Cinacalcet
(QANQWUQOEJZMLL-PKLMIRHRSA-N)
Structure
- SMILES
- C[C@H](c1cccc2c1cccc2)NCCCc1cccc(c1)C(F)(F)F.Cl
- Molecular Formula:
- C22H23ClF3N
- Molecular Weight:
- 393.873
- Log P:
- 7.3349
- Hydrogen Bond Acceptor:
- 1
- Hydrogen Bond Donor:
- 2
- TPSA:
- 12.03
- CAS Number(s):
- 364782-34-3; 1217809-88-5
Synonym(s)
1.
Cinacalcet
2.
AMG 073
3.
AMG073
4.
Alpha-methyl-N-(3-(3-(trifluoromethyl)phenyl)propyl)-1-naphthalenemethanamine, (alphaR)-hydrochloride
5.
Cinacalcet Hydrochloride
6.
KRN 1493
7.
Sensipar
External Link(s)
| MeSH | D000069449 |
| PubChem Compound | 57504192 156418 |
| ChEBI | 48391 |
| CHEMBL | CHEMBL1200776 |
| KEGG | dr:D03505 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug dose omission | FAERS: 8673 | US FAERS | |
| 2 | Intentional product misuse | FAERS: 2067 | US FAERS | |
| 3 | Nausea | FAERS: 1784 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 4 | Malaise | FAERS: 1415 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 5 | Vomiting | FAERS: 1196 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 6 | Abdominal discomfort | FAERS: 669 | US FAERS | |
| 7 | Unevaluable event | FAERS: 471 | US FAERS | |
| 8 | Adverse event | FAERS: 424 | US FAERS | |
| 9 | Blood parathyroid hormone increased | FAERS: 377 | US FAERS | |
| 10 | Hypotension | FAERS: 367 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Dizziness | FAERS: 362 | US FAERS | |
| 12 | Hypophagia | FAERS: 297 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Drug ineffective | FAERS: 289 | US FAERS | |
| 14 | Fatigue | FAERS: 282 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Blood parathyroid hormone abnormal | FAERS: 274 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 16 | Hospice Care | FAERS: 265 | US FAERS | |
| 17 | Pruritus | FAERS: 250 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Headache | FAERS: 236 | US FAERS | |
| 19 | Constipation | FAERS: 225 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Pneumonia | FAERS: 220 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 21 | Living in residential institution | FAERS: 212 | US FAERS | |
| 22 | Rehabilitation therapy | FAERS: 200 | US FAERS | |
| 23 | Nasopharyngitis | FAERS: 183 | US FAERS | |
| 24 | Cerebrovascular accident | FAERS: 173 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Wrong technique in product usage process | FAERS: 165 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Blood parathyroid hormone decreased | FAERS: 151 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Pain | FAERS: 150 | US FAERS | |
| 28 | Transplant | FAERS: 143 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Asthenia | FAERS: 141 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 30 | Myocardial Infarction | FAERS: 120 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 31 | Myalgia | FAERS: 119 | US FAERS | |
| 32 | Feeling abnormal | FAERS: 107 | US FAERS | |
| 33 | Blood calcium abnormal | FAERS: 105 | US FAERS | |
| 34 | Weight decreased | FAERS: 103 | US FAERS | |
| 35 | Blood phosphorus increased | FAERS: 99 | US FAERS | |
| 36 | Chest Pain | FAERS: 94 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Inappropriate schedule of drug administration | FAERS: 87 | US FAERS | |
| 38 | Infection | FAERS: 83 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 39 | Arthralgia | FAERS: 80 | US FAERS | |
| 40 | Dyspepsia | FAERS: 77 | US FAERS | |
| 41 | Hypersensitivity | FAERS: 77 | US FAERS | |
| 42 | Drug effect incomplete | FAERS: 76 | US FAERS | |
| 43 | Bone pain | FAERS: 72 | US FAERS | |
| 44 | Somnolence | FAERS: 71 | US FAERS | |
| 45 | Parathyroidectomy | FAERS: 67 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 46 | Back Pain | FAERS: 66 | US FAERS | |
| 47 | Mastication disorder | FAERS: 63 | US FAERS | |
| 48 | Tremor | FAERS: 63 | US FAERS | |
| 49 | Alopecia | FAERS: 61 | US FAERS | |
| 50 | Abdominal Pain | FAERS: 54 | US FAERS | |
| 51 | Incorrect dose administered | FAERS: 53 | US FAERS | |
| 52 | Cardiac Arrest | FAERS: 48 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 53 | Unevaluable investigation | FAERS: 48 | US FAERS | |
| 54 | Gastrostomy | FAERS: 46 | US FAERS | |
| 55 | Wrong technique in drug usage process | FAERS: 45 | US FAERS | |
| 56 | Sepsis | FAERS: 44 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 57 | Peripheral swelling | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Thrombosis | FAERS: 43 | US FAERS | |
| 59 | Influenza | FAERS: 42 | US FAERS | |
| 60 | Memory impairment | FAERS: 41 | US FAERS | |
| 61 | Peritonitis | FAERS: 41 | US FAERS | |
| 62 | Arteriovenous fistula site complication | FAERS: 39 | US FAERS | |
| 63 | Palpitations | FAERS: 38 | US FAERS | |
| 64 | Calciphylaxis | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Dehydration | FAERS: 34 | US FAERS | |
| 66 | Pancreatitis | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Anxiety | FAERS: 32 | US FAERS | |
| 68 | Enteral Nutrition | FAERS: 32 | US FAERS | |
| 69 | Flatulence | FAERS: 32 | US FAERS | |
| 70 | Medication Error | FAERS: 31 | US FAERS | |
| 71 | Swelling | FAERS: 31 | US FAERS | |
| 72 | Diabetes Mellitus | FAERS: 30 | US FAERS | |
| 73 | Urticaria | FAERS: 30 | US FAERS | |
| 74 | Acute myocardial infarction | FAERS: 29 | US FAERS | |
| 75 | Blood phosphorus abnormal | FAERS: 29 | US FAERS | |
| 76 | Blood potassium increased | FAERS: 29 | US FAERS | |
| 77 | Bronchitis | FAERS: 28 | US FAERS | |
| 78 | Urinary tract infection | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Atrial Fibrillation | FAERS: 27 | US FAERS | |
| 80 | Angina Pectoris | FAERS: 26 | US FAERS | |
| 81 | Visual Impairment | FAERS: 26 | US FAERS | |
| 82 | Dementia | FAERS: 25 | US FAERS | |
| 83 | Lethargy | FAERS: 25 | US FAERS | |
| 84 | Blindness | FAERS: 24 | US FAERS | |
| 85 | Dysgeusia | FAERS: 24 | US FAERS | |
| 86 | Respiratory Failure | FAERS: 24 | US FAERS | |
| 87 | Blood phosphorus decreased | FAERS: 23 | US FAERS | |
| 88 | Nephrolithiasis | FAERS: 23 | US FAERS | |
| 89 | Oropharyngeal pain | FAERS: 23 | US FAERS | |
| 90 | Therapy cessation | FAERS: 23 | US FAERS | |
| 91 | Blood glucose decreased | FAERS: 22 | US FAERS | |
| 92 | Fluid overload | FAERS: 22 | US FAERS | |
| 93 | Therapeutic procedure | FAERS: 22 | US FAERS | |
| 94 | Amnesia | FAERS: 21 | US FAERS | |
| 95 | Syncope | FAERS: 21 | US FAERS | |
| 96 | Therapy non-responder | FAERS: 21 | US FAERS | |
| 97 | Burning sensation | FAERS: 20 | US FAERS | |
| 98 | Musculoskeletal Pain | FAERS: 20 | US FAERS | |
| 99 | Skin Ulcer | FAERS: 20 | US FAERS | |
| 100 | Abasia | FAERS: 19 | US FAERS | |
| 101 | General physical health deterioration | FAERS: 19 | US FAERS | |
| 102 | Gout | FAERS: 19 | US FAERS | |
| 103 | Neck Pain | FAERS: 19 | US FAERS | |
| 104 | Arthritis | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Discomfort | FAERS: 18 | US FAERS | |
| 106 | Protein total decreased | FAERS: 18 | US FAERS | |
| 107 | Adjusted calcium decreased | FAERS: 17 | US FAERS | |
| 108 | Fracture | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 109 | Vertigo | FAERS: 17 | US FAERS | |
| 110 | Hyperparathyroidism | FAERS: 16 | US FAERS | |
| 111 | Inflammation | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Nervousness | FAERS: 16 | US FAERS | |
| 113 | Throat irritation | FAERS: 16 | US FAERS | |
| 114 | Asthma | FAERS: 15 | US FAERS | |
| 115 | Chest discomfort | FAERS: 15 | US FAERS | |
| 116 | Chills | FAERS: 15 | US FAERS | |
| 117 | Circumstance or information capable of leading to medication error | FAERS: 15 | US FAERS | |
| 118 | Gastritis | FAERS: 15 | US FAERS | |
| 119 | Limb operation | FAERS: 15 | US FAERS | |
| 120 | Tachycardia | FAERS: 15 | US FAERS | |
| 121 | Ulcer | FAERS: 14 | US FAERS | |
| 122 | Blood glucose increased | FAERS: 13 | US FAERS | |
| 123 | Device related infection | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Dysphonia | FAERS: 13 | US FAERS | |
| 125 | Gastric ulcer | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 126 | Joint swelling | FAERS: 13 | US FAERS | |
| 127 | Peritoneal Dialysis | FAERS: 13 | US FAERS | |
| 128 | Product use complaint | FAERS: 13 | US FAERS | |
| 129 | Arthropathy | FAERS: 12 | US FAERS | |
| 130 | Cataract | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 131 | Drug administration error | FAERS: 12 | US FAERS | |
| 132 | Epistaxis | FAERS: 12 | US FAERS | |
| 133 | Limb discomfort | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 134 | Lip swelling | FAERS: 12 | US FAERS | |
| 135 | Shunt occlusion | FAERS: 12 | US FAERS | |
| 136 | Thyroidectomy | FAERS: 12 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 137 | Blood albumin decreased | FAERS: 11 | US FAERS | |
| 138 | Deafness | FAERS: 11 | US FAERS | |
| 139 | Disorientation | FAERS: 11 | US FAERS | |
| 140 | Incorrect route of drug administration | FAERS: 11 | US FAERS | |
| 141 | Pulmonary Embolism | FAERS: 11 | US FAERS | |
| 142 | Respiratory distress | FAERS: 11 | US FAERS | |
| 143 | Retching | FAERS: 11 | US FAERS | |
| 144 | Back disorder | FAERS: 10 | US FAERS | |
| 145 | Dysuria | FAERS: 10 | US FAERS | |
| 146 | Hernia | FAERS: 10 | US FAERS | |
| 147 | Musculoskeletal stiffness | FAERS: 10 | US FAERS | |
| 148 | Abscess | FAERS: 9 | US FAERS | |
| 149 | Ageusia | FAERS: 9 | US FAERS | |
| 150 | Blood creatinine increased | FAERS: 9 | US FAERS | |
| 151 | Blood pressure fluctuation | FAERS: 9 | US FAERS | |
| 152 | Blood urine present | FAERS: 9 | US FAERS | |
| 153 | Cellulitis | FAERS: 9 | US FAERS | |
| 154 | Cholelithiasis | FAERS: 9 | US FAERS | |
| 155 | Fistula repair | FAERS: 9 | US FAERS | |
| 156 | Medical procedure | FAERS: 9 | US FAERS | |
| 157 | Mental impairment | FAERS: 9 | US FAERS | |
| 158 | Mental status changes | FAERS: 9 | US FAERS | |
| 159 | Product physical consistency issue | FAERS: 9 | US FAERS | |
| 160 | Restless Legs Syndrome | FAERS: 9 | US FAERS | |
| 161 | Blood glucose abnormal | FAERS: 8 | US FAERS | |
| 162 | Dry skin | FAERS: 8 | US FAERS | |
| 163 | Eructation | FAERS: 8 | US FAERS | |
| 164 | Erythema | FAERS: 8 | US FAERS | |
| 165 | Feeding tube user | FAERS: 8 | US FAERS | |
| 166 | Feeling jittery | FAERS: 8 | US FAERS | |
| 167 | Gamma-Glutamyltransferase Increased | FAERS: 8 | US FAERS | |
| 168 | Impaired gastric emptying | FAERS: 8 | US FAERS | |
| 169 | Infarction | FAERS: 8 | US FAERS | |
| 170 | Intestinal Obstruction | FAERS: 8 | US FAERS | |
| 171 | Limb injury | FAERS: 8 | US FAERS | |
| 172 | Osteomyelitis | FAERS: 8 | US FAERS | |
| 173 | Osteoporosis | FAERS: 8 | US FAERS | |
| 174 | Restlessness | FAERS: 8 | US FAERS | |
| 175 | Stress | FAERS: 8 | US FAERS | |
| 176 | Tetany | FAERS: 8 | US FAERS | |
| 177 | Thrombocytopenia | FAERS: 8 | US FAERS | |
| 178 | intensive care | FAERS: 8 | US FAERS | |
| 179 | nervous system disorder | FAERS: 8 | US FAERS | |
| 180 | Ankle Fracture | FAERS: 7 | US FAERS | |
| 181 | Arteriovenous fistula occlusion | FAERS: 7 | US FAERS | |
| 182 | Blood alkaline phosphatase increased | FAERS: 7 | US FAERS | |
| 183 | Bradycardia | FAERS: 7 | US FAERS | |
| 184 | Diverticulitis | FAERS: 7 | US FAERS | |
| 185 | Epigastric discomfort | FAERS: 7 | US FAERS | |
| 186 | Facial paralysis | FAERS: 7 | US FAERS | |
| 187 | Gastroenteritis | FAERS: 7 | US FAERS | |
| 188 | Gastrointestinal Pain | FAERS: 7 | US FAERS | |
| 189 | Hypercalciuria | FAERS: 7 | US FAERS | |
| 190 | Hypersomnia | FAERS: 7 | US FAERS | |
| 191 | Lower respiratory tract infection | FAERS: 7 | US FAERS | |
| 192 | Nephrectomy | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | Post procedural complication | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 194 | Respiratory arrest | FAERS: 7 | US FAERS | |
| 195 | Shunt stenosis | FAERS: 7 | US FAERS | |
| 196 | Sinusitis | FAERS: 7 | US FAERS | |
| 197 | Thirst | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Tinnitus | FAERS: 7 | US FAERS | |
| 199 | Venous occlusion | FAERS: 7 | US FAERS | |
| 200 | Accidental overdose | FAERS: 6 | US FAERS | |
| 201 | Acne | FAERS: 6 | US FAERS | |
| 202 | Agitation | FAERS: 6 | US FAERS | |
| 203 | Aphonia | FAERS: 6 | US FAERS | |
| 204 | Ascites | FAERS: 6 | US FAERS | |
| 205 | Asphyxia | FAERS: 6 | US FAERS | |
| 206 | Colitis | FAERS: 6 | US FAERS | |
| 207 | Coronary Artery Disease | FAERS: 6 | US FAERS | |
| 208 | Disability | FAERS: 6 | US FAERS | |
| 209 | Erectile dysfunction | FAERS: 6 | US FAERS | |
| 210 | Formication | FAERS: 6 | US FAERS | |
| 211 | Gangrene | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | General physical condition abnormal | FAERS: 6 | US FAERS | |
| 213 | Hungry bone syndrome | FAERS: 6 | US FAERS | |
| 214 | Maternal exposure during pregnancy | FAERS: 6 | US FAERS | |
| 215 | Nodule | FAERS: 6 | US FAERS | |
| 216 | Pericardial effusion | FAERS: 6 | US FAERS | |
| 217 | Post procedural infection | FAERS: 6 | US FAERS | |
| 218 | Presyncope | FAERS: 6 | US FAERS | |
| 219 | Procedural hypotension | FAERS: 6 | US FAERS | |
| 220 | Product dose omission | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 221 | Respiratory tract congestion | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 222 | Sudden death | FAERS: 6 | US FAERS | |
| 223 | Therapeutic response unexpected | FAERS: 6 | US FAERS | |
| 224 | Amputation | FAERS: 5 | US FAERS | |
| 225 | Angioedema | FAERS: 5 | US FAERS | |
| 226 | Cerebral Infarction | FAERS: 5 | US FAERS | |
| 227 | Conjunctivitis | FAERS: 5 | US FAERS | |
| 228 | Cystitis | FAERS: 5 | US FAERS | |
| 229 | Dialysis related complication | FAERS: 5 | US FAERS | |
| 230 | Disease complication | FAERS: 5 | US FAERS | |
| 231 | Epilepsy | FAERS: 5 | US FAERS | |
| 232 | Full blood count decreased | FAERS: 5 | US FAERS | |
| 233 | Gait inability | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 234 | Gastric Bypass | FAERS: 5 | US FAERS | |
| 235 | Joint injury | FAERS: 5 | US FAERS | |
| 236 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 237 | Neuralgia | FAERS: 5 | US FAERS | |
| 238 | Overdose | FAERS: 5 | US FAERS | |
| 239 | Poor peripheral circulation | FAERS: 5 | US FAERS | |
| 240 | Productive Cough | FAERS: 5 | US FAERS | |
| 241 | Pulmonary Hypertension | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 242 | Scab | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 243 | Secretion discharge | FAERS: 5 | US FAERS | |
| 244 | Shunt infection | FAERS: 5 | US FAERS | |
| 245 | Skin irritation | FAERS: 5 | US FAERS | |
| 246 | Skin lesion | FAERS: 5 | US FAERS | |
| 247 | Sluggishness | FAERS: 5 | US FAERS | |
| 248 | Tooth Extraction | FAERS: 5 | US FAERS | |
| 249 | Toothache | FAERS: 5 | US FAERS | |
| 250 | Unresponsive to stimuli | FAERS: 5 | US FAERS | |
| 251 | treatment failure | FAERS: 5 | US FAERS | |
| 252 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 253 | Ammonia increased | FAERS: 4 | US FAERS | |
| 254 | Aphasia | FAERS: 4 | US FAERS | |
| 255 | Blood count abnormal | FAERS: 4 | US FAERS | |
| 256 | Blood iron decreased | FAERS: 4 | US FAERS | |
| 257 | Blood potassium abnormal | FAERS: 4 | US FAERS | |
| 258 | Bone density decreased | FAERS: 4 | US FAERS | |
| 259 | Bowel movement irregularity | FAERS: 4 | US FAERS | |
| 260 | Cardiac Flutter | FAERS: 4 | US FAERS | |
| 261 | Carpal Tunnel Syndrome | FAERS: 4 | US FAERS | |
| 262 | Catheter placement | FAERS: 4 | US FAERS | |
| 263 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 264 | Depressed mood | FAERS: 4 | US FAERS | |
| 265 | Dysarthria | FAERS: 4 | US FAERS | |
| 266 | Electrolyte imbalance | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 267 | Excoriation | FAERS: 4 | US FAERS | |
| 268 | Extra dose administered | FAERS: 4 | US FAERS | |
| 269 | Gastric infection | FAERS: 4 | US FAERS | |
| 270 | Head discomfort | FAERS: 4 | US FAERS | |
| 271 | Hip surgery | FAERS: 4 | US FAERS | |
| 272 | Implantable defibrillator insertion | FAERS: 4 | US FAERS | |
| 273 | Intermittent Claudication | FAERS: 4 | US FAERS | |
| 274 | Intracranial Aneurysm | FAERS: 4 | US FAERS | |
| 275 | Investigation abnormal | FAERS: 4 | US FAERS | |
| 276 | Laziness | FAERS: 4 | US FAERS | |
| 277 | Low turnover osteopathy | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 278 | Malnutrition | FAERS: 4 | US FAERS | |
| 279 | Night sweats | FAERS: 4 | US FAERS | |
| 280 | Non-cardiac chest pain | FAERS: 4 | US FAERS | |
| 281 | Oral pain | FAERS: 4 | US FAERS | |
| 282 | Papule | FAERS: 4 | US FAERS | |
| 283 | Protein total abnormal | FAERS: 4 | US FAERS | |
| 284 | Protein total increased | FAERS: 4 | US FAERS | |
| 285 | Rebound effect | FAERS: 4 | US FAERS | |
| 286 | Renal Colic | FAERS: 4 | US FAERS | |
| 287 | Renal cyst | FAERS: 4 | US FAERS | |
| 288 | Skin reaction | FAERS: 4 | US FAERS | |
| 289 | Status Epilepticus | FAERS: 4 | US FAERS | |
| 290 | Upper respiratory tract inflammation | FAERS: 4 | US FAERS | |
| 291 | White blood cell count decreased | FAERS: 4 | US FAERS | |
| 292 | furuncle | FAERS: 4 | US FAERS | |
| 293 | Abdominal cavity drainage | FAERS: 3 | US FAERS | |
| 294 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 295 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 296 | Anger | FAERS: 3 | US FAERS | |
| 297 | Anorexia | FAERS: 3 | US FAERS | |
| 298 | Apparent death | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 299 | Application site pain | FAERS: 3 | US FAERS | |
| 300 | Arteriosclerosis | FAERS: 3 | US FAERS | |
| 301 | Arteriovenous fistula site infection | FAERS: 3 | US FAERS | |
| 302 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 303 | Atypical pneumonia | FAERS: 3 | US FAERS | |
| 304 | Bedridden | FAERS: 3 | US FAERS | |
| 305 | Blood cholesterol increased | FAERS: 3 | US FAERS | |
| 306 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 307 | Blood thyroid stimulating hormone increased | FAERS: 3 | US FAERS | |
| 308 | Blood viscosity decreased | FAERS: 3 | US FAERS | |
| 309 | Calcinosis | FAERS: 3 | US FAERS | |
| 310 | Cerebral Thrombosis | FAERS: 3 | US FAERS | |
| 311 | Choking | FAERS: 3 | US FAERS | |
| 312 | Clostridium difficile infection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 313 | Cold sweat | FAERS: 3 | US FAERS | |
| 314 | Crying | FAERS: 3 | US FAERS | |
| 315 | Cyst | FAERS: 3 | US FAERS | |
| 316 | Delirium | FAERS: 3 | US FAERS | |
| 317 | Dental caries | FAERS: 3 | US FAERS | |
| 318 | Dermatitis | FAERS: 3 | US FAERS | |
| 319 | Device occlusion | FAERS: 3 | US FAERS | |
| 320 | Diplopia | FAERS: 3 | US FAERS | |
| 321 | Disease Progression | FAERS: 3 | US FAERS | |
| 322 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 323 | Eczema | FAERS: 3 | US FAERS | |
| 324 | Ejection Fraction Decreased | FAERS: 3 | US FAERS | |
| 325 | Eye Infection | FAERS: 3 | US FAERS | |
| 326 | Flushing | FAERS: 3 | US FAERS | |
| 327 | Gastrectomy | FAERS: 3 | US FAERS | |
| 328 | Gastrointestinal sounds abnormal | FAERS: 3 | US FAERS | |
| 329 | Hepatitis C | FAERS: 3 | US FAERS | |
| 330 | Hordeolum | FAERS: 3 | US FAERS | |
| 331 | Hormone level abnormal | FAERS: 3 | US FAERS | |
| 332 | Hunger | FAERS: 3 | US FAERS | |
| 333 | Impaired work ability | FAERS: 3 | US FAERS | |
| 334 | Incorrect product storage | FAERS: 3 | US FAERS | |
| 335 | Infected fistula | FAERS: 3 | US FAERS | |
| 336 | Infectious peritonitis | FAERS: 3 | US FAERS | |
| 337 | Initial insomnia | FAERS: 3 | US FAERS | |
| 338 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 339 | Intestinal Perforation | FAERS: 3 | US FAERS | |
| 340 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 341 | Laceration | FAERS: 3 | US FAERS | |
| 342 | Malignant neoplasm progression | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 343 | Mechanical ventilation | FAERS: 3 | US FAERS | |
| 344 | Medical device complication | FAERS: 3 | US FAERS | |
| 345 | Metabolic acidosis | FAERS: 3 | US FAERS | |
| 346 | Metastatic Neoplasm | FAERS: 3 | US FAERS | |
| 347 | Mood swings | FAERS: 3 | US FAERS | |
| 348 | Muscle strain | FAERS: 3 | US FAERS | |
| 349 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 350 | Musculoskeletal discomfort | FAERS: 3 | US FAERS | |
| 351 | Nephrocalcinosis | FAERS: 3 | US FAERS | |
| 352 | Nipple pain | FAERS: 3 | US FAERS | |
| 353 | Osteopenia | FAERS: 3 | US FAERS | |
| 354 | Peripheral arterial occlusive disease | FAERS: 3 | US FAERS | |
| 355 | Pneumothorax | FAERS: 3 | US FAERS | |
| 356 | Postoperative wound complication | FAERS: 3 | US FAERS | |
| 357 | Procedural complication | FAERS: 3 | US FAERS | |
| 358 | Sciatica | FAERS: 3 | US FAERS | |
| 359 | Sleep disorder due to general medical condition, insomnia type | FAERS: 3 | US FAERS | |
| 360 | Sneezing | FAERS: 3 | US FAERS | |
| 361 | Spinal column stenosis | FAERS: 3 | US FAERS | |
| 362 | Spondylitis | FAERS: 3 | US FAERS | |
| 363 | Stevens-Johnson Syndrome | FAERS: 3 | US FAERS | |
| 364 | Stomatitis | FAERS: 3 | US FAERS | |
| 365 | Therapy change | FAERS: 3 | US FAERS | |
| 366 | Thermal burn | FAERS: 3 | US FAERS | |
| 367 | Urine calcium increased | FAERS: 3 | US FAERS | |
| 368 | Vascular Access Complication | FAERS: 3 | US FAERS | |
| 369 | Wheelchair user | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 370 | Wheezing | FAERS: 3 | US FAERS | |
| 371 | Wound Infection | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 372 | effusion | FAERS: 3 | US FAERS | |
| 373 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 374 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 375 | Angioplasty | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 376 | Aphagia | FAERS: 2 | US FAERS | |
| 377 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 378 | Autonomic neuropathy | FAERS: 2 | US FAERS | |
| 379 | Bladder pain | FAERS: 2 | US FAERS | |
| 380 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 381 | Brain Contusion | FAERS: 2 | US FAERS | |
| 382 | Breast tenderness | FAERS: 2 | US FAERS | |
| 383 | Calcium phosphate product increased | FAERS: 2 | US FAERS | |
| 384 | Carditis | FAERS: 2 | US FAERS | |
| 385 | Catheter management | FAERS: 2 | US FAERS | |
| 386 | Catheter site infection | FAERS: 2 | US FAERS | |
| 387 | Central Nervous System Infection | FAERS: 2 | US FAERS | |
| 388 | Central nervous system lesion | FAERS: 2 | US FAERS | |
| 389 | Chemotherapy | FAERS: 2 | US FAERS | |
| 390 | Choking sensation | FAERS: 2 | US FAERS | |
| 391 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 392 | Cholecystitis | FAERS: 2 | US FAERS | |
| 393 | Chromaturia | FAERS: 2 | US FAERS | |
| 394 | Clostridium difficile colitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 395 | Colectomy | FAERS: 2 | US FAERS | |
| 396 | Cyanosis | FAERS: 2 | US FAERS | |
| 397 | Decreased immune responsiveness | FAERS: 2 | US FAERS | |
| 398 | Depressed Level of Consciousness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 399 | Device related sepsis | FAERS: 2 | US FAERS | |
| 400 | Dialysis device complication | FAERS: 2 | US FAERS | |
| 401 | Dialysis device insertion | FAERS: 2 | US FAERS | |
| 402 | Drug resistance | FAERS: 2 | US FAERS | |
| 403 | Ear discomfort | FAERS: 2 | US FAERS | |
| 404 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 405 | Embolism | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 406 | Enterocolitis | FAERS: 2 | US FAERS | |
| 407 | Eosinophilia | FAERS: 2 | US FAERS | |
| 408 | Exophthalmos | FAERS: 2 | US FAERS | |
| 409 | Eye irritation | FAERS: 2 | US FAERS | |
| 410 | Failure to Thrive | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 411 | Feeling Cold | FAERS: 2 | US FAERS | |
| 412 | Flank Pain | FAERS: 2 | US FAERS | |
| 413 | Fluid imbalance | FAERS: 2 | US FAERS | |
| 414 | Food Poisoning | FAERS: 2 | US FAERS | |
| 415 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 416 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 417 | Gluten sensitivity | FAERS: 2 | US FAERS | |
| 418 | Hepatic Infection | FAERS: 2 | US FAERS | |
| 419 | Hernia pain | FAERS: 2 | US FAERS | |
| 420 | High turnover osteopathy | FAERS: 2 | US FAERS | |
| 421 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 422 | Ileus | FAERS: 2 | US FAERS | |
| 423 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 424 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 425 | Incoherent | FAERS: 2 | US FAERS | |
| 426 | Incorrect route of product administration | FAERS: 2 | US FAERS | |
| 427 | Increased viscosity of bronchial secretion | FAERS: 2 | US FAERS | |
| 428 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 429 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 430 | Joint warmth | FAERS: 2 | US FAERS | |
| 431 | Ketoacidosis | FAERS: 2 | US FAERS | |
| 432 | Leukocytosis | FAERS: 2 | US FAERS | |
| 433 | Leukopenia | FAERS: 2 | US FAERS | |
| 434 | Ligament injury | FAERS: 2 | US FAERS | |
| 435 | Low birth weight baby | FAERS: 2 | US FAERS | |
| 436 | Macular degeneration | FAERS: 2 | US FAERS | |
| 437 | Macule | FAERS: 2 | US FAERS | |
| 438 | Medical observation | FAERS: 2 | US FAERS | |
| 439 | Medication residue present | FAERS: 2 | US FAERS | |
| 440 | Micturition frequency decreased | FAERS: 2 | US FAERS | |
| 441 | Monoparesis | FAERS: 2 | US FAERS | |
| 442 | Multimorbidity | FAERS: 2 | US FAERS | |
| 443 | Multiple allergies | FAERS: 2 | US FAERS | |
| 444 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 445 | Muscle tightness | FAERS: 2 | US FAERS | |
| 446 | Myoclonus | FAERS: 2 | US FAERS | |
| 447 | Pallor | FAERS: 2 | US FAERS | |
| 448 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 449 | Paranoia | FAERS: 2 | US FAERS | |
| 450 | Paraparesis | FAERS: 2 | US FAERS | |
| 451 | Peptic Ulcer | FAERS: 2 | US FAERS | |
| 452 | Periodontitis | FAERS: 2 | US FAERS | |
| 453 | Personality Change | FAERS: 2 | US FAERS | |
| 454 | Pharyngitis | FAERS: 2 | US FAERS | |
| 455 | Poisoning | FAERS: 2 | US FAERS | |
| 456 | Polydipsia | FAERS: 2 | US FAERS | |
| 457 | Polyuria | FAERS: 2 | US FAERS | |
| 458 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 459 | Portal venous gas | FAERS: 2 | US FAERS | |
| 460 | Pregnancy | FAERS: 2 | US FAERS | |
| 461 | Product prescribing issue | FAERS: 2 | US FAERS | |
| 462 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 463 | Purpura | FAERS: 2 | US FAERS | |
| 464 | Quadriparesis | FAERS: 2 | US FAERS | |
| 465 | Renal pain | FAERS: 2 | US FAERS | |
| 466 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 467 | Rhinitis | FAERS: 2 | US FAERS | |
| 468 | Salivary gland adenoma | FAERS: 2 | US FAERS | |
| 469 | Schizophrenia | FAERS: 2 | US FAERS | |
| 470 | Seizure like phenomena | FAERS: 2 | US FAERS | |
| 471 | Septic Shock | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 472 | Shock | FAERS: 2 | US FAERS | |
| 473 | Shunt thrombosis | FAERS: 2 | US FAERS | |
| 474 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 475 | Spinal cord infection | FAERS: 2 | US FAERS | |
| 476 | Splenic Rupture | FAERS: 2 | US FAERS | |
| 477 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 478 | Tension | FAERS: 2 | US FAERS | |
| 479 | Terminal state | FAERS: 2 | US FAERS | |
| 480 | Thrombosis in device | FAERS: 2 | US FAERS | |
| 481 | Thyroid hormones decreased | FAERS: 2 | US FAERS | |
| 482 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 483 | Tonsillitis | FAERS: 2 | US FAERS | |
| 484 | Toxic Epidermal Necrolysis | FAERS: 2 | US FAERS | |
| 485 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 486 | Trismus | FAERS: 2 | US FAERS | |
| 487 | Ultrafiltration failure | FAERS: 2 | US FAERS | |
| 488 | Vascular calcification | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 489 | Vasculitis | FAERS: 2 | US FAERS | |
| 490 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 491 | Venous thrombosis limb | FAERS: 2 | US FAERS | |
| 492 | Ventricular Fibrillation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 493 | Walking aid user | FAERS: 2 | US FAERS | |
| 494 | Wound Complication | FAERS: 2 | US FAERS | |
| 495 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 496 | colonoscopy | FAERS: 2 | US FAERS | |
| 497 | jaundice | FAERS: 2 | US FAERS | |
| 498 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 499 | Abdominal mass | FAERS: 1 | US FAERS | |
| 500 | Abdominal strangulated hernia | FAERS: 1 | US FAERS | |
| 501 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 502 | Acute Coronary Syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 503 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 504 | Albinism | FAERS: 1 | US FAERS | |
| 505 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 506 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 507 | Angular cheilitis | FAERS: 1 | US FAERS | |
| 508 | Animal bite | FAERS: 1 | US FAERS | |
| 509 | Animal scratch | FAERS: 1 | US FAERS | |
| 510 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 511 | Anorectal infection | FAERS: 1 | US FAERS | |
| 512 | Anuria | FAERS: 1 | US FAERS | |
| 513 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 514 | Aortic stent insertion | FAERS: 1 | US FAERS | |
| 515 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 516 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 517 | Arteriovenous fistula aneurysm | FAERS: 1 | US FAERS | |
| 518 | Arteriovenous fistula thrombosis | FAERS: 1 | US FAERS | |
| 519 | Arteritis | FAERS: 1 | US FAERS | |
| 520 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 521 | Balanoposthitis | FAERS: 1 | US FAERS | |
| 522 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 523 | Bed rest | FAERS: 1 | US FAERS | |
| 524 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 525 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 526 | Bladder cyst | FAERS: 1 | US FAERS | |
| 527 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 528 | Bladder dysfunction | FAERS: 1 | US FAERS | |
| 529 | Blepharospasm | FAERS: 1 | US FAERS | |
| 530 | Blood chloride abnormal | FAERS: 1 | US FAERS | |
| 531 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 532 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 533 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 534 | Blood gastrin increased | FAERS: 1 | US FAERS | |
| 535 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 536 | Blood iron increased | FAERS: 1 | US FAERS | |
| 537 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 538 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 539 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 540 | Blood pH abnormal | FAERS: 1 | US FAERS | |
| 541 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 542 | Blood parathyroid hormone | FAERS: 1 | US FAERS | |
| 543 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 544 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 545 | Blood urea increased | FAERS: 1 | US FAERS | |
| 546 | Bone decalcification | FAERS: 1 | US FAERS | |
| 547 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 548 | Bone scan abnormal | FAERS: 1 | US FAERS | |
| 549 | Brain Death | FAERS: 1 | US FAERS | |
| 550 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 551 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 552 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 553 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 554 | Cachexia | FAERS: 1 | US FAERS | |
| 555 | Cardiac Death | FAERS: 1 | US FAERS | |
| 556 | Cardiac infection | FAERS: 1 | US FAERS | |
| 557 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 558 | Cataract operation | FAERS: 1 | US FAERS | |
| 559 | Catheter related complication | FAERS: 1 | US FAERS | |
| 560 | Catheter site pain | FAERS: 1 | US FAERS | |
| 561 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 562 | Cervicogenic Headache | FAERS: 1 | US FAERS | |
| 563 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 564 | Cholangiolitis | FAERS: 1 | US FAERS | |
| 565 | Cholelithotomy | FAERS: 1 | US FAERS | |
| 566 | Colposcopy | FAERS: 1 | US FAERS | |
| 567 | Complication associated with device | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 568 | Concomitant disease progression | FAERS: 1 | US FAERS | |
| 569 | Congenital cystic kidney disease | FAERS: 1 | US FAERS | |
| 570 | Continuous Positive Airway Pressure | FAERS: 1 | US FAERS | |
| 571 | Craniotomy | FAERS: 1 | US FAERS | |
| 572 | Crystal deposit intestine | FAERS: 1 | US FAERS | |
| 573 | Cyst removal | FAERS: 1 | US FAERS | |
| 574 | Dental Plaque | FAERS: 1 | US FAERS | |
| 575 | Dependence on enabling machine or device | FAERS: 1 | US FAERS | |
| 576 | Device Failure | FAERS: 1 | US FAERS | |
| 577 | Device breakage | FAERS: 1 | US FAERS | |
| 578 | Device dislocation | FAERS: 1 | US FAERS | |
| 579 | Device malfunction | FAERS: 1 | US FAERS | |
| 580 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 581 | Diabetic Retinopathy | FAERS: 1 | US FAERS | |
| 582 | Diabetic foot infection | FAERS: 1 | US FAERS | |
| 583 | Diplegia | FAERS: 1 | US FAERS | |
| 584 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 585 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 586 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 587 | Drug effect faster than expected | FAERS: 1 | US FAERS | |
| 588 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 589 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 590 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 591 | Dry gangrene | FAERS: 1 | US FAERS | |
| 592 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 593 | Duodenitis | FAERS: 1 | US FAERS | |
| 594 | Dysentery | FAERS: 1 | US FAERS | |
| 595 | Dysgraphia | FAERS: 1 | US FAERS | |
| 596 | Dysphemia | FAERS: 1 | US FAERS | |
| 597 | Dystonia | FAERS: 1 | US FAERS | |
| 598 | Elective procedure | FAERS: 1 | US FAERS | |
| 599 | Electrocardiogram RR interval prolonged | FAERS: 1 | US FAERS | |
| 600 | Electrocardiogram T wave amplitude increased | FAERS: 1 | US FAERS | |
| 601 | Emotional disorder | FAERS: 1 | US FAERS | |
| 602 | Endocarditis | FAERS: 1 | US FAERS | |
| 603 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 604 | Erysipelas | FAERS: 1 | US FAERS | |
| 605 | Erythema Nodosum | FAERS: 1 | US FAERS | |
| 606 | Expired product administered | FAERS: 1 | US FAERS | |
| 607 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 608 | Eye pain | FAERS: 1 | US FAERS | |
| 609 | Fasciitis | FAERS: 1 | US FAERS | |
| 610 | Fasting | FAERS: 1 | US FAERS | |
| 611 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 612 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 613 | Food Allergy | FAERS: 1 | US FAERS | |
| 614 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 615 | Gastric Antral Vascular Ectasia | FAERS: 1 | US FAERS | |
| 616 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 617 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 618 | Genital tract inflammation | FAERS: 1 | US FAERS | |
| 619 | Glaucoma surgery | FAERS: 1 | US FAERS | |
| 620 | Glaucoma | FAERS: 1 | US FAERS | |
| 621 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 622 | Graft thrombosis | FAERS: 1 | US FAERS | |
| 623 | Grief reaction | FAERS: 1 | US FAERS | |
| 624 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 625 | Head titubation | FAERS: 1 | US FAERS | |
| 626 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 627 | Heat illness | FAERS: 1 | US FAERS | |
| 628 | Hemiparesis | FAERS: 1 | US FAERS | |
| 629 | Hepatitis | FAERS: 1 | US FAERS | |
| 630 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 631 | Hidradenitis | FAERS: 1 | US FAERS | |
| 632 | House dust allergy | FAERS: 1 | US FAERS | |
| 633 | Hydrothorax | FAERS: 1 | US FAERS | |
| 634 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 635 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 636 | Hyperphagia | FAERS: 1 | US FAERS | |
| 637 | Hyperreflexia | FAERS: 1 | US FAERS | |
| 638 | Hypertensive Encephalopathy | FAERS: 1 | US FAERS | |
| 639 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 640 | Hypocalciuria | FAERS: 1 | US FAERS | |
| 641 | Hypokinesia | FAERS: 1 | US FAERS | |
| 642 | Hypoparathyroidism | FAERS: 1 | US FAERS | |
| 643 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 644 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 645 | Hypoxia | FAERS: 1 | US FAERS | |
| 646 | Ileectomy | FAERS: 1 | US FAERS | |
| 647 | Immobile | FAERS: 1 | US FAERS | |
| 648 | Impaired self-care | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 649 | Incontinence | FAERS: 1 | US FAERS | |
| 650 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 651 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 652 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 653 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 654 | Infected bite | FAERS: 1 | US FAERS | |
| 655 | Infectious colitis | FAERS: 1 | US FAERS | |
| 656 | Infusion Site Extravasation | FAERS: 1 | US FAERS | |
| 657 | Injection site mass | FAERS: 1 | US FAERS | |
| 658 | Intestinal gangrene | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 659 | Intestinal resection | FAERS: 1 | US FAERS | |
| 660 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 661 | Iron deficiency | FAERS: 1 | US FAERS | |
| 662 | Joint Instability | FAERS: 1 | US FAERS | |
| 663 | Joint dislocation postoperative | FAERS: 1 | US FAERS | |
| 664 | Joint stiffness | FAERS: 1 | US FAERS | |
| 665 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 666 | Laboratory test interference | FAERS: 1 | US FAERS | |
| 667 | Laboratory test normal | FAERS: 1 | US FAERS | |
| 668 | Large intestine perforation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 669 | Laryngitis | FAERS: 1 | US FAERS | |
| 670 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 671 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 672 | Lipase increased | FAERS: 1 | US FAERS | |
| 673 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 674 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 675 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 676 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 677 | Malabsorption | FAERS: 1 | US FAERS | |
| 678 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 679 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 680 | Mass excision | FAERS: 1 | US FAERS | |
| 681 | Medical device change | FAERS: 1 | US FAERS | |
| 682 | Medical device site infection | FAERS: 1 | US FAERS | |
| 683 | Medical diet | FAERS: 1 | US FAERS | |
| 684 | Meningioma | FAERS: 1 | US FAERS | |
| 685 | Meningitis | FAERS: 1 | US FAERS | |
| 686 | Metabolic alkalosis | FAERS: 1 | US FAERS | |
| 687 | Middle insomnia | FAERS: 1 | US FAERS | |
| 688 | Mitral Valve Stenosis | FAERS: 1 | US FAERS | |
| 689 | Mouth swelling | FAERS: 1 | US FAERS | |
| 690 | Multiple Endocrine Neoplasia Type 1 | FAERS: 1 | US FAERS | |
| 691 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 692 | Myopathy | FAERS: 1 | US FAERS | |
| 693 | Neck exploration | FAERS: 1 | US FAERS | |
| 694 | Negative thoughts | FAERS: 1 | US FAERS | |
| 695 | Neoplasm growth accelerated | FAERS: 1 | US FAERS | |
| 696 | Nephrogenic Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 697 | Neutropenia | FAERS: 1 | US FAERS | |
| 698 | Neutrophil count decreased | FAERS: 1 | US FAERS | |
| 699 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 700 | Obesity | FAERS: 1 | US FAERS | |
| 701 | Obstruction | FAERS: 1 | US FAERS | |
| 702 | Occult blood positive | FAERS: 1 | US FAERS | |
| 703 | Onychoclasis | FAERS: 1 | US FAERS | |
| 704 | Onycholysis | FAERS: 1 | US FAERS | |
| 705 | Ophthalmoplegia | FAERS: 1 | US FAERS | |
| 706 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 707 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 708 | Oral administration complication | FAERS: 1 | US FAERS | |
| 709 | Oral infection | FAERS: 1 | US FAERS | |
| 710 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 711 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 712 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 713 | Osteitis | FAERS: 1 | US FAERS | |
| 714 | Osteolysis | FAERS: 1 | US FAERS | |
| 715 | Osteomalacia | FAERS: 1 | US FAERS | |
| 716 | Osteosclerosis | FAERS: 1 | US FAERS | |
| 717 | Overweight | FAERS: 1 | US FAERS | |
| 718 | Pacemaker generated arrhythmia | FAERS: 1 | US FAERS | |
| 719 | Pain of skin | FAERS: 1 | US FAERS | |
| 720 | Palliative Care | FAERS: 1 | US FAERS | |
| 721 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 722 | Pancreatic enzymes increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 723 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 724 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 725 | Parathyroid hormone-related protein abnormal | FAERS: 1 | US FAERS | |
| 726 | Parathyroid scan abnormal | FAERS: 1 | US FAERS | |
| 727 | Paroxysmal choreoathetosis | FAERS: 1 | US FAERS | |
| 728 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 729 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 730 | Periarthritis | FAERS: 1 | US FAERS | |
| 731 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 732 | Personality change due to a general medical condition | FAERS: 1 | US FAERS | |
| 733 | Pneumonitis | FAERS: 1 | US FAERS | |
| 734 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 735 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 736 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 737 | Post procedural swelling | FAERS: 1 | US FAERS | |
| 738 | Post-tussive vomiting | FAERS: 1 | US FAERS | |
| 739 | Postoperative fever | FAERS: 1 | US FAERS | |
| 740 | Postoperative heterotopic calcification | FAERS: 1 | US FAERS | |
| 741 | Pregnancy test false positive | FAERS: 1 | US FAERS | |
| 742 | Prerenal failure | FAERS: 1 | US FAERS | |
| 743 | Procedural hypertension | FAERS: 1 | US FAERS | |
| 744 | Procedural nausea | FAERS: 1 | US FAERS | |
| 745 | Product difficult to swallow | FAERS: 1 | US FAERS | |
| 746 | Product size issue | FAERS: 1 | US FAERS | |
| 747 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 748 | Product supply issue | FAERS: 1 | US FAERS | |
| 749 | Product use issue | FAERS: 1 | US FAERS | |
| 750 | Prostatectomy | FAERS: 1 | US FAERS | |
| 751 | Protein urine present | FAERS: 1 | US FAERS | |
| 752 | Proteinuria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 753 | Pseudohypoparathyroidism | FAERS: 1 | US FAERS | |
| 754 | Psoriasis | FAERS: 1 | US FAERS | |
| 755 | Psychiatric decompensation | FAERS: 1 | US FAERS | |
| 756 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 757 | Puncture site pain | FAERS: 1 | US FAERS | |
| 758 | Purging | FAERS: 1 | US FAERS | |
| 759 | Purulence | FAERS: 1 | US FAERS | |
| 760 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 761 | Pyoderma | FAERS: 1 | US FAERS | |
| 762 | Pyuria | FAERS: 1 | US FAERS | |
| 763 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 764 | Rash erythematous | FAERS: 1 | US FAERS | |
| 765 | Regurgitation | FAERS: 1 | US FAERS | |
| 766 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 767 | Renal and pancreas transplant | FAERS: 1 | US FAERS | |
| 768 | Renal mass | FAERS: 1 | US FAERS | |
| 769 | Replacement of ambulatory peritoneal catheter | FAERS: 1 | US FAERS | |
| 770 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 771 | Retinal Degeneration | FAERS: 1 | US FAERS | |
| 772 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 773 | Retinal Vein Occlusion | FAERS: 1 | US FAERS | |
| 774 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 775 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 776 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 777 | Saliva altered | FAERS: 1 | US FAERS | |
| 778 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 779 | Septic arthritis staphylococcal | FAERS: 1 | US FAERS | |
| 780 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 781 | Shunt aneurysm | FAERS: 1 | US FAERS | |
| 782 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 783 | Skin necrosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 784 | Sleep Talking | FAERS: 1 | US FAERS | |
| 785 | Small intestinal ulcer perforation | FAERS: 1 | US FAERS | |
| 786 | Snoring | FAERS: 1 | US FAERS | |
| 787 | Speech rehabilitation | FAERS: 1 | US FAERS | |
| 788 | Sphincter of Oddi Dysfunction | FAERS: 1 | US FAERS | |
| 789 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 790 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 791 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 792 | Strabismus | FAERS: 1 | US FAERS | |
| 793 | Subileus | FAERS: 1 | US FAERS | |
| 794 | Suture insertion | FAERS: 1 | US FAERS | |
| 795 | Synovial Cyst | FAERS: 1 | US FAERS | |
| 796 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 797 | Thoracotomy | FAERS: 1 | US FAERS | |
| 798 | Throat cancer | FAERS: 1 | US FAERS | |
| 799 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 800 | Thyroiditis | FAERS: 1 | US FAERS | |
| 801 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 802 | Toe operation | FAERS: 1 | US FAERS | |
| 803 | Tongue blistering | FAERS: 1 | US FAERS | |
| 804 | Tongue eruption | FAERS: 1 | US FAERS | |
| 805 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 806 | Tooth Infection | FAERS: 1 | US FAERS | |
| 807 | Tooth Loss | FAERS: 1 | US FAERS | |
| 808 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 809 | Tuberculosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 810 | Underweight | FAERS: 1 | US FAERS | |
| 811 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 812 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 813 | Urinary Retention | FAERS: 1 | US FAERS | |
| 814 | Uterine Cancer | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 815 | Varicocele | FAERS: 1 | US FAERS | |
| 816 | Varicose vein operation | FAERS: 1 | US FAERS | |
| 817 | Vascular graft complication | FAERS: 1 | US FAERS | |
| 818 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 819 | Vascular rupture | FAERS: 1 | US FAERS | |
| 820 | Vascular stent stenosis | FAERS: 1 | US FAERS | |
| 821 | Vein collapse | FAERS: 1 | US FAERS | |
| 822 | Venous aneurysm | FAERS: 1 | US FAERS | |
| 823 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 824 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 825 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 826 | Visual disturbance | FAERS: 1 | US FAERS | |
| 827 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 828 | Vitamin D abnormal | FAERS: 1 | US FAERS | |
| 829 | Vitreous opacities | FAERS: 1 | US FAERS | |
| 830 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 831 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 832 | Yawning | FAERS: 1 | US FAERS | |
| 833 | cancer surgery | FAERS: 1 | US FAERS | |
| 834 | heart rate | FAERS: 1 | US FAERS | |
| 835 | insulinoma | FAERS: 1 | US FAERS | |
| 836 | skin abrasion | FAERS: 1 | US FAERS | |
| 837 | Abdominal adhesions | Canada Vigilance: 2 | Canada Vigilance | |
| 838 | Blood electrolytes abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 839 | Blood pressure inadequately controlled | Canada Vigilance: 1 | Canada Vigilance | |
| 840 | Hypercapnia | Canada Vigilance: 1 | Canada Vigilance | |
| 841 | Vascular device infection | Canada Vigilance: 2 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.