Meloxicam
(ZRVUJXDFFKFLMG-UHFFFAOYSA-N)
Structure
- SMILES
- Cc1cnc(s1)NC(=O)C1=C(O)c2ccccc2S(=O)(=O)N1C
- Type(s)
- Approved; Vet_approved
- ATC code(s)
- M01AC06; M01AC56
- Molecular Formula:
- C14H13N3O4S2
- Molecular Weight:
- 351.401
- Log P:
- 3.0426
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 136.22
- CAS Number(s):
- 71125-38-7; 133687-22-6; 1027136-06-6
Synonym(s)
1.
Meloxicam
2.
Masflex
3.
Miloxicam
4.
Mobec
5.
Mobic
6.
Mobicox
7.
Movalis
8.
Movicox
9.
Parocin
10.
Reumoxicam
11.
Uticox
External Link(s)
| MeSH | D000077239 |
| PubChem Compound | 54677470 |
| BindingDB | 50056998 |
| ChEBI | 6741 |
| CHEMBL | CHEMBL599 CHEMBL1741042 |
| DrugBank | DB00814 |
| DrugCentral | 1676 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7220 |
| KEGG | cpd:C08169 dr:D00969 |
| Therapeutic Target Database | D0G7FJ |
| ZINC | 13129998 103620661 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 148 Canada Vigilance: 10 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Nausea | FAERS: 61 Canada Vigilance: 3 | 20073572 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 3 | Dizziness | FAERS: 54 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Pain | FAERS: 46 | 12269398 19617648 | CTD OFFSIDES SIDER US FAERS |
| 5 | Headache | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 6 | Accidental exposure | FAERS: 39 | US FAERS | |
| 7 | Asthenia | FAERS: 37 | SIDER US FAERS | |
| 8 | Pruritus | FAERS: 36 | SIDER US FAERS | |
| 9 | Eye irritation | FAERS: 34 | US FAERS | |
| 10 | Fatigue | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 11 | Gastric ulcer | FAERS: 32 | OFFSIDES SIDER US FAERS | |
| 12 | Myocardial Infarction | FAERS: 31 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 13 | Abdominal Pain | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | Urticaria | FAERS: 30 Canada Vigilance: 2 | 11792017 | CTD SIDER Canada Vigilance US FAERS |
| 15 | Chest Pain | FAERS: 28 | OFFSIDES US FAERS | |
| 16 | Malaise | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 17 | Vomiting | FAERS: 27 Canada Vigilance: 2 | 11897121 20073572 | CTD SIDER Canada Vigilance US FAERS |
| 18 | Abdominal discomfort | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Arthralgia | FAERS: 24 | SIDER US FAERS | |
| 20 | Tinnitus | FAERS: 22 | SIDER US FAERS | |
| 21 | Feeling abnormal | FAERS: 21 | SIDER US FAERS | |
| 22 | Cerebrovascular accident | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Hypersensitivity | FAERS: 18 | SIDER US FAERS | |
| 24 | Product substitution issue | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Chest discomfort | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Constipation | FAERS: 17 | SIDER US FAERS | |
| 27 | Duodenal Ulcer | FAERS: 17 | OFFSIDES SIDER US FAERS | |
| 28 | Swelling | FAERS: 17 | SIDER US FAERS | |
| 29 | Ulcer | FAERS: 17 | SIDER US FAERS | |
| 30 | Arthritis | FAERS: 14 Canada Vigilance: 2 | 24152722 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 31 | Erythema | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 32 | Palpitations | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 33 | Medication Error | FAERS: 13 | US FAERS | |
| 34 | Overdose | FAERS: 13 | US FAERS | |
| 35 | Therapeutic response unexpected with drug substitution | FAERS: 13 | US FAERS | |
| 36 | Alopecia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 37 | Disease Progression | FAERS: 12 | US FAERS | |
| 38 | Dysarthria | FAERS: 12 | US FAERS | |
| 39 | Dyspepsia | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 40 | Eye pain | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 41 | Syncope | FAERS: 12 | SIDER US FAERS | |
| 42 | Tremor | FAERS: 12 | 20073572 | CTD SIDER US FAERS |
| 43 | Angioedema | FAERS: 11 | SIDER US FAERS | |
| 44 | Back Pain | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 45 | Drug resistance | FAERS: 11 | US FAERS | |
| 46 | Intestinal diaphragm disease | FAERS: 11 | US FAERS | |
| 47 | Myalgia | FAERS: 11 | SIDER US FAERS | |
| 48 | Atrial Fibrillation | FAERS: 10 | US FAERS | |
| 49 | Flatulence | FAERS: 10 | SIDER US FAERS | |
| 50 | Pharmaceutical product complaint | FAERS: 10 | US FAERS | |
| 51 | Product quality issue | FAERS: 10 | US FAERS | |
| 52 | Somnolence | FAERS: 10 | SIDER US FAERS | |
| 53 | Stevens-Johnson Syndrome | FAERS: 10 | 25811541 | CTD OFFSIDES SIDER US FAERS |
| 54 | Stomatitis | FAERS: 10 | SIDER US FAERS | |
| 55 | Tachycardia | FAERS: 10 | SIDER US FAERS | |
| 56 | Burning sensation | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 57 | Cardiac Arrest | FAERS: 9 | US FAERS | |
| 58 | Dysgeusia | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 59 | Hepatitis | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 60 | Hypotension | FAERS: 9 | SIDER US FAERS | |
| 61 | Ileal Stenosis | FAERS: 9 | US FAERS | |
| 62 | Joint swelling | FAERS: 9 | SIDER US FAERS | |
| 63 | Disorientation | FAERS: 8 | SIDER US FAERS | |
| 64 | Flushing | FAERS: 8 | SIDER US FAERS | |
| 65 | Gastritis | FAERS: 8 | SIDER US FAERS | |
| 66 | Neck Pain | FAERS: 8 | US FAERS | |
| 67 | Suicide attempt | FAERS: 8 | US FAERS | |
| 68 | Thrombosis | FAERS: 8 | US FAERS | |
| 69 | jaundice | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 70 | Acute myocardial infarction | FAERS: 7 | US FAERS | |
| 71 | Autoimmune hepatitis | FAERS: 7 | US FAERS | |
| 72 | Chills | FAERS: 7 | US FAERS | |
| 73 | Chromaturia | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 74 | Dehydration | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 75 | Lip swelling | FAERS: 7 | US FAERS | |
| 76 | Memory impairment | FAERS: 7 | US FAERS | |
| 77 | Pallor | FAERS: 7 | US FAERS | |
| 78 | Thrombocytopenia | FAERS: 7 | SIDER US FAERS | |
| 79 | Toxic Epidermal Necrolysis | FAERS: 7 | SIDER US FAERS | |
| 80 | Acute kidney injury | FAERS: 6 | US FAERS | |
| 81 | Anaphylactic shock | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 82 | Anxiety | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 83 | Blood creatinine increased | FAERS: 6 | SIDER US FAERS | |
| 84 | Colitis | FAERS: 6 | SIDER US FAERS | |
| 85 | Diplopia | FAERS: 6 | US FAERS | |
| 86 | Gastrointestinal perforation | FAERS: 6 | SIDER US FAERS | |
| 87 | Gastrointestinal ulcer | FAERS: 6 | OFFSIDES US FAERS | |
| 88 | Musculoskeletal stiffness | FAERS: 6 | US FAERS | |
| 89 | Peripheral swelling | FAERS: 6 | US FAERS | |
| 90 | Pneumonia | FAERS: 6 | US FAERS | |
| 91 | Rash erythematous | FAERS: 6 | SIDER US FAERS | |
| 92 | Urinary Retention | FAERS: 6 | SIDER US FAERS | |
| 93 | Urinary tract infection | FAERS: 6 | SIDER US FAERS | |
| 94 | Visual Impairment | FAERS: 6 | SIDER US FAERS | |
| 95 | Visual disturbance | FAERS: 6 | SIDER US FAERS | |
| 96 | treatment failure | FAERS: 6 | US FAERS | |
| 97 | Anorexia | FAERS: 5 | OFFSIDES US FAERS | |
| 98 | Candidiasis | FAERS: 5 | US FAERS | |
| 99 | Crying | FAERS: 5 | US FAERS | |
| 100 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 101 | Eosinophilia | FAERS: 5 | US FAERS | |
| 102 | Epistaxis | FAERS: 5 | OFFSIDES US FAERS | |
| 103 | Gastrointestinal Pain | FAERS: 5 | SIDER US FAERS | |
| 104 | Ileus | FAERS: 5 | US FAERS | |
| 105 | Impaired work ability | FAERS: 5 | US FAERS | |
| 106 | Influenza | FAERS: 5 | SIDER US FAERS | |
| 107 | Intestinal Perforation | FAERS: 5 | SIDER US FAERS | |
| 108 | Intracranial Aneurysm | FAERS: 5 | US FAERS | |
| 109 | Musculoskeletal discomfort | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 110 | Nephrotic Syndrome | FAERS: 5 | US FAERS | |
| 111 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 112 | Small Intestinal Stenosis | FAERS: 5 | US FAERS | |
| 113 | Adverse event | FAERS: 4 | US FAERS | |
| 114 | Agitation | FAERS: 4 | US FAERS | |
| 115 | Asthma | FAERS: 4 | SIDER US FAERS | |
| 116 | Blood potassium increased | FAERS: 4 | SIDER US FAERS | |
| 117 | Deafness | FAERS: 4 | US FAERS | |
| 118 | Diverticulum | FAERS: 4 | OFFSIDES US FAERS | |
| 119 | Drug effect incomplete | FAERS: 4 | US FAERS | |
| 120 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 121 | Irritable Bowel Syndrome | FAERS: 4 | US FAERS | |
| 122 | Lymphopenia | FAERS: 4 | US FAERS | |
| 123 | Middle insomnia | FAERS: 4 | OFFSIDES US FAERS | |
| 124 | Musculoskeletal Pain | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 125 | Nonspecific reaction | FAERS: 4 | US FAERS | |
| 126 | Oropharyngeal swelling | FAERS: 4 | US FAERS | |
| 127 | Peptic Ulcer | FAERS: 4 | SIDER US FAERS | |
| 128 | Peritonitis | FAERS: 4 | US FAERS | |
| 129 | Renal tubular necrosis | FAERS: 4 | US FAERS | |
| 130 | VIIth nerve paralysis | FAERS: 4 | US FAERS | |
| 131 | Vertigo | FAERS: 4 | SIDER US FAERS | |
| 132 | Weight decreased | FAERS: 4 | SIDER US FAERS | |
| 133 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 134 | Agranulocytosis | FAERS: 3 | SIDER US FAERS | |
| 135 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 136 | Amnesia | FAERS: 3 | OFFSIDES US FAERS | |
| 137 | Amnestic Disorder | FAERS: 3 | US FAERS | |
| 138 | Angina Pectoris | FAERS: 3 | SIDER US FAERS | |
| 139 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 140 | Blood triglycerides increased | FAERS: 3 | OFFSIDES US FAERS | |
| 141 | Blood urine present | FAERS: 3 | US FAERS | |
| 142 | Cheilitis | FAERS: 3 | OFFSIDES US FAERS | |
| 143 | Cholestasis | FAERS: 3 | US FAERS | |
| 144 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 145 | Disease recurrence | FAERS: 3 | US FAERS | |
| 146 | Diverticulitis | FAERS: 3 | OFFSIDES US FAERS | |
| 147 | Dry skin | FAERS: 3 | OFFSIDES US FAERS | |
| 148 | Duodenal ulcer perforation | FAERS: 3 | SIDER US FAERS | |
| 149 | Ecchymosis | FAERS: 3 | US FAERS | |
| 150 | Eczema | FAERS: 3 | OFFSIDES US FAERS | |
| 151 | Feeling jittery | FAERS: 3 | US FAERS | |
| 152 | Hypoaesthesia facial | FAERS: 3 | US FAERS | |
| 153 | Inflammation | FAERS: 3 | 11605650 21870464 28422384 | CTD US FAERS |
| 154 | Joint stiffness | FAERS: 3 | OFFSIDES US FAERS | |
| 155 | Laceration | FAERS: 3 | OFFSIDES US FAERS | |
| 156 | Mental status changes | FAERS: 3 | OFFSIDES US FAERS | |
| 157 | Muscle tightness | FAERS: 3 | US FAERS | |
| 158 | Nervousness | FAERS: 3 | SIDER US FAERS | |
| 159 | Oral pain | FAERS: 3 | US FAERS | |
| 160 | Pathological fracture | FAERS: 3 | US FAERS | |
| 161 | Product use issue | FAERS: 3 | US FAERS | |
| 162 | Pulmonary Embolism | FAERS: 3 | US FAERS | |
| 163 | Respiratory Failure | FAERS: 3 | US FAERS | |
| 164 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 165 | Retrograde amnesia | FAERS: 3 | US FAERS | |
| 166 | Scotoma | FAERS: 3 | OFFSIDES US FAERS | |
| 167 | Sepsis | FAERS: 3 | US FAERS | |
| 168 | Skin irritation | FAERS: 3 | US FAERS | |
| 169 | Skin lesion | FAERS: 3 | US FAERS | |
| 170 | Stress | FAERS: 3 | US FAERS | |
| 171 | Sunburn | FAERS: 3 | US FAERS | |
| 172 | Therapy cessation | FAERS: 3 | OFFSIDES US FAERS | |
| 173 | Thrombocytopenic purpura | FAERS: 3 | US FAERS | |
| 174 | Toothache | FAERS: 3 | US FAERS | |
| 175 | nervous system disorder | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 176 | Abasia | FAERS: 2 | US FAERS | |
| 177 | Abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 178 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 179 | Alanine Aminotransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 180 | Aneurysm | FAERS: 2 | US FAERS | |
| 181 | Apathy | FAERS: 2 | OFFSIDES US FAERS | |
| 182 | Aphasia | FAERS: 2 | US FAERS | |
| 183 | Aspartate Aminotransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 184 | Blindness | FAERS: 2 | US FAERS | |
| 185 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 186 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 187 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 188 | Breast tenderness | FAERS: 2 | US FAERS | |
| 189 | Cardiac Flutter | FAERS: 2 | OFFSIDES US FAERS | |
| 190 | Cataract | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 191 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 192 | Choking | FAERS: 2 | US FAERS | |
| 193 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 194 | Completed Suicide | FAERS: 2 | US FAERS | |
| 195 | Conjunctivitis | FAERS: 2 | SIDER US FAERS | |
| 196 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 197 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 198 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 199 | Discomfort | FAERS: 2 | SIDER US FAERS | |
| 200 | Documented hypersensitivity to administered drug | FAERS: 2 | US FAERS | |
| 201 | Drug Dependence | FAERS: 2 | US FAERS | |
| 202 | Drug abuser | FAERS: 2 | US FAERS | |
| 203 | Drug dose omission | FAERS: 2 | US FAERS | |
| 204 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 205 | Drug withdrawal syndrome | FAERS: 2 | US FAERS | |
| 206 | Dysphonia | FAERS: 2 | US FAERS | |
| 207 | Dysuria | FAERS: 2 | US FAERS | |
| 208 | Emotional distress | FAERS: 2 | OFFSIDES US FAERS | |
| 209 | Enteritis | FAERS: 2 | US FAERS | |
| 210 | Eosinophilic Pneumonia | FAERS: 2 | US FAERS | |
| 211 | Erosive Duodenitis | FAERS: 2 | US FAERS | |
| 212 | Euphoric mood | FAERS: 2 | US FAERS | |
| 213 | Feeling Cold | FAERS: 2 | US FAERS | |
| 214 | Folliculitis | FAERS: 2 | US FAERS | |
| 215 | Gamma-Glutamyltransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 216 | Gastric Stenosis | FAERS: 2 | US FAERS | |
| 217 | Gastroenteritis | FAERS: 2 | OFFSIDES US FAERS | |
| 218 | Gastrointestinal erosion | FAERS: 2 | US FAERS | |
| 219 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 220 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 221 | Hernia | FAERS: 2 | US FAERS | |
| 222 | Hypersomnia | FAERS: 2 | US FAERS | |
| 223 | Hypophagia | FAERS: 2 | OFFSIDES US FAERS | |
| 224 | Hypoventilation | FAERS: 2 | US FAERS | |
| 225 | Ileal ulcer | FAERS: 2 | US FAERS | |
| 226 | Incision site pain | FAERS: 2 | US FAERS | |
| 227 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 228 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 229 | Infection | FAERS: 2 | SIDER US FAERS | |
| 230 | Iron deficiency | FAERS: 2 | US FAERS | |
| 231 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 232 | Lethargy | FAERS: 2 | 20073572 | CTD US FAERS |
| 233 | Lip exfoliation | FAERS: 2 | US FAERS | |
| 234 | Macular degeneration | FAERS: 2 | US FAERS | |
| 235 | Medication residue present | FAERS: 2 | US FAERS | |
| 236 | Multiple allergies | FAERS: 2 | OFFSIDES US FAERS | |
| 237 | Muscle strain | FAERS: 2 | US FAERS | |
| 238 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 239 | Neuritis | FAERS: 2 | US FAERS | |
| 240 | No adverse event | FAERS: 2 | US FAERS | |
| 241 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 242 | Pain of skin | FAERS: 2 | US FAERS | |
| 243 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 244 | Pancreatitis | FAERS: 2 | SIDER US FAERS | |
| 245 | Pancytopenia | FAERS: 2 | SIDER US FAERS | |
| 246 | Personality Change | FAERS: 2 | US FAERS | |
| 247 | Physical disability | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 248 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 249 | Post procedural complication | FAERS: 2 | US FAERS | |
| 250 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 251 | Pupillary light reflex tests abnormal | FAERS: 2 | US FAERS | |
| 252 | Respiratory distress | FAERS: 2 | US FAERS | |
| 253 | Retching | FAERS: 2 | US FAERS | |
| 254 | Rheumatoid Arthritis | FAERS: 2 | SIDER US FAERS | |
| 255 | Sciatica | FAERS: 2 | SIDER US FAERS | |
| 256 | Shock | FAERS: 2 | SIDER US FAERS | |
| 257 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 258 | Sneezing | FAERS: 2 | US FAERS | |
| 259 | Splenomegaly | FAERS: 2 | US FAERS | |
| 260 | Thermal burn | FAERS: 2 | US FAERS | |
| 261 | Transaminases increased | FAERS: 2 | US FAERS | |
| 262 | Unevaluable event | FAERS: 2 | US FAERS | |
| 263 | Vascular rupture | FAERS: 2 | US FAERS | |
| 264 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 265 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 266 | Wheezing | FAERS: 2 | SIDER US FAERS | |
| 267 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 268 | Abdominal tenderness | FAERS: 1 | OFFSIDES US FAERS | |
| 269 | Accidental overdose | FAERS: 1 | US FAERS | |
| 270 | Acne | FAERS: 1 | OFFSIDES US FAERS | |
| 271 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 272 | Acute Coronary Syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 273 | Acute prerenal failure | FAERS: 1 | US FAERS | |
| 274 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 275 | Alanine aminotransferase decreased | FAERS: 1 | US FAERS | |
| 276 | Alphavirus test positive | FAERS: 1 | US FAERS | |
| 277 | Anaphylactoid Reaction | FAERS: 1 | SIDER US FAERS | |
| 278 | Anger | FAERS: 1 | US FAERS | |
| 279 | Anhedonia | FAERS: 1 | OFFSIDES US FAERS | |
| 280 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 281 | Ankylosing spondylitis | FAERS: 1 | SIDER US FAERS | |
| 282 | Anoxic Encephalopathy | FAERS: 1 | US FAERS | |
| 283 | Anuria | FAERS: 1 | US FAERS | |
| 284 | Apparent death | FAERS: 1 | US FAERS | |
| 285 | Apparent life threatening event | FAERS: 1 | US FAERS | |
| 286 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 287 | Ascites | FAERS: 1 | US FAERS | |
| 288 | Asthenopia | FAERS: 1 | US FAERS | |
| 289 | Ataxia | FAERS: 1 | 20073572 | CTD OFFSIDES US FAERS |
| 290 | Aura | FAERS: 1 | OFFSIDES US FAERS | |
| 291 | Balanoposthitis | FAERS: 1 | US FAERS | |
| 292 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 293 | Blepharospasm | FAERS: 1 | US FAERS | |
| 294 | Blood count abnormal | FAERS: 1 | SIDER US FAERS | |
| 295 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 296 | Blood immunoglobulin G increased | FAERS: 1 | US FAERS | |
| 297 | Blood iron increased | FAERS: 1 | US FAERS | |
| 298 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 299 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 300 | Blood urea increased | FAERS: 1 | SIDER US FAERS | |
| 301 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 302 | Bradycardia | FAERS: 1 | US FAERS | |
| 303 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 304 | Bronchitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 305 | Bursitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 306 | Cardiac enzymes increased | FAERS: 1 | US FAERS | |
| 307 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 308 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 309 | Chloasma | FAERS: 1 | US FAERS | |
| 310 | Cholestatic liver injury | FAERS: 1 | US FAERS | |
| 311 | Clonus | FAERS: 1 | US FAERS | |
| 312 | Coagulation factor increased | FAERS: 1 | US FAERS | |
| 313 | Cold sweat | FAERS: 1 | OFFSIDES US FAERS | |
| 314 | Compression fracture | FAERS: 1 | US FAERS | |
| 315 | Coronary artery reocclusion | FAERS: 1 | US FAERS | |
| 316 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 317 | Depressed mood | FAERS: 1 | OFFSIDES US FAERS | |
| 318 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 319 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 320 | Drug dose titration not performed | FAERS: 1 | US FAERS | |
| 321 | Drug effect variable | FAERS: 1 | US FAERS | |
| 322 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 323 | Drug screen positive | FAERS: 1 | US FAERS | |
| 324 | Duodenal fistula | FAERS: 1 | US FAERS | |
| 325 | Dysentery | FAERS: 1 | US FAERS | |
| 326 | Dyspnoea exacerbated | FAERS: 1 | US FAERS | |
| 327 | Ear discomfort | FAERS: 1 | US FAERS | |
| 328 | Economic problem | FAERS: 1 | US FAERS | |
| 329 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 330 | Embolism | FAERS: 1 | US FAERS | |
| 331 | Emotional disorder | FAERS: 1 | US FAERS | |
| 332 | Enterococcus test positive | FAERS: 1 | US FAERS | |
| 333 | Epidemic polyarthritis | FAERS: 1 | US FAERS | |
| 334 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 335 | Epilepsy | FAERS: 1 | US FAERS | |
| 336 | Epstein-Barr virus antibody positive | FAERS: 1 | US FAERS | |
| 337 | Erection increased | FAERS: 1 | US FAERS | |
| 338 | Eructation | FAERS: 1 | SIDER US FAERS | |
| 339 | Erythema Multiforme | FAERS: 1 | SIDER US FAERS | |
| 340 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 341 | Expired product administered | FAERS: 1 | US FAERS | |
| 342 | Extra dose administered | FAERS: 1 | US FAERS | |
| 343 | Eye Burns | FAERS: 1 | US FAERS | |
| 344 | Eye inflammation | FAERS: 1 | OFFSIDES US FAERS | |
| 345 | Facial Pain | FAERS: 1 | US FAERS | |
| 346 | Facial Paresis | FAERS: 1 | US FAERS | |
| 347 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 348 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 349 | Fibromyalgia | FAERS: 1 | OFFSIDES US FAERS | |
| 350 | Flank Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 351 | Full blood count increased | FAERS: 1 | US FAERS | |
| 352 | Gastric mucosa erythema | FAERS: 1 | US FAERS | |
| 353 | Gastrointestinal mucosal necrosis | FAERS: 1 | US FAERS | |
| 354 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 355 | Gout | FAERS: 1 | OFFSIDES US FAERS | |
| 356 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 357 | Hemiplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 358 | Hepatitis E | FAERS: 1 | US FAERS | |
| 359 | Hip surgery | FAERS: 1 | US FAERS | |
| 360 | Hypercapnia | FAERS: 1 | US FAERS | |
| 361 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 362 | Hypervitaminosis | FAERS: 1 | US FAERS | |
| 363 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 364 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 365 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 366 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 367 | Incontinence | FAERS: 1 | OFFSIDES US FAERS | |
| 368 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 369 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 370 | Infarction | FAERS: 1 | US FAERS | |
| 371 | Initial insomnia | FAERS: 1 | US FAERS | |
| 372 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 373 | Injection site urticaria | FAERS: 1 | OFFSIDES US FAERS | |
| 374 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 375 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 376 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 377 | Intervertebral disc disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 378 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 379 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 380 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 381 | Leukocytosis | FAERS: 1 | US FAERS | |
| 382 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 383 | Ligament rupture | FAERS: 1 | OFFSIDES US FAERS | |
| 384 | Limb discomfort | FAERS: 1 | US FAERS | |
| 385 | Lip erythema | FAERS: 1 | US FAERS | |
| 386 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 387 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 388 | Lymphoma | FAERS: 1 | US FAERS | |
| 389 | Malignant ascites | FAERS: 1 | OFFSIDES US FAERS | |
| 390 | Mental impairment | FAERS: 1 | US FAERS | |
| 391 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 392 | Mood swings | FAERS: 1 | SIDER US FAERS | |
| 393 | Mouth swelling | FAERS: 1 | US FAERS | |
| 394 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 395 | Musculoskeletal chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 396 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 397 | Myoclonus | FAERS: 1 | US FAERS | |
| 398 | Myositis | FAERS: 1 | US FAERS | |
| 399 | Nasopharyngitis | FAERS: 1 | SIDER US FAERS | |
| 400 | No adverse effect | FAERS: 1 | US FAERS | |
| 401 | Ocular icterus | FAERS: 1 | US FAERS | |
| 402 | Opiates positive | FAERS: 1 | US FAERS | |
| 403 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 404 | Oral mucosal exfoliation | FAERS: 1 | OFFSIDES US FAERS | |
| 405 | Overlap syndrome | FAERS: 1 | US FAERS | |
| 406 | Overweight | FAERS: 1 | US FAERS | |
| 407 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 408 | Penile blister | FAERS: 1 | US FAERS | |
| 409 | Pericarditis | FAERS: 1 | US FAERS | |
| 410 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 411 | Petechiae | FAERS: 1 | US FAERS | |
| 412 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 413 | Phonophobia | FAERS: 1 | US FAERS | |
| 414 | Photophobia | FAERS: 1 | US FAERS | |
| 415 | Platelet function test abnormal | FAERS: 1 | US FAERS | |
| 416 | Pleurisy | FAERS: 1 | US FAERS | |
| 417 | Pneumocystis jiroveci pneumonia | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 419 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 420 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 421 | Product formulation issue | FAERS: 1 | US FAERS | |
| 422 | Product label issue | FAERS: 1 | US FAERS | |
| 423 | Product packaging issue | FAERS: 1 | US FAERS | |
| 424 | Product physical issue | FAERS: 1 | US FAERS | |
| 425 | Product shape issue | FAERS: 1 | US FAERS | |
| 426 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 427 | Psoriasis | FAERS: 1 | US FAERS | |
| 428 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 429 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 430 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 431 | Purpura | FAERS: 1 | SIDER US FAERS | |
| 432 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 433 | Regurgitation | FAERS: 1 | US FAERS | |
| 434 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 435 | Renal cyst | FAERS: 1 | US FAERS | |
| 436 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 437 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 438 | Rhinalgia | FAERS: 1 | US FAERS | |
| 439 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 440 | Scab | FAERS: 1 | US FAERS | |
| 441 | Screaming | FAERS: 1 | US FAERS | |
| 442 | Secretion discharge | FAERS: 1 | US FAERS | |
| 443 | Septic Shock | FAERS: 1 | US FAERS | |
| 444 | Sinusitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 445 | Skin laceration | FAERS: 1 | US FAERS | |
| 446 | Skin reaction | FAERS: 1 | US FAERS | |
| 447 | Sluggishness | FAERS: 1 | US FAERS | |
| 448 | Spinal column stenosis | FAERS: 1 | OFFSIDES US FAERS | |
| 449 | Stress at work | FAERS: 1 | US FAERS | |
| 450 | Sudden death | FAERS: 1 | US FAERS | |
| 451 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 452 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 453 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 454 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 455 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 456 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 457 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 458 | Thirst | FAERS: 1 | US FAERS | |
| 459 | Thrombotic cerebral infarction | FAERS: 1 | US FAERS | |
| 460 | Tongue eruption | FAERS: 1 | US FAERS | |
| 461 | Tongue exfoliation | FAERS: 1 | OFFSIDES US FAERS | |
| 462 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 463 | Vasculitis | FAERS: 1 | SIDER US FAERS | |
| 464 | Vasospasm | FAERS: 1 | US FAERS | |
| 465 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 466 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 467 | Vitello-intestinal duct remnant | FAERS: 1 | US FAERS | |
| 468 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 469 | Walking aid user | FAERS: 1 | OFFSIDES US FAERS | |
| 470 | Waxy flexibility | FAERS: 1 | US FAERS | |
| 471 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 472 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 473 | prostatitis | FAERS: 1 | US FAERS | |
| 474 | Abnormal cervical smear | OFFSIDES | ||
| 475 | Abnormal vision | OFFSIDES SIDER | ||
| 476 | Abuse | OFFSIDES | ||
| 477 | Acid reflux | OFFSIDES | ||
| 478 | Acute bronchitis | OFFSIDES | ||
| 479 | Acute retention of urine | SIDER | ||
| 480 | Adenoma | OFFSIDES | ||
| 481 | Albuminuria | SIDER | ||
| 482 | Amaurosis Fugax | OFFSIDES | ||
| 483 | Amblyopia | OFFSIDES | ||
| 484 | Anal candidiasis | OFFSIDES | ||
| 485 | Anaplastic astrocytoma | OFFSIDES | ||
| 486 | Angiofibroma | OFFSIDES | ||
| 487 | Anhidrosis | OFFSIDES | ||
| 488 | Anosmia | OFFSIDES | ||
| 489 | Aortic valve sclerosis | OFFSIDES | ||
| 490 | Application site rash | OFFSIDES | ||
| 491 | Arthralgia aggravated | SIDER | ||
| 492 | Arthropathy | OFFSIDES | ||
| 493 | Arthropod bite | OFFSIDES | ||
| 494 | Atelectasis | OFFSIDES | ||
| 495 | Automatism | OFFSIDES | ||
| 496 | Back pain aggravated | SIDER | ||
| 497 | Bipolar Disorder | OFFSIDES | ||
| 498 | Blepharitis | OFFSIDES | ||
| 499 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 500 | Blood Glucose | OFFSIDES | ||
| 501 | Blood and lymphatic system disorders | SIDER | ||
| 502 | Blood cholesterol | OFFSIDES | ||
| 503 | Blood creatine phosphokinase decreased | OFFSIDES | ||
| 504 | Blood immunoglobulin A decreased | OFFSIDES | ||
| 505 | Blood immunoglobulin G decreased | OFFSIDES | ||
| 506 | Blood immunoglobulin M decreased | OFFSIDES | ||
| 507 | Blood iron abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 508 | Blood triglycerides | OFFSIDES | ||
| 509 | Blurred vision | OFFSIDES | ||
| 510 | Bone density decreased | OFFSIDES | ||
| 511 | Bone marrow necrosis | OFFSIDES | ||
| 512 | Bone pain | OFFSIDES | ||
| 513 | Bone scan abnormal | OFFSIDES | ||
| 514 | Brain scan abnormal | OFFSIDES | ||
| 515 | Brief psychotic disorder with marked stressors | OFFSIDES | ||
| 516 | Bronchoalveolar Lavage | OFFSIDES | ||
| 517 | Bronchospasm | SIDER | ||
| 518 | Bullous eruption | SIDER | ||
| 519 | Cancer Pain | OFFSIDES | ||
| 520 | Candidiasis of vagina | OFFSIDES | ||
| 521 | Carpal Tunnel Syndrome | SIDER | ||
| 522 | Cartilage injury | OFFSIDES | ||
| 523 | Cellulitis | OFFSIDES | ||
| 524 | Cervical spine flattening | OFFSIDES | ||
| 525 | Cervicobrachial syndrome | OFFSIDES | ||
| 526 | Chemical and Drug Induced Liver Injury | 10427794 15066135 | CTD | |
| 527 | Choking sensation | OFFSIDES | ||
| 528 | Chondromalacia | OFFSIDES | ||
| 529 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 530 | Colon adenoma | OFFSIDES | ||
| 531 | Colorectal Neoplasms | 11197048 | CTD | |
| 532 | Confusion | 20073572 | CTD | |
| 533 | Creatinine increased | SIDER | ||
| 534 | Creatinine renal clearance decreased | SIDER | ||
| 535 | Cubital Tunnel Syndrome | OFFSIDES | ||
| 536 | Cystocele | OFFSIDES | ||
| 537 | Cytopenia | SIDER | ||
| 538 | Dacryostenosis acquired | OFFSIDES | ||
| 539 | Delusional disorder, unspecified type | OFFSIDES | ||
| 540 | Demyelination | OFFSIDES | ||
| 541 | Dental abscess | OFFSIDES | ||
| 542 | Dental caries | OFFSIDES | ||
| 543 | Denture wearer | OFFSIDES | ||
| 544 | Dependence | OFFSIDES | ||
| 545 | Dermatitis | SIDER | ||
| 546 | Dermoid Cyst | OFFSIDES | ||
| 547 | Device Failure | OFFSIDES | ||
| 548 | Diabetes | OFFSIDES | ||
| 549 | Diabetic Nephropathy | OFFSIDES | ||
| 550 | Diarrhea | 20073572 | CTD OFFSIDES | |
| 551 | Disseminated Intravascular Coagulation | OFFSIDES | ||
| 552 | Drowsiness | OFFSIDES SIDER | ||
| 553 | Drug Eruptions | 11792017 | CTD | |
| 554 | Drug addict | OFFSIDES | ||
| 555 | Drug toxicity | OFFSIDES | ||
| 556 | Drug withdrawal headache | OFFSIDES | ||
| 557 | Duodenitis | OFFSIDES | ||
| 558 | Dysmenorrhea | OFFSIDES | ||
| 559 | Dyspareunia | OFFSIDES | ||
| 560 | Dyspepsia aggravated | SIDER | ||
| 561 | Dyspeptic signs and symptoms | SIDER | ||
| 562 | Ear and labyrinth disorders | SIDER | ||
| 563 | Ejection Fraction Decreased | OFFSIDES | ||
| 564 | Epididymitis | OFFSIDES | ||
| 565 | Erectile dysfunction | OFFSIDES | ||
| 566 | Essential Hypertension | OFFSIDES | ||
| 567 | Expired drug administered | OFFSIDES | ||
| 568 | Facial Neuralgia | OFFSIDES | ||
| 569 | Fistula repair | OFFSIDES | ||
| 570 | Food Poisoning | OFFSIDES | ||
| 571 | Food craving | OFFSIDES | ||
| 572 | Formication | OFFSIDES | ||
| 573 | Gambling | OFFSIDES | ||
| 574 | Gangrene | OFFSIDES | ||
| 575 | Gastrointestinal Diseases | 15234645 | CTD | |
| 576 | Gastrointestinal motility disorder | OFFSIDES | ||
| 577 | General disorders and administration site conditions | SIDER | ||
| 578 | Genital Herpes | OFFSIDES | ||
| 579 | Goiter | OFFSIDES | ||
| 580 | Hay fever | OFFSIDES | ||
| 581 | Hepatosplenomegaly | OFFSIDES | ||
| 582 | High frequency ablation | OFFSIDES | ||
| 583 | Hostility | OFFSIDES | ||
| 584 | Hydronephrosis | OFFSIDES | ||
| 585 | Hyperreflexia | OFFSIDES | ||
| 586 | Ileitis | OFFSIDES | ||
| 587 | Immunosuppression | OFFSIDES | ||
| 588 | Impaired driving ability | OFFSIDES | ||
| 589 | Incisional hernia | OFFSIDES | ||
| 590 | Incoherent | OFFSIDES | ||
| 591 | Infected cyst | OFFSIDES | ||
| 592 | Infestation | SIDER | ||
| 593 | Influenza-like symptoms | SIDER | ||
| 594 | Injection site erythema | OFFSIDES | ||
| 595 | Injection site irritation | OFFSIDES | ||
| 596 | Injection site nodule | OFFSIDES | ||
| 597 | Injection site pruritus | OFFSIDES | ||
| 598 | Injection site warmth | OFFSIDES | ||
| 599 | Intention tremor | OFFSIDES | ||
| 600 | Intentional drug misuse | OFFSIDES | ||
| 601 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 602 | Intestinal ulcer perforation | Canada Vigilance: 2 | Canada Vigilance | |
| 603 | Jaw lesion excision | OFFSIDES | ||
| 604 | Joint injury | OFFSIDES | ||
| 605 | Joint related signs and symptoms | SIDER | ||
| 606 | Keratitis sicca | OFFSIDES | ||
| 607 | Keratomileusis | OFFSIDES | ||
| 608 | Kidney Diseases | 17485922 24799355 | CTD | |
| 609 | Kidney Failure | OFFSIDES | ||
| 610 | Labyrinthine disorder | SIDER | ||
| 611 | Laryngitis | SIDER | ||
| 612 | Laryngospasm | OFFSIDES | ||
| 613 | Left atrial dilatation | OFFSIDES | ||
| 614 | Leg edema | SIDER | ||
| 615 | Leukopenia neonatal | OFFSIDES | ||
| 616 | Lightheadedness | SIDER | ||
| 617 | Limb injury | OFFSIDES | ||
| 618 | Lordosis | OFFSIDES | ||
| 619 | Low Back Pain | SIDER | ||
| 620 | Lumbar radiculopathy | OFFSIDES | ||
| 621 | Lung consolidation | OFFSIDES | ||
| 622 | Lung cyst | OFFSIDES | ||
| 623 | Lymphocyte count decreased | OFFSIDES | ||
| 624 | Lymphocyte stimulation test positive | OFFSIDES | ||
| 625 | Lymphocytosis | OFFSIDES | ||
| 626 | Malignant Hypertension | OFFSIDES | ||
| 627 | Malignant neoplasm progression | OFFSIDES | ||
| 628 | Malnutrition | SIDER | ||
| 629 | Meningitis | SIDER | ||
| 630 | Mitral valve sclerosis | OFFSIDES | ||
| 631 | Monoclonal immunoglobulin present | OFFSIDES | ||
| 632 | Murphy's sign positive | OFFSIDES | ||
| 633 | Muscle Weakness | 20073572 | CTD OFFSIDES | |
| 634 | Neoplasms | 16684565 | CTD | |
| 635 | Nephrectomy | OFFSIDES | ||
| 636 | Nephritis | SIDER | ||
| 637 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 638 | Nephrolithiasis | OFFSIDES | ||
| 639 | Nervous tension | OFFSIDES | ||
| 640 | Neuralgia | OFFSIDES | ||
| 641 | Nicotine Dependence | OFFSIDES | ||
| 642 | Non-cardiac chest pain | OFFSIDES | ||
| 643 | Oculomucocutaneous syndrome | OFFSIDES | ||
| 644 | Optic Neuritis | OFFSIDES | ||
| 645 | Oral Cavity Fistula | OFFSIDES | ||
| 646 | Oral discharge | OFFSIDES | ||
| 647 | Oral fungal infection | OFFSIDES | ||
| 648 | Orthopnea | OFFSIDES | ||
| 649 | Osteochondrosis | OFFSIDES | ||
| 650 | Osteomyelitis | OFFSIDES | ||
| 651 | Osteoporosis | OFFSIDES | ||
| 652 | Pain, Postoperative | 11698316 | CTD | |
| 653 | Pericardial effusion | OFFSIDES | ||
| 654 | Periodontitis | OFFSIDES | ||
| 655 | Peripheral arterial occlusive disease | OFFSIDES | ||
| 656 | Pharyngitis | SIDER | ||
| 657 | Pharyngolaryngeal Pain | OFFSIDES | ||
| 658 | Phlebitis | OFFSIDES | ||
| 659 | Pilonidal Cyst | OFFSIDES | ||
| 660 | Platybasia | OFFSIDES | ||
| 661 | Pleuritic pain | SIDER | ||
| 662 | Pleurodesis | OFFSIDES | ||
| 663 | Polymerase Chain Reaction | OFFSIDES | ||
| 664 | Postoperative infection | OFFSIDES | ||
| 665 | Premature Birth | 12861172 | CTD | |
| 666 | Productive Cough | OFFSIDES | ||
| 667 | Prolapse repair | OFFSIDES | ||
| 668 | Proteinuria | 17485922 | CTD | |
| 669 | Pulmonary Hypertension | OFFSIDES | ||
| 670 | Purulent discharge | OFFSIDES | ||
| 671 | Rectal fissure | OFFSIDES | ||
| 672 | Rectocele | OFFSIDES | ||
| 673 | Reflex, Abnormal | 20073572 | CTD | |
| 674 | Reflux gastritis | OFFSIDES | ||
| 675 | Reflux laryngitis | OFFSIDES | ||
| 676 | Reperfusion Injury | 10594344 | CTD | |
| 677 | Residual urine | OFFSIDES | ||
| 678 | Respiratory Hypersensitivity | 15329003 | CTD | |
| 679 | Respiratory tract congestion | OFFSIDES | ||
| 680 | Retinal Vasculitis | OFFSIDES | ||
| 681 | Retroperitoneal fibrosis | OFFSIDES | ||
| 682 | Rhinitis | SIDER | ||
| 683 | Salpingo-oophorectomy | OFFSIDES | ||
| 684 | Schizoaffective Disorder | OFFSIDES | ||
| 685 | Schizophrenia | OFFSIDES | ||
| 686 | Sensorimotor disorder | OFFSIDES | ||
| 687 | Sequestrectomy | OFFSIDES | ||
| 688 | Seroma | OFFSIDES | ||
| 689 | Serum potassium increased | SIDER | ||
| 690 | Sialorrhea | 20073572 | CTD | |
| 691 | Sick Sinus Syndrome | OFFSIDES | ||
| 692 | Skeletal injury | OFFSIDES | ||
| 693 | Skin toxicity | OFFSIDES | ||
| 694 | Sleep Talking | OFFSIDES | ||
| 695 | Snoring | OFFSIDES | ||
| 696 | Sphincter of Oddi Dysfunction | OFFSIDES | ||
| 697 | Spondylolysis | OFFSIDES | ||
| 698 | Stomach ache | SIDER | ||
| 699 | Subcutaneous Emphysema | OFFSIDES | ||
| 700 | Superficial Thrombophlebitis | OFFSIDES | ||
| 701 | Sweating | SIDER | ||
| 702 | Synovial Cyst | OFFSIDES | ||
| 703 | Tarsal Tunnel Syndrome | OFFSIDES | ||
| 704 | Tendinitis | OFFSIDES | ||
| 705 | Tension | SIDER | ||
| 706 | Thirst decreased | OFFSIDES | ||
| 707 | Thoracic cavity drainage | OFFSIDES | ||
| 708 | Thromboembolism | 15234645 | CTD | |
| 709 | Thyroiditis | OFFSIDES | ||
| 710 | Tooth Extraction | OFFSIDES | ||
| 711 | Tooth Infection | OFFSIDES | ||
| 712 | Tooth Loss | OFFSIDES | ||
| 713 | Tooth repair | OFFSIDES | ||
| 714 | Ulcerative stomatitis | SIDER | ||
| 715 | Unresponsive to stimuli | OFFSIDES | ||
| 716 | Urinary Incontinence | Canada Vigilance: 1 | Canada Vigilance | |
| 717 | Uterine Prolapse | OFFSIDES | ||
| 718 | Vascular purpura | SIDER | ||
| 719 | Venous Insufficiency | OFFSIDES | ||
| 720 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 721 | Vitreous Detachment | OFFSIDES | ||
| 722 | Vulvovaginal dryness | OFFSIDES | ||
| 723 | Weight Gain | OFFSIDES | ||
| 724 | Wound infection staphylococcal | OFFSIDES | ||
| 725 | Wrong technique in drug usage process | OFFSIDES | ||
| 726 | effusion | OFFSIDES | ||
| 727 | kyphosis | OFFSIDES | ||
| 728 | muscle injury | OFFSIDES | ||
| 729 | rhinoplasty | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120237
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.