Fulvestrant
(VWUXBMIQPBEWFH-WCCTWKNTSA-N)
Structure
- SMILES
- O=S(CCCC(C(F)(F)F)(F)F)CCCCCCCCC[C@@H]1Cc2cc(O)ccc2[C@@H]2[C@@H]1[C@@H]1CC[C@@H]([C@]1(CC2)C)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- L02BA03
- Molecular Formula:
- C32H47F5O3S
- Molecular Weight:
- 606.771
- Log P:
- 9.5483
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 2
- TPSA:
- 76.74
- CAS Number(s):
- 129453-61-8
Synonym(s)
1.
Fulvestrant
2.
7-(9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl)estra-1,3,5(10)-triene-3,17-diol
3.
Faslodex
4.
ICI 182,780
5.
ICI 182780
6.
ICI-182780
7.
ZM 182780
8.
ZM-182780
9.
ICI182780
10.
ZM182780
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malignant neoplasm progression | FAERS: 230 Canada Vigilance: 18 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Injection site pain | FAERS: 75 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 3 | Disease Progression | FAERS: 67 Canada Vigilance: 12 | Canada Vigilance OFFSIDES US FAERS | |
| 4 | Nausea | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 5 | Asthenia | FAERS: 36 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 6 | Back Pain | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Dizziness | FAERS: 36 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 8 | Arthralgia | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Fatigue | FAERS: 34 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 10 | Pain | FAERS: 34 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 11 | Headache | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 12 | Bone pain | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 13 | Pulmonary Embolism | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Malaise | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Vomiting | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Alopecia | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 17 | Drug ineffective | FAERS: 20 Canada Vigilance: 29 | Canada Vigilance US FAERS | |
| 18 | Chest discomfort | FAERS: 18 | US FAERS | |
| 19 | Hypersensitivity | FAERS: 18 | US FAERS | |
| 20 | Myalgia | FAERS: 18 | US FAERS | |
| 21 | Drug dose omission | FAERS: 17 | US FAERS | |
| 22 | Injection site mass | FAERS: 17 | US FAERS | |
| 23 | Metastasis | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Pruritus | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Throat irritation | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Cerebrovascular accident | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Injection Site Reaction | FAERS: 16 | US FAERS | |
| 28 | Injection site erythema | FAERS: 16 | OFFSIDES US FAERS | |
| 29 | Weight decreased | FAERS: 16 | US FAERS | |
| 30 | Erythema | FAERS: 14 | OFFSIDES US FAERS | |
| 31 | Product use issue | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Chest Pain | FAERS: 13 | OFFSIDES US FAERS | |
| 33 | Dysgeusia | FAERS: 13 | OFFSIDES US FAERS | |
| 34 | Incorrect route of drug administration | FAERS: 13 | US FAERS | |
| 35 | Injection site necrosis | FAERS: 13 | US FAERS | |
| 36 | Pneumonia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Urinary tract infection | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Incorrect dose administered | FAERS: 12 | US FAERS | |
| 39 | Flushing | FAERS: 11 | US FAERS | |
| 40 | Injection site pruritus | FAERS: 11 | OFFSIDES US FAERS | |
| 41 | Musculoskeletal Pain | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 42 | Syncope | FAERS: 11 | US FAERS | |
| 43 | Thrombocytopenia | FAERS: 11 | US FAERS | |
| 44 | Abdominal Pain | FAERS: 10 | OFFSIDES US FAERS | |
| 45 | Ascites | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 46 | Chills | FAERS: 10 | US FAERS | |
| 47 | Sciatica | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Swelling | FAERS: 10 | US FAERS | |
| 49 | Transaminases increased | FAERS: 10 | US FAERS | |
| 50 | Adverse event | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Deep Vein Thrombosis | FAERS: 9 | US FAERS | |
| 52 | Feeling abnormal | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 53 | Injection site extravasation | FAERS: 9 | US FAERS | |
| 54 | Presyncope | FAERS: 9 | US FAERS | |
| 55 | Anxiety | FAERS: 8 | OFFSIDES US FAERS | |
| 56 | Dehydration | FAERS: 8 | OFFSIDES US FAERS | |
| 57 | Drug administration error | FAERS: 8 | US FAERS | |
| 58 | Injection site bruising | FAERS: 8 | US FAERS | |
| 59 | Injection site nodule | FAERS: 8 | OFFSIDES US FAERS | |
| 60 | Tremor | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Urticaria | FAERS: 8 | US FAERS | |
| 62 | Aspartate Aminotransferase Increased | FAERS: 7 | US FAERS | |
| 63 | Atrial Fibrillation | FAERS: 7 | US FAERS | |
| 64 | Breast cancer recurrent | FAERS: 7 | OFFSIDES US FAERS | |
| 65 | Bronchospasm | FAERS: 7 | US FAERS | |
| 66 | Constipation | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Dry skin | FAERS: 7 | US FAERS | |
| 68 | Injection site nerve damage | FAERS: 7 | US FAERS | |
| 69 | Lip swelling | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Product quality issue | FAERS: 7 | US FAERS | |
| 71 | Wheezing | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Activities of daily living impaired | FAERS: 6 | OFFSIDES US FAERS | |
| 73 | Cerebral Infarction | FAERS: 6 | US FAERS | |
| 74 | Injection site inflammation | FAERS: 6 | US FAERS | |
| 75 | Respiratory Failure | FAERS: 6 | OFFSIDES US FAERS | |
| 76 | Terminal state | FAERS: 6 | US FAERS | |
| 77 | Upper-airway cough syndrome | FAERS: 6 | US FAERS | |
| 78 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 79 | Abasia | FAERS: 5 | OFFSIDES US FAERS | |
| 80 | Alanine Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 81 | Blood alkaline phosphatase increased | FAERS: 5 | US FAERS | |
| 82 | Carbohydrate antigen 15-3 increased | FAERS: 5 | US FAERS | |
| 83 | Discomfort | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 84 | Dysphonia | FAERS: 5 | OFFSIDES US FAERS | |
| 85 | Embolism | FAERS: 5 | US FAERS | |
| 86 | Gamma-Glutamyltransferase Increased | FAERS: 5 | US FAERS | |
| 87 | Hepatomegaly | FAERS: 5 | US FAERS | |
| 88 | Hormone level abnormal | FAERS: 5 | US FAERS | |
| 89 | Influenza | FAERS: 5 | US FAERS | |
| 90 | Injection site abscess | FAERS: 5 | US FAERS | |
| 91 | Injection site scar | FAERS: 5 | US FAERS | |
| 92 | Injury associated with device | FAERS: 5 | US FAERS | |
| 93 | Neuralgia | FAERS: 5 | OFFSIDES US FAERS | |
| 94 | Nodule | FAERS: 5 | US FAERS | |
| 95 | Overdose | FAERS: 5 | US FAERS | |
| 96 | Pericardial effusion | FAERS: 5 | OFFSIDES US FAERS | |
| 97 | Stomatitis | FAERS: 5 | US FAERS | |
| 98 | Vertigo | FAERS: 5 | US FAERS | |
| 99 | White blood cell count decreased | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 100 | jaundice | FAERS: 5 | US FAERS | |
| 101 | Asthma | FAERS: 4 | OFFSIDES US FAERS | |
| 102 | Blood urine present | FAERS: 4 | US FAERS | |
| 103 | General physical health deterioration | FAERS: 4 | OFFSIDES US FAERS | |
| 104 | Hypotension | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 105 | Infection | FAERS: 4 | OFFSIDES US FAERS | |
| 106 | Injection site injury | FAERS: 4 | US FAERS | |
| 107 | Mood swings | FAERS: 4 | US FAERS | |
| 108 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 109 | Neutropenia | FAERS: 4 | US FAERS | |
| 110 | Peripheral swelling | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Polyuria | FAERS: 4 | OFFSIDES US FAERS | |
| 112 | Product dose omission | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 113 | Skin laceration | FAERS: 4 | OFFSIDES US FAERS | |
| 114 | Tachycardia | FAERS: 4 | US FAERS | |
| 115 | Thrombosis | FAERS: 4 | US FAERS | |
| 116 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 117 | Abdominal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 118 | Anaphylactoid Reaction | FAERS: 3 | US FAERS | |
| 119 | Arthritis | FAERS: 3 | OFFSIDES US FAERS | |
| 120 | Bedridden | FAERS: 3 | OFFSIDES US FAERS | |
| 121 | Blindness | FAERS: 3 | US FAERS | |
| 122 | Blood cholesterol increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Blood creatinine increased | FAERS: 3 | OFFSIDES US FAERS | |
| 124 | Burning sensation | FAERS: 3 | OFFSIDES US FAERS | |
| 125 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 126 | Cellulitis | FAERS: 3 | OFFSIDES US FAERS | |
| 127 | Choking | FAERS: 3 | US FAERS | |
| 128 | Dementia | FAERS: 3 | US FAERS | |
| 129 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 130 | Dysarthria | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 131 | Eczema Herpeticum | FAERS: 3 | US FAERS | |
| 132 | Epilepsy | FAERS: 3 | OFFSIDES US FAERS | |
| 133 | Epistaxis | FAERS: 3 | OFFSIDES US FAERS | |
| 134 | Eye pain | FAERS: 3 | OFFSIDES US FAERS | |
| 135 | Feeling Cold | FAERS: 3 | US FAERS | |
| 136 | Flatulence | FAERS: 3 | OFFSIDES US FAERS | |
| 137 | Hepatotoxicity | FAERS: 3 | US FAERS | |
| 138 | Hydronephrosis | FAERS: 3 | OFFSIDES US FAERS | |
| 139 | Hypokinesia | FAERS: 3 | US FAERS | |
| 140 | Inflammation | FAERS: 3 | US FAERS | |
| 141 | Injection site discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 142 | Injection site fibrosis | FAERS: 3 | US FAERS | |
| 143 | Injection site infection | FAERS: 3 | US FAERS | |
| 144 | Injection site irritation | FAERS: 3 | OFFSIDES US FAERS | |
| 145 | Injection site ulcer | FAERS: 3 | US FAERS | |
| 146 | Joint Instability | FAERS: 3 | US FAERS | |
| 147 | Joint swelling | FAERS: 3 | US FAERS | |
| 148 | Laryngospasm | FAERS: 3 | US FAERS | |
| 149 | Lethargy | FAERS: 3 | OFFSIDES US FAERS | |
| 150 | Malignant breast lump removal | FAERS: 3 | US FAERS | |
| 151 | Medication Error | FAERS: 3 | US FAERS | |
| 152 | Metastatic Neoplasm | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 153 | Monoplegia | FAERS: 3 | OFFSIDES US FAERS | |
| 154 | Musculoskeletal chest pain | FAERS: 3 | OFFSIDES US FAERS | |
| 155 | Musculoskeletal stiffness | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 156 | Nasopharyngitis | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 157 | Needle issue | FAERS: 3 | US FAERS | |
| 158 | No adverse event | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 159 | Oropharyngeal discomfort | FAERS: 3 | US FAERS | |
| 160 | Oropharyngeal pain | FAERS: 3 | OFFSIDES US FAERS | |
| 161 | Palpitations | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 162 | Pneumonitis | FAERS: 3 | US FAERS | |
| 163 | Pneumothorax | FAERS: 3 | OFFSIDES US FAERS | |
| 164 | Polydipsia | FAERS: 3 | US FAERS | |
| 165 | Right ventricular failure | FAERS: 3 | US FAERS | |
| 166 | Seroma | FAERS: 3 | OFFSIDES US FAERS | |
| 167 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 168 | Somnolence | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 169 | Syringe issue | FAERS: 3 | US FAERS | |
| 170 | Abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 171 | Amnesia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 172 | Angioedema | FAERS: 2 | US FAERS | |
| 173 | Anorexia | FAERS: 2 | OFFSIDES US FAERS | |
| 174 | Aphagia | FAERS: 2 | US FAERS | |
| 175 | Arthropathy | FAERS: 2 | OFFSIDES US FAERS | |
| 176 | Asphyxia | FAERS: 2 | US FAERS | |
| 177 | Blood creatine phosphokinase increased | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 178 | Blood creatinine abnormal | FAERS: 2 | US FAERS | |
| 179 | Blood glucose increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 180 | Bronchitis | FAERS: 2 | OFFSIDES US FAERS | |
| 181 | Cataract | FAERS: 2 | US FAERS | |
| 182 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 183 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 184 | Cold sweat | FAERS: 2 | US FAERS | |
| 185 | Cyanosis | FAERS: 2 | US FAERS | |
| 186 | Cystitis | FAERS: 2 | US FAERS | |
| 187 | Deafness | FAERS: 2 | OFFSIDES US FAERS | |
| 188 | Dermatitis | FAERS: 2 | US FAERS | |
| 189 | Device Failure | FAERS: 2 | OFFSIDES US FAERS | |
| 190 | Device breakage | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Diabetes Insipidus | FAERS: 2 | OFFSIDES US FAERS | |
| 192 | Disease complication | FAERS: 2 | US FAERS | |
| 193 | Disuse syndrome | FAERS: 2 | US FAERS | |
| 194 | Drug administered at inappropriate site | FAERS: 2 | US FAERS | |
| 195 | Drug resistance | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 196 | Dysuria | FAERS: 2 | OFFSIDES US FAERS | |
| 197 | Erysipelas | FAERS: 2 | US FAERS | |
| 198 | Factor VIII Deficiency | FAERS: 2 | US FAERS | |
| 199 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 200 | Hypertrichosis | FAERS: 2 | US FAERS | |
| 201 | Hypophagia | FAERS: 2 | OFFSIDES US FAERS | |
| 202 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 203 | Injection site cellulitis | FAERS: 2 | US FAERS | |
| 204 | Injection site vesicles | FAERS: 2 | US FAERS | |
| 205 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 206 | Joint injury | FAERS: 2 | OFFSIDES US FAERS | |
| 207 | Ketosis | FAERS: 2 | US FAERS | |
| 208 | Leukopenia | FAERS: 2 | US FAERS | |
| 209 | Limb discomfort | FAERS: 2 | US FAERS | |
| 210 | Limb injury | FAERS: 2 | US FAERS | |
| 211 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 212 | Lymphoma | FAERS: 2 | US FAERS | |
| 213 | Memory impairment | FAERS: 2 | US FAERS | |
| 214 | Menopause | FAERS: 2 | US FAERS | |
| 215 | Miliaria | FAERS: 2 | US FAERS | |
| 216 | Neck Pain | FAERS: 2 | US FAERS | |
| 217 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 218 | Pallor | FAERS: 2 | US FAERS | |
| 219 | Pancreatitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 220 | Pancytopenia | FAERS: 2 | US FAERS | |
| 221 | Peripheral nerve lesion | FAERS: 2 | US FAERS | |
| 222 | Portal Vein Thrombosis | FAERS: 2 | US FAERS | |
| 223 | Post procedural complication | FAERS: 2 | US FAERS | |
| 224 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 225 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 226 | Renal pain | FAERS: 2 | US FAERS | |
| 227 | Restlessness | FAERS: 2 | US FAERS | |
| 228 | Retching | FAERS: 2 | US FAERS | |
| 229 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 230 | Sepsis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 231 | Shoulder Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 232 | Skin reaction | FAERS: 2 | US FAERS | |
| 233 | Sneezing | FAERS: 2 | US FAERS | |
| 234 | Subcutaneous Abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 235 | Suicide attempt | FAERS: 2 | US FAERS | |
| 236 | Therapy cessation | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 237 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 238 | Trichorrhexis | FAERS: 2 | US FAERS | |
| 239 | Ulcer | FAERS: 2 | US FAERS | |
| 240 | Uterine Cancer | FAERS: 2 | US FAERS | |
| 241 | Vasculitis | FAERS: 2 | US FAERS | |
| 242 | Visual disturbance | FAERS: 2 | US FAERS | |
| 243 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 244 | Accidental overdose | FAERS: 1 | OFFSIDES US FAERS | |
| 245 | Acne | FAERS: 1 | US FAERS | |
| 246 | Acute Coronary Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 247 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 248 | Administration site abscess | FAERS: 1 | US FAERS | |
| 249 | Administration site urticaria | FAERS: 1 | US FAERS | |
| 250 | Ageusia | FAERS: 1 | OFFSIDES US FAERS | |
| 251 | Akathisia | FAERS: 1 | US FAERS | |
| 252 | Allergic bronchitis | FAERS: 1 | US FAERS | |
| 253 | Altered state of consciousness | FAERS: 1 | OFFSIDES US FAERS | |
| 254 | Anger | FAERS: 1 | OFFSIDES US FAERS | |
| 255 | Ankle Fracture | FAERS: 1 | OFFSIDES US FAERS | |
| 256 | Apathy | FAERS: 1 | US FAERS | |
| 257 | Back disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 258 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 259 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 260 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 261 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 262 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 263 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 264 | Blood iron decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 265 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 266 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 267 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 268 | Blood pressure immeasurable | FAERS: 1 | OFFSIDES US FAERS | |
| 269 | Blood thyroid stimulating hormone decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 270 | Bradycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 271 | Breast engorgement | FAERS: 1 | US FAERS | |
| 272 | Breast necrosis | FAERS: 1 | US FAERS | |
| 273 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 274 | Bursitis | FAERS: 1 | OFFSIDES US FAERS | |
| 275 | Calcium deficiency | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 276 | Capillary Leak Syndrome | FAERS: 1 | US FAERS | |
| 277 | Carbohydrate antigen 27.29 increased | FAERS: 1 | US FAERS | |
| 278 | Carcinoma | FAERS: 1 | US FAERS | |
| 279 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 280 | Cardiac Tamponade | FAERS: 1 | OFFSIDES US FAERS | |
| 281 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 282 | Carpal Tunnel Syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 283 | Cell marker increased | FAERS: 1 | US FAERS | |
| 284 | Cerebral ataxia | FAERS: 1 | US FAERS | |
| 285 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 286 | Chemotherapy | FAERS: 1 | US FAERS | |
| 287 | Cholecystitis | FAERS: 1 | US FAERS | |
| 288 | Chromaturia | FAERS: 1 | US FAERS | |
| 289 | Circumstance or information capable of leading to device use error | FAERS: 1 | US FAERS | |
| 290 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 291 | Contrast media allergy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 292 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 293 | Crying | FAERS: 1 | OFFSIDES US FAERS | |
| 294 | Culture wound positive | FAERS: 1 | US FAERS | |
| 295 | Cytopenia | FAERS: 1 | US FAERS | |
| 296 | Degenerative bone disease | FAERS: 1 | US FAERS | |
| 297 | Dehydroepiandrosterone increased | FAERS: 1 | US FAERS | |
| 298 | Demyelination | FAERS: 1 | OFFSIDES US FAERS | |
| 299 | Depressed mood | FAERS: 1 | OFFSIDES US FAERS | |
| 300 | Device leakage | FAERS: 1 | US FAERS | |
| 301 | Device malfunction | FAERS: 1 | US FAERS | |
| 302 | Device related infection | FAERS: 1 | OFFSIDES US FAERS | |
| 303 | Disease recurrence | FAERS: 1 | OFFSIDES US FAERS | |
| 304 | Disorientation | FAERS: 1 | US FAERS | |
| 305 | Drooling | FAERS: 1 | US FAERS | |
| 306 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 307 | Dyspareunia | FAERS: 1 | US FAERS | |
| 308 | Ear discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 309 | Early satiety | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 310 | Eczema | FAERS: 1 | OFFSIDES US FAERS | |
| 311 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 312 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 313 | Emotional disorder | FAERS: 1 | US FAERS | |
| 314 | Emotional distress | FAERS: 1 | OFFSIDES US FAERS | |
| 315 | Endometrial Hyperplasia | FAERS: 1 | US FAERS | |
| 316 | Endometrial hypertrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 317 | Endometrial sarcoma | FAERS: 1 | US FAERS | |
| 318 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 319 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 320 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 321 | Fibrosis | FAERS: 1 | US FAERS | |
| 322 | Flank Pain | FAERS: 1 | US FAERS | |
| 323 | Food craving | FAERS: 1 | US FAERS | |
| 324 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 325 | Gastric ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 326 | Gastrocoele | FAERS: 1 | US FAERS | |
| 327 | Gene Mutation | FAERS: 1 | US FAERS | |
| 328 | Genital swelling | FAERS: 1 | OFFSIDES US FAERS | |
| 329 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 330 | Hemiparesis | FAERS: 1 | US FAERS | |
| 331 | Hepatitis A | FAERS: 1 | US FAERS | |
| 332 | Hepatitis | FAERS: 1 | US FAERS | |
| 333 | Hirsutism | FAERS: 1 | US FAERS | |
| 334 | Hoarseness | FAERS: 1 | US FAERS | |
| 335 | Hunger | FAERS: 1 | US FAERS | |
| 336 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 337 | Hyperkeratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 338 | Hypersomnia | FAERS: 1 | US FAERS | |
| 339 | Ileus | FAERS: 1 | US FAERS | |
| 340 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 341 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 342 | Impaired work ability | FAERS: 1 | US FAERS | |
| 343 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 344 | Incision site erythema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 345 | Incoherent | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 346 | Induration | FAERS: 1 | US FAERS | |
| 347 | Injection site cyst | FAERS: 1 | US FAERS | |
| 348 | Injection site hypertrophy | FAERS: 1 | US FAERS | |
| 349 | Injection site scab | FAERS: 1 | US FAERS | |
| 350 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 351 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 352 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 353 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 354 | Iron deficiency | FAERS: 1 | US FAERS | |
| 355 | Laceration | FAERS: 1 | US FAERS | |
| 356 | Lichen Planus | FAERS: 1 | US FAERS | |
| 357 | Lipase increased | FAERS: 1 | US FAERS | |
| 358 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 359 | Lymphangitis | FAERS: 1 | US FAERS | |
| 360 | Lymphopenia | FAERS: 1 | US FAERS | |
| 361 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 362 | Magnesium Deficiency | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 363 | Malabsorption from injection site | FAERS: 1 | US FAERS | |
| 364 | Malignant ascites | FAERS: 1 | OFFSIDES US FAERS | |
| 365 | Mastication disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 366 | Megacolon | FAERS: 1 | US FAERS | |
| 367 | Meningeal disorder | FAERS: 1 | US FAERS | |
| 368 | Menorrhagia | FAERS: 1 | US FAERS | |
| 369 | Metastases to pelvis | FAERS: 1 | US FAERS | |
| 370 | Metastatic pain | FAERS: 1 | OFFSIDES US FAERS | |
| 371 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 372 | Migration of implanted drug | FAERS: 1 | US FAERS | |
| 373 | Monocyte count increased | FAERS: 1 | US FAERS | |
| 374 | Mouth swelling | FAERS: 1 | US FAERS | |
| 375 | Multiple allergies | FAERS: 1 | US FAERS | |
| 376 | Muscle necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 377 | Muscle strain | FAERS: 1 | OFFSIDES US FAERS | |
| 378 | Myopathy | FAERS: 1 | US FAERS | |
| 379 | Myositis | FAERS: 1 | US FAERS | |
| 380 | Nephritis | FAERS: 1 | US FAERS | |
| 381 | Nephrolithiasis | FAERS: 1 | OFFSIDES US FAERS | |
| 382 | Nerve injury | FAERS: 1 | US FAERS | |
| 383 | Nervousness | FAERS: 1 | US FAERS | |
| 384 | Night sweats | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 385 | Nocturia | FAERS: 1 | US FAERS | |
| 386 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 387 | Obesity | FAERS: 1 | US FAERS | |
| 388 | Open wound | FAERS: 1 | OFFSIDES US FAERS | |
| 389 | Optic Neuritis | FAERS: 1 | OFFSIDES US FAERS | |
| 390 | Oral pain | FAERS: 1 | US FAERS | |
| 391 | Osteomyelitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 392 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 393 | Osteosclerosis | FAERS: 1 | OFFSIDES US FAERS | |
| 394 | Pain of skin | FAERS: 1 | US FAERS | |
| 395 | Palmar erythema | FAERS: 1 | US FAERS | |
| 396 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 397 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 398 | Paraplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 399 | Paresis | FAERS: 1 | US FAERS | |
| 400 | Pathological fracture | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 401 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 402 | Performance status decreased | FAERS: 1 | US FAERS | |
| 403 | Pericarditis | FAERS: 1 | US FAERS | |
| 404 | Periostitis | FAERS: 1 | US FAERS | |
| 405 | Personality Change | FAERS: 1 | US FAERS | |
| 406 | Pharyngitis | FAERS: 1 | US FAERS | |
| 407 | Phlebitis | FAERS: 1 | US FAERS | |
| 408 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 409 | Pneumoconiosis | FAERS: 1 | US FAERS | |
| 410 | Post procedural infection | FAERS: 1 | US FAERS | |
| 411 | Procedural complication | FAERS: 1 | US FAERS | |
| 412 | Product contamination | FAERS: 1 | US FAERS | |
| 413 | Product dispensing error | FAERS: 1 | US FAERS | |
| 414 | Product label confusion | FAERS: 1 | US FAERS | |
| 415 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 416 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 417 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 418 | Prothrombin level decreased | FAERS: 1 | US FAERS | |
| 419 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 420 | Pulmonary congestion | FAERS: 1 | OFFSIDES US FAERS | |
| 421 | Purpura | FAERS: 1 | US FAERS | |
| 422 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 423 | Radicular pain | FAERS: 1 | OFFSIDES US FAERS | |
| 424 | Refractory cancer | FAERS: 1 | US FAERS | |
| 425 | Respiratory arrest | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 426 | Respiratory distress | FAERS: 1 | US FAERS | |
| 427 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 428 | Rhinalgia | FAERS: 1 | US FAERS | |
| 429 | Rhinitis | FAERS: 1 | OFFSIDES US FAERS | |
| 430 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 431 | Scab | FAERS: 1 | US FAERS | |
| 432 | Sense of oppression | FAERS: 1 | US FAERS | |
| 433 | Sinusitis | FAERS: 1 | OFFSIDES US FAERS | |
| 434 | Skin discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 435 | Skin irritation | FAERS: 1 | US FAERS | |
| 436 | Skin necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 437 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 438 | Sopor | FAERS: 1 | US FAERS | |
| 439 | Spinal column injury | FAERS: 1 | US FAERS | |
| 440 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 441 | Stridor | FAERS: 1 | US FAERS | |
| 442 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 443 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 444 | Thrombophlebitis | FAERS: 1 | OFFSIDES US FAERS | |
| 445 | Tooth Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 446 | Tooth Loss | FAERS: 1 | OFFSIDES US FAERS | |
| 447 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 448 | Traumatic fracture | FAERS: 1 | US FAERS | |
| 449 | Tuberculosis | FAERS: 1 | US FAERS | |
| 450 | Underweight | FAERS: 1 | US FAERS | |
| 451 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 452 | VIIth nerve paralysis | FAERS: 1 | OFFSIDES US FAERS | |
| 453 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 454 | Venous Injury | FAERS: 1 | US FAERS | |
| 455 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 456 | Visual Impairment | FAERS: 1 | US FAERS | |
| 457 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 458 | Vulvovaginal dryness | FAERS: 1 | OFFSIDES US FAERS | |
| 459 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 460 | Vulvovaginal pruritus | FAERS: 1 | OFFSIDES US FAERS | |
| 461 | Wound necrosis | FAERS: 1 | US FAERS | |
| 462 | nervous system disorder | FAERS: 1 | US FAERS | |
| 463 | Abdominal mass | OFFSIDES | ||
| 464 | Abnormal vision | OFFSIDES | ||
| 465 | Acid reflux | OFFSIDES | ||
| 466 | Actinic keratosis | OFFSIDES | ||
| 467 | Actinomycosis | OFFSIDES | ||
| 468 | Acute bronchitis | OFFSIDES | ||
| 469 | Acute respiratory failure | OFFSIDES | ||
| 470 | Adenocarcinoma | OFFSIDES | ||
| 471 | Adenoma | OFFSIDES | ||
| 472 | Adnexa uteri cyst | OFFSIDES | ||
| 473 | Adrenal mass | OFFSIDES | ||
| 474 | Agraphia | OFFSIDES | ||
| 475 | Albumin globulin ratio decreased | OFFSIDES | ||
| 476 | Allergic sinusitis | OFFSIDES | ||
| 477 | Altered bowel function | OFFSIDES | ||
| 478 | Altered visual depth perception | OFFSIDES | ||
| 479 | Alveolitis | OFFSIDES | ||
| 480 | Alveoloplasty | OFFSIDES | ||
| 481 | Amaurosis Fugax | OFFSIDES | ||
| 482 | Ammonia increased | OFFSIDES | ||
| 483 | Amputation | OFFSIDES | ||
| 484 | Aneurysm | OFFSIDES | ||
| 485 | Angiofibroma | OFFSIDES | ||
| 486 | Anhedonia | OFFSIDES | ||
| 487 | Anhidrosis | OFFSIDES | ||
| 488 | Aortic Aneurysm | OFFSIDES | ||
| 489 | Aortic valve sclerosis | OFFSIDES | ||
| 490 | Aphthous Stomatitis | OFFSIDES | ||
| 491 | Appendectomy | OFFSIDES | ||
| 492 | Appendicitis | OFFSIDES | ||
| 493 | Arteriosclerosis | OFFSIDES | ||
| 494 | Aspiration Pneumonia | OFFSIDES | ||
| 495 | Asthenopia | OFFSIDES | ||
| 496 | Ataxia | OFFSIDES | ||
| 497 | Atelectasis | OFFSIDES | ||
| 498 | Atrial Flutter | OFFSIDES | ||
| 499 | Atrial tachycardia | OFFSIDES | ||
| 500 | Atrophic vulvovaginitis | OFFSIDES | ||
| 501 | Auricular swelling | OFFSIDES | ||
| 502 | Bacterial disease carrier | OFFSIDES | ||
| 503 | Bacterial test positive | OFFSIDES | ||
| 504 | Basal cell carcinoma | OFFSIDES | ||
| 505 | Benign neoplasm of adrenal gland | OFFSIDES | ||
| 506 | Biopsy bone abnormal | OFFSIDES | ||
| 507 | Blepharospasm | OFFSIDES | ||
| 508 | Blood 25-hydroxycholecalciferol decreased | OFFSIDES | ||
| 509 | Blood alkaline phosphatase decreased | OFFSIDES | ||
| 510 | Blood cholesterol | OFFSIDES | ||
| 511 | Blood cortisol abnormal | OFFSIDES | ||
| 512 | Blood creatine phosphokinase decreased | OFFSIDES | ||
| 513 | Blood homocysteine | OFFSIDES | ||
| 514 | Blood magnesium increased | OFFSIDES | ||
| 515 | Blood sodium increased | OFFSIDES | ||
| 516 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 517 | Blood thyroid stimulating hormone increased | OFFSIDES | ||
| 518 | Blood triglycerides increased | OFFSIDES | ||
| 519 | Blood urea increased | OFFSIDES | ||
| 520 | Blurred vision | OFFSIDES | ||
| 521 | Bone abscess | OFFSIDES | ||
| 522 | Bone density decreased | OFFSIDES | ||
| 523 | Bone fragmentation | OFFSIDES | ||
| 524 | Bone lesion | OFFSIDES | ||
| 525 | Bone swelling | OFFSIDES | ||
| 526 | Bone trimming | OFFSIDES | ||
| 527 | Bowel movement irregularity | OFFSIDES | ||
| 528 | Breast prosthesis user | OFFSIDES | ||
| 529 | Bruxism | OFFSIDES | ||
| 530 | Bunion operation | OFFSIDES | ||
| 531 | Bunion | OFFSIDES | ||
| 532 | Carcinoembryonic antigen increased | OFFSIDES | ||
| 533 | Cardiac stress test abnormal | OFFSIDES | ||
| 534 | Carotid bruit | OFFSIDES | ||
| 535 | Cataract operation | OFFSIDES | ||
| 536 | Catheter placement | OFFSIDES | ||
| 537 | Cauda Equina Syndrome | OFFSIDES | ||
| 538 | Causalgia | OFFSIDES | ||
| 539 | Central nervous system lesion | OFFSIDES | ||
| 540 | Central venous catheter removal | OFFSIDES | ||
| 541 | Cerebral Arteriosclerosis | OFFSIDES | ||
| 542 | Cerebral atrophy | OFFSIDES | ||
| 543 | Cervical cord compression | OFFSIDES | ||
| 544 | Cervical dysplasia | OFFSIDES | ||
| 545 | Cervical polyp | OFFSIDES | ||
| 546 | Choking sensation | OFFSIDES | ||
| 547 | Chondromalacia | OFFSIDES | ||
| 548 | Chondroplasty | OFFSIDES | ||
| 549 | Chromosome Aberrations | 21059909 | CTD | |
| 550 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 551 | Cirrhosis | OFFSIDES | ||
| 552 | Colitis | OFFSIDES | ||
| 553 | Compression fracture | OFFSIDES | ||
| 554 | Confabulation | OFFSIDES | ||
| 555 | Conjunctival deposit | OFFSIDES | ||
| 556 | Contact Dermatitis | OFFSIDES | ||
| 557 | Craniotomy | OFFSIDES | ||
| 558 | Creatinine renal clearance increased | OFFSIDES | ||
| 559 | Culture positive | OFFSIDES | ||
| 560 | Cyst drainage | OFFSIDES | ||
| 561 | Cystocele | OFFSIDES | ||
| 562 | Cyst | OFFSIDES | ||
| 563 | Deafness Neurosensory | OFFSIDES | ||
| 564 | Debridement | OFFSIDES | ||
| 565 | Decreased Libido | OFFSIDES | ||
| 566 | Dental Plaque | OFFSIDES | ||
| 567 | Dental abscess | OFFSIDES | ||
| 568 | Dental caries | OFFSIDES | ||
| 569 | Dental cleaning | OFFSIDES | ||
| 570 | Dental examination | OFFSIDES | ||
| 571 | Dental prosthesis placement | OFFSIDES | ||
| 572 | Denture wearer | OFFSIDES | ||
| 573 | Device occlusion | OFFSIDES | ||
| 574 | Diabetic Foot | OFFSIDES | ||
| 575 | Diarrhea | OFFSIDES | ||
| 576 | Diastolic dysfunction | OFFSIDES | ||
| 577 | Diplopia | OFFSIDES | ||
| 578 | Diverticulitis | OFFSIDES | ||
| 579 | Diverticulosis | OFFSIDES | ||
| 580 | Diverticulum | OFFSIDES | ||
| 581 | Drowsiness | OFFSIDES | ||
| 582 | Drug addict | OFFSIDES | ||
| 583 | Drug withdrawal headache | OFFSIDES | ||
| 584 | Duodenitis | OFFSIDES | ||
| 585 | Dysmorphism | OFFSIDES | ||
| 586 | Dyspepsia | OFFSIDES | ||
| 587 | Dysphemia | OFFSIDES | ||
| 588 | Dysthymic Disorder | OFFSIDES | ||
| 589 | Ear congestion | OFFSIDES | ||
| 590 | Eating disorder symptom | OFFSIDES | ||
| 591 | Economic problem | OFFSIDES | ||
| 592 | Ejection fraction abnormal | OFFSIDES | ||
| 593 | Electrocardiogram ST-T change | OFFSIDES | ||
| 594 | Embryo Loss | 30061528 | CTD | |
| 595 | Encephalomalacia | OFFSIDES | ||
| 596 | Endocarditis | OFFSIDES | ||
| 597 | Endodontic procedure | OFFSIDES | ||
| 598 | Endometriosis | OFFSIDES | ||
| 599 | Enterocutaneous Fistula | OFFSIDES | ||
| 600 | Epidermal growth factor receptor increased | OFFSIDES | ||
| 601 | Escherichia sepsis | OFFSIDES | ||
| 602 | Essential Hypertension | OFFSIDES | ||
| 603 | Ethmoid sinus surgery | OFFSIDES | ||
| 604 | Eye Infection | OFFSIDES | ||
| 605 | Facial Neuralgia | OFFSIDES | ||
| 606 | Failure of implant | OFFSIDES | ||
| 607 | Fat necrosis | OFFSIDES | ||
| 608 | Fatty Liver | OFFSIDES | ||
| 609 | Fibromyalgia | OFFSIDES | ||
| 610 | Fistula repair | OFFSIDES | ||
| 611 | Flat affect | OFFSIDES | ||
| 612 | Fluid overload | OFFSIDES | ||
| 613 | Formication | OFFSIDES | ||
| 614 | Gangrene | OFFSIDES | ||
| 615 | Gastrointestinal inflammation | OFFSIDES | ||
| 616 | Gastrointestinal sounds abnormal | OFFSIDES | ||
| 617 | Gastrostomy | OFFSIDES | ||
| 618 | General physical condition | OFFSIDES | ||
| 619 | Genital Herpes | OFFSIDES | ||
| 620 | Gingival Hyperplasia | OFFSIDES | ||
| 621 | Gliosis | OFFSIDES | ||
| 622 | Glossitis | OFFSIDES | ||
| 623 | Goiter | OFFSIDES | ||
| 624 | Granulocytosis | OFFSIDES | ||
| 625 | Granuloma | OFFSIDES | ||
| 626 | Hay fever | OFFSIDES | ||
| 627 | Hearing aid user | OFFSIDES | ||
| 628 | Hepatic cancer metastatic | OFFSIDES | ||
| 629 | Hepatosplenomegaly | OFFSIDES | ||
| 630 | Hordeolum | OFFSIDES | ||
| 631 | Hospice Care | OFFSIDES | ||
| 632 | Hydrocephalus | OFFSIDES | ||
| 633 | Hypermetabolism | OFFSIDES | ||
| 634 | Hypertrophy | 18634860 | CTD | |
| 635 | Hypoaesthesia facial | OFFSIDES | ||
| 636 | Hypomania | OFFSIDES | ||
| 637 | Hysterectomy | OFFSIDES | ||
| 638 | Ileitis | OFFSIDES | ||
| 639 | Incontinence | OFFSIDES | ||
| 640 | Inguinal mass | OFFSIDES | ||
| 641 | Intention tremor | OFFSIDES | ||
| 642 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 643 | Intervertebral disc compression | OFFSIDES | ||
| 644 | Intervertebral disc disorder | OFFSIDES | ||
| 645 | Intestinal resection | OFFSIDES | ||
| 646 | Intracranial Aneurysm | OFFSIDES | ||
| 647 | Joint Range of Motion Decreased | OFFSIDES | ||
| 648 | Joint prosthesis user | OFFSIDES | ||
| 649 | Joint sprain | OFFSIDES | ||
| 650 | Keratitis sicca | OFFSIDES | ||
| 651 | Keratomileusis | OFFSIDES | ||
| 652 | Lactose Intolerance | OFFSIDES | ||
| 653 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 654 | Left atrial dilatation | OFFSIDES | ||
| 655 | Lesion excision | OFFSIDES | ||
| 656 | Leukodystrophy | OFFSIDES | ||
| 657 | Life expectancy shortened | OFFSIDES | ||
| 658 | Loose tooth | OFFSIDES | ||
| 659 | Lumbar radiculopathy | OFFSIDES | ||
| 660 | Lung hyperinflation | OFFSIDES | ||
| 661 | Lymph node palpable | OFFSIDES | ||
| 662 | Lymphedema | OFFSIDES | ||
| 663 | Lymphocyte count decreased | OFFSIDES | ||
| 664 | Lymphocyte percentage decreased | OFFSIDES | ||
| 665 | Macrocytosis | OFFSIDES | ||
| 666 | Mastectomy | OFFSIDES | ||
| 667 | Maxillofacial operation | OFFSIDES | ||
| 668 | Mechanical ventilation | OFFSIDES | ||
| 669 | Medical device complication | OFFSIDES | ||
| 670 | Medical device removal | OFFSIDES | ||
| 671 | Memory Disorders | 25074486 | CTD | |
| 672 | Meningioma surgery | OFFSIDES | ||
| 673 | Meningioma | OFFSIDES | ||
| 674 | Meniscus removal | OFFSIDES | ||
| 675 | Mental status changes | OFFSIDES | ||
| 676 | Metaplasia | OFFSIDES | ||
| 677 | Metastases to abdominal cavity | OFFSIDES | ||
| 678 | Metastases to nasal sinuses | OFFSIDES | ||
| 679 | Metastases to stomach | OFFSIDES | ||
| 680 | Metastases to thorax | OFFSIDES | ||
| 681 | Microcytosis | OFFSIDES | ||
| 682 | Modified radical mastectomy | OFFSIDES | ||
| 683 | Monocyte percentage increased | OFFSIDES | ||
| 684 | Mononeuritis | OFFSIDES | ||
| 685 | Mouth cyst | OFFSIDES | ||
| 686 | Mucosal atrophy | OFFSIDES | ||
| 687 | Muscle Weakness | OFFSIDES | ||
| 688 | Musculoskeletal discomfort | OFFSIDES | ||
| 689 | Myelodysplasia | OFFSIDES | ||
| 690 | Myelomalacia | OFFSIDES | ||
| 691 | Nasal mucosal disorder | OFFSIDES | ||
| 692 | Neoplasm Invasiveness | 20951759 26546977 27366082 | CTD | |
| 693 | Nephrotic Syndrome | OFFSIDES | ||
| 694 | Nerve Block | OFFSIDES | ||
| 695 | Nerve Degeneration | 16951259 | CTD | |
| 696 | Nerve Root Compression | OFFSIDES | ||
| 697 | Neuroblastoma | 27366082 | CTD | |
| 698 | Nodal osteoarthritis | OFFSIDES | ||
| 699 | Non-small cell lung cancer recurrent | OFFSIDES | ||
| 700 | Occult blood positive | OFFSIDES | ||
| 701 | Oliguria | OFFSIDES | ||
| 702 | Open reduction of fracture | OFFSIDES | ||
| 703 | Optic Neuropathy | OFFSIDES | ||
| 704 | Oral Cavity Fistula | OFFSIDES | ||
| 705 | Oral infection | OFFSIDES | ||
| 706 | Oral mucosal exfoliation | OFFSIDES | ||
| 707 | Oral polypectomy | OFFSIDES | ||
| 708 | Oroantral Fistula | OFFSIDES | ||
| 709 | Oropharyngeal plaque | OFFSIDES | ||
| 710 | Orthosis user | OFFSIDES | ||
| 711 | Osteolysis | OFFSIDES | ||
| 712 | Osteopenia | OFFSIDES | ||
| 713 | Osteoporosis | OFFSIDES | ||
| 714 | Osteoradionecrosis | OFFSIDES | ||
| 715 | Oxygen supplementation | OFFSIDES | ||
| 716 | Pancreatic Cyst | OFFSIDES | ||
| 717 | Pancreatic Neoplasm | OFFSIDES | ||
| 718 | Pancreatic calcification | OFFSIDES | ||
| 719 | Panic Disorder | OFFSIDES | ||
| 720 | Paracentesis | OFFSIDES | ||
| 721 | Parakeratosis | OFFSIDES | ||
| 722 | Parathyroidectomy | OFFSIDES | ||
| 723 | Periarthritis | OFFSIDES | ||
| 724 | Periodontal infection | OFFSIDES | ||
| 725 | Periodontitis | OFFSIDES | ||
| 726 | Perivascular dermatitis | OFFSIDES | ||
| 727 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 728 | Physical disability | OFFSIDES | ||
| 729 | Pleurodesis | OFFSIDES | ||
| 730 | Pneumonectomy | OFFSIDES | ||
| 731 | Poisoning | 18324785 | CTD | |
| 732 | Polyneuropathy | OFFSIDES | ||
| 733 | Poor dental condition | OFFSIDES | ||
| 734 | Poor personal hygiene | OFFSIDES | ||
| 735 | Poor quality sleep | Canada Vigilance: 1 | Canada Vigilance | |
| 736 | Post procedural discharge | OFFSIDES | ||
| 737 | Postmenopausal bleeding | OFFSIDES | ||
| 738 | Posturing | OFFSIDES | ||
| 739 | Primary sequestrum | OFFSIDES | ||
| 740 | Procollagen type I C-terminal propeptide increased | OFFSIDES | ||
| 741 | Productive Cough | OFFSIDES | ||
| 742 | Prolapse repair | OFFSIDES | ||
| 743 | Protein total decreased | OFFSIDES | ||
| 744 | Psychomotor Agitation | 25074486 | CTD | |
| 745 | Pulmonary Hypertension | OFFSIDES | ||
| 746 | Pulmonary radiation injury | OFFSIDES | ||
| 747 | Purulence | OFFSIDES | ||
| 748 | Purulent discharge | OFFSIDES | ||
| 749 | Radiotherapy to brain | OFFSIDES | ||
| 750 | Rales | OFFSIDES | ||
| 751 | Reaction to medical agent preservatives | OFFSIDES | ||
| 752 | Rectal fissure | OFFSIDES | ||
| 753 | Rectocele | OFFSIDES | ||
| 754 | Red blood cell schistocytes present | OFFSIDES | ||
| 755 | Renal cyst | OFFSIDES | ||
| 756 | Residual urine | OFFSIDES | ||
| 757 | Respiratory tract congestion | OFFSIDES | ||
| 758 | Retinal Vasculitis | OFFSIDES | ||
| 759 | Retinal Vein Occlusion | OFFSIDES | ||
| 760 | Rhonchi | OFFSIDES | ||
| 761 | Risus sardonicus | OFFSIDES | ||
| 762 | Salpingo-oophorectomy | OFFSIDES | ||
| 763 | Sarcoidosis | OFFSIDES | ||
| 764 | Secretion discharge | OFFSIDES | ||
| 765 | Septoplasty | OFFSIDES | ||
| 766 | Sequestrectomy | OFFSIDES | ||
| 767 | Single functional kidney | OFFSIDES | ||
| 768 | Sinus antrostomy | OFFSIDES | ||
| 769 | Sinus bradycardia | OFFSIDES | ||
| 770 | Sinus headache | OFFSIDES | ||
| 771 | Sinus operation | OFFSIDES | ||
| 772 | Sjogren's Syndrome | OFFSIDES | ||
| 773 | Skin lesion | OFFSIDES | ||
| 774 | Spinal claudication | OFFSIDES | ||
| 775 | Spinal column stenosis | OFFSIDES | ||
| 776 | Spinal corpectomy | OFFSIDES | ||
| 777 | Spinal fusion surgery | OFFSIDES | ||
| 778 | Spondylolisthesis | OFFSIDES | ||
| 779 | Stress | OFFSIDES | ||
| 780 | Subcutaneous Emphysema | OFFSIDES | ||
| 781 | Superior Vena Cava Syndrome | OFFSIDES | ||
| 782 | Suture insertion | OFFSIDES | ||
| 783 | Synovial Cyst | OFFSIDES | ||
| 784 | Thoracotomy | OFFSIDES | ||
| 785 | Tinnitus | OFFSIDES | ||
| 786 | Toe operation | OFFSIDES | ||
| 787 | Tooth Erosion | OFFSIDES | ||
| 788 | Tooth Extraction | OFFSIDES | ||
| 789 | Tooth repair | OFFSIDES | ||
| 790 | Transferrin decreased | OFFSIDES | ||
| 791 | Tricuspid valve sclerosis | OFFSIDES | ||
| 792 | Unresponsive to stimuli | OFFSIDES | ||
| 793 | Urethral Stenosis | OFFSIDES | ||
| 794 | Urinary tract infection enterococcal | OFFSIDES | ||
| 795 | Uterine Prolapse | OFFSIDES | ||
| 796 | Vaginal burning sensation | OFFSIDES | ||
| 797 | Vaginoplasty | OFFSIDES | ||
| 798 | Vascular anomaly | OFFSIDES | ||
| 799 | Vascular calcification | OFFSIDES | ||
| 800 | Vena cava injury | OFFSIDES | ||
| 801 | Venous Insufficiency | OFFSIDES | ||
| 802 | Venous occlusion | OFFSIDES | ||
| 803 | Venous stenosis | OFFSIDES | ||
| 804 | Vertebral wedging | OFFSIDES | ||
| 805 | Vertebroplasty | OFFSIDES | ||
| 806 | Viral labyrinthitis | OFFSIDES | ||
| 807 | Vitamin A Deficiency | OFFSIDES | ||
| 808 | Walking aid user | OFFSIDES | ||
| 809 | Wheelchair user | OFFSIDES | ||
| 810 | Wound Debridement | OFFSIDES | ||
| 811 | Wound Infection | OFFSIDES | ||
| 812 | Wound dehiscence | OFFSIDES | ||
| 813 | Wound infection staphylococcal | OFFSIDES | ||
| 814 | kyphosis | OFFSIDES | ||
| 815 | rhinoplasty | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.