treprostinil
(PAJMKGZZBBTTOY-ZFORQUDYSA-N)
Structure
- SMILES
- CCCCC[C@@H](CC[C@H]1[C@H](O)C[C@H]2[C@@H]1Cc1cccc(c1C2)OCC(=O)O)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- B01AC21
- Molecular Formula:
- C23H34O5
- Molecular Weight:
- 390.513
- Log P:
- 3.5832
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 86.99
- CAS Number(s):
- 81846-19-7
Synonym(s)
1.
treprostinil
2.
((1R,2R,3AS,9AS)-2-hydroxy-1-((3S)-3-hydroxyoctyl)-2,3,3A,4,9,9A-hexahydro-1H-cylopent(b)naphthalen-5-yl)oxy)acetate
3.
Orenitram
4.
Remodulin
5.
UT-15
6.
UT-15C
7.
trepostinil sodium
8.
treprostinil diethanolamine
9.
treprostinil diolamin
10.
treprostinil diolamine
11.
treprostinil sodium
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Headache | FAERS: 1001 Canada Vigilance: 9 | 15755791 | CTD SIDER Canada Vigilance US FAERS |
| 2 | Nausea | FAERS: 719 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 3 | Drug dose omission | FAERS: 493 | US FAERS | |
| 4 | Fatigue | FAERS: 448 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 5 | Dizziness | FAERS: 446 Canada Vigilance: 8 | Canada Vigilance SIDER US FAERS | |
| 6 | Pneumonia | FAERS: 442 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 7 | Vomiting | FAERS: 357 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 8 | Pulmonary arterial hypertension | FAERS: 355 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Infusion site pain | FAERS: 326 Canada Vigilance: 12 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 10 | Chest Pain | FAERS: 313 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 11 | Malaise | FAERS: 311 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 12 | Product use issue | FAERS: 258 | US FAERS | |
| 13 | Hypotension | FAERS: 245 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 14 | Asthenia | FAERS: 242 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 15 | Flushing | FAERS: 230 Canada Vigilance: 1 | 15755791 | CTD SIDER Canada Vigilance US FAERS |
| 16 | Pain | FAERS: 205 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 17 | Device related infection | FAERS: 195 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 18 | Nasopharyngitis | FAERS: 186 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Infusion site erythema | FAERS: 177 Canada Vigilance: 11 | Canada Vigilance OFFSIDES US FAERS | |
| 20 | Device dislocation | FAERS: 166 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Fluid overload | FAERS: 161 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 22 | Pulmonary Hypertension | FAERS: 155 Canada Vigilance: 9 | Canada Vigilance SIDER US FAERS | |
| 23 | Disease Progression | FAERS: 144 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Weight decreased | FAERS: 141 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Therapy cessation | FAERS: 140 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Syncope | FAERS: 139 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 27 | Chest discomfort | FAERS: 126 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Palpitations | FAERS: 125 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 29 | Back Pain | FAERS: 124 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 30 | Peripheral swelling | FAERS: 124 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 31 | Arthralgia | FAERS: 123 | SIDER US FAERS | |
| 32 | Respiratory Failure | FAERS: 120 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Influenza | FAERS: 118 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 34 | Right ventricular failure | FAERS: 118 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 35 | Oxygen consumption increased | FAERS: 115 | US FAERS | |
| 36 | Sepsis | FAERS: 114 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 37 | Infusion site infection | FAERS: 109 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 38 | Throat irritation | FAERS: 101 | SIDER US FAERS | |
| 39 | Feeling abnormal | FAERS: 100 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 40 | Dehydration | FAERS: 99 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 41 | General physical health deterioration | FAERS: 96 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 42 | Myalgia | FAERS: 90 | SIDER US FAERS | |
| 43 | Abdominal Pain | FAERS: 89 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 44 | Bronchitis | FAERS: 85 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 45 | Abdominal discomfort | FAERS: 77 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 46 | Oropharyngeal pain | FAERS: 77 | US FAERS | |
| 47 | Therapy non-responder | FAERS: 77 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 48 | Urinary tract infection | FAERS: 76 | SIDER US FAERS | |
| 49 | Drug ineffective | FAERS: 74 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 50 | Hypoxia | FAERS: 71 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 51 | Productive Cough | FAERS: 71 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Chills | FAERS: 70 | US FAERS | |
| 53 | Constipation | FAERS: 70 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Infection | FAERS: 68 | SIDER US FAERS | |
| 55 | Epistaxis | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 56 | Incorrect dose administered | FAERS: 63 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 57 | Infusion site swelling | FAERS: 63 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 58 | Anxiety | FAERS: 62 | SIDER US FAERS | |
| 59 | Sinusitis | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 60 | Device leakage | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 61 | Ascites | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Cardiac Arrest | FAERS: 57 | US FAERS | |
| 63 | Cellulitis | FAERS: 57 | SIDER US FAERS | |
| 64 | Erythema | FAERS: 57 | OFFSIDES SIDER US FAERS | |
| 65 | Injection site discharge | FAERS: 57 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 66 | Infusion site discharge | FAERS: 55 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Pruritus | FAERS: 53 | SIDER US FAERS | |
| 68 | Tremor | FAERS: 52 | US FAERS | |
| 69 | Atrial Fibrillation | FAERS: 51 | US FAERS | |
| 70 | Device malfunction | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 71 | Dyspepsia | FAERS: 50 | SIDER US FAERS | |
| 72 | Accidental overdose | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 73 | Respiratory distress | FAERS: 47 | US FAERS | |
| 74 | Cerebrovascular accident | FAERS: 45 | US FAERS | |
| 75 | Myocardial Infarction | FAERS: 45 | US FAERS | |
| 76 | Somnolence | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 77 | Injection site pain | FAERS: 43 | US FAERS | |
| 78 | Clostridium difficile infection | FAERS: 42 | US FAERS | |
| 79 | Device breakage | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Musculoskeletal Pain | FAERS: 42 | US FAERS | |
| 81 | Overdose | FAERS: 41 | US FAERS | |
| 82 | Tachycardia | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 83 | Lethargy | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Pericardial effusion | FAERS: 37 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 85 | Joint swelling | FAERS: 36 | US FAERS | |
| 86 | Neck Pain | FAERS: 36 | SIDER US FAERS | |
| 87 | Complication associated with device | FAERS: 35 | US FAERS | |
| 88 | Infusion site induration | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 89 | Injection site erythema | FAERS: 35 | OFFSIDES US FAERS | |
| 90 | Device occlusion | FAERS: 32 | US FAERS | |
| 91 | Infusion site pruritus | FAERS: 32 | OFFSIDES US FAERS | |
| 92 | Infusion site warmth | FAERS: 32 | US FAERS | |
| 93 | Thrombosis | FAERS: 32 | US FAERS | |
| 94 | Blood potassium decreased | FAERS: 31 | US FAERS | |
| 95 | Presyncope | FAERS: 30 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 96 | Asthma | FAERS: 29 | US FAERS | |
| 97 | Pulmonary Embolism | FAERS: 28 | SIDER US FAERS | |
| 98 | Device related sepsis | FAERS: 27 | US FAERS | |
| 99 | Wheezing | FAERS: 27 | SIDER US FAERS | |
| 100 | Burning sensation | FAERS: 26 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 101 | Injection site infection | FAERS: 26 | OFFSIDES US FAERS | |
| 102 | Mental status changes | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Pulmonary arterial pressure increased | FAERS: 26 | US FAERS | |
| 104 | Swelling | FAERS: 26 | US FAERS | |
| 105 | Infusion site reaction | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 106 | Medical device complication | FAERS: 24 | US FAERS | |
| 107 | Accidental exposure to product | FAERS: 23 | US FAERS | |
| 108 | Acute respiratory failure | FAERS: 23 | US FAERS | |
| 109 | Dysgeusia | FAERS: 23 | US FAERS | |
| 110 | Flatulence | FAERS: 23 | US FAERS | |
| 111 | Infusion site abscess | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 112 | Infusion site cellulitis | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Product dose omission | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 114 | Acute kidney injury | FAERS: 22 | US FAERS | |
| 115 | Adverse event | FAERS: 22 | US FAERS | |
| 116 | Alopecia | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Infusion site irritation | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 118 | Thrombocytopenia | FAERS: 22 | SIDER US FAERS | |
| 119 | Thrombosis in device | FAERS: 22 | US FAERS | |
| 120 | Dysphonia | FAERS: 21 | US FAERS | |
| 121 | Hernia | FAERS: 21 | US FAERS | |
| 122 | Hypersensitivity | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 123 | Inappropriate schedule of drug administration | FAERS: 21 | US FAERS | |
| 124 | Vertigo | FAERS: 21 | US FAERS | |
| 125 | Visual Impairment | FAERS: 21 | US FAERS | |
| 126 | Blood glucose increased | FAERS: 20 | US FAERS | |
| 127 | Bone pain | FAERS: 20 | SIDER US FAERS | |
| 128 | Device infusion issue | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Device use error | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Device use issue | FAERS: 20 | US FAERS | |
| 131 | Injection site pruritus | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Cyanosis | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Gout | FAERS: 18 | SIDER US FAERS | |
| 134 | Incorrect dose administered by device | FAERS: 18 | US FAERS | |
| 135 | Infusion site nodule | FAERS: 18 | US FAERS | |
| 136 | Scleroderma | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Drug administration error | FAERS: 17 | OFFSIDES US FAERS | |
| 138 | Feeling Cold | FAERS: 17 | US FAERS | |
| 139 | Pallor | FAERS: 17 | SIDER US FAERS | |
| 140 | Post procedural complication | FAERS: 17 | US FAERS | |
| 141 | Restlessness | FAERS: 17 | US FAERS | |
| 142 | Secretion discharge | FAERS: 17 | US FAERS | |
| 143 | Stress | FAERS: 17 | US FAERS | |
| 144 | Urticaria | FAERS: 17 | US FAERS | |
| 145 | Drug titration error | FAERS: 16 | US FAERS | |
| 146 | Infusion Site Extravasation | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 147 | Night sweats | FAERS: 16 | US FAERS | |
| 148 | Respiratory tract congestion | FAERS: 16 | US FAERS | |
| 149 | Cholelithiasis | FAERS: 15 | US FAERS | |
| 150 | Infusion site rash | FAERS: 15 | OFFSIDES US FAERS | |
| 151 | Neuralgia | FAERS: 15 | US FAERS | |
| 152 | Pregnancy | FAERS: 15 | US FAERS | |
| 153 | Wrong technique in product usage process | FAERS: 15 | US FAERS | |
| 154 | Head discomfort | FAERS: 14 | US FAERS | |
| 155 | Infusion site pustule | FAERS: 14 | US FAERS | |
| 156 | Musculoskeletal stiffness | FAERS: 14 | US FAERS | |
| 157 | Nervousness | FAERS: 14 | SIDER US FAERS | |
| 158 | Retching | FAERS: 14 | US FAERS | |
| 159 | Septic Shock | FAERS: 14 | US FAERS | |
| 160 | Sneezing | FAERS: 14 | US FAERS | |
| 161 | Tinnitus | FAERS: 14 | US FAERS | |
| 162 | Infusion site inflammation | FAERS: 13 | US FAERS | |
| 163 | Oxygen saturation abnormal | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 164 | Rales | FAERS: 13 | US FAERS | |
| 165 | Unresponsive to stimuli | FAERS: 13 | US FAERS | |
| 166 | Arthritis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Device battery issue | FAERS: 12 | US FAERS | |
| 168 | Dry skin | FAERS: 12 | US FAERS | |
| 169 | Injection site extravasation | FAERS: 12 | US FAERS | |
| 170 | Intestinal Obstruction | FAERS: 12 | US FAERS | |
| 171 | Joint injury | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Maternal exposure during pregnancy | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Pancreatitis | FAERS: 12 | US FAERS | |
| 174 | Pulmonary Fibrosis | FAERS: 12 | US FAERS | |
| 175 | Shock | FAERS: 12 | SIDER US FAERS | |
| 176 | Transplant | FAERS: 12 | US FAERS | |
| 177 | Vascular device infection | FAERS: 12 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 178 | Agitation | FAERS: 11 | US FAERS | |
| 179 | Blood count abnormal | FAERS: 11 | US FAERS | |
| 180 | Blood pressure fluctuation | FAERS: 11 | US FAERS | |
| 181 | Blood sodium decreased | FAERS: 11 | US FAERS | |
| 182 | Lower respiratory tract infection | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Medication Error | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | Musculoskeletal discomfort | FAERS: 11 | SIDER US FAERS | |
| 185 | Pneumothorax | FAERS: 11 | US FAERS | |
| 186 | Restless Legs Syndrome | FAERS: 11 | US FAERS | |
| 187 | Unevaluable event | FAERS: 11 | US FAERS | |
| 188 | Walking distance test abnormal | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 189 | Depressed mood | FAERS: 10 | US FAERS | |
| 190 | Diverticulitis | FAERS: 10 | US FAERS | |
| 191 | Limb discomfort | FAERS: 10 | US FAERS | |
| 192 | Muscle tightness | FAERS: 10 | US FAERS | |
| 193 | Oral pain | FAERS: 10 | US FAERS | |
| 194 | Respiratory arrest | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 195 | Respiratory tract infection viral | FAERS: 10 | US FAERS | |
| 196 | Rhinovirus infection | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Skin irritation | FAERS: 10 | US FAERS | |
| 198 | Ulcer | FAERS: 10 | US FAERS | |
| 199 | Atrial Flutter | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 200 | Blood creatinine increased | FAERS: 9 | US FAERS | |
| 201 | Blood potassium increased | FAERS: 9 | US FAERS | |
| 202 | Cardiomegaly | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 203 | Catheter placement | FAERS: 9 | US FAERS | |
| 204 | Cystitis | FAERS: 9 | US FAERS | |
| 205 | Device alarm issue | FAERS: 9 | US FAERS | |
| 206 | Ear discomfort | FAERS: 9 | US FAERS | |
| 207 | Eye irritation | FAERS: 9 | US FAERS | |
| 208 | Eye pain | FAERS: 9 | US FAERS | |
| 209 | Feeling jittery | FAERS: 9 | US FAERS | |
| 210 | Gastrointestinal infection | FAERS: 9 | US FAERS | |
| 211 | Hypersomnia | FAERS: 9 | US FAERS | |
| 212 | Infusion site discomfort | FAERS: 9 | US FAERS | |
| 213 | Laceration | FAERS: 9 | US FAERS | |
| 214 | Memory impairment | FAERS: 9 | US FAERS | |
| 215 | Musculoskeletal chest pain | FAERS: 9 | US FAERS | |
| 216 | Product use in unapproved indication | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 217 | Rheumatoid Arthritis | FAERS: 9 | US FAERS | |
| 218 | Sudden Cardiac Death | FAERS: 9 | US FAERS | |
| 219 | Supraventricular tachycardia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 220 | Tooth Extraction | FAERS: 9 | US FAERS | |
| 221 | Abscess | FAERS: 8 | OFFSIDES US FAERS | |
| 222 | Activities of daily living impaired | FAERS: 8 | US FAERS | |
| 223 | Ageusia | FAERS: 8 | US FAERS | |
| 224 | Amnesia | FAERS: 8 | US FAERS | |
| 225 | Carbon dioxide increased | FAERS: 8 | US FAERS | |
| 226 | Cataract | FAERS: 8 | US FAERS | |
| 227 | Colitis | FAERS: 8 | US FAERS | |
| 228 | Gastroenteritis | FAERS: 8 | US FAERS | |
| 229 | Injection site irritation | FAERS: 8 | US FAERS | |
| 230 | Loss of personal independence in daily activities | FAERS: 8 | US FAERS | |
| 231 | Muscle strain | FAERS: 8 | US FAERS | |
| 232 | Polyuria | FAERS: 8 | US FAERS | |
| 233 | Product physical issue | FAERS: 8 | US FAERS | |
| 234 | Pulmonary congestion | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 235 | Toothache | FAERS: 8 | US FAERS | |
| 236 | Blood glucose decreased | FAERS: 7 | US FAERS | |
| 237 | Catheter site infection | FAERS: 7 | OFFSIDES US FAERS | |
| 238 | Deep Vein Thrombosis | FAERS: 7 | US FAERS | |
| 239 | Device damage | FAERS: 7 | US FAERS | |
| 240 | Device related thrombosis | FAERS: 7 | US FAERS | |
| 241 | Eructation | FAERS: 7 | US FAERS | |
| 242 | Inappropriate schedule of product administration | FAERS: 7 | US FAERS | |
| 243 | Low birth weight baby | FAERS: 7 | US FAERS | |
| 244 | Mechanical ventilation | FAERS: 7 | US FAERS | |
| 245 | Product leakage | FAERS: 7 | US FAERS | |
| 246 | Sudden death | FAERS: 7 | US FAERS | |
| 247 | Blood magnesium decreased | FAERS: 6 | US FAERS | |
| 248 | Cholecystitis | FAERS: 6 | US FAERS | |
| 249 | Clostridium difficile colitis | FAERS: 6 | US FAERS | |
| 250 | Cold sweat | FAERS: 6 | US FAERS | |
| 251 | Delirium | FAERS: 6 | US FAERS | |
| 252 | Device connection issue | FAERS: 6 | US FAERS | |
| 253 | Disorientation | FAERS: 6 | US FAERS | |
| 254 | Electrolyte imbalance | FAERS: 6 | US FAERS | |
| 255 | Facial Pain | FAERS: 6 | US FAERS | |
| 256 | Failure to Thrive | FAERS: 6 | US FAERS | |
| 257 | Hepatic Encephalopathy | FAERS: 6 | US FAERS | |
| 258 | Incorrect drug administration rate | FAERS: 6 | US FAERS | |
| 259 | Inflammation | FAERS: 6 | US FAERS | |
| 260 | Infusion site bruising | FAERS: 6 | OFFSIDES US FAERS | |
| 261 | Infusion site injury | FAERS: 6 | US FAERS | |
| 262 | Infusion site vesicles | FAERS: 6 | US FAERS | |
| 263 | Injection site pustule | FAERS: 6 | US FAERS | |
| 264 | Injection site vesicles | FAERS: 6 | US FAERS | |
| 265 | No adverse event | FAERS: 6 | US FAERS | |
| 266 | Product quality issue | FAERS: 6 | US FAERS | |
| 267 | Psoriasis | FAERS: 6 | US FAERS | |
| 268 | Pulmonary pain | FAERS: 6 | US FAERS | |
| 269 | Sinus headache | FAERS: 6 | US FAERS | |
| 270 | Sluggishness | FAERS: 6 | US FAERS | |
| 271 | Stomatitis | FAERS: 6 | US FAERS | |
| 272 | Upper-airway cough syndrome | FAERS: 6 | US FAERS | |
| 273 | Abasia | FAERS: 5 | US FAERS | |
| 274 | Ammonia increased | FAERS: 5 | US FAERS | |
| 275 | Aphonia | FAERS: 5 | US FAERS | |
| 276 | Arthropathy | FAERS: 5 | US FAERS | |
| 277 | Bedridden | FAERS: 5 | US FAERS | |
| 278 | Bradycardia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 279 | Choking | FAERS: 5 | US FAERS | |
| 280 | Dementia | FAERS: 5 | US FAERS | |
| 281 | Device Failure | FAERS: 5 | OFFSIDES US FAERS | |
| 282 | Diabetes Mellitus | FAERS: 5 | US FAERS | |
| 283 | Dialysis related complication | FAERS: 5 | US FAERS | |
| 284 | Discomfort | FAERS: 5 | SIDER US FAERS | |
| 285 | Disease complication | FAERS: 5 | US FAERS | |
| 286 | Ear congestion | FAERS: 5 | US FAERS | |
| 287 | Echocardiogram abnormal | FAERS: 5 | US FAERS | |
| 288 | Eczema | FAERS: 5 | US FAERS | |
| 289 | Emotional distress | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 290 | Feeling of body temperature change | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 291 | Food Allergy | FAERS: 5 | US FAERS | |
| 292 | Gastritis | FAERS: 5 | US FAERS | |
| 293 | Laryngitis | FAERS: 5 | US FAERS | |
| 294 | Limb injury | FAERS: 5 | US FAERS | |
| 295 | Lymphoma | FAERS: 5 | US FAERS | |
| 296 | Poor quality sleep | FAERS: 5 | US FAERS | |
| 297 | Sarcoidosis | FAERS: 5 | US FAERS | |
| 298 | Systemic Scleroderma | FAERS: 5 | US FAERS | |
| 299 | Thermal burn | FAERS: 5 | US FAERS | |
| 300 | Tooth Infection | FAERS: 5 | US FAERS | |
| 301 | Toxicity to various agents | FAERS: 5 | US FAERS | |
| 302 | Transplantation complication | FAERS: 5 | US FAERS | |
| 303 | White blood cell count decreased | FAERS: 5 | US FAERS | |
| 304 | Wound Infection | FAERS: 5 | US FAERS | |
| 305 | Abdominal Infection | FAERS: 4 | US FAERS | |
| 306 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 307 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 308 | Aneurysm | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 309 | Ankle Fracture | FAERS: 4 | US FAERS | |
| 310 | Blood iron decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 311 | Brain natriuretic peptide increased | FAERS: 4 | US FAERS | |
| 312 | Bronchospasm | FAERS: 4 | US FAERS | |
| 313 | Cardiac Flutter | FAERS: 4 | US FAERS | |
| 314 | Catheter site discharge | FAERS: 4 | OFFSIDES US FAERS | |
| 315 | Catheter site pain | FAERS: 4 | OFFSIDES US FAERS | |
| 316 | Chronic respiratory failure | FAERS: 4 | US FAERS | |
| 317 | Deafness | FAERS: 4 | US FAERS | |
| 318 | Device difficult to use | FAERS: 4 | US FAERS | |
| 319 | Drug abuse | FAERS: 4 | US FAERS | |
| 320 | Flank Pain | FAERS: 4 | US FAERS | |
| 321 | Gait inability | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 322 | Hypophagia | FAERS: 4 | US FAERS | |
| 323 | Hysterectomy | FAERS: 4 | US FAERS | |
| 324 | Injection site warmth | FAERS: 4 | US FAERS | |
| 325 | Malabsorption from injection site | FAERS: 4 | US FAERS | |
| 326 | Malnutrition | FAERS: 4 | US FAERS | |
| 327 | Neutropenia | FAERS: 4 | US FAERS | |
| 328 | Ocular discomfort | FAERS: 4 | US FAERS | |
| 329 | Oral candidiasis | FAERS: 4 | US FAERS | |
| 330 | Oxygen consumption decreased | FAERS: 4 | US FAERS | |
| 331 | Pain of skin | FAERS: 4 | US FAERS | |
| 332 | Pancreatic carcinoma | FAERS: 4 | US FAERS | |
| 333 | Paracentesis | FAERS: 4 | US FAERS | |
| 334 | Pleurisy | FAERS: 4 | OFFSIDES US FAERS | |
| 335 | Poor peripheral circulation | FAERS: 4 | US FAERS | |
| 336 | Procedural complication | FAERS: 4 | US FAERS | |
| 337 | Product preparation error | FAERS: 4 | US FAERS | |
| 338 | Product taste abnormal | FAERS: 4 | US FAERS | |
| 339 | Pulmonary arterial pressure abnormal | FAERS: 4 | US FAERS | |
| 340 | Pulmonary hypertensive crisis | FAERS: 4 | OFFSIDES US FAERS | |
| 341 | Pyelonephritis | FAERS: 4 | US FAERS | |
| 342 | Quality of life decreased | FAERS: 4 | US FAERS | |
| 343 | Rash erythematous | FAERS: 4 | US FAERS | |
| 344 | Skin reaction | FAERS: 4 | US FAERS | |
| 345 | Terminal state | FAERS: 4 | US FAERS | |
| 346 | Trismus | FAERS: 4 | US FAERS | |
| 347 | Urinary Retention | FAERS: 4 | US FAERS | |
| 348 | Venoocclusive disease | FAERS: 4 | US FAERS | |
| 349 | Viral upper respiratory tract infection | FAERS: 4 | US FAERS | |
| 350 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 351 | Acidosis | FAERS: 3 | US FAERS | |
| 352 | Arthropod bite | FAERS: 3 | US FAERS | |
| 353 | Blood potassium abnormal | FAERS: 3 | US FAERS | |
| 354 | Blood urea increased | FAERS: 3 | US FAERS | |
| 355 | Blood urine present | FAERS: 3 | US FAERS | |
| 356 | Bowel movement irregularity | FAERS: 3 | US FAERS | |
| 357 | Brain Abscess | FAERS: 3 | US FAERS | |
| 358 | Brain Death | FAERS: 3 | US FAERS | |
| 359 | Cardiac Tamponade | FAERS: 3 | OFFSIDES US FAERS | |
| 360 | Cardiac ablation | FAERS: 3 | US FAERS | |
| 361 | Cataract operation | FAERS: 3 | US FAERS | |
| 362 | Catheter related infection | FAERS: 3 | OFFSIDES US FAERS | |
| 363 | Central line infection | FAERS: 3 | OFFSIDES US FAERS | |
| 364 | Cor pulmonale | FAERS: 3 | US FAERS | |
| 365 | Dermatitis | FAERS: 3 | SIDER US FAERS | |
| 366 | Diabetic Ketoacidosis | FAERS: 3 | US FAERS | |
| 367 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 368 | Dysarthria | FAERS: 3 | US FAERS | |
| 369 | Dysuria | FAERS: 3 | US FAERS | |
| 370 | Exposure via direct contact | FAERS: 3 | US FAERS | |
| 371 | Eye Infection | FAERS: 3 | US FAERS | |
| 372 | Fibromyalgia | FAERS: 3 | US FAERS | |
| 373 | Frustration tolerance decreased | FAERS: 3 | US FAERS | |
| 374 | Full blood count decreased | FAERS: 3 | US FAERS | |
| 375 | Gastrointestinal Pain | FAERS: 3 | SIDER US FAERS | |
| 376 | Glaucoma | FAERS: 3 | US FAERS | |
| 377 | Glossitis | FAERS: 3 | US FAERS | |
| 378 | Grip strength decreased | FAERS: 3 | US FAERS | |
| 379 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 380 | Hepatorenal Syndrome | FAERS: 3 | US FAERS | |
| 381 | Implant site extravasation | FAERS: 3 | US FAERS | |
| 382 | Incontinence | FAERS: 3 | US FAERS | |
| 383 | Infusion site hypersensitivity | FAERS: 3 | US FAERS | |
| 384 | Infusion site mass | FAERS: 3 | US FAERS | |
| 385 | Injection Site Reaction | FAERS: 3 | US FAERS | |
| 386 | Injection site discomfort | FAERS: 3 | US FAERS | |
| 387 | Injection site scab | FAERS: 3 | US FAERS | |
| 388 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 389 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 390 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 391 | Joint stiffness | FAERS: 3 | US FAERS | |
| 392 | Lip swelling | FAERS: 3 | US FAERS | |
| 393 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 394 | Menorrhagia | FAERS: 3 | US FAERS | |
| 395 | Mood swings | FAERS: 3 | US FAERS | |
| 396 | Myocardial necrosis marker increased | FAERS: 3 | US FAERS | |
| 397 | Oliguria | FAERS: 3 | US FAERS | |
| 398 | Onychoclasis | FAERS: 3 | US FAERS | |
| 399 | Oxygen saturation increased | FAERS: 3 | US FAERS | |
| 400 | Paranasal sinus hypersecretion | FAERS: 3 | US FAERS | |
| 401 | Pharmaceutical product complaint | FAERS: 3 | US FAERS | |
| 402 | Post procedural infection | FAERS: 3 | US FAERS | |
| 403 | Pulmonary thrombosis | FAERS: 3 | US FAERS | |
| 404 | Respiratory tract inflammation | FAERS: 3 | US FAERS | |
| 405 | Right Ventricular Dysfunction | FAERS: 3 | US FAERS | |
| 406 | Rosacea | FAERS: 3 | US FAERS | |
| 407 | Sciatica | FAERS: 3 | US FAERS | |
| 408 | Sjogren's Syndrome | FAERS: 3 | US FAERS | |
| 409 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 410 | Soft tissue swelling | FAERS: 3 | US FAERS | |
| 411 | Suture related complication | FAERS: 3 | US FAERS | |
| 412 | Thirst | FAERS: 3 | US FAERS | |
| 413 | Tracheitis | FAERS: 3 | US FAERS | |
| 414 | Tracheostomy malfunction | FAERS: 3 | US FAERS | |
| 415 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 416 | Vascular Access Complication | FAERS: 3 | US FAERS | |
| 417 | Wrong technique in device usage process | FAERS: 3 | US FAERS | |
| 418 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 419 | Accidental underdose | FAERS: 2 | US FAERS | |
| 420 | Acne | FAERS: 2 | OFFSIDES US FAERS | |
| 421 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 422 | Animal bite | FAERS: 2 | US FAERS | |
| 423 | Appendicitis | FAERS: 2 | US FAERS | |
| 424 | Arterial thrombosis | FAERS: 2 | US FAERS | |
| 425 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 426 | Atelectasis | FAERS: 2 | US FAERS | |
| 427 | Back disorder | FAERS: 2 | US FAERS | |
| 428 | Bilevel positive airway pressure | FAERS: 2 | US FAERS | |
| 429 | Blister rupture | FAERS: 2 | US FAERS | |
| 430 | Blood calcium abnormal | FAERS: 2 | US FAERS | |
| 431 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 432 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 433 | Bronchopulmonary Dysplasia | FAERS: 2 | US FAERS | |
| 434 | Calcinosis | FAERS: 2 | US FAERS | |
| 435 | Cardiac valve vegetation | FAERS: 2 | US FAERS | |
| 436 | Choking sensation | FAERS: 2 | US FAERS | |
| 437 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 438 | Claudication of jaw muscles | FAERS: 2 | US FAERS | |
| 439 | Colectomy | FAERS: 2 | US FAERS | |
| 440 | Compression fracture | FAERS: 2 | US FAERS | |
| 441 | Croup infectious | FAERS: 2 | US FAERS | |
| 442 | Crying | FAERS: 2 | US FAERS | |
| 443 | Culture urine positive | FAERS: 2 | US FAERS | |
| 444 | Dental caries | FAERS: 2 | US FAERS | |
| 445 | Dependence | FAERS: 2 | US FAERS | |
| 446 | Device extrusion | FAERS: 2 | US FAERS | |
| 447 | Device kink | FAERS: 2 | US FAERS | |
| 448 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 449 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 450 | Dysentery | FAERS: 2 | US FAERS | |
| 451 | Electrocardiogram abnormal | FAERS: 2 | US FAERS | |
| 452 | Emotional disorder | FAERS: 2 | US FAERS | |
| 453 | Empyema | FAERS: 2 | US FAERS | |
| 454 | Endarterectomy | FAERS: 2 | US FAERS | |
| 455 | Endocarditis | FAERS: 2 | OFFSIDES US FAERS | |
| 456 | Enterobacter sepsis | FAERS: 2 | OFFSIDES US FAERS | |
| 457 | Enterococcal infection | FAERS: 2 | OFFSIDES US FAERS | |
| 458 | Escherichia infection | FAERS: 2 | US FAERS | |
| 459 | Euphoric mood | FAERS: 2 | US FAERS | |
| 460 | Expired product administered | FAERS: 2 | US FAERS | |
| 461 | Extra dose administered | FAERS: 2 | US FAERS | |
| 462 | Fluid imbalance | FAERS: 2 | US FAERS | |
| 463 | Food Poisoning | FAERS: 2 | US FAERS | |
| 464 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 465 | Graft infection | FAERS: 2 | US FAERS | |
| 466 | Granuloma | FAERS: 2 | US FAERS | |
| 467 | Hernia pain | FAERS: 2 | US FAERS | |
| 468 | Hydrothorax | FAERS: 2 | US FAERS | |
| 469 | Hyperacusis | FAERS: 2 | US FAERS | |
| 470 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 471 | Hyperventilation | FAERS: 2 | US FAERS | |
| 472 | Idiopathic Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 473 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 474 | Impaired quality of life | FAERS: 2 | US FAERS | |
| 475 | Implant site infection | FAERS: 2 | US FAERS | |
| 476 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 477 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 478 | Infected cyst | FAERS: 2 | US FAERS | |
| 479 | Infusion site dryness | FAERS: 2 | US FAERS | |
| 480 | Infusion site erosion | FAERS: 2 | US FAERS | |
| 481 | Infusion site scab | FAERS: 2 | US FAERS | |
| 482 | Infusion site scar | FAERS: 2 | US FAERS | |
| 483 | Infusion site streaking | FAERS: 2 | US FAERS | |
| 484 | Infusion site thrombosis | FAERS: 2 | US FAERS | |
| 485 | Injection site abscess | FAERS: 2 | US FAERS | |
| 486 | Injection site bruising | FAERS: 2 | US FAERS | |
| 487 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 488 | Intracranial Aneurysm | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 489 | Intracranial mass | FAERS: 2 | US FAERS | |
| 490 | Intussusception | FAERS: 2 | US FAERS | |
| 491 | Living in residential institution | FAERS: 2 | US FAERS | |
| 492 | Loose tooth | FAERS: 2 | US FAERS | |
| 493 | Malabsorption from administration site | FAERS: 2 | US FAERS | |
| 494 | Malignant Atrophic Papulosis | FAERS: 2 | US FAERS | |
| 495 | Medical device removal | FAERS: 2 | US FAERS | |
| 496 | Medical procedure | FAERS: 2 | US FAERS | |
| 497 | Meningitis | FAERS: 2 | US FAERS | |
| 498 | Mental impairment | FAERS: 2 | US FAERS | |
| 499 | Morganella infection | FAERS: 2 | US FAERS | |
| 500 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 501 | Oral viral infection | FAERS: 2 | US FAERS | |
| 502 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 503 | Osteoporosis | FAERS: 2 | US FAERS | |
| 504 | Paranasal sinus discomfort | FAERS: 2 | US FAERS | |
| 505 | Paranoia | FAERS: 2 | US FAERS | |
| 506 | Perforated ulcer | FAERS: 2 | US FAERS | |
| 507 | Pericarditis | FAERS: 2 | US FAERS | |
| 508 | Petechiae | FAERS: 2 | US FAERS | |
| 509 | Physical assault | FAERS: 2 | SIDER US FAERS | |
| 510 | Pneumonitis | FAERS: 2 | US FAERS | |
| 511 | Portal Hypertension | FAERS: 2 | OFFSIDES US FAERS | |
| 512 | Product label confusion | FAERS: 2 | US FAERS | |
| 513 | Pulmonary arterial pressure decreased | FAERS: 2 | US FAERS | |
| 514 | Rectal Prolapse | FAERS: 2 | US FAERS | |
| 515 | Renal mass | FAERS: 2 | US FAERS | |
| 516 | Respiratory tract irritation | FAERS: 2 | US FAERS | |
| 517 | Restrictive pulmonary disease | FAERS: 2 | US FAERS | |
| 518 | Rhinalgia | FAERS: 2 | US FAERS | |
| 519 | Rhonchi | FAERS: 2 | US FAERS | |
| 520 | Rubber sensitivity | FAERS: 2 | US FAERS | |
| 521 | Scab | FAERS: 2 | US FAERS | |
| 522 | Septic embolus | FAERS: 2 | OFFSIDES US FAERS | |
| 523 | Sinus pain | FAERS: 2 | US FAERS | |
| 524 | Skin lesion | FAERS: 2 | US FAERS | |
| 525 | Splenomegaly | FAERS: 2 | US FAERS | |
| 526 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 527 | Status Epilepticus | FAERS: 2 | US FAERS | |
| 528 | Stenosis | FAERS: 2 | US FAERS | |
| 529 | Subcutaneous drug absorption impaired | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 530 | Suture rupture | FAERS: 2 | US FAERS | |
| 531 | Tension Headache | FAERS: 2 | US FAERS | |
| 532 | Therapy change | FAERS: 2 | US FAERS | |
| 533 | Thoracic vertebral fracture | FAERS: 2 | US FAERS | |
| 534 | Thyroiditis | FAERS: 2 | OFFSIDES US FAERS | |
| 535 | Tonsillectomy | FAERS: 2 | US FAERS | |
| 536 | Troponin increased | FAERS: 2 | US FAERS | |
| 537 | Vascular device occlusion | FAERS: 2 | US FAERS | |
| 538 | Withdrawal of life support | FAERS: 2 | US FAERS | |
| 539 | jaundice | FAERS: 2 | US FAERS | |
| 540 | nervous system disorder | FAERS: 2 | US FAERS | |
| 541 | skin abrasion | FAERS: 2 | US FAERS | |
| 542 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 543 | Abdominal cavity drainage | FAERS: 1 | US FAERS | |
| 544 | Acarodermatitis | FAERS: 1 | US FAERS | |
| 545 | Accelerated Idioventricular Rhythm | FAERS: 1 | US FAERS | |
| 546 | Accidental exposure | FAERS: 1 | US FAERS | |
| 547 | Acute Chest Syndrome | FAERS: 1 | US FAERS | |
| 548 | Acute right ventricular failure | FAERS: 1 | US FAERS | |
| 549 | African Trypanosomiasis | FAERS: 1 | US FAERS | |
| 550 | Akathisia | FAERS: 1 | US FAERS | |
| 551 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 552 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 553 | Alcohol poisoning | FAERS: 1 | US FAERS | |
| 554 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 555 | Alveolar capillary dysplasia | FAERS: 1 | US FAERS | |
| 556 | Ammonia abnormal | FAERS: 1 | US FAERS | |
| 557 | Anger | FAERS: 1 | US FAERS | |
| 558 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 559 | Angioplasty | FAERS: 1 | US FAERS | |
| 560 | Antibiotic therapy | FAERS: 1 | US FAERS | |
| 561 | Antinuclear antibody increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 562 | Anuria | FAERS: 1 | US FAERS | |
| 563 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 564 | Aortic Rupture | FAERS: 1 | US FAERS | |
| 565 | Aortic anastomosis | FAERS: 1 | US FAERS | |
| 566 | Aortic aneurysm repair | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 567 | Apathy | FAERS: 1 | US FAERS | |
| 568 | Apparent death | FAERS: 1 | US FAERS | |
| 569 | Application site discharge | FAERS: 1 | US FAERS | |
| 570 | Application site erythema | FAERS: 1 | US FAERS | |
| 571 | Arteriovenous fistula thrombosis | FAERS: 1 | US FAERS | |
| 572 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 573 | Asphyxia | FAERS: 1 | US FAERS | |
| 574 | Asthenopia | FAERS: 1 | US FAERS | |
| 575 | Astigmatism | FAERS: 1 | US FAERS | |
| 576 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 577 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 578 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 579 | Autoimmune pancytopenia | FAERS: 1 | US FAERS | |
| 580 | Bacterial sepsis | FAERS: 1 | OFFSIDES US FAERS | |
| 581 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 582 | Bacterial tracheitis | FAERS: 1 | US FAERS | |
| 583 | Bed rest | FAERS: 1 | US FAERS | |
| 584 | Bendopnoea | FAERS: 1 | US FAERS | |
| 585 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 586 | Biliary Colic | FAERS: 1 | US FAERS | |
| 587 | Bipolar Disorder | FAERS: 1 | US FAERS | |
| 588 | Blindness | FAERS: 1 | US FAERS | |
| 589 | Blood Pressure | FAERS: 1 | US FAERS | |
| 590 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 591 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 592 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 593 | Blood gases abnormal | FAERS: 1 | US FAERS | |
| 594 | Blood immunoglobulin G decreased | FAERS: 1 | US FAERS | |
| 595 | Blood pH increased | FAERS: 1 | US FAERS | |
| 596 | Blood pressure difference of extremities | FAERS: 1 | US FAERS | |
| 597 | Blood pressure orthostatic abnormal | FAERS: 1 | US FAERS | |
| 598 | Blood sodium abnormal | FAERS: 1 | US FAERS | |
| 599 | Blood sodium | FAERS: 1 | US FAERS | |
| 600 | Bone contusion | FAERS: 1 | US FAERS | |
| 601 | Brain natriuretic peptide decreased | FAERS: 1 | US FAERS | |
| 602 | Breast tenderness | FAERS: 1 | US FAERS | |
| 603 | Breath Holding | FAERS: 1 | US FAERS | |
| 604 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 605 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 606 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 607 | Bronchoscopy | FAERS: 1 | US FAERS | |
| 608 | Bursitis | FAERS: 1 | US FAERS | |
| 609 | CREST Syndrome | FAERS: 1 | US FAERS | |
| 610 | Capillary nail refill test | FAERS: 1 | US FAERS | |
| 611 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 612 | Cardiac Death | FAERS: 1 | US FAERS | |
| 613 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 614 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 615 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 616 | Cardiovascular evaluation | FAERS: 1 | US FAERS | |
| 617 | Carditis | FAERS: 1 | US FAERS | |
| 618 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 619 | Catatonia | FAERS: 1 | US FAERS | |
| 620 | Catheter bacteraemia | FAERS: 1 | OFFSIDES US FAERS | |
| 621 | Catheter culture positive | FAERS: 1 | US FAERS | |
| 622 | Catheter management | FAERS: 1 | US FAERS | |
| 623 | Catheter related complication | FAERS: 1 | OFFSIDES US FAERS | |
| 624 | Catheter site extravasation | FAERS: 1 | US FAERS | |
| 625 | Catheter site inflammation | FAERS: 1 | US FAERS | |
| 626 | Catheter site nodule | FAERS: 1 | US FAERS | |
| 627 | Catheter site scab | FAERS: 1 | US FAERS | |
| 628 | Central venous catheter removal | FAERS: 1 | US FAERS | |
| 629 | Cervix carcinoma recurrent | FAERS: 1 | US FAERS | |
| 630 | Chemotherapy | FAERS: 1 | US FAERS | |
| 631 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 632 | Chronic right ventricular failure | FAERS: 1 | US FAERS | |
| 633 | Clostridium difficile sepsis | FAERS: 1 | US FAERS | |
| 634 | Combined pulmonary fibrosis and emphysema | FAERS: 1 | US FAERS | |
| 635 | Complication of device insertion | FAERS: 1 | US FAERS | |
| 636 | Congenital diaphragmatic hernia | FAERS: 1 | US FAERS | |
| 637 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 638 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 639 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 640 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 641 | Critical Illness | FAERS: 1 | US FAERS | |
| 642 | Cyst removal | FAERS: 1 | US FAERS | |
| 643 | Cystic Fibrosis | FAERS: 1 | US FAERS | |
| 644 | Cyst | FAERS: 1 | US FAERS | |
| 645 | Dependence on oxygen therapy | FAERS: 1 | US FAERS | |
| 646 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 647 | Depression suicidal | FAERS: 1 | US FAERS | |
| 648 | Device adhesion issue | FAERS: 1 | US FAERS | |
| 649 | Device allergy | FAERS: 1 | US FAERS | |
| 650 | Device computer issue | FAERS: 1 | US FAERS | |
| 651 | Device defective | FAERS: 1 | US FAERS | |
| 652 | Device loosening | FAERS: 1 | US FAERS | |
| 653 | Device power source issue | FAERS: 1 | US FAERS | |
| 654 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 655 | Diplopia | FAERS: 1 | US FAERS | |
| 656 | Diuretic therapy | FAERS: 1 | US FAERS | |
| 657 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 658 | Drooling | FAERS: 1 | US FAERS | |
| 659 | Drug Tolerance | FAERS: 1 | US FAERS | |
| 660 | Drug administered in wrong device | FAERS: 1 | US FAERS | |
| 661 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 662 | Drug resistance | FAERS: 1 | US FAERS | |
| 663 | Duodenitis | FAERS: 1 | US FAERS | |
| 664 | Dysphemia | FAERS: 1 | US FAERS | |
| 665 | Ear tube insertion | FAERS: 1 | US FAERS | |
| 666 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 667 | Electroencephalogram | FAERS: 1 | US FAERS | |
| 668 | Embedded device | FAERS: 1 | US FAERS | |
| 669 | Embolism | FAERS: 1 | US FAERS | |
| 670 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 671 | Encephalitis | FAERS: 1 | US FAERS | |
| 672 | Endometrial hypertrophy | FAERS: 1 | US FAERS | |
| 673 | Enterococcal sepsis | FAERS: 1 | US FAERS | |
| 674 | Epiglottitis | FAERS: 1 | US FAERS | |
| 675 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 676 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 677 | Excessive eye blinking | FAERS: 1 | US FAERS | |
| 678 | Expired device used | FAERS: 1 | US FAERS | |
| 679 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 680 | Exposure via eye contact | FAERS: 1 | US FAERS | |
| 681 | Facial Paresis | FAERS: 1 | US FAERS | |
| 682 | Facial paralysis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 683 | Fibrosis | FAERS: 1 | US FAERS | |
| 684 | Flat affect | FAERS: 1 | US FAERS | |
| 685 | Fracture | FAERS: 1 | US FAERS | |
| 686 | Frustration | FAERS: 1 | US FAERS | |
| 687 | Fungal pharyngitis | FAERS: 1 | US FAERS | |
| 688 | Gangrene | FAERS: 1 | US FAERS | |
| 689 | Gastric infection | FAERS: 1 | OFFSIDES US FAERS | |
| 690 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 691 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 692 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 693 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 694 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 695 | Gastrointestinal wall thickening | FAERS: 1 | US FAERS | |
| 696 | Gastrostomy tube site complication | FAERS: 1 | US FAERS | |
| 697 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 698 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 699 | Gingival erythema | FAERS: 1 | US FAERS | |
| 700 | Gingivitis | FAERS: 1 | US FAERS | |
| 701 | Glioblastoma | FAERS: 1 | US FAERS | |
| 702 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 703 | Growth failure | FAERS: 1 | US FAERS | |
| 704 | Hemiparesis | FAERS: 1 | OFFSIDES US FAERS | |
| 705 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 706 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 707 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 708 | Hepatopulmonary Syndrome | FAERS: 1 | US FAERS | |
| 709 | Hip surgery | FAERS: 1 | US FAERS | |
| 710 | Hordeolum | FAERS: 1 | US FAERS | |
| 711 | Hospice Care | FAERS: 1 | US FAERS | |
| 712 | House dust allergy | FAERS: 1 | US FAERS | |
| 713 | Hunger | FAERS: 1 | US FAERS | |
| 714 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 715 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 716 | Hyperosmolar state | FAERS: 1 | US FAERS | |
| 717 | Hypogeusia | FAERS: 1 | US FAERS | |
| 718 | Hypokinesia | FAERS: 1 | US FAERS | |
| 719 | Hypometabolism | FAERS: 1 | US FAERS | |
| 720 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 721 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 722 | Immunoglobulin Therapy | FAERS: 1 | US FAERS | |
| 723 | Impaired self-care | FAERS: 1 | US FAERS | |
| 724 | Impetigo | FAERS: 1 | US FAERS | |
| 725 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 726 | Incision site pain | FAERS: 1 | US FAERS | |
| 727 | Incoherent | FAERS: 1 | US FAERS | |
| 728 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 729 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 730 | Increased bronchial secretion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 731 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 732 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 733 | Infectious colitis | FAERS: 1 | US FAERS | |
| 734 | Influenza A virus test positive | FAERS: 1 | US FAERS | |
| 735 | Infusion site coldness | FAERS: 1 | US FAERS | |
| 736 | Infusion site cyst | FAERS: 1 | US FAERS | |
| 737 | Infusion site exfoliation | FAERS: 1 | US FAERS | |
| 738 | Infusion site macule | FAERS: 1 | US FAERS | |
| 739 | Infusion site necrosis | FAERS: 1 | US FAERS | |
| 740 | Infusion site urticaria | FAERS: 1 | US FAERS | |
| 741 | Initial insomnia | FAERS: 1 | US FAERS | |
| 742 | Injection site cellulitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 743 | Injection site inflammation | FAERS: 1 | US FAERS | |
| 744 | Injection site injury | FAERS: 1 | US FAERS | |
| 745 | Injection site nodule | FAERS: 1 | US FAERS | |
| 746 | Injection site papule | FAERS: 1 | US FAERS | |
| 747 | Injection site phlebitis | FAERS: 1 | US FAERS | |
| 748 | Injection site urticaria | FAERS: 1 | US FAERS | |
| 749 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 750 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 751 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 752 | Intracardiac pressure increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 753 | Iron deficiency | FAERS: 1 | US FAERS | |
| 754 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 755 | Kidney ablation | FAERS: 1 | US FAERS | |
| 756 | Klebsiella test positive | FAERS: 1 | US FAERS | |
| 757 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 758 | Life expectancy shortened | FAERS: 1 | US FAERS | |
| 759 | Limb operation | FAERS: 1 | US FAERS | |
| 760 | Lip erythema | FAERS: 1 | US FAERS | |
| 761 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 762 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 763 | Local reaction | FAERS: 1 | US FAERS | |
| 764 | Lower respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 765 | Lung Abscess | FAERS: 1 | US FAERS | |
| 766 | Lung hyperinflation | FAERS: 1 | US FAERS | |
| 767 | Lung transplant rejection | FAERS: 1 | US FAERS | |
| 768 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 769 | Lymph nodes scan abnormal | FAERS: 1 | US FAERS | |
| 770 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 771 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 772 | Macular degeneration | FAERS: 1 | US FAERS | |
| 773 | Malabsorption from application site | FAERS: 1 | US FAERS | |
| 774 | Malabsorption | FAERS: 1 | US FAERS | |
| 775 | Malignant ascites | FAERS: 1 | US FAERS | |
| 776 | Mediastinal mass | FAERS: 1 | US FAERS | |
| 777 | Medical device change | FAERS: 1 | US FAERS | |
| 778 | Medical device site infection | FAERS: 1 | US FAERS | |
| 779 | Medical device site swelling | FAERS: 1 | US FAERS | |
| 780 | Medical induction of coma | FAERS: 1 | US FAERS | |
| 781 | Medication residue present | FAERS: 1 | US FAERS | |
| 782 | Menopause | FAERS: 1 | US FAERS | |
| 783 | Mesothelioma | FAERS: 1 | US FAERS | |
| 784 | Metabolic function test abnormal | FAERS: 1 | US FAERS | |
| 785 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 786 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 787 | Middle insomnia | FAERS: 1 | US FAERS | |
| 788 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 789 | Miliaria | FAERS: 1 | US FAERS | |
| 790 | Mixed Connective Tissue Disease | FAERS: 1 | US FAERS | |
| 791 | Moaning | FAERS: 1 | US FAERS | |
| 792 | Motion Sickness | FAERS: 1 | US FAERS | |
| 793 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 794 | Mycotic allergy | FAERS: 1 | US FAERS | |
| 795 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 796 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 797 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 798 | Needle issue | FAERS: 1 | US FAERS | |
| 799 | Nipple pain | FAERS: 1 | US FAERS | |
| 800 | Nodule | FAERS: 1 | US FAERS | |
| 801 | Noninfective encephalitis | FAERS: 1 | US FAERS | |
| 802 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 803 | Obesity | FAERS: 1 | US FAERS | |
| 804 | Occult blood positive | FAERS: 1 | US FAERS | |
| 805 | Onychomycosis | FAERS: 1 | US FAERS | |
| 806 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 807 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 808 | Oropharyngeal plaque | FAERS: 1 | US FAERS | |
| 809 | Orthostatic intolerance | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 810 | Osteitis | FAERS: 1 | US FAERS | |
| 811 | Otitis Media | FAERS: 1 | US FAERS | |
| 812 | Overweight | FAERS: 1 | US FAERS | |
| 813 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 814 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 815 | PO2 decreased | FAERS: 1 | US FAERS | |
| 816 | Pain management | FAERS: 1 | US FAERS | |
| 817 | Palmar erythema | FAERS: 1 | US FAERS | |
| 818 | Parotitis | FAERS: 1 | US FAERS | |
| 819 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 820 | Pathogen resistance | FAERS: 1 | OFFSIDES US FAERS | |
| 821 | Pelvic Inflammatory Disease | FAERS: 1 | US FAERS | |
| 822 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 823 | Peritonitis | FAERS: 1 | US FAERS | |
| 824 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 825 | Phlebitis | FAERS: 1 | US FAERS | |
| 826 | Photophobia | FAERS: 1 | US FAERS | |
| 827 | Pilonidal Cyst | FAERS: 1 | US FAERS | |
| 828 | Pneumococcal sepsis | FAERS: 1 | US FAERS | |
| 829 | Pneumoconiosis | FAERS: 1 | US FAERS | |
| 830 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 831 | Product administration error | FAERS: 1 | US FAERS | |
| 832 | Product dispensing error | FAERS: 1 | US FAERS | |
| 833 | Product distribution issue | FAERS: 1 | US FAERS | |
| 834 | Product packaging issue | FAERS: 1 | US FAERS | |
| 835 | Product size issue | FAERS: 1 | US FAERS | |
| 836 | Product storage error | FAERS: 1 | US FAERS | |
| 837 | Product substitution issue | FAERS: 1 | US FAERS | |
| 838 | Pseudocyst | FAERS: 1 | US FAERS | |
| 839 | Pseudomonal sepsis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 840 | Pseudomonas test positive | FAERS: 1 | US FAERS | |
| 841 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 842 | Pulmonary endarterectomy | FAERS: 1 | US FAERS | |
| 843 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 844 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 845 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 846 | Purulence | FAERS: 1 | US FAERS | |
| 847 | Purulent discharge | FAERS: 1 | OFFSIDES US FAERS | |
| 848 | Rebound effect | FAERS: 1 | US FAERS | |
| 849 | Rectal discharge | FAERS: 1 | US FAERS | |
| 850 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 851 | Renal pain | FAERS: 1 | US FAERS | |
| 852 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 853 | Respiratory Therapy | FAERS: 1 | US FAERS | |
| 854 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 855 | Retinopathy of Prematurity | FAERS: 1 | US FAERS | |
| 856 | Rhinitis | FAERS: 1 | SIDER US FAERS | |
| 857 | Right Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 858 | Right atrial pressure increased | FAERS: 1 | US FAERS | |
| 859 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 860 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 861 | Salpingectomy | FAERS: 1 | US FAERS | |
| 862 | Sarcoma | FAERS: 1 | US FAERS | |
| 863 | Schizophrenia | FAERS: 1 | US FAERS | |
| 864 | Screaming | FAERS: 1 | US FAERS | |
| 865 | Sedation complication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 866 | Seroma | FAERS: 1 | US FAERS | |
| 867 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 868 | Shunt infection | FAERS: 1 | US FAERS | |
| 869 | Shunt malfunction | FAERS: 1 | US FAERS | |
| 870 | Sinus operation | FAERS: 1 | US FAERS | |
| 871 | Sleep Talking | FAERS: 1 | US FAERS | |
| 872 | Small intestine carcinoma stage IV | FAERS: 1 | US FAERS | |
| 873 | Spinal Stenosis | FAERS: 1 | US FAERS | |
| 874 | Splenectomy | FAERS: 1 | US FAERS | |
| 875 | Sputum retention | FAERS: 1 | US FAERS | |
| 876 | Squamous cell carcinoma of lung | FAERS: 1 | US FAERS | |
| 877 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 878 | Staring | FAERS: 1 | US FAERS | |
| 879 | Stenotrophomonas infection | FAERS: 1 | OFFSIDES US FAERS | |
| 880 | Stress echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 881 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 882 | Superior Mesenteric Artery Syndrome | FAERS: 1 | US FAERS | |
| 883 | Surgical vascular shunt | FAERS: 1 | US FAERS | |
| 884 | Suspected product contamination | FAERS: 1 | US FAERS | |
| 885 | Syringe issue | FAERS: 1 | US FAERS | |
| 886 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 887 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 888 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 889 | Therapeutic reaction time decreased | FAERS: 1 | US FAERS | |
| 890 | Thoracostomy | FAERS: 1 | US FAERS | |
| 891 | Throat cancer | FAERS: 1 | US FAERS | |
| 892 | Thromboembolectomy | FAERS: 1 | US FAERS | |
| 893 | Thrombophlebitis | FAERS: 1 | SIDER US FAERS | |
| 894 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 895 | Tongue biting | FAERS: 1 | US FAERS | |
| 896 | Tongue erythema | FAERS: 1 | US FAERS | |
| 897 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 898 | Tooth Loss | FAERS: 1 | US FAERS | |
| 899 | Tooth Resorption | FAERS: 1 | US FAERS | |
| 900 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 901 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 902 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 903 | Tracheomalacia | FAERS: 1 | US FAERS | |
| 904 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 905 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 906 | Unevaluable investigation | FAERS: 1 | US FAERS | |
| 907 | Unintentional medical device removal | FAERS: 1 | US FAERS | |
| 908 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 909 | Urethral discharge | FAERS: 1 | US FAERS | |
| 910 | Urine output increased | FAERS: 1 | US FAERS | |
| 911 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 912 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 913 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 914 | Venous occlusion | FAERS: 1 | US FAERS | |
| 915 | Ventilation/perfusion scan abnormal | FAERS: 1 | US FAERS | |
| 916 | Ventricle rupture | FAERS: 1 | US FAERS | |
| 917 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 918 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 919 | Viral sinusitis | FAERS: 1 | OFFSIDES US FAERS | |
| 920 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 921 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 922 | Vulvovaginal erythema | FAERS: 1 | US FAERS | |
| 923 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 924 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 925 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 926 | West Nile viral infection | FAERS: 1 | US FAERS | |
| 927 | Wound Complication | FAERS: 1 | US FAERS | |
| 928 | Wound abscess | FAERS: 1 | US FAERS | |
| 929 | Wound infection bacterial | FAERS: 1 | OFFSIDES US FAERS | |
| 930 | Wound infection staphylococcal | FAERS: 1 | OFFSIDES US FAERS | |
| 931 | Wrong dose | FAERS: 1 | US FAERS | |
| 932 | Wrong product administered | FAERS: 1 | US FAERS | |
| 933 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 934 | Yawning | FAERS: 1 | US FAERS | |
| 935 | colonoscopy | FAERS: 1 | US FAERS | |
| 936 | furuncle | FAERS: 1 | US FAERS | |
| 937 | muscle injury | FAERS: 1 | US FAERS | |
| 938 | Abdominal mass | OFFSIDES | ||
| 939 | Acid fast bacilli infection | OFFSIDES | ||
| 940 | Anorexia | SIDER | ||
| 941 | Axillary vein thrombosis | OFFSIDES | ||
| 942 | Bacterial Endocarditis | OFFSIDES | ||
| 943 | Blood albumin decreased | OFFSIDES | ||
| 944 | Body Temperature | OFFSIDES | ||
| 945 | Catheter sepsis | OFFSIDES | ||
| 946 | Cramps of lower extremities | SIDER | ||
| 947 | Culture positive | OFFSIDES | ||
| 948 | Diarrhea | OFFSIDES | ||
| 949 | Ecchymosis | SIDER | ||
| 950 | Hepatitis | OFFSIDES | ||
| 951 | Incorrect drug administration duration | OFFSIDES | ||
| 952 | Induration | SIDER | ||
| 953 | Intra-abdominal fluid collection | Canada Vigilance: 1 | Canada Vigilance | |
| 954 | Mycobacterium fortuitum infection | OFFSIDES | ||
| 955 | Pelvic discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 956 | Pericardiotomy | OFFSIDES | ||
| 957 | Pharyngolaryngeal Pain | SIDER | ||
| 958 | Poor personal hygiene | OFFSIDES | ||
| 959 | Propionibacterium infection | OFFSIDES | ||
| 960 | Protein total decreased | OFFSIDES | ||
| 961 | Stenotrophomonas sepsis | OFFSIDES | ||
| 962 | Suprapubic pain | OFFSIDES | ||
| 963 | Tension | SIDER | ||
| 964 | Venous stenosis | OFFSIDES | ||
| 965 | Venous thrombosis limb | OFFSIDES | ||
| 966 | Wheelchair user | Canada Vigilance: 1 | Canada Vigilance | |
| 967 | White blood cell count abnormal | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.