Olmesartan Medoxomil
(UQGKUQLKSCSZGY-UHFFFAOYSA-N)
Structure
- SMILES
- CCCc1nc(c(n1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)C(=O)OCc1oc(=O)oc1C)C(O)(C)C
- Molecular Formula:
- C29H30N6O6
- Molecular Weight:
- 558.585
- Log P:
- 4.1700
- Hydrogen Bond Acceptor:
- 11
- Hydrogen Bond Donor:
- 2
- TPSA:
- 162.16
- CAS Number(s):
- 144689-63-4
Synonym(s)
1.
Olmesartan Medoxomil
2.
5-Methyl-2-oxo-1,3-dioxolen-4-yl)methoxy-4-(1-hydroxy-1-methylethyl)-2-propyl-1-(4-(2-(tetrazol-5-yl)phenyl)phenyl)methylimidazol-5-carboxylate - T287346
3.
Benicar
4.
CS 866
5.
CS-866
6.
Olmetec
7.
Votum
8.
CS866
9.
Medoxomil, Olmesartan
External Link(s)
| MeSH | D000068557 |
| PubChem Compound | 130881 |
| BindingDB | 50442892 |
| ChEBI | 31932 |
| CHEMBL | CHEMBL1200692 |
| DrugCentral | 1985 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 591 |
| KEGG | dr:D01204 |
| Therapeutic Target Database | D07UBG |
| ZINC | 4149248 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Weight decreased | FAERS: 1925 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Sprue-like enteropathy | FAERS: 1837 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Acute kidney injury | FAERS: 670 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Malabsorption | FAERS: 517 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Diverticulitis | FAERS: 515 | US FAERS | |
| 6 | Diverticulum | FAERS: 447 | OFFSIDES US FAERS | |
| 7 | Constipation | FAERS: 399 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Irritable Bowel Syndrome | FAERS: 303 | US FAERS | |
| 9 | Dizziness | FAERS: 302 Canada Vigilance: 7 | 20528002 | CTD OFFSIDES Canada Vigilance US FAERS |
| 10 | Hypotension | FAERS: 266 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 11 | Nausea | FAERS: 256 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 12 | Dehydration | FAERS: 239 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 13 | Vomiting | FAERS: 238 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 14 | Abdominal Pain | FAERS: 213 | US FAERS | |
| 15 | Syncope | FAERS: 179 | US FAERS | |
| 16 | Drug administration error | FAERS: 174 | OFFSIDES US FAERS | |
| 17 | Cholelithiasis | FAERS: 162 | US FAERS | |
| 18 | Gastritis | FAERS: 149 | US FAERS | |
| 19 | Gastric ulcer | FAERS: 136 | OFFSIDES US FAERS | |
| 20 | Pancreatitis | FAERS: 119 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 21 | Drug ineffective | FAERS: 113 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 22 | Colitis | FAERS: 110 | 23665423 | CTD US FAERS |
| 23 | Peptic Ulcer | FAERS: 105 | US FAERS | |
| 24 | Cholecystitis | FAERS: 85 | OFFSIDES US FAERS | |
| 25 | Gastroenteritis | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Headache | FAERS: 83 Canada Vigilance: 3 | 20528002 | CTD Canada Vigilance US FAERS |
| 27 | Product administration error | FAERS: 81 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Fatigue | FAERS: 71 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 29 | Clostridium difficile colitis | FAERS: 60 | US FAERS | |
| 30 | Impaired gastric emptying | FAERS: 60 | US FAERS | |
| 31 | Dyspepsia | FAERS: 57 | US FAERS | |
| 32 | Malaise | FAERS: 55 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 33 | Asthenia | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 34 | Duodenal Ulcer | FAERS: 47 | US FAERS | |
| 35 | Abdominal discomfort | FAERS: 46 | US FAERS | |
| 36 | No adverse event | FAERS: 42 | US FAERS | |
| 37 | Umbilical hernia | FAERS: 42 | US FAERS | |
| 38 | Intestinal Obstruction | FAERS: 41 | US FAERS | |
| 39 | Malnutrition | FAERS: 41 | US FAERS | |
| 40 | Rectal polyp | FAERS: 41 | US FAERS | |
| 41 | Feeling abnormal | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 42 | Alopecia | FAERS: 36 | US FAERS | |
| 43 | Ileus | FAERS: 36 | US FAERS | |
| 44 | Presyncope | FAERS: 36 | US FAERS | |
| 45 | Cerebrovascular accident | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Chest Pain | FAERS: 34 | US FAERS | |
| 47 | Anxiety | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 48 | Duodenitis | FAERS: 32 | US FAERS | |
| 49 | Oligohydramnios | FAERS: 32 | US FAERS | |
| 50 | Unevaluable event | FAERS: 32 | US FAERS | |
| 51 | Metabolic acidosis | FAERS: 30 | US FAERS | |
| 52 | Reactive gastropathy | FAERS: 30 | US FAERS | |
| 53 | Chronic gastritis | FAERS: 29 | US FAERS | |
| 54 | Pain | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 55 | Palpitations | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 56 | Ulcer | FAERS: 28 | US FAERS | |
| 57 | Intestinal villi atrophy | FAERS: 27 | US FAERS | |
| 58 | Myalgia | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Pruritus | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Angioedema | FAERS: 26 Canada Vigilance: 1 | 17341528 | CTD Canada Vigilance US FAERS |
| 61 | Hernia | FAERS: 25 | US FAERS | |
| 62 | Blood creatinine increased | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 63 | Helicobacter test positive | FAERS: 23 | US FAERS | |
| 64 | Infectious colitis | FAERS: 23 | US FAERS | |
| 65 | Arthralgia | FAERS: 22 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 66 | Flatulence | FAERS: 22 | OFFSIDES US FAERS | |
| 67 | Nephrolithiasis | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Appendicitis | FAERS: 21 | US FAERS | |
| 69 | Colon adenoma | FAERS: 21 | OFFSIDES US FAERS | |
| 70 | Incorrect dose administered | FAERS: 21 | US FAERS | |
| 71 | Myocardial Infarction | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Enteritis | FAERS: 20 | US FAERS | |
| 73 | Blood potassium increased | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 74 | Clostridium difficile infection | FAERS: 19 | US FAERS | |
| 75 | Diverticular perforation | FAERS: 19 | US FAERS | |
| 76 | Renal cyst | FAERS: 19 | OFFSIDES US FAERS | |
| 77 | Urticaria | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Gastrointestinal inflammation | FAERS: 18 | US FAERS | |
| 79 | Back Pain | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 80 | Gastrointestinal bacterial overgrowth | FAERS: 17 | US FAERS | |
| 81 | Enterocolitis | FAERS: 16 | US FAERS | |
| 82 | Erosive Duodenitis | FAERS: 16 | US FAERS | |
| 83 | Pneumonia | FAERS: 16 | US FAERS | |
| 84 | Tremor | FAERS: 16 | US FAERS | |
| 85 | Urinary tract infection | FAERS: 16 | US FAERS | |
| 86 | Nasopharyngitis | FAERS: 15 | US FAERS | |
| 87 | Peripheral swelling | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 88 | Thrombocytopenia | FAERS: 15 | US FAERS | |
| 89 | Vertigo | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 90 | Anal Fissure | FAERS: 14 | US FAERS | |
| 91 | Atrial Fibrillation | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Diabetes Mellitus | FAERS: 14 | US FAERS | |
| 93 | Intestinal Perforation | FAERS: 14 | US FAERS | |
| 94 | Cardiac Arrest | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Drug exposure during pregnancy | FAERS: 13 | US FAERS | |
| 96 | Neonatal hypotension | FAERS: 13 | US FAERS | |
| 97 | Ascites | FAERS: 12 | US FAERS | |
| 98 | Chest discomfort | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Diaphragmatic Hernia | FAERS: 12 | US FAERS | |
| 100 | Renal dysplasia | FAERS: 12 | US FAERS | |
| 101 | Tachycardia | FAERS: 12 | US FAERS | |
| 102 | Angina Pectoris | FAERS: 11 | US FAERS | |
| 103 | Blood cholesterol increased | FAERS: 11 | US FAERS | |
| 104 | Bradycardia | FAERS: 11 | OFFSIDES US FAERS | |
| 105 | Electrolyte imbalance | FAERS: 11 | US FAERS | |
| 106 | Hypersensitivity | FAERS: 11 | US FAERS | |
| 107 | Infarction | FAERS: 11 | US FAERS | |
| 108 | Occult blood positive | FAERS: 11 | OFFSIDES US FAERS | |
| 109 | Proctitis | FAERS: 11 | US FAERS | |
| 110 | Blood glucose increased | FAERS: 10 | US FAERS | |
| 111 | Blood pressure fluctuation | FAERS: 10 | OFFSIDES US FAERS | |
| 112 | Erectile dysfunction | FAERS: 10 | US FAERS | |
| 113 | Gastrointestinal tract adenoma | FAERS: 10 | US FAERS | |
| 114 | Hydronephrosis | FAERS: 10 | US FAERS | |
| 115 | Product substitution issue | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 116 | Sepsis | FAERS: 10 | US FAERS | |
| 117 | Somnolence | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Visual Impairment | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Blood pressure inadequately controlled | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 120 | Emotional distress | FAERS: 9 | OFFSIDES US FAERS | |
| 121 | Epistaxis | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Hepatitis | FAERS: 9 | US FAERS | |
| 123 | Inflammation | FAERS: 9 | US FAERS | |
| 124 | Leukocytosis | FAERS: 9 | US FAERS | |
| 125 | Lipoma | FAERS: 9 | US FAERS | |
| 126 | Neonatal anuria | FAERS: 9 | US FAERS | |
| 127 | Renal tubular necrosis | FAERS: 9 | US FAERS | |
| 128 | Swelling | FAERS: 9 | US FAERS | |
| 129 | Urinary Incontinence | FAERS: 9 | US FAERS | |
| 130 | Abdominal adhesions | FAERS: 8 | US FAERS | |
| 131 | Anuria | FAERS: 8 | US FAERS | |
| 132 | Bronchitis | FAERS: 8 | US FAERS | |
| 133 | Colectomy | FAERS: 8 | US FAERS | |
| 134 | Dysgeusia | FAERS: 8 | OFFSIDES US FAERS | |
| 135 | Gastroduodenitis | FAERS: 8 | US FAERS | |
| 136 | Heart sounds abnormal | FAERS: 8 | US FAERS | |
| 137 | Lactose Intolerance | FAERS: 8 | US FAERS | |
| 138 | Peritoneal Dialysis | FAERS: 8 | US FAERS | |
| 139 | Peritonitis | FAERS: 8 | US FAERS | |
| 140 | Pulmonary Embolism | FAERS: 8 | US FAERS | |
| 141 | Renal failure neonatal | FAERS: 8 | US FAERS | |
| 142 | Rhabdomyolysis | FAERS: 8 | OFFSIDES US FAERS | |
| 143 | Amnesia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 144 | Aortic Aneurysm | FAERS: 7 | US FAERS | |
| 145 | Blood alkaline phosphatase increased | FAERS: 7 | US FAERS | |
| 146 | Blood potassium decreased | FAERS: 7 | US FAERS | |
| 147 | Drug dose omission | FAERS: 7 | US FAERS | |
| 148 | Flushing | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | General physical health deterioration | FAERS: 7 | OFFSIDES US FAERS | |
| 150 | Gluten sensitivity | FAERS: 7 | US FAERS | |
| 151 | Hepatomegaly | FAERS: 7 | US FAERS | |
| 152 | Joint swelling | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 153 | Lethargy | FAERS: 7 | OFFSIDES US FAERS | |
| 154 | Leukopenia | FAERS: 7 | US FAERS | |
| 155 | Pancreatic Insufficiency | FAERS: 7 | US FAERS | |
| 156 | Pneumatosis intestinalis | FAERS: 7 | US FAERS | |
| 157 | Product quality issue | FAERS: 7 | OFFSIDES US FAERS | |
| 158 | Proteinuria | FAERS: 7 | US FAERS | |
| 159 | Transaminases increased | FAERS: 7 | US FAERS | |
| 160 | Anal Fistula | FAERS: 6 | US FAERS | |
| 161 | Biliary dilatation | FAERS: 6 | US FAERS | |
| 162 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 163 | Blood urine present | FAERS: 6 | US FAERS | |
| 164 | Clostridium test positive | FAERS: 6 | US FAERS | |
| 165 | Drug prescribing error | FAERS: 6 | US FAERS | |
| 166 | Enterovesical Fistula | FAERS: 6 | US FAERS | |
| 167 | Incisional hernia | FAERS: 6 | US FAERS | |
| 168 | Influenza | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 169 | Intestinal Fistula | FAERS: 6 | US FAERS | |
| 170 | Intestinal resection | FAERS: 6 | US FAERS | |
| 171 | Lymphoid tissue hyperplasia | FAERS: 6 | US FAERS | |
| 172 | Pneumothorax | FAERS: 6 | US FAERS | |
| 173 | Sinusitis | FAERS: 6 | US FAERS | |
| 174 | jaundice | FAERS: 6 | US FAERS | |
| 175 | Acidosis | FAERS: 5 | US FAERS | |
| 176 | Anorectal discomfort | FAERS: 5 | US FAERS | |
| 177 | Arthritis | FAERS: 5 | OFFSIDES US FAERS | |
| 178 | Chills | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 179 | Cholangitis | FAERS: 5 | US FAERS | |
| 180 | Cystitis | FAERS: 5 | US FAERS | |
| 181 | Deafness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 182 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 183 | Erythema | FAERS: 5 | US FAERS | |
| 184 | Flank Pain | FAERS: 5 | US FAERS | |
| 185 | Gastric Xanthoma | FAERS: 5 | US FAERS | |
| 186 | Gastrointestinal carcinoma | FAERS: 5 | US FAERS | |
| 187 | Gastrointestinal wall thickening | FAERS: 5 | US FAERS | |
| 188 | Gout | FAERS: 5 | US FAERS | |
| 189 | Hypertensive crisis | FAERS: 5 | US FAERS | |
| 190 | Ileal ulcer | FAERS: 5 | US FAERS | |
| 191 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 192 | Neck Pain | FAERS: 5 | US FAERS | |
| 193 | Pancreatorenal syndrome | FAERS: 5 | US FAERS | |
| 194 | Pregnancy | FAERS: 5 | US FAERS | |
| 195 | Renal aneurysm | FAERS: 5 | US FAERS | |
| 196 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 197 | Retinopathy of Prematurity | FAERS: 5 | US FAERS | |
| 198 | Throat irritation | FAERS: 5 | US FAERS | |
| 199 | Thrombosis | FAERS: 5 | US FAERS | |
| 200 | Wrong drug administered | FAERS: 5 | US FAERS | |
| 201 | pseudomembranous colitis | FAERS: 5 | US FAERS | |
| 202 | Abdominal Abscess | FAERS: 4 | US FAERS | |
| 203 | Acute prerenal failure | FAERS: 4 | OFFSIDES US FAERS | |
| 204 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 205 | Anal polyp | FAERS: 4 | US FAERS | |
| 206 | Aphonia | FAERS: 4 | US FAERS | |
| 207 | Asthma | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 208 | Autoimmune Pancreatitis | FAERS: 4 | US FAERS | |
| 209 | Biliary Dyskinesia | FAERS: 4 | US FAERS | |
| 210 | Blood triglycerides increased | FAERS: 4 | US FAERS | |
| 211 | Blood urea increased | FAERS: 4 | OFFSIDES US FAERS | |
| 212 | Cataract operation | FAERS: 4 | US FAERS | |
| 213 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 214 | Delirium | FAERS: 4 | US FAERS | |
| 215 | Dysphonia | FAERS: 4 | US FAERS | |
| 216 | Dysuria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 217 | Enterocutaneous Fistula | FAERS: 4 | US FAERS | |
| 218 | Gastrointestinal infection | FAERS: 4 | US FAERS | |
| 219 | Gastrointestinal motility disorder | FAERS: 4 | US FAERS | |
| 220 | Gastrointestinal ulcer | FAERS: 4 | US FAERS | |
| 221 | Head discomfort | FAERS: 4 | US FAERS | |
| 222 | Impaired driving ability | FAERS: 4 | US FAERS | |
| 223 | Infection | FAERS: 4 | US FAERS | |
| 224 | Intestinal Atresia | FAERS: 4 | US FAERS | |
| 225 | Large intestinal polypectomy | FAERS: 4 | US FAERS | |
| 226 | Large intestinal stenosis | FAERS: 4 | US FAERS | |
| 227 | Large intestine perforation | FAERS: 4 | US FAERS | |
| 228 | Lip swelling | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 229 | Lymphocytosis | FAERS: 4 | US FAERS | |
| 230 | Mallory-Weiss Syndrome | FAERS: 4 | US FAERS | |
| 231 | Microalbuminuria | FAERS: 4 | US FAERS | |
| 232 | Microcephaly | FAERS: 4 | US FAERS | |
| 233 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 234 | Osteoporosis | FAERS: 4 | US FAERS | |
| 235 | Overdose | FAERS: 4 | OFFSIDES US FAERS | |
| 236 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 237 | Psoriasis | FAERS: 4 | US FAERS | |
| 238 | Rectal abscess | FAERS: 4 | US FAERS | |
| 239 | Small intestinal bacterial overgrowth | FAERS: 4 | US FAERS | |
| 240 | Stoma obstruction | FAERS: 4 | US FAERS | |
| 241 | Therapy non-responder | FAERS: 4 | US FAERS | |
| 242 | Ulcerative gastritis | FAERS: 4 | US FAERS | |
| 243 | Abasia | FAERS: 3 | OFFSIDES US FAERS | |
| 244 | Abdominal sepsis | FAERS: 3 | US FAERS | |
| 245 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 246 | Anorexia | FAERS: 3 | OFFSIDES US FAERS | |
| 247 | Asymptomatic bacteriuria | FAERS: 3 | US FAERS | |
| 248 | Autoimmune hepatitis | FAERS: 3 | US FAERS | |
| 249 | Bile Duct Stenosis | FAERS: 3 | US FAERS | |
| 250 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 251 | Burning sensation | FAERS: 3 | US FAERS | |
| 252 | Cataract | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 253 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 254 | Choking | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 255 | Cold sweat | FAERS: 3 | OFFSIDES US FAERS | |
| 256 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 257 | Dermatitis | FAERS: 3 | US FAERS | |
| 258 | Diplopia | FAERS: 3 | OFFSIDES US FAERS | |
| 259 | Disorientation | FAERS: 3 | US FAERS | |
| 260 | Escherichia infection | FAERS: 3 | US FAERS | |
| 261 | Fluid overload | FAERS: 3 | US FAERS | |
| 262 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 263 | Gastrointestinal angiodysplasia | FAERS: 3 | US FAERS | |
| 264 | Gastrointestinal erosion | FAERS: 3 | US FAERS | |
| 265 | Glossitis | FAERS: 3 | US FAERS | |
| 266 | Hepatic Encephalopathy | FAERS: 3 | US FAERS | |
| 267 | Hepatitis C | FAERS: 3 | US FAERS | |
| 268 | Impaired work ability | FAERS: 3 | US FAERS | |
| 269 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 270 | Intestinal metaplasia | FAERS: 3 | US FAERS | |
| 271 | Intra-cerebral aneurysm operation | FAERS: 3 | US FAERS | |
| 272 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 273 | Lymphoma | FAERS: 3 | US FAERS | |
| 274 | Memory impairment | FAERS: 3 | US FAERS | |
| 275 | Musculoskeletal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 276 | Myoclonus | FAERS: 3 | US FAERS | |
| 277 | Myositis | FAERS: 3 | US FAERS | |
| 278 | Neonatal disorder | FAERS: 3 | US FAERS | |
| 279 | Neonatal respiratory arrest | FAERS: 3 | US FAERS | |
| 280 | Nervousness | FAERS: 3 | US FAERS | |
| 281 | Obesity | FAERS: 3 | US FAERS | |
| 282 | Pallor | FAERS: 3 | US FAERS | |
| 283 | Pancreatic carcinoma | FAERS: 3 | US FAERS | |
| 284 | Pelvic floor dyssynergia | FAERS: 3 | US FAERS | |
| 285 | Pharyngitis | FAERS: 3 | US FAERS | |
| 286 | Pneumonitis | FAERS: 3 | US FAERS | |
| 287 | Productive Cough | FAERS: 3 | US FAERS | |
| 288 | Pyelonephritis | FAERS: 3 | US FAERS | |
| 289 | Reflux gastritis | FAERS: 3 | US FAERS | |
| 290 | Secretion discharge | FAERS: 3 | US FAERS | |
| 291 | Septic Shock | FAERS: 3 | US FAERS | |
| 292 | Sinus bradycardia | FAERS: 3 | US FAERS | |
| 293 | Stevens-Johnson Syndrome | FAERS: 3 | US FAERS | |
| 294 | Stomal hernia | FAERS: 3 | US FAERS | |
| 295 | Stress | FAERS: 3 | US FAERS | |
| 296 | Therapy cessation | FAERS: 3 | US FAERS | |
| 297 | Tinnitus | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 298 | Toothache | FAERS: 3 | US FAERS | |
| 299 | Urge Incontinence | FAERS: 3 | US FAERS | |
| 300 | Urinary Retention | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 301 | Vitamin D Deficiency | FAERS: 3 | US FAERS | |
| 302 | Wound Infection | FAERS: 3 | US FAERS | |
| 303 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 304 | Abdominal wound dehiscence | FAERS: 2 | US FAERS | |
| 305 | Abscess | FAERS: 2 | US FAERS | |
| 306 | Acne | FAERS: 2 | US FAERS | |
| 307 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 308 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 309 | Adverse event | FAERS: 2 | US FAERS | |
| 310 | Ageusia | FAERS: 2 | US FAERS | |
| 311 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 312 | Apathy | FAERS: 2 | US FAERS | |
| 313 | Apparent death | FAERS: 2 | US FAERS | |
| 314 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 315 | Atrioventricular Block | FAERS: 2 | OFFSIDES US FAERS | |
| 316 | Bedridden | FAERS: 2 | US FAERS | |
| 317 | Biliary Colic | FAERS: 2 | US FAERS | |
| 318 | Blindness | FAERS: 2 | US FAERS | |
| 319 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 320 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 321 | Blood prolactin increased | FAERS: 2 | US FAERS | |
| 322 | Cachexia | FAERS: 2 | US FAERS | |
| 323 | Cardiac Flutter | FAERS: 2 | US FAERS | |
| 324 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 325 | Catabolic state | FAERS: 2 | US FAERS | |
| 326 | Cellulitis | FAERS: 2 | US FAERS | |
| 327 | Cerebral ventricle dilatation | FAERS: 2 | US FAERS | |
| 328 | Chromaturia | FAERS: 2 | US FAERS | |
| 329 | Chronic sinusitis | FAERS: 2 | US FAERS | |
| 330 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 331 | Diabetic Nephropathy | FAERS: 2 | OFFSIDES US FAERS | |
| 332 | Disease Progression | FAERS: 2 | US FAERS | |
| 333 | Drug clearance decreased | FAERS: 2 | US FAERS | |
| 334 | Dysmorphism | FAERS: 2 | US FAERS | |
| 335 | Dysplasia | FAERS: 2 | US FAERS | |
| 336 | Economic problem | FAERS: 2 | OFFSIDES US FAERS | |
| 337 | Electrolyte depletion | FAERS: 2 | US FAERS | |
| 338 | Endometritis | FAERS: 2 | US FAERS | |
| 339 | Eosinophil percentage increased | FAERS: 2 | US FAERS | |
| 340 | Eructation | FAERS: 2 | US FAERS | |
| 341 | Erysipelas | FAERS: 2 | US FAERS | |
| 342 | Eye allergy | FAERS: 2 | US FAERS | |
| 343 | Feeling Cold | FAERS: 2 | OFFSIDES US FAERS | |
| 344 | Feeling jittery | FAERS: 2 | US FAERS | |
| 345 | Fistula of small intestine | FAERS: 2 | US FAERS | |
| 346 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 347 | HLA marker study positive | FAERS: 2 | US FAERS | |
| 348 | Henoch-Schonlein purpura nephritis | FAERS: 2 | US FAERS | |
| 349 | Hypocalvaria | FAERS: 2 | US FAERS | |
| 350 | Hypophagia | FAERS: 2 | US FAERS | |
| 351 | Hysterectomy | FAERS: 2 | US FAERS | |
| 352 | Incarcerated hernia | FAERS: 2 | US FAERS | |
| 353 | Insulin-requiring type 2 diabetes mellitus | FAERS: 2 | US FAERS | |
| 354 | Intestinal cyst | FAERS: 2 | US FAERS | |
| 355 | Intussusception | FAERS: 2 | US FAERS | |
| 356 | Limb discomfort | FAERS: 2 | US FAERS | |
| 357 | Medication Error | FAERS: 2 | US FAERS | |
| 358 | Melanosis coli | FAERS: 2 | US FAERS | |
| 359 | Meniscus operation | FAERS: 2 | US FAERS | |
| 360 | Mesenteric arterial occlusion | FAERS: 2 | US FAERS | |
| 361 | Mesenteric artery stenosis | FAERS: 2 | US FAERS | |
| 362 | Mesenteric artery stent insertion | FAERS: 2 | US FAERS | |
| 363 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 364 | Muscle strain | FAERS: 2 | US FAERS | |
| 365 | Myopathy | FAERS: 2 | US FAERS | |
| 366 | Neutropenia | FAERS: 2 | US FAERS | |
| 367 | Nocturia | FAERS: 2 | US FAERS | |
| 368 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 369 | Osteopenia | FAERS: 2 | US FAERS | |
| 370 | Overweight | FAERS: 2 | US FAERS | |
| 371 | Pancreatic Cyst | FAERS: 2 | US FAERS | |
| 372 | Patent ductus arteriosus | FAERS: 2 | US FAERS | |
| 373 | Pelvic Inflammatory Disease | FAERS: 2 | US FAERS | |
| 374 | Perirectal abscess | FAERS: 2 | US FAERS | |
| 375 | Pharyngolaryngeal Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 376 | Portal hypertensive gastropathy | FAERS: 2 | US FAERS | |
| 377 | Post procedural complication | FAERS: 2 | US FAERS | |
| 378 | Product counterfeit | FAERS: 2 | US FAERS | |
| 379 | Product dose omission | FAERS: 2 | US FAERS | |
| 380 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 381 | Product use issue | FAERS: 2 | US FAERS | |
| 382 | Prostatectomy | FAERS: 2 | US FAERS | |
| 383 | Rash erythematous | FAERS: 2 | US FAERS | |
| 384 | Renal Colic | FAERS: 2 | OFFSIDES US FAERS | |
| 385 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 386 | Respiratory distress | FAERS: 2 | US FAERS | |
| 387 | Retching | FAERS: 2 | US FAERS | |
| 388 | Retinopathy congenital | FAERS: 2 | US FAERS | |
| 389 | Sciatica | FAERS: 2 | US FAERS | |
| 390 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 391 | Sluggishness | FAERS: 2 | US FAERS | |
| 392 | Sudden death | FAERS: 2 | US FAERS | |
| 393 | Suicide attempt | FAERS: 2 | US FAERS | |
| 394 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 395 | Thrombosis in device | FAERS: 2 | US FAERS | |
| 396 | Tobacco user | FAERS: 2 | US FAERS | |
| 397 | Tuberculosis | FAERS: 2 | US FAERS | |
| 398 | Uveitis | FAERS: 2 | US FAERS | |
| 399 | Vasculitis | FAERS: 2 | US FAERS | |
| 400 | Visual disturbance | FAERS: 2 | US FAERS | |
| 401 | Vitreous Detachment | FAERS: 2 | OFFSIDES US FAERS | |
| 402 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 403 | Abdominal tenderness | FAERS: 1 | OFFSIDES US FAERS | |
| 404 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 405 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 406 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 407 | Agranulocytosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 408 | Alcohol Intolerance | FAERS: 1 | US FAERS | |
| 409 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 410 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 411 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 412 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 413 | Anger | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 414 | Angioplasty | FAERS: 1 | US FAERS | |
| 415 | Anosmia | FAERS: 1 | US FAERS | |
| 416 | Anti-transglutaminase antibody | FAERS: 1 | US FAERS | |
| 417 | Anti-transglutaminase antibody increased | FAERS: 1 | US FAERS | |
| 418 | Anticoagulant therapy | FAERS: 1 | US FAERS | |
| 419 | Antisynthetase syndrome | FAERS: 1 | US FAERS | |
| 420 | Aphasia | FAERS: 1 | US FAERS | |
| 421 | Apoptosis | FAERS: 1 | US FAERS | |
| 422 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 423 | Beta 2 microglobulin increased | FAERS: 1 | US FAERS | |
| 424 | Biopsy small intestine abnormal | FAERS: 1 | US FAERS | |
| 425 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 426 | Bipolar I disorder | FAERS: 1 | US FAERS | |
| 427 | Bladder Diverticulum | FAERS: 1 | US FAERS | |
| 428 | Bladder cancer recurrent | FAERS: 1 | US FAERS | |
| 429 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 430 | Bladder pain | FAERS: 1 | US FAERS | |
| 431 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 432 | Blood blister | FAERS: 1 | US FAERS | |
| 433 | Blood chloride decreased | FAERS: 1 | US FAERS | |
| 434 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 435 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 436 | Blood glucose decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 437 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 438 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 439 | Blood sodium abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 440 | Body mass index | FAERS: 1 | US FAERS | |
| 441 | Bone fragmentation | FAERS: 1 | US FAERS | |
| 442 | Bronchoalveolar Lavage | FAERS: 1 | US FAERS | |
| 443 | Caffeine consumption | FAERS: 1 | US FAERS | |
| 444 | Cardiac Death | FAERS: 1 | US FAERS | |
| 445 | Cardiac ablation | FAERS: 1 | US FAERS | |
| 446 | Catheter placement | FAERS: 1 | US FAERS | |
| 447 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 448 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 449 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 450 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 451 | Cholelithiasis obstructive | FAERS: 1 | US FAERS | |
| 452 | Cholestasis | FAERS: 1 | US FAERS | |
| 453 | Cholestatic pruritus | FAERS: 1 | US FAERS | |
| 454 | Completed Suicide | FAERS: 1 | US FAERS | |
| 455 | Congenital pulmonary hypertension | FAERS: 1 | US FAERS | |
| 456 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 457 | Congenital urinary tract obstruction | FAERS: 1 | US FAERS | |
| 458 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 459 | Coronary angioplasty | FAERS: 1 | OFFSIDES US FAERS | |
| 460 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 461 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 462 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 463 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 464 | Dementia | FAERS: 1 | US FAERS | |
| 465 | Dengue Fever | FAERS: 1 | US FAERS | |
| 466 | Dental caries | FAERS: 1 | US FAERS | |
| 467 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 468 | Depressed mood | FAERS: 1 | OFFSIDES US FAERS | |
| 469 | Device dislocation | FAERS: 1 | US FAERS | |
| 470 | Device related infection | FAERS: 1 | US FAERS | |
| 471 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 472 | Diaphragmalgia | FAERS: 1 | US FAERS | |
| 473 | Disability | FAERS: 1 | US FAERS | |
| 474 | Disease recurrence | FAERS: 1 | OFFSIDES US FAERS | |
| 475 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 476 | Drug abuser | FAERS: 1 | US FAERS | |
| 477 | Drug abuse | FAERS: 1 | US FAERS | |
| 478 | Drug diversion | FAERS: 1 | US FAERS | |
| 479 | Drug level increased | FAERS: 1 | US FAERS | |
| 480 | Drug resistance | FAERS: 1 | US FAERS | |
| 481 | Ear congestion | FAERS: 1 | US FAERS | |
| 482 | Eating disorder symptom | FAERS: 1 | US FAERS | |
| 483 | Eczema | FAERS: 1 | US FAERS | |
| 484 | Elbow operation | FAERS: 1 | US FAERS | |
| 485 | Embolic stroke | FAERS: 1 | US FAERS | |
| 486 | Encephalomalacia | FAERS: 1 | US FAERS | |
| 487 | Endoscopy abnormal | FAERS: 1 | US FAERS | |
| 488 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 489 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 490 | Epiploic appendagitis | FAERS: 1 | US FAERS | |
| 491 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 492 | Essential Tremor | FAERS: 1 | US FAERS | |
| 493 | Exaggerated startle response | FAERS: 1 | US FAERS | |
| 494 | Expired drug administered | FAERS: 1 | US FAERS | |
| 495 | Expired product administered | FAERS: 1 | US FAERS | |
| 496 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 497 | Extra dose administered | FAERS: 1 | US FAERS | |
| 498 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 499 | Food Poisoning | FAERS: 1 | US FAERS | |
| 500 | Food craving | FAERS: 1 | US FAERS | |
| 501 | Gastrectomy | FAERS: 1 | US FAERS | |
| 502 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 503 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 504 | Gastric infection | FAERS: 1 | US FAERS | |
| 505 | Gastric mucosa erythema | FAERS: 1 | US FAERS | |
| 506 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 507 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 508 | Gastrointestinal melanosis | FAERS: 1 | US FAERS | |
| 509 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 510 | Gastrostomy | FAERS: 1 | US FAERS | |
| 511 | Genital rash | FAERS: 1 | US FAERS | |
| 512 | Gingivitis | FAERS: 1 | US FAERS | |
| 513 | Glaucoma | FAERS: 1 | US FAERS | |
| 514 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 515 | Hemiparesis | FAERS: 1 | US FAERS | |
| 516 | Hemiplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 517 | Hepatic necrosis | FAERS: 1 | US FAERS | |
| 518 | Hepatitis B | FAERS: 1 | US FAERS | |
| 519 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 520 | Hypertensive Encephalopathy | FAERS: 1 | US FAERS | |
| 521 | Hypospadias | FAERS: 1 | US FAERS | |
| 522 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 523 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 524 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 525 | Incontinence | FAERS: 1 | OFFSIDES US FAERS | |
| 526 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 527 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 528 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 529 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 530 | Intestinal angioedema | FAERS: 1 | US FAERS | |
| 531 | Intestinal intraepithelial lymphocytes increased | FAERS: 1 | US FAERS | |
| 532 | Intestinal stoma complication | FAERS: 1 | US FAERS | |
| 533 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 534 | Joint injury | FAERS: 1 | OFFSIDES US FAERS | |
| 535 | Joint prosthesis user | FAERS: 1 | US FAERS | |
| 536 | Joint sprain | FAERS: 1 | US FAERS | |
| 537 | Joint stiffness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 538 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 539 | Labyrinthitis | FAERS: 1 | US FAERS | |
| 540 | Laceration | FAERS: 1 | US FAERS | |
| 541 | Laryngospasm | FAERS: 1 | US FAERS | |
| 542 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 543 | Limb injury | FAERS: 1 | OFFSIDES US FAERS | |
| 544 | Lip pruritus | FAERS: 1 | US FAERS | |
| 545 | Lithotripsy | FAERS: 1 | US FAERS | |
| 546 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 547 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 548 | Lymphangiosis carcinomatosa | FAERS: 1 | US FAERS | |
| 549 | Lymphocyte stimulation test positive | FAERS: 1 | US FAERS | |
| 550 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 551 | Medical device complication | FAERS: 1 | US FAERS | |
| 552 | Medication residue present | FAERS: 1 | US FAERS | |
| 553 | Mental impairment | FAERS: 1 | US FAERS | |
| 554 | Mental status changes | FAERS: 1 | US FAERS | |
| 555 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 556 | Miscarriage of partner | FAERS: 1 | US FAERS | |
| 557 | Monoplegia | FAERS: 1 | OFFSIDES US FAERS | |
| 558 | Mouth swelling | FAERS: 1 | US FAERS | |
| 559 | Mucosal atrophy | FAERS: 1 | US FAERS | |
| 560 | Multiple Myeloma | FAERS: 1 | OFFSIDES US FAERS | |
| 561 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 562 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 563 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 564 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 565 | Narcolepsy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 566 | Neonatal pneumonia | FAERS: 1 | US FAERS | |
| 567 | Nephritis | FAERS: 1 | US FAERS | |
| 568 | Nephrogenic Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 569 | Nerve injury | FAERS: 1 | US FAERS | |
| 570 | Neuralgia | FAERS: 1 | OFFSIDES US FAERS | |
| 571 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 572 | Obesity surgery | FAERS: 1 | US FAERS | |
| 573 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 574 | Oliguria | FAERS: 1 | US FAERS | |
| 575 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 576 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 577 | Oral pain | FAERS: 1 | US FAERS | |
| 578 | Oral pruritus | FAERS: 1 | US FAERS | |
| 579 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 580 | Orthostatic intolerance | FAERS: 1 | US FAERS | |
| 581 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 582 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 583 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 584 | Paranoia | FAERS: 1 | US FAERS | |
| 585 | Parenteral Nutrition | FAERS: 1 | US FAERS | |
| 586 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 587 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 588 | Peptic ulcer helicobacter | FAERS: 1 | US FAERS | |
| 589 | Pericarditis | FAERS: 1 | US FAERS | |
| 590 | Personality Change | FAERS: 1 | OFFSIDES US FAERS | |
| 591 | Plasminogen activator inhibitor increased | FAERS: 1 | US FAERS | |
| 592 | Pleurisy | FAERS: 1 | US FAERS | |
| 593 | Polyuria | FAERS: 1 | US FAERS | |
| 594 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 595 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 596 | Porphyria non-acute | FAERS: 1 | US FAERS | |
| 597 | Post-Traumatic Headache | FAERS: 1 | US FAERS | |
| 598 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 599 | Postoperative ileus | FAERS: 1 | US FAERS | |
| 600 | Prerenal failure | FAERS: 1 | US FAERS | |
| 601 | Procedural complication | FAERS: 1 | US FAERS | |
| 602 | Product availability issue | FAERS: 1 | US FAERS | |
| 603 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 604 | Product prescribing error | FAERS: 1 | US FAERS | |
| 605 | Product size issue | FAERS: 1 | US FAERS | |
| 606 | Product tampering | FAERS: 1 | US FAERS | |
| 607 | Protein C Deficiency | FAERS: 1 | US FAERS | |
| 608 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 609 | Protein urine present | FAERS: 1 | US FAERS | |
| 610 | Protein-losing gastroenteropathy | FAERS: 1 | US FAERS | |
| 611 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 612 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 613 | Purpura | FAERS: 1 | US FAERS | |
| 614 | Purulent discharge | FAERS: 1 | US FAERS | |
| 615 | Quality of life decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 616 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 617 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 618 | Rebound effect | FAERS: 1 | US FAERS | |
| 619 | Rebound hypertension | FAERS: 1 | US FAERS | |
| 620 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 621 | Rectal discharge | FAERS: 1 | US FAERS | |
| 622 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 623 | Renal Replacement Therapy | FAERS: 1 | US FAERS | |
| 624 | Renal abscess | FAERS: 1 | US FAERS | |
| 625 | Renal pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 626 | Renin increased | FAERS: 1 | US FAERS | |
| 627 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 628 | Schizoaffective Disorder | FAERS: 1 | US FAERS | |
| 629 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 630 | Shock | FAERS: 1 | US FAERS | |
| 631 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 632 | Skin irritation | FAERS: 1 | US FAERS | |
| 633 | Skin lesion | FAERS: 1 | US FAERS | |
| 634 | Smoker | FAERS: 1 | US FAERS | |
| 635 | Sneezing | FAERS: 1 | US FAERS | |
| 636 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 637 | Spigelian hernia | FAERS: 1 | US FAERS | |
| 638 | Splenomegaly | FAERS: 1 | US FAERS | |
| 639 | Starvation | FAERS: 1 | US FAERS | |
| 640 | Stillbirth | FAERS: 1 | US FAERS | |
| 641 | Stomatitis | FAERS: 1 | US FAERS | |
| 642 | Stridor | FAERS: 1 | US FAERS | |
| 643 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 644 | Synovial Cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 645 | Synovitis | FAERS: 1 | US FAERS | |
| 646 | Tension Headache | FAERS: 1 | US FAERS | |
| 647 | Tension | FAERS: 1 | US FAERS | |
| 648 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 649 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 650 | Therapy change | FAERS: 1 | US FAERS | |
| 651 | Thirst | FAERS: 1 | US FAERS | |
| 652 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 653 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 654 | Tonsillitis | FAERS: 1 | US FAERS | |
| 655 | Tooth Extraction | FAERS: 1 | OFFSIDES US FAERS | |
| 656 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 657 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 658 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 659 | Urine output increased | FAERS: 1 | US FAERS | |
| 660 | Vascular purpura | FAERS: 1 | US FAERS | |
| 661 | Vein collapse | FAERS: 1 | US FAERS | |
| 662 | Venous Injury | FAERS: 1 | US FAERS | |
| 663 | Venous occlusion | FAERS: 1 | US FAERS | |
| 664 | Victim of child abuse | FAERS: 1 | US FAERS | |
| 665 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 666 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 667 | Wheelchair user | FAERS: 1 | US FAERS | |
| 668 | Wheezing | FAERS: 1 | US FAERS | |
| 669 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 670 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 671 | Yawning | FAERS: 1 | US FAERS | |
| 672 | kyphosis | FAERS: 1 | US FAERS | |
| 673 | nervous system disorder | FAERS: 1 | US FAERS | |
| 674 | prostatitis | FAERS: 1 | US FAERS | |
| 675 | Acid reflux | OFFSIDES | ||
| 676 | Acute respiratory failure | OFFSIDES | ||
| 677 | Adenocarcinoma | OFFSIDES | ||
| 678 | Agitation | Canada Vigilance: 1 | Canada Vigilance | |
| 679 | Agraphia | OFFSIDES | ||
| 680 | Amphetamines | OFFSIDES | ||
| 681 | Anhedonia | OFFSIDES | ||
| 682 | Ankle Fracture | OFFSIDES | ||
| 683 | Apnea | OFFSIDES | ||
| 684 | Application site pain | OFFSIDES | ||
| 685 | Application site pruritus | OFFSIDES | ||
| 686 | Application site reaction | OFFSIDES | ||
| 687 | Application site scar | OFFSIDES | ||
| 688 | Application site urticaria | OFFSIDES | ||
| 689 | Atrial tachycardia | OFFSIDES | ||
| 690 | Basal cell carcinoma | OFFSIDES | ||
| 691 | Blood Glucose | OFFSIDES | ||
| 692 | Blood albumin decreased | OFFSIDES | ||
| 693 | Bone lesion | OFFSIDES | ||
| 694 | Bone pain | OFFSIDES | ||
| 695 | Brain stem syndrome | OFFSIDES | ||
| 696 | Breast tenderness | OFFSIDES | ||
| 697 | Bronchiectasis | OFFSIDES | ||
| 698 | Bursitis | Canada Vigilance: 1 | Canada Vigilance | |
| 699 | Cardioactive drug level | OFFSIDES | ||
| 700 | Central nervous system lesion | OFFSIDES | ||
| 701 | Choking sensation | OFFSIDES | ||
| 702 | Cholangiolitis | OFFSIDES | ||
| 703 | Concomitant disease aggravated | Canada Vigilance: 1 | Canada Vigilance | |
| 704 | Debridement | OFFSIDES | ||
| 705 | Demyelination | OFFSIDES | ||
| 706 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 707 | Drug withdrawal headache | OFFSIDES | ||
| 708 | Edema | 30594690 | CTD | |
| 709 | Elevated pacing threshold | OFFSIDES | ||
| 710 | Endodontic procedure | OFFSIDES | ||
| 711 | Enterobacter pneumonia | OFFSIDES | ||
| 712 | Eosinophilic myocarditis | OFFSIDES | ||
| 713 | Fatty Liver | 18501344 | CTD | |
| 714 | Formication | OFFSIDES | ||
| 715 | Gambling | OFFSIDES | ||
| 716 | Gastrointestinal Diseases | 20528002 | CTD | |
| 717 | Gastrointestinal amyloidosis | OFFSIDES | ||
| 718 | General physical condition | OFFSIDES | ||
| 719 | Glomerulonephritis | 17891346 | CTD | |
| 720 | Granuloma | OFFSIDES | ||
| 721 | Heart Diseases | 15467259 | CTD | |
| 722 | Hemorrhage | 30594690 | CTD | |
| 723 | Hepatic congestion | OFFSIDES | ||
| 724 | Hyperpigmentation | OFFSIDES | ||
| 725 | Hypertension, Renovascular | 14763026 | CTD | |
| 726 | Hyperventilation | Canada Vigilance: 1 | Canada Vigilance | |
| 727 | Implantable defibrillator insertion | OFFSIDES | ||
| 728 | Infusion site mobility decreased | OFFSIDES | ||
| 729 | Injection site infection | OFFSIDES | ||
| 730 | Injection site irritation | OFFSIDES | ||
| 731 | Insulin Resistance | 18501344 | CTD | |
| 732 | Intervertebral disc disorder | OFFSIDES | ||
| 733 | Joint Range of Motion Decreased | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 734 | Kidney Diseases | 15467259 | CTD | |
| 735 | Kidney Failure, Chronic | 15018153 | CTD | |
| 736 | Kidney Failure | OFFSIDES | ||
| 737 | Lichen Planus | OFFSIDES | ||
| 738 | Liver Cirrhosis | 18501344 | CTD | |
| 739 | Loose tooth | OFFSIDES | ||
| 740 | Metastatic Neoplasm | OFFSIDES | ||
| 741 | Metatarsalgia | OFFSIDES | ||
| 742 | Micrographic skin surgery | OFFSIDES | ||
| 743 | Mouth cyst | Canada Vigilance: 1 | Canada Vigilance | |
| 744 | Multiple Sclerosis | Canada Vigilance: 1 | Canada Vigilance | |
| 745 | Muscle Weakness | OFFSIDES | ||
| 746 | Muscle tightness | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 747 | Myopia | OFFSIDES | ||
| 748 | Nasal Flaring | OFFSIDES | ||
| 749 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 750 | Night sweats | Canada Vigilance: 1 | Canada Vigilance | |
| 751 | Ocular icterus | OFFSIDES | ||
| 752 | Ocular vascular disorder | OFFSIDES | ||
| 753 | Oral mucosal erythema | OFFSIDES | ||
| 754 | Oral mucosal petechiae | OFFSIDES | ||
| 755 | Oral polypectomy | OFFSIDES | ||
| 756 | Oropharyngeal blistering | OFFSIDES | ||
| 757 | Osteolysis | OFFSIDES | ||
| 758 | Osteomyelitis | OFFSIDES | ||
| 759 | PO2 decreased | OFFSIDES | ||
| 760 | Periodontitis | OFFSIDES | ||
| 761 | Photophobia | Canada Vigilance: 1 | Canada Vigilance | |
| 762 | Physical disability | OFFSIDES | ||
| 763 | Post procedural fistula | OFFSIDES | ||
| 764 | Post procedural infection | OFFSIDES | ||
| 765 | Post procedural stroke | OFFSIDES | ||
| 766 | Primary sequestrum | OFFSIDES | ||
| 767 | Procedural hypertension | OFFSIDES | ||
| 768 | Protein total decreased | OFFSIDES | ||
| 769 | Protein total increased | OFFSIDES | ||
| 770 | Pulmonary Fibrosis | 26781185 | CTD | |
| 771 | Pulmonary congestion | OFFSIDES | ||
| 772 | Recall phenomenon | OFFSIDES | ||
| 773 | Retinoic acid syndrome | OFFSIDES | ||
| 774 | Septic phlebitis | OFFSIDES | ||
| 775 | Skin Induration | OFFSIDES | ||
| 776 | Skin hypertrophy | OFFSIDES | ||
| 777 | Skin laceration | OFFSIDES | ||
| 778 | Skin necrosis | OFFSIDES | ||
| 779 | Skin tightness | OFFSIDES | ||
| 780 | Spondylolisthesis | OFFSIDES | ||
| 781 | Sputum retention | OFFSIDES | ||
| 782 | Superficial Thrombophlebitis | OFFSIDES | ||
| 783 | Tarsal Tunnel Syndrome | OFFSIDES | ||
| 784 | Thyroid gland scan abnormal | OFFSIDES | ||
| 785 | Trismus | Canada Vigilance: 1 | Canada Vigilance | |
| 786 | Urea urine increased | OFFSIDES | ||
| 787 | Vascular Diseases | 15467259 | CTD | |
| 788 | Weight Gain | OFFSIDES | ||
| 789 | Wound infection staphylococcal | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.