Paroxetine
(GELRVIPPMNMYGS-RVXRQPKJSA-N)
Structure
- SMILES
- Fc1ccc(cc1)[C@@H]1CCNC[C@H]1COc1ccc2c(c1)OCO2.Cl
- Molecular Formula:
- C19H21ClFNO3
- Molecular Weight:
- 365.826
- Log P:
- 4.4573
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 39.72
- CAS Number(s):
- 78246-49-8; 110429-35-1
Synonym(s)
1.
Paroxetine
2.
Aropax
3.
BRL-29060
4.
FG-7051
5.
Paroxetine Acetate
6.
Paroxetine Hydrochloride
7.
Paroxetine Hydrochloride Anhydrous
8.
Paroxetine Hydrochloride Hemihydrate
9.
Paroxetine Hydrochloride, Hemihydrate
10.
Paroxetine Maleate
11.
Paroxetine, cis-(+)-Isomer
12.
Paroxetine, cis-(-)-Isomer
13.
Paroxetine, trans-(+)-Isomer
14.
Paxil
15.
Seroxat
16.
BRL 29060
17.
BRL29060
18.
FG 7051
19.
FG7051
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug withdrawal syndrome | FAERS: 383 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 2 | Anxiety | FAERS: 235 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Dizziness | FAERS: 198 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Drug ineffective | FAERS: 198 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 5 | Nausea | FAERS: 186 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 6 | Completed Suicide | FAERS: 174 | US FAERS | |
| 7 | Drug exposure during pregnancy | FAERS: 174 | US FAERS | |
| 8 | Agitation | FAERS: 156 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Headache | FAERS: 155 | US FAERS | |
| 10 | Tremor | FAERS: 128 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Fatigue | FAERS: 126 | US FAERS | |
| 12 | Depressed mood | FAERS: 89 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Suicide attempt | FAERS: 88 | US FAERS | |
| 14 | Anger | FAERS: 84 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Feeling abnormal | FAERS: 79 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Crying | FAERS: 78 | US FAERS | |
| 17 | Malaise | FAERS: 76 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 18 | Vomiting | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Memory impairment | FAERS: 57 | US FAERS | |
| 20 | Mood swings | FAERS: 57 | US FAERS | |
| 21 | Pharmaceutical product complaint | FAERS: 54 | US FAERS | |
| 22 | Somnolence | FAERS: 54 | US FAERS | |
| 23 | Product substitution issue | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Lethargy | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Overdose | FAERS: 48 | US FAERS | |
| 26 | Vertigo | FAERS: 47 | US FAERS | |
| 27 | Drug Dependence | FAERS: 43 | US FAERS | |
| 28 | Restlessness | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Tinnitus | FAERS: 39 | US FAERS | |
| 30 | Intentional self-injury | FAERS: 38 | US FAERS | |
| 31 | Palpitations | FAERS: 37 | US FAERS | |
| 32 | Paranoia | FAERS: 36 | US FAERS | |
| 33 | Adverse event | FAERS: 33 | US FAERS | |
| 34 | Arthralgia | FAERS: 31 | US FAERS | |
| 35 | Emotional disorder | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Myalgia | FAERS: 28 | US FAERS | |
| 37 | Psychiatric symptom | FAERS: 28 | US FAERS | |
| 38 | Serotonin Syndrome | FAERS: 28 | US FAERS | |
| 39 | Asthenia | FAERS: 27 | US FAERS | |
| 40 | Nervousness | FAERS: 26 | US FAERS | |
| 41 | Pain | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Influenza | FAERS: 25 | US FAERS | |
| 43 | Maternal exposure during pregnancy | FAERS: 25 | US FAERS | |
| 44 | Syncope | FAERS: 25 | US FAERS | |
| 45 | Apathy | FAERS: 24 | US FAERS | |
| 46 | Night sweats | FAERS: 24 | US FAERS | |
| 47 | Akathisia | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Weight decreased | FAERS: 23 | US FAERS | |
| 49 | Chills | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Patent ductus arteriosus | FAERS: 22 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 51 | Talipes | FAERS: 21 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 52 | Chest Pain | FAERS: 20 | US FAERS | |
| 53 | Disorientation | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Emotional distress | FAERS: 20 | US FAERS | |
| 55 | Personality Change | FAERS: 19 | US FAERS | |
| 56 | Pruritus | FAERS: 19 | US FAERS | |
| 57 | Anorexia | FAERS: 18 | US FAERS | |
| 58 | Product quality issue | FAERS: 18 | US FAERS | |
| 59 | Dissociation | FAERS: 17 | US FAERS | |
| 60 | Therapeutic response unexpected with drug substitution | FAERS: 16 | US FAERS | |
| 61 | Pulmonary Hypertension | FAERS: 15 | US FAERS | |
| 62 | Visual disturbance | FAERS: 15 | US FAERS | |
| 63 | Hypoplastic Left Heart Syndrome | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Pulmonary Valve Stenosis | FAERS: 14 | US FAERS | |
| 65 | Tension | FAERS: 14 | US FAERS | |
| 66 | Abdominal Pain | FAERS: 13 | US FAERS | |
| 67 | Activation syndrome | FAERS: 13 | US FAERS | |
| 68 | Agoraphobia | FAERS: 13 | US FAERS | |
| 69 | Amnesia | FAERS: 13 | US FAERS | |
| 70 | Discomfort | FAERS: 13 | US FAERS | |
| 71 | Feeling jittery | FAERS: 12 | US FAERS | |
| 72 | Impaired work ability | FAERS: 12 | US FAERS | |
| 73 | Violence-related symptom | FAERS: 12 | US FAERS | |
| 74 | Bicuspid aortic valve | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 75 | Hypomania | FAERS: 11 | US FAERS | |
| 76 | Physical assault | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 77 | Stress | FAERS: 11 | US FAERS | |
| 78 | Abdominal discomfort | FAERS: 10 | US FAERS | |
| 79 | Activities of daily living impaired | FAERS: 10 | US FAERS | |
| 80 | Alopecia | FAERS: 10 | US FAERS | |
| 81 | Constipation | FAERS: 10 | US FAERS | |
| 82 | Drug dose omission | FAERS: 10 | US FAERS | |
| 83 | Eye pain | FAERS: 10 | US FAERS | |
| 84 | Hyperreflexia | FAERS: 10 | US FAERS | |
| 85 | Medication Error | FAERS: 10 | US FAERS | |
| 86 | Tachycardia | FAERS: 10 | US FAERS | |
| 87 | Flat affect | FAERS: 9 | US FAERS | |
| 88 | Sexual Dysfunction | FAERS: 9 | US FAERS | |
| 89 | Unevaluable event | FAERS: 9 | US FAERS | |
| 90 | Anorgasmia | FAERS: 8 | US FAERS | |
| 91 | Cyanosis | FAERS: 8 | US FAERS | |
| 92 | Dependence | FAERS: 8 | US FAERS | |
| 93 | Disability | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 94 | Dysmorphism | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Erectile dysfunction | FAERS: 8 | US FAERS | |
| 96 | General physical health deterioration | FAERS: 8 | US FAERS | |
| 97 | Homicide | FAERS: 8 | US FAERS | |
| 98 | Negative thoughts | FAERS: 8 | US FAERS | |
| 99 | Obsessive-Compulsive Disorder | FAERS: 8 | US FAERS | |
| 100 | Poor quality sleep | FAERS: 8 | US FAERS | |
| 101 | Supraventricular tachycardia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 102 | Anhedonia | FAERS: 7 | US FAERS | |
| 103 | Congenital pulmonary hypertension | FAERS: 7 | US FAERS | |
| 104 | Dehydration | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Depressed Level of Consciousness | FAERS: 7 | US FAERS | |
| 106 | Drug level increased | FAERS: 7 | US FAERS | |
| 107 | Euphoric mood | FAERS: 7 | US FAERS | |
| 108 | Hypersomnia | FAERS: 7 | US FAERS | |
| 109 | Hypospadias | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Injury asphyxiation | FAERS: 7 | US FAERS | |
| 111 | Intentional misuse | FAERS: 7 | US FAERS | |
| 112 | Mental status changes | FAERS: 7 | US FAERS | |
| 113 | Performance status decreased | FAERS: 7 | US FAERS | |
| 114 | Restless Legs Syndrome | FAERS: 7 | US FAERS | |
| 115 | Skin laceration | FAERS: 7 | US FAERS | |
| 116 | Stupor | FAERS: 7 | US FAERS | |
| 117 | nervous system disorder | FAERS: 7 | US FAERS | |
| 118 | Asphyxia | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Dysuria | FAERS: 6 | US FAERS | |
| 120 | Erythema | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Frustration | FAERS: 6 | US FAERS | |
| 122 | Hypoaesthesia facial | FAERS: 6 | US FAERS | |
| 123 | Musculoskeletal Pain | FAERS: 6 | US FAERS | |
| 124 | Mydriasis | FAERS: 6 | US FAERS | |
| 125 | Myoclonus | FAERS: 6 | US FAERS | |
| 126 | Neonatal disorder | FAERS: 6 | US FAERS | |
| 127 | Pyloric Stenosis | FAERS: 6 | US FAERS | |
| 128 | Renal dysplasia | FAERS: 6 | US FAERS | |
| 129 | Respiratory distress | FAERS: 6 | US FAERS | |
| 130 | Self Mutilation | FAERS: 6 | US FAERS | |
| 131 | Urticaria | FAERS: 6 | US FAERS | |
| 132 | Yawning | FAERS: 6 | US FAERS | |
| 133 | Alcohol poisoning | FAERS: 5 | US FAERS | |
| 134 | Antidepressant drug level increased | FAERS: 5 | US FAERS | |
| 135 | Bruxism | FAERS: 5 | US FAERS | |
| 136 | Congenital Hydrocephalus | FAERS: 5 | US FAERS | |
| 137 | Delirium | FAERS: 5 | US FAERS | |
| 138 | Dyspepsia | FAERS: 5 | US FAERS | |
| 139 | Dysphonia | FAERS: 5 | US FAERS | |
| 140 | Electrolyte imbalance | FAERS: 5 | US FAERS | |
| 141 | Feeling Cold | FAERS: 5 | US FAERS | |
| 142 | Formication | FAERS: 5 | US FAERS | |
| 143 | Hemiparesis | FAERS: 5 | US FAERS | |
| 144 | Hyperventilation | FAERS: 5 | US FAERS | |
| 145 | Initial insomnia | FAERS: 5 | US FAERS | |
| 146 | Mental impairment | FAERS: 5 | US FAERS | |
| 147 | Muscle Rigidity | FAERS: 5 | US FAERS | |
| 148 | Musculoskeletal stiffness | FAERS: 5 | US FAERS | |
| 149 | Pregnancy | FAERS: 5 | US FAERS | |
| 150 | Rhabdomyolysis | FAERS: 5 | US FAERS | |
| 151 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 152 | Asthma | FAERS: 4 | US FAERS | |
| 153 | Bedridden | FAERS: 4 | US FAERS | |
| 154 | Blood amylase increased | FAERS: 4 | US FAERS | |
| 155 | Bradycardia | FAERS: 4 | US FAERS | |
| 156 | Bradyphrenia | FAERS: 4 | US FAERS | |
| 157 | Carcinogenic effect in offspring | FAERS: 4 | US FAERS | |
| 158 | Cerebral ventricle dilatation | FAERS: 4 | US FAERS | |
| 159 | Choking | FAERS: 4 | US FAERS | |
| 160 | Cleft Palate | FAERS: 4 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 161 | Colitis | FAERS: 4 | US FAERS | |
| 162 | Compulsive sexual behaviour | FAERS: 4 | US FAERS | |
| 163 | Congenital cystic kidney disease | FAERS: 4 | US FAERS | |
| 164 | Diplopia | FAERS: 4 | US FAERS | |
| 165 | Disease recurrence | FAERS: 4 | US FAERS | |
| 166 | Drug abuser | FAERS: 4 | US FAERS | |
| 167 | Drug abuse | FAERS: 4 | US FAERS | |
| 168 | Drug administration error | FAERS: 4 | US FAERS | |
| 169 | Drug exposure via breast milk | FAERS: 4 | US FAERS | |
| 170 | Dysarthria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 171 | Dystonia | FAERS: 4 | US FAERS | |
| 172 | Economic problem | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Electrocardiogram ST segment abnormal | FAERS: 4 | US FAERS | |
| 174 | Eyelid Function Disorder | FAERS: 4 | US FAERS | |
| 175 | Feeding disorder neonatal | FAERS: 4 | US FAERS | |
| 176 | Flight of ideas | FAERS: 4 | US FAERS | |
| 177 | Hepatitis | FAERS: 4 | US FAERS | |
| 178 | Hypersensitivity | FAERS: 4 | US FAERS | |
| 179 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 180 | Muscle tightness | FAERS: 4 | US FAERS | |
| 181 | Neck Pain | FAERS: 4 | US FAERS | |
| 182 | Panic Disorder | FAERS: 4 | US FAERS | |
| 183 | Respiratory arrest | FAERS: 4 | US FAERS | |
| 184 | Rhabdomyoma | FAERS: 4 | US FAERS | |
| 185 | Stridor | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 186 | Tachyphrenia | FAERS: 4 | US FAERS | |
| 187 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 188 | Urachal abnormality | FAERS: 4 | US FAERS | |
| 189 | Visual Impairment | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Acne | FAERS: 3 | US FAERS | |
| 191 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 192 | Angle Closure Glaucoma | FAERS: 3 | US FAERS | |
| 193 | Aphasia | FAERS: 3 | US FAERS | |
| 194 | Apparent life threatening event | FAERS: 3 | US FAERS | |
| 195 | Automatism | FAERS: 3 | US FAERS | |
| 196 | Autonomic nervous system imbalance | FAERS: 3 | US FAERS | |
| 197 | Bipolar Disorder | FAERS: 3 | US FAERS | |
| 198 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 199 | Cerebral atrophy | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Cerebrovascular accident | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 201 | Chest discomfort | FAERS: 3 | US FAERS | |
| 202 | Congenital visual acuity reduced | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Dandy-Walker Syndrome | FAERS: 3 | US FAERS | |
| 204 | Disturbance in sexual arousal | FAERS: 3 | US FAERS | |
| 205 | Dysgeusia | FAERS: 3 | US FAERS | |
| 206 | Dysphemia | FAERS: 3 | US FAERS | |
| 207 | Eye irritation | FAERS: 3 | US FAERS | |
| 208 | Flushing | FAERS: 3 | US FAERS | |
| 209 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 210 | Head deformity | FAERS: 3 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 211 | Hydrocephalus | FAERS: 3 | US FAERS | |
| 212 | Hyporeflexia | FAERS: 3 | US FAERS | |
| 213 | Immobile | FAERS: 3 | US FAERS | |
| 214 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 215 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 216 | Labyrinthitis | FAERS: 3 | US FAERS | |
| 217 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 218 | Live Birth | FAERS: 3 | US FAERS | |
| 219 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 220 | Neonatal respiratory failure | FAERS: 3 | US FAERS | |
| 221 | Nystagmus | FAERS: 3 | US FAERS | |
| 222 | Obsessive thoughts | FAERS: 3 | US FAERS | |
| 223 | Opisthotonus | FAERS: 3 | US FAERS | |
| 224 | Oral pain | FAERS: 3 | US FAERS | |
| 225 | Oxygen saturation abnormal | FAERS: 3 | US FAERS | |
| 226 | Poor sucking reflex | FAERS: 3 | US FAERS | |
| 227 | Pre-Eclampsia | FAERS: 3 | US FAERS | |
| 228 | Premature Ejaculation | FAERS: 3 | US FAERS | |
| 229 | Premenstrual syndrome | FAERS: 3 | US FAERS | |
| 230 | Product measured potency issue | FAERS: 3 | US FAERS | |
| 231 | Pulmonary malformation | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 232 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 233 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 234 | Sepsis | FAERS: 3 | US FAERS | |
| 235 | Skin lesion | FAERS: 3 | US FAERS | |
| 236 | Skin reaction | FAERS: 3 | US FAERS | |
| 237 | Therapeutic response changed | FAERS: 3 | US FAERS | |
| 238 | Thirst | FAERS: 3 | US FAERS | |
| 239 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 240 | Vasculitis | FAERS: 3 | US FAERS | |
| 241 | Vitreous floaters | FAERS: 3 | US FAERS | |
| 242 | Abasia | FAERS: 2 | US FAERS | |
| 243 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 244 | Accidental overdose | FAERS: 2 | US FAERS | |
| 245 | Acquired macrocephaly | FAERS: 2 | US FAERS | |
| 246 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 247 | Alcohol interaction | FAERS: 2 | US FAERS | |
| 248 | Anencephaly | FAERS: 2 | US FAERS | |
| 249 | Anosognosia | FAERS: 2 | US FAERS | |
| 250 | Aortic Valve Stenosis | FAERS: 2 | US FAERS | |
| 251 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 252 | Avoidant Personality Disorder | FAERS: 2 | US FAERS | |
| 253 | Bipolar I disorder | FAERS: 2 | US FAERS | |
| 254 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 255 | Bronchopulmonary Dysplasia | FAERS: 2 | US FAERS | |
| 256 | Burning sensation | FAERS: 2 | US FAERS | |
| 257 | Cerebral disorder | FAERS: 2 | US FAERS | |
| 258 | Chordee | FAERS: 2 | US FAERS | |
| 259 | Chromaturia | FAERS: 2 | US FAERS | |
| 260 | Cold sweat | FAERS: 2 | US FAERS | |
| 261 | Congenital Hypothyroidism | FAERS: 2 | US FAERS | |
| 262 | Congenital abdominal hernia | FAERS: 2 | US FAERS | |
| 263 | Congenital brain damage | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 264 | Congenital hyperextension of spine | FAERS: 2 | US FAERS | |
| 265 | Congenital inguinal hernia | FAERS: 2 | US FAERS | |
| 266 | Congenital neurological disorder | FAERS: 2 | US FAERS | |
| 267 | Craniosynostosis | FAERS: 2 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 268 | Deafness | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 269 | Dementia | FAERS: 2 | US FAERS | |
| 270 | Dextrocardia | FAERS: 2 | US FAERS | |
| 271 | Disease complication | FAERS: 2 | US FAERS | |
| 272 | Drug dispensing error | FAERS: 2 | US FAERS | |
| 273 | Drug toxicity | FAERS: 2 | US FAERS | |
| 274 | Dry skin | FAERS: 2 | US FAERS | |
| 275 | Electroencephalogram abnormal | FAERS: 2 | US FAERS | |
| 276 | Emotional poverty | FAERS: 2 | US FAERS | |
| 277 | Enzyme abnormality | FAERS: 2 | US FAERS | |
| 278 | Erection increased | FAERS: 2 | US FAERS | |
| 279 | Exophthalmos | FAERS: 2 | US FAERS | |
| 280 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 281 | Feeding disorder of infancy OR early childhood | FAERS: 2 | US FAERS | |
| 282 | Feelings of worthlessness | FAERS: 2 | US FAERS | |
| 283 | Head discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 284 | Head titubation | FAERS: 2 | US FAERS | |
| 285 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 286 | Hostility | FAERS: 2 | US FAERS | |
| 287 | Hypophagia | FAERS: 2 | US FAERS | |
| 288 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 289 | Inappropriate affect | FAERS: 2 | US FAERS | |
| 290 | Incoherent | FAERS: 2 | US FAERS | |
| 291 | Infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 292 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 293 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 294 | Left ventricle outflow tract obstruction | FAERS: 2 | US FAERS | |
| 295 | Malnutrition | FAERS: 2 | US FAERS | |
| 296 | Medication residue | FAERS: 2 | US FAERS | |
| 297 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 298 | Microcephaly | FAERS: 2 | US FAERS | |
| 299 | Middle insomnia | FAERS: 2 | US FAERS | |
| 300 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 301 | Murder | FAERS: 2 | US FAERS | |
| 302 | Muscle Spasticity | FAERS: 2 | US FAERS | |
| 303 | Myocardial Infarction | FAERS: 2 | US FAERS | |
| 304 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 305 | Oligodipsia | FAERS: 2 | US FAERS | |
| 306 | Ophthalmoplegia | FAERS: 2 | US FAERS | |
| 307 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 308 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 309 | Photophobia | FAERS: 2 | US FAERS | |
| 310 | Pneumonia | FAERS: 2 | US FAERS | |
| 311 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 312 | Poor personal hygiene | FAERS: 2 | US FAERS | |
| 313 | Regurgitation of food | FAERS: 2 | US FAERS | |
| 314 | Retching | FAERS: 2 | US FAERS | |
| 315 | Reversible cerebral vasoconstriction syndrome | FAERS: 2 | US FAERS | |
| 316 | Schizophrenia | FAERS: 2 | US FAERS | |
| 317 | Screaming | FAERS: 2 | US FAERS | |
| 318 | Serum serotonin decreased | FAERS: 2 | US FAERS | |
| 319 | Single umbilical artery | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 320 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 321 | Snoring | FAERS: 2 | US FAERS | |
| 322 | Somnambulism | FAERS: 2 | US FAERS | |
| 323 | Spina Bifida | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 324 | Staring | FAERS: 2 | US FAERS | |
| 325 | Temperature regulation disorder | FAERS: 2 | US FAERS | |
| 326 | Theft | FAERS: 2 | US FAERS | |
| 327 | Therapy cessation | FAERS: 2 | US FAERS | |
| 328 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 329 | Tongue biting | FAERS: 2 | US FAERS | |
| 330 | Toxicologic test abnormal | FAERS: 2 | US FAERS | |
| 331 | Trismus | FAERS: 2 | US FAERS | |
| 332 | Underweight | FAERS: 2 | US FAERS | |
| 333 | Urinary Retention | FAERS: 2 | US FAERS | |
| 334 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 335 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 336 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 337 | jaundice | FAERS: 2 | US FAERS | |
| 338 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 339 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 340 | Amniotic cavity disorder | FAERS: 1 | US FAERS | |
| 341 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 342 | Angioedema | FAERS: 1 | US FAERS | |
| 343 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 344 | Anticipatory anxiety | FAERS: 1 | US FAERS | |
| 345 | Aphagia | FAERS: 1 | US FAERS | |
| 346 | Arterial bruit | FAERS: 1 | US FAERS | |
| 347 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 348 | Asthenopia | FAERS: 1 | US FAERS | |
| 349 | Ataxia | FAERS: 1 | US FAERS | |
| 350 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 351 | Atrioventricular Septal Defect | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 352 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 353 | Autoscopy | FAERS: 1 | US FAERS | |
| 354 | Back Pain | FAERS: 1 | US FAERS | |
| 355 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 356 | Blepharospasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 357 | Blindness | FAERS: 1 | US FAERS | |
| 358 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 359 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 360 | Blood caffeine | FAERS: 1 | US FAERS | |
| 361 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 362 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 363 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 364 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 365 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 366 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 367 | Blood uric acid decreased | FAERS: 1 | US FAERS | |
| 368 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 369 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 370 | Breast hyperplasia | FAERS: 1 | US FAERS | |
| 371 | Brief psychotic disorder, with postpartum onset | FAERS: 1 | US FAERS | |
| 372 | Bronchiectasis | FAERS: 1 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 373 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 374 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 375 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 376 | Cardio-respiratory distress | FAERS: 1 | US FAERS | |
| 377 | Cardiomegaly | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 378 | Cellulitis | FAERS: 1 | US FAERS | |
| 379 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 380 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 381 | Cerebral vasoconstriction | FAERS: 1 | US FAERS | |
| 382 | Cholestasis | FAERS: 1 | US FAERS | |
| 383 | Chorea | FAERS: 1 | US FAERS | |
| 384 | Clonus | FAERS: 1 | US FAERS | |
| 385 | Clumsiness | FAERS: 1 | US FAERS | |
| 386 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 387 | Congenital cerebellar agenesis | FAERS: 1 | US FAERS | |
| 388 | Congenital hydronephrosis | FAERS: 1 | US FAERS | |
| 389 | Congenital renal cyst | FAERS: 1 | US FAERS | |
| 390 | Congenital renal disorder | FAERS: 1 | US FAERS | |
| 391 | Congenital teratoma | FAERS: 1 | US FAERS | |
| 392 | Congenital torticollis | FAERS: 1 | US FAERS | |
| 393 | Craniofacial Dysostosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 394 | Cutaneous sarcoidosis | FAERS: 1 | US FAERS | |
| 395 | Cystitis | FAERS: 1 | US FAERS | |
| 396 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 397 | Death of friend | FAERS: 1 | US FAERS | |
| 398 | Decreased immune responsiveness | FAERS: 1 | US FAERS | |
| 399 | Dependent Personality Disorder | FAERS: 1 | US FAERS | |
| 400 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 401 | Diabetic Autonomic Neuropathy | FAERS: 1 | US FAERS | |
| 402 | Disease Progression | FAERS: 1 | US FAERS | |
| 403 | Dissociative Identity Disorder | FAERS: 1 | US FAERS | |
| 404 | Diverticulitis | FAERS: 1 | US FAERS | |
| 405 | Double Outlet Right Ventricle | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 406 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 407 | Drug level changed | FAERS: 1 | US FAERS | |
| 408 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 409 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 410 | Dysphasia | FAERS: 1 | US FAERS | |
| 411 | Dysthymic Disorder | FAERS: 1 | US FAERS | |
| 412 | Ear discomfort | FAERS: 1 | US FAERS | |
| 413 | Ecchymosis | FAERS: 1 | US FAERS | |
| 414 | Eczema | FAERS: 1 | US FAERS | |
| 415 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 416 | Endometriosis | FAERS: 1 | US FAERS | |
| 417 | Epilepsy | FAERS: 1 | US FAERS | |
| 418 | Erysipelas | FAERS: 1 | US FAERS | |
| 419 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 420 | Excitability | FAERS: 1 | US FAERS | |
| 421 | Exposure via ingestion | FAERS: 1 | US FAERS | |
| 422 | Eye Redness | FAERS: 1 | US FAERS | |
| 423 | Facial Paresis | FAERS: 1 | US FAERS | |
| 424 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 425 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 426 | Female sexual dysfunction | FAERS: 1 | US FAERS | |
| 427 | Fine motor delay | FAERS: 1 | US FAERS | |
| 428 | Flank Pain | FAERS: 1 | US FAERS | |
| 429 | Flatulence | FAERS: 1 | US FAERS | |
| 430 | Fluid overload | FAERS: 1 | US FAERS | |
| 431 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 432 | Gastritis | FAERS: 1 | US FAERS | |
| 433 | Gastrointestinal disorder congenital | FAERS: 1 | US FAERS | |
| 434 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 435 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 436 | Glaucoma | FAERS: 1 | US FAERS | |
| 437 | Glossoptosis | FAERS: 1 | US FAERS | |
| 438 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 439 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 440 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 441 | Herbal interaction | FAERS: 1 | US FAERS | |
| 442 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 443 | Hunger | FAERS: 1 | US FAERS | |
| 444 | Hypereosinophilic syndrome | FAERS: 1 | US FAERS | |
| 445 | Hyperphagia | FAERS: 1 | US FAERS | |
| 446 | Hyperviscosity syndrome | FAERS: 1 | US FAERS | |
| 447 | Hypokinesia | FAERS: 1 | US FAERS | |
| 448 | Hypotension | FAERS: 1 | US FAERS | |
| 449 | Immature respiratory system | FAERS: 1 | US FAERS | |
| 450 | Impatience | FAERS: 1 | US FAERS | |
| 451 | Incontinence | FAERS: 1 | US FAERS | |
| 452 | Infantile asthma | FAERS: 1 | US FAERS | |
| 453 | Infarction | FAERS: 1 | US FAERS | |
| 454 | Inflammatory pain | FAERS: 1 | US FAERS | |
| 455 | Intermittent Explosive Disorder | FAERS: 1 | US FAERS | |
| 456 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 457 | Joint stiffness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 458 | Kleptomania | FAERS: 1 | US FAERS | |
| 459 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 460 | Laceration | FAERS: 1 | US FAERS | |
| 461 | Laryngeal neoplasm | FAERS: 1 | US FAERS | |
| 462 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 463 | Leukopenia | FAERS: 1 | US FAERS | |
| 464 | Lip swelling | FAERS: 1 | US FAERS | |
| 465 | Lipase increased | FAERS: 1 | US FAERS | |
| 466 | Liver prolapse | FAERS: 1 | US FAERS | |
| 467 | Macrocephaly | FAERS: 1 | US FAERS | |
| 468 | Macular degeneration | FAERS: 1 | US FAERS | |
| 469 | Medication residue present | FAERS: 1 | US FAERS | |
| 470 | Meningioma | FAERS: 1 | US FAERS | |
| 471 | Metanephrine urine increased | FAERS: 1 | US FAERS | |
| 472 | Mitochondrial cytopathy | FAERS: 1 | US FAERS | |
| 473 | Monoparesis | FAERS: 1 | US FAERS | |
| 474 | Monoplegia | FAERS: 1 | US FAERS | |
| 475 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 476 | Motion Sickness | FAERS: 1 | US FAERS | |
| 477 | Musculoskeletal discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 478 | Mutism | FAERS: 1 | US FAERS | |
| 479 | Myositis-like syndrome | FAERS: 1 | US FAERS | |
| 480 | Narcissistic Personality Disorder | FAERS: 1 | US FAERS | |
| 481 | Nerve injury | FAERS: 1 | US FAERS | |
| 482 | Neuralgic Amyotrophy | FAERS: 1 | US FAERS | |
| 483 | Neurogenic Bowel | FAERS: 1 | US FAERS | |
| 484 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 485 | Neurological examination abnormal | FAERS: 1 | US FAERS | |
| 486 | No adverse event | FAERS: 1 | US FAERS | |
| 487 | Nocturia | FAERS: 1 | US FAERS | |
| 488 | Nocturnal emission | FAERS: 1 | US FAERS | |
| 489 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 490 | Ototoxicity | FAERS: 1 | US FAERS | |
| 491 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 492 | Pancreatitis | FAERS: 1 | US FAERS | |
| 493 | Paranoid Personality Disorder | FAERS: 1 | US FAERS | |
| 494 | Paraplegia | FAERS: 1 | US FAERS | |
| 495 | Partner stress | FAERS: 1 | US FAERS | |
| 496 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 497 | Phonophobia | FAERS: 1 | US FAERS | |
| 498 | Pierre Robin Syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 499 | Pilonidal cyst congenital | FAERS: 1 | US FAERS | |
| 500 | Plagiocephaly | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 501 | Pneumothorax | FAERS: 1 | US FAERS | |
| 502 | Poisoning | FAERS: 1 | US FAERS | |
| 503 | Polyhydramnios | FAERS: 1 | US FAERS | |
| 504 | Polyuria | FAERS: 1 | US FAERS | |
| 505 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 506 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 507 | Post-traumatic amnestic disorder | FAERS: 1 | US FAERS | |
| 508 | Presbyopia | FAERS: 1 | US FAERS | |
| 509 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 510 | Pressure of speech | FAERS: 1 | US FAERS | |
| 511 | Presyncope | FAERS: 1 | US FAERS | |
| 512 | Primary Hypothyroidism | FAERS: 1 | US FAERS | |
| 513 | Product dose omission | FAERS: 1 | US FAERS | |
| 514 | Product physical issue | FAERS: 1 | US FAERS | |
| 515 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 516 | Proteinuria | FAERS: 1 | US FAERS | |
| 517 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 518 | Pulmonary artery stenosis | FAERS: 1 | US FAERS | |
| 519 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 520 | Purpura | FAERS: 1 | US FAERS | |
| 521 | Reaction to azo-dyes | FAERS: 1 | US FAERS | |
| 522 | Renal cyst | FAERS: 1 | US FAERS | |
| 523 | Residual urine | FAERS: 1 | US FAERS | |
| 524 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 525 | Retrognathia | FAERS: 1 | US FAERS | |
| 526 | Right Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 527 | Right atrial dilatation | FAERS: 1 | US FAERS | |
| 528 | Right ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 529 | Saliva altered | FAERS: 1 | US FAERS | |
| 530 | Secretion discharge | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 531 | Septic Shock | FAERS: 1 | US FAERS | |
| 532 | Shock | FAERS: 1 | US FAERS | |
| 533 | Shoplifting | FAERS: 1 | US FAERS | |
| 534 | Shoulder Pain | FAERS: 1 | US FAERS | |
| 535 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 536 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 537 | Skin irritation | FAERS: 1 | US FAERS | |
| 538 | Sneezing | FAERS: 1 | US FAERS | |
| 539 | Soliloquy | FAERS: 1 | US FAERS | |
| 540 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 541 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 542 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 543 | Stereotypic Movement Disorder | FAERS: 1 | US FAERS | |
| 544 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 545 | Stillbirth | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 546 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 547 | Sunburn | FAERS: 1 | US FAERS | |
| 548 | Syndactyly | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 549 | Tension Headache | FAERS: 1 | US FAERS | |
| 550 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 551 | Throat irritation | FAERS: 1 | US FAERS | |
| 552 | Tobacco user | FAERS: 1 | US FAERS | |
| 553 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 554 | Tooth Loss | FAERS: 1 | US FAERS | |
| 555 | Torticollis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 556 | Tracheomalacia | FAERS: 1 | US FAERS | |
| 557 | Transmission of drug via semen | FAERS: 1 | US FAERS | |
| 558 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 559 | Unemployment | FAERS: 1 | US FAERS | |
| 560 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 561 | Vein pain | FAERS: 1 | US FAERS | |
| 562 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 563 | Ventricular hypoplasia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 564 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 565 | Wound Infection | FAERS: 1 | US FAERS | |
| 566 | treatment failure | FAERS: 1 | US FAERS | |
| 567 | Abdominal wall cyst | Canada Vigilance: 1 | Canada Vigilance | |
| 568 | Angina Pectoris | Canada Vigilance: 1 | Canada Vigilance | |
| 569 | Aortic Valve Prolapse | Canada Vigilance: 1 | Canada Vigilance | |
| 570 | Arthropathy | Canada Vigilance: 1 | Canada Vigilance | |
| 571 | Atelectasis | Canada Vigilance: 2 | Canada Vigilance | |
| 572 | Bone lesion | Canada Vigilance: 1 | Canada Vigilance | |
| 573 | Cardiac ventricular disorder | Canada Vigilance: 1 | Canada Vigilance | |
| 574 | Cleft uvula | Canada Vigilance: 1 | Canada Vigilance | |
| 575 | Colloid brain cyst | Canada Vigilance: 1 | Canada Vigilance | |
| 576 | Congenital diaphragmatic hernia | Canada Vigilance: 1 | Canada Vigilance | |
| 577 | Congenital laryngeal stridor | Canada Vigilance: 1 | Canada Vigilance | |
| 578 | Congenital skin dimples | Canada Vigilance: 1 | Canada Vigilance | |
| 579 | Cyclothymic Disorder | Canada Vigilance: 1 | Canada Vigilance | |
| 580 | Dental alveolar anomaly | Canada Vigilance: 1 | Canada Vigilance | |
| 581 | Duodenal atresia | Canada Vigilance: 1 | Canada Vigilance | |
| 582 | Dysplasia | Canada Vigilance: 1 | Canada Vigilance | |
| 583 | Encephalocele | Canada Vigilance: 1 | Canada Vigilance | |
| 584 | Exposure via breast milk | Canada Vigilance: 1 | Canada Vigilance | |
| 585 | Gastroschisis | Canada Vigilance: 2 | Canada Vigilance | |
| 586 | Gingivitis | Canada Vigilance: 1 | Canada Vigilance | |
| 587 | Hepatomegaly | Canada Vigilance: 1 | Canada Vigilance | |
| 588 | Hirsutism | Canada Vigilance: 1 | Canada Vigilance | |
| 589 | Hydronephrosis | Canada Vigilance: 1 | Canada Vigilance | |
| 590 | Joint injury | Canada Vigilance: 1 | Canada Vigilance | |
| 591 | Malocclusion | Canada Vigilance: 1 | Canada Vigilance | |
| 592 | Meningomyelocele | Canada Vigilance: 2 | Canada Vigilance | |
| 593 | Oligohydramnios | Canada Vigilance: 1 | Canada Vigilance | |
| 594 | Oropharyngeal plaque | Canada Vigilance: 1 | Canada Vigilance | |
| 595 | Otitis Media | Canada Vigilance: 1 | Canada Vigilance | |
| 596 | Pelvic cyst | Canada Vigilance: 1 | Canada Vigilance | |
| 597 | Personal relationship issue | Canada Vigilance: 1 | Canada Vigilance | |
| 598 | Physical disability | Canada Vigilance: 1 | Canada Vigilance | |
| 599 | Polydactyly | Canada Vigilance: 1 | Canada Vigilance | |
| 600 | Premature baby death | Canada Vigilance: 1 | Canada Vigilance | |
| 601 | Pulmonary arterial hypertension | Canada Vigilance: 1 | Canada Vigilance | |
| 602 | Retinopathy of Prematurity | Canada Vigilance: 1 | Canada Vigilance | |
| 603 | Single functional kidney | Canada Vigilance: 1 | Canada Vigilance | |
| 604 | Skin Papilloma | Canada Vigilance: 1 | Canada Vigilance | |
| 605 | Vocal Cord Paralysis | Canada Vigilance: 1 | Canada Vigilance | |
| 606 | Wrist deformity | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.