Citalopram
(WIHMBLDNRMIGDW-UHFFFAOYSA-N)
Structure
- SMILES
- N#Cc1ccc2c(c1)COC2(CCCN(C)C)c1ccc(cc1)F.Br
- Molecular Formula:
- C20H22BrFN2O
- Molecular Weight:
- 405.304
- Log P:
- 4.7711
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 36.26
- CAS Number(s):
- 59729-32-7
Synonym(s)
1.
Citalopram
2.
Celexa
3.
Citalopram Hydrobromide
4.
Cytalopram
5.
Escitalopram
6.
Escitalopram Oxalate
7.
Lexapro
8.
Lu-10-171
9.
Seropram
10.
Lu10171
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug exposure during pregnancy | FAERS: 134 | US FAERS | |
| 2 | Anxiety | FAERS: 115 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Completed Suicide | FAERS: 112 | US FAERS | |
| 4 | Tremor | FAERS: 97 | US FAERS | |
| 5 | Dizziness | FAERS: 95 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 6 | Headache | FAERS: 93 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Agitation | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Overdose | FAERS: 63 | US FAERS | |
| 9 | Nausea | FAERS: 60 | US FAERS | |
| 10 | Drug ineffective | FAERS: 59 Canada Vigilance: 20 | Canada Vigilance US FAERS | |
| 11 | Feeling abnormal | FAERS: 54 | US FAERS | |
| 12 | Pregnancy | FAERS: 43 | US FAERS | |
| 13 | Suicide attempt | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Vomiting | FAERS: 43 | US FAERS | |
| 15 | Fatigue | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Somnolence | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Restlessness | FAERS: 38 | US FAERS | |
| 18 | Drug withdrawal syndrome | FAERS: 37 | US FAERS | |
| 19 | Malaise | FAERS: 37 | US FAERS | |
| 20 | Palpitations | FAERS: 36 | US FAERS | |
| 21 | Product substitution issue | FAERS: 35 | US FAERS | |
| 22 | Asthenia | FAERS: 32 | US FAERS | |
| 23 | Syncope | FAERS: 32 | US FAERS | |
| 24 | Drug toxicity | FAERS: 29 | US FAERS | |
| 25 | Tachycardia | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Pharmaceutical product complaint | FAERS: 25 | US FAERS | |
| 27 | Swelling | FAERS: 24 | US FAERS | |
| 28 | Weight decreased | FAERS: 24 | US FAERS | |
| 29 | Chills | FAERS: 23 | US FAERS | |
| 30 | Maternal exposure during pregnancy | FAERS: 23 | US FAERS | |
| 31 | Serotonin Syndrome | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 32 | Abdominal Pain | FAERS: 20 | US FAERS | |
| 33 | Asphyxia | FAERS: 19 | US FAERS | |
| 34 | Azoospermia | FAERS: 19 | US FAERS | |
| 35 | Bruxism | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Chest discomfort | FAERS: 19 | US FAERS | |
| 37 | Pruritus | FAERS: 19 | US FAERS | |
| 38 | Mood swings | FAERS: 18 | US FAERS | |
| 39 | Paranoia | FAERS: 18 | US FAERS | |
| 40 | Product quality issue | FAERS: 18 | US FAERS | |
| 41 | Visual Impairment | FAERS: 18 | US FAERS | |
| 42 | Anencephaly | FAERS: 17 | US FAERS | |
| 43 | Arthralgia | FAERS: 17 | US FAERS | |
| 44 | Chest Pain | FAERS: 17 | US FAERS | |
| 45 | Posturing | FAERS: 17 | US FAERS | |
| 46 | Retinal Vein Occlusion | FAERS: 17 | US FAERS | |
| 47 | Impaired driving ability | FAERS: 15 | US FAERS | |
| 48 | Infertility | FAERS: 15 | US FAERS | |
| 49 | Intentional self-injury | FAERS: 15 | US FAERS | |
| 50 | Myalgia | FAERS: 15 | US FAERS | |
| 51 | Neonatal disorder | FAERS: 15 | US FAERS | |
| 52 | Nervousness | FAERS: 15 | US FAERS | |
| 53 | Stillbirth | FAERS: 15 | US FAERS | |
| 54 | Sudden death | FAERS: 15 | US FAERS | |
| 55 | Tinnitus | FAERS: 15 | US FAERS | |
| 56 | Visual disturbance | FAERS: 15 | US FAERS | |
| 57 | Amnesia | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Hydrocephalus | FAERS: 14 | US FAERS | |
| 59 | Medication Error | FAERS: 14 | US FAERS | |
| 60 | Urticaria | FAERS: 14 | US FAERS | |
| 61 | Cardiac Arrest | FAERS: 13 | US FAERS | |
| 62 | Crying | FAERS: 13 | US FAERS | |
| 63 | Disorientation | FAERS: 13 | US FAERS | |
| 64 | Hypersensitivity | FAERS: 13 | US FAERS | |
| 65 | Pain | FAERS: 13 | US FAERS | |
| 66 | Proteinuria | FAERS: 13 | US FAERS | |
| 67 | Somnambulism | FAERS: 13 | US FAERS | |
| 68 | Therapeutic response unexpected with drug substitution | FAERS: 13 | US FAERS | |
| 69 | Angle Closure Glaucoma | FAERS: 12 | US FAERS | |
| 70 | Deafness Neurosensory | FAERS: 12 | US FAERS | |
| 71 | Depressed Level of Consciousness | FAERS: 12 | US FAERS | |
| 72 | Dystonia | FAERS: 12 | US FAERS | |
| 73 | Exposure during breast feeding | FAERS: 12 | US FAERS | |
| 74 | Memory impairment | FAERS: 12 | US FAERS | |
| 75 | Mydriasis | FAERS: 12 | US FAERS | |
| 76 | Poor quality sleep | FAERS: 12 | US FAERS | |
| 77 | Toxicity to various agents | FAERS: 12 | US FAERS | |
| 78 | Anger | FAERS: 11 | US FAERS | |
| 79 | Burning sensation | FAERS: 11 | US FAERS | |
| 80 | Emotional disorder | FAERS: 11 | US FAERS | |
| 81 | Erythema | FAERS: 11 | US FAERS | |
| 82 | Impaired work ability | FAERS: 11 | US FAERS | |
| 83 | Mental status changes | FAERS: 11 | US FAERS | |
| 84 | Respiratory arrest | FAERS: 11 | US FAERS | |
| 85 | Sexual Dysfunction | FAERS: 11 | US FAERS | |
| 86 | Akathisia | FAERS: 10 | US FAERS | |
| 87 | Bipolar Disorder | FAERS: 10 | US FAERS | |
| 88 | Hypotension | FAERS: 10 | US FAERS | |
| 89 | Tongue biting | FAERS: 10 | US FAERS | |
| 90 | Anorgasmia | FAERS: 9 | US FAERS | |
| 91 | Balanitis | FAERS: 9 | US FAERS | |
| 92 | Disease recurrence | FAERS: 9 | US FAERS | |
| 93 | Drug dispensing error | FAERS: 9 | US FAERS | |
| 94 | Erectile dysfunction | FAERS: 9 | US FAERS | |
| 95 | Injury asphyxiation | FAERS: 9 | US FAERS | |
| 96 | Long QT Syndrome | FAERS: 9 | US FAERS | |
| 97 | Muscle Rigidity | FAERS: 9 | US FAERS | |
| 98 | Nuchal Rigidity | FAERS: 9 | US FAERS | |
| 99 | Obsessive-Compulsive Disorder | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Cleft Palate | FAERS: 8 | US FAERS | |
| 101 | Dehydration | FAERS: 8 | US FAERS | |
| 102 | Depressed mood | FAERS: 8 | US FAERS | |
| 103 | Diplopia | FAERS: 8 | US FAERS | |
| 104 | Dysarthria | FAERS: 8 | US FAERS | |
| 105 | Epilepsy | FAERS: 8 | US FAERS | |
| 106 | Hepatitis | FAERS: 8 | US FAERS | |
| 107 | Hypersomnia | FAERS: 8 | US FAERS | |
| 108 | Photophobia | FAERS: 8 | US FAERS | |
| 109 | Sinus Tachycardia | FAERS: 8 | US FAERS | |
| 110 | Trismus | FAERS: 8 | US FAERS | |
| 111 | Unevaluable event | FAERS: 8 | US FAERS | |
| 112 | Ventricular Fibrillation | FAERS: 8 | US FAERS | |
| 113 | Ventricular hypoplasia | FAERS: 8 | US FAERS | |
| 114 | Abdominal discomfort | FAERS: 7 | US FAERS | |
| 115 | Abnormal palmar/plantar creases | FAERS: 7 | US FAERS | |
| 116 | Alcohol interaction | FAERS: 7 | US FAERS | |
| 117 | Apathy | FAERS: 7 | US FAERS | |
| 118 | Blood glucose increased | FAERS: 7 | US FAERS | |
| 119 | Cerebral Palsy | FAERS: 7 | US FAERS | |
| 120 | Choking | FAERS: 7 | US FAERS | |
| 121 | Cholestasis | FAERS: 7 | US FAERS | |
| 122 | Chorioamnionitis | FAERS: 7 | US FAERS | |
| 123 | Drug abuse | FAERS: 7 | US FAERS | |
| 124 | Laceration | FAERS: 7 | US FAERS | |
| 125 | Narcolepsy | FAERS: 7 | US FAERS | |
| 126 | Obsessive thoughts | FAERS: 7 | US FAERS | |
| 127 | Optic Nerve Hypoplasia | FAERS: 7 | US FAERS | |
| 128 | Pilonidal cyst congenital | FAERS: 7 | US FAERS | |
| 129 | Tardive Dyskinesia | FAERS: 7 | US FAERS | |
| 130 | Thoracic vertebral fracture | FAERS: 7 | US FAERS | |
| 131 | Accidental overdose | FAERS: 6 | US FAERS | |
| 132 | Anhedonia | FAERS: 6 | US FAERS | |
| 133 | Aphasia | FAERS: 6 | US FAERS | |
| 134 | Back Pain | FAERS: 6 | US FAERS | |
| 135 | Cerebral Infarction | FAERS: 6 | US FAERS | |
| 136 | Constipation | FAERS: 6 | US FAERS | |
| 137 | Delirium | FAERS: 6 | US FAERS | |
| 138 | Diabetes Mellitus | FAERS: 6 | US FAERS | |
| 139 | Duodenal Ulcer | FAERS: 6 | US FAERS | |
| 140 | Dysgeusia | FAERS: 6 | US FAERS | |
| 141 | Emotional distress | FAERS: 6 | US FAERS | |
| 142 | Feeling Cold | FAERS: 6 | US FAERS | |
| 143 | Feeling jittery | FAERS: 6 | US FAERS | |
| 144 | Flushing | FAERS: 6 | US FAERS | |
| 145 | Hypermobility syndrome | FAERS: 6 | US FAERS | |
| 146 | Hyperventilation | FAERS: 6 | US FAERS | |
| 147 | Hypomania | FAERS: 6 | US FAERS | |
| 148 | Incorrect dose administered | FAERS: 6 | US FAERS | |
| 149 | Metabolic acidosis | FAERS: 6 | US FAERS | |
| 150 | Metrorrhagia | FAERS: 6 | US FAERS | |
| 151 | Musculoskeletal discomfort | FAERS: 6 | US FAERS | |
| 152 | Musculoskeletal stiffness | FAERS: 6 | US FAERS | |
| 153 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 154 | Pallor | FAERS: 6 | US FAERS | |
| 155 | Panic Disorder | FAERS: 6 | US FAERS | |
| 156 | Patent ductus arteriosus | FAERS: 6 | US FAERS | |
| 157 | Stress | FAERS: 6 | US FAERS | |
| 158 | Urinary Incontinence | FAERS: 6 | US FAERS | |
| 159 | Vertigo | FAERS: 6 | US FAERS | |
| 160 | nervous system disorder | FAERS: 6 | US FAERS | |
| 161 | Accidental drug intake by child | FAERS: 5 | US FAERS | |
| 162 | Anorexia | FAERS: 5 | US FAERS | |
| 163 | Blood creatine phosphokinase increased | FAERS: 5 | US FAERS | |
| 164 | Bradycardia | FAERS: 5 | US FAERS | |
| 165 | Cerebral vasoconstriction | FAERS: 5 | US FAERS | |
| 166 | Epistaxis | FAERS: 5 | US FAERS | |
| 167 | Feeding disorder neonatal | FAERS: 5 | US FAERS | |
| 168 | Foreign body trauma | FAERS: 5 | US FAERS | |
| 169 | Hemiplegia | FAERS: 5 | US FAERS | |
| 170 | Homicide | FAERS: 5 | US FAERS | |
| 171 | Infantile apnoeic attack | FAERS: 5 | US FAERS | |
| 172 | Influenza | FAERS: 5 | US FAERS | |
| 173 | Mental impairment | FAERS: 5 | US FAERS | |
| 174 | Middle insomnia | FAERS: 5 | US FAERS | |
| 175 | Morbid thoughts | FAERS: 5 | US FAERS | |
| 176 | Neck Pain | FAERS: 5 | US FAERS | |
| 177 | Petechiae | FAERS: 5 | US FAERS | |
| 178 | Physical assault | FAERS: 5 | US FAERS | |
| 179 | Presyncope | FAERS: 5 | US FAERS | |
| 180 | Pulmonary Hypertension | FAERS: 5 | US FAERS | |
| 181 | Respiratory distress | FAERS: 5 | US FAERS | |
| 182 | Restless Legs Syndrome | FAERS: 5 | US FAERS | |
| 183 | Sinus bradycardia | FAERS: 5 | US FAERS | |
| 184 | Vasculitis | FAERS: 5 | US FAERS | |
| 185 | Yawning | FAERS: 5 | US FAERS | |
| 186 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 187 | Alopecia | FAERS: 4 | US FAERS | |
| 188 | Angioedema | FAERS: 4 | US FAERS | |
| 189 | Blood alcohol increased | FAERS: 4 | US FAERS | |
| 190 | Blood potassium decreased | FAERS: 4 | US FAERS | |
| 191 | Bradyphrenia | FAERS: 4 | US FAERS | |
| 192 | Cerebrovascular accident | FAERS: 4 | US FAERS | |
| 193 | Congenital Hydrocephalus | FAERS: 4 | US FAERS | |
| 194 | Conversion disorder | FAERS: 4 | US FAERS | |
| 195 | Dementia | FAERS: 4 | US FAERS | |
| 196 | Discomfort | FAERS: 4 | US FAERS | |
| 197 | Drug exposure before pregnancy | FAERS: 4 | US FAERS | |
| 198 | Drug exposure via breast milk | FAERS: 4 | US FAERS | |
| 199 | Drug level increased | FAERS: 4 | US FAERS | |
| 200 | Duodenal perforation | FAERS: 4 | US FAERS | |
| 201 | Dyspepsia | FAERS: 4 | US FAERS | |
| 202 | Facial Paresis | FAERS: 4 | US FAERS | |
| 203 | Feelings of worthlessness | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 204 | Flatulence | FAERS: 4 | US FAERS | |
| 205 | Foreign body aspiration | FAERS: 4 | US FAERS | |
| 206 | Gastrointestinal sounds abnormal | FAERS: 4 | US FAERS | |
| 207 | Glaucoma | FAERS: 4 | US FAERS | |
| 208 | Hostility | FAERS: 4 | US FAERS | |
| 209 | Hydronephrosis | FAERS: 4 | US FAERS | |
| 210 | Hypoxia | FAERS: 4 | US FAERS | |
| 211 | Increased tendency to bruise | FAERS: 4 | US FAERS | |
| 212 | Intentional drug misuse | FAERS: 4 | US FAERS | |
| 213 | Leukocytosis | FAERS: 4 | US FAERS | |
| 214 | Myoclonus | FAERS: 4 | US FAERS | |
| 215 | Night sweats | FAERS: 4 | US FAERS | |
| 216 | Personality Change | FAERS: 4 | US FAERS | |
| 217 | Poisoning | FAERS: 4 | US FAERS | |
| 218 | Priapism | FAERS: 4 | US FAERS | |
| 219 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 220 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 221 | Transmission of drug via semen | FAERS: 4 | US FAERS | |
| 222 | Abasia | FAERS: 3 | US FAERS | |
| 223 | Aborted pregnancy | FAERS: 3 | US FAERS | |
| 224 | Acidosis | FAERS: 3 | US FAERS | |
| 225 | Acute tonsillitis | FAERS: 3 | US FAERS | |
| 226 | Ageusia | FAERS: 3 | US FAERS | |
| 227 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 228 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 229 | Aphonia | FAERS: 3 | US FAERS | |
| 230 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 231 | Blindness | FAERS: 3 | US FAERS | |
| 232 | Blood follicle stimulating hormone increased | FAERS: 3 | US FAERS | |
| 233 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 234 | Blood glucose fluctuation | FAERS: 3 | US FAERS | |
| 235 | Blood sodium increased | FAERS: 3 | US FAERS | |
| 236 | Bradykinesia | FAERS: 3 | US FAERS | |
| 237 | Cerebral atrophy | FAERS: 3 | US FAERS | |
| 238 | Clonus | FAERS: 3 | US FAERS | |
| 239 | Cold sweat | FAERS: 3 | US FAERS | |
| 240 | Drug level above therapeutic | FAERS: 3 | US FAERS | |
| 241 | Dysphemia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 242 | Dysuria | FAERS: 3 | US FAERS | |
| 243 | Economic problem | FAERS: 3 | US FAERS | |
| 244 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 245 | Eye pain | FAERS: 3 | US FAERS | |
| 246 | Facial Pain | FAERS: 3 | US FAERS | |
| 247 | General physical health deterioration | FAERS: 3 | US FAERS | |
| 248 | Head deformity | FAERS: 3 | US FAERS | |
| 249 | Hyperacusis | FAERS: 3 | US FAERS | |
| 250 | Hypoaesthesia facial | FAERS: 3 | US FAERS | |
| 251 | Hypokinesia | FAERS: 3 | US FAERS | |
| 252 | Hypophagia | FAERS: 3 | US FAERS | |
| 253 | Hypoplastic Left Heart Syndrome | FAERS: 3 | US FAERS | |
| 254 | Hypospadias | FAERS: 3 | US FAERS | |
| 255 | Initial insomnia | FAERS: 3 | US FAERS | |
| 256 | Lethargy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 257 | Lip swelling | FAERS: 3 | US FAERS | |
| 258 | Multiple drug overdose intentional | FAERS: 3 | US FAERS | |
| 259 | Muscle tightness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Nasal Flaring | FAERS: 3 | US FAERS | |
| 261 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 262 | Nephritis | FAERS: 3 | US FAERS | |
| 263 | Neutropenia | FAERS: 3 | US FAERS | |
| 264 | Nystagmus | FAERS: 3 | US FAERS | |
| 265 | Partner stress | FAERS: 3 | US FAERS | |
| 266 | Product measured potency issue | FAERS: 3 | US FAERS | |
| 267 | Product taste abnormal | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 268 | Protein urine present | FAERS: 3 | US FAERS | |
| 269 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 270 | Synovitis | FAERS: 3 | US FAERS | |
| 271 | Tachyphrenia | FAERS: 3 | US FAERS | |
| 272 | Tension Headache | FAERS: 3 | US FAERS | |
| 273 | Tension | FAERS: 3 | US FAERS | |
| 274 | Tonic clonic movements | FAERS: 3 | US FAERS | |
| 275 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 276 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 277 | Violence-related symptom | FAERS: 3 | US FAERS | |
| 278 | Acne | FAERS: 2 | US FAERS | |
| 279 | Adverse event | FAERS: 2 | US FAERS | |
| 280 | Agoraphobia | FAERS: 2 | US FAERS | |
| 281 | Albuminuria | FAERS: 2 | US FAERS | |
| 282 | Alcohol withdrawal syndrome | FAERS: 2 | US FAERS | |
| 283 | Amniotic fluid volume increased | FAERS: 2 | US FAERS | |
| 284 | Anhidrosis | FAERS: 2 | US FAERS | |
| 285 | Aphagia | FAERS: 2 | US FAERS | |
| 286 | Ataxia | FAERS: 2 | US FAERS | |
| 287 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 288 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 289 | Atrioventricular Septal Defect | FAERS: 2 | US FAERS | |
| 290 | Ballismus | FAERS: 2 | US FAERS | |
| 291 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 292 | Blood amylase increased | FAERS: 2 | US FAERS | |
| 293 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 294 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 295 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 296 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 297 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 298 | Breech Presentation | FAERS: 2 | US FAERS | |
| 299 | Cardiac neoplasm unspecified | FAERS: 2 | US FAERS | |
| 300 | Catatonia | FAERS: 2 | US FAERS | |
| 301 | Chromatopsia | FAERS: 2 | US FAERS | |
| 302 | Coagulation test abnormal | FAERS: 2 | US FAERS | |
| 303 | Congenital cystic kidney disease | FAERS: 2 | US FAERS | |
| 304 | Congenital hydronephrosis | FAERS: 2 | US FAERS | |
| 305 | Deafness | FAERS: 2 | US FAERS | |
| 306 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 307 | Dissociation | FAERS: 2 | US FAERS | |
| 308 | Disturbance in sexual arousal | FAERS: 2 | US FAERS | |
| 309 | Drug Dependence | FAERS: 2 | US FAERS | |
| 310 | Drug ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 311 | Dry skin | FAERS: 2 | US FAERS | |
| 312 | Dysthymic Disorder | FAERS: 2 | US FAERS | |
| 313 | Electrocardiogram T wave biphasic | FAERS: 2 | US FAERS | |
| 314 | Eosinophilia | FAERS: 2 | US FAERS | |
| 315 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 316 | Euphoric mood | FAERS: 2 | US FAERS | |
| 317 | Excessive eye blinking | FAERS: 2 | US FAERS | |
| 318 | Female sexual arousal disorder | FAERS: 2 | US FAERS | |
| 319 | Female sexual dysfunction | FAERS: 2 | US FAERS | |
| 320 | Food craving | FAERS: 2 | US FAERS | |
| 321 | Formication | FAERS: 2 | US FAERS | |
| 322 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 323 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 324 | Head discomfort | FAERS: 2 | US FAERS | |
| 325 | Hepatic necrosis | FAERS: 2 | US FAERS | |
| 326 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 327 | Hyperreflexia | FAERS: 2 | US FAERS | |
| 328 | Hypoventilation | FAERS: 2 | US FAERS | |
| 329 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 330 | Incoherent | FAERS: 2 | US FAERS | |
| 331 | Incontinence | FAERS: 2 | US FAERS | |
| 332 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 333 | Joint stiffness | FAERS: 2 | US FAERS | |
| 334 | Joint swelling | FAERS: 2 | US FAERS | |
| 335 | Lennox-Gastaut syndrome | FAERS: 2 | US FAERS | |
| 336 | Lissencephaly | FAERS: 2 | US FAERS | |
| 337 | Localised intraabdominal fluid collection | FAERS: 2 | US FAERS | |
| 338 | Menorrhagia | FAERS: 2 | US FAERS | |
| 339 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 340 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 341 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 342 | Orgasmic sensation decreased | FAERS: 2 | US FAERS | |
| 343 | Oropharyngeal pain | FAERS: 2 | US FAERS | |
| 344 | Pancytopenia | FAERS: 2 | US FAERS | |
| 345 | Pneumothorax | FAERS: 2 | US FAERS | |
| 346 | Pre-Eclampsia | FAERS: 2 | US FAERS | |
| 347 | Premature Ejaculation | FAERS: 2 | US FAERS | |
| 348 | Prescribed overdose | FAERS: 2 | US FAERS | |
| 349 | Product contamination | FAERS: 2 | US FAERS | |
| 350 | Product formulation issue | FAERS: 2 | US FAERS | |
| 351 | Product size issue | FAERS: 2 | US FAERS | |
| 352 | Protein total increased | FAERS: 2 | US FAERS | |
| 353 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 354 | Puerperal pyrexia | FAERS: 2 | US FAERS | |
| 355 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 356 | Purpura | FAERS: 2 | US FAERS | |
| 357 | Pyelectasia | FAERS: 2 | US FAERS | |
| 358 | Rash erythematous | FAERS: 2 | US FAERS | |
| 359 | Retching | FAERS: 2 | US FAERS | |
| 360 | Retinal Vascular Disorder | FAERS: 2 | US FAERS | |
| 361 | Screaming | FAERS: 2 | US FAERS | |
| 362 | Sjogren's Syndrome | FAERS: 2 | US FAERS | |
| 363 | Skin laceration | FAERS: 2 | US FAERS | |
| 364 | Skin tightness | FAERS: 2 | US FAERS | |
| 365 | Sopor | FAERS: 2 | US FAERS | |
| 366 | Spermatozoa morphology abnormal | FAERS: 2 | US FAERS | |
| 367 | Spermatozoa progressive motility decreased | FAERS: 2 | US FAERS | |
| 368 | Spina Bifida | FAERS: 2 | US FAERS | |
| 369 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 370 | Stomatitis | FAERS: 2 | US FAERS | |
| 371 | Suppressed lactation | FAERS: 2 | US FAERS | |
| 372 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 373 | Therapy non-responder | FAERS: 2 | US FAERS | |
| 374 | Trisomy 21 | FAERS: 2 | US FAERS | |
| 375 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 376 | Abscess | FAERS: 1 | US FAERS | |
| 377 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 378 | Accidental exposure | FAERS: 1 | US FAERS | |
| 379 | Activation syndrome | FAERS: 1 | US FAERS | |
| 380 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 381 | Acute psychosis | FAERS: 1 | US FAERS | |
| 382 | Agonal rhythm | FAERS: 1 | US FAERS | |
| 383 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 384 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 385 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 386 | Ammonia increased | FAERS: 1 | US FAERS | |
| 387 | Amniotic cavity disorder | FAERS: 1 | US FAERS | |
| 388 | Amyloidosis | FAERS: 1 | US FAERS | |
| 389 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 390 | Anorexia Nervosa | FAERS: 1 | US FAERS | |
| 391 | Anosmia | FAERS: 1 | US FAERS | |
| 392 | Antidepressant drug level decreased | FAERS: 1 | US FAERS | |
| 393 | Antidepressant drug level increased | FAERS: 1 | US FAERS | |
| 394 | Apparent death | FAERS: 1 | US FAERS | |
| 395 | Arthritis | FAERS: 1 | US FAERS | |
| 396 | Asthma | FAERS: 1 | US FAERS | |
| 397 | Atherosclerosis | FAERS: 1 | US FAERS | |
| 398 | Atrophic vulvovaginitis | FAERS: 1 | US FAERS | |
| 399 | Avulsion fracture | FAERS: 1 | US FAERS | |
| 400 | Basilar Artery Stenosis | FAERS: 1 | US FAERS | |
| 401 | Bedridden | FAERS: 1 | US FAERS | |
| 402 | Bipolar II disorder | FAERS: 1 | US FAERS | |
| 403 | Blepharospasm | FAERS: 1 | US FAERS | |
| 404 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 405 | Blood chloride increased | FAERS: 1 | US FAERS | |
| 406 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 407 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 408 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 409 | Blood ketone body increased | FAERS: 1 | US FAERS | |
| 410 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 411 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 412 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 413 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 414 | Blood triglycerides abnormal | FAERS: 1 | US FAERS | |
| 415 | Blood urine present | FAERS: 1 | US FAERS | |
| 416 | Bone marrow necrosis | FAERS: 1 | US FAERS | |
| 417 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 418 | Breast tenderness | FAERS: 1 | US FAERS | |
| 419 | Cardiac Death | FAERS: 1 | US FAERS | |
| 420 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 421 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 422 | Cellulitis | FAERS: 1 | US FAERS | |
| 423 | Central nervous system function test abnormal | FAERS: 1 | US FAERS | |
| 424 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 425 | Change in sustained attention | FAERS: 1 | US FAERS | |
| 426 | Choanal Atresia | FAERS: 1 | US FAERS | |
| 427 | Choreoathetosis | FAERS: 1 | US FAERS | |
| 428 | Chromaturia | FAERS: 1 | US FAERS | |
| 429 | Coma scale abnormal | FAERS: 1 | US FAERS | |
| 430 | Congenital pulmonary hypertension | FAERS: 1 | US FAERS | |
| 431 | Congenital scoliosis | FAERS: 1 | US FAERS | |
| 432 | Congenital urinary tract obstruction | FAERS: 1 | US FAERS | |
| 433 | Continuous Positive Airway Pressure | FAERS: 1 | US FAERS | |
| 434 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 435 | Creatine urine increased | FAERS: 1 | US FAERS | |
| 436 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 437 | Culture urine positive | FAERS: 1 | US FAERS | |
| 438 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 439 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 440 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 441 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 442 | Diplegia | FAERS: 1 | US FAERS | |
| 443 | Disability | FAERS: 1 | US FAERS | |
| 444 | Drug administration error | FAERS: 1 | US FAERS | |
| 445 | Drug dose omission | FAERS: 1 | US FAERS | |
| 446 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 447 | Drug level decreased | FAERS: 1 | US FAERS | |
| 448 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 449 | Drug screen positive | FAERS: 1 | US FAERS | |
| 450 | Duodenal atresia | FAERS: 1 | US FAERS | |
| 451 | Dysgraphia | FAERS: 1 | US FAERS | |
| 452 | Dysmorphism | FAERS: 1 | US FAERS | |
| 453 | Dysphonia | FAERS: 1 | US FAERS | |
| 454 | Ecchymosis | FAERS: 1 | US FAERS | |
| 455 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 456 | Eczema | FAERS: 1 | US FAERS | |
| 457 | Educational problem | FAERS: 1 | US FAERS | |
| 458 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 459 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 460 | Electrocardiogram ST-T change | FAERS: 1 | US FAERS | |
| 461 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 462 | Enuresis | FAERS: 1 | US FAERS | |
| 463 | Erection increased | FAERS: 1 | US FAERS | |
| 464 | Eructation | FAERS: 1 | US FAERS | |
| 465 | Escherichia infection | FAERS: 1 | US FAERS | |
| 466 | Executive dysfunction | FAERS: 1 | US FAERS | |
| 467 | Eye inflammation | FAERS: 1 | US FAERS | |
| 468 | Feeding disorder of infancy OR early childhood | FAERS: 1 | US FAERS | |
| 469 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 470 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 471 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 472 | Food Allergy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 473 | Food Poisoning | FAERS: 1 | US FAERS | |
| 474 | Forceps delivery | FAERS: 1 | US FAERS | |
| 475 | Fracture | FAERS: 1 | US FAERS | |
| 476 | Frustration | FAERS: 1 | US FAERS | |
| 477 | Gastritis | FAERS: 1 | US FAERS | |
| 478 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 479 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 480 | Glioblastoma | FAERS: 1 | US FAERS | |
| 481 | Head lag abnormal | FAERS: 1 | US FAERS | |
| 482 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 483 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 484 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 485 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 486 | Hunger | FAERS: 1 | US FAERS | |
| 487 | Hypercalciuria | FAERS: 1 | US FAERS | |
| 488 | Hyperkinesia | FAERS: 1 | US FAERS | |
| 489 | Hyperplasia | FAERS: 1 | US FAERS | |
| 490 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 491 | Hypoaesthesia of genital male | FAERS: 1 | US FAERS | |
| 492 | Hypogeusia | FAERS: 1 | US FAERS | |
| 493 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 494 | Idiosyncratic drug reaction | FAERS: 1 | US FAERS | |
| 495 | Impatience | FAERS: 1 | US FAERS | |
| 496 | Infection | FAERS: 1 | US FAERS | |
| 497 | Inflammation | FAERS: 1 | US FAERS | |
| 498 | Joint Instability | FAERS: 1 | US FAERS | |
| 499 | Lactation Disorder | FAERS: 1 | US FAERS | |
| 500 | Leukopenia | FAERS: 1 | US FAERS | |
| 501 | Limb injury | FAERS: 1 | US FAERS | |
| 502 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 503 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 504 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 505 | Macular degeneration | FAERS: 1 | US FAERS | |
| 506 | Malaria | FAERS: 1 | US FAERS | |
| 507 | Mastitis | FAERS: 1 | US FAERS | |
| 508 | Meningism | FAERS: 1 | US FAERS | |
| 509 | Meningomyelocele | FAERS: 1 | US FAERS | |
| 510 | Microphthalmos | FAERS: 1 | US FAERS | |
| 511 | Miscarriage of partner | FAERS: 1 | US FAERS | |
| 512 | Motion Sickness | FAERS: 1 | US FAERS | |
| 513 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 514 | Multiple allergies | FAERS: 1 | US FAERS | |
| 515 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 516 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 517 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 518 | Myopathy | FAERS: 1 | US FAERS | |
| 519 | Myopia | FAERS: 1 | US FAERS | |
| 520 | Negative thoughts | FAERS: 1 | US FAERS | |
| 521 | Neonatal respiratory depression | FAERS: 1 | US FAERS | |
| 522 | Neonatal respiratory failure | FAERS: 1 | US FAERS | |
| 523 | Nerve injury | FAERS: 1 | US FAERS | |
| 524 | Neuralgia | FAERS: 1 | US FAERS | |
| 525 | Neuritis | FAERS: 1 | US FAERS | |
| 526 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 527 | Ocular icterus | FAERS: 1 | US FAERS | |
| 528 | Onychoclasis | FAERS: 1 | US FAERS | |
| 529 | Osmotic demyelination syndrome | FAERS: 1 | US FAERS | |
| 530 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 531 | PCO2 increased | FAERS: 1 | US FAERS | |
| 532 | PO2 decreased | FAERS: 1 | US FAERS | |
| 533 | PO2 increased | FAERS: 1 | US FAERS | |
| 534 | Pain of skin | FAERS: 1 | US FAERS | |
| 535 | Paradoxical drug reaction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 536 | Pemphigus | FAERS: 1 | US FAERS | |
| 537 | Perianal abscess | FAERS: 1 | US FAERS | |
| 538 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 539 | Peripheral swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 540 | Persistent genital arousal disorder | FAERS: 1 | US FAERS | |
| 541 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 542 | Pharyngitis | FAERS: 1 | US FAERS | |
| 543 | Plagiocephaly | FAERS: 1 | US FAERS | |
| 544 | Platelet aggregation inhibition | FAERS: 1 | US FAERS | |
| 545 | Platelet function test abnormal | FAERS: 1 | US FAERS | |
| 546 | Pneumonia | FAERS: 1 | US FAERS | |
| 547 | Polyhydramnios | FAERS: 1 | US FAERS | |
| 548 | Polymerase Chain Reaction | FAERS: 1 | US FAERS | |
| 549 | Poor sucking reflex | FAERS: 1 | US FAERS | |
| 550 | Positron emission tomogram abnormal | FAERS: 1 | US FAERS | |
| 551 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 552 | Postural Orthostatic Tachycardia Syndrome | FAERS: 1 | US FAERS | |
| 553 | Premenstrual syndrome | FAERS: 1 | US FAERS | |
| 554 | Pressure of speech | FAERS: 1 | US FAERS | |
| 555 | Proctitis | FAERS: 1 | US FAERS | |
| 556 | Product counterfeit | FAERS: 1 | US FAERS | |
| 557 | Product label issue | FAERS: 1 | US FAERS | |
| 558 | Product shape issue | FAERS: 1 | US FAERS | |
| 559 | Product tampering | FAERS: 1 | US FAERS | |
| 560 | Prurigo | FAERS: 1 | US FAERS | |
| 561 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 562 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 563 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 564 | Reactive attachment disorder of infancy or early childhood | FAERS: 1 | US FAERS | |
| 565 | Renal Colic | FAERS: 1 | US FAERS | |
| 566 | Renal dysplasia | FAERS: 1 | US FAERS | |
| 567 | Renal pain | FAERS: 1 | US FAERS | |
| 568 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 569 | Respiratory depth decreased | FAERS: 1 | US FAERS | |
| 570 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 571 | Retrograde ejaculation | FAERS: 1 | US FAERS | |
| 572 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 573 | Ruptured cerebral aneurysm | FAERS: 1 | US FAERS | |
| 574 | Salt craving | FAERS: 1 | US FAERS | |
| 575 | Scotoma | FAERS: 1 | US FAERS | |
| 576 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 577 | Shock | FAERS: 1 | US FAERS | |
| 578 | Shoulder deformity | FAERS: 1 | US FAERS | |
| 579 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 580 | Sinusitis | FAERS: 1 | US FAERS | |
| 581 | Skin reaction | FAERS: 1 | US FAERS | |
| 582 | Sleep-related eating disorder | FAERS: 1 | US FAERS | |
| 583 | Snoring | FAERS: 1 | US FAERS | |
| 584 | Sperm concentration abnormal | FAERS: 1 | US FAERS | |
| 585 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 586 | Spermatozoa progressive motility abnormal | FAERS: 1 | US FAERS | |
| 587 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 588 | Strabismus | FAERS: 1 | US FAERS | |
| 589 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 590 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 591 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 592 | Tablet physical issue | FAERS: 1 | US FAERS | |
| 593 | Talipes | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 594 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 595 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 596 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 597 | Thirst | FAERS: 1 | US FAERS | |
| 598 | Tobacco user | FAERS: 1 | US FAERS | |
| 599 | Tocolysis | FAERS: 1 | US FAERS | |
| 600 | Torticollis | FAERS: 1 | US FAERS | |
| 601 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 602 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 603 | Unmasking of previously unidentified disease | FAERS: 1 | US FAERS | |
| 604 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 605 | Urinary Retention | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 606 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 607 | Uvulitis | FAERS: 1 | US FAERS | |
| 608 | Vaginal mucosal blistering | FAERS: 1 | US FAERS | |
| 609 | Vein pain | FAERS: 1 | US FAERS | |
| 610 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 611 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 612 | Vitreous opacities | FAERS: 1 | US FAERS | |
| 613 | Wheezing | FAERS: 1 | US FAERS | |
| 614 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 615 | Xerophthalmia | FAERS: 1 | US FAERS | |
| 616 | furuncle | FAERS: 1 | US FAERS | |
| 617 | jaundice | FAERS: 1 | US FAERS | |
| 618 | Heart valve stenosis | Canada Vigilance: 1 | Canada Vigilance | |
| 619 | Lactose Intolerance | Canada Vigilance: 1 | Canada Vigilance | |
| 620 | Selective eating disorder | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120269
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.