Sunitinib
(LBWFXVZLPYTWQI-IPOVEDGCSA-N)
Structure
- SMILES
- OC(=O)C[C@@H](C(=O)O)O.CCN(CCNC(=O)c1c(C)[nH]c(c1C)/C=C/1\C(=O)Nc2c1cc(F)cc2)CC
- Molecular Formula:
- C26H33FN4O7
- Molecular Weight:
- 532.561
- Log P:
- 2.7704
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 6
- TPSA:
- 172.06
- CAS Number(s):
- 341031-54-7
Synonym(s)
1.
Sunitinib
2.
5-(5-Fluoro-2-oxo-1,2-dihydroindolylidenemethyl)-2,4-dimethyl-1H-pyrrole-3-carboxylic acid (2-diethylaminoethyl)amide
3.
SU 011248
4.
SU 11248
5.
SU-011248
6.
SU-11248
7.
SU011248
8.
SU11248
9.
Sunitinib Malate
10.
Sutent
External Link(s)
| MeSH | D000077210 |
| PubChem Compound | 6456015 |
| BindingDB | 50244950 |
| CHEMBL | CHEMBL1567 |
| KEGG | dr:D06402 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Disease Progression | FAERS: 131 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Thrombocytopenia | FAERS: 95 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Vomiting | FAERS: 73 | US FAERS | |
| 4 | Dehydration | FAERS: 71 | OFFSIDES US FAERS | |
| 5 | Asthenia | FAERS: 66 | OFFSIDES US FAERS | |
| 6 | Hypothyroidism | FAERS: 66 | US FAERS | |
| 7 | Fatigue | FAERS: 60 | OFFSIDES US FAERS | |
| 8 | Nausea | FAERS: 58 | US FAERS | |
| 9 | General physical health deterioration | FAERS: 51 | OFFSIDES US FAERS | |
| 10 | Disseminated Intravascular Coagulation | FAERS: 41 | OFFSIDES US FAERS | |
| 11 | Neutropenia | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Metastatic Renal Cell Carcinoma | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 13 | Renal Cell Carcinoma | FAERS: 29 | US FAERS | |
| 14 | Pneumonia | FAERS: 28 | US FAERS | |
| 15 | White blood cell count decreased | FAERS: 27 | US FAERS | |
| 16 | Hypotension | FAERS: 26 | US FAERS | |
| 17 | Stomatitis | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Renal cancer metastatic | FAERS: 24 | OFFSIDES US FAERS | |
| 19 | Abdominal Pain | FAERS: 23 | US FAERS | |
| 20 | Malaise | FAERS: 23 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 21 | Myocardial Infarction | FAERS: 23 | US FAERS | |
| 22 | Ascites | FAERS: 21 | OFFSIDES US FAERS | |
| 23 | Pancytopenia | FAERS: 21 | US FAERS | |
| 24 | Sepsis | FAERS: 21 | US FAERS | |
| 25 | Pulmonary Embolism | FAERS: 20 | US FAERS | |
| 26 | Epistaxis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 27 | Osteonecrosis of Jaw | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Cardiac Arrest | FAERS: 18 | US FAERS | |
| 29 | Respiratory Failure | FAERS: 18 | US FAERS | |
| 30 | Blood creatinine increased | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Infection | FAERS: 17 | US FAERS | |
| 32 | Lower respiratory tract infection | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Lethargy | FAERS: 16 | OFFSIDES US FAERS | |
| 34 | Leukopenia | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Pneumatosis intestinalis | FAERS: 15 | US FAERS | |
| 36 | Sudden death | FAERS: 15 | US FAERS | |
| 37 | Pneumonitis | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Headache | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Pneumothorax | FAERS: 13 | US FAERS | |
| 40 | Syncope | FAERS: 13 | US FAERS | |
| 41 | Acute kidney injury | FAERS: 12 | US FAERS | |
| 42 | Cholecystitis | FAERS: 12 | OFFSIDES US FAERS | |
| 43 | Dizziness | FAERS: 12 | US FAERS | |
| 44 | Hepatitis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Thrombosis | FAERS: 12 | US FAERS | |
| 46 | jaundice | FAERS: 12 | US FAERS | |
| 47 | Chest Pain | FAERS: 11 | US FAERS | |
| 48 | Deep Vein Thrombosis | FAERS: 11 | US FAERS | |
| 49 | Depressed Level of Consciousness | FAERS: 11 | US FAERS | |
| 50 | Drug toxicity | FAERS: 11 | OFFSIDES US FAERS | |
| 51 | Pericardial effusion | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Skin toxicity | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 53 | Alanine Aminotransferase Increased | FAERS: 10 | US FAERS | |
| 54 | Intestinal Obstruction | FAERS: 10 | US FAERS | |
| 55 | Urinary tract infection | FAERS: 10 | US FAERS | |
| 56 | Abdominal Abscess | FAERS: 9 | OFFSIDES US FAERS | |
| 57 | Atrial Fibrillation | FAERS: 9 | US FAERS | |
| 58 | Cerebral Infarction | FAERS: 9 | US FAERS | |
| 59 | Hemiparesis | FAERS: 9 | US FAERS | |
| 60 | Hyperthyroidism | FAERS: 9 | US FAERS | |
| 61 | Urinary Retention | FAERS: 9 | US FAERS | |
| 62 | Acute myocardial infarction | FAERS: 8 | US FAERS | |
| 63 | Cholangitis | FAERS: 8 | US FAERS | |
| 64 | Constipation | FAERS: 8 | US FAERS | |
| 65 | Diverticulitis | FAERS: 8 | OFFSIDES US FAERS | |
| 66 | Ejection Fraction Decreased | FAERS: 8 | OFFSIDES US FAERS | |
| 67 | Haematotoxicity | FAERS: 8 | US FAERS | |
| 68 | Hypertensive crisis | FAERS: 8 | US FAERS | |
| 69 | MYELODYSPLASTIC SYNDROME | FAERS: 8 | US FAERS | |
| 70 | Neutrophil count decreased | FAERS: 8 | OFFSIDES US FAERS | |
| 71 | Peritonitis | FAERS: 8 | US FAERS | |
| 72 | Proteinuria | FAERS: 8 | US FAERS | |
| 73 | Rhabdomyolysis | FAERS: 8 | US FAERS | |
| 74 | Toxicity to various agents | FAERS: 8 | US FAERS | |
| 75 | Weight decreased | FAERS: 8 | US FAERS | |
| 76 | Anal abscess | FAERS: 7 | OFFSIDES US FAERS | |
| 77 | Blood thyroid stimulating hormone increased | FAERS: 7 | OFFSIDES US FAERS | |
| 78 | Colitis | FAERS: 7 | US FAERS | |
| 79 | Dysgeusia | FAERS: 7 | OFFSIDES US FAERS | |
| 80 | Ileus | FAERS: 7 | US FAERS | |
| 81 | Intestinal Perforation | FAERS: 7 | OFFSIDES US FAERS | |
| 82 | Leukoencephalopathy | FAERS: 7 | OFFSIDES US FAERS | |
| 83 | Septic Shock | FAERS: 7 | US FAERS | |
| 84 | Abscess | FAERS: 6 | US FAERS | |
| 85 | Altered state of consciousness | FAERS: 6 | US FAERS | |
| 86 | Anal Fistula | FAERS: 6 | OFFSIDES US FAERS | |
| 87 | Back Pain | FAERS: 6 | US FAERS | |
| 88 | Cerebrovascular accident | FAERS: 6 | US FAERS | |
| 89 | Dyspepsia | FAERS: 6 | US FAERS | |
| 90 | Erythema Multiforme | FAERS: 6 | US FAERS | |
| 91 | Gastritis | FAERS: 6 | US FAERS | |
| 92 | Liver Abscess | FAERS: 6 | OFFSIDES US FAERS | |
| 93 | Malnutrition | FAERS: 6 | US FAERS | |
| 94 | Performance status decreased | FAERS: 6 | OFFSIDES US FAERS | |
| 95 | Skin Ulcer | FAERS: 6 | US FAERS | |
| 96 | Anorexia | FAERS: 5 | OFFSIDES US FAERS | |
| 97 | Aspartate Aminotransferase Increased | FAERS: 5 | US FAERS | |
| 98 | Bone marrow toxicity | FAERS: 5 | US FAERS | |
| 99 | Bradycardia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Febrile Neutropenia | FAERS: 5 | US FAERS | |
| 101 | Gastroenteritis | FAERS: 5 | OFFSIDES US FAERS | |
| 102 | Gastrointestinal toxicity | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Palpitations | FAERS: 5 | US FAERS | |
| 104 | Tachycardia | FAERS: 5 | US FAERS | |
| 105 | Thyroiditis | FAERS: 5 | OFFSIDES US FAERS | |
| 106 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 107 | Aphasia | FAERS: 4 | US FAERS | |
| 108 | Appendicitis | FAERS: 4 | US FAERS | |
| 109 | Blood magnesium decreased | FAERS: 4 | US FAERS | |
| 110 | Blood urea increased | FAERS: 4 | US FAERS | |
| 111 | Cardiotoxicity | FAERS: 4 | OFFSIDES US FAERS | |
| 112 | Cardiovascular insufficiency | FAERS: 4 | US FAERS | |
| 113 | Cellulitis | FAERS: 4 | US FAERS | |
| 114 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 115 | Electrolyte imbalance | FAERS: 4 | US FAERS | |
| 116 | Enteritis | FAERS: 4 | US FAERS | |
| 117 | Flushing | FAERS: 4 | US FAERS | |
| 118 | Gastrointestinal perforation | FAERS: 4 | US FAERS | |
| 119 | Hypoxia | FAERS: 4 | US FAERS | |
| 120 | Inflammation | FAERS: 4 | US FAERS | |
| 121 | Lentigo | FAERS: 4 | OFFSIDES US FAERS | |
| 122 | Leukocytosis | FAERS: 4 | US FAERS | |
| 123 | Mental status changes | FAERS: 4 | OFFSIDES US FAERS | |
| 124 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 125 | Neutropenic sepsis | FAERS: 4 | OFFSIDES US FAERS | |
| 126 | Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Polyneuropathy | FAERS: 4 | US FAERS | |
| 128 | Posterior reversible encephalopathy syndrome | FAERS: 4 | US FAERS | |
| 129 | Product use in unapproved indication | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Pruritus | FAERS: 4 | US FAERS | |
| 131 | Purpura | FAERS: 4 | US FAERS | |
| 132 | Renal tubular necrosis | FAERS: 4 | US FAERS | |
| 133 | Respiratory distress | FAERS: 4 | US FAERS | |
| 134 | Tremor | FAERS: 4 | US FAERS | |
| 135 | Wound Complication | FAERS: 4 | US FAERS | |
| 136 | Acne | FAERS: 3 | US FAERS | |
| 137 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 138 | Ammonia increased | FAERS: 3 | US FAERS | |
| 139 | Anuria | FAERS: 3 | US FAERS | |
| 140 | Arthralgia | FAERS: 3 | US FAERS | |
| 141 | Ataxia | FAERS: 3 | OFFSIDES US FAERS | |
| 142 | Atrial Flutter | FAERS: 3 | US FAERS | |
| 143 | Blood cholesterol abnormal | FAERS: 3 | US FAERS | |
| 144 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 145 | Cholestasis | FAERS: 3 | US FAERS | |
| 146 | Chromaturia | FAERS: 3 | OFFSIDES US FAERS | |
| 147 | Conjunctivitis | FAERS: 3 | US FAERS | |
| 148 | Cystitis | FAERS: 3 | US FAERS | |
| 149 | Cytolytic hepatitis | FAERS: 3 | US FAERS | |
| 150 | Cytopenia | FAERS: 3 | US FAERS | |
| 151 | Deafness | FAERS: 3 | US FAERS | |
| 152 | Dermatitis | FAERS: 3 | US FAERS | |
| 153 | Device related sepsis | FAERS: 3 | US FAERS | |
| 154 | Discomfort | FAERS: 3 | US FAERS | |
| 155 | Diverticular perforation | FAERS: 3 | OFFSIDES US FAERS | |
| 156 | Dysarthria | FAERS: 3 | US FAERS | |
| 157 | Dysuria | FAERS: 3 | US FAERS | |
| 158 | Embolism | FAERS: 3 | OFFSIDES US FAERS | |
| 159 | Erythema | FAERS: 3 | US FAERS | |
| 160 | Flank Pain | FAERS: 3 | US FAERS | |
| 161 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 162 | Gingivitis | FAERS: 3 | US FAERS | |
| 163 | Myoclonus | FAERS: 3 | US FAERS | |
| 164 | Nephrotic Syndrome | FAERS: 3 | OFFSIDES US FAERS | |
| 165 | Osteitis | FAERS: 3 | US FAERS | |
| 166 | Pancreatic Insufficiency | FAERS: 3 | US FAERS | |
| 167 | Pancreatitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Peridiverticular abscess | FAERS: 3 | US FAERS | |
| 169 | Petechiae | FAERS: 3 | US FAERS | |
| 170 | Pharyngeal fistula | FAERS: 3 | OFFSIDES US FAERS | |
| 171 | Pharyngitis | FAERS: 3 | US FAERS | |
| 172 | Presyncope | FAERS: 3 | US FAERS | |
| 173 | Product use issue | FAERS: 3 | US FAERS | |
| 174 | Pulmonary Hypertension | FAERS: 3 | US FAERS | |
| 175 | Pyoderma Gangrenosum | FAERS: 3 | OFFSIDES US FAERS | |
| 176 | Rales | FAERS: 3 | US FAERS | |
| 177 | Renal pain | FAERS: 3 | US FAERS | |
| 178 | Shock | FAERS: 3 | US FAERS | |
| 179 | Skin necrosis | FAERS: 3 | OFFSIDES US FAERS | |
| 180 | Skin reaction | FAERS: 3 | US FAERS | |
| 181 | Splenic abscess | FAERS: 3 | US FAERS | |
| 182 | Splenic cyst | FAERS: 3 | US FAERS | |
| 183 | Tracheal fistula | FAERS: 3 | OFFSIDES US FAERS | |
| 184 | Tumour haemorrhage | FAERS: 3 | US FAERS | |
| 185 | Urinary tract obstruction | FAERS: 3 | US FAERS | |
| 186 | Visual Impairment | FAERS: 3 | US FAERS | |
| 187 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 188 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 189 | Agitation | FAERS: 2 | US FAERS | |
| 190 | Alanine aminotransferase abnormal | FAERS: 2 | US FAERS | |
| 191 | Amyotrophic Lateral Sclerosis | FAERS: 2 | US FAERS | |
| 192 | Anxiety | FAERS: 2 | US FAERS | |
| 193 | Aspartate aminotransferase abnormal | FAERS: 2 | US FAERS | |
| 194 | Atelectasis | FAERS: 2 | US FAERS | |
| 195 | Autoimmune thyroiditis | FAERS: 2 | OFFSIDES US FAERS | |
| 196 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 197 | Blood albumin decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 198 | Blood creatine increased | FAERS: 2 | OFFSIDES US FAERS | |
| 199 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 200 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 201 | Blood testosterone decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 202 | Blood triglycerides abnormal | FAERS: 2 | US FAERS | |
| 203 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 204 | Bone lesion | FAERS: 2 | US FAERS | |
| 205 | Bronchial Obstruction | FAERS: 2 | US FAERS | |
| 206 | Bronchitis | FAERS: 2 | US FAERS | |
| 207 | Bursitis | FAERS: 2 | US FAERS | |
| 208 | Campylobacter infection | FAERS: 2 | US FAERS | |
| 209 | Cardiac Tamponade | FAERS: 2 | US FAERS | |
| 210 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 211 | Carotid artery aneurysm | FAERS: 2 | OFFSIDES US FAERS | |
| 212 | Chills | FAERS: 2 | US FAERS | |
| 213 | Cor pulmonale | FAERS: 2 | US FAERS | |
| 214 | Coronary artery insufficiency | FAERS: 2 | US FAERS | |
| 215 | Dementia | FAERS: 2 | US FAERS | |
| 216 | Duodenal Ulcer | FAERS: 2 | US FAERS | |
| 217 | Encephalitis | FAERS: 2 | US FAERS | |
| 218 | Escherichia test positive | FAERS: 2 | US FAERS | |
| 219 | Exfoliative rash | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 220 | Fracture | FAERS: 2 | US FAERS | |
| 221 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 222 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 223 | Hypophagia | FAERS: 2 | US FAERS | |
| 224 | Lymphocyte count decreased | FAERS: 2 | US FAERS | |
| 225 | Lymphopenia | FAERS: 2 | US FAERS | |
| 226 | Malignant Hypertension | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 227 | Medical device complication | FAERS: 2 | US FAERS | |
| 228 | Memory impairment | FAERS: 2 | US FAERS | |
| 229 | Metastasis | FAERS: 2 | US FAERS | |
| 230 | Monoplegia | FAERS: 2 | US FAERS | |
| 231 | Mucosal toxicity | FAERS: 2 | US FAERS | |
| 232 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 233 | Necrosis | FAERS: 2 | US FAERS | |
| 234 | No adverse event | FAERS: 2 | US FAERS | |
| 235 | Oncologic complication | FAERS: 2 | OFFSIDES US FAERS | |
| 236 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 237 | Oral pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Pathological fracture | FAERS: 2 | US FAERS | |
| 239 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 240 | Periproctitis | FAERS: 2 | OFFSIDES US FAERS | |
| 241 | Pneumocystis jiroveci pneumonia | FAERS: 2 | US FAERS | |
| 242 | Pneumoperitoneum | FAERS: 2 | OFFSIDES US FAERS | |
| 243 | Prostatic specific antigen decreased | FAERS: 2 | US FAERS | |
| 244 | Pulmonary artery thrombosis | FAERS: 2 | US FAERS | |
| 245 | Renal tubular disorder | FAERS: 2 | US FAERS | |
| 246 | Residual urine | FAERS: 2 | US FAERS | |
| 247 | Sensorimotor disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 248 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 249 | Skin lesion | FAERS: 2 | US FAERS | |
| 250 | Subcutaneous Abscess | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 251 | Subileus | FAERS: 2 | US FAERS | |
| 252 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 253 | Swelling | FAERS: 2 | US FAERS | |
| 254 | Transaminases increased | FAERS: 2 | US FAERS | |
| 255 | Troponin increased | FAERS: 2 | OFFSIDES US FAERS | |
| 256 | Vertigo | FAERS: 2 | US FAERS | |
| 257 | Abasia | FAERS: 1 | US FAERS | |
| 258 | Acidosis | FAERS: 1 | US FAERS | |
| 259 | Ageusia | FAERS: 1 | OFFSIDES US FAERS | |
| 260 | Albuminuria | FAERS: 1 | US FAERS | |
| 261 | Alopecia | FAERS: 1 | US FAERS | |
| 262 | Anal Fissure | FAERS: 1 | OFFSIDES US FAERS | |
| 263 | Anal erosion | FAERS: 1 | US FAERS | |
| 264 | Aneurysm | FAERS: 1 | US FAERS | |
| 265 | Aphonia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 266 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 267 | Aspergillosis | FAERS: 1 | US FAERS | |
| 268 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 269 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 270 | Autoresuscitation | FAERS: 1 | US FAERS | |
| 271 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 272 | Blindness | FAERS: 1 | US FAERS | |
| 273 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 274 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 275 | Blood count abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 276 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 277 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 278 | Blood pressure fluctuation | FAERS: 1 | OFFSIDES US FAERS | |
| 279 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 280 | Blood product transfusion dependent | FAERS: 1 | OFFSIDES US FAERS | |
| 281 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 282 | Blood urine present | FAERS: 1 | US FAERS | |
| 283 | Blue Toe Syndrome | FAERS: 1 | US FAERS | |
| 284 | Bone abscess | FAERS: 1 | US FAERS | |
| 285 | Bone pain | FAERS: 1 | US FAERS | |
| 286 | Bone swelling | FAERS: 1 | US FAERS | |
| 287 | Bronchial Fistula | FAERS: 1 | OFFSIDES US FAERS | |
| 288 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 289 | Bronchospasm | FAERS: 1 | US FAERS | |
| 290 | Cachexia | FAERS: 1 | US FAERS | |
| 291 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 292 | Cauda Equina Syndrome | FAERS: 1 | US FAERS | |
| 293 | Chest discomfort | FAERS: 1 | US FAERS | |
| 294 | Cholecystitis infective | FAERS: 1 | OFFSIDES US FAERS | |
| 295 | Cholecystocholangitis | FAERS: 1 | US FAERS | |
| 296 | Cold sweat | FAERS: 1 | US FAERS | |
| 297 | Completed Suicide | FAERS: 1 | US FAERS | |
| 298 | Cyst | FAERS: 1 | US FAERS | |
| 299 | Delirium | FAERS: 1 | US FAERS | |
| 300 | Dental caries | FAERS: 1 | US FAERS | |
| 301 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 302 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 303 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 304 | Diplegia | FAERS: 1 | US FAERS | |
| 305 | Disease complication | FAERS: 1 | OFFSIDES US FAERS | |
| 306 | Disease recurrence | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 307 | Disorientation | FAERS: 1 | US FAERS | |
| 308 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 309 | Dry skin | FAERS: 1 | US FAERS | |
| 310 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 311 | Ecchymosis | FAERS: 1 | US FAERS | |
| 312 | Empyema | FAERS: 1 | US FAERS | |
| 313 | Enterocutaneous Fistula | FAERS: 1 | OFFSIDES US FAERS | |
| 314 | Epilepsy | FAERS: 1 | US FAERS | |
| 315 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 316 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 317 | Exposure via partner | FAERS: 1 | US FAERS | |
| 318 | Feeling abnormal | FAERS: 1 | US FAERS | |
| 319 | Gait inability | FAERS: 1 | US FAERS | |
| 320 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 321 | Gastrointestinal angiodysplasia | FAERS: 1 | US FAERS | |
| 322 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 323 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 324 | Glossitis | FAERS: 1 | OFFSIDES US FAERS | |
| 325 | Gout | FAERS: 1 | OFFSIDES US FAERS | |
| 326 | Hepatic artery thrombosis | FAERS: 1 | US FAERS | |
| 327 | Hepatitis B | FAERS: 1 | US FAERS | |
| 328 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 329 | Hepatotoxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 330 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 331 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 332 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 333 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 334 | Hypertensive Encephalopathy | FAERS: 1 | US FAERS | |
| 335 | Hyperventilation | FAERS: 1 | US FAERS | |
| 336 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 337 | Hypocapnia | FAERS: 1 | US FAERS | |
| 338 | Hypoventilation | FAERS: 1 | US FAERS | |
| 339 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 340 | Immunosuppression | FAERS: 1 | US FAERS | |
| 341 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 342 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 343 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 344 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 345 | Joint swelling | FAERS: 1 | US FAERS | |
| 346 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 347 | Leriche Syndrome | FAERS: 1 | US FAERS | |
| 348 | Lipase increased | FAERS: 1 | US FAERS | |
| 349 | Liver carcinoma ruptured | FAERS: 1 | US FAERS | |
| 350 | Lung consolidation | FAERS: 1 | US FAERS | |
| 351 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 352 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 353 | Meningitis | FAERS: 1 | US FAERS | |
| 354 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 355 | Metastatic Neoplasm | FAERS: 1 | OFFSIDES US FAERS | |
| 356 | Mucositis management | FAERS: 1 | US FAERS | |
| 357 | Muscle strain | FAERS: 1 | US FAERS | |
| 358 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 359 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 360 | Myalgia | FAERS: 1 | US FAERS | |
| 361 | Myelocytosis | FAERS: 1 | US FAERS | |
| 362 | Neck Pain | FAERS: 1 | US FAERS | |
| 363 | Nephrectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 364 | Nephritic syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 365 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 366 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 367 | Ocular icterus | FAERS: 1 | US FAERS | |
| 368 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 369 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 370 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 371 | Penile exfoliation | FAERS: 1 | US FAERS | |
| 372 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 373 | Pericarditis | FAERS: 1 | US FAERS | |
| 374 | Pleural fistula | FAERS: 1 | US FAERS | |
| 375 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 376 | Pneumopericardium | FAERS: 1 | US FAERS | |
| 377 | Poisoning | FAERS: 1 | US FAERS | |
| 378 | Polyglandular disorder | FAERS: 1 | US FAERS | |
| 379 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 380 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 381 | Prosthesis Implantation | FAERS: 1 | US FAERS | |
| 382 | Protein urine present | FAERS: 1 | US FAERS | |
| 383 | Prothrombin level abnormal | FAERS: 1 | US FAERS | |
| 384 | Psoriasis | FAERS: 1 | US FAERS | |
| 385 | Pulmonary arterial hypertension | FAERS: 1 | OFFSIDES US FAERS | |
| 386 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 387 | Pulmonary toxicity | FAERS: 1 | US FAERS | |
| 388 | Radiation Pneumonitis | FAERS: 1 | US FAERS | |
| 389 | Rebound effect | FAERS: 1 | US FAERS | |
| 390 | Recall phenomenon | FAERS: 1 | OFFSIDES US FAERS | |
| 391 | Regurgitation | FAERS: 1 | US FAERS | |
| 392 | Renal abscess | FAERS: 1 | US FAERS | |
| 393 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 394 | Retroperitoneal abscess | FAERS: 1 | OFFSIDES US FAERS | |
| 395 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 396 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 397 | Schizophrenia | FAERS: 1 | US FAERS | |
| 398 | Scrotal erythema | FAERS: 1 | OFFSIDES US FAERS | |
| 399 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 400 | Skin Erosion | FAERS: 1 | OFFSIDES US FAERS | |
| 401 | Somnolence | FAERS: 1 | US FAERS | |
| 402 | Sopor | FAERS: 1 | US FAERS | |
| 403 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 404 | Stupor | FAERS: 1 | US FAERS | |
| 405 | Subcorneal pustular dermatosis | FAERS: 1 | US FAERS | |
| 406 | Superior Vena Cava Syndrome | FAERS: 1 | US FAERS | |
| 407 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 408 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 409 | Toothache | FAERS: 1 | US FAERS | |
| 410 | Tuberculosis | FAERS: 1 | US FAERS | |
| 411 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 412 | Urinary tract inflammation | FAERS: 1 | US FAERS | |
| 413 | Vascular fragility | FAERS: 1 | US FAERS | |
| 414 | Venous Injury | FAERS: 1 | US FAERS | |
| 415 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 416 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 417 | Wound dehiscence | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | insulinoma | FAERS: 1 | US FAERS | |
| 419 | nervous system disorder | FAERS: 1 | US FAERS | |
| 420 | pseudomembranous colitis | FAERS: 1 | US FAERS | |
| 421 | Abdominal mass | OFFSIDES | ||
| 422 | Abortion early | OFFSIDES | ||
| 423 | Adenocarcinoma | OFFSIDES | ||
| 424 | Adrenal gland cancer metastatic | OFFSIDES | ||
| 425 | Adrenal mass | OFFSIDES | ||
| 426 | Adverse event | OFFSIDES | ||
| 427 | Anal discomfort | OFFSIDES | ||
| 428 | Anal infection | OFFSIDES | ||
| 429 | Anal inflammation | OFFSIDES | ||
| 430 | Angiodysplasia | OFFSIDES | ||
| 431 | Anisocoria | OFFSIDES | ||
| 432 | Anorectal cellulitis | OFFSIDES | ||
| 433 | Aortitis | OFFSIDES | ||
| 434 | Arteritis | OFFSIDES | ||
| 435 | Bacterial disease carrier | OFFSIDES | ||
| 436 | Beta 2 microglobulin increased | OFFSIDES | ||
| 437 | Beta-N-acetyl-D-glucosaminidase increased | OFFSIDES | ||
| 438 | Bladder cancer stage IV | OFFSIDES | ||
| 439 | Bladder discomfort | OFFSIDES | ||
| 440 | Blepharoptosis | OFFSIDES | ||
| 441 | Blood albumin | OFFSIDES | ||
| 442 | Blood alkaline phosphatase | OFFSIDES | ||
| 443 | Blood bilirubin unconjugated increased | OFFSIDES | ||
| 444 | Blood calcium abnormal | OFFSIDES | ||
| 445 | Blood chloride abnormal | OFFSIDES | ||
| 446 | Blood copper abnormal | OFFSIDES | ||
| 447 | Blood glucose abnormal | OFFSIDES | ||
| 448 | Blood human chorionic gonadotropin increased | OFFSIDES | ||
| 449 | Blood phosphorus | OFFSIDES | ||
| 450 | Blood triglycerides | OFFSIDES | ||
| 451 | Budd-Chiari Syndrome | OFFSIDES | ||
| 452 | Burning Mouth Syndrome | OFFSIDES | ||
| 453 | Cancer Pain | OFFSIDES | ||
| 454 | Cardiac enzymes increased | OFFSIDES | ||
| 455 | Cerebral Thrombosis | OFFSIDES | ||
| 456 | Cervical cord compression | OFFSIDES | ||
| 457 | Cholangiolitis | OFFSIDES | ||
| 458 | Colonic fistula | OFFSIDES | ||
| 459 | Confabulation | OFFSIDES | ||
| 460 | Conjunctival irritation | OFFSIDES | ||
| 461 | Corneal Ulcer | OFFSIDES | ||
| 462 | Coronary artery dilatation | OFFSIDES | ||
| 463 | Creatinine renal clearance increased | OFFSIDES | ||
| 464 | Denervation atrophy | OFFSIDES | ||
| 465 | Dental alveolar anomaly | OFFSIDES | ||
| 466 | Device migration | OFFSIDES | ||
| 467 | Drug ineffective | Canada Vigilance: 1 | Canada Vigilance | |
| 468 | Early satiety | OFFSIDES | ||
| 469 | Ejection fraction abnormal | OFFSIDES | ||
| 470 | Electrocardiogram ST-T segment abnormal | OFFSIDES | ||
| 471 | Electrocardiogram change | OFFSIDES | ||
| 472 | Emphysematous Cholecystitis | OFFSIDES | ||
| 473 | Enterobacter sepsis | OFFSIDES | ||
| 474 | Enterovesical Fistula | OFFSIDES | ||
| 475 | Eosinophilic myocarditis | OFFSIDES | ||
| 476 | Esophageal Perforation | OFFSIDES | ||
| 477 | Excoriation | OFFSIDES | ||
| 478 | Febrile infection | OFFSIDES | ||
| 479 | Focal glomerulosclerosis | OFFSIDES | ||
| 480 | Full blood count decreased | OFFSIDES | ||
| 481 | Gastric infection | OFFSIDES | ||
| 482 | Gastroduodenitis | OFFSIDES | ||
| 483 | Gastrointestinal amyloidosis | OFFSIDES | ||
| 484 | Gene mutation identification test | OFFSIDES | ||
| 485 | Genital burning sensation | OFFSIDES | ||
| 486 | Genital erythema | OFFSIDES | ||
| 487 | Genital rash | OFFSIDES | ||
| 488 | Globulin abnormal | OFFSIDES | ||
| 489 | Globulinuria | OFFSIDES | ||
| 490 | Heat Stroke | OFFSIDES | ||
| 491 | Hepatectomy | OFFSIDES | ||
| 492 | Hepatic infection bacterial | OFFSIDES | ||
| 493 | Hordeolum | OFFSIDES | ||
| 494 | Incision site infection | OFFSIDES | ||
| 495 | Inspiratory capacity decreased | OFFSIDES | ||
| 496 | Intussusception | OFFSIDES | ||
| 497 | Leukopenia neonatal | OFFSIDES | ||
| 498 | Lipase abnormal | OFFSIDES | ||
| 499 | Lipase | OFFSIDES | ||
| 500 | Lividity | OFFSIDES | ||
| 501 | Loose tooth | OFFSIDES | ||
| 502 | Loss of proprioception | OFFSIDES | ||
| 503 | Low Cardiac Output Syndrome | OFFSIDES | ||
| 504 | Lymphocele | OFFSIDES | ||
| 505 | Lymphocytosis | OFFSIDES | ||
| 506 | Malignant mesenteric neoplasm | OFFSIDES | ||
| 507 | Mental disorder due to a general medical condition | OFFSIDES | ||
| 508 | Metastatic pain | OFFSIDES | ||
| 509 | Muscle necrosis | OFFSIDES | ||
| 510 | Neutropenic infection | OFFSIDES | ||
| 511 | No adverse effect | OFFSIDES | ||
| 512 | Nuchal Rigidity | OFFSIDES | ||
| 513 | Ophthalmoplegia | OFFSIDES | ||
| 514 | Optic Disc Edema | OFFSIDES | ||
| 515 | Oral discharge | OFFSIDES | ||
| 516 | Oral fungal infection | OFFSIDES | ||
| 517 | Oral mucosal exfoliation | OFFSIDES | ||
| 518 | Oroantral Fistula | OFFSIDES | ||
| 519 | Oropharyngeal blistering | OFFSIDES | ||
| 520 | Palpatory finding abnormal | OFFSIDES | ||
| 521 | Pancreatic enzymes increased | OFFSIDES | ||
| 522 | Paraparesis | OFFSIDES | ||
| 523 | Perianal abscess | OFFSIDES | ||
| 524 | Pericoronitis | OFFSIDES | ||
| 525 | Perirectal abscess | OFFSIDES | ||
| 526 | Peritonsillar Abscess | OFFSIDES | ||
| 527 | Platelet count abnormal | OFFSIDES | ||
| 528 | Pleurectomy | OFFSIDES | ||
| 529 | Pneumobilia | OFFSIDES | ||
| 530 | Postoperative abscess | OFFSIDES | ||
| 531 | Procedural hypotension | OFFSIDES | ||
| 532 | Psychotic disorder due to a general medical condition | OFFSIDES | ||
| 533 | Pulmonary thrombosis | OFFSIDES | ||
| 534 | Renal mass | OFFSIDES | ||
| 535 | Seroconversion test positive | OFFSIDES | ||
| 536 | Sinus rhythm | OFFSIDES | ||
| 537 | Soft tissue necrosis | OFFSIDES | ||
| 538 | Status Epilepticus | OFFSIDES | ||
| 539 | Subclavian artery thrombosis | OFFSIDES | ||
| 540 | Tachyphylaxis | OFFSIDES | ||
| 541 | Testicular mass | OFFSIDES | ||
| 542 | Tinea cruris | OFFSIDES | ||
| 543 | Tongue blistering | OFFSIDES | ||
| 544 | Tonsillitis | OFFSIDES | ||
| 545 | Upper airway obstruction | OFFSIDES | ||
| 546 | Vaginal Fistula | OFFSIDES | ||
| 547 | Vaginal burning sensation | OFFSIDES | ||
| 548 | Vascular insufficiency | OFFSIDES | ||
| 549 | Vertebroplasty | OFFSIDES | ||
| 550 | Very low density lipoprotein increased | OFFSIDES | ||
| 551 | White blood cell count abnormal | OFFSIDES | ||
| 552 | Wound decomposition | OFFSIDES | ||
| 553 | treatment failure | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.