Sulfamethoxazole
(JLKIGFTWXXRPMT-UHFFFAOYSA-N)
Structure
- SMILES
- Nc1ccc(cc1)S(=O)(=O)Nc1noc(c1)C
- Type(s)
- Approved
- ATC code(s)
- G01AE10; J01EC01; J01EE01; J04AM08
- Molecular Formula:
- C10H11N3O3S
- Molecular Weight:
- 253.278
- Log P:
- 3.1010
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 106.6
- CAS Number(s):
- 723-46-6; 129378-89-8
Synonym(s)
1.
Sulfamethoxazole
2.
Sulfamethylisoxazole
3.
Gantanol
4.
Sulfisomezole
5.
Sulphamethoxazole
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Stevens-Johnson Syndrome | FAERS: 86 Canada Vigilance: 5 | 25811541 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Nausea | FAERS: 50 Canada Vigilance: 6 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 3 | Vomiting | FAERS: 39 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 4 | Pruritus | FAERS: 38 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 5 | Headache | FAERS: 36 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 6 | Fatigue | FAERS: 33 | OFFSIDES SIDER US FAERS | |
| 7 | Urticaria | FAERS: 32 Canada Vigilance: 14 | Canada Vigilance SIDER US FAERS | |
| 8 | Hypersensitivity | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Pain | FAERS: 25 | OFFSIDES US FAERS | |
| 10 | Drug ineffective | FAERS: 23 | US FAERS | |
| 11 | Toxic Epidermal Necrolysis | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 12 | Arthralgia | FAERS: 20 | SIDER US FAERS | |
| 13 | Chills | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 14 | Myalgia | FAERS: 18 | SIDER US FAERS | |
| 15 | Asthenia | FAERS: 16 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 16 | Erythema | FAERS: 16 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 17 | Dizziness | FAERS: 15 | OFFSIDES US FAERS | |
| 18 | Rash erythematous | FAERS: 15 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 19 | jaundice | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Abdominal Pain | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 21 | Alanine Aminotransferase Increased | FAERS: 14 | OFFSIDES US FAERS | |
| 22 | Aspartate Aminotransferase Increased | FAERS: 13 | US FAERS | |
| 23 | Malaise | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 24 | Swelling | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Tremor | FAERS: 13 | US FAERS | |
| 26 | Acute kidney injury | FAERS: 11 | US FAERS | |
| 27 | Burning sensation | FAERS: 11 | US FAERS | |
| 28 | Thrombocytopenia | FAERS: 11 | SIDER US FAERS | |
| 29 | Mental status changes | FAERS: 10 | OFFSIDES US FAERS | |
| 30 | Oropharyngeal pain | FAERS: 10 | OFFSIDES US FAERS | |
| 31 | Chest Pain | FAERS: 9 | OFFSIDES US FAERS | |
| 32 | Hypotension | FAERS: 9 | US FAERS | |
| 33 | Lip swelling | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 34 | White blood cell count decreased | FAERS: 9 | US FAERS | |
| 35 | Abdominal discomfort | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 36 | Anxiety | FAERS: 8 | OFFSIDES US FAERS | |
| 37 | Blood alkaline phosphatase increased | FAERS: 8 | OFFSIDES US FAERS | |
| 38 | Weight decreased | FAERS: 8 | US FAERS | |
| 39 | Dehydration | FAERS: 7 | OFFSIDES US FAERS | |
| 40 | Musculoskeletal stiffness | FAERS: 7 | US FAERS | |
| 41 | Stomatitis | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 42 | Alopecia | FAERS: 6 | OFFSIDES US FAERS | |
| 43 | Anorexia | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 44 | Back Pain | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Chromaturia | FAERS: 6 | US FAERS | |
| 46 | Anaphylactic shock | FAERS: 5 | SIDER US FAERS | |
| 47 | Angioedema | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 48 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 49 | Cytopenia | FAERS: 5 | US FAERS | |
| 50 | Dyspepsia | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 51 | Hypophagia | FAERS: 5 | US FAERS | |
| 52 | Lethargy | FAERS: 5 | OFFSIDES US FAERS | |
| 53 | Medication Error | FAERS: 5 | US FAERS | |
| 54 | Pancytopenia | FAERS: 5 | US FAERS | |
| 55 | Syncope | FAERS: 5 | US FAERS | |
| 56 | Abasia | FAERS: 4 | US FAERS | |
| 57 | Agitation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Asthma | FAERS: 4 | OFFSIDES US FAERS | |
| 59 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 60 | Dysuria | FAERS: 4 | OFFSIDES US FAERS | |
| 61 | Eye pain | FAERS: 4 | OFFSIDES US FAERS | |
| 62 | Feeling abnormal | FAERS: 4 | OFFSIDES US FAERS | |
| 63 | Flushing | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 64 | Hepatitis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 65 | Impaired work ability | FAERS: 4 | US FAERS | |
| 66 | Joint swelling | FAERS: 4 | US FAERS | |
| 67 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 68 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 69 | Palpitations | FAERS: 4 | US FAERS | |
| 70 | Pneumonia | FAERS: 4 | US FAERS | |
| 71 | Respiratory Failure | FAERS: 4 | OFFSIDES US FAERS | |
| 72 | Tachycardia | FAERS: 4 | US FAERS | |
| 73 | Urinary tract infection | FAERS: 4 | US FAERS | |
| 74 | Visual Impairment | FAERS: 4 | US FAERS | |
| 75 | Ageusia | FAERS: 3 | US FAERS | |
| 76 | Amnesia | FAERS: 3 | OFFSIDES US FAERS | |
| 77 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 78 | Cholestasis | FAERS: 3 | 7261840 | CTD US FAERS |
| 79 | Clostridium difficile colitis | FAERS: 3 | OFFSIDES US FAERS | |
| 80 | Delirium | FAERS: 3 | US FAERS | |
| 81 | Diabetic Ketoacidosis | FAERS: 3 | US FAERS | |
| 82 | Discomfort | FAERS: 3 | US FAERS | |
| 83 | Disorientation | FAERS: 3 | US FAERS | |
| 84 | Dry skin | FAERS: 3 | US FAERS | |
| 85 | Dysgeusia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 86 | Epistaxis | FAERS: 3 | US FAERS | |
| 87 | Erythema Multiforme | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 88 | Facial paralysis | FAERS: 3 | US FAERS | |
| 89 | Glossitis | FAERS: 3 | SIDER US FAERS | |
| 90 | Hepatotoxicity | FAERS: 3 | OFFSIDES US FAERS | |
| 91 | Influenza | FAERS: 3 | US FAERS | |
| 92 | Leukocytosis | FAERS: 3 | US FAERS | |
| 93 | Neck Pain | FAERS: 3 | US FAERS | |
| 94 | Pain of skin | FAERS: 3 | US FAERS | |
| 95 | Shock | FAERS: 3 | US FAERS | |
| 96 | Splenomegaly | FAERS: 3 | US FAERS | |
| 97 | Transaminases increased | FAERS: 3 | US FAERS | |
| 98 | Wheezing | FAERS: 3 | US FAERS | |
| 99 | Activities of daily living impaired | FAERS: 2 | OFFSIDES US FAERS | |
| 100 | Aphasia | FAERS: 2 | US FAERS | |
| 101 | Bedridden | FAERS: 2 | OFFSIDES US FAERS | |
| 102 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 103 | Blood urine present | FAERS: 2 | US FAERS | |
| 104 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 105 | Cataract | FAERS: 2 | OFFSIDES US FAERS | |
| 106 | Chest discomfort | FAERS: 2 | US FAERS | |
| 107 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 108 | Conjunctivitis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 109 | Crying | FAERS: 2 | US FAERS | |
| 110 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 111 | Diplopia | FAERS: 2 | US FAERS | |
| 112 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 113 | Drug-disease interaction | FAERS: 2 | US FAERS | |
| 114 | Dysphonia | FAERS: 2 | OFFSIDES US FAERS | |
| 115 | Feeling Cold | FAERS: 2 | US FAERS | |
| 116 | Fluid overload | FAERS: 2 | OFFSIDES US FAERS | |
| 117 | Granulomatosis with polyangiitis | FAERS: 2 | US FAERS | |
| 118 | Histiocytosis haematophagic | FAERS: 2 | US FAERS | |
| 119 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 120 | Infection | FAERS: 2 | OFFSIDES US FAERS | |
| 121 | Inflammation | FAERS: 2 | US FAERS | |
| 122 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 123 | Lupus-like syndrome | FAERS: 2 | US FAERS | |
| 124 | Mood swings | FAERS: 2 | US FAERS | |
| 125 | Nerve injury | FAERS: 2 | US FAERS | |
| 126 | Neutropenia | FAERS: 2 | SIDER US FAERS | |
| 127 | Ocular icterus | FAERS: 2 | US FAERS | |
| 128 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 129 | Pancreatitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 130 | Penile exfoliation | FAERS: 2 | US FAERS | |
| 131 | Penile swelling | FAERS: 2 | US FAERS | |
| 132 | Petechiae | FAERS: 2 | US FAERS | |
| 133 | Product substitution issue | FAERS: 2 | US FAERS | |
| 134 | Protein total increased | FAERS: 2 | OFFSIDES US FAERS | |
| 135 | Renal pain | FAERS: 2 | US FAERS | |
| 136 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 137 | Respiratory distress | FAERS: 2 | US FAERS | |
| 138 | Restlessness | FAERS: 2 | US FAERS | |
| 139 | Scab | FAERS: 2 | US FAERS | |
| 140 | Septic Shock | FAERS: 2 | US FAERS | |
| 141 | Skin lesion | FAERS: 2 | US FAERS | |
| 142 | Thrombosis | FAERS: 2 | US FAERS | |
| 143 | Toxic Shock Syndrome | FAERS: 2 | US FAERS | |
| 144 | Vasculitis | FAERS: 2 | US FAERS | |
| 145 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 146 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 147 | Adverse event | FAERS: 1 | US FAERS | |
| 148 | Agranulocytosis | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 149 | Anger | FAERS: 1 | US FAERS | |
| 150 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 151 | Antibody test positive | FAERS: 1 | US FAERS | |
| 152 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 153 | Aphonia | FAERS: 1 | US FAERS | |
| 154 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 155 | Apparent death | FAERS: 1 | US FAERS | |
| 156 | Arthritis | FAERS: 1 | OFFSIDES US FAERS | |
| 157 | Arthropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 158 | Ascites | FAERS: 1 | OFFSIDES US FAERS | |
| 159 | Astigmatism | FAERS: 1 | OFFSIDES US FAERS | |
| 160 | Ataxia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 161 | Atrial Fibrillation | FAERS: 1 | US FAERS | |
| 162 | Auricular swelling | FAERS: 1 | US FAERS | |
| 163 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 164 | Autoinflammatory disease | FAERS: 1 | US FAERS | |
| 165 | Bacteria stool identified | FAERS: 1 | US FAERS | |
| 166 | Band neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 167 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 168 | Biliary tract infection | FAERS: 1 | US FAERS | |
| 169 | Biopsy kidney abnormal | FAERS: 1 | US FAERS | |
| 170 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 171 | Blood alkaline phosphatase | FAERS: 1 | US FAERS | |
| 172 | Blood blister | FAERS: 1 | US FAERS | |
| 173 | Blood creatine phosphokinase increased | FAERS: 1 | OFFSIDES US FAERS | |
| 174 | Blood creatinine increased | FAERS: 1 | OFFSIDES US FAERS | |
| 175 | Blood folate decreased | FAERS: 1 | US FAERS | |
| 176 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 177 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 178 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 179 | Blood potassium decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 180 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 181 | Bone pain | FAERS: 1 | OFFSIDES US FAERS | |
| 182 | Bradycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 183 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 184 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 185 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 186 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 187 | Chemical injury | FAERS: 1 | US FAERS | |
| 188 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 189 | Cholangitis | FAERS: 1 | US FAERS | |
| 190 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 191 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 192 | Constipation | FAERS: 1 | US FAERS | |
| 193 | Corneal lesion | FAERS: 1 | US FAERS | |
| 194 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 195 | Deformity | FAERS: 1 | US FAERS | |
| 196 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 197 | Depressed mood | FAERS: 1 | OFFSIDES US FAERS | |
| 198 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 199 | Disease recurrence | FAERS: 1 | US FAERS | |
| 200 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 201 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 202 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 203 | Drug dose omission | FAERS: 1 | US FAERS | |
| 204 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 205 | Dysarthria | FAERS: 1 | US FAERS | |
| 206 | Dysgraphia | FAERS: 1 | US FAERS | |
| 207 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 208 | Encephalitis | FAERS: 1 | US FAERS | |
| 209 | Eosinophil percentage increased | FAERS: 1 | US FAERS | |
| 210 | Eosinophilia | FAERS: 1 | SIDER US FAERS | |
| 211 | Eosinophilic myocarditis | FAERS: 1 | SIDER US FAERS | |
| 212 | Erythema Infectiosum | FAERS: 1 | US FAERS | |
| 213 | Euphoric mood | FAERS: 1 | OFFSIDES US FAERS | |
| 214 | Exfoliative rash | FAERS: 1 | OFFSIDES US FAERS | |
| 215 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 216 | Eye Redness | FAERS: 1 | US FAERS | |
| 217 | Eye inflammation | FAERS: 1 | US FAERS | |
| 218 | Eye irritation | FAERS: 1 | US FAERS | |
| 219 | Febrile Neutropenia | FAERS: 1 | OFFSIDES US FAERS | |
| 220 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 221 | Flatulence | FAERS: 1 | US FAERS | |
| 222 | Food Allergy | FAERS: 1 | US FAERS | |
| 223 | Formication | FAERS: 1 | OFFSIDES US FAERS | |
| 224 | Gastritis | FAERS: 1 | US FAERS | |
| 225 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 226 | Genital erythema | FAERS: 1 | US FAERS | |
| 227 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 228 | Hepatic Infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 229 | Hepatitis B antibody positive | FAERS: 1 | US FAERS | |
| 230 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 231 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 232 | Hypersomnia | FAERS: 1 | US FAERS | |
| 233 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 234 | Hypoxia | FAERS: 1 | OFFSIDES US FAERS | |
| 235 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 236 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 237 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 238 | Initial insomnia | FAERS: 1 | US FAERS | |
| 239 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 240 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 241 | Joint stiffness | FAERS: 1 | OFFSIDES US FAERS | |
| 242 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 243 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 244 | Mastication disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 245 | Memory impairment | FAERS: 1 | US FAERS | |
| 246 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 247 | Muscle tightness | FAERS: 1 | OFFSIDES US FAERS | |
| 248 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 249 | Myeloid maturation arrest | FAERS: 1 | US FAERS | |
| 250 | Myocardial necrosis marker increased | FAERS: 1 | US FAERS | |
| 251 | Myopathy | FAERS: 1 | US FAERS | |
| 252 | Myositis | FAERS: 1 | US FAERS | |
| 253 | Nasal sinus drainage | FAERS: 1 | US FAERS | |
| 254 | Nasopharyngitis | FAERS: 1 | OFFSIDES US FAERS | |
| 255 | Nervousness | FAERS: 1 | SIDER US FAERS | |
| 256 | Neuralgia | FAERS: 1 | US FAERS | |
| 257 | Neuritis | FAERS: 1 | SIDER US FAERS | |
| 258 | Neurosyphilis | FAERS: 1 | US FAERS | |
| 259 | Neutrophil count decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 260 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 261 | Onychoclasis | FAERS: 1 | US FAERS | |
| 262 | Onycholysis | FAERS: 1 | US FAERS | |
| 263 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 264 | Oral pain | FAERS: 1 | US FAERS | |
| 265 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 266 | Osteomyelitis | FAERS: 1 | OFFSIDES US FAERS | |
| 267 | Pallor | FAERS: 1 | US FAERS | |
| 268 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 269 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 270 | Pathogen resistance | FAERS: 1 | OFFSIDES US FAERS | |
| 271 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 272 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 273 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 274 | Pharyngolaryngeal Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 275 | Platelet aggregation decreased | FAERS: 1 | US FAERS | |
| 276 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 277 | Pneumonitis | FAERS: 1 | US FAERS | |
| 278 | Polymyositis | FAERS: 1 | US FAERS | |
| 279 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 280 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 281 | Presyncope | FAERS: 1 | US FAERS | |
| 282 | Product formulation issue | FAERS: 1 | US FAERS | |
| 283 | Product use issue | FAERS: 1 | US FAERS | |
| 284 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 285 | Pulmonary Eosinophilia | FAERS: 1 | US FAERS | |
| 286 | Pyelitis | FAERS: 1 | US FAERS | |
| 287 | Quality of life decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 288 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 289 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 290 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 291 | Retching | FAERS: 1 | US FAERS | |
| 292 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 293 | Rocky Mountain Spotted Fever | FAERS: 1 | US FAERS | |
| 294 | Sciatica | FAERS: 1 | US FAERS | |
| 295 | Screaming | FAERS: 1 | US FAERS | |
| 296 | Scrotal erythema | FAERS: 1 | US FAERS | |
| 297 | Secretion discharge | FAERS: 1 | US FAERS | |
| 298 | Sepsis | FAERS: 1 | US FAERS | |
| 299 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 300 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 301 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 302 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 303 | Skin irritation | FAERS: 1 | US FAERS | |
| 304 | Somnolence | FAERS: 1 | US FAERS | |
| 305 | Splenic Infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 306 | Staphylococcal pharyngitis | FAERS: 1 | US FAERS | |
| 307 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 308 | Stress | FAERS: 1 | US FAERS | |
| 309 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 310 | Sunburn | FAERS: 1 | US FAERS | |
| 311 | Tension | FAERS: 1 | SIDER US FAERS | |
| 312 | Thermal burn | FAERS: 1 | US FAERS | |
| 313 | Thirst | FAERS: 1 | US FAERS | |
| 314 | Throat irritation | FAERS: 1 | US FAERS | |
| 315 | Thrombocytopenic purpura | FAERS: 1 | SIDER US FAERS | |
| 316 | Tongue blistering | FAERS: 1 | US FAERS | |
| 317 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 318 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 319 | Ultrasound abdomen abnormal | FAERS: 1 | US FAERS | |
| 320 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 321 | Urinary tract inflammation | FAERS: 1 | US FAERS | |
| 322 | Uveitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 323 | Vaginal pain | FAERS: 1 | US FAERS | |
| 324 | Vanishing bile duct syndrome | FAERS: 1 | US FAERS | |
| 325 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 326 | Visual acuity tests abnormal | FAERS: 1 | US FAERS | |
| 327 | Vitamin K Deficiency | FAERS: 1 | US FAERS | |
| 328 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 329 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 330 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 331 | Wound Infection | FAERS: 1 | US FAERS | |
| 332 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 333 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 334 | nervous system disorder | FAERS: 1 | US FAERS | |
| 335 | treatment failure | FAERS: 1 | US FAERS | |
| 336 | Abscess | OFFSIDES | ||
| 337 | Acid reflux | OFFSIDES | ||
| 338 | Acidosis | OFFSIDES | ||
| 339 | Actinic keratosis | OFFSIDES | ||
| 340 | Actinomycosis | OFFSIDES | ||
| 341 | Acute Coronary Syndrome | OFFSIDES | ||
| 342 | Acute Generalized Exanthematous Pustulosis | 12861854 | CTD | |
| 343 | Acute prerenal failure | OFFSIDES | ||
| 344 | Acute respiratory failure | OFFSIDES | ||
| 345 | Acute sinusitis | OFFSIDES | ||
| 346 | Adenoma | OFFSIDES | ||
| 347 | Administration site infection | OFFSIDES | ||
| 348 | Adnexa uteri mass | OFFSIDES | ||
| 349 | Alcohol withdrawal syndrome | OFFSIDES | ||
| 350 | Allergy to animal | OFFSIDES | ||
| 351 | Amenorrhea | OFFSIDES | ||
| 352 | Amino acid level increased | OFFSIDES | ||
| 353 | Anhedonia | OFFSIDES | ||
| 354 | Anoxic Encephalopathy | OFFSIDES | ||
| 355 | Anticholinergic Syndrome | OFFSIDES | ||
| 356 | Anuria | SIDER | ||
| 357 | Aortic Aneurysm | OFFSIDES | ||
| 358 | Apathy | SIDER | ||
| 359 | Aphagia | OFFSIDES | ||
| 360 | Appendectomy | OFFSIDES | ||
| 361 | Appendicitis | OFFSIDES | ||
| 362 | Arteriosclerosis | OFFSIDES | ||
| 363 | Arteriovenous fistula aneurysm | OFFSIDES | ||
| 364 | Arthropod bite | OFFSIDES | ||
| 365 | Artificial crown procedure | OFFSIDES | ||
| 366 | Aspiration Pneumonia | OFFSIDES | ||
| 367 | Atelectasis | OFFSIDES | ||
| 368 | Atrial Flutter | OFFSIDES | ||
| 369 | Atrial tachycardia | OFFSIDES | ||
| 370 | Atrioventricular Block | OFFSIDES | ||
| 371 | Atrioventricular Septal Defect | OFFSIDES | ||
| 372 | Bacillus infection | OFFSIDES | ||
| 373 | Back disorder | OFFSIDES | ||
| 374 | Bacteriuria | 6349046 | CTD | |
| 375 | Basal cell carcinoma | OFFSIDES | ||
| 376 | Benign Prostatic Hyperplasia | OFFSIDES | ||
| 377 | Biliary Dyskinesia | OFFSIDES | ||
| 378 | Bladder Neoplasm | OFFSIDES | ||
| 379 | Bladder prolapse | OFFSIDES | ||
| 380 | Blepharitis | OFFSIDES | ||
| 381 | Blepharospasm | OFFSIDES | ||
| 382 | Blood Glucose | OFFSIDES | ||
| 383 | Blood amylase increased | OFFSIDES | ||
| 384 | Blood cholesterol | OFFSIDES | ||
| 385 | Blood immunoglobulin A decreased | OFFSIDES | ||
| 386 | Blood immunoglobulin A increased | OFFSIDES | ||
| 387 | Blood immunoglobulin G decreased | OFFSIDES | ||
| 388 | Blood magnesium decreased | OFFSIDES | ||
| 389 | Blood phosphorus decreased | OFFSIDES | ||
| 390 | Blood sodium | OFFSIDES | ||
| 391 | Blood triglycerides increased | OFFSIDES | ||
| 392 | Blood urea increased | OFFSIDES | ||
| 393 | Bone fragmentation | OFFSIDES | ||
| 394 | Bone swelling | OFFSIDES | ||
| 395 | Bronchiectasis | OFFSIDES | ||
| 396 | Bronchitis | OFFSIDES | ||
| 397 | Bruxism | OFFSIDES | ||
| 398 | Bulimia | OFFSIDES | ||
| 399 | Bursitis | OFFSIDES | ||
| 400 | Cardiac ventricular disorder | OFFSIDES | ||
| 401 | Cardioactive drug level above therapeutic | OFFSIDES | ||
| 402 | Cardioactive drug level increased | OFFSIDES | ||
| 403 | Cartilage atrophy | OFFSIDES | ||
| 404 | Cataract operation | OFFSIDES | ||
| 405 | Catheter placement | OFFSIDES | ||
| 406 | Cellulitis | OFFSIDES | ||
| 407 | Central line infection | OFFSIDES | ||
| 408 | Central venous catheter removal | OFFSIDES | ||
| 409 | Cerebral atrophy | OFFSIDES | ||
| 410 | Cervical myelopathy | OFFSIDES | ||
| 411 | Charles Bonnet Syndrome | OFFSIDES | ||
| 412 | Chemical and Drug Induced Liver Injury | 24014644 28437613 | CTD | |
| 413 | Chest wall pain | OFFSIDES | ||
| 414 | Cholecystitis | OFFSIDES | ||
| 415 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 416 | Chronic sinusitis | OFFSIDES | ||
| 417 | Cirrhosis | OFFSIDES | ||
| 418 | Coagulation factor V level decreased | OFFSIDES | ||
| 419 | Colectomy | OFFSIDES | ||
| 420 | Completed Suicide | OFFSIDES | ||
| 421 | Confabulation | OFFSIDES | ||
| 422 | Congenital pyelocaliectasis | OFFSIDES | ||
| 423 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 424 | Conjunctival deposit | OFFSIDES | ||
| 425 | Craniosynostosis | OFFSIDES | ||
| 426 | Crystalluria | SIDER | ||
| 427 | Cutis Laxa | OFFSIDES | ||
| 428 | Cyanosis | OFFSIDES | ||
| 429 | Cyst | OFFSIDES | ||
| 430 | Cytolytic hepatitis | OFFSIDES | ||
| 431 | Deafness Neurosensory | OFFSIDES | ||
| 432 | Deafness | OFFSIDES | ||
| 433 | Debridement | OFFSIDES | ||
| 434 | Demyelination | OFFSIDES | ||
| 435 | Dental Fistula | OFFSIDES | ||
| 436 | Dental abscess | OFFSIDES | ||
| 437 | Dental caries | OFFSIDES | ||
| 438 | Dermatitis | Canada Vigilance: 3 | Canada Vigilance SIDER | |
| 439 | Dermatomyositis | OFFSIDES | ||
| 440 | Dermoid Cyst | OFFSIDES | ||
| 441 | Diabetes | OFFSIDES | ||
| 442 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 443 | Diabetic Foot | OFFSIDES | ||
| 444 | Diabetic Retinopathy | OFFSIDES | ||
| 445 | Diarrhea | OFFSIDES | ||
| 446 | Disease complication | OFFSIDES | ||
| 447 | Diuresis | SIDER | ||
| 448 | Diverticulum | OFFSIDES | ||
| 449 | Drowsiness | OFFSIDES | ||
| 450 | Drug Eruptions | 12861854 29644860 | CTD | |
| 451 | Drug abuser | OFFSIDES | ||
| 452 | Drug exposure during pregnancy | OFFSIDES | ||
| 453 | Drug specific antibody absent | OFFSIDES | ||
| 454 | Drug toxicity | OFFSIDES | ||
| 455 | Drug withdrawal headache | OFFSIDES | ||
| 456 | Dyspareunia | OFFSIDES | ||
| 457 | Dyspnoea exacerbated | OFFSIDES | ||
| 458 | Dysthymic Disorder | OFFSIDES | ||
| 459 | Economic problem | OFFSIDES | ||
| 460 | Eczema | OFFSIDES | ||
| 461 | Ejection Fraction Decreased | OFFSIDES | ||
| 462 | Emotional disorder | OFFSIDES | ||
| 463 | Emotional distress | OFFSIDES | ||
| 464 | Endocarditis | OFFSIDES | ||
| 465 | Endodontic procedure | OFFSIDES | ||
| 466 | Epicondylitis | OFFSIDES | ||
| 467 | Erosive gastritis | OFFSIDES | ||
| 468 | Escherichia urinary tract infection | OFFSIDES | ||
| 469 | Exophthalmos | OFFSIDES | ||
| 470 | Exposure to toxic agent | OFFSIDES | ||
| 471 | Failure to Thrive | OFFSIDES | ||
| 472 | Fat necrosis | OFFSIDES | ||
| 473 | Fistula discharge | OFFSIDES | ||
| 474 | Fistula repair | OFFSIDES | ||
| 475 | Flank Pain | OFFSIDES | ||
| 476 | Flat affect | SIDER | ||
| 477 | Gammopathy | OFFSIDES | ||
| 478 | Gangrene | OFFSIDES | ||
| 479 | Gastric ulcer | OFFSIDES | ||
| 480 | Gastrointestinal obstruction | OFFSIDES | ||
| 481 | Gene Mutation | OFFSIDES | ||
| 482 | General physical health deterioration | OFFSIDES | ||
| 483 | Globulinuria | OFFSIDES | ||
| 484 | Goiter | OFFSIDES | ||
| 485 | Gout | OFFSIDES | ||
| 486 | Graft dysfunction | OFFSIDES | ||
| 487 | Graft infection | OFFSIDES | ||
| 488 | Gram stain positive | OFFSIDES | ||
| 489 | Granulocytosis | OFFSIDES | ||
| 490 | Granuloma | OFFSIDES | ||
| 491 | Grip strength | OFFSIDES | ||
| 492 | Heat Stroke | OFFSIDES | ||
| 493 | Hepatic necrosis | OFFSIDES SIDER | ||
| 494 | Hepatojugular reflux | OFFSIDES | ||
| 495 | Hernia | OFFSIDES | ||
| 496 | Hiccough | OFFSIDES | ||
| 497 | Histoplasmosis | OFFSIDES | ||
| 498 | Hostility | OFFSIDES | ||
| 499 | Hydronephrosis | OFFSIDES | ||
| 500 | Hyperkeratosis | OFFSIDES | ||
| 501 | Hyperventilation | OFFSIDES | ||
| 502 | Hypoaesthesia facial | OFFSIDES | ||
| 503 | Hypoplastic Left Heart Syndrome | OFFSIDES | ||
| 504 | Hypotonic urinary bladder | OFFSIDES | ||
| 505 | Impetigo | OFFSIDES | ||
| 506 | Incisional hernia | OFFSIDES | ||
| 507 | Induration | OFFSIDES | ||
| 508 | Infectious disease carrier | OFFSIDES | ||
| 509 | Intention tremor | OFFSIDES | ||
| 510 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 511 | Intestinal Obstruction | OFFSIDES | ||
| 512 | Intracranial Aneurysm | OFFSIDES | ||
| 513 | Intracranial Hypertension | 5419321 | CTD | |
| 514 | Iritis | Canada Vigilance: 1 | Canada Vigilance | |
| 515 | Joint sprain | OFFSIDES | ||
| 516 | Jugular vein distension | OFFSIDES | ||
| 517 | Keratitis sicca | OFFSIDES | ||
| 518 | Kidney Diseases | 6349046 | CTD | |
| 519 | Kidney Failure | OFFSIDES | ||
| 520 | Laryngocele | OFFSIDES | ||
| 521 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 522 | Left atrial dilatation | OFFSIDES | ||
| 523 | Leukoencephalopathy | OFFSIDES | ||
| 524 | Leukopenia neonatal | OFFSIDES | ||
| 525 | Leukopenia | SIDER | ||
| 526 | Life expectancy shortened | OFFSIDES | ||
| 527 | Limb injury | OFFSIDES | ||
| 528 | Lipase | OFFSIDES | ||
| 529 | Liver Abscess | OFFSIDES | ||
| 530 | Long QT Syndrome | 10984545 | CTD | |
| 531 | Loose tooth | OFFSIDES | ||
| 532 | Lymphedema | OFFSIDES | ||
| 533 | Lymphocyte count decreased | OFFSIDES | ||
| 534 | Lymphoma | OFFSIDES | ||
| 535 | Macroglossia | OFFSIDES | ||
| 536 | Mammary duct ectasia | OFFSIDES | ||
| 537 | Mass excision | OFFSIDES | ||
| 538 | Mastectomy | OFFSIDES | ||
| 539 | Mechanical ventilation | OFFSIDES | ||
| 540 | Medical device complication | OFFSIDES | ||
| 541 | Meibomianitis | OFFSIDES | ||
| 542 | Metastatic Neoplasm | OFFSIDES | ||
| 543 | Molluscum Contagiosum | OFFSIDES | ||
| 544 | Motor retardation | OFFSIDES | ||
| 545 | Multiple Myeloma | OFFSIDES | ||
| 546 | Muscle necrosis | OFFSIDES | ||
| 547 | Musculoskeletal chest pain | OFFSIDES | ||
| 548 | Musculoskeletal discomfort | OFFSIDES SIDER | ||
| 549 | Myopia | OFFSIDES | ||
| 550 | Nephrolithiasis | OFFSIDES | ||
| 551 | Nephrosis | SIDER | ||
| 552 | Nephrotic Syndrome | SIDER | ||
| 553 | Nocturia | Canada Vigilance: 1 | Canada Vigilance | |
| 554 | Nodule | OFFSIDES | ||
| 555 | Nystagmus | OFFSIDES | ||
| 556 | Occult blood positive | OFFSIDES | ||
| 557 | Oliguria | SIDER | ||
| 558 | Oral infection | OFFSIDES | ||
| 559 | Orthopnea | OFFSIDES | ||
| 560 | Osteolysis | OFFSIDES | ||
| 561 | Osteopenia | OFFSIDES | ||
| 562 | Osteoporosis | OFFSIDES | ||
| 563 | Osteoradionecrosis | OFFSIDES | ||
| 564 | Overdose | OFFSIDES | ||
| 565 | Overweight | OFFSIDES | ||
| 566 | Papilledema | 5419321 | CTD | |
| 567 | Parathyroidectomy | OFFSIDES | ||
| 568 | Parotidectomy | OFFSIDES | ||
| 569 | Parotitis | OFFSIDES | ||
| 570 | Partner stress | OFFSIDES | ||
| 571 | Pericardial effusion | OFFSIDES | ||
| 572 | Perirectal abscess | OFFSIDES | ||
| 573 | Physical disability | OFFSIDES | ||
| 574 | Pinguecula | OFFSIDES | ||
| 575 | Pityriasis Lichenoides et Varioliformis Acuta | OFFSIDES | ||
| 576 | Plasmacytoma | OFFSIDES | ||
| 577 | Plasmacytosis | OFFSIDES | ||
| 578 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 579 | Pneumothorax | OFFSIDES | ||
| 580 | Poisoning | 28728110 | CTD | |
| 581 | Polyarteritis Nodosa | SIDER | ||
| 582 | Polyuria | SIDER | ||
| 583 | Postinfarction angina | OFFSIDES | ||
| 584 | Presbyopia | OFFSIDES | ||
| 585 | Prescribed overdose | OFFSIDES | ||
| 586 | Primary sequestrum | OFFSIDES | ||
| 587 | Procedural site reaction | OFFSIDES | ||
| 588 | Productive Cough | OFFSIDES | ||
| 589 | Psoriasis | OFFSIDES | ||
| 590 | Pulmonary Hypertension | OFFSIDES | ||
| 591 | Pulmonary artery stenosis | OFFSIDES | ||
| 592 | Pulmonary congestion | OFFSIDES | ||
| 593 | Purpura | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 594 | Purulent discharge | OFFSIDES | ||
| 595 | Pyelonephritis | OFFSIDES | ||
| 596 | Reflux laryngitis | OFFSIDES | ||
| 597 | Renal Artery Stenosis | OFFSIDES | ||
| 598 | Renal abscess | OFFSIDES | ||
| 599 | Renal cyst | OFFSIDES | ||
| 600 | Renal tubular necrosis | OFFSIDES | ||
| 601 | Respiratory tract congestion | OFFSIDES | ||
| 602 | Restrictive pulmonary disease | OFFSIDES | ||
| 603 | Retinal Vascular Disorder | Canada Vigilance: 1 | Canada Vigilance | |
| 604 | Rhabdomyolysis | SIDER | ||
| 605 | Rhinorrhea | OFFSIDES | ||
| 606 | Risus sardonicus | OFFSIDES | ||
| 607 | Sarcoidosis | OFFSIDES | ||
| 608 | Schizoaffective Disorder | OFFSIDES | ||
| 609 | Sequestrectomy | OFFSIDES | ||
| 610 | Serum Sickness | SIDER | ||
| 611 | Sick Sinus Syndrome | OFFSIDES | ||
| 612 | Sinus bradycardia | OFFSIDES | ||
| 613 | Sinus operation | OFFSIDES | ||
| 614 | Sinusitis | OFFSIDES | ||
| 615 | Skin Erosion | OFFSIDES | ||
| 616 | Skin laceration | OFFSIDES | ||
| 617 | Skin neoplasm excision | OFFSIDES | ||
| 618 | Spinal column stenosis | OFFSIDES | ||
| 619 | Splenic abscess | OFFSIDES | ||
| 620 | Spondylolisthesis | OFFSIDES | ||
| 621 | Squamous cell carcinoma of skin | OFFSIDES | ||
| 622 | Staphylococcal abscess | OFFSIDES | ||
| 623 | Stem cell transplant | OFFSIDES | ||
| 624 | Supraventricular tachycardia | OFFSIDES | ||
| 625 | Synovial Cyst | OFFSIDES | ||
| 626 | Teeth brittle | OFFSIDES | ||
| 627 | Temperature intolerance | OFFSIDES | ||
| 628 | Thoracic Outlet Syndrome | OFFSIDES | ||
| 629 | Thoracic vertebral fracture | OFFSIDES | ||
| 630 | Thyroid Diseases | 21800831 | CTD | |
| 631 | Tinnitus | SIDER | ||
| 632 | Tooth Erosion | OFFSIDES | ||
| 633 | Tooth Extraction | OFFSIDES | ||
| 634 | Tracheobronchitis | OFFSIDES | ||
| 635 | Tympanic Membrane Perforation | OFFSIDES | ||
| 636 | Ulcer | OFFSIDES | ||
| 637 | Umbilical hernia | OFFSIDES | ||
| 638 | Unevaluable event | OFFSIDES | ||
| 639 | Unresponsive to stimuli | OFFSIDES | ||
| 640 | Ureteral obstruction | 6057870 | CTD | |
| 641 | Urine leukocyte esterase | OFFSIDES | ||
| 642 | Urolithiasis | 1448305 | CTD | |
| 643 | Uterine Prolapse | OFFSIDES | ||
| 644 | Vasculitis, Leukocytoclastic, Cutaneous | 12861854 | CTD | |
| 645 | Vena cava filter insertion | OFFSIDES | ||
| 646 | Ventricular hypokinesia | OFFSIDES | ||
| 647 | Vertebroplasty | OFFSIDES | ||
| 648 | Vertigo | SIDER | ||
| 649 | Viral upper respiratory tract infection | OFFSIDES | ||
| 650 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 651 | Weight Gain | OFFSIDES | ||
| 652 | Wound dehiscence | OFFSIDES | ||
| 653 | Wound infection staphylococcal | OFFSIDES | ||
| 654 | Yawning | OFFSIDES | ||
| 655 | effusion | OFFSIDES | ||
| 656 | fibroma | OFFSIDES | ||
| 657 | keratoacanthoma | OFFSIDES | ||
| 658 | kyphosis | OFFSIDES | ||
| 659 | pseudomembranous colitis | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.