Fluticasone-Salmeterol Drug Combination
(YYAZJTUGSQOFHG-IAVNQIGZSA-N)
Structure
- SMILES
- OCc1cc(ccc1O)C(CNCCCCCCOCCCCc1ccccc1)O.FCSC(=O)[C@@]1(OC(=O)CC)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)C1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F
- Molecular Formula:
- C50H68F3NO9S
- Molecular Weight:
- 916.136
- Log P:
- 8.9283
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 5
- TPSA:
- 187.92
- CAS Number(s):
- N/A
Synonym(s)
1.
Fluticasone-Salmeterol Drug Combination
2.
Advair
3.
Advair Diskus
4.
Advair HFA
5.
Fluticasone - Salmeterol
6.
Fluticasone Propionate - Salmeterol
7.
Fluticasone Propionate - Salmeterol Combination
8.
Fluticasone Propionate - Salmeterol Xinafoate
9.
Fluticasone Propionate, Salmeterol Xinafoate Drug Combination
10.
Fluticasone Propionate-Salmeterol Drug Combination
11.
Fluticasone Propionate-Salmeterol Xinafoate Combination
12.
Fluticasone Propionate-Salmeterol Xinafoate Drug Combination
13.
Fluticasone-Salmeterol Combination
14.
Seretide
15.
Combination, Fluticasone-Salmeterol
16.
Drug Combination, Fluticasone-Salmeterol
17.
Fluticasone Propionate Salmeterol
18.
Fluticasone Propionate Salmeterol Combination
19.
Fluticasone Propionate Salmeterol Drug Combination
20.
Fluticasone Propionate Salmeterol Xinafoate
21.
Fluticasone Propionate Salmeterol Xinafoate Combination
22.
Fluticasone Propionate Salmeterol Xinafoate Drug Combination
23.
Fluticasone Salmeterol
24.
Fluticasone Salmeterol Combination
25.
Fluticasone Salmeterol Drug Combination
External Link(s)
| MeSH | D000068297 |
| PubChem Compound | 56841124 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 878 | US FAERS | |
| 2 | Asthma | FAERS: 626 | 17654129 | CTD OFFSIDES US FAERS |
| 3 | Product quality issue | FAERS: 569 | US FAERS | |
| 4 | Pharmaceutical product complaint | FAERS: 533 | US FAERS | |
| 5 | Pneumonia | FAERS: 381 | US FAERS | |
| 6 | Dysphonia | FAERS: 357 | US FAERS | |
| 7 | Candidiasis | FAERS: 149 | US FAERS | |
| 8 | Overdose | FAERS: 146 | US FAERS | |
| 9 | Adverse event | FAERS: 143 | US FAERS | |
| 10 | Malaise | FAERS: 128 | US FAERS | |
| 11 | Dizziness | FAERS: 117 | US FAERS | |
| 12 | Pulmonary Fibrosis | FAERS: 116 | US FAERS | |
| 13 | Headache | FAERS: 111 | US FAERS | |
| 14 | Wheezing | FAERS: 93 | US FAERS | |
| 15 | Chest discomfort | FAERS: 92 | US FAERS | |
| 16 | Drug administration error | FAERS: 90 | US FAERS | |
| 17 | Throat irritation | FAERS: 90 | US FAERS | |
| 18 | Tremor | FAERS: 88 | US FAERS | |
| 19 | Palpitations | FAERS: 87 | US FAERS | |
| 20 | Chest Pain | FAERS: 84 | OFFSIDES US FAERS | |
| 21 | Fatigue | FAERS: 82 | US FAERS | |
| 22 | Dysgeusia | FAERS: 73 | US FAERS | |
| 23 | Myocardial Infarction | FAERS: 73 | US FAERS | |
| 24 | Hypersensitivity | FAERS: 72 | US FAERS | |
| 25 | Pharyngolaryngeal Pain | FAERS: 71 | US FAERS | |
| 26 | Aphonia | FAERS: 69 | US FAERS | |
| 27 | Pain | FAERS: 68 | OFFSIDES US FAERS | |
| 28 | Nasopharyngitis | FAERS: 67 | OFFSIDES US FAERS | |
| 29 | Bronchitis | FAERS: 61 | OFFSIDES US FAERS | |
| 30 | Oral candidiasis | FAERS: 61 | US FAERS | |
| 31 | Respiratory Failure | FAERS: 58 | OFFSIDES US FAERS | |
| 32 | Nausea | FAERS: 55 | US FAERS | |
| 33 | Oropharyngeal pain | FAERS: 55 | OFFSIDES US FAERS | |
| 34 | Product use issue | FAERS: 55 | US FAERS | |
| 35 | Feeling abnormal | FAERS: 54 | US FAERS | |
| 36 | Asthenia | FAERS: 53 | US FAERS | |
| 37 | Hoarseness | FAERS: 53 | US FAERS | |
| 38 | Tachycardia | FAERS: 52 | US FAERS | |
| 39 | Cerebrovascular accident | FAERS: 50 | US FAERS | |
| 40 | Myalgia | FAERS: 50 | US FAERS | |
| 41 | Pruritus | FAERS: 47 | US FAERS | |
| 42 | Urticaria | FAERS: 47 | US FAERS | |
| 43 | Medication Error | FAERS: 45 | US FAERS | |
| 44 | Anxiety | FAERS: 44 | US FAERS | |
| 45 | Choking | FAERS: 44 | OFFSIDES US FAERS | |
| 46 | Productive Cough | FAERS: 44 | OFFSIDES US FAERS | |
| 47 | Cataract | FAERS: 41 | US FAERS | |
| 48 | Inappropriate schedule of drug administration | FAERS: 41 | US FAERS | |
| 49 | Product use in unapproved indication | FAERS: 41 | US FAERS | |
| 50 | Bronchospasm | FAERS: 40 | US FAERS | |
| 51 | Arthralgia | FAERS: 39 | US FAERS | |
| 52 | Respiratory arrest | FAERS: 39 | US FAERS | |
| 53 | Laryngitis | FAERS: 38 | US FAERS | |
| 54 | Wrong technique in product usage process | FAERS: 37 | US FAERS | |
| 55 | Expired drug administered | FAERS: 36 | US FAERS | |
| 56 | Nervousness | FAERS: 36 | US FAERS | |
| 57 | Blood glucose increased | FAERS: 35 | US FAERS | |
| 58 | Cardiac Arrest | FAERS: 34 | US FAERS | |
| 59 | Vomiting | FAERS: 34 | US FAERS | |
| 60 | Drug exposure during pregnancy | FAERS: 32 | US FAERS | |
| 61 | Oral fungal infection | FAERS: 32 | US FAERS | |
| 62 | Oral pain | FAERS: 31 | US FAERS | |
| 63 | Incorrect dose administered | FAERS: 30 | OFFSIDES US FAERS | |
| 64 | Stomatitis | FAERS: 30 | US FAERS | |
| 65 | Device malfunction | FAERS: 29 | US FAERS | |
| 66 | Infection | FAERS: 29 | OFFSIDES US FAERS | |
| 67 | Feeling jittery | FAERS: 28 | US FAERS | |
| 68 | Back Pain | FAERS: 27 | US FAERS | |
| 69 | Diabetes Mellitus | FAERS: 27 | US FAERS | |
| 70 | Osteoporosis | FAERS: 27 | OFFSIDES US FAERS | |
| 71 | General physical health deterioration | FAERS: 26 | OFFSIDES US FAERS | |
| 72 | Agitation | FAERS: 25 | US FAERS | |
| 73 | Alopecia | FAERS: 25 | US FAERS | |
| 74 | Device Failure | FAERS: 25 | US FAERS | |
| 75 | Drug dose omission | FAERS: 25 | US FAERS | |
| 76 | Increased upper airway secretion | FAERS: 25 | US FAERS | |
| 77 | Drug Dependence | FAERS: 24 | US FAERS | |
| 78 | Accidental overdose | FAERS: 23 | US FAERS | |
| 79 | Disease recurrence | FAERS: 22 | US FAERS | |
| 80 | Epistaxis | FAERS: 22 | US FAERS | |
| 81 | Glaucoma | FAERS: 21 | US FAERS | |
| 82 | Abdominal discomfort | FAERS: 20 | OFFSIDES US FAERS | |
| 83 | Ageusia | FAERS: 20 | US FAERS | |
| 84 | Lower respiratory tract infection | FAERS: 20 | US FAERS | |
| 85 | Syncope | FAERS: 20 | US FAERS | |
| 86 | Weight decreased | FAERS: 20 | US FAERS | |
| 87 | Burning sensation | FAERS: 19 | US FAERS | |
| 88 | Dental caries | FAERS: 19 | US FAERS | |
| 89 | Device ineffective | FAERS: 19 | US FAERS | |
| 90 | Discomfort | FAERS: 19 | US FAERS | |
| 91 | Infarction | FAERS: 19 | US FAERS | |
| 92 | Influenza | FAERS: 19 | US FAERS | |
| 93 | Somnolence | FAERS: 19 | US FAERS | |
| 94 | Blood cortisol decreased | FAERS: 18 | OFFSIDES US FAERS | |
| 95 | Erythema | FAERS: 18 | OFFSIDES US FAERS | |
| 96 | Anger | FAERS: 16 | US FAERS | |
| 97 | Aphasia | FAERS: 16 | US FAERS | |
| 98 | Intentional product misuse | FAERS: 16 | US FAERS | |
| 99 | Muscle Cramp | FAERS: 16 | US FAERS | |
| 100 | Atrial Fibrillation | FAERS: 15 | US FAERS | |
| 101 | Bone pain | FAERS: 15 | US FAERS | |
| 102 | Chills | FAERS: 14 | US FAERS | |
| 103 | Dyspepsia | FAERS: 14 | US FAERS | |
| 104 | Nonspecific reaction | FAERS: 14 | US FAERS | |
| 105 | Pharyngitis | FAERS: 14 | US FAERS | |
| 106 | Product complaint | FAERS: 14 | US FAERS | |
| 107 | Angina Pectoris | FAERS: 13 | US FAERS | |
| 108 | Asphyxia | FAERS: 13 | US FAERS | |
| 109 | Inhalation Therapy | FAERS: 13 | US FAERS | |
| 110 | Oropharyngitis fungal | FAERS: 13 | US FAERS | |
| 111 | Thrombosis | FAERS: 13 | US FAERS | |
| 112 | Oropharyngeal discomfort | FAERS: 12 | US FAERS | |
| 113 | Urinary tract infection | FAERS: 12 | US FAERS | |
| 114 | Visual disturbance | FAERS: 12 | OFFSIDES US FAERS | |
| 115 | Acne | FAERS: 11 | US FAERS | |
| 116 | Anoxic Encephalopathy | FAERS: 11 | US FAERS | |
| 117 | Circumstance or information capable of leading to medication error | FAERS: 11 | US FAERS | |
| 118 | Drug dispensing error | FAERS: 11 | US FAERS | |
| 119 | Fracture | FAERS: 11 | US FAERS | |
| 120 | Hypotension | FAERS: 11 | US FAERS | |
| 121 | Lung hyperinflation | FAERS: 11 | US FAERS | |
| 122 | Nasal discomfort | FAERS: 11 | US FAERS | |
| 123 | Suspected counterfeit product | FAERS: 11 | US FAERS | |
| 124 | Swelling | FAERS: 11 | US FAERS | |
| 125 | Therapy cessation | FAERS: 11 | US FAERS | |
| 126 | Tinnitus | FAERS: 11 | US FAERS | |
| 127 | Visual Impairment | FAERS: 11 | US FAERS | |
| 128 | Anosmia | FAERS: 10 | US FAERS | |
| 129 | Dry skin | FAERS: 10 | US FAERS | |
| 130 | Oropharyngeal candidiasis | FAERS: 10 | US FAERS | |
| 131 | Pulmonary Embolism | FAERS: 10 | US FAERS | |
| 132 | Respiratory tract congestion | FAERS: 10 | OFFSIDES US FAERS | |
| 133 | Sinusitis | FAERS: 10 | OFFSIDES US FAERS | |
| 134 | Sneezing | FAERS: 10 | US FAERS | |
| 135 | Therapeutic response unexpected | FAERS: 10 | US FAERS | |
| 136 | Abasia | FAERS: 9 | US FAERS | |
| 137 | Anorexia | FAERS: 9 | OFFSIDES US FAERS | |
| 138 | Blindness | FAERS: 9 | US FAERS | |
| 139 | Bronchiectasis | FAERS: 9 | OFFSIDES US FAERS | |
| 140 | Cyanosis | FAERS: 9 | US FAERS | |
| 141 | Depressed Level of Consciousness | FAERS: 9 | US FAERS | |
| 142 | Eye pain | FAERS: 9 | OFFSIDES US FAERS | |
| 143 | Flatulence | FAERS: 9 | US FAERS | |
| 144 | Increased tendency to bruise | FAERS: 9 | US FAERS | |
| 145 | Macular degeneration | FAERS: 9 | US FAERS | |
| 146 | Medication residue | FAERS: 9 | US FAERS | |
| 147 | Middle insomnia | FAERS: 9 | US FAERS | |
| 148 | Musculoskeletal Pain | FAERS: 9 | OFFSIDES US FAERS | |
| 149 | No adverse event | FAERS: 9 | US FAERS | |
| 150 | Product availability issue | FAERS: 9 | US FAERS | |
| 151 | Rash erythematous | FAERS: 9 | US FAERS | |
| 152 | Respiratory distress | FAERS: 9 | US FAERS | |
| 153 | Restlessness | FAERS: 9 | US FAERS | |
| 154 | Acute respiratory failure | FAERS: 8 | OFFSIDES US FAERS | |
| 155 | Bedridden | FAERS: 8 | US FAERS | |
| 156 | Choking sensation | FAERS: 8 | OFFSIDES US FAERS | |
| 157 | Constipation | FAERS: 8 | US FAERS | |
| 158 | Crying | FAERS: 8 | US FAERS | |
| 159 | Dehydration | FAERS: 8 | OFFSIDES US FAERS | |
| 160 | Disability | FAERS: 8 | US FAERS | |
| 161 | Disease Progression | FAERS: 8 | OFFSIDES US FAERS | |
| 162 | Dysuria | FAERS: 8 | OFFSIDES US FAERS | |
| 163 | Gastrointestinal candidiasis | FAERS: 8 | US FAERS | |
| 164 | Glossitis | FAERS: 8 | US FAERS | |
| 165 | Multiple allergies | FAERS: 8 | US FAERS | |
| 166 | Pancreatitis | FAERS: 8 | US FAERS | |
| 167 | Pneumothorax | FAERS: 8 | US FAERS | |
| 168 | Status Asthmaticus | FAERS: 8 | US FAERS | |
| 169 | Tooth Loss | FAERS: 8 | US FAERS | |
| 170 | Abdominal Pain | FAERS: 7 | US FAERS | |
| 171 | Activities of daily living impaired | FAERS: 7 | US FAERS | |
| 172 | Aphthous Stomatitis | FAERS: 7 | US FAERS | |
| 173 | Apparent death | FAERS: 7 | US FAERS | |
| 174 | Bone density decreased | FAERS: 7 | US FAERS | |
| 175 | Cheilitis | FAERS: 7 | US FAERS | |
| 176 | Dementia | FAERS: 7 | US FAERS | |
| 177 | Diplopia | FAERS: 7 | OFFSIDES US FAERS | |
| 178 | Drug exposure via breast milk | FAERS: 7 | US FAERS | |
| 179 | Drug ineffective for unapproved indication | FAERS: 7 | US FAERS | |
| 180 | Drug prescribing error | FAERS: 7 | US FAERS | |
| 181 | Eczema | FAERS: 7 | US FAERS | |
| 182 | Emotional distress | FAERS: 7 | US FAERS | |
| 183 | Expired product administered | FAERS: 7 | US FAERS | |
| 184 | Gastric ulcer | FAERS: 7 | US FAERS | |
| 185 | Immobile | FAERS: 7 | US FAERS | |
| 186 | Inflammation | FAERS: 7 | US FAERS | |
| 187 | Limb injury | FAERS: 7 | US FAERS | |
| 188 | Lymphadenopathy | FAERS: 7 | US FAERS | |
| 189 | Non-cardiac chest pain | FAERS: 7 | US FAERS | |
| 190 | Product physical issue | FAERS: 7 | US FAERS | |
| 191 | Sputum retention | FAERS: 7 | US FAERS | |
| 192 | Vocal Cord Paralysis | FAERS: 7 | US FAERS | |
| 193 | Blood potassium decreased | FAERS: 6 | US FAERS | |
| 194 | Bronchopneumonia | FAERS: 6 | OFFSIDES US FAERS | |
| 195 | Dyspnoea exacerbated | FAERS: 6 | OFFSIDES US FAERS | |
| 196 | Joint swelling | FAERS: 6 | US FAERS | |
| 197 | Laryngospasm | FAERS: 6 | US FAERS | |
| 198 | Lethargy | FAERS: 6 | OFFSIDES US FAERS | |
| 199 | Memory impairment | FAERS: 6 | US FAERS | |
| 200 | Musculoskeletal stiffness | FAERS: 6 | US FAERS | |
| 201 | Neck Pain | FAERS: 6 | US FAERS | |
| 202 | Obesity | FAERS: 6 | US FAERS | |
| 203 | Personality Change | FAERS: 6 | US FAERS | |
| 204 | Prescribed overdose | FAERS: 6 | US FAERS | |
| 205 | Pulmonary congestion | FAERS: 6 | US FAERS | |
| 206 | Respiratory tract irritation | FAERS: 6 | US FAERS | |
| 207 | Sepsis | FAERS: 6 | US FAERS | |
| 208 | Sudden death | FAERS: 6 | OFFSIDES US FAERS | |
| 209 | Tongue blistering | FAERS: 6 | US FAERS | |
| 210 | Tuberculosis | FAERS: 6 | US FAERS | |
| 211 | Urinary Retention | FAERS: 6 | US FAERS | |
| 212 | Wrong technique in drug usage process | FAERS: 6 | US FAERS | |
| 213 | Amnesia | FAERS: 5 | US FAERS | |
| 214 | Angioedema | FAERS: 5 | US FAERS | |
| 215 | Deafness | FAERS: 5 | US FAERS | |
| 216 | Dermatitis | FAERS: 5 | US FAERS | |
| 217 | Enamel anomaly | FAERS: 5 | US FAERS | |
| 218 | Eye irritation | FAERS: 5 | US FAERS | |
| 219 | Growth retardation | FAERS: 5 | US FAERS | |
| 220 | Hyperthyroidism | FAERS: 5 | US FAERS | |
| 221 | Hypothalamo-pituitary disorder | FAERS: 5 | US FAERS | |
| 222 | Impaired work ability | FAERS: 5 | US FAERS | |
| 223 | Intestinal Obstruction | FAERS: 5 | US FAERS | |
| 224 | Lip swelling | FAERS: 5 | US FAERS | |
| 225 | No adverse effect | FAERS: 5 | US FAERS | |
| 226 | Pneumonitis | FAERS: 5 | US FAERS | |
| 227 | Poisoning | FAERS: 5 | US FAERS | |
| 228 | Retching | FAERS: 5 | US FAERS | |
| 229 | Stress | FAERS: 5 | US FAERS | |
| 230 | Vertigo | FAERS: 5 | US FAERS | |
| 231 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 232 | Aphagia | FAERS: 4 | US FAERS | |
| 233 | Arthropathy | FAERS: 4 | US FAERS | |
| 234 | Back disorder | FAERS: 4 | US FAERS | |
| 235 | Cardiomegaly | FAERS: 4 | US FAERS | |
| 236 | Colitis | FAERS: 4 | OFFSIDES US FAERS | |
| 237 | Diplegia | FAERS: 4 | US FAERS | |
| 238 | Disease complication | FAERS: 4 | US FAERS | |
| 239 | Drug administered to patient of inappropriate age | FAERS: 4 | US FAERS | |
| 240 | Drug effect incomplete | FAERS: 4 | US FAERS | |
| 241 | Enuresis | FAERS: 4 | US FAERS | |
| 242 | Epilepsy | FAERS: 4 | US FAERS | |
| 243 | Flushing | FAERS: 4 | US FAERS | |
| 244 | Hepatitis | FAERS: 4 | US FAERS | |
| 245 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 246 | Inappropriate schedule of product administration | FAERS: 4 | US FAERS | |
| 247 | Incorrect storage of drug | FAERS: 4 | US FAERS | |
| 248 | Increased bronchial secretion | FAERS: 4 | US FAERS | |
| 249 | Live Birth | FAERS: 4 | US FAERS | |
| 250 | Loose tooth | FAERS: 4 | US FAERS | |
| 251 | Mental impairment | FAERS: 4 | OFFSIDES US FAERS | |
| 252 | Musculoskeletal chest pain | FAERS: 4 | OFFSIDES US FAERS | |
| 253 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 254 | Night sweats | FAERS: 4 | US FAERS | |
| 255 | Normal delivery | FAERS: 4 | US FAERS | |
| 256 | Pleuritic pain | FAERS: 4 | US FAERS | |
| 257 | Product prescribing issue | FAERS: 4 | US FAERS | |
| 258 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 259 | Rales | FAERS: 4 | US FAERS | |
| 260 | Rhinalgia | FAERS: 4 | US FAERS | |
| 261 | Septic Shock | FAERS: 4 | US FAERS | |
| 262 | Skin Papilloma | FAERS: 4 | US FAERS | |
| 263 | Tonsillitis | FAERS: 4 | US FAERS | |
| 264 | Tooth Extraction | FAERS: 4 | OFFSIDES US FAERS | |
| 265 | Toothache | FAERS: 4 | US FAERS | |
| 266 | Transaminases increased | FAERS: 4 | US FAERS | |
| 267 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 268 | Vasculitis | FAERS: 4 | US FAERS | |
| 269 | Viral upper respiratory tract infection | FAERS: 4 | US FAERS | |
| 270 | Vulvovaginal mycotic infection | FAERS: 4 | US FAERS | |
| 271 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 272 | Apallic syndrome | FAERS: 3 | US FAERS | |
| 273 | Arthritis | FAERS: 3 | US FAERS | |
| 274 | Asthenopia | FAERS: 3 | US FAERS | |
| 275 | Blood pressure fluctuation | FAERS: 3 | US FAERS | |
| 276 | Bronchiolitis | FAERS: 3 | US FAERS | |
| 277 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 278 | Carpal Tunnel Syndrome | FAERS: 3 | US FAERS | |
| 279 | Cataract operation | FAERS: 3 | US FAERS | |
| 280 | Catheter placement | FAERS: 3 | US FAERS | |
| 281 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 282 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 283 | Chronic gastritis | FAERS: 3 | US FAERS | |
| 284 | Conjunctivitis | FAERS: 3 | US FAERS | |
| 285 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 286 | Dengue Fever | FAERS: 3 | US FAERS | |
| 287 | Dependence | FAERS: 3 | US FAERS | |
| 288 | Diabetes mellitus inadequate control | FAERS: 3 | US FAERS | |
| 289 | Disorientation | FAERS: 3 | US FAERS | |
| 290 | Dysarthria | FAERS: 3 | US FAERS | |
| 291 | Economic problem | FAERS: 3 | US FAERS | |
| 292 | Embolism | FAERS: 3 | US FAERS | |
| 293 | Eosinophilic Pneumonia | FAERS: 3 | US FAERS | |
| 294 | Epiglottitis | FAERS: 3 | US FAERS | |
| 295 | Fat redistribution | FAERS: 3 | US FAERS | |
| 296 | Food Allergy | FAERS: 3 | US FAERS | |
| 297 | Foreign body aspiration | FAERS: 3 | US FAERS | |
| 298 | Gait inability | FAERS: 3 | US FAERS | |
| 299 | Gastric infection | FAERS: 3 | US FAERS | |
| 300 | Gastritis | FAERS: 3 | US FAERS | |
| 301 | Gingival Atrophy | FAERS: 3 | US FAERS | |
| 302 | Hemiparesis | FAERS: 3 | US FAERS | |
| 303 | Hypoxia | FAERS: 3 | US FAERS | |
| 304 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 305 | Incorrect dose administered by device | FAERS: 3 | US FAERS | |
| 306 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 307 | Initial insomnia | FAERS: 3 | US FAERS | |
| 308 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 309 | Joint sprain | FAERS: 3 | US FAERS | |
| 310 | Lichen Planus | FAERS: 3 | US FAERS | |
| 311 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 312 | Mood swings | FAERS: 3 | US FAERS | |
| 313 | Mouth Breathing | FAERS: 3 | US FAERS | |
| 314 | Muscle tightness | FAERS: 3 | US FAERS | |
| 315 | Oral infection | FAERS: 3 | US FAERS | |
| 316 | Oral mucosal exfoliation | FAERS: 3 | US FAERS | |
| 317 | Performance status decreased | FAERS: 3 | US FAERS | |
| 318 | Pneumonectomy | FAERS: 3 | US FAERS | |
| 319 | Presyncope | FAERS: 3 | US FAERS | |
| 320 | Pulmonary arterial hypertension | FAERS: 3 | US FAERS | |
| 321 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 322 | Secretion discharge | FAERS: 3 | US FAERS | |
| 323 | Sinus headache | FAERS: 3 | US FAERS | |
| 324 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 325 | Skin irritation | FAERS: 3 | US FAERS | |
| 326 | Snoring | FAERS: 3 | US FAERS | |
| 327 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 328 | Tooth Erosion | FAERS: 3 | US FAERS | |
| 329 | nervous system disorder | FAERS: 3 | US FAERS | |
| 330 | Abnormal weight gain | FAERS: 2 | US FAERS | |
| 331 | Abscess | FAERS: 2 | US FAERS | |
| 332 | African Trypanosomiasis | FAERS: 2 | US FAERS | |
| 333 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 334 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 335 | Blood Corticotrophin Decreased | FAERS: 2 | US FAERS | |
| 336 | Blood gases abnormal | FAERS: 2 | US FAERS | |
| 337 | Blood glucose fluctuation | FAERS: 2 | US FAERS | |
| 338 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 339 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 340 | Brain Death | FAERS: 2 | US FAERS | |
| 341 | Bronchopulmonary disease | FAERS: 2 | US FAERS | |
| 342 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 343 | Catarrh | FAERS: 2 | US FAERS | |
| 344 | Cellulitis | FAERS: 2 | OFFSIDES US FAERS | |
| 345 | Cold sweat | FAERS: 2 | US FAERS | |
| 346 | Conversion disorder | FAERS: 2 | US FAERS | |
| 347 | Cor pulmonale | FAERS: 2 | US FAERS | |
| 348 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 349 | Depressed mood | FAERS: 2 | OFFSIDES US FAERS | |
| 350 | Diaphragmatic Hernia | FAERS: 2 | US FAERS | |
| 351 | Drug delivery system malfunction | FAERS: 2 | OFFSIDES US FAERS | |
| 352 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 353 | Drug screen positive | FAERS: 2 | US FAERS | |
| 354 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 355 | Dystonia | FAERS: 2 | US FAERS | |
| 356 | Ear discomfort | FAERS: 2 | US FAERS | |
| 357 | Ecchymosis | FAERS: 2 | US FAERS | |
| 358 | Enterocolitis | FAERS: 2 | US FAERS | |
| 359 | Extraocular Muscle Paresis | FAERS: 2 | US FAERS | |
| 360 | Facial Pain | FAERS: 2 | US FAERS | |
| 361 | Feeling Cold | FAERS: 2 | US FAERS | |
| 362 | Foreign body trauma | FAERS: 2 | OFFSIDES US FAERS | |
| 363 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 364 | Gastric Dilatation | FAERS: 2 | US FAERS | |
| 365 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 366 | Head discomfort | FAERS: 2 | US FAERS | |
| 367 | Hunger | FAERS: 2 | US FAERS | |
| 368 | Hypersomnia | FAERS: 2 | US FAERS | |
| 369 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 370 | Hyperventilation | FAERS: 2 | US FAERS | |
| 371 | Hypogeusia | FAERS: 2 | US FAERS | |
| 372 | Hypoventilation | FAERS: 2 | US FAERS | |
| 373 | Idiopathic Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 374 | Immunosuppression | FAERS: 2 | US FAERS | |
| 375 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 376 | Increased viscosity of bronchial secretion | FAERS: 2 | US FAERS | |
| 377 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 378 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 379 | Intervertebral disc disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 380 | Joint stiffness | FAERS: 2 | US FAERS | |
| 381 | Keratitis | FAERS: 2 | US FAERS | |
| 382 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 383 | Laryngeal erythema | FAERS: 2 | US FAERS | |
| 384 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 385 | Leukocytosis | FAERS: 2 | US FAERS | |
| 386 | Leukoplakia | FAERS: 2 | US FAERS | |
| 387 | Limb operation | FAERS: 2 | US FAERS | |
| 388 | Lobar Pneumonia | FAERS: 2 | US FAERS | |
| 389 | Local reaction | FAERS: 2 | US FAERS | |
| 390 | Long QT Syndrome | FAERS: 2 | US FAERS | |
| 391 | Lung consolidation | FAERS: 2 | US FAERS | |
| 392 | Lymphopenia | FAERS: 2 | US FAERS | |
| 393 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 394 | Medical device complication | FAERS: 2 | US FAERS | |
| 395 | Milk Allergy | FAERS: 2 | US FAERS | |
| 396 | Myopathy | FAERS: 2 | US FAERS | |
| 397 | Nipple pain | FAERS: 2 | US FAERS | |
| 398 | Ocular Hypertension | FAERS: 2 | US FAERS | |
| 399 | Onychomycosis | FAERS: 2 | US FAERS | |
| 400 | Oropharyngeal plaque | FAERS: 2 | US FAERS | |
| 401 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 402 | Osteogenesis Imperfecta | FAERS: 2 | US FAERS | |
| 403 | Otitis media fungal | FAERS: 2 | US FAERS | |
| 404 | Pain of skin | FAERS: 2 | US FAERS | |
| 405 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 406 | Paradoxical drug reaction | FAERS: 2 | US FAERS | |
| 407 | Pharyngotonsillitis | FAERS: 2 | US FAERS | |
| 408 | Physical deconditioning | FAERS: 2 | US FAERS | |
| 409 | Pleurisy | FAERS: 2 | US FAERS | |
| 410 | Polydipsia | FAERS: 2 | US FAERS | |
| 411 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 412 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 413 | Post procedural complication | FAERS: 2 | US FAERS | |
| 414 | Pregnancy | FAERS: 2 | US FAERS | |
| 415 | Prescribed underdose | FAERS: 2 | US FAERS | |
| 416 | Product dose omission | FAERS: 2 | US FAERS | |
| 417 | Product substitution issue | FAERS: 2 | US FAERS | |
| 418 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 419 | Pulmonary function test decreased | FAERS: 2 | US FAERS | |
| 420 | Pulmonary pain | FAERS: 2 | US FAERS | |
| 421 | Pulmonary thrombosis | FAERS: 2 | OFFSIDES US FAERS | |
| 422 | Purpura | FAERS: 2 | US FAERS | |
| 423 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 424 | Renal pain | FAERS: 2 | US FAERS | |
| 425 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 426 | Rhinitis | FAERS: 2 | OFFSIDES US FAERS | |
| 427 | Sarcoidosis | FAERS: 2 | US FAERS | |
| 428 | Shock | FAERS: 2 | US FAERS | |
| 429 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 430 | Sinus operation | FAERS: 2 | US FAERS | |
| 431 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 432 | Skin laceration | FAERS: 2 | US FAERS | |
| 433 | Spinal column injury | FAERS: 2 | US FAERS | |
| 434 | Thermal burn | FAERS: 2 | US FAERS | |
| 435 | Thirst | FAERS: 2 | US FAERS | |
| 436 | Thoracic vertebral fracture | FAERS: 2 | US FAERS | |
| 437 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 438 | Ulcer | FAERS: 2 | US FAERS | |
| 439 | Unemployment | FAERS: 2 | US FAERS | |
| 440 | Vaginal burning sensation | FAERS: 2 | US FAERS | |
| 441 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 442 | Visual acuity tests abnormal | FAERS: 2 | US FAERS | |
| 443 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 444 | Accidental underdose | FAERS: 1 | US FAERS | |
| 445 | Acute Coronary Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 446 | Adrenocortical insufficiency chronic | FAERS: 1 | US FAERS | |
| 447 | Akinesia | FAERS: 1 | US FAERS | |
| 448 | Alveolitis | FAERS: 1 | OFFSIDES US FAERS | |
| 449 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 450 | Anal discomfort | FAERS: 1 | US FAERS | |
| 451 | Aneurysm | FAERS: 1 | US FAERS | |
| 452 | Angle Closure Glaucoma | FAERS: 1 | OFFSIDES US FAERS | |
| 453 | Anomalous atrioventricular excitation | FAERS: 1 | US FAERS | |
| 454 | Anorgasmia | FAERS: 1 | US FAERS | |
| 455 | Anuria | FAERS: 1 | US FAERS | |
| 456 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 457 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 458 | Aortic dissection rupture | FAERS: 1 | US FAERS | |
| 459 | Apathy | FAERS: 1 | OFFSIDES US FAERS | |
| 460 | Appendicitis | FAERS: 1 | US FAERS | |
| 461 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 462 | Arthropod bite | FAERS: 1 | US FAERS | |
| 463 | Artificial crown procedure | FAERS: 1 | US FAERS | |
| 464 | Ascites | FAERS: 1 | US FAERS | |
| 465 | Atelectasis | FAERS: 1 | OFFSIDES US FAERS | |
| 466 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 467 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 468 | Autonomic neuropathy | FAERS: 1 | US FAERS | |
| 469 | Bankruptcy | FAERS: 1 | US FAERS | |
| 470 | Belligerence | FAERS: 1 | US FAERS | |
| 471 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 472 | Biliary cirrhosis | FAERS: 1 | US FAERS | |
| 473 | Biopsy | FAERS: 1 | US FAERS | |
| 474 | Blood blister | FAERS: 1 | US FAERS | |
| 475 | Blood calcium normal | FAERS: 1 | US FAERS | |
| 476 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 477 | Blood cholesterol | FAERS: 1 | US FAERS | |
| 478 | Blood corticotrophin abnormal | FAERS: 1 | US FAERS | |
| 479 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 480 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 481 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 482 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 483 | Blood growth hormone decreased | FAERS: 1 | US FAERS | |
| 484 | Blood iron increased | FAERS: 1 | US FAERS | |
| 485 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 486 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 487 | Blood urine present | FAERS: 1 | US FAERS | |
| 488 | Bone fissure | FAERS: 1 | US FAERS | |
| 489 | Borderline glaucoma | FAERS: 1 | US FAERS | |
| 490 | Breast infection | FAERS: 1 | US FAERS | |
| 491 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 492 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 493 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 494 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 495 | Bronchial wall thickening | FAERS: 1 | US FAERS | |
| 496 | Bruxism | FAERS: 1 | US FAERS | |
| 497 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 498 | Bulimia Nervosa | FAERS: 1 | US FAERS | |
| 499 | Cachexia | FAERS: 1 | US FAERS | |
| 500 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 501 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 502 | Cardiac asthma | FAERS: 1 | US FAERS | |
| 503 | Cardio-respiratory distress | FAERS: 1 | US FAERS | |
| 504 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 505 | Central venous catheter removal | FAERS: 1 | OFFSIDES US FAERS | |
| 506 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 507 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 508 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 509 | Chorea | FAERS: 1 | US FAERS | |
| 510 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 511 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 512 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 513 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 514 | Coccidioidomycosis | FAERS: 1 | US FAERS | |
| 515 | Complex partial seizures | FAERS: 1 | US FAERS | |
| 516 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 517 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 518 | Corrective lens user | FAERS: 1 | US FAERS | |
| 519 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 520 | Cortisol increased | FAERS: 1 | US FAERS | |
| 521 | Cystic Fibrosis | FAERS: 1 | US FAERS | |
| 522 | Cystitis | FAERS: 1 | US FAERS | |
| 523 | Cyst | FAERS: 1 | US FAERS | |
| 524 | Delirium | FAERS: 1 | US FAERS | |
| 525 | Denture wearer | FAERS: 1 | US FAERS | |
| 526 | Device breakage | FAERS: 1 | US FAERS | |
| 527 | Device damage | FAERS: 1 | US FAERS | |
| 528 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 529 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 530 | Diabetic metabolic decompensation | FAERS: 1 | US FAERS | |
| 531 | Diaphragmalgia | FAERS: 1 | US FAERS | |
| 532 | Diverticulitis | FAERS: 1 | US FAERS | |
| 533 | Diverticulum | FAERS: 1 | US FAERS | |
| 534 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 535 | Drooling | FAERS: 1 | US FAERS | |
| 536 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 537 | Drug abuse | FAERS: 1 | US FAERS | |
| 538 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 539 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 540 | Dysgraphia | FAERS: 1 | OFFSIDES US FAERS | |
| 541 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 542 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 543 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 544 | Electrocardiogram change | FAERS: 1 | OFFSIDES US FAERS | |
| 545 | Emergency care examination | FAERS: 1 | US FAERS | |
| 546 | Emotional disorder | FAERS: 1 | US FAERS | |
| 547 | Empyema | FAERS: 1 | OFFSIDES US FAERS | |
| 548 | Enteritis | FAERS: 1 | US FAERS | |
| 549 | Eosinophilia | FAERS: 1 | US FAERS | |
| 550 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 551 | Epinephrine increased | FAERS: 1 | US FAERS | |
| 552 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 553 | Eructation | FAERS: 1 | US FAERS | |
| 554 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 555 | Euphoric mood | FAERS: 1 | US FAERS | |
| 556 | Excoriation | FAERS: 1 | OFFSIDES US FAERS | |
| 557 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 558 | Exposure via father | FAERS: 1 | US FAERS | |
| 559 | Extra dose administered | FAERS: 1 | US FAERS | |
| 560 | Eye Redness | FAERS: 1 | US FAERS | |
| 561 | Eyelid Function Disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 562 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 563 | Failure of implant | FAERS: 1 | US FAERS | |
| 564 | Familial Tremor | FAERS: 1 | US FAERS | |
| 565 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 566 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 567 | Fibrosis | FAERS: 1 | US FAERS | |
| 568 | Flank Pain | FAERS: 1 | US FAERS | |
| 569 | Forced expiratory volume increased | FAERS: 1 | US FAERS | |
| 570 | Forceps delivery | FAERS: 1 | US FAERS | |
| 571 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 572 | Frustration | FAERS: 1 | US FAERS | |
| 573 | Fumbling | FAERS: 1 | US FAERS | |
| 574 | Fungal pharyngitis | FAERS: 1 | US FAERS | |
| 575 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 576 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 577 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 578 | Gaze palsy | FAERS: 1 | US FAERS | |
| 579 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 580 | Genital rash | FAERS: 1 | US FAERS | |
| 581 | Gingivitis | FAERS: 1 | US FAERS | |
| 582 | Head deformity | FAERS: 1 | US FAERS | |
| 583 | Hemiplegia | FAERS: 1 | US FAERS | |
| 584 | Hip surgery | FAERS: 1 | US FAERS | |
| 585 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 586 | Hypercapnia | FAERS: 1 | US FAERS | |
| 587 | Hyperinsulinism | FAERS: 1 | US FAERS | |
| 588 | Hyperphagia | FAERS: 1 | US FAERS | |
| 589 | Hypophagia | FAERS: 1 | OFFSIDES US FAERS | |
| 590 | Hysterectomy | FAERS: 1 | US FAERS | |
| 591 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 592 | Incontinence | FAERS: 1 | US FAERS | |
| 593 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 594 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 595 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 596 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 597 | Internal injury | FAERS: 1 | US FAERS | |
| 598 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 599 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 600 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 601 | Joint injury | FAERS: 1 | US FAERS | |
| 602 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 603 | Laceration | FAERS: 1 | US FAERS | |
| 604 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 605 | Laryngitis fungal | FAERS: 1 | US FAERS | |
| 606 | Laryngomalacia | FAERS: 1 | US FAERS | |
| 607 | Laryngoscopy | FAERS: 1 | US FAERS | |
| 608 | Laser Therapy | FAERS: 1 | US FAERS | |
| 609 | Laziness | FAERS: 1 | US FAERS | |
| 610 | Leukoderma | FAERS: 1 | US FAERS | |
| 611 | Leukopenia | FAERS: 1 | US FAERS | |
| 612 | Limb discomfort | FAERS: 1 | US FAERS | |
| 613 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 614 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 615 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 616 | Lipohypertrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 617 | Lipoma | FAERS: 1 | US FAERS | |
| 618 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 619 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 620 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 621 | Lyme Disease | FAERS: 1 | US FAERS | |
| 622 | Lymphocyte count decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 623 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 624 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 625 | Mass excision | FAERS: 1 | US FAERS | |
| 626 | Mastication disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 627 | Mastitis | FAERS: 1 | US FAERS | |
| 628 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 629 | Medication residue present | FAERS: 1 | US FAERS | |
| 630 | Meniscus injury | FAERS: 1 | US FAERS | |
| 631 | Meniscus operation | FAERS: 1 | US FAERS | |
| 632 | Menorrhagia | FAERS: 1 | US FAERS | |
| 633 | Mesenteric Panniculitis | FAERS: 1 | US FAERS | |
| 634 | Metastasis | FAERS: 1 | US FAERS | |
| 635 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 636 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 637 | Moaning | FAERS: 1 | US FAERS | |
| 638 | Monoplegia | FAERS: 1 | US FAERS | |
| 639 | Mouth cyst | FAERS: 1 | US FAERS | |
| 640 | Mouth plaque | FAERS: 1 | US FAERS | |
| 641 | Mouth swelling | FAERS: 1 | US FAERS | |
| 642 | Muscle hypertrophy | FAERS: 1 | US FAERS | |
| 643 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 644 | Mydriasis | FAERS: 1 | US FAERS | |
| 645 | Myopia | FAERS: 1 | US FAERS | |
| 646 | Myositis | FAERS: 1 | US FAERS | |
| 647 | Nasal Polyps | FAERS: 1 | US FAERS | |
| 648 | Nasal mucosal disorder | FAERS: 1 | US FAERS | |
| 649 | Nasal sinus drainage | FAERS: 1 | US FAERS | |
| 650 | Nasopharyngeal surgery | FAERS: 1 | US FAERS | |
| 651 | Neonatal aspiration | FAERS: 1 | US FAERS | |
| 652 | Neuralgia | FAERS: 1 | US FAERS | |
| 653 | Neuropathy | FAERS: 1 | US FAERS | |
| 654 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 655 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 656 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 657 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 658 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 659 | Oliguria | FAERS: 1 | US FAERS | |
| 660 | Oncologic complication | FAERS: 1 | US FAERS | |
| 661 | Optic Neuritis | FAERS: 1 | OFFSIDES US FAERS | |
| 662 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 663 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 664 | Osteitis | FAERS: 1 | US FAERS | |
| 665 | Osteolysis | FAERS: 1 | US FAERS | |
| 666 | Osteomyelitis | FAERS: 1 | OFFSIDES US FAERS | |
| 667 | Osteopenia | FAERS: 1 | US FAERS | |
| 668 | Otitis Externa | FAERS: 1 | US FAERS | |
| 669 | Oxygen consumption increased | FAERS: 1 | US FAERS | |
| 670 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 671 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 672 | Palatal dysplasia | FAERS: 1 | US FAERS | |
| 673 | Pallor | FAERS: 1 | OFFSIDES US FAERS | |
| 674 | Palmar erythema | FAERS: 1 | US FAERS | |
| 675 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 676 | Panic Disorder | FAERS: 1 | US FAERS | |
| 677 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 678 | Paranoia | FAERS: 1 | US FAERS | |
| 679 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 680 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 681 | Petechiae | FAERS: 1 | US FAERS | |
| 682 | Pharyngolaryngeal discomfort | FAERS: 1 | US FAERS | |
| 683 | Physical examination abnormal | FAERS: 1 | US FAERS | |
| 684 | Physical examination normal | FAERS: 1 | US FAERS | |
| 685 | Plasmapheresis | FAERS: 1 | US FAERS | |
| 686 | Polyarthritis | FAERS: 1 | US FAERS | |
| 687 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 688 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 689 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 690 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 691 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 692 | Procedural complication | FAERS: 1 | US FAERS | |
| 693 | Product administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 694 | Product dosage form confusion | FAERS: 1 | US FAERS | |
| 695 | Product formulation issue | FAERS: 1 | US FAERS | |
| 696 | Product lot number issue | FAERS: 1 | US FAERS | |
| 697 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 698 | Product package associated injury | FAERS: 1 | US FAERS | |
| 699 | Product prescribing error | FAERS: 1 | US FAERS | |
| 700 | Prostatic pain | FAERS: 1 | US FAERS | |
| 701 | Pruritus Ani | FAERS: 1 | US FAERS | |
| 702 | Psoriasis | FAERS: 1 | OFFSIDES US FAERS | |
| 703 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 704 | Puberty | FAERS: 1 | US FAERS | |
| 705 | Pulmonary function test increased | FAERS: 1 | US FAERS | |
| 706 | Pulmonary necrosis | FAERS: 1 | US FAERS | |
| 707 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 708 | Purulent discharge | FAERS: 1 | OFFSIDES US FAERS | |
| 709 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 710 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 711 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 712 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 713 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 714 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 715 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 716 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 717 | Retinitis | FAERS: 1 | US FAERS | |
| 718 | Rheumatic Heart Disease | FAERS: 1 | US FAERS | |
| 719 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 720 | Rickets | FAERS: 1 | US FAERS | |
| 721 | Saliva altered | FAERS: 1 | US FAERS | |
| 722 | Schizophrenia | FAERS: 1 | US FAERS | |
| 723 | Sebaceous hyperplasia | FAERS: 1 | US FAERS | |
| 724 | Semen abnormal | FAERS: 1 | US FAERS | |
| 725 | Sense of oppression | FAERS: 1 | US FAERS | |
| 726 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 727 | Skin lesion | FAERS: 1 | US FAERS | |
| 728 | Skin reaction | FAERS: 1 | US FAERS | |
| 729 | Sleep Talking | FAERS: 1 | US FAERS | |
| 730 | Sperm count decreased | FAERS: 1 | US FAERS | |
| 731 | Spermatozoa abnormal | FAERS: 1 | US FAERS | |
| 732 | Spermatozoa progressive motility decreased | FAERS: 1 | US FAERS | |
| 733 | Spinal cord herniation | FAERS: 1 | US FAERS | |
| 734 | Splenomegaly | FAERS: 1 | US FAERS | |
| 735 | Sputum culture positive | FAERS: 1 | US FAERS | |
| 736 | Staring | FAERS: 1 | US FAERS | |
| 737 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 738 | Stillbirth | FAERS: 1 | US FAERS | |
| 739 | Stupor | FAERS: 1 | US FAERS | |
| 740 | Suicide attempt | FAERS: 1 | US FAERS | |
| 741 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 742 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 743 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 744 | Teeth brittle | FAERS: 1 | US FAERS | |
| 745 | Temperature regulation disorder | FAERS: 1 | US FAERS | |
| 746 | Tetany | FAERS: 1 | US FAERS | |
| 747 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 748 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 749 | Therapy change | FAERS: 1 | US FAERS | |
| 750 | Throat cancer | FAERS: 1 | US FAERS | |
| 751 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 752 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 753 | Tobacco user | FAERS: 1 | US FAERS | |
| 754 | Tongue eruption | FAERS: 1 | US FAERS | |
| 755 | Tracheitis | FAERS: 1 | US FAERS | |
| 756 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 757 | Trichotillomania | FAERS: 1 | US FAERS | |
| 758 | Trismus | FAERS: 1 | US FAERS | |
| 759 | Underweight | FAERS: 1 | US FAERS | |
| 760 | Unevaluable event | FAERS: 1 | US FAERS | |
| 761 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 762 | Upper respiratory fungal infection | FAERS: 1 | US FAERS | |
| 763 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 764 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 765 | Uveitis | FAERS: 1 | US FAERS | |
| 766 | VIIth nerve paralysis | FAERS: 1 | OFFSIDES US FAERS | |
| 767 | Vaginal mycosis | FAERS: 1 | US FAERS | |
| 768 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 769 | Vascular resistance systemic increased | FAERS: 1 | US FAERS | |
| 770 | Venous occlusion | FAERS: 1 | US FAERS | |
| 771 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 772 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 773 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 774 | Water Pollution | FAERS: 1 | US FAERS | |
| 775 | Wheelchair user | FAERS: 1 | US FAERS | |
| 776 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 777 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 778 | furuncle | FAERS: 1 | US FAERS | |
| 779 | jaundice | FAERS: 1 | US FAERS | |
| 780 | prostatitis | FAERS: 1 | US FAERS | |
| 781 | skin abrasion | FAERS: 1 | US FAERS | |
| 782 | treatment failure | FAERS: 1 | US FAERS | |
| 783 | Abdominal mass | OFFSIDES | ||
| 784 | Accidental exposure | OFFSIDES | ||
| 785 | Accidental needle stick | OFFSIDES | ||
| 786 | Acute bronchitis | OFFSIDES | ||
| 787 | Albumin globulin ratio decreased | OFFSIDES | ||
| 788 | Arthrodesis | OFFSIDES | ||
| 789 | Aspiration Pneumonia | OFFSIDES | ||
| 790 | Atrial tachycardia | OFFSIDES | ||
| 791 | Atrophy of tongue papillae | OFFSIDES | ||
| 792 | B-cell lymphoma stage I | OFFSIDES | ||
| 793 | Biliary Dyskinesia | OFFSIDES | ||
| 794 | Blepharospasm | OFFSIDES | ||
| 795 | Blood albumin increased | OFFSIDES | ||
| 796 | Blood creatinine increased | OFFSIDES | ||
| 797 | Blood electrolytes abnormal | OFFSIDES | ||
| 798 | Blood sodium | OFFSIDES | ||
| 799 | Blood urea abnormal | OFFSIDES | ||
| 800 | Blood urea increased | OFFSIDES | ||
| 801 | Bone abscess | OFFSIDES | ||
| 802 | Bone lesion | OFFSIDES | ||
| 803 | Bone swelling | OFFSIDES | ||
| 804 | Breast cancer recurrent | OFFSIDES | ||
| 805 | Bronchopneumopathy | OFFSIDES | ||
| 806 | Candidiasis of vagina | OFFSIDES | ||
| 807 | Capillary Leak Syndrome | OFFSIDES | ||
| 808 | Cardiomyopathy, Dilated | 19081299 | CTD | |
| 809 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 810 | Color blindness | OFFSIDES | ||
| 811 | Dental Fistula | OFFSIDES | ||
| 812 | Duodenitis | OFFSIDES | ||
| 813 | Ejection fraction abnormal | OFFSIDES | ||
| 814 | Endodontic procedure | OFFSIDES | ||
| 815 | Epicondylitis | OFFSIDES | ||
| 816 | Eye inflammation | OFFSIDES | ||
| 817 | Fat necrosis | OFFSIDES | ||
| 818 | Febrile Neutropenia | OFFSIDES | ||
| 819 | Flat affect | OFFSIDES | ||
| 820 | Food Poisoning | OFFSIDES | ||
| 821 | Galactorrhea | OFFSIDES | ||
| 822 | Gallbladder necrosis | OFFSIDES | ||
| 823 | High density lipoprotein increased | OFFSIDES | ||
| 824 | Hordeolum | OFFSIDES | ||
| 825 | Hyperkeratosis | OFFSIDES | ||
| 826 | Implant site thrombosis | OFFSIDES | ||
| 827 | Kidney Failure | OFFSIDES | ||
| 828 | Left atrial dilatation | OFFSIDES | ||
| 829 | Leukodystrophy | OFFSIDES | ||
| 830 | Leukopenia neonatal | OFFSIDES | ||
| 831 | Lymph node palpable | OFFSIDES | ||
| 832 | Lymphedema | OFFSIDES | ||
| 833 | Maxillofacial operation | OFFSIDES | ||
| 834 | Metamorphopsia | OFFSIDES | ||
| 835 | Monocytosis | OFFSIDES | ||
| 836 | Mononeuritis | OFFSIDES | ||
| 837 | Myelodysplasia | OFFSIDES | ||
| 838 | Nephroangiosclerosis | OFFSIDES | ||
| 839 | Neutropenic infection | OFFSIDES | ||
| 840 | Oral polypectomy | OFFSIDES | ||
| 841 | Osteitis Deformans | OFFSIDES | ||
| 842 | Pancreatic Cyst | OFFSIDES | ||
| 843 | Perivascular dermatitis | OFFSIDES | ||
| 844 | Primary sequestrum | OFFSIDES | ||
| 845 | QRS axis abnormal | OFFSIDES | ||
| 846 | Risus sardonicus | OFFSIDES | ||
| 847 | Skin neoplasm excision | OFFSIDES | ||
| 848 | Tardive Dyskinesia | OFFSIDES | ||
| 849 | Ultrasound scan abnormal | OFFSIDES | ||
| 850 | Ventricular hypokinesia | OFFSIDES | ||
| 851 | Wound necrosis | OFFSIDES | ||
| 852 | effusion | OFFSIDES | ||
| 853 | kyphosis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.