Warfarin
(KYITYFHKDODNCQ-UHFFFAOYSA-M)
Structure
- SMILES
- CC(=O)CC(c1c(=O)oc2c(c1[O-])cccc2)c1ccccc1.[Na+]
- Molecular Formula:
- C19H15NaO4
- Molecular Weight:
- 330.310
- Log P:
- 4.0478
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 70.34
- CAS Number(s):
- 129-06-6; 5543-79-3; 67430-45-9
Synonym(s)
1.
Warfarin
2.
4-Hydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one
3.
Aldocumar
4.
Apo-Warfarin
5.
Coumadin
6.
Coumadine
7.
Gen-Warfarin
8.
Marevan
9.
Tedicumar
10.
Warfant
11.
Warfarin Potassium
12.
Warfarin Sodium
13.
Potassium, Warfarin
14.
Sodium, Warfarin
External Link(s)
| MeSH | D014859 |
| PubChem Compound | 16204922 |
| BindingDB | 50248297 |
| CHEMBL | CHEMBL1200879 |
| KEGG | dr:D00564 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Epistaxis | FAERS: 190 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Asthenia | FAERS: 142 | US FAERS | |
| 3 | Drug ineffective | FAERS: 133 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Cerebrovascular accident | FAERS: 113 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Overdose | FAERS: 113 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Dizziness | FAERS: 99 | US FAERS | |
| 7 | Thrombosis | FAERS: 97 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Pharmaceutical product complaint | FAERS: 95 | US FAERS | |
| 9 | Calciphylaxis | FAERS: 94 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Adverse event | FAERS: 93 | US FAERS | |
| 11 | Deep Vein Thrombosis | FAERS: 87 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Nausea | FAERS: 78 | US FAERS | |
| 13 | Drug toxicity | FAERS: 77 | US FAERS | |
| 14 | Atrial Fibrillation | FAERS: 76 | US FAERS | |
| 15 | Hypotension | FAERS: 76 | US FAERS | |
| 16 | Maternal exposure during pregnancy | FAERS: 71 | US FAERS | |
| 17 | Vomiting | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Abdominal Pain | FAERS: 65 | US FAERS | |
| 19 | Headache | FAERS: 64 | US FAERS | |
| 20 | Fatigue | FAERS: 60 | US FAERS | |
| 21 | Skin necrosis | FAERS: 59 | US FAERS | |
| 22 | Product substitution issue | FAERS: 58 | US FAERS | |
| 23 | Pain | FAERS: 53 | US FAERS | |
| 24 | Pulmonary Embolism | FAERS: 49 | US FAERS | |
| 25 | Ecchymosis | FAERS: 47 | US FAERS | |
| 26 | Malaise | FAERS: 46 | US FAERS | |
| 27 | Medication Error | FAERS: 44 | US FAERS | |
| 28 | Pneumonia | FAERS: 43 | US FAERS | |
| 29 | Product quality issue | FAERS: 42 | US FAERS | |
| 30 | Incorrect dose administered | FAERS: 41 | US FAERS | |
| 31 | Urinary tract infection | FAERS: 39 | US FAERS | |
| 32 | Prothrombin time abnormal | FAERS: 37 | US FAERS | |
| 33 | Alopecia | FAERS: 35 | US FAERS | |
| 34 | Pruritus | FAERS: 32 | US FAERS | |
| 35 | Syncope | FAERS: 31 | US FAERS | |
| 36 | Respiratory Failure | FAERS: 30 | US FAERS | |
| 37 | Weight decreased | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Chest Pain | FAERS: 27 | US FAERS | |
| 39 | Anticoagulation drug level above therapeutic | FAERS: 26 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 40 | Arthralgia | FAERS: 26 | US FAERS | |
| 41 | Blood urine present | FAERS: 26 | US FAERS | |
| 42 | Acute kidney injury | FAERS: 24 | US FAERS | |
| 43 | Swelling | FAERS: 24 | US FAERS | |
| 44 | Drug dispensing error | FAERS: 23 | US FAERS | |
| 45 | Hypersensitivity | FAERS: 23 | US FAERS | |
| 46 | Therapeutic response unexpected with drug substitution | FAERS: 23 | US FAERS | |
| 47 | Anticoagulation drug level below therapeutic | FAERS: 22 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 48 | Feeling abnormal | FAERS: 22 | US FAERS | |
| 49 | Back Pain | FAERS: 21 | US FAERS | |
| 50 | Diverticulum | FAERS: 21 | US FAERS | |
| 51 | Constipation | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Mental status changes | FAERS: 20 | US FAERS | |
| 53 | Myocardial Infarction | FAERS: 20 | US FAERS | |
| 54 | Accidental overdose | FAERS: 19 | US FAERS | |
| 55 | Cardiac Arrest | FAERS: 19 | US FAERS | |
| 56 | Sepsis | FAERS: 19 | US FAERS | |
| 57 | Blood creatinine increased | FAERS: 18 | US FAERS | |
| 58 | General physical health deterioration | FAERS: 17 | US FAERS | |
| 59 | Gastric ulcer | FAERS: 16 | US FAERS | |
| 60 | Gastritis | FAERS: 16 | US FAERS | |
| 61 | Peripheral swelling | FAERS: 16 | US FAERS | |
| 62 | Cardiac Tamponade | FAERS: 15 | US FAERS | |
| 63 | Cerebral Infarction | FAERS: 15 | US FAERS | |
| 64 | Dehydration | FAERS: 15 | US FAERS | |
| 65 | Laceration | FAERS: 15 | US FAERS | |
| 66 | Live Birth | FAERS: 15 | US FAERS | |
| 67 | Pallor | FAERS: 15 | US FAERS | |
| 68 | Skin Ulcer | FAERS: 15 | US FAERS | |
| 69 | Erythema | FAERS: 14 | US FAERS | |
| 70 | Infection | FAERS: 14 | US FAERS | |
| 71 | Joint swelling | FAERS: 14 | US FAERS | |
| 72 | Respiratory distress | FAERS: 14 | US FAERS | |
| 73 | Hypophagia | FAERS: 13 | US FAERS | |
| 74 | Tachycardia | FAERS: 13 | US FAERS | |
| 75 | Unresponsive to stimuli | FAERS: 13 | US FAERS | |
| 76 | Abdominal discomfort | FAERS: 12 | US FAERS | |
| 77 | Embolism | FAERS: 12 | US FAERS | |
| 78 | Product use in unapproved indication | FAERS: 12 | US FAERS | |
| 79 | Urticaria | FAERS: 12 | US FAERS | |
| 80 | Duodenal Ulcer | FAERS: 11 | US FAERS | |
| 81 | Occult blood positive | FAERS: 11 | US FAERS | |
| 82 | Post procedural complication | FAERS: 11 | US FAERS | |
| 83 | Urinary Retention | FAERS: 11 | US FAERS | |
| 84 | Blue Toe Syndrome | FAERS: 10 | US FAERS | |
| 85 | Drug administered to patient of inappropriate age | FAERS: 10 | US FAERS | |
| 86 | Lethargy | FAERS: 10 | US FAERS | |
| 87 | Menorrhagia | FAERS: 10 | US FAERS | |
| 88 | Palpitations | FAERS: 10 | US FAERS | |
| 89 | Thrombocytopenia | FAERS: 10 | US FAERS | |
| 90 | Wrong drug administered | FAERS: 10 | US FAERS | |
| 91 | Abasia | FAERS: 9 | US FAERS | |
| 92 | Acute myocardial infarction | FAERS: 9 | US FAERS | |
| 93 | Aphasia | FAERS: 9 | US FAERS | |
| 94 | Blindness | FAERS: 9 | US FAERS | |
| 95 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 96 | Discomfort | FAERS: 9 | US FAERS | |
| 97 | Dysarthria | FAERS: 9 | US FAERS | |
| 98 | Hypoxia | FAERS: 9 | US FAERS | |
| 99 | Increased tendency to bruise | FAERS: 9 | US FAERS | |
| 100 | Intestinal Obstruction | FAERS: 9 | US FAERS | |
| 101 | Leukocytoclastic vasculitis | FAERS: 9 | US FAERS | |
| 102 | Musculoskeletal Pain | FAERS: 9 | US FAERS | |
| 103 | Prothrombin level abnormal | FAERS: 9 | US FAERS | |
| 104 | Somnolence | FAERS: 9 | US FAERS | |
| 105 | treatment failure | FAERS: 9 | US FAERS | |
| 106 | Blood urea increased | FAERS: 8 | US FAERS | |
| 107 | Bone density decreased | FAERS: 8 | US FAERS | |
| 108 | Catheter related complication | FAERS: 8 | US FAERS | |
| 109 | Cellulitis | FAERS: 8 | US FAERS | |
| 110 | Diverticulitis | FAERS: 8 | US FAERS | |
| 111 | Hemiparesis | FAERS: 8 | US FAERS | |
| 112 | Ileus | FAERS: 8 | US FAERS | |
| 113 | Joint injury | FAERS: 8 | US FAERS | |
| 114 | Necrosis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Pregnancy | FAERS: 8 | US FAERS | |
| 116 | Prothrombin level decreased | FAERS: 8 | US FAERS | |
| 117 | Shock | FAERS: 8 | US FAERS | |
| 118 | Anuria | FAERS: 7 | US FAERS | |
| 119 | Anxiety | FAERS: 7 | US FAERS | |
| 120 | Aortic Aneurysm | FAERS: 7 | US FAERS | |
| 121 | Atrial thrombosis | FAERS: 7 | US FAERS | |
| 122 | Cardiac valve replacement complication | FAERS: 7 | US FAERS | |
| 123 | Circumstance or information capable of leading to medication error | FAERS: 7 | US FAERS | |
| 124 | Drug exposure during pregnancy | FAERS: 7 | US FAERS | |
| 125 | Dysmorphism | FAERS: 7 | US FAERS | |
| 126 | Flank Pain | FAERS: 7 | US FAERS | |
| 127 | Hydrocephalus | FAERS: 7 | US FAERS | |
| 128 | Mallory-Weiss Syndrome | FAERS: 7 | US FAERS | |
| 129 | Product use issue | FAERS: 7 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 130 | Skin lesion | FAERS: 7 | US FAERS | |
| 131 | Toxicity to various agents | FAERS: 7 | US FAERS | |
| 132 | Tremor | FAERS: 7 | US FAERS | |
| 133 | Abdominal Compartment Syndrome | FAERS: 6 | US FAERS | |
| 134 | Abdominal tenderness | FAERS: 6 | US FAERS | |
| 135 | Blood potassium decreased | FAERS: 6 | US FAERS | |
| 136 | Chest discomfort | FAERS: 6 | US FAERS | |
| 137 | Chromaturia | FAERS: 6 | US FAERS | |
| 138 | Dementia | FAERS: 6 | US FAERS | |
| 139 | Depressed Level of Consciousness | FAERS: 6 | US FAERS | |
| 140 | Disseminated Intravascular Coagulation | FAERS: 6 | US FAERS | |
| 141 | Drug prescribing error | FAERS: 6 | US FAERS | |
| 142 | Dyspepsia | FAERS: 6 | US FAERS | |
| 143 | Dysuria | FAERS: 6 | US FAERS | |
| 144 | Eosinophilia | FAERS: 6 | US FAERS | |
| 145 | Infarction | FAERS: 6 | US FAERS | |
| 146 | Livedo Reticularis | FAERS: 6 | US FAERS | |
| 147 | Memory impairment | FAERS: 6 | US FAERS | |
| 148 | Myalgia | FAERS: 6 | US FAERS | |
| 149 | Peptic Ulcer | FAERS: 6 | US FAERS | |
| 150 | Petechiae | FAERS: 6 | US FAERS | |
| 151 | Purpura | FAERS: 6 | US FAERS | |
| 152 | Reaction to drug excipients | FAERS: 6 | US FAERS | |
| 153 | Septic Shock | FAERS: 6 | US FAERS | |
| 154 | Skin laceration | FAERS: 6 | US FAERS | |
| 155 | Acute Coronary Syndrome | FAERS: 5 | US FAERS | |
| 156 | Agitation | FAERS: 5 | US FAERS | |
| 157 | Anorexia | FAERS: 5 | US FAERS | |
| 158 | Antiphospholipid Syndrome | FAERS: 5 | US FAERS | |
| 159 | Arthritis | FAERS: 5 | US FAERS | |
| 160 | Ascites | FAERS: 5 | US FAERS | |
| 161 | Bronchitis | FAERS: 5 | US FAERS | |
| 162 | Colitis | FAERS: 5 | US FAERS | |
| 163 | Debridement | FAERS: 5 | US FAERS | |
| 164 | Diabetes Mellitus | FAERS: 5 | US FAERS | |
| 165 | Disease recurrence | FAERS: 5 | US FAERS | |
| 166 | Drug level above therapeutic | FAERS: 5 | US FAERS | |
| 167 | Embolic stroke | FAERS: 5 | US FAERS | |
| 168 | Flatulence | FAERS: 5 | US FAERS | |
| 169 | Gastric Antral Vascular Ectasia | FAERS: 5 | US FAERS | |
| 170 | Heparin-induced thrombocytopenia | FAERS: 5 | US FAERS | |
| 171 | Inflammation | FAERS: 5 | US FAERS | |
| 172 | Limb discomfort | FAERS: 5 | US FAERS | |
| 173 | Nasopharyngitis | FAERS: 5 | US FAERS | |
| 174 | Nephrolithiasis | FAERS: 5 | US FAERS | |
| 175 | Pericardial effusion | FAERS: 5 | US FAERS | |
| 176 | Pericarditis | FAERS: 5 | US FAERS | |
| 177 | Presyncope | FAERS: 5 | US FAERS | |
| 178 | Product measured potency issue | FAERS: 5 | US FAERS | |
| 179 | Protein C decreased | FAERS: 5 | US FAERS | |
| 180 | Pulmonary Hypertension | FAERS: 5 | US FAERS | |
| 181 | Respiratory Depression | FAERS: 5 | US FAERS | |
| 182 | Thrombosis in device | FAERS: 5 | US FAERS | |
| 183 | Tumour haemorrhage | FAERS: 5 | US FAERS | |
| 184 | Vertigo | FAERS: 5 | US FAERS | |
| 185 | Vitamin K Deficiency | FAERS: 5 | US FAERS | |
| 186 | nervous system disorder | FAERS: 5 | US FAERS | |
| 187 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 188 | Arthropathy | FAERS: 4 | US FAERS | |
| 189 | Atrial Flutter | FAERS: 4 | US FAERS | |
| 190 | Autonomic nervous system imbalance | FAERS: 4 | US FAERS | |
| 191 | Blood count abnormal | FAERS: 4 | US FAERS | |
| 192 | Cardiomegaly | FAERS: 4 | US FAERS | |
| 193 | Cerebral Thrombosis | FAERS: 4 | US FAERS | |
| 194 | Cerebral ventricle dilatation | FAERS: 4 | US FAERS | |
| 195 | Chills | FAERS: 4 | US FAERS | |
| 196 | Disorientation | FAERS: 4 | US FAERS | |
| 197 | Drug administration error | FAERS: 4 | US FAERS | |
| 198 | Drug level increased | FAERS: 4 | US FAERS | |
| 199 | Dysgeusia | FAERS: 4 | US FAERS | |
| 200 | Gangrene | FAERS: 4 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 201 | Gastrointestinal arteriovenous malformation | FAERS: 4 | US FAERS | |
| 202 | Hemiplegia | FAERS: 4 | US FAERS | |
| 203 | Implant site infection | FAERS: 4 | US FAERS | |
| 204 | Leukocytosis | FAERS: 4 | US FAERS | |
| 205 | Limb injury | FAERS: 4 | US FAERS | |
| 206 | Macular degeneration | FAERS: 4 | US FAERS | |
| 207 | Medical device complication | FAERS: 4 | US FAERS | |
| 208 | Meningorrhagia | FAERS: 4 | US FAERS | |
| 209 | Metabolic acidosis | FAERS: 4 | US FAERS | |
| 210 | Musculoskeletal stiffness | FAERS: 4 | US FAERS | |
| 211 | No adverse event | FAERS: 4 | US FAERS | |
| 212 | Ovarian Rupture | FAERS: 4 | US FAERS | |
| 213 | Pocket erosion | FAERS: 4 | US FAERS | |
| 214 | Portal Vein Thrombosis | FAERS: 4 | US FAERS | |
| 215 | Productive Cough | FAERS: 4 | US FAERS | |
| 216 | Pseudocyst | FAERS: 4 | US FAERS | |
| 217 | Quadriplegia | FAERS: 4 | US FAERS | |
| 218 | Renal tubular necrosis | FAERS: 4 | US FAERS | |
| 219 | Stillbirth | FAERS: 4 | US FAERS | |
| 220 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 221 | Vascular calcification | FAERS: 4 | US FAERS | |
| 222 | Vena cava filter insertion | FAERS: 4 | US FAERS | |
| 223 | Visual Impairment | FAERS: 4 | US FAERS | |
| 224 | Wrong technique in product usage process | FAERS: 4 | US FAERS | |
| 225 | jaundice | FAERS: 4 | US FAERS | |
| 226 | Abscess | FAERS: 3 | US FAERS | |
| 227 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 228 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 229 | Adenocarcinoma | FAERS: 3 | US FAERS | |
| 230 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 231 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 232 | Aneurysm | FAERS: 3 | US FAERS | |
| 233 | Angiodysplasia | FAERS: 3 | US FAERS | |
| 234 | Anoxic Encephalopathy | FAERS: 3 | US FAERS | |
| 235 | Antiphospholipid antibodies positive | FAERS: 3 | US FAERS | |
| 236 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 237 | Back disorder | FAERS: 3 | US FAERS | |
| 238 | Bedridden | FAERS: 3 | US FAERS | |
| 239 | Blood albumin decreased | FAERS: 3 | US FAERS | |
| 240 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 241 | Brain Death | FAERS: 3 | US FAERS | |
| 242 | Burning sensation | FAERS: 3 | US FAERS | |
| 243 | Calcinosis | FAERS: 3 | US FAERS | |
| 244 | Clostridium difficile infection | FAERS: 3 | US FAERS | |
| 245 | Coagulation factor VII level decreased | FAERS: 3 | US FAERS | |
| 246 | Coagulation test abnormal | FAERS: 3 | US FAERS | |
| 247 | Colectomy | FAERS: 3 | US FAERS | |
| 248 | Completed Suicide | FAERS: 3 | US FAERS | |
| 249 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 250 | Cyanosis | FAERS: 3 | US FAERS | |
| 251 | Disease Progression | FAERS: 3 | US FAERS | |
| 252 | Drug dose omission | FAERS: 3 | US FAERS | |
| 253 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 254 | Drug level below therapeutic | FAERS: 3 | US FAERS | |
| 255 | Drug level changed | FAERS: 3 | US FAERS | |
| 256 | Drug resistance | FAERS: 3 | US FAERS | |
| 257 | Dry skin | FAERS: 3 | US FAERS | |
| 258 | Duodenitis | FAERS: 3 | US FAERS | |
| 259 | Endocarditis | FAERS: 3 | US FAERS | |
| 260 | Erosive Duodenitis | FAERS: 3 | US FAERS | |
| 261 | Eructation | FAERS: 3 | US FAERS | |
| 262 | Erysipelas | FAERS: 3 | US FAERS | |
| 263 | Exophthalmos | FAERS: 3 | US FAERS | |
| 264 | Gastric mucosal lesion | FAERS: 3 | US FAERS | |
| 265 | Gastroenteritis | FAERS: 3 | US FAERS | |
| 266 | High frequency ablation | FAERS: 3 | US FAERS | |
| 267 | Hydronephrosis | FAERS: 3 | US FAERS | |
| 268 | Hypocoagulable state | FAERS: 3 | US FAERS | |
| 269 | Hysterectomy | FAERS: 3 | US FAERS | |
| 270 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 271 | Intestinal infarction | FAERS: 3 | US FAERS | |
| 272 | Intracranial mass | FAERS: 3 | US FAERS | |
| 273 | Lactose Intolerance | FAERS: 3 | US FAERS | |
| 274 | Low birth weight baby | FAERS: 3 | US FAERS | |
| 275 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 276 | Macrocytosis | FAERS: 3 | US FAERS | |
| 277 | Muscle strain | FAERS: 3 | US FAERS | |
| 278 | Neck Pain | FAERS: 3 | US FAERS | |
| 279 | Neurological decompensation | FAERS: 3 | US FAERS | |
| 280 | Obstruction | FAERS: 3 | US FAERS | |
| 281 | Oliguria | FAERS: 3 | US FAERS | |
| 282 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 283 | Osteolysis | FAERS: 3 | US FAERS | |
| 284 | Osteomyelitis | FAERS: 3 | US FAERS | |
| 285 | Paraplegia | FAERS: 3 | US FAERS | |
| 286 | Patent ductus arteriosus | FAERS: 3 | US FAERS | |
| 287 | Pelvic Pain | FAERS: 3 | US FAERS | |
| 288 | Poisoning | FAERS: 3 | US FAERS | |
| 289 | Post procedural fistula | FAERS: 3 | US FAERS | |
| 290 | Prescribed overdose | FAERS: 3 | US FAERS | |
| 291 | Product label issue | FAERS: 3 | US FAERS | |
| 292 | Protein S decreased | FAERS: 3 | US FAERS | |
| 293 | Rash erythematous | FAERS: 3 | US FAERS | |
| 294 | Rectal polyp | FAERS: 3 | US FAERS | |
| 295 | Renal tubular disorder | FAERS: 3 | US FAERS | |
| 296 | Scab | FAERS: 3 | US FAERS | |
| 297 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 298 | Sopor | FAERS: 3 | US FAERS | |
| 299 | Splenic Infarction | FAERS: 3 | US FAERS | |
| 300 | Splenic Rupture | FAERS: 3 | US FAERS | |
| 301 | Suicide attempt | FAERS: 3 | US FAERS | |
| 302 | Throat irritation | FAERS: 3 | US FAERS | |
| 303 | Troponin increased | FAERS: 3 | US FAERS | |
| 304 | Ulcer | FAERS: 3 | US FAERS | |
| 305 | Unevaluable event | FAERS: 3 | US FAERS | |
| 306 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 307 | Wheezing | FAERS: 3 | US FAERS | |
| 308 | Abnormal palmar/plantar creases | FAERS: 2 | US FAERS | |
| 309 | Accidental exposure | FAERS: 2 | US FAERS | |
| 310 | Acidosis | FAERS: 2 | US FAERS | |
| 311 | Adrenal cortex necrosis | FAERS: 2 | US FAERS | |
| 312 | Ageusia | FAERS: 2 | US FAERS | |
| 313 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 314 | Amnesia | FAERS: 2 | US FAERS | |
| 315 | Angioedema | FAERS: 2 | US FAERS | |
| 316 | Angle Closure Glaucoma | FAERS: 2 | US FAERS | |
| 317 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 318 | Anticoagulation drug level abnormal | FAERS: 2 | US FAERS | |
| 319 | Antinuclear antibody increased | FAERS: 2 | US FAERS | |
| 320 | Arteriovenous fistula thrombosis | FAERS: 2 | US FAERS | |
| 321 | Atelectasis | FAERS: 2 | US FAERS | |
| 322 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 323 | Bladder spasm | FAERS: 2 | US FAERS | |
| 324 | Blood alcohol increased | FAERS: 2 | US FAERS | |
| 325 | Blood fibrinogen decreased | FAERS: 2 | US FAERS | |
| 326 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 327 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 328 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 329 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 330 | Bone pain | FAERS: 2 | US FAERS | |
| 331 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 332 | Bronchial Obstruction | FAERS: 2 | US FAERS | |
| 333 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 334 | Cardiac Death | FAERS: 2 | US FAERS | |
| 335 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 336 | Cataract | FAERS: 2 | US FAERS | |
| 337 | Cerebral Amyloid Angiopathy | FAERS: 2 | US FAERS | |
| 338 | Cerebral atrophy | FAERS: 2 | US FAERS | |
| 339 | Cholecystitis | FAERS: 2 | US FAERS | |
| 340 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 341 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 342 | Coagulation time shortened | FAERS: 2 | US FAERS | |
| 343 | Coma scale abnormal | FAERS: 2 | US FAERS | |
| 344 | Congenital Hydrocephalus | FAERS: 2 | US FAERS | |
| 345 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 346 | Crying | FAERS: 2 | US FAERS | |
| 347 | Cyst | FAERS: 2 | US FAERS | |
| 348 | Deafness | FAERS: 2 | US FAERS | |
| 349 | Delirium | FAERS: 2 | US FAERS | |
| 350 | Dermatitis | FAERS: 2 | US FAERS | |
| 351 | Dieulafoy's vascular malformation | FAERS: 2 | US FAERS | |
| 352 | Drug abuse | FAERS: 2 | US FAERS | |
| 353 | Drug level decreased | FAERS: 2 | US FAERS | |
| 354 | Drug level fluctuating | FAERS: 2 | US FAERS | |
| 355 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 356 | Duodenal Obstruction | FAERS: 2 | US FAERS | |
| 357 | Eschar | FAERS: 2 | US FAERS | |
| 358 | Escherichia infection | FAERS: 2 | US FAERS | |
| 359 | Escherichia urinary tract infection | FAERS: 2 | US FAERS | |
| 360 | Excoriation | FAERS: 2 | US FAERS | |
| 361 | Expired product administered | FAERS: 2 | US FAERS | |
| 362 | Eye pain | FAERS: 2 | US FAERS | |
| 363 | Feeding disorder neonatal | FAERS: 2 | US FAERS | |
| 364 | Feeling Cold | FAERS: 2 | US FAERS | |
| 365 | Fibrin D dimer increased | FAERS: 2 | US FAERS | |
| 366 | Floppy iris syndrome | FAERS: 2 | US FAERS | |
| 367 | Fracture | FAERS: 2 | US FAERS | |
| 368 | Full blood count abnormal | FAERS: 2 | US FAERS | |
| 369 | Gait inability | FAERS: 2 | US FAERS | |
| 370 | Gastric Bypass | FAERS: 2 | US FAERS | |
| 371 | Gastrointestinal telangiectasia | FAERS: 2 | US FAERS | |
| 372 | Gestational Diabetes | FAERS: 2 | US FAERS | |
| 373 | Glomerular vascular disorder | FAERS: 2 | US FAERS | |
| 374 | Gout | FAERS: 2 | US FAERS | |
| 375 | Hepatic congestion | FAERS: 2 | US FAERS | |
| 376 | Hepatitis | FAERS: 2 | US FAERS | |
| 377 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 378 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 379 | Hypokinesia | FAERS: 2 | US FAERS | |
| 380 | Iatrogenic injury | FAERS: 2 | US FAERS | |
| 381 | Idiopathic Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 382 | Immobile | FAERS: 2 | US FAERS | |
| 383 | Infectious peritonitis | FAERS: 2 | US FAERS | |
| 384 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 385 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 386 | Iron deficiency | FAERS: 2 | US FAERS | |
| 387 | Laparotomy | FAERS: 2 | US FAERS | |
| 388 | Lip swelling | FAERS: 2 | US FAERS | |
| 389 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 390 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 391 | Macroglossia | FAERS: 2 | US FAERS | |
| 392 | Malabsorption | FAERS: 2 | US FAERS | |
| 393 | Malnutrition | FAERS: 2 | US FAERS | |
| 394 | Medical diet | FAERS: 2 | US FAERS | |
| 395 | Metastasis | FAERS: 2 | US FAERS | |
| 396 | Microcephaly | FAERS: 2 | US FAERS | |
| 397 | Monoparesis | FAERS: 2 | US FAERS | |
| 398 | Muscle necrosis | FAERS: 2 | US FAERS | |
| 399 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 400 | Mydriasis | FAERS: 2 | US FAERS | |
| 401 | Nephritis allergic | FAERS: 2 | US FAERS | |
| 402 | Neuropathy | FAERS: 2 | US FAERS | |
| 403 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 404 | Night sweats | FAERS: 2 | US FAERS | |
| 405 | Nodule | FAERS: 2 | US FAERS | |
| 406 | Oligohydramnios | FAERS: 2 | US FAERS | |
| 407 | Onychoclasis | FAERS: 2 | US FAERS | |
| 408 | Pain of skin | FAERS: 2 | US FAERS | |
| 409 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 410 | Pancreatitis | FAERS: 2 | US FAERS | |
| 411 | Pancytopenia | FAERS: 2 | US FAERS | |
| 412 | Paresis | FAERS: 2 | US FAERS | |
| 413 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 414 | Priapism | FAERS: 2 | US FAERS | |
| 415 | Product contamination | FAERS: 2 | US FAERS | |
| 416 | Product counterfeit | FAERS: 2 | US FAERS | |
| 417 | Product formulation issue | FAERS: 2 | US FAERS | |
| 418 | Prosthetic cardiac valve thrombosis | FAERS: 2 | US FAERS | |
| 419 | Protein S Deficiency | FAERS: 2 | US FAERS | |
| 420 | Protein urine present | FAERS: 2 | US FAERS | |
| 421 | Proteinuria | FAERS: 2 | US FAERS | |
| 422 | Prothrombin time ratio abnormal | FAERS: 2 | US FAERS | |
| 423 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 424 | Purulence | FAERS: 2 | US FAERS | |
| 425 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 426 | Pyogenic granuloma | FAERS: 2 | US FAERS | |
| 427 | Radiation proctitis | FAERS: 2 | US FAERS | |
| 428 | Right ventricular failure | FAERS: 2 | US FAERS | |
| 429 | Sinusitis | FAERS: 2 | US FAERS | |
| 430 | Soft tissue necrosis | FAERS: 2 | US FAERS | |
| 431 | Splenic vein thrombosis | FAERS: 2 | US FAERS | |
| 432 | Stenosis | FAERS: 2 | US FAERS | |
| 433 | Stomatitis | FAERS: 2 | US FAERS | |
| 434 | Teratoma | FAERS: 2 | US FAERS | |
| 435 | Thrombophlebitis | FAERS: 2 | US FAERS | |
| 436 | Thrombotic stroke | FAERS: 2 | US FAERS | |
| 437 | Tongue biting | FAERS: 2 | US FAERS | |
| 438 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 439 | Transaminases increased | FAERS: 2 | US FAERS | |
| 440 | Upper airway obstruction | FAERS: 2 | US FAERS | |
| 441 | Urine leukocyte esterase positive | FAERS: 2 | US FAERS | |
| 442 | Vascular pseudoaneurysm ruptured | FAERS: 2 | US FAERS | |
| 443 | Vertebrobasilar Insufficiency | FAERS: 2 | US FAERS | |
| 444 | Wound Infection | FAERS: 2 | US FAERS | |
| 445 | Wound abscess | FAERS: 2 | US FAERS | |
| 446 | Wound necrosis | FAERS: 2 | US FAERS | |
| 447 | Wrong dose | FAERS: 2 | US FAERS | |
| 448 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 449 | effusion | FAERS: 2 | US FAERS | |
| 450 | furuncle | FAERS: 2 | US FAERS | |
| 451 | muscle injury | FAERS: 2 | US FAERS | |
| 452 | Abdominal cavity drainage | FAERS: 1 | US FAERS | |
| 453 | Accidental underdose | FAERS: 1 | US FAERS | |
| 454 | Acne | FAERS: 1 | US FAERS | |
| 455 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 456 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 457 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 458 | Amylase increased | FAERS: 1 | US FAERS | |
| 459 | Anal Fissure | FAERS: 1 | US FAERS | |
| 460 | Anal sphincter atony | FAERS: 1 | US FAERS | |
| 461 | Anastomotic complication | FAERS: 1 | US FAERS | |
| 462 | Anastomotic ulcer | FAERS: 1 | US FAERS | |
| 463 | Animal bite | FAERS: 1 | US FAERS | |
| 464 | Animal scratch | FAERS: 1 | US FAERS | |
| 465 | Anosmia | FAERS: 1 | US FAERS | |
| 466 | Anti-platelet antibody positive | FAERS: 1 | US FAERS | |
| 467 | Anticoagulation drug level decreased | FAERS: 1 | US FAERS | |
| 468 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 469 | Aphagia | FAERS: 1 | US FAERS | |
| 470 | Apparent death | FAERS: 1 | US FAERS | |
| 471 | Arachnoiditis | FAERS: 1 | US FAERS | |
| 472 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 473 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 474 | Arteritis | FAERS: 1 | US FAERS | |
| 475 | Asterixis | FAERS: 1 | US FAERS | |
| 476 | Asthma | FAERS: 1 | US FAERS | |
| 477 | Ataxia | FAERS: 1 | US FAERS | |
| 478 | Aura | FAERS: 1 | US FAERS | |
| 479 | Auricular swelling | FAERS: 1 | US FAERS | |
| 480 | Bacillus infection | FAERS: 1 | US FAERS | |
| 481 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 482 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 483 | Bleeding time abnormal | FAERS: 1 | US FAERS | |
| 484 | Blepharospasm | FAERS: 1 | US FAERS | |
| 485 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 486 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 487 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 488 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 489 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 490 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 491 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 492 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 493 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 494 | Blood viscosity abnormal | FAERS: 1 | US FAERS | |
| 495 | Bradycardia | FAERS: 1 | US FAERS | |
| 496 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 497 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 498 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 499 | Breast necrosis | FAERS: 1 | US FAERS | |
| 500 | Breathing-related sleep disorder | FAERS: 1 | US FAERS | |
| 501 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 502 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 503 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 504 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 505 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 506 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 507 | Catheter placement | FAERS: 1 | US FAERS | |
| 508 | Cell Death | FAERS: 1 | US FAERS | |
| 509 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 510 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 511 | Cerebral calcification | FAERS: 1 | US FAERS | |
| 512 | Cerebral microhaemorrhage | FAERS: 1 | US FAERS | |
| 513 | Chest wall pain | FAERS: 1 | US FAERS | |
| 514 | Choanal Atresia | FAERS: 1 | US FAERS | |
| 515 | Cholestasis | FAERS: 1 | US FAERS | |
| 516 | Clonus | FAERS: 1 | US FAERS | |
| 517 | Clostridium test positive | FAERS: 1 | US FAERS | |
| 518 | Coagulation factor V level decreased | FAERS: 1 | US FAERS | |
| 519 | Coagulation factor XI level decreased | FAERS: 1 | US FAERS | |
| 520 | Coagulation time abnormal | FAERS: 1 | US FAERS | |
| 521 | Cold sweat | FAERS: 1 | US FAERS | |
| 522 | Colon adenoma | FAERS: 1 | US FAERS | |
| 523 | Complement factor C3 decreased | FAERS: 1 | US FAERS | |
| 524 | Complement factor C4 decreased | FAERS: 1 | US FAERS | |
| 525 | Compression fracture | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 526 | Congenital tracheomalacia | FAERS: 1 | US FAERS | |
| 527 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 528 | Craniotomy | FAERS: 1 | US FAERS | |
| 529 | Cystitis | FAERS: 1 | US FAERS | |
| 530 | Dental caries | FAERS: 1 | US FAERS | |
| 531 | Dependence on enabling machine or device | FAERS: 1 | US FAERS | |
| 532 | Depressed mood | FAERS: 1 | US FAERS | |
| 533 | Device ineffective | FAERS: 1 | US FAERS | |
| 534 | Device migration | FAERS: 1 | US FAERS | |
| 535 | Diplopia | FAERS: 1 | US FAERS | |
| 536 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 537 | Dose calculation error | FAERS: 1 | US FAERS | |
| 538 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 539 | Drug abuser | FAERS: 1 | US FAERS | |
| 540 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 541 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 542 | Drug screen positive | FAERS: 1 | US FAERS | |
| 543 | Drug specific antibody present | FAERS: 1 | US FAERS | |
| 544 | Drug therapeutic incompatibility | FAERS: 1 | US FAERS | |
| 545 | Dysphasia | FAERS: 1 | US FAERS | |
| 546 | Dysphonia | FAERS: 1 | US FAERS | |
| 547 | Early satiety | FAERS: 1 | US FAERS | |
| 548 | Economic problem | FAERS: 1 | US FAERS | |
| 549 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 550 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 551 | Electrocardiogram ST-T segment abnormal | FAERS: 1 | US FAERS | |
| 552 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 553 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 554 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 555 | Emergency care examination | FAERS: 1 | US FAERS | |
| 556 | Emphysematous cystitis | FAERS: 1 | US FAERS | |
| 557 | Encephalomalacia | FAERS: 1 | US FAERS | |
| 558 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 559 | Endoscopy gastrointestinal abnormal | FAERS: 1 | US FAERS | |
| 560 | Enterococcus test positive | FAERS: 1 | US FAERS | |
| 561 | Enterocutaneous Fistula | FAERS: 1 | US FAERS | |
| 562 | Epicondylitis | FAERS: 1 | US FAERS | |
| 563 | Epiploic appendagitis | FAERS: 1 | US FAERS | |
| 564 | Erdheim-Chester Disease | FAERS: 1 | US FAERS | |
| 565 | Erythrodermic psoriasis | FAERS: 1 | US FAERS | |
| 566 | Escherichia test positive | FAERS: 1 | US FAERS | |
| 567 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 568 | Extremity necrosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 569 | Facial paralysis | FAERS: 1 | US FAERS | |
| 570 | Factor V Leiden mutation | FAERS: 1 | US FAERS | |
| 571 | Factor VIII Deficiency | FAERS: 1 | US FAERS | |
| 572 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 573 | Fasciitis | FAERS: 1 | US FAERS | |
| 574 | Fasciotomy | FAERS: 1 | US FAERS | |
| 575 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 576 | Fluid overload | FAERS: 1 | US FAERS | |
| 577 | Flushing | FAERS: 1 | US FAERS | |
| 578 | Frustration | FAERS: 1 | US FAERS | |
| 579 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 580 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 581 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 582 | Gastrointestinal angiodysplasia | FAERS: 1 | US FAERS | |
| 583 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 584 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 585 | Gastrointestinal obstruction | FAERS: 1 | US FAERS | |
| 586 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 587 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 588 | Gastrointestinal vascular malformation | FAERS: 1 | US FAERS | |
| 589 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 590 | Glaucoma | FAERS: 1 | US FAERS | |
| 591 | Graft infection | FAERS: 1 | US FAERS | |
| 592 | Halitosis | FAERS: 1 | US FAERS | |
| 593 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 594 | Heart valve calcification | FAERS: 1 | US FAERS | |
| 595 | Hepatic Vein Thrombosis | FAERS: 1 | US FAERS | |
| 596 | Hernia | FAERS: 1 | US FAERS | |
| 597 | Hunger | FAERS: 1 | US FAERS | |
| 598 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 599 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 600 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 601 | Hypoperfusion | FAERS: 1 | US FAERS | |
| 602 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 603 | Hypothrombinaemia | FAERS: 1 | US FAERS | |
| 604 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 605 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 606 | Ileectomy | FAERS: 1 | US FAERS | |
| 607 | Ileitis | FAERS: 1 | US FAERS | |
| 608 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 609 | Impaired self-care | FAERS: 1 | US FAERS | |
| 610 | Impaired work ability | FAERS: 1 | US FAERS | |
| 611 | Incarcerated hernia | FAERS: 1 | US FAERS | |
| 612 | Incision site pain | FAERS: 1 | US FAERS | |
| 613 | Incontinence | FAERS: 1 | US FAERS | |
| 614 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 615 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 616 | Induration | FAERS: 1 | US FAERS | |
| 617 | Influenza | FAERS: 1 | US FAERS | |
| 618 | Injection site bruising | FAERS: 1 | US FAERS | |
| 619 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 620 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 621 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 622 | Intracranial Hypotension | FAERS: 1 | US FAERS | |
| 623 | Intubation complication | FAERS: 1 | US FAERS | |
| 624 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 625 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 626 | Jugular vein distension | FAERS: 1 | US FAERS | |
| 627 | Kaolin cephalin clotting time prolonged | FAERS: 1 | US FAERS | |
| 628 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 629 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 630 | Laryngeal Obstruction | FAERS: 1 | US FAERS | |
| 631 | Laryngitis | FAERS: 1 | US FAERS | |
| 632 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 633 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 634 | Lipase increased | FAERS: 1 | US FAERS | |
| 635 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 636 | Loop electrosurgical excision procedure | FAERS: 1 | US FAERS | |
| 637 | Loose tooth | FAERS: 1 | US FAERS | |
| 638 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 639 | Lower respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 640 | Lung consolidation | FAERS: 1 | US FAERS | |
| 641 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 642 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 643 | Meningioma | FAERS: 1 | US FAERS | |
| 644 | Mental impairment | FAERS: 1 | US FAERS | |
| 645 | Middle insomnia | FAERS: 1 | US FAERS | |
| 646 | Monoplegia | FAERS: 1 | US FAERS | |
| 647 | Mouth swelling | FAERS: 1 | US FAERS | |
| 648 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 649 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 650 | Myocardial necrosis | FAERS: 1 | US FAERS | |
| 651 | Nerve injury | FAERS: 1 | US FAERS | |
| 652 | Nervousness | FAERS: 1 | US FAERS | |
| 653 | Neutropenia | FAERS: 1 | US FAERS | |
| 654 | Nocturia | FAERS: 1 | US FAERS | |
| 655 | Nystagmus | FAERS: 1 | US FAERS | |
| 656 | Obesity | FAERS: 1 | US FAERS | |
| 657 | Occult blood negative | FAERS: 1 | US FAERS | |
| 658 | Ophthalmic vein thrombosis | FAERS: 1 | US FAERS | |
| 659 | Ophthalmoplegia | FAERS: 1 | US FAERS | |
| 660 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 661 | Otitis Media | FAERS: 1 | US FAERS | |
| 662 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 663 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 664 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 665 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 666 | Panniculitis | FAERS: 1 | US FAERS | |
| 667 | Paracentesis | FAERS: 1 | US FAERS | |
| 668 | Paraparesis | FAERS: 1 | US FAERS | |
| 669 | Penile necrosis | FAERS: 1 | US FAERS | |
| 670 | Penile swelling | FAERS: 1 | US FAERS | |
| 671 | Percutaneous Coronary Intervention | FAERS: 1 | US FAERS | |
| 672 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 673 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 674 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 675 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 676 | Peritonitis | FAERS: 1 | US FAERS | |
| 677 | Phlebitis | FAERS: 1 | US FAERS | |
| 678 | Pleurisy | FAERS: 1 | US FAERS | |
| 679 | Pneumonitis | FAERS: 1 | US FAERS | |
| 680 | Pneumothorax | FAERS: 1 | US FAERS | |
| 681 | Polydipsia | FAERS: 1 | US FAERS | |
| 682 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 683 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 684 | Porencephaly | FAERS: 1 | US FAERS | |
| 685 | Portal hypertensive gastropathy | FAERS: 1 | US FAERS | |
| 686 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 687 | Proctitis | FAERS: 1 | US FAERS | |
| 688 | Product dosage form confusion | FAERS: 1 | US FAERS | |
| 689 | Product monitoring error | FAERS: 1 | US FAERS | |
| 690 | Product physical issue | FAERS: 1 | US FAERS | |
| 691 | Product storage error | FAERS: 1 | US FAERS | |
| 692 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 693 | Prostatic Obstruction | FAERS: 1 | US FAERS | |
| 694 | Protein C Deficiency | FAERS: 1 | US FAERS | |
| 695 | Protein S abnormal | FAERS: 1 | US FAERS | |
| 696 | Protein total decreased | FAERS: 1 | US FAERS | |
| 697 | Prothrombin time ratio decreased | FAERS: 1 | US FAERS | |
| 698 | Prothrombin time ratio increased | FAERS: 1 | US FAERS | |
| 699 | Pseudoxanthoma Elasticum | FAERS: 1 | US FAERS | |
| 700 | Psoriasis | FAERS: 1 | US FAERS | |
| 701 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 702 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 703 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 704 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 705 | Pupillary light reflex tests abnormal | FAERS: 1 | US FAERS | |
| 706 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 707 | Pyloric Stenosis | FAERS: 1 | US FAERS | |
| 708 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 709 | Radiation mucositis | FAERS: 1 | US FAERS | |
| 710 | Radiation skin injury | FAERS: 1 | US FAERS | |
| 711 | Rales | FAERS: 1 | US FAERS | |
| 712 | Rectal discharge | FAERS: 1 | US FAERS | |
| 713 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 714 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 715 | Renal Colic | FAERS: 1 | US FAERS | |
| 716 | Renal abscess | FAERS: 1 | US FAERS | |
| 717 | Renal mass | FAERS: 1 | US FAERS | |
| 718 | Renal pain | FAERS: 1 | US FAERS | |
| 719 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 720 | Retching | FAERS: 1 | US FAERS | |
| 721 | Reticulocyte count decreased | FAERS: 1 | US FAERS | |
| 722 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 723 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 724 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 725 | Rosacea | FAERS: 1 | US FAERS | |
| 726 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 727 | Russell's viper venom time abnormal | FAERS: 1 | US FAERS | |
| 728 | Salpingitis | FAERS: 1 | US FAERS | |
| 729 | Sciatica | FAERS: 1 | US FAERS | |
| 730 | Septic embolus | FAERS: 1 | US FAERS | |
| 731 | Seroma | FAERS: 1 | US FAERS | |
| 732 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 733 | Silent myocardial infarction | FAERS: 1 | US FAERS | |
| 734 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 735 | Sinus rhythm | FAERS: 1 | US FAERS | |
| 736 | Skeletal injury | FAERS: 1 | US FAERS | |
| 737 | Skin irritation | FAERS: 1 | US FAERS | |
| 738 | Sluggishness | FAERS: 1 | US FAERS | |
| 739 | Sneezing | FAERS: 1 | US FAERS | |
| 740 | Sodium retention | FAERS: 1 | US FAERS | |
| 741 | Solar lentigo | FAERS: 1 | US FAERS | |
| 742 | Splenectomy | FAERS: 1 | US FAERS | |
| 743 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 744 | Staphylococcal mediastinitis | FAERS: 1 | US FAERS | |
| 745 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 746 | Stress | FAERS: 1 | US FAERS | |
| 747 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 748 | Sudden death | FAERS: 1 | US FAERS | |
| 749 | Sunburn | FAERS: 1 | US FAERS | |
| 750 | Superficial siderosis of central nervous system | FAERS: 1 | US FAERS | |
| 751 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 752 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 753 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 754 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 755 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 756 | Therapy cessation | FAERS: 1 | US FAERS | |
| 757 | Therapy change | FAERS: 1 | US FAERS | |
| 758 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 759 | Thoracostomy | FAERS: 1 | US FAERS | |
| 760 | Thoracotomy | FAERS: 1 | US FAERS | |
| 761 | Thrombectomy | FAERS: 1 | US FAERS | |
| 762 | Thyroglobulin increased | FAERS: 1 | US FAERS | |
| 763 | Tinnitus | FAERS: 1 | US FAERS | |
| 764 | Tongue erythema | FAERS: 1 | US FAERS | |
| 765 | Toothache | FAERS: 1 | US FAERS | |
| 766 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 767 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 768 | Transfusion Reaction | FAERS: 1 | US FAERS | |
| 769 | Tuberculosis | FAERS: 1 | US FAERS | |
| 770 | Unresponsive to pain stimuli | FAERS: 1 | US FAERS | |
| 771 | Unresponsive to verbal stimuli | FAERS: 1 | US FAERS | |
| 772 | Urinary tract infection staphylococcal | FAERS: 1 | US FAERS | |
| 773 | Urine alcohol test positive | FAERS: 1 | US FAERS | |
| 774 | Vascular graft thrombosis | FAERS: 1 | US FAERS | |
| 775 | Vascular procedure complication | FAERS: 1 | US FAERS | |
| 776 | Vascular stent thrombosis | FAERS: 1 | US FAERS | |
| 777 | Vasospasm | FAERS: 1 | US FAERS | |
| 778 | Vein collapse | FAERS: 1 | US FAERS | |
| 779 | Venous occlusion | FAERS: 1 | US FAERS | |
| 780 | Vitamin K | FAERS: 1 | US FAERS | |
| 781 | Walking aid user | FAERS: 1 | US FAERS | |
| 782 | Weaning failure | FAERS: 1 | US FAERS | |
| 783 | Wheelchair user | FAERS: 1 | US FAERS | |
| 784 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 785 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 786 | Xanthoma | FAERS: 1 | US FAERS | |
| 787 | kyphosis | FAERS: 1 | US FAERS | |
| 788 | prostatitis | FAERS: 1 | US FAERS |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.