Citalopram
(KTGRHKOEFSJQNS-BDQAORGHSA-N)
Structure
- SMILES
- OC(=O)C(=O)O.N#Cc1ccc2c(c1)CO[C@@]2(CCCN(C)C)c1ccc(cc1)F
- Molecular Formula:
- C22H23FN2O5
- Molecular Weight:
- 414.427
- Log P:
- 2.9686
- Hydrogen Bond Acceptor:
- 7
- Hydrogen Bond Donor:
- 2
- TPSA:
- 110.86
- CAS Number(s):
- 219861-08-2
Synonym(s)
1.
Citalopram
2.
Celexa
3.
Citalopram Hydrobromide
4.
Cytalopram
5.
Escitalopram
6.
Escitalopram Oxalate
7.
Lexapro
8.
Lu-10-171
9.
Seropram
10.
Lu10171
External Link(s)
| MeSH | D015283 |
| PubChem Compound | 146571 |
| BindingDB | 50323776 |
| CHEMBL | CHEMBL1200322 |
| KEGG | dr:D02567 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Completed Suicide | FAERS: 171 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 2 | Anxiety | FAERS: 167 Canada Vigilance: 18 | Canada Vigilance US FAERS | |
| 3 | Dizziness | FAERS: 150 Canada Vigilance: 26 | Canada Vigilance US FAERS | |
| 4 | Nausea | FAERS: 147 Canada Vigilance: 31 | Canada Vigilance US FAERS | |
| 5 | Drug ineffective | FAERS: 144 Canada Vigilance: 23 | Canada Vigilance US FAERS | |
| 6 | Feeling abnormal | FAERS: 114 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 7 | Headache | FAERS: 96 Canada Vigilance: 19 | Canada Vigilance US FAERS | |
| 8 | Fatigue | FAERS: 87 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 9 | Tremor | FAERS: 85 Canada Vigilance: 15 | Canada Vigilance US FAERS | |
| 10 | Product substitution issue | FAERS: 76 | US FAERS | |
| 11 | Agitation | FAERS: 73 Canada Vigilance: 12 | Canada Vigilance US FAERS | |
| 12 | Suicide attempt | FAERS: 72 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 13 | Drug exposure during pregnancy | FAERS: 70 | US FAERS | |
| 14 | Vomiting | FAERS: 62 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 15 | Amnesia | FAERS: 53 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Overdose | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Drug withdrawal syndrome | FAERS: 49 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 18 | Malaise | FAERS: 44 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 19 | Pregnancy | FAERS: 43 | US FAERS | |
| 20 | Somnolence | FAERS: 43 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 21 | Asthenia | FAERS: 41 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 22 | Palpitations | FAERS: 36 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 23 | Anger | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Talipes | FAERS: 34 | US FAERS | |
| 25 | Pain | FAERS: 32 | US FAERS | |
| 26 | Patent ductus arteriosus | FAERS: 32 | US FAERS | |
| 27 | Restlessness | FAERS: 32 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 28 | Hypersensitivity | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 29 | Serotonin Syndrome | FAERS: 31 | US FAERS | |
| 30 | Memory impairment | FAERS: 30 | US FAERS | |
| 31 | Crying | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 32 | Tinnitus | FAERS: 29 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 33 | Craniosynostosis | FAERS: 28 | US FAERS | |
| 34 | Depressed mood | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Weight decreased | FAERS: 28 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 36 | Chest Pain | FAERS: 26 | US FAERS | |
| 37 | Alopecia | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 38 | Impaired work ability | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Intentional self-injury | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 40 | Nervousness | FAERS: 25 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 41 | Syncope | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 42 | Abdominal Pain | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 43 | Sexual Dysfunction | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Drug dose omission | FAERS: 23 | US FAERS | |
| 45 | Emotional disorder | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | nervous system disorder | FAERS: 22 | US FAERS | |
| 47 | Paranoia | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Arthralgia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Dystonia | FAERS: 19 | US FAERS | |
| 50 | Abdominal discomfort | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 51 | Erectile dysfunction | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 52 | Hypoplastic Left Heart Syndrome | FAERS: 18 | US FAERS | |
| 53 | Injury asphyxiation | FAERS: 18 | US FAERS | |
| 54 | Mood swings | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Myalgia | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | Tachycardia | FAERS: 18 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 57 | Vertigo | FAERS: 18 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 58 | Medication Error | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Pruritus | FAERS: 17 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 60 | Urinary Retention | FAERS: 17 | US FAERS | |
| 61 | Visual Impairment | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 62 | Chills | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 63 | Drug exposure via breast milk | FAERS: 16 | US FAERS | |
| 64 | Physical assault | FAERS: 16 | US FAERS | |
| 65 | Anorgasmia | FAERS: 15 | US FAERS | |
| 66 | Incorrect dose administered | FAERS: 15 | US FAERS | |
| 67 | Lethargy | FAERS: 15 | US FAERS | |
| 68 | Spina Bifida | FAERS: 15 | US FAERS | |
| 69 | Thrombocytopenia | FAERS: 15 | US FAERS | |
| 70 | Unevaluable event | FAERS: 15 | US FAERS | |
| 71 | Urticaria | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Apathy | FAERS: 14 | US FAERS | |
| 73 | Disease recurrence | FAERS: 14 | US FAERS | |
| 74 | Impaired driving ability | FAERS: 14 | US FAERS | |
| 75 | Personality Change | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Asphyxia | FAERS: 13 | US FAERS | |
| 77 | Disorientation | FAERS: 13 | US FAERS | |
| 78 | Activities of daily living impaired | FAERS: 12 | US FAERS | |
| 79 | Burning sensation | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 80 | Constipation | FAERS: 12 | US FAERS | |
| 81 | Discomfort | FAERS: 12 | US FAERS | |
| 82 | Dysgeusia | FAERS: 12 | US FAERS | |
| 83 | Hostility | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Hypotension | FAERS: 12 | US FAERS | |
| 85 | Mental status changes | FAERS: 12 | US FAERS | |
| 86 | Photophobia | FAERS: 12 | US FAERS | |
| 87 | Product quality issue | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Restless Legs Syndrome | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | Torticollis | FAERS: 12 | US FAERS | |
| 90 | Blood cholesterol increased | FAERS: 11 | US FAERS | |
| 91 | Emotional distress | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Hypersomnia | FAERS: 11 | US FAERS | |
| 93 | Intentional product misuse | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Tardive Dyskinesia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Atrial Fibrillation | FAERS: 10 | US FAERS | |
| 96 | Cardiac Arrest | FAERS: 10 | US FAERS | |
| 97 | Cerebral disorder | FAERS: 10 | US FAERS | |
| 98 | Cleft Palate | FAERS: 10 | US FAERS | |
| 99 | Mydriasis | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 100 | Neck Pain | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 101 | Nephrolithiasis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 102 | Sinusitis | FAERS: 10 | US FAERS | |
| 103 | Akathisia | FAERS: 9 | US FAERS | |
| 104 | Anhedonia | FAERS: 9 | US FAERS | |
| 105 | Bipolar Disorder | FAERS: 9 | US FAERS | |
| 106 | Blood sodium decreased | FAERS: 9 | US FAERS | |
| 107 | Bradycardia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 108 | Bruxism | FAERS: 9 | US FAERS | |
| 109 | Diplopia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Drug dispensing error | FAERS: 9 | US FAERS | |
| 111 | Drug toxicity | FAERS: 9 | US FAERS | |
| 112 | Dysarthria | FAERS: 9 | US FAERS | |
| 113 | Euphoric mood | FAERS: 9 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 114 | Flushing | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 115 | Night sweats | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Alanine Aminotransferase Increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Aspartate Aminotransferase Increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Bicuspid aortic valve | FAERS: 8 | US FAERS | |
| 119 | Blood triglycerides increased | FAERS: 8 | US FAERS | |
| 120 | Drug Dependence | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 121 | Dyspepsia | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 122 | Educational problem | FAERS: 8 | US FAERS | |
| 123 | Erythema | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Feeling jittery | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 125 | Hydrocephalus | FAERS: 8 | US FAERS | |
| 126 | Mental impairment | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Petechiae | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 128 | Stress | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Visual disturbance | FAERS: 8 | US FAERS | |
| 130 | White blood cell count decreased | FAERS: 8 | US FAERS | |
| 131 | Yawning | FAERS: 8 | US FAERS | |
| 132 | treatment failure | FAERS: 8 | US FAERS | |
| 133 | Angle Closure Glaucoma | FAERS: 7 | US FAERS | |
| 134 | Anorexia | FAERS: 7 | US FAERS | |
| 135 | Aphasia | FAERS: 7 | US FAERS | |
| 136 | Chest discomfort | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Congenital Hydrocephalus | FAERS: 7 | US FAERS | |
| 138 | Deafness | FAERS: 7 | US FAERS | |
| 139 | Dissociation | FAERS: 7 | US FAERS | |
| 140 | Economic problem | FAERS: 7 | US FAERS | |
| 141 | Flatulence | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 142 | Inappropriate schedule of drug administration | FAERS: 7 | US FAERS | |
| 143 | Musculoskeletal stiffness | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 144 | Myocardial Infarction | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 145 | Neonatal disorder | FAERS: 7 | US FAERS | |
| 146 | Obsessive-Compulsive Disorder | FAERS: 7 | US FAERS | |
| 147 | Pancreatitis | FAERS: 7 | US FAERS | |
| 148 | Pharmaceutical product complaint | FAERS: 7 | US FAERS | |
| 149 | Priapism | FAERS: 7 | US FAERS | |
| 150 | Pulmonary Valve Stenosis | FAERS: 7 | US FAERS | |
| 151 | Pulmonary congestion | FAERS: 7 | US FAERS | |
| 152 | Screaming | FAERS: 7 | US FAERS | |
| 153 | Wrong technique in product usage process | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Adverse event | FAERS: 6 | US FAERS | |
| 155 | Arteriosclerosis | FAERS: 6 | US FAERS | |
| 156 | Back Pain | FAERS: 6 | US FAERS | |
| 157 | Blindness | FAERS: 6 | US FAERS | |
| 158 | Blood creatine phosphokinase increased | FAERS: 6 | US FAERS | |
| 159 | Cardiomegaly | FAERS: 6 | US FAERS | |
| 160 | Conversion disorder | FAERS: 6 | US FAERS | |
| 161 | Delirium | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 162 | Depressed Level of Consciousness | FAERS: 6 | US FAERS | |
| 163 | Electrocardiogram abnormal | FAERS: 6 | US FAERS | |
| 164 | Epistaxis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 165 | Homicide | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Hyperventilation | FAERS: 6 | US FAERS | |
| 167 | Hypospadias | FAERS: 6 | US FAERS | |
| 168 | Incoherent | FAERS: 6 | US FAERS | |
| 169 | Leukopenia | FAERS: 6 | US FAERS | |
| 170 | Muscle Rigidity | FAERS: 6 | US FAERS | |
| 171 | Nerve injury | FAERS: 6 | US FAERS | |
| 172 | Pulmonary Hypertension | FAERS: 6 | US FAERS | |
| 173 | Retching | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 174 | Supraventricular tachycardia | FAERS: 6 | US FAERS | |
| 175 | Tachyphrenia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 176 | Atrioventricular Septal Defect | FAERS: 5 | US FAERS | |
| 177 | Breast tenderness | FAERS: 5 | US FAERS | |
| 178 | Cerebrovascular accident | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 179 | Cholelithiasis | FAERS: 5 | US FAERS | |
| 180 | Dehydration | FAERS: 5 | US FAERS | |
| 181 | Double Outlet Right Ventricle | FAERS: 5 | US FAERS | |
| 182 | Drug abuse | FAERS: 5 | US FAERS | |
| 183 | Electroencephalogram abnormal | FAERS: 5 | US FAERS | |
| 184 | Excoriation | FAERS: 5 | US FAERS | |
| 185 | Eye pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 186 | Feeling Cold | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 187 | Feelings of worthlessness | FAERS: 5 | US FAERS | |
| 188 | Formication | FAERS: 5 | US FAERS | |
| 189 | Hip Dysplasia | FAERS: 5 | US FAERS | |
| 190 | Hyperacusis | FAERS: 5 | US FAERS | |
| 191 | Infection | FAERS: 5 | US FAERS | |
| 192 | Influenza | FAERS: 5 | US FAERS | |
| 193 | Mastitis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 195 | Megacolon | FAERS: 5 | US FAERS | |
| 196 | Menorrhagia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Murder | FAERS: 5 | US FAERS | |
| 198 | Muscle tightness | FAERS: 5 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 199 | Musculoskeletal Pain | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Neutropenia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 201 | Partner stress | FAERS: 5 | US FAERS | |
| 202 | Respiratory distress | FAERS: 5 | US FAERS | |
| 203 | Therapy cessation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 204 | Thrombosis | FAERS: 5 | US FAERS | |
| 205 | Unresponsive to stimuli | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 206 | Abasia | FAERS: 4 | US FAERS | |
| 207 | Accidental overdose | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 208 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 209 | Blood glucose decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 210 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 211 | Cataract | FAERS: 4 | US FAERS | |
| 212 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 213 | Dysuria | FAERS: 4 | US FAERS | |
| 214 | Ear discomfort | FAERS: 4 | US FAERS | |
| 215 | Epilepsy | FAERS: 4 | US FAERS | |
| 216 | Feeding disorder neonatal | FAERS: 4 | US FAERS | |
| 217 | Flat affect | FAERS: 4 | US FAERS | |
| 218 | Food Allergy | FAERS: 4 | US FAERS | |
| 219 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 220 | Head discomfort | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 221 | Hepatomegaly | FAERS: 4 | US FAERS | |
| 222 | Hernia | FAERS: 4 | US FAERS | |
| 223 | Hypertensive crisis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 224 | Intentional misuse | FAERS: 4 | US FAERS | |
| 225 | Irritable Bowel Syndrome | FAERS: 4 | US FAERS | |
| 226 | Joint swelling | FAERS: 4 | US FAERS | |
| 227 | Laceration | FAERS: 4 | US FAERS | |
| 228 | Metrorrhagia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Microcephaly | FAERS: 4 | US FAERS | |
| 230 | Obsessive thoughts | FAERS: 4 | US FAERS | |
| 231 | Optic Neuritis | FAERS: 4 | US FAERS | |
| 232 | Pallor | FAERS: 4 | US FAERS | |
| 233 | Pancytopenia | FAERS: 4 | US FAERS | |
| 234 | Presyncope | FAERS: 4 | US FAERS | |
| 235 | Pulmonary artery stenosis | FAERS: 4 | US FAERS | |
| 236 | Rash erythematous | FAERS: 4 | US FAERS | |
| 237 | Right Ventricular Hypertrophy | FAERS: 4 | US FAERS | |
| 238 | Sexual abuse | FAERS: 4 | US FAERS | |
| 239 | Skin laceration | FAERS: 4 | US FAERS | |
| 240 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 241 | Activation syndrome | FAERS: 3 | US FAERS | |
| 242 | Ageusia | FAERS: 3 | US FAERS | |
| 243 | Angioedema | FAERS: 3 | US FAERS | |
| 244 | Asthma | FAERS: 3 | US FAERS | |
| 245 | Ataxia | FAERS: 3 | US FAERS | |
| 246 | Autoimmune thyroiditis | FAERS: 3 | US FAERS | |
| 247 | Autonomic nervous system imbalance | FAERS: 3 | US FAERS | |
| 248 | Blood iron decreased | FAERS: 3 | US FAERS | |
| 249 | Choking | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 250 | Cold sweat | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 251 | Complication of delivery | FAERS: 3 | US FAERS | |
| 252 | Complications of maternal exposure to therapeutic drugs | FAERS: 3 | US FAERS | |
| 253 | Congenital pulmonary hypertension | FAERS: 3 | US FAERS | |
| 254 | Congenital torticollis | FAERS: 3 | US FAERS | |
| 255 | Device malfunction | FAERS: 3 | US FAERS | |
| 256 | Dry gangrene | FAERS: 3 | US FAERS | |
| 257 | Ecchymosis | FAERS: 3 | US FAERS | |
| 258 | Eczema | FAERS: 3 | US FAERS | |
| 259 | Eye irritation | FAERS: 3 | US FAERS | |
| 260 | Failure to Thrive | FAERS: 3 | US FAERS | |
| 261 | Female Orgasmic Disorder | FAERS: 3 | US FAERS | |
| 262 | Food craving | FAERS: 3 | US FAERS | |
| 263 | Glaucoma | FAERS: 3 | US FAERS | |
| 264 | Guillain-Barre Syndrome | FAERS: 3 | US FAERS | |
| 265 | Hallucinations, mixed | FAERS: 3 | US FAERS | |
| 266 | Hyperreflexia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 267 | Hyperthyroidism | FAERS: 3 | US FAERS | |
| 268 | Hypokinesia | FAERS: 3 | US FAERS | |
| 269 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 270 | Incontinence | FAERS: 3 | US FAERS | |
| 271 | Infarction | FAERS: 3 | US FAERS | |
| 272 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 273 | Male Orgasmic Disorder | FAERS: 3 | US FAERS | |
| 274 | Multiple Sclerosis | FAERS: 3 | US FAERS | |
| 275 | Multiple drug overdose | FAERS: 3 | US FAERS | |
| 276 | Neuralgia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 277 | Nystagmus | FAERS: 3 | US FAERS | |
| 278 | Oliguria | FAERS: 3 | US FAERS | |
| 279 | Oropharyngeal pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 280 | Pneumonia | FAERS: 3 | US FAERS | |
| 281 | Polydipsia | FAERS: 3 | US FAERS | |
| 282 | Poor quality sleep | FAERS: 3 | US FAERS | |
| 283 | Product formulation issue | FAERS: 3 | US FAERS | |
| 284 | Product label issue | FAERS: 3 | US FAERS | |
| 285 | Psychiatric symptom | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 286 | Pulmonary malformation | FAERS: 3 | US FAERS | |
| 287 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 288 | Respiratory Depression | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 289 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 290 | Rheumatoid Arthritis | FAERS: 3 | US FAERS | |
| 291 | Scotoma | FAERS: 3 | US FAERS | |
| 292 | Sepsis | FAERS: 3 | US FAERS | |
| 293 | Shock | FAERS: 3 | US FAERS | |
| 294 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 295 | Skin lesion | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 296 | Spina Bifida Occulta | FAERS: 3 | US FAERS | |
| 297 | Staring | FAERS: 3 | US FAERS | |
| 298 | Stillbirth | FAERS: 3 | US FAERS | |
| 299 | Subileus | FAERS: 3 | US FAERS | |
| 300 | Sudden death | FAERS: 3 | US FAERS | |
| 301 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 302 | Throat irritation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 303 | Thyroid Neoplasm | FAERS: 3 | US FAERS | |
| 304 | Trismus | FAERS: 3 | US FAERS | |
| 305 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 306 | Urine output increased | FAERS: 3 | US FAERS | |
| 307 | furuncle | FAERS: 3 | US FAERS | |
| 308 | Acidosis | FAERS: 2 | US FAERS | |
| 309 | Acute psychosis | FAERS: 2 | US FAERS | |
| 310 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 311 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 312 | Alcohol interaction | FAERS: 2 | US FAERS | |
| 313 | Alcohol poisoning | FAERS: 2 | US FAERS | |
| 314 | Anosmia | FAERS: 2 | US FAERS | |
| 315 | Anoxic Encephalopathy | FAERS: 2 | US FAERS | |
| 316 | Anticholinergic Syndrome | FAERS: 2 | US FAERS | |
| 317 | Aphagia | FAERS: 2 | US FAERS | |
| 318 | Apparent death | FAERS: 2 | US FAERS | |
| 319 | Arthropathy | FAERS: 2 | US FAERS | |
| 320 | Back disorder | FAERS: 2 | US FAERS | |
| 321 | Bipolar I disorder | FAERS: 2 | US FAERS | |
| 322 | Blepharospasm | FAERS: 2 | US FAERS | |
| 323 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 324 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 325 | Blood prolactin increased | FAERS: 2 | US FAERS | |
| 326 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 327 | Blood testosterone decreased | FAERS: 2 | US FAERS | |
| 328 | Bronchitis | FAERS: 2 | US FAERS | |
| 329 | Butterfly rash | FAERS: 2 | US FAERS | |
| 330 | Catatonia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 331 | Cerebral Palsy | FAERS: 2 | US FAERS | |
| 332 | Cerebral ventricle dilatation | FAERS: 2 | US FAERS | |
| 333 | Chorea | FAERS: 2 | US FAERS | |
| 334 | Clonus | FAERS: 2 | US FAERS | |
| 335 | Clumsiness | FAERS: 2 | US FAERS | |
| 336 | Cluster Headache | FAERS: 2 | US FAERS | |
| 337 | Complex partial seizures | FAERS: 2 | US FAERS | |
| 338 | Dementia | FAERS: 2 | US FAERS | |
| 339 | Dental caries | FAERS: 2 | US FAERS | |
| 340 | Dextrocardia | FAERS: 2 | US FAERS | |
| 341 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 342 | Diaphragmatic Hernia | FAERS: 2 | US FAERS | |
| 343 | Disturbance in sexual arousal | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 344 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 345 | Drug level increased | FAERS: 2 | US FAERS | |
| 346 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 347 | Drug screen positive | FAERS: 2 | US FAERS | |
| 348 | Dry skin | FAERS: 2 | US FAERS | |
| 349 | Ectopic kidney | FAERS: 2 | US FAERS | |
| 350 | Encephalocele | FAERS: 2 | US FAERS | |
| 351 | Encephalomalacia | FAERS: 2 | US FAERS | |
| 352 | Eructation | FAERS: 2 | US FAERS | |
| 353 | Facial Paresis | FAERS: 2 | US FAERS | |
| 354 | Feeling of body temperature change | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 355 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 356 | Fracture | FAERS: 2 | US FAERS | |
| 357 | Frustration | FAERS: 2 | US FAERS | |
| 358 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 359 | Gastric mucosal lesion | FAERS: 2 | US FAERS | |
| 360 | Gastroschisis | FAERS: 2 | US FAERS | |
| 361 | Gestational Diabetes | FAERS: 2 | US FAERS | |
| 362 | Head titubation | FAERS: 2 | US FAERS | |
| 363 | Hepatitis | FAERS: 2 | US FAERS | |
| 364 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 365 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 366 | Hyperphagia | FAERS: 2 | US FAERS | |
| 367 | Hypomania | FAERS: 2 | US FAERS | |
| 368 | Hypotrichosis | FAERS: 2 | US FAERS | |
| 369 | Immobile | FAERS: 2 | US FAERS | |
| 370 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 371 | Impaired self-care | FAERS: 2 | US FAERS | |
| 372 | Inappropriate affect | FAERS: 2 | US FAERS | |
| 373 | Increased tendency to bruise | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 374 | Intellectual Disability | FAERS: 2 | US FAERS | |
| 375 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 376 | Labile blood pressure | FAERS: 2 | US FAERS | |
| 377 | Leukocytosis | FAERS: 2 | US FAERS | |
| 378 | Libido disorder | FAERS: 2 | US FAERS | |
| 379 | Lichen Planus | FAERS: 2 | US FAERS | |
| 380 | Limb discomfort | FAERS: 2 | US FAERS | |
| 381 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 382 | Macular degeneration | FAERS: 2 | US FAERS | |
| 383 | Male sexual dysfunction | FAERS: 2 | US FAERS | |
| 384 | Morbid thoughts | FAERS: 2 | US FAERS | |
| 385 | Motion Sickness | FAERS: 2 | US FAERS | |
| 386 | Muscle Spasticity | FAERS: 2 | US FAERS | |
| 387 | Myoclonus | FAERS: 2 | US FAERS | |
| 388 | Myopia | FAERS: 2 | US FAERS | |
| 389 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 390 | Neonatal cardiac failure | FAERS: 2 | US FAERS | |
| 391 | Neonatal respiratory depression | FAERS: 2 | US FAERS | |
| 392 | No adverse effect | FAERS: 2 | US FAERS | |
| 393 | No adverse event | FAERS: 2 | US FAERS | |
| 394 | Oculogyric crisis | FAERS: 2 | US FAERS | |
| 395 | Oligohydramnios | FAERS: 2 | US FAERS | |
| 396 | Osteopenia | FAERS: 2 | US FAERS | |
| 397 | Osteoporosis | FAERS: 2 | US FAERS | |
| 398 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 399 | Plagiocephaly | FAERS: 2 | US FAERS | |
| 400 | Polyuria | FAERS: 2 | US FAERS | |
| 401 | Post procedural complication | FAERS: 2 | US FAERS | |
| 402 | Post-Traumatic Stress Disorder | FAERS: 2 | US FAERS | |
| 403 | Premature Ejaculation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 404 | Prescription drug used without a prescription | FAERS: 2 | US FAERS | |
| 405 | Product dispensing error | FAERS: 2 | US FAERS | |
| 406 | Productive Cough | FAERS: 2 | US FAERS | |
| 407 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 408 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 409 | Purpura | FAERS: 2 | US FAERS | |
| 410 | Pyelocaliectasis | FAERS: 2 | US FAERS | |
| 411 | Pyloric Stenosis | FAERS: 2 | US FAERS | |
| 412 | Rebound effect | FAERS: 2 | US FAERS | |
| 413 | Refusal of treatment by relative | FAERS: 2 | US FAERS | |
| 414 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 415 | Right atrial dilatation | FAERS: 2 | US FAERS | |
| 416 | Sarcoidosis | FAERS: 2 | US FAERS | |
| 417 | Schizophrenia | FAERS: 2 | US FAERS | |
| 418 | Shoplifting | FAERS: 2 | US FAERS | |
| 419 | Skin irritation | FAERS: 2 | US FAERS | |
| 420 | Sluggishness | FAERS: 2 | US FAERS | |
| 421 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 422 | Swelling | FAERS: 2 | US FAERS | |
| 423 | Syndactyly | FAERS: 2 | US FAERS | |
| 424 | Tension | FAERS: 2 | US FAERS | |
| 425 | Tethered Cord Syndrome | FAERS: 2 | US FAERS | |
| 426 | Therapeutic response unexpected with drug substitution | FAERS: 2 | US FAERS | |
| 427 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 428 | Thirst | FAERS: 2 | US FAERS | |
| 429 | Toxicity to various agents | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 430 | Vaginal abscess | FAERS: 2 | US FAERS | |
| 431 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 432 | Victim of sexual abuse | FAERS: 2 | US FAERS | |
| 433 | Vitamin D Deficiency | FAERS: 2 | US FAERS | |
| 434 | Wheelchair user | FAERS: 2 | US FAERS | |
| 435 | Wheezing | FAERS: 2 | US FAERS | |
| 436 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 437 | muscle injury | FAERS: 2 | US FAERS | |
| 438 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 439 | Abnormal palmar/plantar creases | FAERS: 1 | US FAERS | |
| 440 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 441 | Abscess | FAERS: 1 | US FAERS | |
| 442 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 443 | Acne | FAERS: 1 | US FAERS | |
| 444 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 445 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 446 | Agoraphobia | FAERS: 1 | US FAERS | |
| 447 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 448 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 449 | Ammonia increased | FAERS: 1 | US FAERS | |
| 450 | Amniotic cavity disorder | FAERS: 1 | US FAERS | |
| 451 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 452 | Animal scratch | FAERS: 1 | US FAERS | |
| 453 | Antibody test positive | FAERS: 1 | US FAERS | |
| 454 | Antidepressant drug level increased | FAERS: 1 | US FAERS | |
| 455 | Anuria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 456 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 457 | Aortic Valve Prolapse | FAERS: 1 | US FAERS | |
| 458 | Aphonia | FAERS: 1 | US FAERS | |
| 459 | Aqueductal Stenosis | FAERS: 1 | US FAERS | |
| 460 | Asthenopia | FAERS: 1 | US FAERS | |
| 461 | Autoimmune Pancreatitis | FAERS: 1 | US FAERS | |
| 462 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 463 | Bedridden | FAERS: 1 | US FAERS | |
| 464 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 465 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 466 | Bipolar II disorder | FAERS: 1 | US FAERS | |
| 467 | Bladder pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 468 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 469 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 470 | Blood amylase increased | FAERS: 1 | US FAERS | |
| 471 | Blood citric acid increased | FAERS: 1 | US FAERS | |
| 472 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 473 | Blood creatine phosphokinase MB abnormal | FAERS: 1 | US FAERS | |
| 474 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 475 | Blood fibrinogen decreased | FAERS: 1 | US FAERS | |
| 476 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 477 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 478 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 479 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 480 | Blood phosphorus abnormal | FAERS: 1 | US FAERS | |
| 481 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 482 | Blood urea increased | FAERS: 1 | US FAERS | |
| 483 | Blood urine present | FAERS: 1 | US FAERS | |
| 484 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 485 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 486 | Breath Holding | FAERS: 1 | US FAERS | |
| 487 | Bronchoscopy abnormal | FAERS: 1 | US FAERS | |
| 488 | Bronchospasm | FAERS: 1 | US FAERS | |
| 489 | Bulimia Nervosa | FAERS: 1 | US FAERS | |
| 490 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 491 | Cachexia | FAERS: 1 | US FAERS | |
| 492 | Calcinosis | FAERS: 1 | US FAERS | |
| 493 | Candidiasis | FAERS: 1 | US FAERS | |
| 494 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 495 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 496 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 497 | Cardiac infection | FAERS: 1 | US FAERS | |
| 498 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 499 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 500 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 501 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 502 | Cerebral dysgenesis | FAERS: 1 | US FAERS | |
| 503 | Cervicobrachial syndrome | FAERS: 1 | US FAERS | |
| 504 | Cheilitis | FAERS: 1 | US FAERS | |
| 505 | Cholestasis | FAERS: 1 | US FAERS | |
| 506 | Choreoathetosis | FAERS: 1 | US FAERS | |
| 507 | Colitis | FAERS: 1 | US FAERS | |
| 508 | Compulsive shopping | FAERS: 1 | US FAERS | |
| 509 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 510 | Congenital diaphragmatic hernia | FAERS: 1 | US FAERS | |
| 511 | Congenital heart valve disorder | FAERS: 1 | US FAERS | |
| 512 | Congenital hydronephrosis | FAERS: 1 | US FAERS | |
| 513 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 514 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 515 | Conus Medullaris Syndrome | FAERS: 1 | US FAERS | |
| 516 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 517 | Culture urine positive | FAERS: 1 | US FAERS | |
| 518 | Cyanosis | FAERS: 1 | US FAERS | |
| 519 | Cyclic neutropenia | FAERS: 1 | US FAERS | |
| 520 | Cyclothymic Disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 521 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 522 | Death of relative | FAERS: 1 | US FAERS | |
| 523 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 524 | Delusional disorder, persecutory type | FAERS: 1 | US FAERS | |
| 525 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 526 | Dissociative Identity Disorder | FAERS: 1 | US FAERS | |
| 527 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 528 | Drowning | FAERS: 1 | US FAERS | |
| 529 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 530 | Drug dose titration not performed | FAERS: 1 | US FAERS | |
| 531 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 532 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 533 | Drug titration error | FAERS: 1 | US FAERS | |
| 534 | Drug withdrawal convulsions | FAERS: 1 | US FAERS | |
| 535 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 536 | Duodenal atresia | FAERS: 1 | US FAERS | |
| 537 | Dysgraphia | FAERS: 1 | US FAERS | |
| 538 | Dysmorphism | FAERS: 1 | US FAERS | |
| 539 | Dysphemia | FAERS: 1 | US FAERS | |
| 540 | Dysphonia | FAERS: 1 | US FAERS | |
| 541 | Eclampsia | FAERS: 1 | US FAERS | |
| 542 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 543 | Electrocardiogram delta waves abnormal | FAERS: 1 | US FAERS | |
| 544 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 545 | Elevated mood | FAERS: 1 | US FAERS | |
| 546 | Encephalitis | FAERS: 1 | US FAERS | |
| 547 | Endometriosis | FAERS: 1 | US FAERS | |
| 548 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 549 | Epispadias | FAERS: 1 | US FAERS | |
| 550 | Erythropenia | FAERS: 1 | US FAERS | |
| 551 | Escherichia infection | FAERS: 1 | US FAERS | |
| 552 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 553 | Exposure via father | FAERS: 1 | US FAERS | |
| 554 | Eye Burns | FAERS: 1 | US FAERS | |
| 555 | Facial paralysis | FAERS: 1 | US FAERS | |
| 556 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 557 | Flight of ideas | FAERS: 1 | US FAERS | |
| 558 | Food Poisoning | FAERS: 1 | US FAERS | |
| 559 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 560 | Gambling | FAERS: 1 | US FAERS | |
| 561 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 562 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 563 | Gastritis | FAERS: 1 | US FAERS | |
| 564 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 565 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 566 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 567 | Gaze palsy | FAERS: 1 | US FAERS | |
| 568 | Global Amnesia | FAERS: 1 | US FAERS | |
| 569 | Gout | FAERS: 1 | US FAERS | |
| 570 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 571 | Granulomatous liver disease | FAERS: 1 | US FAERS | |
| 572 | Head Banging | FAERS: 1 | US FAERS | |
| 573 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 574 | Heat Stroke | FAERS: 1 | US FAERS | |
| 575 | Hemiplegia | FAERS: 1 | US FAERS | |
| 576 | Hunger | FAERS: 1 | US FAERS | |
| 577 | Hypercalciuria | FAERS: 1 | US FAERS | |
| 578 | Hyperemesis Gravidarum | FAERS: 1 | US FAERS | |
| 579 | Hyperoxaluria | FAERS: 1 | US FAERS | |
| 580 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 581 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 582 | Hypometabolism | FAERS: 1 | US FAERS | |
| 583 | Hypophagia | FAERS: 1 | US FAERS | |
| 584 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 585 | Hypoxia | FAERS: 1 | US FAERS | |
| 586 | Immunosuppression | FAERS: 1 | US FAERS | |
| 587 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 588 | Impatience | FAERS: 1 | US FAERS | |
| 589 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 590 | Incisional hernia | FAERS: 1 | US FAERS | |
| 591 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 592 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 593 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 594 | Increased insulin requirement | FAERS: 1 | US FAERS | |
| 595 | Infantile apnoeic attack | FAERS: 1 | US FAERS | |
| 596 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 597 | Infertility | FAERS: 1 | US FAERS | |
| 598 | Inflammation | FAERS: 1 | US FAERS | |
| 599 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 600 | Intentional product use issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 601 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 602 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 603 | Joint sprain | FAERS: 1 | US FAERS | |
| 604 | Joint stiffness | FAERS: 1 | US FAERS | |
| 605 | Klippel-Feil Syndrome | FAERS: 1 | US FAERS | |
| 606 | Laryngospasm | FAERS: 1 | US FAERS | |
| 607 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 608 | Left ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 609 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 610 | Limb injury | FAERS: 1 | US FAERS | |
| 611 | Limb operation | FAERS: 1 | US FAERS | |
| 612 | Lipoma | FAERS: 1 | US FAERS | |
| 613 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 614 | Low set ears | FAERS: 1 | US FAERS | |
| 615 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 616 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 617 | Macrocephaly | FAERS: 1 | US FAERS | |
| 618 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 619 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 620 | Malnutrition | FAERS: 1 | US FAERS | |
| 621 | Markedly reduced dietary intake | FAERS: 1 | US FAERS | |
| 622 | Mastication disorder | FAERS: 1 | US FAERS | |
| 623 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 624 | Maternal exposure during delivery | FAERS: 1 | US FAERS | |
| 625 | Medication overuse headache | FAERS: 1 | US FAERS | |
| 626 | Meningioma | FAERS: 1 | US FAERS | |
| 627 | Mental Retardation | FAERS: 1 | US FAERS | |
| 628 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 629 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 630 | Metastases to stomach | FAERS: 1 | US FAERS | |
| 631 | Metastasis | FAERS: 1 | US FAERS | |
| 632 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 633 | Middle insomnia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 634 | Monoplegia | FAERS: 1 | US FAERS | |
| 635 | Multiple drug overdose intentional | FAERS: 1 | US FAERS | |
| 636 | Muscle strain | FAERS: 1 | US FAERS | |
| 637 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 638 | Myopathy | FAERS: 1 | US FAERS | |
| 639 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 640 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 641 | Negative thoughts | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 642 | Neonatal multi-organ failure | FAERS: 1 | US FAERS | |
| 643 | Neonatal respiratory arrest | FAERS: 1 | US FAERS | |
| 644 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 645 | Ocular icterus | FAERS: 1 | US FAERS | |
| 646 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 647 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 648 | Orgasmic sensation decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 649 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 650 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 651 | PO2 decreased | FAERS: 1 | US FAERS | |
| 652 | Panic Disorder | FAERS: 1 | US FAERS | |
| 653 | Paraplegia | FAERS: 1 | US FAERS | |
| 654 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 655 | Pericarditis | FAERS: 1 | US FAERS | |
| 656 | Perineal fistula | FAERS: 1 | US FAERS | |
| 657 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 658 | Pharyngeal swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 659 | Physical disability | FAERS: 1 | US FAERS | |
| 660 | Platelet adhesiveness increased | FAERS: 1 | US FAERS | |
| 661 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 662 | Pneumonitis | FAERS: 1 | US FAERS | |
| 663 | Pneumothorax | FAERS: 1 | US FAERS | |
| 664 | Poisoning | FAERS: 1 | US FAERS | |
| 665 | Polysubstance abuse | FAERS: 1 | US FAERS | |
| 666 | Poor weight gain neonatal | FAERS: 1 | US FAERS | |
| 667 | Postictal headache | FAERS: 1 | US FAERS | |
| 668 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 669 | Pre-Eclampsia | FAERS: 1 | US FAERS | |
| 670 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 671 | Premature Menopause | FAERS: 1 | US FAERS | |
| 672 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 673 | Prescribed overdose | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 674 | Product contamination | FAERS: 1 | US FAERS | |
| 675 | Product counterfeit | FAERS: 1 | US FAERS | |
| 676 | Product dose omission | FAERS: 1 | US FAERS | |
| 677 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 678 | Product lot number issue | FAERS: 1 | US FAERS | |
| 679 | Product physical issue | FAERS: 1 | US FAERS | |
| 680 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 681 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 682 | Product use issue | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 683 | Prostatectomy | FAERS: 1 | US FAERS | |
| 684 | Pseudocyst | FAERS: 1 | US FAERS | |
| 685 | Psoriasis | FAERS: 1 | US FAERS | |
| 686 | Psychiatric decompensation | FAERS: 1 | US FAERS | |
| 687 | Psychiatric evaluation | FAERS: 1 | US FAERS | |
| 688 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 689 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 690 | Purulence | FAERS: 1 | US FAERS | |
| 691 | Purulent discharge | FAERS: 1 | US FAERS | |
| 692 | Radicular pain | FAERS: 1 | US FAERS | |
| 693 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 694 | Rectal discharge | FAERS: 1 | US FAERS | |
| 695 | Renal pain | FAERS: 1 | US FAERS | |
| 696 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 697 | Respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 698 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 699 | Rhinitis | FAERS: 1 | US FAERS | |
| 700 | Right ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 701 | School refusal | FAERS: 1 | US FAERS | |
| 702 | Scleroderma | FAERS: 1 | US FAERS | |
| 703 | Self Mutilation | FAERS: 1 | US FAERS | |
| 704 | Semen analysis abnormal | FAERS: 1 | US FAERS | |
| 705 | Senile dementia | FAERS: 1 | US FAERS | |
| 706 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 707 | Sickle Cell Trait | FAERS: 1 | US FAERS | |
| 708 | Single functional kidney | FAERS: 1 | US FAERS | |
| 709 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 710 | Skeleton dysplasia | FAERS: 1 | US FAERS | |
| 711 | Skin tightness | FAERS: 1 | US FAERS | |
| 712 | Sleep Talking | FAERS: 1 | US FAERS | |
| 713 | Sleep sex | FAERS: 1 | US FAERS | |
| 714 | Sneezing | FAERS: 1 | US FAERS | |
| 715 | Sopor | FAERS: 1 | US FAERS | |
| 716 | Sperm count decreased | FAERS: 1 | US FAERS | |
| 717 | Spermatocele | FAERS: 1 | US FAERS | |
| 718 | Spermatozoa progressive motility decreased | FAERS: 1 | US FAERS | |
| 719 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 720 | Stress at work | FAERS: 1 | US FAERS | |
| 721 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 722 | Suppressed lactation | FAERS: 1 | US FAERS | |
| 723 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 724 | Synostosis | FAERS: 1 | US FAERS | |
| 725 | Syringomyelia | FAERS: 1 | US FAERS | |
| 726 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 727 | Tension Headache | FAERS: 1 | US FAERS | |
| 728 | Tetany | FAERS: 1 | US FAERS | |
| 729 | Theft | FAERS: 1 | US FAERS | |
| 730 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 731 | Therapy change | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 732 | Thermal burn | FAERS: 1 | US FAERS | |
| 733 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 734 | Thyroiditis | FAERS: 1 | US FAERS | |
| 735 | Tobacco user | FAERS: 1 | US FAERS | |
| 736 | Tongue biting | FAERS: 1 | US FAERS | |
| 737 | Tongue spasm | FAERS: 1 | US FAERS | |
| 738 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 739 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 740 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 741 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 742 | Toxoplasmosis | FAERS: 1 | US FAERS | |
| 743 | Transaminases increased | FAERS: 1 | US FAERS | |
| 744 | Traumatic Brain Injury | FAERS: 1 | US FAERS | |
| 745 | Trichotillomania | FAERS: 1 | US FAERS | |
| 746 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 747 | Ulcer | FAERS: 1 | US FAERS | |
| 748 | Underweight | FAERS: 1 | US FAERS | |
| 749 | Unemployment | FAERS: 1 | US FAERS | |
| 750 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 751 | Urine osmolarity decreased | FAERS: 1 | US FAERS | |
| 752 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 753 | Uveitis | FAERS: 1 | US FAERS | |
| 754 | Vaginal Fistula | FAERS: 1 | US FAERS | |
| 755 | Vascular anomaly | FAERS: 1 | US FAERS | |
| 756 | Vasculitis | FAERS: 1 | US FAERS | |
| 757 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 758 | Ventricular hypoplasia | FAERS: 1 | US FAERS | |
| 759 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 760 | Visual brightness | FAERS: 1 | US FAERS | |
| 761 | Vitamin A | FAERS: 1 | US FAERS | |
| 762 | Vitamin D | FAERS: 1 | US FAERS | |
| 763 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 764 | Vitreous opacities | FAERS: 1 | US FAERS | |
| 765 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 766 | Vulvovaginal rash | FAERS: 1 | US FAERS | |
| 767 | Walking aid user | FAERS: 1 | US FAERS | |
| 768 | Wolff-Parkinson-White Syndrome | FAERS: 1 | US FAERS | |
| 769 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 770 | Acute kidney injury | Canada Vigilance: 1 | Canada Vigilance | |
| 771 | Alopecia totalis | Canada Vigilance: 1 | Canada Vigilance | |
| 772 | Ankle Fracture | Canada Vigilance: 1 | Canada Vigilance | |
| 773 | Binge Drinking | Canada Vigilance: 1 | Canada Vigilance | |
| 774 | Breast engorgement | Canada Vigilance: 1 | Canada Vigilance | |
| 775 | Chromaturia | Canada Vigilance: 1 | Canada Vigilance | |
| 776 | Enzyme abnormality | Canada Vigilance: 1 | Canada Vigilance | |
| 777 | Exposure via breast milk | Canada Vigilance: 1 | Canada Vigilance | |
| 778 | Hypohidrosis | Canada Vigilance: 1 | Canada Vigilance | |
| 779 | Inappropriate schedule of product administration | Canada Vigilance: 1 | Canada Vigilance | |
| 780 | Initial insomnia | Canada Vigilance: 1 | Canada Vigilance | |
| 781 | Loss of personal independence in daily activities | Canada Vigilance: 1 | Canada Vigilance | |
| 782 | Opisthotonus | Canada Vigilance: 1 | Canada Vigilance | |
| 783 | Pain of skin | Canada Vigilance: 1 | Canada Vigilance | |
| 784 | Peripheral swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 785 | Shock symptom | Canada Vigilance: 1 | Canada Vigilance | |
| 786 | Somatic symptom disorder | Canada Vigilance: 1 | Canada Vigilance | |
| 787 | Somnambulism | Canada Vigilance: 1 | Canada Vigilance | |
| 788 | Stupor | Canada Vigilance: 1 | Canada Vigilance | |
| 789 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 790 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance | |
| 791 | Therapeutic product ineffective | Canada Vigilance: 2 | Canada Vigilance | |
| 792 | Tongue movement disturbance | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.