capable of leading to medication error | FAERS: 7 | US FAERS | |
| 219 | Cyanosis | FAERS: 7 | US FAERS | |
| 220 | Drug effective for unapproved indication | FAERS: 7 | US FAERS | |
| 221 | Dysphemia | FAERS: 7 | US FAERS | |
| 222 | Dysuria | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 223 | Flatulence | FAERS: 7 | US FAERS | |
| 224 | Flushing | FAERS: 7 | US FAERS | |
| 225 | Infarction | FAERS: 7 | US FAERS | |
| 226 | Joint injury | FAERS: 7 | OFFSIDES US FAERS | |
| 227 | Limb discomfort | FAERS: 7 | US FAERS | |
| 228 | Oropharyngeal pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Prescription form tampering | FAERS: 7 | US FAERS | |
| 230 | Product counterfeit | FAERS: 7 | US FAERS | |
| 231 | Product dispensing error | FAERS: 7 | US FAERS | |
| 232 | Product label issue | FAERS: 7 | US FAERS | |
| 233 | Product size issue | FAERS: 7 | US FAERS | |
| 234 | Reaction to excipient | FAERS: 7 | US FAERS | |
| 235 | Sinusitis | FAERS: 7 | OFFSIDES US FAERS | |
| 236 | Somnambulism | FAERS: 7 | US FAERS | |
| 237 | Tachyphrenia | FAERS: 7 | US FAERS | |
| 238 | Tension | FAERS: 7 | SIDER US FAERS | |
| 239 | Acute Coronary Syndrome | FAERS: 6 | OFFSIDES US FAERS | |
| 240 | Bone pain | FAERS: 6 | US FAERS | |
| 241 | Disability | FAERS: 6 | US FAERS | |
| 242 | Drug level increased | FAERS: 6 | US FAERS | |
| 243 | Eructation | FAERS: 6 | US FAERS | |
| 244 | Gastritis | FAERS: 6 | US FAERS | |
| 245 | Hallucinations, mixed | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 246 | Incorrect drug administration duration | FAERS: 6 | OFFSIDES US FAERS | |
| 247 | Joint swelling | FAERS: 6 | US FAERS | |
| 248 | Lymphadenopathy | FAERS: 6 | US FAERS | |
| 249 | Paradoxical drug reaction | FAERS: 6 | US FAERS | |
| 250 | Presyncope | FAERS: 6 | US FAERS | |
| 251 | Product formulation issue | FAERS: 6 | US FAERS | |
| 252 | Psychomotor skills impaired | FAERS: 6 | US FAERS | |
| 253 | Screaming | FAERS: 6 | US FAERS | |
| 254 | Sinus Tachycardia | FAERS: 6 | SIDER US FAERS | |
| 255 | Therapeutic product effect incomplete | FAERS: 6 | US FAERS | |
| 256 | Thrombocytopenia | FAERS: 6 | US FAERS | |
| 257 | Unresponsive to stimuli | FAERS: 6 | OFFSIDES US FAERS | |
| 258 | Urinary tract infection | FAERS: 6 | US FAERS | |
| 259 | Acute kidney injury | FAERS: 5 | US FAERS | |
| 260 | Angle Closure Glaucoma | FAERS: 5 | US FAERS | |
| 261 | Aphasia | FAERS: 5 | US FAERS | |
| 262 | Blood cholesterol abnormal | FAERS: 5 | US FAERS | |
| 263 | Cachexia | FAERS: 5 | US FAERS | |
| 264 | Cerebral disorder | FAERS: 5 | US FAERS | |
| 265 | Disease recurrence | FAERS: 5 | US FAERS | |
| 266 | Drug clearance decreased | FAERS: 5 | US FAERS | |
| 267 | Eye irritation | FAERS: 5 | US FAERS | |
| 268 | Gait inability | FAERS: 5 | US FAERS | |
| 269 | Gastrointestinal Pain | FAERS: 5 | SIDER US FAERS | |
| 270 | Head discomfort | FAERS: 5 | US FAERS | |
| 271 | Hyporeflexia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 272 | Hypoxia | FAERS: 5 | 11815692 | CTD US FAERS |
| 273 | Inappropriate affect | FAERS: 5 | US FAERS | |
| 274 | Labyrinthitis | FAERS: 5 | US FAERS | |
| 275 | Libido disorder | FAERS: 5 | US FAERS | |
| 276 | Limb injury | FAERS: 5 | OFFSIDES US FAERS | |
| 277 | Multiple drug overdose intentional | FAERS: 5 | US FAERS | |
| 278 | Neonatal disorder | FAERS: 5 | US FAERS | |
| 279 | Osteoporosis | FAERS: 5 | US FAERS | |
| 280 | Pancreatitis | FAERS: 5 | OFFSIDES US FAERS | |
| 281 | Peripheral swelling | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 282 | Pharyngolaryngeal Pain | FAERS: 5 | SIDER US FAERS | |
| 283 | Product complaint | FAERS: 5 | US FAERS | |
| 284 | Quality of life decreased | FAERS: 5 | US FAERS | |
| 285 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 286 | Retching | FAERS: 5 | US FAERS | |
| 287 | Rotator cuff syndrome | FAERS: 5 | US FAERS | |
| 288 | Sexual Dysfunction | FAERS: 5 | SIDER US FAERS | |
| 289 | Shock | FAERS: 5 | SIDER US FAERS | |
| 290 | Stupor | FAERS: 5 | SIDER US FAERS | |
| 291 | Therapeutic response changed | FAERS: 5 | US FAERS | |
| 292 | Vitreous floaters | FAERS: 5 | US FAERS | |
| 293 | White blood cell count decreased | FAERS: 5 | US FAERS | |
| 294 | Abnormal sleep-related event | FAERS: 4 | US FAERS | |
| 295 | Acute respiratory failure | FAERS: 4 | OFFSIDES US FAERS | |
| 296 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 297 | Allergic reaction to excipient | FAERS: 4 | US FAERS | |
| 298 | Bronchospasm | FAERS: 4 | US FAERS | |
| 299 | Cerebral atrophy | FAERS: 4 | OFFSIDES US FAERS | |
| 300 | Chemical submission | FAERS: 4 | US FAERS | |
| 301 | Conversion disorder | FAERS: 4 | US FAERS | |
| 302 | Counterfeit drug administered | FAERS: 4 | US FAERS | |
| 303 | Cystitis | FAERS: 4 | US FAERS | |
| 304 | Dissociation | FAERS: 4 | US FAERS | |
| 305 | Diverticulitis | FAERS: 4 | OFFSIDES US FAERS | |
| 306 | Gastric ulcer | FAERS: 4 | OFFSIDES US FAERS | |
| 307 | Gluten sensitivity | FAERS: 4 | US FAERS | |
| 308 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 309 | Hunger | FAERS: 4 | US FAERS | |
| 310 | Hyperacusis | FAERS: 4 | US FAERS | |
| 311 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 312 | Initial insomnia | FAERS: 4 | US FAERS | |
| 313 | Laceration | FAERS: 4 | US FAERS | |
| 314 | Lyme Disease | FAERS: 4 | US FAERS | |
| 315 | Macular degeneration | FAERS: 4 | US FAERS | |
| 316 | Maternal exposure timing unspecified | FAERS: 4 | US FAERS | |
| 317 | Medication residue | FAERS: 4 | US FAERS | |
| 318 | Nasal discomfort | FAERS: 4 | US FAERS | |
| 319 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 320 | Pallor | FAERS: 4 | US FAERS | |
| 321 | Papillary muscle disorder | FAERS: 4 | US FAERS | |
| 322 | Prescribed overdose | FAERS: 4 | US FAERS | |
| 323 | Product physical consistency issue | FAERS: 4 | US FAERS | |
| 324 | Rebound effect | FAERS: 4 | US FAERS | |
| 325 | Rhabdomyolysis | FAERS: 4 | OFFSIDES US FAERS | |
| 326 | Sepsis | FAERS: 4 | US FAERS | |
| 327 | Soliloquy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 328 | Staring | FAERS: 4 | US FAERS | |
| 329 | Tardive Dyskinesia | FAERS: 4 | US FAERS | |
| 330 | Tension Headache | FAERS: 4 | US FAERS | |
| 331 | Theft | FAERS: 4 | US FAERS | |
| 332 | Therapeutic product effect decreased | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 333 | Transcription medication error | FAERS: 4 | US FAERS | |
| 334 | Ulcer | FAERS: 4 | OFFSIDES US FAERS | |
| 335 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 336 | Accidental drug intake by child | FAERS: 3 | US FAERS | |
| 337 | Ageusia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 338 | Alcohol withdrawal syndrome | FAERS: 3 | US FAERS | |
| 339 | Anhedonia | FAERS: 3 | OFFSIDES US FAERS | |
| 340 | Aphonia | FAERS: 3 | US FAERS | |
| 341 | Blood alcohol increased | FAERS: 3 | US FAERS | |
| 342 | Blood creatinine increased | FAERS: 3 | US FAERS | |
| 343 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 344 | Cerebellar Ataxia | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 345 | Choking sensation | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 346 | Clumsiness | FAERS: 3 | SIDER US FAERS | |
| 347 | Coma scale abnormal | FAERS: 3 | US FAERS | |
| 348 | Coronary no-reflow phenomenon | FAERS: 3 | US FAERS | |
| 349 | Cyst | FAERS: 3 | US FAERS | |
| 350 | Diet refusal | FAERS: 3 | US FAERS | |
| 351 | Drug administered to patient of inappropriate age | FAERS: 3 | US FAERS | |
| 352 | Drug dispensed to wrong patient | FAERS: 3 | US FAERS | |
| 353 | Dysphonia | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 354 | Economic problem | FAERS: 3 | OFFSIDES US FAERS | |
| 355 | Erythema Multiforme | FAERS: 3 | SIDER US FAERS | |
| 356 | Food Allergy | FAERS: 3 | US FAERS | |
| 357 | Formication | FAERS: 3 | OFFSIDES US FAERS | |
| 358 | Fracture | FAERS: 3 | US FAERS | |
| 359 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 360 | Glossopharyngeal Nerve Disorder | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 361 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 362 | Hormone level abnormal | FAERS: 3 | US FAERS | |
| 363 | Hyperphagia | FAERS: 3 | US FAERS | |
| 364 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 365 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 366 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 367 | Impaired self-care | FAERS: 3 | US FAERS | |
| 368 | Incorrect product administration duration | FAERS: 3 | US FAERS | |
| 369 | Intervertebral Disc Degeneration | FAERS: 3 | OFFSIDES US FAERS | |
| 370 | Intrusive thoughts | FAERS: 3 | US FAERS | |
| 371 | Joint stiffness | FAERS: 3 | US FAERS | |
| 372 | Lactose Intolerance | FAERS: 3 | US FAERS | |
| 373 | Laryngitis | FAERS: 3 | US FAERS | |
| 374 | Ligament injury | FAERS: 3 | US FAERS | |
| 375 | Lip and/or oral cavity cancer | FAERS: 3 | US FAERS | |
| 376 | Lip swelling | FAERS: 3 | US FAERS | |
| 377 | Lymphoma | FAERS: 3 | OFFSIDES US FAERS | |
| 378 | Multiple Sclerosis | FAERS: 3 | OFFSIDES US FAERS | |
| 379 | Multiple drug overdose | FAERS: 3 | OFFSIDES US FAERS | |
| 380 | Musculoskeletal discomfort | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 381 | Mutism | FAERS: 3 | US FAERS | |
| 382 | Myoclonus | FAERS: 3 | US FAERS | |
| 383 | Nasopharyngitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 384 | Night sweats | FAERS: 3 | US FAERS | |
| 385 | Peritonitis | FAERS: 3 | US FAERS | |
| 386 | Pneumothorax | FAERS: 3 | US FAERS | |
| 387 | Polydipsia | FAERS: 3 | US FAERS | |
| 388 | Posturing | FAERS: 3 | US FAERS | |
| 389 | Pregnancy | FAERS: 3 | US FAERS | |
| 390 | Saliva altered | FAERS: 3 | US FAERS | |
| 391 | Sarcoma | FAERS: 3 | US FAERS | |
| 392 | Sciatica | FAERS: 3 | US FAERS | |
| 393 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 394 | Skin irritation | FAERS: 3 | US FAERS | |
| 395 | Skin reaction | FAERS: 3 | US FAERS | |
| 396 | Status Epilepticus | FAERS: 3 | 14644903 | CTD US FAERS |
| 397 | Sudden onset of sleep | FAERS: 3 | US FAERS | |
| 398 | Therapy change | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 399 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 400 | Tongue biting | FAERS: 3 | US FAERS | |
| 401 | Vagus Nerve Disorder | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 402 | Vitamin D Deficiency | FAERS: 3 | US FAERS | |
| 403 | Wrong drug | FAERS: 3 | US FAERS | |
| 404 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 405 | Accidental exposure | FAERS: 2 | US FAERS | |
| 406 | Allergic sinusitis | FAERS: 2 | US FAERS | |
| 407 | Aneurysm | FAERS: 2 | OFFSIDES US FAERS | |
| 408 | Angioedema | FAERS: 2 | 16987489 | CTD SIDER US FAERS |
| 409 | Anion gap abnormal | FAERS: 2 | US FAERS | |
| 410 | Anorexia | FAERS: 2 | SIDER US FAERS | |
| 411 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 412 | Ascites | FAERS: 2 | US FAERS | |
| 413 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 414 | Asphyxia | FAERS: 2 | OFFSIDES US FAERS | |
| 415 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 416 | Atypical attention deficit syndrome | FAERS: 2 | US FAERS | |
| 417 | Benign Prostatic Hyperplasia | FAERS: 2 | US FAERS | |
| 418 | Bipolar II disorder | FAERS: 2 | US FAERS | |
| 419 | Blepharospasm | FAERS: 2 | US FAERS | |
| 420 | Blindness | FAERS: 2 | US FAERS | |
| 421 | Blood creatine phosphokinase MB increased | FAERS: 2 | US FAERS | |
| 422 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 423 | Blood ketone body increased | FAERS: 2 | US FAERS | |
| 424 | Blood prolactin increased | FAERS: 2 | US FAERS | |
| 425 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 426 | Blood urea abnormal | FAERS: 2 | US FAERS | |
| 427 | Borderline Personality Disorder | FAERS: 2 | US FAERS | |
| 428 | Boredom | FAERS: 2 | US FAERS | |
| 429 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 430 | Bronchopneumonia | FAERS: 2 | OFFSIDES US FAERS | |
| 431 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 432 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 433 | Cleft uvula | FAERS: 2 | US FAERS | |
| 434 | Congenital neurological disorder | FAERS: 2 | US FAERS | |
| 435 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 436 | Dengue Fever | FAERS: 2 | US FAERS | |
| 437 | Dental caries | FAERS: 2 | OFFSIDES US FAERS | |
| 438 | Depression suicidal | FAERS: 2 | US FAERS | |
| 439 | Drug effect variable | FAERS: 2 | US FAERS | |
| 440 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 441 | Drug withdrawal headache | FAERS: 2 | OFFSIDES US FAERS | |
| 442 | Dry skin | FAERS: 2 | US FAERS | |
| 443 | Ductus arteriosus premature closure | FAERS: 2 | US FAERS | |
| 444 | Dysentery | FAERS: 2 | US FAERS | |
| 445 | Dyslalia | FAERS: 2 | US FAERS | |
| 446 | Dyslexia | FAERS: 2 | US FAERS | |
| 447 | Dystonia | FAERS: 2 | US FAERS | |
| 448 | Excessive ocular convergence | FAERS: 2 | US FAERS | |
| 449 | Excoriation | FAERS: 2 | OFFSIDES US FAERS | |
| 450 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 451 | Extra dose administered | FAERS: 2 | US FAERS | |
| 452 | Flat affect | FAERS: 2 | SIDER US FAERS | |
| 453 | Frustration | FAERS: 2 | US FAERS | |
| 454 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 455 | Gingivitis | FAERS: 2 | US FAERS | |
| 456 | Head Banging | FAERS: 2 | US FAERS | |
| 457 | Hernia | FAERS: 2 | OFFSIDES US FAERS | |
| 458 | Hypercapnia | FAERS: 2 | US FAERS | |
| 459 | Hypervigilance | FAERS: 2 | US FAERS | |
| 460 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 461 | Impatience | FAERS: 2 | US FAERS | |
| 462 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 463 | Inflammation | FAERS: 2 | US FAERS | |
| 464 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 465 | Intentional misuse | FAERS: 2 | US FAERS | |
| 466 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 467 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 468 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 469 | Irregular breathing | FAERS: 2 | US FAERS | |
| 470 | Limb crushing injury | FAERS: 2 | US FAERS | |
| 471 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 472 | Mastitis | FAERS: 2 | US FAERS | |
| 473 | Medication residue present | FAERS: 2 | US FAERS | |
| 474 | Mental Retardation | FAERS: 2 | SIDER US FAERS | |
| 475 | Metabolic acidosis | FAERS: 2 | OFFSIDES US FAERS | |
| 476 | Muscle Rigidity | FAERS: 2 | SIDER US FAERS | |
| 477 | Musculoskeletal Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 478 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 479 | Negativism | FAERS: 2 | US FAERS | |
| 480 | Neutropenia | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 481 | No adverse effect | FAERS: 2 | US FAERS | |
| 482 | No adverse reaction | FAERS: 2 | US FAERS | |
| 483 | Nocturia | FAERS: 2 | OFFSIDES US FAERS | |
| 484 | Oral pain | FAERS: 2 | US FAERS | |
| 485 | Oropharyngeal discomfort | FAERS: 2 | US FAERS | |
| 486 | Oxygen consumption decreased | FAERS: 2 | US FAERS | |
| 487 | Persistent depressive disorder | FAERS: 2 | US FAERS | |
| 488 | Post procedural complication | FAERS: 2 | US FAERS | |
| 489 | Posterior reversible encephalopathy syndrome | FAERS: 2 | US FAERS | |
| 490 | Pregnancy test false positive | FAERS: 2 | US FAERS | |
| 491 | Pregnancy test positive | FAERS: 2 | US FAERS | |
| 492 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 493 | Product name confusion | FAERS: 2 | US FAERS | |
| 494 | Product packaging issue | FAERS: 2 | US FAERS | |
| 495 | Product prescribing issue | FAERS: 2 | US FAERS | |
| 496 | Product tampering | FAERS: 2 | US FAERS | |
| 497 | Psoriasis | FAERS: 2 | US FAERS | |
| 498 | Pupillary light reflex tests abnormal | FAERS: 2 | US FAERS | |
| 499 | Reflux gastritis | FAERS: 2 | US FAERS | |
| 500 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 501 | Retrograde amnesia | FAERS: 2 | US FAERS | |
| 502 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 503 | Right Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 504 | Right ventricular failure | FAERS: 2 | US FAERS | |
| 505 | Ruptured cerebral aneurysm | FAERS: 2 | US FAERS | |
| 506 | Salivary gland pain | FAERS: 2 | US FAERS | |
| 507 | Schizophrenia | FAERS: 2 Canada Vigilance: 1 | 10464538 | CTD Canada Vigilance US FAERS |
| 508 | Scleroderma | FAERS: 2 | US FAERS | |
| 509 | Seizure like phenomena | FAERS: 2 | US FAERS | |
| 510 | Slow response to stimuli | FAERS: 2 | US FAERS | |
| 511 | Sneezing | FAERS: 2 | US FAERS | |
| 512 | Splenic Rupture | FAERS: 2 | US FAERS | |
| 513 | Teeth brittle | FAERS: 2 | US FAERS | |
| 514 | Therapy cessation | FAERS: 2 | US FAERS | |
| 515 | Throat cancer | FAERS: 2 | US FAERS | |
| 516 | Toe operation | FAERS: 2 | US FAERS | |
| 517 | Toothache | FAERS: 2 | US FAERS | |
| 518 | Trismus | FAERS: 2 | US FAERS | |
| 519 | Troponin increased | FAERS: 2 | US FAERS | |
| 520 | Ventricular hypokinesia | FAERS: 2 | US FAERS | |
| 521 | Victim of homicide | FAERS: 2 | US FAERS | |
| 522 | Victim of sexual abuse | FAERS: 2 | US FAERS | |
| 523 | Vulvovaginal dryness | FAERS: 2 | US FAERS | |
| 524 | Walking aid user | FAERS: 2 | US FAERS | |
| 525 | Wheelchair user | FAERS: 2 | OFFSIDES US FAERS | |
| 526 | Wheezing | FAERS: 2 | US FAERS | |
| 527 | Withdrawal catatonia | FAERS: 2 | US FAERS | |
| 528 | Wrong product administered | FAERS: 2 | US FAERS | |
| 529 | treatment failure | FAERS: 2 | US FAERS | |
| 530 | Abulia | FAERS: 1 | US FAERS | |
| 531 | Accidental death | FAERS: 1 | OFFSIDES US FAERS | |
| 532 | Acne | FAERS: 1 | US FAERS | |
| 533 | Acute psychosis | FAERS: 1 | US FAERS | |
| 534 | Akathisia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 535 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 536 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 537 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 538 | Amputation | FAERS: 1 | US FAERS | |
| 539 | Anal Fissure | FAERS: 1 | US FAERS | |
| 540 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 541 | Anosmia | FAERS: 1 | US FAERS | |
| 542 | Antidepressant drug level increased | FAERS: 1 | US FAERS | |
| 543 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 544 | Aphagia | FAERS: 1 | US FAERS | |
| 545 | Appendicitis | FAERS: 1 | US FAERS | |
| 546 | Arthropod bite | FAERS: 1 | US FAERS | |
| 547 | Asthenopia | FAERS: 1 | US FAERS | |
| 548 | Auricular swelling | FAERS: 1 | US FAERS | |
| 549 | Autoimmune thyroiditis | FAERS: 1 | OFFSIDES US FAERS | |
| 550 | Autonomic nervous system imbalance | FAERS: 1 | US FAERS | |
| 551 | Bipolar I disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 552 | Bladder pain | FAERS: 1 | US FAERS | |
| 553 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 554 | Blood alcohol abnormal | FAERS: 1 | US FAERS | |
| 555 | Blood alcohol | FAERS: 1 | US FAERS | |
| 556 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 557 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 558 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 559 | Blood ethanol increased | FAERS: 1 | US FAERS | |
| 560 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 561 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 562 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 563 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 564 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 565 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 566 | Blood triglycerides increased | FAERS: 1 | OFFSIDES US FAERS | |
| 567 | Blood urea increased | FAERS: 1 | US FAERS | |
| 568 | Blood urine present | FAERS: 1 | US FAERS | |
| 569 | Blunted affect | FAERS: 1 | US FAERS | |
| 570 | Brain Death | FAERS: 1 | OFFSIDES US FAERS | |
| 571 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 572 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 573 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 574 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 575 | Bursitis | FAERS: 1 | OFFSIDES US FAERS | |
| 576 | Cancer Pain | FAERS: 1 | US FAERS | |
| 577 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 578 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 579 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 580 | Cartilage injury | FAERS: 1 | US FAERS | |
| 581 | Cataract operation | FAERS: 1 | OFFSIDES US FAERS | |
| 582 | Catheter site infection | FAERS: 1 | US FAERS | |
| 583 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 584 | Chromaturia | FAERS: 1 | US FAERS | |
| 585 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 586 | Cleft Palate | FAERS: 1 | US FAERS | |
| 587 | Clinodactyly | FAERS: 1 | US FAERS | |
| 588 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 589 | Coating in mouth | FAERS: 1 | US FAERS | |
| 590 | Cogwheel Rigidity | FAERS: 1 | US FAERS | |
| 591 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 592 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 593 | Compression fracture | FAERS: 1 | US FAERS | |
| 594 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 595 | Corneal erosion | FAERS: 1 | US FAERS | |
| 596 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 597 | Cubital Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 598 | Death of relative | FAERS: 1 | US FAERS | |
| 599 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 600 | Delusional perception | FAERS: 1 | US FAERS | |
| 601 | Demyelination | FAERS: 1 | OFFSIDES US FAERS | |
| 602 | Dental Fistula | FAERS: 1 | US FAERS | |
| 603 | Dental discomfort | FAERS: 1 | US FAERS | |
| 604 | Denture wearer | FAERS: 1 | OFFSIDES US FAERS | |
| 605 | Device related sepsis | FAERS: 1 | US FAERS | |
| 606 | Device use error | FAERS: 1 | US FAERS | |
| 607 | Diabetes mellitus inadequate control | FAERS: 1 | OFFSIDES US FAERS | |
| 608 | Disease Progression | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 609 | Disruptive mood dysregulation disorder | FAERS: 1 | US FAERS | |
| 610 | Diverticulum | FAERS: 1 | OFFSIDES US FAERS | |
| 611 | Drooling | FAERS: 1 | US FAERS | |
| 612 | Drowning | FAERS: 1 | US FAERS | |
| 613 | Drug diversion | FAERS: 1 | US FAERS | |
| 614 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 615 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 616 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 617 | Drug level changed | FAERS: 1 | US FAERS | |
| 618 | Drug resistance | FAERS: 1 | US FAERS | |
| 619 | Dysbacteriosis | FAERS: 1 | US FAERS | |
| 620 | Dyschezia | FAERS: 1 | OFFSIDES US FAERS | |
| 621 | Dysmorphism | FAERS: 1 | US FAERS | |
| 622 | Dyspareunia | FAERS: 1 | US FAERS | |
| 623 | Ear discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 624 | Echography abnormal | FAERS: 1 | US FAERS | |
| 625 | Eczema | FAERS: 1 | US FAERS | |
| 626 | Elder Abuse | FAERS: 1 | US FAERS | |
| 627 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 628 | Endocardial Fibroelastosis | FAERS: 1 | US FAERS | |
| 629 | Enuresis | FAERS: 1 | 7802851 | CTD US FAERS |
| 630 | Eosinophilia | FAERS: 1 | US FAERS | |
| 631 | Erection increased | FAERS: 1 | US FAERS | |
| 632 | Exaggerated startle response | FAERS: 1 | US FAERS | |
| 633 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 634 | Exfoliation Syndrome | FAERS: 1 | US FAERS | |
| 635 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 636 | Eyelid pain | FAERS: 1 | US FAERS | |
| 637 | Facial Pain | FAERS: 1 | US FAERS | |
| 638 | Facial wasting | FAERS: 1 | US FAERS | |
| 639 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 640 | Feeding disorder neonatal | FAERS: 1 | US FAERS | |
| 641 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 642 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 643 | Finger hypoplasia | FAERS: 1 | US FAERS | |
| 644 | Flight of ideas | FAERS: 1 | US FAERS | |
| 645 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 646 | Food Poisoning | FAERS: 1 | US FAERS | |
| 647 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 648 | Fracture pain | FAERS: 1 | US FAERS | |
| 649 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 650 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 651 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 652 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 653 | Gastrointestinal lymphoma | FAERS: 1 | US FAERS | |
| 654 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 655 | Gastroschisis | FAERS: 1 | US FAERS | |
| 656 | Genital discharge | FAERS: 1 | US FAERS | |
| 657 | Glutamate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 658 | Grief reaction | FAERS: 1 | US FAERS | |
| 659 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 660 | Group B streptococcus neonatal sepsis | FAERS: 1 | US FAERS | |
| 661 | Hand-eye coordination impaired | FAERS: 1 | US FAERS | |
| 662 | Hemicephalalgia | FAERS: 1 | US FAERS | |
| 663 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 664 | Hepatitis C | FAERS: 1 | OFFSIDES US FAERS | |
| 665 | Hidradenitis | FAERS: 1 | US FAERS | |
| 666 | Human chorionic gonadotropin increased | FAERS: 1 | US FAERS | |
| 667 | Hypometabolism | FAERS: 1 | US FAERS | |
| 668 | Hypopituitarism | FAERS: 1 | US FAERS | |
| 669 | Hypothalamo-pituitary disorder | FAERS: 1 | US FAERS | |
| 670 | Hypoventilation | FAERS: 1 | US FAERS | |
| 671 | Hysterectomy | FAERS: 1 | US FAERS | |
| 672 | Iatrogenic injury | FAERS: 1 | OFFSIDES US FAERS | |
| 673 | Ileus | FAERS: 1 | US FAERS | |
| 674 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 675 | Incoherent | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 676 | Incontinence | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 677 | Infective exacerbation of chronic obstructive airways disease | FAERS: 1 | US FAERS | |
| 678 | Injection site ulcer | FAERS: 1 | US FAERS | |
| 679 | Intellectual Disability | FAERS: 1 | US FAERS | |
| 680 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 681 | Intercepted product administration error | FAERS: 1 | US FAERS | |
| 682 | Intercepted product selection error | FAERS: 1 | US FAERS | |
| 683 | Intraocular pressure test | FAERS: 1 | US FAERS | |
| 684 | Joint Instability | FAERS: 1 | US FAERS | |
| 685 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 686 | Joint destruction | FAERS: 1 | US FAERS | |
| 687 | Joint sprain | FAERS: 1 | OFFSIDES US FAERS | |
| 688 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 689 | Large intestine perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 690 | Latex allergy | FAERS: 1 | US FAERS | |
| 691 | Laziness | FAERS: 1 | US FAERS | |
| 692 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 693 | Leukopenia | FAERS: 1 | US FAERS | |
| 694 | Ligament rupture | FAERS: 1 | US FAERS | |
| 695 | Ligamentitis | FAERS: 1 | US FAERS | |
| 696 | Lipase increased | FAERS: 1 | US FAERS | |
| 697 | Lipoma | FAERS: 1 | US FAERS | |
| 698 | Locked-In Syndrome | FAERS: 1 | US FAERS | |
| 699 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 700 | Lymphopenia | FAERS: 1 | US FAERS | |
| 701 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 702 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 703 | Malabsorption | FAERS: 1 | US FAERS | |
| 704 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 705 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 706 | Manufacturing issue | FAERS: 1 | US FAERS | |
| 707 | Manufacturing materials issue | FAERS: 1 | US FAERS | |
| 708 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 709 | Mastication disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 710 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 711 | Metastasis | FAERS: 1 | US FAERS | |
| 712 | Metastatic Neoplasm | FAERS: 1 | OFFSIDES US FAERS | |
| 713 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 714 | Milk Allergy | FAERS: 1 | US FAERS | |
| 715 | Mitochondrial toxicity | FAERS: 1 | US FAERS | |
| 716 | Moaning | FAERS: 1 | US FAERS | |
| 717 | Monoparesis | FAERS: 1 | US FAERS | |
| 718 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 719 | Motion Sickness | FAERS: 1 | US FAERS | |
| 720 | Multiple Chemical Sensitivity | FAERS: 1 | US FAERS | |
| 721 | Muscle Spasticity | FAERS: 1 | SIDER US FAERS | |
| 722 | Muscle strain | FAERS: 1 | US FAERS | |
| 723 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 724 | Myasthenic Syndrome | FAERS: 1 | US FAERS | |
| 725 | Myopia | FAERS: 1 | US FAERS | |
| 726 | Necrosis | FAERS: 1 | 19490937 | CTD US FAERS |
| 727 | Neonatal infection | FAERS: 1 | US FAERS | |
| 728 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 729 | Neuritis | FAERS: 1 | US FAERS | |
| 730 | Neuroleptic Malignant Syndrome | FAERS: 1 | 16720068 | CTD US FAERS |
| 731 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 732 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 733 | Occupational physical problem | FAERS: 1 | US FAERS | |
| 734 | Ocular icterus | FAERS: 1 | US FAERS | |
| 735 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 736 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 737 | Osteolysis | FAERS: 1 | US FAERS | |
| 738 | Ovarian adhesion | FAERS: 1 | US FAERS | |
| 739 | Papule | FAERS: 1 | US FAERS | |
| 740 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 741 | Parent-child problem | FAERS: 1 | US FAERS | |
| 742 | Pectus excavatum | FAERS: 1 | US FAERS | |
| 743 | Pelvic discomfort | FAERS: 1 | US FAERS | |
| 744 | Periarthritis | FAERS: 1 | US FAERS | |
| 745 | Periodontitis | FAERS: 1 | US FAERS | |
| 746 | Peripheral arterial occlusive disease | FAERS: 1 | OFFSIDES US FAERS | |
| 747 | Pharyngitis | FAERS: 1 | US FAERS | |
| 748 | Phonophobia | FAERS: 1 | US FAERS | |
| 749 | Phytotherapy | FAERS: 1 | US FAERS | |
| 750 | Pilonidal Cyst | FAERS: 1 | US FAERS | |
| 751 | Polyneuropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 752 | Poverty of speech | FAERS: 1 | US FAERS | |
| 753 | Procedural complication | FAERS: 1 | US FAERS | |
| 754 | Product availability issue | FAERS: 1 | US FAERS | |
| 755 | Product coating issue | FAERS: 1 | US FAERS | |
| 756 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 757 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 758 | Product dose omission | FAERS: 1 | US FAERS | |
| 759 | Product friable | FAERS: 1 | US FAERS | |
| 760 | Product lot number issue | FAERS: 1 | US FAERS | |
| 761 | Product packaging counterfeit | FAERS: 1 | US FAERS | |
| 762 | Product storage error | FAERS: 1 | US FAERS | |
| 763 | Product substitution | FAERS: 1 | US FAERS | |
| 764 | Product supply issue | FAERS: 1 | US FAERS | |
| 765 | Product use complaint | FAERS: 1 | US FAERS | |
| 766 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 767 | Pupillary deformity | FAERS: 1 | US FAERS | |
| 768 | Purulence | FAERS: 1 | US FAERS | |
| 769 | Rash erythematous | FAERS: 1 | US FAERS | |
| 770 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 771 | Reaction to medical agent preservatives | FAERS: 1 | US FAERS | |
| 772 | Rectal discharge | FAERS: 1 | US FAERS | |
| 773 | Renal cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 774 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 775 | Retrognathia | FAERS: 1 | US FAERS | |
| 776 | Rhinalgia | FAERS: 1 | US FAERS | |
| 777 | Rhinitis | FAERS: 1 | US FAERS | |
| 778 | Saliva analysis abnormal | FAERS: 1 | US FAERS | |
| 779 | Scab | FAERS: 1 | US FAERS | |
| 780 | Schizotypal Personality Disorder | FAERS: 1 | US FAERS | |
| 781 | Sedation complication | FAERS: 1 | US FAERS | |
| 782 | Self Mutilation | FAERS: 1 | US FAERS | |
| 783 | Septic Shock | FAERS: 1 | US FAERS | |
| 784 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 785 | Sexual abuse | FAERS: 1 | US FAERS | |
| 786 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 787 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 788 | Skeletal injury | FAERS: 1 | OFFSIDES US FAERS | |
| 789 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 790 | Skin laceration | FAERS: 1 | US FAERS | |
| 791 | Spinal column stenosis | FAERS: 1 | OFFSIDES US FAERS | |
| 792 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 793 | Stevens-Johnson Syndrome | FAERS: 1 | 25811541 | CTD SIDER US FAERS |
| 794 | Stomatitis | FAERS: 1 | US FAERS | |
| 795 | Suspected product tampering | FAERS: 1 | US FAERS | |
| 796 | Suspected suicide attempt | FAERS: 1 | US FAERS | |
| 797 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 798 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 799 | Tetany | FAERS: 1 | US FAERS | |
| 800 | Therapeutic product effect delayed | FAERS: 1 | US FAERS | |
| 801 | Therapeutic product effect variable | FAERS: 1 | US FAERS | |
| 802 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 803 | Thermohypoaesthesia | FAERS: 1 | US FAERS | |
| 804 | Thrombotic stroke | FAERS: 1 | US FAERS | |
| 805 | Thyroid malformation | FAERS: 1 | US FAERS | |
| 806 | Thyroiditis | FAERS: 1 | US FAERS | |
| 807 | Tissue rupture | FAERS: 1 | US FAERS | |
| 808 | Tongue blistering | FAERS: 1 | US FAERS | |
| 809 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 810 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 811 | Tooth Loss | FAERS: 1 | OFFSIDES US FAERS | |
| 812 | Torticollis | FAERS: 1 | US FAERS | |
| 813 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 814 | Toxic leukoencephalopathy | FAERS: 1 | US FAERS | |
| 815 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 816 | Transaminases increased | FAERS: 1 | US FAERS | |
| 817 | Tryptase increased | FAERS: 1 | US FAERS | |
| 818 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 819 | Underweight | FAERS: 1 | US FAERS | |
| 820 | Unexpected therapeutic drug effect | FAERS: 1 | US FAERS | |
| 821 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 822 | Vascular bypass graft | FAERS: 1 | US FAERS | |
| 823 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 824 | Vascular pain | FAERS: 1 | US FAERS | |
| 825 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 826 | Visual disturbance | FAERS: 1 | US FAERS | |
| 827 | Vitamin B6 increased | FAERS: 1 | US FAERS | |
| 828 | Vulvovaginal burning sensation | FAERS: 1 | US FAERS | |
| 829 | Waxy flexibility | FAERS: 1 | US FAERS | |
| 830 | Williams Syndrome | FAERS: 1 | US FAERS | |
| 831 | Wound Infection | FAERS: 1 | US FAERS | |
| 832 | Wrist deformity | FAERS: 1 | US FAERS | |
| 833 | furuncle | FAERS: 1 | US FAERS | |
| 834 | insulinoma | FAERS: 1 | US FAERS | |
| 835 | prostatitis | FAERS: 1 | US FAERS | |
| 836 | Abdominal distress | SIDER | ||
| 837 | Abnormal vision | OFFSIDES | ||
| 838 | Abscess | OFFSIDES | ||
| 839 | Abuse | OFFSIDES | ||
| 840 | Acid reflux | OFFSIDES | ||
| 841 | Actinomycosis | OFFSIDES | ||
| 842 | Acute otitis media | OFFSIDES | ||
| 843 | Akathisia, Drug-Induced | 16513883 | CTD | |
| 844 | Ammonia increased | OFFSIDES | ||
| 845 | Analgesia | OFFSIDES | ||
| 846 | Anaphylactoid Reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 847 | Angiolipoma | OFFSIDES | ||
| 848 | Anhidrosis | OFFSIDES | ||
| 849 | Anticonvulsant drug level below therapeutic | OFFSIDES | ||
| 850 | Anxiety Disorders |
1673080
2268689 2307974 2335496 2858187 3092780 3286686 3379150 8234145 8666573 11304902 12388988 12527476 12561965 14638603 16143734 | CTD | |
| 851 | Aphthous Stomatitis | OFFSIDES | ||
| 852 | Apnea | OFFSIDES | ||
| 853 | Arteriosclerosis | OFFSIDES | ||
| 854 | Aura | OFFSIDES | ||
| 855 | Automatism | OFFSIDES | ||
| 856 | Basal cell carcinoma | OFFSIDES | ||
| 857 | Bereavement | OFFSIDES | ||
| 858 | Bladder discomfort | OFFSIDES | ||
| 859 | Blood Glucose | OFFSIDES | ||
| 860 | Blood chloride decreased | OFFSIDES | ||
| 861 | Blood cholesterol | OFFSIDES | ||
| 862 | Blood glucose decreased | OFFSIDES | ||
| 863 | Blood pressure inadequately controlled | OFFSIDES | ||
| 864 | Blurred vision | OFFSIDES | ||
| 865 | Bone Sarcoma | OFFSIDES | ||
| 866 | Bone lesion | OFFSIDES | ||
| 867 | Bone swelling | OFFSIDES | ||
| 868 | Bullous lung disease | OFFSIDES | ||
| 869 | Catheter related complication | OFFSIDES | ||
| 870 | Causalgia | OFFSIDES | ||
| 871 | Cellulitis | OFFSIDES | ||
| 872 | Chemical and Drug Induced Liver Injury | 2869702 3358644 | CTD | |
| 873 | Chest tightness | SIDER | ||
| 874 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 875 | Cognition Disorders | 11815692 | CTD | |
| 876 | Colitis | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 877 | Confabulation | OFFSIDES | ||
| 878 | Culture positive | OFFSIDES | ||
| 879 | Debridement | OFFSIDES | ||
| 880 | Dental abscess | OFFSIDES | ||
| 881 | Depressive disorder | CTD | ||
| 882 | Dermatitis | SIDER | ||
| 883 | Diabetes | OFFSIDES | ||
| 884 | Diabetic Nephropathy | OFFSIDES | ||
| 885 | Diabetic Retinopathy | OFFSIDES | ||
| 886 | Disorders of Excessive Somnolence | 2858187 17097811 18635690 | CTD | |
| 887 | Disorders of Sex Development | 7883836 | CTD | |
| 888 | Disseminated Intravascular Coagulation | 10464538 | CTD | |
| 889 | Disturbance in sexual arousal | SIDER | ||
| 890 | Diverticulosis | OFFSIDES | ||
| 891 | Drowsiness | OFFSIDES SIDER | ||
| 892 | Drug addict | OFFSIDES | ||
| 893 | Drug half-life reduced | Canada Vigilance: 1 | Canada Vigilance | |
| 894 | Duodenitis | OFFSIDES | ||
| 895 | Dysthymic Disorder | OFFSIDES | ||
| 896 | Ear and labyrinth disorders | SIDER | ||
| 897 | Ejection Fraction Decreased | OFFSIDES | ||
| 898 | Encephalomalacia | OFFSIDES | ||
| 899 | Endometriosis | OFFSIDES | ||
| 900 | Enteritis | OFFSIDES | ||
| 901 | Eustachian tube disorder | OFFSIDES | ||
| 902 | Eye Infection | OFFSIDES | ||
| 903 | Fever | 11815692 | CTD | |
| 904 | Fluid overload | OFFSIDES | ||
| 905 | Food craving | OFFSIDES | ||
| 906 | Gambling | OFFSIDES | ||
| 907 | Gastrointestinal sounds abnormal | OFFSIDES | ||
| 908 | Granulocytosis | OFFSIDES | ||
| 909 | Hallucinations | 2397358 12923827 | CTD | |
| 910 | Heart Block | 3224354 | CTD | |
| 911 | Hepatitis | SIDER | ||
| 912 | High frequency ablation | OFFSIDES | ||
| 913 | Hyperprolactinemia | 8803653 | CTD | |
| 914 | Hypocoagulable state | OFFSIDES | ||
| 915 | Hypomania | SIDER | ||
| 916 | Infestation | SIDER | ||
| 917 | Infusion site mobility decreased | OFFSIDES | ||
| 918 | Injection site dermatitis | OFFSIDES | ||
| 919 | Intention tremor | OFFSIDES | ||
| 920 | Intermittent Claudication | OFFSIDES | ||
| 921 | Lightheadedness | SIDER | ||
| 922 | Lumbar radiculopathy | OFFSIDES | ||
| 923 | Lymphedema | OFFSIDES | ||
| 924 | Maxillofacial operation | OFFSIDES | ||
| 925 | Memory Disorders | 7802851 12388988 14644903 | CTD | |
| 926 | Mental disorders | 3421354 | CTD | |
| 927 | Movement Disorders | 19519270 | CTD | |
| 928 | Multiple sclerosis relapse | OFFSIDES | ||
| 929 | Muscle Weakness | OFFSIDES | ||
| 930 | Muscle relaxant therapy | SIDER | ||
| 931 | Nephritic syndrome | OFFSIDES | ||
| 932 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 933 | Nervous tension | OFFSIDES | ||
| 934 | Non-cardiac chest pain | OFFSIDES | ||
| 935 | Nystagmus | Canada Vigilance: 1 | Canada Vigilance | |
| 936 | Oral pruritus | Canada Vigilance: 1 | Canada Vigilance | |
| 937 | Oropharyngeal blistering | OFFSIDES | ||
| 938 | Osteomyelitis | OFFSIDES | ||
| 939 | Osteopenia | OFFSIDES | ||
| 940 | Osteosclerosis | OFFSIDES | ||
| 941 | Pericardial effusion | OFFSIDES | ||
| 942 | Periostitis | OFFSIDES | ||
| 943 | Personality Disorders | 2912273 8749839 12388988 | CTD | |
| 944 | Phantom pain | OFFSIDES | ||
| 945 | Physical disability | OFFSIDES | ||
| 946 | Pneumoconiosis | OFFSIDES | ||
| 947 | Polymyalgia Rheumatica | OFFSIDES | ||
| 948 | Post inflammatory pigmentation change | OFFSIDES | ||
| 949 | Post procedural pain | OFFSIDES | ||
| 950 | Postoperative Complications | 1863727 | CTD | |
| 951 | Premenstrual syndrome | SIDER | ||
| 952 | Prenatal Exposure Delayed Effects | 12388988 12561965 | CTD | |
| 953 | Primary sequestrum | OFFSIDES | ||
| 954 | Productive Cough | OFFSIDES | ||
| 955 | Proteinuria | 3622604 | CTD | |
| 956 | Psychotic Disorders | 2300914 2307974 | CTD | |
| 957 | Pulmonary congestion | OFFSIDES | ||
| 958 | Pulmonary radiation injury | OFFSIDES | ||
| 959 | Pyuria | OFFSIDES | ||
| 960 | Renal lipomatosis | OFFSIDES | ||
| 961 | Reticulocyte count increased | OFFSIDES | ||
| 962 | Retinal Vascular Disorder | OFFSIDES | ||
| 963 | Retinal vascular thrombosis | OFFSIDES | ||
| 964 | Sarcoidosis | OFFSIDES | ||
| 965 | Seizures | CTD | ||
| 966 | Sinus headache | OFFSIDES | ||
| 967 | Skin lesion | OFFSIDES | ||
| 968 | Sleep Initiation and Maintenance Disorders | 15341891 | CTD | |
| 969 | Sleep Talking | SIDER | ||
| 970 | Sleep Wake Disorders | 2307974 2335496 | CTD | |
| 971 | Slurred speech | SIDER | ||
| 972 | Soft Tissue Injuries | OFFSIDES | ||
| 973 | Spasm | 2307974 | CTD | |
| 974 | Speech Disorders | 3358644 19519270 | CTD | |
| 975 | Splenic Infarction | OFFSIDES | ||
| 976 | Spondylolisthesis | OFFSIDES | ||
| 977 | Subcutaneous nodule | OFFSIDES | ||
| 978 | Substance Withdrawal Syndrome |
1559372
1742638 1863727 2300914 2307974 2335496 2397358 2637682 3806075 3826428 6141159 9617514 9884109 12525317 12701671 14644903 | CTD | |
| 979 | Substance-Related Disorders | 3258735 | CTD | |
| 980 | Suicide | SIDER | ||
| 981 | Sweating | SIDER | ||
| 982 | Talkativeness | SIDER | ||
| 983 | Thrombophlebitis | OFFSIDES | ||
| 984 | Tooth Extraction | OFFSIDES | ||
| 985 | Tracheitis | OFFSIDES | ||
| 986 | Urine output increased | OFFSIDES | ||
| 987 | Vascular Diseases | 10464538 | CTD | |
| 988 | Vitreous Detachment | OFFSIDES | ||
| 989 | Weight Gain | OFFSIDES | ||
| 990 | Withdrawal seizures | SIDER | ||
| 991 | jaundice | 2869702 | CTD SIDER | |
| 992 | muscle injury | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.