ropinirole
(UHSKFQJFRQCDBE-UHFFFAOYSA-N)
Structure
- SMILES
- CCCN(CCC)CCc1cccc2c1CC(=O)N2
- Type(s)
- Approved; Investigational
- ATC code(s)
- N04BC04
- Molecular Formula:
- C16H24N2O
- Molecular Weight:
- 260.375
- Log P:
- 2.9837
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 32.34
- CAS Number(s):
- 91374-21-9
Synonym(s)
1.
ropinirole
2.
4-(2-(di-n-propylamino)ethyl)-2(3H)-indolone
3.
Requip
4.
SK&F 101468
5.
SK&F-101,468
6.
SKF 101468
7.
ropinirol
8.
ropinirole hydrochloride
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 340 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Nausea | FAERS: 173 Canada Vigilance: 2 | 11956968 20461803 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 3 | Restless Legs Syndrome | FAERS: 149 | 18656214 18855926 19011442 | CTD US FAERS |
| 4 | Somnolence | FAERS: 133 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 5 | Gambling | FAERS: 118 | OFFSIDES US FAERS | |
| 6 | Vomiting | FAERS: 95 | SIDER US FAERS | |
| 7 | Sudden onset of sleep | FAERS: 67 | OFFSIDES SIDER US FAERS | |
| 8 | Malaise | FAERS: 64 | SIDER US FAERS | |
| 9 | Dizziness | FAERS: 59 Canada Vigilance: 1 | 20461803 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 10 | Fatigue | FAERS: 58 Canada Vigilance: 1 | 20461803 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 11 | Tremor | FAERS: 48 | SIDER US FAERS | |
| 12 | Headache | FAERS: 46 | SIDER US FAERS | |
| 13 | Adverse event | FAERS: 44 | OFFSIDES US FAERS | |
| 14 | Asthenia | FAERS: 34 | SIDER US FAERS | |
| 15 | Feeling abnormal | FAERS: 34 | SIDER US FAERS | |
| 16 | Pain | FAERS: 34 | 20461803 | CTD SIDER US FAERS |
| 17 | Obsessive-Compulsive Disorder | FAERS: 31 | US FAERS | |
| 18 | Product quality issue | FAERS: 31 | US FAERS | |
| 19 | Syncope | FAERS: 31 | SIDER US FAERS | |
| 20 | Compulsive shopping | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 21 | Economic problem | FAERS: 25 | OFFSIDES US FAERS | |
| 22 | Agitation | FAERS: 24 | SIDER US FAERS | |
| 23 | Anxiety | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 24 | Product substitution issue | FAERS: 24 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 25 | Medication Error | FAERS: 23 | US FAERS | |
| 26 | Drug administration error | FAERS: 22 | OFFSIDES US FAERS | |
| 27 | Palpitations | FAERS: 22 | SIDER US FAERS | |
| 28 | Pharmaceutical product complaint | FAERS: 21 | US FAERS | |
| 29 | Cerebrovascular accident | FAERS: 20 | US FAERS | |
| 30 | Overdose | FAERS: 20 | US FAERS | |
| 31 | Memory impairment | FAERS: 18 | SIDER US FAERS | |
| 32 | Weight decreased | FAERS: 16 | SIDER US FAERS | |
| 33 | Arthralgia | FAERS: 15 | 20461803 | CTD SIDER US FAERS |
| 34 | Constipation | FAERS: 15 | SIDER US FAERS | |
| 35 | Hypersensitivity | FAERS: 15 | SIDER US FAERS | |
| 36 | Pruritus | FAERS: 15 | SIDER US FAERS | |
| 37 | Drug dispensing error | FAERS: 14 | OFFSIDES US FAERS | |
| 38 | Restlessness | FAERS: 14 | US FAERS | |
| 39 | Suicide attempt | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 40 | Therapeutic response unexpected | FAERS: 14 | OFFSIDES US FAERS | |
| 41 | Chest Pain | FAERS: 13 | SIDER US FAERS | |
| 42 | Dystonia | FAERS: 13 | OFFSIDES US FAERS | |
| 43 | Myalgia | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 44 | Nervousness | FAERS: 13 | SIDER US FAERS | |
| 45 | Chest discomfort | FAERS: 12 | SIDER US FAERS | |
| 46 | Inappropriate schedule of drug administration | FAERS: 12 | US FAERS | |
| 47 | Pneumonia | FAERS: 12 | SIDER US FAERS | |
| 48 | Urticaria | FAERS: 12 | SIDER US FAERS | |
| 49 | Disorientation | FAERS: 11 | SIDER US FAERS | |
| 50 | Pulmonary Fibrosis | FAERS: 11 | US FAERS | |
| 51 | Visual Impairment | FAERS: 11 | SIDER US FAERS | |
| 52 | Accidental overdose | FAERS: 10 | US FAERS | |
| 53 | Atrial Fibrillation | FAERS: 10 | SIDER US FAERS | |
| 54 | Back Pain | FAERS: 10 | 20461803 | CTD SIDER US FAERS |
| 55 | Drug Dependence | FAERS: 10 | US FAERS | |
| 56 | Drug withdrawal syndrome | FAERS: 10 | US FAERS | |
| 57 | Hypokinesia | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 58 | Impaired driving ability | FAERS: 10 | OFFSIDES US FAERS | |
| 59 | Middle insomnia | FAERS: 10 | OFFSIDES US FAERS | |
| 60 | Muscle Rigidity | FAERS: 10 | US FAERS | |
| 61 | Amnesia | FAERS: 9 | SIDER US FAERS | |
| 62 | Delirium | FAERS: 9 | SIDER US FAERS | |
| 63 | Hypotension | FAERS: 9 | SIDER US FAERS | |
| 64 | Incorrect dose administered | FAERS: 9 | US FAERS | |
| 65 | Joint swelling | FAERS: 9 | SIDER US FAERS | |
| 66 | Stress | FAERS: 9 | SIDER US FAERS | |
| 67 | Therapeutic response unexpected with drug substitution | FAERS: 9 | US FAERS | |
| 68 | Abasia | FAERS: 8 | US FAERS | |
| 69 | Bradycardia | FAERS: 8 | SIDER US FAERS | |
| 70 | Dysgeusia | FAERS: 8 | SIDER US FAERS | |
| 71 | Musculoskeletal stiffness | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 72 | Quality of life decreased | FAERS: 8 | OFFSIDES US FAERS | |
| 73 | Anger | FAERS: 7 | US FAERS | |
| 74 | Dependence | FAERS: 7 | OFFSIDES US FAERS | |
| 75 | Dyspepsia | FAERS: 7 | SIDER US FAERS | |
| 76 | Feeling Cold | FAERS: 7 | US FAERS | |
| 77 | Jealous delusion | FAERS: 7 | US FAERS | |
| 78 | Medication residue | FAERS: 7 | OFFSIDES US FAERS | |
| 79 | Night sweats | FAERS: 7 | SIDER US FAERS | |
| 80 | Paranoia | FAERS: 7 | SIDER US FAERS | |
| 81 | Swelling | FAERS: 7 | US FAERS | |
| 82 | Activities of daily living impaired | FAERS: 6 | US FAERS | |
| 83 | Alopecia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 84 | Burning sensation | FAERS: 6 | SIDER US FAERS | |
| 85 | Cardiac Arrest | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 86 | Crying | FAERS: 6 | US FAERS | |
| 87 | Dementia | FAERS: 6 | SIDER US FAERS | |
| 88 | Drug exposure during pregnancy | FAERS: 6 | US FAERS | |
| 89 | Feeling jittery | FAERS: 6 | US FAERS | |
| 90 | Flushing | FAERS: 6 | SIDER US FAERS | |
| 91 | Hemiparesis | FAERS: 6 | SIDER US FAERS | |
| 92 | Hypersomnia | FAERS: 6 | SIDER US FAERS | |
| 93 | Impaired work ability | FAERS: 6 | US FAERS | |
| 94 | Mental impairment | FAERS: 6 | US FAERS | |
| 95 | Performance status decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 96 | Sexual Dysfunction | FAERS: 6 | US FAERS | |
| 97 | Theft | FAERS: 6 | OFFSIDES US FAERS | |
| 98 | Tinnitus | FAERS: 6 | SIDER US FAERS | |
| 99 | Vertigo | FAERS: 6 | SIDER US FAERS | |
| 100 | Wrong technique in product usage process | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Anorexia | FAERS: 5 | SIDER US FAERS | |
| 102 | Bankruptcy | FAERS: 5 | OFFSIDES US FAERS | |
| 103 | Choking | FAERS: 5 | US FAERS | |
| 104 | Compulsive sexual behaviour | FAERS: 5 | OFFSIDES US FAERS | |
| 105 | Dehydration | FAERS: 5 | SIDER US FAERS | |
| 106 | Disability | FAERS: 5 | US FAERS | |
| 107 | Discomfort | FAERS: 5 | SIDER US FAERS | |
| 108 | Drug dose omission | FAERS: 5 | US FAERS | |
| 109 | Dysarthria | FAERS: 5 | US FAERS | |
| 110 | Dysuria | FAERS: 5 | SIDER US FAERS | |
| 111 | Erectile dysfunction | FAERS: 5 | SIDER US FAERS | |
| 112 | Hepatitis | FAERS: 5 | US FAERS | |
| 113 | Hepatotoxicity | FAERS: 5 | US FAERS | |
| 114 | Lethargy | FAERS: 5 | SIDER US FAERS | |
| 115 | Leukocytoclastic vasculitis | FAERS: 5 | US FAERS | |
| 116 | Medication residue present | FAERS: 5 | US FAERS | |
| 117 | Muscle tightness | FAERS: 5 | SIDER US FAERS | |
| 118 | Poor quality sleep | FAERS: 5 | OFFSIDES US FAERS | |
| 119 | Walking aid user | FAERS: 5 | US FAERS | |
| 120 | Abdominal Pain | FAERS: 4 | SIDER US FAERS | |
| 121 | Aortic Injury | FAERS: 4 | OFFSIDES US FAERS | |
| 122 | Apathy | FAERS: 4 | SIDER US FAERS | |
| 123 | Asthma | FAERS: 4 | SIDER US FAERS | |
| 124 | Bedridden | FAERS: 4 | US FAERS | |
| 125 | Camptocormia | FAERS: 4 | US FAERS | |
| 126 | Cardiac valve sclerosis | FAERS: 4 | OFFSIDES US FAERS | |
| 127 | Chills | FAERS: 4 | SIDER US FAERS | |
| 128 | Completed Suicide | FAERS: 4 | US FAERS | |
| 129 | Drug effect incomplete | FAERS: 4 | US FAERS | |
| 130 | Dysphonia | FAERS: 4 | SIDER US FAERS | |
| 131 | Epilepsy | FAERS: 4 | US FAERS | |
| 132 | Erythema | FAERS: 4 | US FAERS | |
| 133 | Excoriation | FAERS: 4 | US FAERS | |
| 134 | Flatulence | FAERS: 4 | SIDER US FAERS | |
| 135 | Formication | FAERS: 4 | US FAERS | |
| 136 | Fracture | FAERS: 4 | US FAERS | |
| 137 | Ileus | FAERS: 4 | US FAERS | |
| 138 | Laryngospasm | FAERS: 4 | US FAERS | |
| 139 | Musculoskeletal chest pain | FAERS: 4 | US FAERS | |
| 140 | Myocardial Infarction | FAERS: 4 | SIDER US FAERS | |
| 141 | Personality Change | FAERS: 4 | OFFSIDES US FAERS | |
| 142 | Product use complaint | FAERS: 4 | US FAERS | |
| 143 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 144 | Product use issue | FAERS: 4 | US FAERS | |
| 145 | Retching | FAERS: 4 | US FAERS | |
| 146 | Tachycardia | FAERS: 4 | SIDER US FAERS | |
| 147 | Therapy cessation | FAERS: 4 | US FAERS | |
| 148 | Urinary Incontinence | FAERS: 4 | SIDER US FAERS | |
| 149 | Urinary tract infection | FAERS: 4 | SIDER US FAERS | |
| 150 | Vasculitis | FAERS: 4 | US FAERS | |
| 151 | Yawning | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 152 | jaundice | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Abdominal discomfort | FAERS: 3 | SIDER US FAERS | |
| 154 | Accidental drug intake by child | FAERS: 3 | OFFSIDES US FAERS | |
| 155 | Akinesia | FAERS: 3 | OFFSIDES US FAERS | |
| 156 | Alcohol abuse | FAERS: 3 | US FAERS | |
| 157 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 158 | Aphasia | FAERS: 3 | SIDER US FAERS | |
| 159 | Apparent death | FAERS: 3 | US FAERS | |
| 160 | Cellulitis | FAERS: 3 | SIDER US FAERS | |
| 161 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 162 | Cytolytic hepatitis | FAERS: 3 | OFFSIDES US FAERS | |
| 163 | Diplopia | FAERS: 3 | SIDER US FAERS | |
| 164 | Dopamine dysregulation syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 165 | Dropped head syndrome | FAERS: 3 | US FAERS | |
| 166 | Drug Tolerance | FAERS: 3 | US FAERS | |
| 167 | Drug level fluctuating | FAERS: 3 | US FAERS | |
| 168 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 169 | Drug screen false positive | FAERS: 3 | US FAERS | |
| 170 | Emotional distress | FAERS: 3 | OFFSIDES US FAERS | |
| 171 | Euphoric mood | FAERS: 3 | SIDER US FAERS | |
| 172 | Excessive sexual fantasies | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 173 | Eye pain | FAERS: 3 | SIDER US FAERS | |
| 174 | Frustration | FAERS: 3 | US FAERS | |
| 175 | Gastric Fistula | FAERS: 3 | US FAERS | |
| 176 | Hyperphagia | FAERS: 3 | US FAERS | |
| 177 | Hypomania | FAERS: 3 | OFFSIDES US FAERS | |
| 178 | Inability to afford medication | FAERS: 3 | US FAERS | |
| 179 | Incoherent | FAERS: 3 | OFFSIDES US FAERS | |
| 180 | Infection | FAERS: 3 | SIDER US FAERS | |
| 181 | Influenza | FAERS: 3 | SIDER US FAERS | |
| 182 | Initial insomnia | FAERS: 3 | OFFSIDES US FAERS | |
| 183 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 184 | Intentional self-injury | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 185 | Mental status changes | FAERS: 3 | US FAERS | |
| 186 | Monoplegia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 187 | Musculoskeletal Pain | FAERS: 3 | US FAERS | |
| 188 | Myoclonus | FAERS: 3 | US FAERS | |
| 189 | Myopathy | FAERS: 3 | US FAERS | |
| 190 | Neck Pain | FAERS: 3 | SIDER US FAERS | |
| 191 | Neuroleptic Malignant Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 192 | Neutropenia | FAERS: 3 | US FAERS | |
| 193 | Papule | FAERS: 3 | US FAERS | |
| 194 | Paranasal sinus hypersecretion | FAERS: 3 | OFFSIDES US FAERS | |
| 195 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 196 | Presyncope | FAERS: 3 | SIDER US FAERS | |
| 197 | Priapism | FAERS: 3 | US FAERS | |
| 198 | Rebound effect | FAERS: 3 | OFFSIDES US FAERS | |
| 199 | Sexual abuse | FAERS: 3 | OFFSIDES US FAERS | |
| 200 | Toothache | FAERS: 3 | SIDER US FAERS | |
| 201 | Ulcer | FAERS: 3 | US FAERS | |
| 202 | Wrong drug administered | FAERS: 3 | OFFSIDES US FAERS | |
| 203 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 204 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 205 | Alanine Aminotransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 206 | Alcohol interaction | FAERS: 2 | US FAERS | |
| 207 | Angina Pectoris | FAERS: 2 | SIDER US FAERS | |
| 208 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 209 | Anhedonia | FAERS: 2 | OFFSIDES US FAERS | |
| 210 | Anorgasmia | FAERS: 2 | US FAERS | |
| 211 | Arthritis | FAERS: 2 | SIDER US FAERS | |
| 212 | Arthropathy | FAERS: 2 | SIDER US FAERS | |
| 213 | Aspartate Aminotransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 214 | Benign Neoplasm | FAERS: 2 | US FAERS | |
| 215 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 216 | Blindness | FAERS: 2 | SIDER US FAERS | |
| 217 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 218 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 219 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 220 | Blood pressure fluctuation | FAERS: 2 | OFFSIDES US FAERS | |
| 221 | Blunted affect | FAERS: 2 | US FAERS | |
| 222 | Breakthrough Pain | FAERS: 2 | US FAERS | |
| 223 | Breast tenderness | FAERS: 2 | US FAERS | |
| 224 | Bronchitis | FAERS: 2 | SIDER US FAERS | |
| 225 | Bruxism | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 226 | Bulimia Nervosa | FAERS: 2 | US FAERS | |
| 227 | Cataract | FAERS: 2 | SIDER US FAERS | |
| 228 | Chromaturia | FAERS: 2 | US FAERS | |
| 229 | Circumstance or information capable of leading to medication error | FAERS: 2 | OFFSIDES US FAERS | |
| 230 | Cystitis | FAERS: 2 | SIDER US FAERS | |
| 231 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 232 | Deja Vu | FAERS: 2 | US FAERS | |
| 233 | Depressed Level of Consciousness | FAERS: 2 | SIDER US FAERS | |
| 234 | Diabetes Mellitus | FAERS: 2 | SIDER US FAERS | |
| 235 | Disturbance in sexual arousal | FAERS: 2 | SIDER US FAERS | |
| 236 | Drug abuse | FAERS: 2 | US FAERS | |
| 237 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 238 | Drug screen positive | FAERS: 2 | US FAERS | |
| 239 | Drug toxicity | FAERS: 2 | US FAERS | |
| 240 | Emotional disorder | FAERS: 2 | US FAERS | |
| 241 | Exhibitionism | FAERS: 2 | OFFSIDES US FAERS | |
| 242 | Food craving | FAERS: 2 | OFFSIDES US FAERS | |
| 243 | Global Amnesia | FAERS: 2 | US FAERS | |
| 244 | Homosexuality | FAERS: 2 | OFFSIDES US FAERS | |
| 245 | Hyperthyroidism | FAERS: 2 | SIDER US FAERS | |
| 246 | Hypophagia | FAERS: 2 | US FAERS | |
| 247 | Hypotonic urinary bladder | FAERS: 2 | OFFSIDES US FAERS | |
| 248 | Immobile | FAERS: 2 | OFFSIDES US FAERS | |
| 249 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 250 | Intestinal Obstruction | FAERS: 2 | SIDER US FAERS | |
| 251 | Laryngitis | FAERS: 2 | SIDER US FAERS | |
| 252 | Lip swelling | FAERS: 2 | US FAERS | |
| 253 | Lower respiratory tract infection | FAERS: 2 | SIDER US FAERS | |
| 254 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 255 | Narcolepsy | FAERS: 2 | US FAERS | |
| 256 | Nasopharyngitis | FAERS: 2 | SIDER US FAERS | |
| 257 | No adverse event | FAERS: 2 | US FAERS | |
| 258 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 259 | Obsessive thoughts | FAERS: 2 | OFFSIDES US FAERS | |
| 260 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 261 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 262 | Overweight | FAERS: 2 | US FAERS | |
| 263 | Partner stress | FAERS: 2 | OFFSIDES US FAERS | |
| 264 | Pemphigus | FAERS: 2 | US FAERS | |
| 265 | Peritonitis | FAERS: 2 | US FAERS | |
| 266 | Poisoning | FAERS: 2 | US FAERS | |
| 267 | Polydipsia | FAERS: 2 | US FAERS | |
| 268 | Psychiatric symptom | FAERS: 2 | OFFSIDES US FAERS | |
| 269 | Rash erythematous | FAERS: 2 | SIDER US FAERS | |
| 270 | Rehabilitation therapy | FAERS: 2 | US FAERS | |
| 271 | Respiratory tract congestion | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 272 | Scab | FAERS: 2 | US FAERS | |
| 273 | Sinus bradycardia | FAERS: 2 | US FAERS | |
| 274 | Skin irritation | FAERS: 2 | US FAERS | |
| 275 | Skin laceration | FAERS: 2 | US FAERS | |
| 276 | Skin lesion | FAERS: 2 | SIDER US FAERS | |
| 277 | Small intestine carcinoma | FAERS: 2 | OFFSIDES US FAERS | |
| 278 | Somnambulism | FAERS: 2 | SIDER US FAERS | |
| 279 | Tachyphylaxis | FAERS: 2 | OFFSIDES US FAERS | |
| 280 | Therapeutic response changed | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 281 | Therapeutic response delayed | FAERS: 2 | US FAERS | |
| 282 | Therapy regimen changed | FAERS: 2 | US FAERS | |
| 283 | Thrombosis | FAERS: 2 | SIDER US FAERS | |
| 284 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 285 | Transaminases increased | FAERS: 2 | US FAERS | |
| 286 | Unevaluable event | FAERS: 2 | US FAERS | |
| 287 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 288 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 289 | Venous occlusion | FAERS: 2 | US FAERS | |
| 290 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 291 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 292 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 293 | Abscess | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 294 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 295 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 296 | Anuria | FAERS: 1 | US FAERS | |
| 297 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 298 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 299 | Aphagia | FAERS: 1 | US FAERS | |
| 300 | Aphonia | FAERS: 1 | US FAERS | |
| 301 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 302 | Arteriopathic disease | FAERS: 1 | US FAERS | |
| 303 | Asterixis | FAERS: 1 | US FAERS | |
| 304 | Asthenopia | FAERS: 1 | US FAERS | |
| 305 | Atrioventricular Block | FAERS: 1 | SIDER US FAERS | |
| 306 | Back disorder | FAERS: 1 | US FAERS | |
| 307 | Basal ganglion degeneration | FAERS: 1 | US FAERS | |
| 308 | Biopsy skin abnormal | FAERS: 1 | US FAERS | |
| 309 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 310 | Blood Pressure | FAERS: 1 | US FAERS | |
| 311 | Blood alkaline phosphatase increased | FAERS: 1 | SIDER US FAERS | |
| 312 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 313 | Blood electrolytes abnormal | FAERS: 1 | SIDER US FAERS | |
| 314 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 315 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 316 | Blood iron decreased | FAERS: 1 | SIDER US FAERS | |
| 317 | Blood lactate dehydrogenase increased | FAERS: 1 | SIDER US FAERS | |
| 318 | Blood osmolarity decreased | FAERS: 1 | US FAERS | |
| 319 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 320 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 321 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 322 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 323 | Blood urea increased | FAERS: 1 | SIDER US FAERS | |
| 324 | Blood urine present | FAERS: 1 | SIDER US FAERS | |
| 325 | Bone pain | FAERS: 1 | SIDER US FAERS | |
| 326 | Bradykinesia | FAERS: 1 | US FAERS | |
| 327 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 328 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 329 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 330 | Carotid Endarterectomy | FAERS: 1 | US FAERS | |
| 331 | Catatonia | FAERS: 1 | US FAERS | |
| 332 | Cheilitis | FAERS: 1 | US FAERS | |
| 333 | Cholecystitis | FAERS: 1 | SIDER US FAERS | |
| 334 | Cholelithiasis | FAERS: 1 | SIDER US FAERS | |
| 335 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 336 | Cleft Palate | FAERS: 1 | OFFSIDES US FAERS | |
| 337 | Clumsiness | FAERS: 1 | US FAERS | |
| 338 | Coagulation factor increased | FAERS: 1 | US FAERS | |
| 339 | Cold sweat | FAERS: 1 | SIDER US FAERS | |
| 340 | Compulsive hoarding | FAERS: 1 | US FAERS | |
| 341 | Cyanosis | FAERS: 1 | SIDER US FAERS | |
| 342 | Deep Brain Stimulation | FAERS: 1 | OFFSIDES US FAERS | |
| 343 | Depression suicidal | FAERS: 1 | US FAERS | |
| 344 | Disease Progression | FAERS: 1 | US FAERS | |
| 345 | Dissociation | FAERS: 1 | US FAERS | |
| 346 | Drooling | FAERS: 1 | US FAERS | |
| 347 | Drug effect delayed | FAERS: 1 | OFFSIDES US FAERS | |
| 348 | Drug level above therapeutic | FAERS: 1 | US FAERS | |
| 349 | Drug level decreased | FAERS: 1 | US FAERS | |
| 350 | Drug monitoring procedure not performed | FAERS: 1 | US FAERS | |
| 351 | Electrocardiogram abnormal | FAERS: 1 | SIDER US FAERS | |
| 352 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 353 | Electrolyte imbalance | FAERS: 1 | SIDER US FAERS | |
| 354 | Encephalitis | FAERS: 1 | US FAERS | |
| 355 | Epistaxis | FAERS: 1 | SIDER US FAERS | |
| 356 | Erection increased | FAERS: 1 | OFFSIDES US FAERS | |
| 357 | Essential Tremor | FAERS: 1 | US FAERS | |
| 358 | Eye irritation | FAERS: 1 | SIDER US FAERS | |
| 359 | False negative investigation result | FAERS: 1 | US FAERS | |
| 360 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 361 | Fibrosis | FAERS: 1 | US FAERS | |
| 362 | Food Poisoning | FAERS: 1 | US FAERS | |
| 363 | Food aversion | FAERS: 1 | US FAERS | |
| 364 | Freezing phenomenon | FAERS: 1 | OFFSIDES US FAERS | |
| 365 | Gamma-Glutamyltransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 366 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 367 | Gastroenteritis | FAERS: 1 | SIDER US FAERS | |
| 368 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 369 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 370 | Gout | FAERS: 1 | SIDER US FAERS | |
| 371 | Grief reaction | FAERS: 1 | US FAERS | |
| 372 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 373 | Head titubation | FAERS: 1 | OFFSIDES US FAERS | |
| 374 | Hepatitis C | FAERS: 1 | US FAERS | |
| 375 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 376 | Hospice Care | FAERS: 1 | US FAERS | |
| 377 | Hypoventilation | FAERS: 1 | US FAERS | |
| 378 | Hypoxia | FAERS: 1 | US FAERS | |
| 379 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 380 | Impatience | FAERS: 1 | US FAERS | |
| 381 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 382 | Incontinence | FAERS: 1 | US FAERS | |
| 383 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 384 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 385 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 386 | Infarction | FAERS: 1 | US FAERS | |
| 387 | Inflammation | FAERS: 1 | US FAERS | |
| 388 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 389 | Joint sprain | FAERS: 1 | US FAERS | |
| 390 | Joint stiffness | FAERS: 1 | SIDER US FAERS | |
| 391 | Laceration | FAERS: 1 | US FAERS | |
| 392 | Limb discomfort | FAERS: 1 | US FAERS | |
| 393 | Lipase increased | FAERS: 1 | US FAERS | |
| 394 | Live Birth | FAERS: 1 | US FAERS | |
| 395 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 396 | Male Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 397 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 398 | Mood swings | FAERS: 1 | SIDER US FAERS | |
| 399 | Motion Sickness | FAERS: 1 | US FAERS | |
| 400 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 401 | Multiple allergies | FAERS: 1 | US FAERS | |
| 402 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 403 | Musculoskeletal discomfort | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 404 | Mydriasis | FAERS: 1 | US FAERS | |
| 405 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 406 | Myositis | FAERS: 1 | SIDER US FAERS | |
| 407 | Necrotising myositis | FAERS: 1 | US FAERS | |
| 408 | Neuralgia | FAERS: 1 | SIDER US FAERS | |
| 409 | Nocturia | FAERS: 1 | SIDER US FAERS | |
| 410 | Nystagmus | FAERS: 1 | US FAERS | |
| 411 | Obsessive-compulsive symptom | FAERS: 1 | US FAERS | |
| 412 | Opisthotonus | FAERS: 1 | US FAERS | |
| 413 | Oral pain | FAERS: 1 | US FAERS | |
| 414 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 415 | Orthosis user | FAERS: 1 | US FAERS | |
| 416 | Pain of skin | FAERS: 1 | OFFSIDES US FAERS | |
| 417 | Pallor | FAERS: 1 | SIDER US FAERS | |
| 418 | Pancreatitis | FAERS: 1 | SIDER US FAERS | |
| 419 | Pancytopenia | FAERS: 1 | US FAERS | |
| 420 | Paradoxical drug reaction | FAERS: 1 | OFFSIDES US FAERS | |
| 421 | Peptic Ulcer | FAERS: 1 | SIDER US FAERS | |
| 422 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 423 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 424 | Pharyngolaryngeal Pain | FAERS: 1 | SIDER US FAERS | |
| 425 | Photodermatosis | FAERS: 1 | US FAERS | |
| 426 | Polydactyly | FAERS: 1 | US FAERS | |
| 427 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 428 | Poriomania | FAERS: 1 | OFFSIDES US FAERS | |
| 429 | Post procedural infection | FAERS: 1 | SIDER US FAERS | |
| 430 | Proctocolitis | FAERS: 1 | US FAERS | |
| 431 | Product counterfeit | FAERS: 1 | US FAERS | |
| 432 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 433 | Product name confusion | FAERS: 1 | US FAERS | |
| 434 | Product preparation issue | FAERS: 1 | US FAERS | |
| 435 | Productive Cough | FAERS: 1 | US FAERS | |
| 436 | Proteinuria | FAERS: 1 | SIDER US FAERS | |
| 437 | Psychiatric decompensation | FAERS: 1 | US FAERS | |
| 438 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 439 | Radiculopathy | FAERS: 1 | SIDER US FAERS | |
| 440 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 441 | Respiratory Failure | FAERS: 1 | SIDER US FAERS | |
| 442 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 443 | Respiratory distress | FAERS: 1 | US FAERS | |
| 444 | Rheumatoid Arthritis | FAERS: 1 | SIDER US FAERS | |
| 445 | Rotator cuff syndrome | FAERS: 1 | SIDER US FAERS | |
| 446 | Screaming | FAERS: 1 | US FAERS | |
| 447 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 448 | Sexual relationship change | FAERS: 1 | OFFSIDES US FAERS | |
| 449 | Shock | FAERS: 1 | SIDER US FAERS | |
| 450 | Shoplifting | FAERS: 1 | OFFSIDES US FAERS | |
| 451 | Sinus headache | FAERS: 1 | SIDER US FAERS | |
| 452 | Sinusitis | FAERS: 1 | SIDER US FAERS | |
| 453 | Skin Ulcer | FAERS: 1 | SIDER US FAERS | |
| 454 | Smoker | FAERS: 1 | US FAERS | |
| 455 | Sneezing | FAERS: 1 | SIDER US FAERS | |
| 456 | Snoring | FAERS: 1 | US FAERS | |
| 457 | Sopor | FAERS: 1 | US FAERS | |
| 458 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 459 | Stem cell transplant | FAERS: 1 | OFFSIDES US FAERS | |
| 460 | Strabismus | FAERS: 1 | US FAERS | |
| 461 | Supraventricular tachycardia | FAERS: 1 | SIDER US FAERS | |
| 462 | Tablet issue | FAERS: 1 | US FAERS | |
| 463 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 464 | Therapeutic product effect incomplete | FAERS: 1 | US FAERS | |
| 465 | Thirst | FAERS: 1 | SIDER US FAERS | |
| 466 | Throat irritation | FAERS: 1 | US FAERS | |
| 467 | Tongue biting | FAERS: 1 | US FAERS | |
| 468 | Transfer factor reduced | FAERS: 1 | US FAERS | |
| 469 | Transvestism | FAERS: 1 | US FAERS | |
| 470 | Trismus | FAERS: 1 | US FAERS | |
| 471 | Tuberculosis | FAERS: 1 | US FAERS | |
| 472 | Urinary Retention | FAERS: 1 | SIDER US FAERS | |
| 473 | Urine leukocyte esterase positive | FAERS: 1 | US FAERS | |
| 474 | Urine output increased | FAERS: 1 | SIDER US FAERS | |
| 475 | Vasculitic rash | FAERS: 1 | OFFSIDES US FAERS | |
| 476 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 477 | Visual disturbance | FAERS: 1 | SIDER US FAERS | |
| 478 | Vitreous Detachment | FAERS: 1 | SIDER US FAERS | |
| 479 | Vitreous degeneration | FAERS: 1 | US FAERS | |
| 480 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 481 | Voyeurism | FAERS: 1 | US FAERS | |
| 482 | Wheezing | FAERS: 1 | SIDER US FAERS | |
| 483 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 484 | furuncle | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 485 | 5-hydroxyindolacetic acid increased | OFFSIDES | ||
| 486 | Abdominal adhesions | SIDER | ||
| 487 | Abdominal sepsis | OFFSIDES | ||
| 488 | Abnormal vision | SIDER | ||
| 489 | Abuse | OFFSIDES | ||
| 490 | Accelerated Idioventricular Rhythm | OFFSIDES | ||
| 491 | Acidosis | SIDER | ||
| 492 | Acne | SIDER | ||
| 493 | Actinic keratosis | OFFSIDES SIDER | ||
| 494 | Acute Coronary Syndrome | SIDER | ||
| 495 | Acute bronchitis | SIDER | ||
| 496 | Acute sinusitis | OFFSIDES | ||
| 497 | Adenocarcinoma of prostate | SIDER | ||
| 498 | Adenocarcinoma | SIDER | ||
| 499 | Aggressive reaction | SIDER | ||
| 500 | Agranulocytosis | SIDER | ||
| 501 | Albumin globulin ratio decreased | OFFSIDES | ||
| 502 | Albuminuria | SIDER | ||
| 503 | Alcohol consumption | OFFSIDES | ||
| 504 | Alveoloplasty | OFFSIDES | ||
| 505 | Ammonia increased | OFFSIDES | ||
| 506 | Amphetamines | OFFSIDES | ||
| 507 | Amylase increased | SIDER | ||
| 508 | Aneurysm | SIDER | ||
| 509 | Angina pectoris aggravated | SIDER | ||
| 510 | Angioedema | SIDER | ||
| 511 | Angiomyolipoma | SIDER | ||
| 512 | Anisocoria | OFFSIDES | ||
| 513 | Anorectal discomfort | SIDER | ||
| 514 | Anterior chamber inflammation | OFFSIDES | ||
| 515 | Anti-erythropoietin antibody positive | OFFSIDES | ||
| 516 | Antiphospholipid Syndrome | OFFSIDES | ||
| 517 | Appendectomy | OFFSIDES | ||
| 518 | Appendicitis | OFFSIDES SIDER | ||
| 519 | Arteriosclerosis | SIDER | ||
| 520 | Arteritis | SIDER | ||
| 521 | Arthritis aggravated | SIDER | ||
| 522 | Artificial crown procedure | OFFSIDES | ||
| 523 | Ascites | SIDER | ||
| 524 | Aseptic Necrosis of Bone | SIDER | ||
| 525 | Ataxia | SIDER | ||
| 526 | Atherosclerosis | SIDER | ||
| 527 | Aura | OFFSIDES SIDER | ||
| 528 | Autoimmune thrombocytopenia | OFFSIDES | ||
| 529 | Balanoposthitis | SIDER | ||
| 530 | Basal cell carcinoma | SIDER | ||
| 531 | Bereavement | OFFSIDES | ||
| 532 | Bile Duct Stenosis | OFFSIDES | ||
| 533 | Biliary Colic | SIDER | ||
| 534 | Biopsy bone marrow abnormal | OFFSIDES | ||
| 535 | Bladder discomfort | OFFSIDES | ||
| 536 | Bladder pain | SIDER | ||
| 537 | Blepharitis | SIDER | ||
| 538 | Blepharoptosis | OFFSIDES | ||
| 539 | Blepharospasm | SIDER | ||
| 540 | Blood alkaline phosphatase | OFFSIDES | ||
| 541 | Blood and lymphatic system disorders | SIDER | ||
| 542 | Blood cholesterol increased | SIDER | ||
| 543 | Blood homocysteine | OFFSIDES | ||
| 544 | Blood phosphorus increased | SIDER | ||
| 545 | Breast Cyst | SIDER | ||
| 546 | Bulimia | OFFSIDES | ||
| 547 | Bullous eruption | SIDER | ||
| 548 | Bunion operation | OFFSIDES | ||
| 549 | Bursitis | SIDER | ||
| 550 | Candidiasis of vagina | OFFSIDES | ||
| 551 | Capillary Leak Syndrome | OFFSIDES | ||
| 552 | Carcinoma | SIDER | ||
| 553 | Cardiac Hypertrophy | OFFSIDES | ||
| 554 | Cardioactive drug level below therapeutic | OFFSIDES | ||
| 555 | Cardiomegaly | SIDER | ||
| 556 | Carpal Tunnel Syndrome | SIDER | ||
| 557 | Catalepsy | 10683491 | CTD | |
| 558 | Catheter site related reaction | OFFSIDES | ||
| 559 | Central Nervous System Infection | OFFSIDES | ||
| 560 | Central nervous system lesion | OFFSIDES | ||
| 561 | Central venous catheter removal | OFFSIDES | ||
| 562 | Cerebral atrophy | SIDER | ||
| 563 | Chondromalacia | OFFSIDES | ||
| 564 | Choreoathetosis | SIDER | ||
| 565 | Cocaine-Related Disorders | 18393062 | CTD | |
| 566 | Cognitive deterioration | OFFSIDES | ||
| 567 | Cogwheel Rigidity | OFFSIDES | ||
| 568 | Colitis | SIDER | ||
| 569 | Conjunctival abrasion | OFFSIDES | ||
| 570 | Conjunctivitis | SIDER | ||
| 571 | Coronary Artery Disease | SIDER | ||
| 572 | Cramps of lower extremities | SIDER | ||
| 573 | Craniotomy | OFFSIDES | ||
| 574 | Cyst | OFFSIDES | ||
| 575 | Deafness | SIDER | ||
| 576 | Dental Fistula | OFFSIDES | ||
| 577 | Dental caries | SIDER | ||
| 578 | Depressed mood | OFFSIDES SIDER | ||
| 579 | Depression aggravated | SIDER | ||
| 580 | Dermatitis | SIDER | ||
| 581 | Dermoid Cyst | OFFSIDES SIDER | ||
| 582 | Device occlusion | OFFSIDES | ||
| 583 | Diabetes mellitus exacerbated | SIDER | ||
| 584 | Diabetic Nephropathy | OFFSIDES | ||
| 585 | Diffuse alveolar damage | OFFSIDES | ||
| 586 | Disorders of Excessive Somnolence | 11487183 11665873 20461803 | CTD | |
| 587 | Disruptive, Impulse Control, and Conduct Disorders | 20447020 20457959 | CTD | |
| 588 | Diverticulitis | SIDER | ||
| 589 | Drowsiness | OFFSIDES | ||
| 590 | Drug level increased | SIDER | ||
| 591 | Dry skin | SIDER | ||
| 592 | Duodenal Ulcer | SIDER | ||
| 593 | Duodenitis | SIDER | ||
| 594 | Duodenogastric Reflux | OFFSIDES | ||
| 595 | Dysentery | SIDER | ||
| 596 | Dysgraphia | OFFSIDES | ||
| 597 | Dyskinesia, Drug-Induced | 11956968 20461803 20721904 | CTD | |
| 598 | Ear and labyrinth disorders | SIDER | ||
| 599 | Ear discharge | OFFSIDES | ||
| 600 | Eczema | SIDER | ||
| 601 | Embolism | SIDER | ||
| 602 | Endodontic procedure | OFFSIDES | ||
| 603 | Endothelial dysfunction | OFFSIDES | ||
| 604 | Enlargement abdomen | SIDER | ||
| 605 | Enzyme abnormality | SIDER | ||
| 606 | Eosinophilia | SIDER | ||
| 607 | Epididymitis | SIDER | ||
| 608 | Eructation | SIDER | ||
| 609 | Erythromelalgia | OFFSIDES | ||
| 610 | Escherichia urinary tract infection | OFFSIDES | ||
| 611 | Excessive masturbation | OFFSIDES | ||
| 612 | Expired drug administered | OFFSIDES | ||
| 613 | Extremity contracture | OFFSIDES | ||
| 614 | Facial Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 615 | Feeding and Eating Disorders | 16534128 | CTD | |
| 616 | Feelings of worthlessness | OFFSIDES | ||
| 617 | Fibroadenoma of breast | SIDER | ||
| 618 | Fibroadenosis of breast | SIDER | ||
| 619 | Flat affect | SIDER | ||
| 620 | Fluid overload | OFFSIDES SIDER | ||
| 621 | Folliculitis | SIDER | ||
| 622 | Furunculosis | SIDER | ||
| 623 | Galactorrhea | OFFSIDES | ||
| 624 | Gangrene | SIDER | ||
| 625 | Gastric ulcer | SIDER | ||
| 626 | Gastrointestinal infection | SIDER | ||
| 627 | Gingivitis | SIDER | ||
| 628 | Glaucoma | SIDER | ||
| 629 | Glossitis | SIDER | ||
| 630 | Glycosuria | SIDER | ||
| 631 | Goiter | OFFSIDES | ||
| 632 | Groin infection | OFFSIDES | ||
| 633 | Hallucinations | 11956968 | CTD | |
| 634 | Head discomfort | SIDER | ||
| 635 | Hemiplegia | SIDER | ||
| 636 | Hoarseness | SIDER | ||
| 637 | Hunger | SIDER | ||
| 638 | Hydrocephalus | SIDER | ||
| 639 | Hyperacusis | SIDER | ||
| 640 | Hyperbilirubinemia aggravated | SIDER | ||
| 641 | Hyperkeratosis | OFFSIDES SIDER | ||
| 642 | Hyperkinesia | SIDER | ||
| 643 | Hyperpyrexia | SIDER | ||
| 644 | Hyperreflexia | SIDER | ||
| 645 | Hypertension worsened | SIDER | ||
| 646 | Hypertrophic Cardiomyopathy | OFFSIDES | ||
| 647 | Hypotension symptomatic | SIDER | ||
| 648 | Hypothyroidism | SIDER | ||
| 649 | Illogical thinking | OFFSIDES | ||
| 650 | Impaired self-care | OFFSIDES | ||
| 651 | Implantable defibrillator insertion | OFFSIDES | ||
| 652 | Infected cyst | SIDER | ||
| 653 | Infestation | SIDER | ||
| 654 | Influenza-like symptoms | SIDER | ||
| 655 | Infusion site mobility decreased | OFFSIDES | ||
| 656 | Insulin-like growth factor decreased | OFFSIDES | ||
| 657 | Intention tremor | OFFSIDES | ||
| 658 | Intercepted medication error | OFFSIDES | ||
| 659 | Intervertebral Disc Degeneration | OFFSIDES SIDER | ||
| 660 | Intracranial Aneurysm | OFFSIDES | ||
| 661 | Intubation | OFFSIDES | ||
| 662 | Irritable Bowel Syndrome | SIDER | ||
| 663 | Jaw lesion excision | OFFSIDES | ||
| 664 | Joint injury | OFFSIDES | ||
| 665 | Keratitis | SIDER | ||
| 666 | Keratoconjunctivitis Sicca | SIDER | ||
| 667 | Labyrinthine disorder | SIDER | ||
| 668 | Lacrimation abnormal NOS | SIDER | ||
| 669 | Lactic dehydrogenase activity increased | SIDER | ||
| 670 | Lactose Intolerance | SIDER | ||
| 671 | Left atrial dilatation | OFFSIDES | ||
| 672 | Leg edema | SIDER | ||
| 673 | Leukocytosis | SIDER | ||
| 674 | Leukodystrophy | OFFSIDES | ||
| 675 | Leukopenia | SIDER | ||
| 676 | Limb crushing injury | OFFSIDES | ||
| 677 | Lipoma | SIDER | ||
| 678 | Lymph node palpable | OFFSIDES | ||
| 679 | Lymphadenopathy | SIDER | ||
| 680 | Lymphedema | OFFSIDES | ||
| 681 | Lymphocyte count decreased | OFFSIDES | ||
| 682 | Lymphocytosis | SIDER | ||
| 683 | Lymphoma | SIDER | ||
| 684 | Lymphopenia | SIDER | ||
| 685 | Macular degeneration | SIDER | ||
| 686 | Malabsorption | OFFSIDES | ||
| 687 | Malaise and fatigue | SIDER | ||
| 688 | Malignant melanoma in situ | OFFSIDES | ||
| 689 | Malnutrition | SIDER | ||
| 690 | Manic psychosis | SIDER | ||
| 691 | Mastitis | SIDER | ||
| 692 | Menorrhagia | SIDER | ||
| 693 | Metrorrhagia | SIDER | ||
| 694 | Mobility Limitation | 25053526 | CTD | |
| 695 | Mononeuritis | OFFSIDES | ||
| 696 | Mood disorder due to a general medical condition | OFFSIDES | ||
| 697 | Multiple sclerosis relapse | OFFSIDES | ||
| 698 | Muscle relaxant therapy | SIDER | ||
| 699 | Myomectomy | OFFSIDES | ||
| 700 | Nasal Polyps | SIDER | ||
| 701 | Nasal mucosal disorder | SIDER | ||
| 702 | Necrosis | SIDER | ||
| 703 | Nephritis | SIDER | ||
| 704 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 705 | Nephrolithiasis | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 706 | Nerve root lesion | SIDER | ||
| 707 | Neuroma | SIDER | ||
| 708 | Neuropathy | SIDER | ||
| 709 | Nevus | SIDER | ||
| 710 | Nicotine Dependence | OFFSIDES | ||
| 711 | Non-small cell lung cancer stage I | OFFSIDES | ||
| 712 | Obesity | SIDER | ||
| 713 | Oliguria | SIDER | ||
| 714 | Osteoporosis | SIDER | ||
| 715 | Osteosclerosis | OFFSIDES | ||
| 716 | Otitis Externa | SIDER | ||
| 717 | Otitis Media | SIDER | ||
| 718 | Ovarian adhesion | OFFSIDES | ||
| 719 | Pancreatic Cyst | OFFSIDES | ||
| 720 | Pancreatic Duct Stenosis | OFFSIDES | ||
| 721 | Paranoid reaction | SIDER | ||
| 722 | Paresis | SIDER | ||
| 723 | Parkinson Disease | CTD | ||
| 724 | Parkinson's disease aggravated | SIDER | ||
| 725 | Parkinsonian Disorders | 10683491 15899244 | CTD | |
| 726 | Parkinsonian crisis | OFFSIDES | ||
| 727 | Parkinsonism aggravated | SIDER | ||
| 728 | Patellofemoral Pain Syndrome | OFFSIDES | ||
| 729 | Peptic Ulcer Perforation | OFFSIDES | ||
| 730 | Perineal pain | SIDER | ||
| 731 | Periodontitis | SIDER | ||
| 732 | Peripheral gangrene | SIDER | ||
| 733 | Perivascular dermatitis | OFFSIDES | ||
| 734 | Pharyngitis | SIDER | ||
| 735 | Phlebitis | SIDER | ||
| 736 | Phonophobia | OFFSIDES | ||
| 737 | Phosphate increased | SIDER | ||
| 738 | Photophobia | SIDER | ||
| 739 | Photosensitivity allergic reaction | SIDER | ||
| 740 | Plasmacytoma | OFFSIDES | ||
| 741 | Pleurisy | SIDER | ||
| 742 | Poliomyelitis | SIDER | ||
| 743 | Polymyalgia Rheumatica | SIDER | ||
| 744 | Polyuria | OFFSIDES SIDER | ||
| 745 | Postoperative infection | SIDER | ||
| 746 | Precordial pain | SIDER | ||
| 747 | Premenstrual syndrome | SIDER | ||
| 748 | Presbyopia | OFFSIDES | ||
| 749 | Procedural complication | SIDER | ||
| 750 | Product taste abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 751 | Progressive supranuclear palsy | OFFSIDES | ||
| 752 | Protein urine present | SIDER | ||
| 753 | Prothrombin time abnormal | OFFSIDES | ||
| 754 | Prurigo | SIDER | ||
| 755 | Psoriasis flare-up | SIDER | ||
| 756 | Psoriasis | SIDER | ||
| 757 | Psychomotor skills impaired | OFFSIDES | ||
| 758 | Psychoses, Substance-Induced | 20620094 | CTD | |
| 759 | Pulmonary Embolism | SIDER | ||
| 760 | Pulmonary arterial pressure increased | OFFSIDES | ||
| 761 | Pulmonary toxicity | OFFSIDES | ||
| 762 | Purpura | SIDER | ||
| 763 | Pyelonephritis | SIDER | ||
| 764 | Pyuria | SIDER | ||
| 765 | Radical hysterectomy | OFFSIDES | ||
| 766 | Rectal tenesmus | SIDER | ||
| 767 | Renal cyst | SIDER | ||
| 768 | Renal pain | SIDER | ||
| 769 | Residual urine volume increased | OFFSIDES | ||
| 770 | Respiratory Insufficiency | SIDER | ||
| 771 | Restrictive cardiomyopathy | OFFSIDES | ||
| 772 | Retrosternal pain | SIDER | ||
| 773 | Rheumatoid Nodule | OFFSIDES | ||
| 774 | Rhinitis | SIDER | ||
| 775 | Sacroiliitis | SIDER | ||
| 776 | Saliva altered | SIDER | ||
| 777 | Salpingitis | OFFSIDES | ||
| 778 | Sarcoidosis | OFFSIDES | ||
| 779 | Schizoaffective Disorder | OFFSIDES | ||
| 780 | Sciatica | SIDER | ||
| 781 | Scotoma | SIDER | ||
| 782 | Selective Mutism | OFFSIDES | ||
| 783 | Self-induced vomiting | OFFSIDES | ||
| 784 | Sepsis | SIDER | ||
| 785 | Sexual activity increased | OFFSIDES | ||
| 786 | Sick Sinus Syndrome | SIDER | ||
| 787 | Silicosis | OFFSIDES | ||
| 788 | Skeletal injury | OFFSIDES | ||
| 789 | Skin Induration | OFFSIDES | ||
| 790 | Skin Papilloma | SIDER | ||
| 791 | Skin hypertrophy | OFFSIDES SIDER | ||
| 792 | Sleep Initiation and Maintenance Disorders | 20461803 | CTD | |
| 793 | Sleep Talking | OFFSIDES | ||
| 794 | Sperm count decreased | OFFSIDES | ||
| 795 | Sphincter of Oddi Dysfunction | OFFSIDES | ||
| 796 | Spinal column stenosis | OFFSIDES | ||
| 797 | Spontaneous penile erection | OFFSIDES | ||
| 798 | Spousal Abuse | OFFSIDES | ||
| 799 | Squamous cell carcinoma | SIDER | ||
| 800 | Stomatitis | SIDER | ||
| 801 | Stubbornness | OFFSIDES | ||
| 802 | Stupor | SIDER | ||
| 803 | Synovial Cyst | OFFSIDES | ||
| 804 | Synovitis | SIDER | ||
| 805 | Taste Disorders | 16534128 | CTD | |
| 806 | Tension Headache | SIDER | ||
| 807 | Tension | SIDER | ||
| 808 | Thrombocytopenia | SIDER | ||
| 809 | Thrombophlebitis | SIDER | ||
| 810 | Thymoma | OFFSIDES | ||
| 811 | Thyroidectomy | OFFSIDES | ||
| 812 | Tobacco withdrawal symptoms | OFFSIDES | ||
| 813 | Tonsillitis | SIDER | ||
| 814 | Tooth Infection | SIDER | ||
| 815 | Tooth caries aggravated NOS | SIDER | ||
| 816 | Tooth repair | OFFSIDES | ||
| 817 | Torticollis | SIDER | ||
| 818 | Tracheobronchitis | OFFSIDES SIDER | ||
| 819 | Trichotillomania | 18855926 | CTD | |
| 820 | Ulcerative stomatitis | SIDER | ||
| 821 | Umbilical hernia perforation | OFFSIDES | ||
| 822 | Upset stomach | SIDER | ||
| 823 | Uremia | SIDER | ||
| 824 | Urinary tract infection staphylococcal | OFFSIDES | ||
| 825 | Urine arsenic increased | OFFSIDES | ||
| 826 | Vaginal mycosis | SIDER | ||
| 827 | Vascular purpura | SIDER | ||
| 828 | Violence-related symptom | OFFSIDES | ||
| 829 | Viral upper respiratory tract infection | SIDER | ||
| 830 | Vocal Cord Paralysis | SIDER | ||
| 831 | Vulvovaginal mycotic infection | OFFSIDES SIDER | ||
| 832 | Weight Gain | OFFSIDES | ||
| 833 | Wound Infection | SIDER | ||
| 834 | Xerophthalmia | SIDER | ||
| 835 | effusion | OFFSIDES | ||
| 836 | muscle injury | OFFSIDES | ||
| 837 | prostatitis | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.