Venlafaxine Hydrochloride
(PNVNVHUZROJLTJ-UHFFFAOYSA-N)
Structure
- SMILES
- COc1ccc(cc1)C(C1(O)CCCCC1)CN(C)C
- Type(s)
- Approved
- ATC code(s)
- N06AX16
- Molecular Formula:
- C17H27NO2
- Molecular Weight:
- 277.402
- Log P:
- 3.0356
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 32.7
- CAS Number(s):
- 93413-69-5; 99300-78-4
Synonym(s)
1.
Venlafaxine Hydrochloride
2.
1-(2-(dimethylamino)-1-(4-methoxyphenyl)ethyl)cyclohexanol HCl
3.
Cyclohexanol, 1-(2-(dimethylamino)-1-(4-methoxyphenyl)ethyl)-, hydrochloride
4.
Dobupal
5.
Efexor
6.
Effexor
7.
Sila-Venlafaxine
8.
Trevilor
9.
Vandral
10.
Venlafaxine
11.
Wy 45030
12.
Wy-45,030
13.
Wy-45030
14.
Hydrochloride, Venlafaxine
15.
Sila Venlafaxine
16.
Wy 45,030
17.
Wy45,030
18.
Wy45030
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 208 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 2 | Product substitution issue | FAERS: 206 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Nausea | FAERS: 196 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Dizziness | FAERS: 176 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Anxiety | FAERS: 149 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 6 | Headache | FAERS: 149 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 7 | Feeling abnormal | FAERS: 102 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Fatigue | FAERS: 100 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Tremor | FAERS: 91 | SIDER US FAERS | |
| 10 | Drug withdrawal syndrome | FAERS: 89 | US FAERS | |
| 11 | Toxicity to various agents | FAERS: 82 | US FAERS | |
| 12 | Malaise | FAERS: 63 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 13 | Suicide attempt | FAERS: 62 | SIDER US FAERS | |
| 14 | Somnolence | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 15 | Vomiting | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 16 | Agitation | FAERS: 56 | SIDER US FAERS | |
| 17 | Completed Suicide | FAERS: 49 | OFFSIDES SIDER US FAERS | |
| 18 | Crying | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 19 | Tinnitus | FAERS: 47 | SIDER US FAERS | |
| 20 | Asthenia | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 21 | Vertigo | FAERS: 41 | SIDER US FAERS | |
| 22 | Anger | FAERS: 40 | OFFSIDES US FAERS | |
| 23 | Cardiac Arrest | FAERS: 38 | SIDER US FAERS | |
| 24 | Overdose | FAERS: 38 | US FAERS | |
| 25 | Depressed mood | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Product quality issue | FAERS: 36 | US FAERS | |
| 27 | Pain | FAERS: 35 | OFFSIDES SIDER US FAERS | |
| 28 | Chest Pain | FAERS: 34 | OFFSIDES SIDER US FAERS | |
| 29 | Memory impairment | FAERS: 34 | US FAERS | |
| 30 | Palpitations | FAERS: 34 | SIDER US FAERS | |
| 31 | Pruritus | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 32 | Abdominal Pain | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | Lethargy | FAERS: 31 | OFFSIDES US FAERS | |
| 34 | Restlessness | FAERS: 29 | US FAERS | |
| 35 | Nervousness | FAERS: 28 | SIDER US FAERS | |
| 36 | Restless Legs Syndrome | FAERS: 28 | US FAERS | |
| 37 | Apathy | FAERS: 27 | OFFSIDES SIDER US FAERS | |
| 38 | Constipation | FAERS: 27 | SIDER US FAERS | |
| 39 | Serotonin Syndrome | FAERS: 26 | SIDER US FAERS | |
| 40 | Tachycardia | FAERS: 25 | SIDER US FAERS | |
| 41 | Disorientation | FAERS: 24 | US FAERS | |
| 42 | Urticaria | FAERS: 24 | SIDER US FAERS | |
| 43 | Visual Impairment | FAERS: 24 | SIDER US FAERS | |
| 44 | Abdominal discomfort | FAERS: 23 | OFFSIDES US FAERS | |
| 45 | Drug dose omission | FAERS: 23 | OFFSIDES US FAERS | |
| 46 | Mydriasis | FAERS: 23 | SIDER US FAERS | |
| 47 | Drug Dependence | FAERS: 22 | SIDER US FAERS | |
| 48 | Aphasia | FAERS: 20 | SIDER US FAERS | |
| 49 | Mood swings | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 50 | Sexual Dysfunction | FAERS: 20 | SIDER US FAERS | |
| 51 | Drug abuse | FAERS: 18 | US FAERS | |
| 52 | Mental impairment | FAERS: 18 | OFFSIDES US FAERS | |
| 53 | Myoclonus | FAERS: 18 | SIDER US FAERS | |
| 54 | Hypotension | FAERS: 17 | SIDER US FAERS | |
| 55 | Rhabdomyolysis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 56 | Acute kidney injury | FAERS: 16 | US FAERS | |
| 57 | Syncope | FAERS: 16 | SIDER US FAERS | |
| 58 | Activities of daily living impaired | FAERS: 15 | US FAERS | |
| 59 | Chills | FAERS: 15 | SIDER US FAERS | |
| 60 | Night sweats | FAERS: 15 | SIDER US FAERS | |
| 61 | Photophobia | FAERS: 15 | SIDER US FAERS | |
| 62 | Product formulation issue | FAERS: 15 | US FAERS | |
| 63 | Adverse event | FAERS: 14 | US FAERS | |
| 64 | Amnesia | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 65 | Medication residue present | FAERS: 14 | US FAERS | |
| 66 | Diplopia | FAERS: 13 | SIDER US FAERS | |
| 67 | Disseminated Intravascular Coagulation | FAERS: 13 | US FAERS | |
| 68 | Dysarthria | FAERS: 13 | US FAERS | |
| 69 | Hypersensitivity | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 70 | Impaired work ability | FAERS: 13 | US FAERS | |
| 71 | Alopecia | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 72 | Arthralgia | FAERS: 12 | SIDER US FAERS | |
| 73 | Dyspepsia | FAERS: 12 | SIDER US FAERS | |
| 74 | Emotional disorder | FAERS: 12 | US FAERS | |
| 75 | Hyperreflexia | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 76 | Intentional product use issue | FAERS: 12 | US FAERS | |
| 77 | Myalgia | FAERS: 12 | SIDER US FAERS | |
| 78 | Product use in unapproved indication | FAERS: 12 | US FAERS | |
| 79 | Product use issue | FAERS: 12 | US FAERS | |
| 80 | Reversible cerebral vasoconstriction syndrome | FAERS: 12 | US FAERS | |
| 81 | Wrong technique in product usage process | FAERS: 12 | US FAERS | |
| 82 | Dystonia | FAERS: 11 | US FAERS | |
| 83 | Feeling jittery | FAERS: 11 | US FAERS | |
| 84 | Hypersomnia | FAERS: 11 | US FAERS | |
| 85 | Intentional self-injury | FAERS: 11 | US FAERS | |
| 86 | nervous system disorder | FAERS: 11 | US FAERS | |
| 87 | Abnormal weight gain | FAERS: 10 | US FAERS | |
| 88 | Erythema | FAERS: 10 | SIDER US FAERS | |
| 89 | Hyperacusis | FAERS: 10 | SIDER US FAERS | |
| 90 | Inappropriate affect | FAERS: 10 | US FAERS | |
| 91 | Incorrect dose administered | FAERS: 10 | OFFSIDES US FAERS | |
| 92 | Infection | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 93 | Personality Change | FAERS: 10 | US FAERS | |
| 94 | Sinus Tachycardia | FAERS: 10 | US FAERS | |
| 95 | Urinary Retention | FAERS: 10 | SIDER US FAERS | |
| 96 | Weight decreased | FAERS: 10 | SIDER US FAERS | |
| 97 | Altered state of consciousness | FAERS: 9 | US FAERS | |
| 98 | Bruxism | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 99 | Dependence | FAERS: 9 | SIDER US FAERS | |
| 100 | Dissociation | FAERS: 9 | US FAERS | |
| 101 | Emotional distress | FAERS: 9 | OFFSIDES US FAERS | |
| 102 | General physical health deterioration | FAERS: 9 | US FAERS | |
| 103 | Head discomfort | FAERS: 9 | US FAERS | |
| 104 | Impaired driving ability | FAERS: 9 | US FAERS | |
| 105 | Atrial Fibrillation | FAERS: 8 | SIDER US FAERS | |
| 106 | Back Pain | FAERS: 8 | SIDER US FAERS | |
| 107 | Bipolar Disorder | FAERS: 8 | OFFSIDES US FAERS | |
| 108 | Blood creatine phosphokinase increased | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 109 | Drug effect incomplete | FAERS: 8 | US FAERS | |
| 110 | Drug exposure during pregnancy | FAERS: 8 | US FAERS | |
| 111 | Dysgeusia | FAERS: 8 | SIDER US FAERS | |
| 112 | Emotional poverty | FAERS: 8 | US FAERS | |
| 113 | Erectile dysfunction | FAERS: 8 | SIDER US FAERS | |
| 114 | Neck Pain | FAERS: 8 | SIDER US FAERS | |
| 115 | Poisoning | FAERS: 8 | US FAERS | |
| 116 | Product physical issue | FAERS: 8 | US FAERS | |
| 117 | Stress | FAERS: 8 | OFFSIDES US FAERS | |
| 118 | Unevaluable event | FAERS: 8 | US FAERS | |
| 119 | Urinary tract infection | FAERS: 8 | US FAERS | |
| 120 | Abasia | FAERS: 7 | US FAERS | |
| 121 | Blood prolactin increased | FAERS: 7 | SIDER US FAERS | |
| 122 | Depressed Level of Consciousness | FAERS: 7 | SIDER US FAERS | |
| 123 | Drug ineffective for unapproved indication | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Economic problem | FAERS: 7 | US FAERS | |
| 125 | Epilepsy | FAERS: 7 | US FAERS | |
| 126 | Gastritis | FAERS: 7 | SIDER US FAERS | |
| 127 | Gastrointestinal Pain | FAERS: 7 | SIDER US FAERS | |
| 128 | Hypertensive emergency | FAERS: 7 | US FAERS | |
| 129 | Intentional product misuse | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Kleptomania | FAERS: 7 | US FAERS | |
| 131 | Medication residue | FAERS: 7 | US FAERS | |
| 132 | Muscle Rigidity | FAERS: 7 | US FAERS | |
| 133 | Muscle Spasticity | FAERS: 7 | US FAERS | |
| 134 | Musculoskeletal stiffness | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 135 | Obsessive-Compulsive Disorder | FAERS: 7 | US FAERS | |
| 136 | Paranoia | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 137 | Respiratory arrest | FAERS: 7 | US FAERS | |
| 138 | Therapeutic response unexpected | FAERS: 7 | US FAERS | |
| 139 | Accidental exposure to product by child | FAERS: 6 | US FAERS | |
| 140 | Burning sensation | FAERS: 6 | US FAERS | |
| 141 | Coma scale abnormal | FAERS: 6 | US FAERS | |
| 142 | Delirium | FAERS: 6 | SIDER US FAERS | |
| 143 | Dysphonia | FAERS: 6 | OFFSIDES US FAERS | |
| 144 | Hypophagia | FAERS: 6 | US FAERS | |
| 145 | Maternal exposure during pregnancy | FAERS: 6 | US FAERS | |
| 146 | Middle insomnia | FAERS: 6 | US FAERS | |
| 147 | Myocardial Infarction | FAERS: 6 | SIDER US FAERS | |
| 148 | Orgasmic sensation decreased | FAERS: 6 | US FAERS | |
| 149 | Pneumonia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 150 | Product solubility abnormal | FAERS: 6 | US FAERS | |
| 151 | Quality of life decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 152 | Sepsis | FAERS: 6 | US FAERS | |
| 153 | Transaminases increased | FAERS: 6 | US FAERS | |
| 154 | Unemployment | FAERS: 6 | US FAERS | |
| 155 | treatment failure | FAERS: 6 | US FAERS | |
| 156 | Agitated depression | FAERS: 5 | US FAERS | |
| 157 | Alcohol abuse | FAERS: 5 | SIDER US FAERS | |
| 158 | Anuria | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 159 | Asthenopia | FAERS: 5 | US FAERS | |
| 160 | Blindness | FAERS: 5 | US FAERS | |
| 161 | Blood cholesterol increased | FAERS: 5 | SIDER US FAERS | |
| 162 | Bowel movement irregularity | FAERS: 5 | US FAERS | |
| 163 | Bradycardia | FAERS: 5 | SIDER US FAERS | |
| 164 | Bronchiectasis | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 165 | Cerebrovascular accident | FAERS: 5 | SIDER US FAERS | |
| 166 | Congenital cystic lung | FAERS: 5 | US FAERS | |
| 167 | Food craving | FAERS: 5 | US FAERS | |
| 168 | Formication | FAERS: 5 | OFFSIDES US FAERS | |
| 169 | Hepatotoxicity | FAERS: 5 | US FAERS | |
| 170 | Herbal interaction | FAERS: 5 | US FAERS | |
| 171 | Hypervigilance | FAERS: 5 | US FAERS | |
| 172 | Incontinence | FAERS: 5 | OFFSIDES US FAERS | |
| 173 | Lichen Planus | FAERS: 5 | US FAERS | |
| 174 | Loss of personal independence in daily activities | FAERS: 5 | US FAERS | |
| 175 | Medication Error | FAERS: 5 | US FAERS | |
| 176 | Mental status changes | FAERS: 5 | US FAERS | |
| 177 | Metrorrhagia | FAERS: 5 | SIDER US FAERS | |
| 178 | Nystagmus | FAERS: 5 | SIDER US FAERS | |
| 179 | Oropharyngeal pain | FAERS: 5 | US FAERS | |
| 180 | Pancreatitis | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 181 | Panic Disorder | FAERS: 5 | OFFSIDES US FAERS | |
| 182 | Pulmonary congestion | FAERS: 5 | SIDER US FAERS | |
| 183 | Slow speech | FAERS: 5 | US FAERS | |
| 184 | Tension Headache | FAERS: 5 | US FAERS | |
| 185 | Tension | FAERS: 5 | SIDER US FAERS | |
| 186 | Urinary Incontinence | FAERS: 5 | SIDER US FAERS | |
| 187 | Urinary hesitation | FAERS: 5 | US FAERS | |
| 188 | Accidental overdose | FAERS: 4 | US FAERS | |
| 189 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 190 | Bradyphrenia | FAERS: 4 | US FAERS | |
| 191 | Cataplexy | FAERS: 4 | US FAERS | |
| 192 | Cerebral atrophy | FAERS: 4 | US FAERS | |
| 193 | Cystitis | FAERS: 4 | SIDER US FAERS | |
| 194 | Drug administration error | FAERS: 4 | US FAERS | |
| 195 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 196 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 197 | Dysuria | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 198 | Endolymphatic Hydrops | FAERS: 4 | US FAERS | |
| 199 | Eructation | FAERS: 4 | SIDER US FAERS | |
| 200 | Feeling of body temperature change | FAERS: 4 | US FAERS | |
| 201 | Flushing | FAERS: 4 | SIDER US FAERS | |
| 202 | Hostility | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 203 | Hypertensive crisis | FAERS: 4 | US FAERS | |
| 204 | Hypomania | FAERS: 4 | SIDER US FAERS | |
| 205 | Limb discomfort | FAERS: 4 | US FAERS | |
| 206 | Lip swelling | FAERS: 4 | US FAERS | |
| 207 | Lipase increased | FAERS: 4 | US FAERS | |
| 208 | Male Orgasmic Disorder | FAERS: 4 | US FAERS | |
| 209 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 210 | Neonatal testicular torsion | FAERS: 4 | US FAERS | |
| 211 | Nerve injury | FAERS: 4 | US FAERS | |
| 212 | Ocular Hypertension | FAERS: 4 | US FAERS | |
| 213 | Poor quality sleep | FAERS: 4 | US FAERS | |
| 214 | Prostatism | FAERS: 4 | US FAERS | |
| 215 | Respiratory Failure | FAERS: 4 | SIDER US FAERS | |
| 216 | Screaming | FAERS: 4 | OFFSIDES US FAERS | |
| 217 | Swelling | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 218 | Therapy cessation | FAERS: 4 | OFFSIDES US FAERS | |
| 219 | Venous Thrombosis | FAERS: 4 | US FAERS | |
| 220 | Yawning | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 221 | Acne | FAERS: 3 | US FAERS | |
| 222 | Akathisia | FAERS: 3 | SIDER US FAERS | |
| 223 | Alanine Aminotransferase Increased | FAERS: 3 | SIDER US FAERS | |
| 224 | Alcohol interaction | FAERS: 3 | US FAERS | |
| 225 | Alcohol poisoning | FAERS: 3 | US FAERS | |
| 226 | Ammonia increased | FAERS: 3 | US FAERS | |
| 227 | Asphyxia | FAERS: 3 | US FAERS | |
| 228 | Atelectasis | FAERS: 3 | SIDER US FAERS | |
| 229 | Autonomic nervous system imbalance | FAERS: 3 | US FAERS | |
| 230 | Autoscopy | FAERS: 3 | US FAERS | |
| 231 | Bipolar I disorder | FAERS: 3 | US FAERS | |
| 232 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 233 | Cardiomegaly | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 234 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 235 | Chest discomfort | FAERS: 3 | US FAERS | |
| 236 | Dehydration | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 237 | Depression suicidal | FAERS: 3 | US FAERS | |
| 238 | Discomfort | FAERS: 3 | SIDER US FAERS | |
| 239 | Drooling | FAERS: 3 | US FAERS | |
| 240 | Drug level increased | FAERS: 3 | US FAERS | |
| 241 | Epistaxis | FAERS: 3 | SIDER US FAERS | |
| 242 | Euphoric mood | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 243 | Exposure during breast feeding | FAERS: 3 | US FAERS | |
| 244 | Exposure via breast milk | FAERS: 3 | US FAERS | |
| 245 | Eye pain | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 246 | Failure to Thrive | FAERS: 3 | US FAERS | |
| 247 | Feeling Cold | FAERS: 3 | US FAERS | |
| 248 | Flatulence | FAERS: 3 | SIDER US FAERS | |
| 249 | Gastrointestinal sounds abnormal | FAERS: 3 | US FAERS | |
| 250 | Homicide | FAERS: 3 | US FAERS | |
| 251 | Hypospadias | FAERS: 3 | US FAERS | |
| 252 | Hypoxia | FAERS: 3 | SIDER US FAERS | |
| 253 | Incorrect drug dosage form administered | FAERS: 3 | US FAERS | |
| 254 | Lower Urinary Tract Symptoms | FAERS: 3 | US FAERS | |
| 255 | Malabsorption | FAERS: 3 | US FAERS | |
| 256 | Mouth swelling | FAERS: 3 | US FAERS | |
| 257 | Muscle tightness | FAERS: 3 | US FAERS | |
| 258 | Neurodermatitis | FAERS: 3 | US FAERS | |
| 259 | Neutropenia | FAERS: 3 | SIDER US FAERS | |
| 260 | Oropharyngeal spasm | FAERS: 3 | OFFSIDES US FAERS | |
| 261 | Physical assault | FAERS: 3 | US FAERS | |
| 262 | Pneumococcal sepsis | FAERS: 3 | US FAERS | |
| 263 | Pre-existing condition improved | FAERS: 3 | US FAERS | |
| 264 | Premature Ejaculation | FAERS: 3 | US FAERS | |
| 265 | Product taste abnormal | FAERS: 3 | US FAERS | |
| 266 | Sarcoidosis | FAERS: 3 | US FAERS | |
| 267 | Snoring | FAERS: 3 | OFFSIDES US FAERS | |
| 268 | Sopor | FAERS: 3 | US FAERS | |
| 269 | Status Epilepticus | FAERS: 3 | US FAERS | |
| 270 | Systemic Inflammatory Response Syndrome | FAERS: 3 | US FAERS | |
| 271 | Tachyphrenia | FAERS: 3 | US FAERS | |
| 272 | Therapeutic response changed | FAERS: 3 | US FAERS | |
| 273 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 274 | Ventricular Fibrillation | FAERS: 3 | SIDER US FAERS | |
| 275 | Wrong dose | FAERS: 3 | US FAERS | |
| 276 | Abulia | FAERS: 2 | US FAERS | |
| 277 | Acute Coronary Syndrome | FAERS: 2 | SIDER US FAERS | |
| 278 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 279 | Adactyly | FAERS: 2 | US FAERS | |
| 280 | Ageusia | FAERS: 2 | SIDER US FAERS | |
| 281 | Akinesia | FAERS: 2 | SIDER US FAERS | |
| 282 | Angina Pectoris | FAERS: 2 | SIDER US FAERS | |
| 283 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 284 | Anhedonia | FAERS: 2 | OFFSIDES US FAERS | |
| 285 | Anorgasmia | FAERS: 2 | SIDER US FAERS | |
| 286 | Aphagia | FAERS: 2 | US FAERS | |
| 287 | Aphonia | FAERS: 2 | US FAERS | |
| 288 | Ataxia | FAERS: 2 | SIDER US FAERS | |
| 289 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 290 | Bone pain | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 291 | Bradykinesia | FAERS: 2 | SIDER US FAERS | |
| 292 | Breast discomfort | FAERS: 2 | US FAERS | |
| 293 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 294 | Cardiotoxicity | FAERS: 2 | US FAERS | |
| 295 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 296 | Cerebral vasoconstriction | FAERS: 2 | US FAERS | |
| 297 | Cholelithiasis | FAERS: 2 | SIDER US FAERS | |
| 298 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 299 | Clonus | FAERS: 2 | US FAERS | |
| 300 | Clumsiness | FAERS: 2 | US FAERS | |
| 301 | Cold sweat | FAERS: 2 | US FAERS | |
| 302 | Congenital ureterocele | FAERS: 2 | US FAERS | |
| 303 | Cyanosis | FAERS: 2 | SIDER US FAERS | |
| 304 | Deafness | FAERS: 2 | SIDER US FAERS | |
| 305 | Disease recurrence | FAERS: 2 | US FAERS | |
| 306 | Drug effect variable | FAERS: 2 | US FAERS | |
| 307 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 308 | Drug screen positive | FAERS: 2 | US FAERS | |
| 309 | Dysphemia | FAERS: 2 | US FAERS | |
| 310 | Ear discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 311 | Ecchymosis | FAERS: 2 | SIDER US FAERS | |
| 312 | Ejection Fraction Decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 313 | Frustration tolerance decreased | FAERS: 2 | US FAERS | |
| 314 | Gastroenteritis | FAERS: 2 | SIDER US FAERS | |
| 315 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 316 | Genital rash | FAERS: 2 | OFFSIDES US FAERS | |
| 317 | Glaucoma | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 318 | Glossitis | FAERS: 2 | SIDER US FAERS | |
| 319 | Growth retardation | FAERS: 2 | US FAERS | |
| 320 | Hemiparesis | FAERS: 2 | US FAERS | |
| 321 | Hyperchlorhydria | FAERS: 2 | SIDER US FAERS | |
| 322 | Impaired gastric emptying | FAERS: 2 | OFFSIDES US FAERS | |
| 323 | Inappropriate schedule of drug administration | FAERS: 2 | OFFSIDES US FAERS | |
| 324 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 325 | Intestinal Obstruction | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 326 | Lactation Disorder | FAERS: 2 | US FAERS | |
| 327 | Leukoencephalopathy | FAERS: 2 | US FAERS | |
| 328 | Locked-In Syndrome | FAERS: 2 | US FAERS | |
| 329 | Long QT Syndrome | FAERS: 2 | US FAERS | |
| 330 | Malocclusion | FAERS: 2 | US FAERS | |
| 331 | Menorrhagia | FAERS: 2 | SIDER US FAERS | |
| 332 | Metamorphopsia | FAERS: 2 | US FAERS | |
| 333 | Mixed liver injury | FAERS: 2 | US FAERS | |
| 334 | Muscle necrosis | FAERS: 2 | US FAERS | |
| 335 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 336 | Myositis | FAERS: 2 | US FAERS | |
| 337 | Narcolepsy | FAERS: 2 | US FAERS | |
| 338 | Neuralgia | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 339 | Oliguria | FAERS: 2 | SIDER US FAERS | |
| 340 | Oral pain | FAERS: 2 | US FAERS | |
| 341 | Paradoxical drug reaction | FAERS: 2 | US FAERS | |
| 342 | Patent ductus arteriosus | FAERS: 2 | US FAERS | |
| 343 | Polydactyly | FAERS: 2 | US FAERS | |
| 344 | Presyncope | FAERS: 2 | US FAERS | |
| 345 | Priapism | FAERS: 2 | US FAERS | |
| 346 | Product commingling | FAERS: 2 | US FAERS | |
| 347 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 348 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 349 | Pulmonary Embolism | FAERS: 2 | SIDER US FAERS | |
| 350 | Pulmonary Fibrosis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 351 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 352 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 353 | Rebound effect | FAERS: 2 | US FAERS | |
| 354 | Renal pain | FAERS: 2 | SIDER US FAERS | |
| 355 | Respiratory distress | FAERS: 2 | US FAERS | |
| 356 | Retching | FAERS: 2 | US FAERS | |
| 357 | Sinusitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 358 | Skin neoplasm excision | FAERS: 2 | US FAERS | |
| 359 | Sluggishness | FAERS: 2 | US FAERS | |
| 360 | Stomatitis | FAERS: 2 | SIDER US FAERS | |
| 361 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 362 | Temperature regulation disorder | FAERS: 2 | US FAERS | |
| 363 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 364 | Throat irritation | FAERS: 2 | US FAERS | |
| 365 | Transfusion-Related Acute Lung Injury | FAERS: 2 | US FAERS | |
| 366 | Trismus | FAERS: 2 | SIDER US FAERS | |
| 367 | Vulvovaginal dryness | FAERS: 2 | SIDER US FAERS | |
| 368 | Wrong technique in drug usage process | FAERS: 2 | OFFSIDES US FAERS | |
| 369 | jaundice | FAERS: 2 | SIDER US FAERS | |
| 370 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 371 | Acidosis | FAERS: 1 | US FAERS | |
| 372 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 373 | Agoraphobia | FAERS: 1 | US FAERS | |
| 374 | Agranulocytosis | FAERS: 1 | SIDER US FAERS | |
| 375 | Alcohol Intolerance | FAERS: 1 | SIDER US FAERS | |
| 376 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 377 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 378 | Anorectal swelling | FAERS: 1 | US FAERS | |
| 379 | Apparent death | FAERS: 1 | US FAERS | |
| 380 | Arthropathy | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 381 | Aspartate Aminotransferase Increased | FAERS: 1 | SIDER US FAERS | |
| 382 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 383 | Atrioventricular Septal Defect | FAERS: 1 | US FAERS | |
| 384 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 385 | Bedridden | FAERS: 1 | US FAERS | |
| 386 | Blepharospasm | FAERS: 1 | OFFSIDES US FAERS | |
| 387 | Blood alkaline phosphatase increased | FAERS: 1 | SIDER US FAERS | |
| 388 | Blood catecholamines increased | FAERS: 1 | US FAERS | |
| 389 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 390 | Blood creatinine increased | FAERS: 1 | SIDER US FAERS | |
| 391 | Blood iron increased | FAERS: 1 | US FAERS | |
| 392 | Blood lactate dehydrogenase increased | FAERS: 1 | SIDER US FAERS | |
| 393 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 394 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 395 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 396 | Blood triglycerides increased | FAERS: 1 | OFFSIDES US FAERS | |
| 397 | Blood urine present | FAERS: 1 | US FAERS | |
| 398 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 399 | Breech Presentation | FAERS: 1 | US FAERS | |
| 400 | Bronchospasm | FAERS: 1 | US FAERS | |
| 401 | Calcinosis | FAERS: 1 | US FAERS | |
| 402 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 403 | Cardiac infection | FAERS: 1 | US FAERS | |
| 404 | Cataract | FAERS: 1 | SIDER US FAERS | |
| 405 | Catatonia | FAERS: 1 | SIDER US FAERS | |
| 406 | Chorea | FAERS: 1 | US FAERS | |
| 407 | Claustrophobia | FAERS: 1 | US FAERS | |
| 408 | Conversion disorder | FAERS: 1 | SIDER US FAERS | |
| 409 | Cyclothymic Disorder | FAERS: 1 | US FAERS | |
| 410 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 411 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 412 | Decreased eye contact | FAERS: 1 | US FAERS | |
| 413 | Deep Vein Thrombosis | FAERS: 1 | SIDER US FAERS | |
| 414 | Dementia | FAERS: 1 | SIDER US FAERS | |
| 415 | Device Failure | FAERS: 1 | US FAERS | |
| 416 | Diaphragmalgia | FAERS: 1 | US FAERS | |
| 417 | Dissociative disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Disturbance in sexual arousal | FAERS: 1 | SIDER US FAERS | |
| 419 | Drug level decreased | FAERS: 1 | US FAERS | |
| 420 | Dysgraphia | FAERS: 1 | US FAERS | |
| 421 | Early satiety | FAERS: 1 | US FAERS | |
| 422 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 423 | Eczema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 424 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 425 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 426 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 427 | Encephalitis | FAERS: 1 | US FAERS | |
| 428 | Encephalocele | FAERS: 1 | US FAERS | |
| 429 | Enteritis | FAERS: 1 | US FAERS | |
| 430 | Enzyme Inhibition | FAERS: 1 | US FAERS | |
| 431 | Eosinophilia | FAERS: 1 | SIDER US FAERS | |
| 432 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 433 | Exaggerated startle response | FAERS: 1 | US FAERS | |
| 434 | Eye Infection | FAERS: 1 | US FAERS | |
| 435 | Eye inflammation | FAERS: 1 | US FAERS | |
| 436 | Eye irritation | FAERS: 1 | US FAERS | |
| 437 | False positive investigation result | FAERS: 1 | US FAERS | |
| 438 | Fine motor delay | FAERS: 1 | US FAERS | |
| 439 | Flank Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 440 | Focal dyscognitive seizures | FAERS: 1 | US FAERS | |
| 441 | Frustration | FAERS: 1 | US FAERS | |
| 442 | Gait inability | FAERS: 1 | US FAERS | |
| 443 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 444 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 445 | Gastrointestinal ulcer | FAERS: 1 | SIDER US FAERS | |
| 446 | Genital swelling | FAERS: 1 | US FAERS | |
| 447 | Gout | FAERS: 1 | SIDER US FAERS | |
| 448 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 449 | Guillain-Barre Syndrome | FAERS: 1 | SIDER US FAERS | |
| 450 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 451 | Head titubation | FAERS: 1 | US FAERS | |
| 452 | Hemiplegia | FAERS: 1 | US FAERS | |
| 453 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 454 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 455 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 456 | Hyperventilation | FAERS: 1 | SIDER US FAERS | |
| 457 | Hypokinesia | FAERS: 1 | SIDER US FAERS | |
| 458 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 459 | Hyporeflexia | FAERS: 1 | SIDER US FAERS | |
| 460 | Hypoventilation | FAERS: 1 | SIDER US FAERS | |
| 461 | Ileus | FAERS: 1 | US FAERS | |
| 462 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 463 | Impaired self-care | FAERS: 1 | OFFSIDES US FAERS | |
| 464 | Impatience | FAERS: 1 | US FAERS | |
| 465 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 466 | Incoherent | FAERS: 1 | US FAERS | |
| 467 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 468 | Infantile vomiting | FAERS: 1 | US FAERS | |
| 469 | Inflammation | FAERS: 1 | US FAERS | |
| 470 | Influenza | FAERS: 1 | SIDER US FAERS | |
| 471 | Initial insomnia | FAERS: 1 | US FAERS | |
| 472 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 473 | Joint swelling | FAERS: 1 | US FAERS | |
| 474 | Laceration | FAERS: 1 | US FAERS | |
| 475 | Laziness | FAERS: 1 | US FAERS | |
| 476 | Leukocytosis | FAERS: 1 | SIDER US FAERS | |
| 477 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 478 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 479 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 480 | Lymphadenopathy | FAERS: 1 | SIDER US FAERS | |
| 481 | Magical thinking | FAERS: 1 | US FAERS | |
| 482 | Mastication disorder | FAERS: 1 | US FAERS | |
| 483 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 484 | Metanephrine urine increased | FAERS: 1 | US FAERS | |
| 485 | Microalbuminuria | FAERS: 1 | US FAERS | |
| 486 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 487 | Motion Sickness | FAERS: 1 | SIDER US FAERS | |
| 488 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 489 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 490 | Muscle strain | FAERS: 1 | OFFSIDES US FAERS | |
| 491 | Mutism | FAERS: 1 | US FAERS | |
| 492 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 493 | Nasopharyngitis | FAERS: 1 | OFFSIDES US FAERS | |
| 494 | Negative thoughts | FAERS: 1 | US FAERS | |
| 495 | Negativism | FAERS: 1 | US FAERS | |
| 496 | Nephritis | FAERS: 1 | US FAERS | |
| 497 | Neuroleptic Malignant Syndrome | FAERS: 1 | SIDER US FAERS | |
| 498 | Neutrophil count abnormal | FAERS: 1 | US FAERS | |
| 499 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 500 | Nuchal Rigidity | FAERS: 1 | SIDER US FAERS | |
| 501 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 502 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 503 | Oral mucosal exfoliation | FAERS: 1 | OFFSIDES US FAERS | |
| 504 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 505 | Pallor | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 506 | Pancytopenia | FAERS: 1 | SIDER US FAERS | |
| 507 | Parapsoriasis | FAERS: 1 | US FAERS | |
| 508 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 509 | Peripancreatic fluid collection | FAERS: 1 | US FAERS | |
| 510 | Photodermatosis | FAERS: 1 | US FAERS | |
| 511 | Physical abuse | FAERS: 1 | US FAERS | |
| 512 | Pityriasis Lichenoides et Varioliformis Acuta | FAERS: 1 | US FAERS | |
| 513 | Pneumothorax | FAERS: 1 | SIDER US FAERS | |
| 514 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 515 | Polyuria | FAERS: 1 | SIDER US FAERS | |
| 516 | Poor personal hygiene | FAERS: 1 | US FAERS | |
| 517 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 518 | Pregnancy | FAERS: 1 | US FAERS | |
| 519 | Proctitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 520 | Product coating issue | FAERS: 1 | US FAERS | |
| 521 | Product contamination chemical | FAERS: 1 | US FAERS | |
| 522 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 523 | Product dispensing error | FAERS: 1 | US FAERS | |
| 524 | Product dosage form issue | FAERS: 1 | US FAERS | |
| 525 | Product packaging issue | FAERS: 1 | US FAERS | |
| 526 | Product residue present | FAERS: 1 | US FAERS | |
| 527 | Product storage error | FAERS: 1 | US FAERS | |
| 528 | Product tampering | FAERS: 1 | US FAERS | |
| 529 | Psoriasis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 530 | Purpura | FAERS: 1 | SIDER US FAERS | |
| 531 | Pyelonephritis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 532 | Rectal discharge | FAERS: 1 | US FAERS | |
| 533 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 534 | Retinal Vein Occlusion | FAERS: 1 | OFFSIDES US FAERS | |
| 535 | Sciatica | FAERS: 1 | US FAERS | |
| 536 | Sclerodactylia | FAERS: 1 | US FAERS | |
| 537 | Scleroderma | FAERS: 1 | US FAERS | |
| 538 | Sensory level abnormal | FAERS: 1 | US FAERS | |
| 539 | Sexual abuse | FAERS: 1 | US FAERS | |
| 540 | Shock | FAERS: 1 | SIDER US FAERS | |
| 541 | Sinus pain | FAERS: 1 | US FAERS | |
| 542 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 543 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 544 | Soliloquy | FAERS: 1 | US FAERS | |
| 545 | Somnambulism | FAERS: 1 | US FAERS | |
| 546 | Spinal fusion surgery | FAERS: 1 | OFFSIDES US FAERS | |
| 547 | Spontaneous ejaculation | FAERS: 1 | US FAERS | |
| 548 | Staring | FAERS: 1 | US FAERS | |
| 549 | Strabismus | FAERS: 1 | US FAERS | |
| 550 | Stupor | FAERS: 1 | SIDER US FAERS | |
| 551 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 552 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 553 | Therapeutic product effect decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 554 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 555 | Therapy change | FAERS: 1 | US FAERS | |
| 556 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 557 | Thought withdrawal | FAERS: 1 | US FAERS | |
| 558 | Thrombocytopenia | FAERS: 1 | SIDER US FAERS | |
| 559 | Thrombosis | FAERS: 1 | US FAERS | |
| 560 | Tongue erythema | FAERS: 1 | US FAERS | |
| 561 | Tooth Loss | FAERS: 1 | OFFSIDES US FAERS | |
| 562 | Toothache | FAERS: 1 | US FAERS | |
| 563 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 564 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 565 | Troponin I increased | FAERS: 1 | US FAERS | |
| 566 | Troponin T increased | FAERS: 1 | US FAERS | |
| 567 | Unable to afford prescribed medication | FAERS: 1 | US FAERS | |
| 568 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 569 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 570 | Urine sodium decreased | FAERS: 1 | US FAERS | |
| 571 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 572 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 573 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 574 | Walking aid user | FAERS: 1 | US FAERS | |
| 575 | Waxy flexibility | FAERS: 1 | US FAERS | |
| 576 | Wheezing | FAERS: 1 | US FAERS | |
| 577 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 578 | Abdominal Compartment Syndrome | OFFSIDES | ||
| 579 | Abnormal ejaculation | SIDER | ||
| 580 | Abnormal vision | OFFSIDES SIDER | ||
| 581 | Acute otitis media | OFFSIDES | ||
| 582 | Acute respiratory failure | OFFSIDES | ||
| 583 | Adenitis | OFFSIDES | ||
| 584 | Agraphia | OFFSIDES | ||
| 585 | Albuminuria | SIDER | ||
| 586 | Altered bowel function | OFFSIDES | ||
| 587 | Alveolitis | OFFSIDES | ||
| 588 | Alveoloplasty | OFFSIDES | ||
| 589 | Amphetamines | OFFSIDES | ||
| 590 | Anaphylactic shock | SIDER | ||
| 591 | Angiofibroma | OFFSIDES | ||
| 592 | Angle Closure Glaucoma | SIDER | ||
| 593 | Anhidrosis | OFFSIDES | ||
| 594 | Anorexia | OFFSIDES SIDER | ||
| 595 | Anoxic Encephalopathy | OFFSIDES | ||
| 596 | Aortic Aneurysm | SIDER | ||
| 597 | Aphthous Stomatitis | OFFSIDES | ||
| 598 | Appendicitis | SIDER | ||
| 599 | Arteritis | SIDER | ||
| 600 | Arthritis | OFFSIDES SIDER | ||
| 601 | Asbestosis | OFFSIDES | ||
| 602 | Aspartate aminotransferase abnormal | OFFSIDES | ||
| 603 | Asthma | SIDER | ||
| 604 | Autoimmune hepatitis | OFFSIDES | ||
| 605 | Autoimmune inner ear disease | OFFSIDES | ||
| 606 | Automatism | OFFSIDES | ||
| 607 | Balanitis | SIDER | ||
| 608 | Basophilia | SIDER | ||
| 609 | Bereavement | OFFSIDES | ||
| 610 | Bile Duct Stenosis | OFFSIDES | ||
| 611 | Biliary Colic | SIDER | ||
| 612 | Bladder Neoplasm | OFFSIDES | ||
| 613 | Bladder pain | SIDER | ||
| 614 | Blepharitis | SIDER | ||
| 615 | Blood Glucose | OFFSIDES | ||
| 616 | Blood cholesterol abnormal | OFFSIDES | ||
| 617 | Blood cholesterol | OFFSIDES | ||
| 618 | Blood glucose decreased | OFFSIDES | ||
| 619 | Blood glucose fluctuation | OFFSIDES | ||
| 620 | Blood triglycerides | OFFSIDES | ||
| 621 | Blood urea increased | SIDER | ||
| 622 | Body odor | SIDER | ||
| 623 | Bone lesion | OFFSIDES | ||
| 624 | Brain Death | OFFSIDES | ||
| 625 | Breast Cyst | OFFSIDES | ||
| 626 | Breast engorgement | SIDER | ||
| 627 | Breathing-related sleep disorder | OFFSIDES | ||
| 628 | Bronchitis | OFFSIDES SIDER | ||
| 629 | Buccoglossal syndrome | SIDER | ||
| 630 | Bullous lung disease | OFFSIDES | ||
| 631 | Bursitis | OFFSIDES SIDER | ||
| 632 | Candidiasis of vagina | OFFSIDES | ||
| 633 | Capillary Fragility | SIDER | ||
| 634 | Carcinoma | SIDER | ||
| 635 | Cell Death | OFFSIDES | ||
| 636 | Cellulitis | OFFSIDES SIDER | ||
| 637 | Central venous catheter removal | OFFSIDES | ||
| 638 | Cerebral cyst | OFFSIDES | ||
| 639 | Cervicobrachial syndrome | OFFSIDES | ||
| 640 | Cheilitis | SIDER | ||
| 641 | Choking sensation | OFFSIDES | ||
| 642 | Cholecystitis | SIDER | ||
| 643 | Chromatopsia | SIDER | ||
| 644 | Circumoral paresthesia | SIDER | ||
| 645 | Cold feet | SIDER | ||
| 646 | Cold hands | SIDER | ||
| 647 | Colitis | OFFSIDES SIDER | ||
| 648 | Colon adenoma | OFFSIDES | ||
| 649 | Compulsive shopping | OFFSIDES | ||
| 650 | Confabulation | OFFSIDES | ||
| 651 | Conjunctivitis | SIDER | ||
| 652 | Corneal lesion | SIDER | ||
| 653 | Coronary Artery Disease | SIDER | ||
| 654 | Cramps of lower extremities | SIDER | ||
| 655 | Creatine Phosphokinase Increased | SIDER | ||
| 656 | Creatinine increased | SIDER | ||
| 657 | Crystalluria calcium | SIDER | ||
| 658 | Culture positive | OFFSIDES | ||
| 659 | Cutaneous Candidiasis | OFFSIDES | ||
| 660 | Cystocele | OFFSIDES | ||
| 661 | Cyst | OFFSIDES SIDER | ||
| 662 | Debridement | OFFSIDES | ||
| 663 | Delayed Orgasm | SIDER | ||
| 664 | Demyelination | OFFSIDES | ||
| 665 | Dental Plaque | OFFSIDES | ||
| 666 | Dental caries | OFFSIDES | ||
| 667 | Denture wearer | OFFSIDES | ||
| 668 | Depressive disorder | SIDER | ||
| 669 | Dermatitis | SIDER | ||
| 670 | Dermoid Cyst | OFFSIDES | ||
| 671 | Device related infection | OFFSIDES | ||
| 672 | Diabetes | OFFSIDES | ||
| 673 | Diabetes Mellitus | SIDER | ||
| 674 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 675 | Diabetic Foot | OFFSIDES | ||
| 676 | Diabetic Nephropathy | OFFSIDES | ||
| 677 | Diastolic hypertension | Canada Vigilance: 1 | Canada Vigilance | |
| 678 | Difficulty focusing eyes | SIDER | ||
| 679 | Diverticulum | OFFSIDES | ||
| 680 | Dreaming excessive | SIDER | ||
| 681 | Drowsiness | OFFSIDES | ||
| 682 | Drug Tolerance | SIDER | ||
| 683 | Drug addict | OFFSIDES | ||
| 684 | Drug administered at inappropriate site | OFFSIDES | ||
| 685 | Drug seeking behavior | SIDER | ||
| 686 | Drug specific antibody present | OFFSIDES | ||
| 687 | Drug toxicity | OFFSIDES | ||
| 688 | Drug withdrawal headache | OFFSIDES | ||
| 689 | Dry skin | OFFSIDES SIDER | ||
| 690 | Duodenitis | SIDER | ||
| 691 | Dyspareunia | OFFSIDES | ||
| 692 | Dysthymic Disorder | OFFSIDES SIDER | ||
| 693 | Electromechanical dissociation | OFFSIDES | ||
| 694 | Encephalomalacia | OFFSIDES | ||
| 695 | Endometriosis | SIDER | ||
| 696 | Epidermal necrosis | SIDER | ||
| 697 | Erection increased | SIDER | ||
| 698 | Erection prolonged | SIDER | ||
| 699 | Erythema Multiforme | SIDER | ||
| 700 | Erythema Nodosum | SIDER | ||
| 701 | Eustachian tube disorder | OFFSIDES | ||
| 702 | Exophthalmos | SIDER | ||
| 703 | Extremity necrosis | OFFSIDES | ||
| 704 | Facial Neuralgia | OFFSIDES | ||
| 705 | Facial paralysis | SIDER | ||
| 706 | Fatty Liver | OFFSIDES | ||
| 707 | Fibromyalgia | OFFSIDES | ||
| 708 | Fistula repair | OFFSIDES | ||
| 709 | Flat affect | SIDER | ||
| 710 | Foaming at mouth | Canada Vigilance: 1 | Canada Vigilance | |
| 711 | Foreign body trauma | OFFSIDES | ||
| 712 | Fracture | SIDER | ||
| 713 | Furunculosis | SIDER | ||
| 714 | Gambling | OFFSIDES | ||
| 715 | Gastric pH decreased | SIDER | ||
| 716 | Gastric ulcer | OFFSIDES | ||
| 717 | Genital pain | OFFSIDES | ||
| 718 | Gingivitis | SIDER | ||
| 719 | Glycosuria | SIDER | ||
| 720 | Granuloma | OFFSIDES SIDER | ||
| 721 | Hair discoloration | SIDER | ||
| 722 | Hay fever | OFFSIDES | ||
| 723 | Heart alternation | OFFSIDES | ||
| 724 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 725 | Hepatitis | SIDER | ||
| 726 | Hirsutism | SIDER | ||
| 727 | Histamine level increased | Canada Vigilance: 1 | Canada Vigilance | |
| 728 | Hydronephrosis | OFFSIDES | ||
| 729 | Hypercalciuria | SIDER | ||
| 730 | Hyperkeratosis | OFFSIDES | ||
| 731 | Hyperkinesia | SIDER | ||
| 732 | Hyperthyroidism | SIDER | ||
| 733 | Hypohidrosis | SIDER | ||
| 734 | Hypothyroidism | SIDER | ||
| 735 | Hysteria | SIDER | ||
| 736 | Ileitis | SIDER | ||
| 737 | Increased bronchial secretion | SIDER | ||
| 738 | Influenza-like symptoms | SIDER | ||
| 739 | Infusion Site Extravasation | OFFSIDES | ||
| 740 | Infusion site mobility decreased | OFFSIDES | ||
| 741 | Injection site pruritus | OFFSIDES | ||
| 742 | Intentional injury | SIDER | ||
| 743 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 744 | Intraocular inflammation | OFFSIDES | ||
| 745 | Joint Instability | OFFSIDES | ||
| 746 | Joint Range of Motion Decreased | OFFSIDES | ||
| 747 | Joint stiffness | OFFSIDES | ||
| 748 | Jugular vein distension | OFFSIDES | ||
| 749 | Keratitis sicca | OFFSIDES | ||
| 750 | Keratitis | SIDER | ||
| 751 | Keratomileusis | OFFSIDES | ||
| 752 | Labyrinthitis | SIDER | ||
| 753 | Lactic dehydrogenase activity increased | SIDER | ||
| 754 | Laryngitis | SIDER | ||
| 755 | Laryngospasm | SIDER | ||
| 756 | Leukoderma | SIDER | ||
| 757 | Leukorrhea | SIDER | ||
| 758 | Live Birth | OFFSIDES | ||
| 759 | Low density lipoprotein increased | SIDER | ||
| 760 | Lumbar radiculopathy | OFFSIDES | ||
| 761 | Lymphocytosis | SIDER | ||
| 762 | Lymphoma | OFFSIDES | ||
| 763 | Manic psychosis | SIDER | ||
| 764 | Mastitis | SIDER | ||
| 765 | Mechanical urticaria | OFFSIDES | ||
| 766 | Meningioma | OFFSIDES | ||
| 767 | Menopause | SIDER | ||
| 768 | Metastatic Renal Cell Carcinoma | OFFSIDES | ||
| 769 | Metatarsalgia | OFFSIDES | ||
| 770 | Migraine with Aura | OFFSIDES | ||
| 771 | Miliaria | SIDER | ||
| 772 | Motor retardation | OFFSIDES | ||
| 773 | Multiple drug overdose intentional | OFFSIDES | ||
| 774 | Muscle Weakness | OFFSIDES | ||
| 775 | Muscle relaxant therapy | SIDER | ||
| 776 | Musculoskeletal discomfort | SIDER | ||
| 777 | Myopathy | SIDER | ||
| 778 | Narcotic intoxication | OFFSIDES | ||
| 779 | Neck stiffness | SIDER | ||
| 780 | Necrosis | SIDER | ||
| 781 | Neonatal respiratory arrest | OFFSIDES | ||
| 782 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 783 | Nephrolithiasis | SIDER | ||
| 784 | Neuritis | SIDER | ||
| 785 | Neuropathy | SIDER | ||
| 786 | No adverse event | Canada Vigilance: 1 | Canada Vigilance | |
| 787 | Nocturia | SIDER | ||
| 788 | Non-cardiac chest pain | OFFSIDES | ||
| 789 | Onychoclasis | SIDER | ||
| 790 | Optic Neuritis | SIDER | ||
| 791 | Oral Cavity Fistula | OFFSIDES | ||
| 792 | Oral candidiasis | SIDER | ||
| 793 | Orchitis noninfective | SIDER | ||
| 794 | Orchitis | SIDER | ||
| 795 | Osteoporosis | OFFSIDES SIDER | ||
| 796 | Osteosclerosis | SIDER | ||
| 797 | Otitis Externa | SIDER | ||
| 798 | Otitis Media | SIDER | ||
| 799 | PRL increased | SIDER | ||
| 800 | Pancreatic Duct Stenosis | OFFSIDES | ||
| 801 | Paranoid reaction | SIDER | ||
| 802 | Paresis | SIDER | ||
| 803 | Parotitis | SIDER | ||
| 804 | Pelvic Pain | SIDER | ||
| 805 | Periodontitis | SIDER | ||
| 806 | Periostitis | OFFSIDES | ||
| 807 | Petechiae | SIDER | ||
| 808 | Pharyngitis | SIDER | ||
| 809 | Physical disability | OFFSIDES | ||
| 810 | Plasmacytoma | SIDER | ||
| 811 | Pleurisy | SIDER | ||
| 812 | Prolapse repair | OFFSIDES | ||
| 813 | Protein total increased | OFFSIDES | ||
| 814 | Protein urine present | SIDER | ||
| 815 | Proteinuria | SIDER | ||
| 816 | Prurigo | SIDER | ||
| 817 | Psychiatric symptom | OFFSIDES | ||
| 818 | Pulmonary Eosinophilia | SIDER | ||
| 819 | Pulmonary Valve Stenosis | OFFSIDES | ||
| 820 | Pulmonary radiation injury | OFFSIDES | ||
| 821 | Pyuria | SIDER | ||
| 822 | Rectal fissure | OFFSIDES | ||
| 823 | Rectocele | OFFSIDES | ||
| 824 | Regurgitation | OFFSIDES | ||
| 825 | Residual urine | OFFSIDES | ||
| 826 | Respiratory tract congestion | SIDER | ||
| 827 | Retrosternal pain | SIDER | ||
| 828 | Rheumatoid Arthritis | SIDER | ||
| 829 | Rhinitis | SIDER | ||
| 830 | Salpingitis | SIDER | ||
| 831 | Salpingo-oophorectomy | OFFSIDES | ||
| 832 | Scleritis | SIDER | ||
| 833 | Scotoma | SIDER | ||
| 834 | Septic necrosis | OFFSIDES | ||
| 835 | Seroma | OFFSIDES | ||
| 836 | Serum Sickness | OFFSIDES | ||
| 837 | Shoulder Pain | OFFSIDES | ||
| 838 | Sinus Arrhythmia | SIDER | ||
| 839 | Sjogren's Syndrome | OFFSIDES | ||
| 840 | Skeletal injury | OFFSIDES | ||
| 841 | Skin Induration | OFFSIDES | ||
| 842 | Skin hypertrophy | OFFSIDES SIDER | ||
| 843 | Skin lesion | OFFSIDES | ||
| 844 | Skin tightness | OFFSIDES | ||
| 845 | Somatoform Disorder | OFFSIDES | ||
| 846 | Sphincter of Oddi Dysfunction | OFFSIDES | ||
| 847 | Splenic Infarction | OFFSIDES | ||
| 848 | Stevens-Johnson Syndrome | SIDER | ||
| 849 | Subconjunctival hemorrhage | SIDER | ||
| 850 | Subcutaneous nodule | OFFSIDES | ||
| 851 | Submandibular mass | OFFSIDES | ||
| 852 | Suicide | SIDER | ||
| 853 | Supraventricular tachycardia | SIDER | ||
| 854 | Sweating | SIDER | ||
| 855 | Tardive Dyskinesia | OFFSIDES SIDER | ||
| 856 | Tendinitis | OFFSIDES | ||
| 857 | Tenosynovitis | SIDER | ||
| 858 | Thirst | SIDER | ||
| 859 | Thrombocytosis | SIDER | ||
| 860 | Thrombophlebitis | SIDER | ||
| 861 | Thyroid Neoplasm | SIDER | ||
| 862 | Thyroid Nodule | SIDER | ||
| 863 | Thyroiditis | SIDER | ||
| 864 | Tolerance development | SIDER | ||
| 865 | Tooth Extraction | OFFSIDES | ||
| 866 | Tooth Infection | OFFSIDES | ||
| 867 | Tooth repair | OFFSIDES | ||
| 868 | Torticollis | SIDER | ||
| 869 | Toxic Epidermal Necrolysis | SIDER | ||
| 870 | Toxicologic test abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 871 | Tracheitis | OFFSIDES | ||
| 872 | Transaminases abnormal | OFFSIDES | ||
| 873 | Trauma | SIDER | ||
| 874 | Troponin increased | OFFSIDES | ||
| 875 | Uremia | SIDER | ||
| 876 | Urine output increased | SIDER | ||
| 877 | Urolithiasis | SIDER | ||
| 878 | Uterine Prolapse | OFFSIDES | ||
| 879 | Uterine spasm | SIDER | ||
| 880 | Uveitis | SIDER | ||
| 881 | VIIth nerve paralysis | SIDER | ||
| 882 | Vaginal Discharge | SIDER | ||
| 883 | Vaginal dryness | SIDER | ||
| 884 | Vascular calcification | OFFSIDES | ||
| 885 | Vascular purpura | SIDER | ||
| 886 | Vasodilation procedure | SIDER | ||
| 887 | Vasodilation | SIDER | ||
| 888 | Venous Insufficiency | SIDER | ||
| 889 | Venous occlusion | OFFSIDES | ||
| 890 | Ventricular bigeminy | SIDER | ||
| 891 | Vesiculobullous rash | SIDER | ||
| 892 | Visual disturbance | OFFSIDES SIDER | ||
| 893 | Weight Gain | OFFSIDES | ||
| 894 | Wheelchair user | OFFSIDES | ||
| 895 | Wound Infection | OFFSIDES | ||
| 896 | Wound dehiscence | OFFSIDES | ||
| 897 | Wound infection staphylococcal | OFFSIDES | ||
| 898 | furuncle | SIDER | ||
| 899 | prostatitis | SIDER | ||
| 900 | rhinoplasty | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.