Losartan
(PSIFNNKUMBGKDQ-UHFFFAOYSA-N)
Structure
- SMILES
- CCCCc1nc(c(n1Cc1ccc(cc1)c1ccccc1c1n[nH]nn1)CO)Cl
- Type(s)
- Approved
- ATC code(s)
- C09CA01; C09DA01; C09DB06
- Molecular Formula:
- C22H23ClN6O
- Molecular Weight:
- 422.911
- Log P:
- 4.2668
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 92.51
- CAS Number(s):
- 114798-26-4
Synonym(s)
1.
Losartan
2.
2-Butyl-4-chloro-1-((2'-(1H-etrazol-5-yl) (1,1'-biphenyl)-4-yl)methyl)-1H-imidazole-5-methanol
3.
Cozaar
4.
DuP-753
5.
Losartan Monopotassium Salt
6.
Losartan Potassium
7.
MK-954
8.
MK954
9.
DuP 753
10.
DuP753
11.
MK 954
12.
Monopotassium Salt, Losartan
13.
Potassium, Losartan
14.
Salt, Losartan Monopotassium
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 121 Canada Vigilance: 32 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 110 Canada Vigilance: 9 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 3 | Angioedema | FAERS: 100 Canada Vigilance: 1 | CTD SIDER Canada Vigilance US FAERS | |
| 4 | Headache | FAERS: 70 Canada Vigilance: 8 | 10455478 14646368 | CTD SIDER Canada Vigilance US FAERS |
| 5 | Nausea | FAERS: 70 Canada Vigilance: 7 | 10455478 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 6 | Fatigue | FAERS: 62 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 7 | Product substitution issue | FAERS: 58 Canada Vigilance: 44 | Canada Vigilance US FAERS | |
| 8 | Malaise | FAERS: 49 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 9 | Hypotension | FAERS: 43 Canada Vigilance: 1 | CTD SIDER Canada Vigilance US FAERS | |
| 10 | Palpitations | FAERS: 36 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 11 | Feeling abnormal | FAERS: 35 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 12 | Pain | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 13 | Pruritus | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 14 | Asthenia | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 15 | Sprue-like enteropathy | FAERS: 26 | US FAERS | |
| 16 | Vomiting | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 17 | Adverse event | FAERS: 25 | OFFSIDES US FAERS | |
| 18 | Arthralgia | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 19 | Hypersensitivity | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 20 | Product quality issue | FAERS: 24 | US FAERS | |
| 21 | Urticaria | FAERS: 24 Canada Vigilance: 1 | 20726206 | CTD SIDER Canada Vigilance US FAERS |
| 22 | Weight decreased | FAERS: 23 | US FAERS | |
| 23 | Alopecia | FAERS: 22 | OFFSIDES SIDER US FAERS | |
| 24 | Atrial Fibrillation | FAERS: 22 | SIDER US FAERS | |
| 25 | Back Pain | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 26 | Myocardial Infarction | FAERS: 21 Canada Vigilance: 1 | CTD Canada Vigilance US FAERS | |
| 27 | Joint swelling | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 28 | Abdominal discomfort | FAERS: 18 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 29 | Anxiety | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 30 | Peripheral swelling | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Acute kidney injury | FAERS: 17 | CTD US FAERS | |
| 32 | Dysphonia | FAERS: 17 | US FAERS | |
| 33 | Syncope | FAERS: 17 Canada Vigilance: 1 | 19708228 | CTD SIDER Canada Vigilance US FAERS |
| 34 | Abdominal Pain | FAERS: 16 | 15464190 | CTD OFFSIDES SIDER US FAERS |
| 35 | Chest discomfort | FAERS: 16 | US FAERS | |
| 36 | Chest Pain | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 37 | Medication Error | FAERS: 15 | US FAERS | |
| 38 | Wrong technique in product usage process | FAERS: 15 | US FAERS | |
| 39 | Blood pressure inadequately controlled | FAERS: 14 Canada Vigilance: 13 | Canada Vigilance OFFSIDES US FAERS | |
| 40 | Blood pressure fluctuation | FAERS: 13 | US FAERS | |
| 41 | Myalgia | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 42 | Recalled product administered | FAERS: 13 | US FAERS | |
| 43 | Pancreatitis | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 44 | Cerebrovascular accident | FAERS: 11 | US FAERS | |
| 45 | Malabsorption | FAERS: 11 | US FAERS | |
| 46 | Nasopharyngitis | FAERS: 11 | US FAERS | |
| 47 | Urinary tract infection | FAERS: 11 | SIDER US FAERS | |
| 48 | Deafness | FAERS: 10 | US FAERS | |
| 49 | Dehydration | FAERS: 10 | OFFSIDES US FAERS | |
| 50 | Drug exposure during pregnancy | FAERS: 10 | US FAERS | |
| 51 | Dysgeusia | FAERS: 10 | 9653007 18786897 | CTD SIDER US FAERS |
| 52 | Lip swelling | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Metabolic acidosis | FAERS: 10 | OFFSIDES US FAERS | |
| 54 | No adverse event | FAERS: 10 | US FAERS | |
| 55 | Oligohydramnios | FAERS: 10 | OFFSIDES US FAERS | |
| 56 | Therapy change | FAERS: 10 | US FAERS | |
| 57 | Abnormal weight gain | FAERS: 9 | US FAERS | |
| 58 | Blood creatinine increased | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 59 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 60 | Depressed mood | FAERS: 9 | US FAERS | |
| 61 | Hypertensive crisis | FAERS: 9 | US FAERS | |
| 62 | Immune thrombocytopenic purpura | FAERS: 9 | US FAERS | |
| 63 | Incorrect dose administered | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Intestinal angioedema | FAERS: 9 | US FAERS | |
| 65 | Product dispensing error | FAERS: 9 | US FAERS | |
| 66 | Somnolence | FAERS: 9 | SIDER US FAERS | |
| 67 | Blood potassium increased | FAERS: 8 | US FAERS | |
| 68 | Epistaxis | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 69 | Erythema | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 70 | Lethargy | FAERS: 8 | US FAERS | |
| 71 | Rhabdomyolysis | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 72 | Sneezing | FAERS: 8 | US FAERS | |
| 73 | Tremor | FAERS: 8 | SIDER US FAERS | |
| 74 | Vertigo | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 75 | Choking | FAERS: 7 | US FAERS | |
| 76 | Musculoskeletal stiffness | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 77 | Pallor | FAERS: 7 | US FAERS | |
| 78 | Pneumonia | FAERS: 7 | SIDER US FAERS | |
| 79 | Therapy non-responder | FAERS: 7 | US FAERS | |
| 80 | Throat irritation | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 81 | Toxicity to various agents | FAERS: 7 | US FAERS | |
| 82 | Urinary Retention | FAERS: 7 | US FAERS | |
| 83 | Visual Impairment | FAERS: 7 | US FAERS | |
| 84 | Abdominal tenderness | FAERS: 6 | US FAERS | |
| 85 | Accidental overdose | FAERS: 6 | US FAERS | |
| 86 | Acute myocardial infarction | FAERS: 6 | US FAERS | |
| 87 | Blood creatine phosphokinase increased | FAERS: 6 | US FAERS | |
| 88 | Blood potassium decreased | FAERS: 6 | US FAERS | |
| 89 | Chronic gastritis | FAERS: 6 | US FAERS | |
| 90 | Constipation | FAERS: 6 | SIDER US FAERS | |
| 91 | Drug dispensing error | FAERS: 6 | US FAERS | |
| 92 | Drug dose omission | FAERS: 6 | US FAERS | |
| 93 | Gastritis | FAERS: 6 | SIDER US FAERS | |
| 94 | Gout | FAERS: 6 | 12759298 | CTD SIDER US FAERS |
| 95 | Tinnitus | FAERS: 6 | SIDER US FAERS | |
| 96 | Wheezing | FAERS: 6 | US FAERS | |
| 97 | Bradycardia | FAERS: 5 | 15685215 19708228 | CTD OFFSIDES US FAERS |
| 98 | Delirium | FAERS: 5 | US FAERS | |
| 99 | Depressed Level of Consciousness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 100 | Diabetes Mellitus | FAERS: 5 | SIDER US FAERS | |
| 101 | Disorientation | FAERS: 5 | US FAERS | |
| 102 | Drug prescribing error | FAERS: 5 | US FAERS | |
| 103 | Duodenal ulcer perforation | FAERS: 5 | US FAERS | |
| 104 | Dyspepsia | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 105 | Exfoliative rash | FAERS: 5 | US FAERS | |
| 106 | Flushing | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 107 | Lymphoma | FAERS: 5 | US FAERS | |
| 108 | Memory impairment | FAERS: 5 | SIDER US FAERS | |
| 109 | Nephrolithiasis | FAERS: 5 | OFFSIDES US FAERS | |
| 110 | Oropharyngeal pain | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 111 | Pancreatic carcinoma | FAERS: 5 | US FAERS | |
| 112 | Respiratory Failure | FAERS: 5 | OFFSIDES US FAERS | |
| 113 | Abasia | FAERS: 4 | OFFSIDES US FAERS | |
| 114 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 115 | Altered state of consciousness | FAERS: 4 | OFFSIDES US FAERS | |
| 116 | Anaphylactic shock | FAERS: 4 | SIDER US FAERS | |
| 117 | Aphonia | FAERS: 4 | US FAERS | |
| 118 | Aspartate Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 119 | Blood sodium decreased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 120 | Blood urea increased | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 121 | Bronchitis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 122 | Cheilitis | FAERS: 4 | OFFSIDES US FAERS | |
| 123 | Chills | FAERS: 4 | US FAERS | |
| 124 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 125 | Discomfort | FAERS: 4 | SIDER US FAERS | |
| 126 | Eczema | FAERS: 4 | US FAERS | |
| 127 | Flatulence | FAERS: 4 | SIDER US FAERS | |
| 128 | Influenza | FAERS: 4 | SIDER US FAERS | |
| 129 | Laryngitis | FAERS: 4 | US FAERS | |
| 130 | Musculoskeletal Pain | FAERS: 4 | SIDER US FAERS | |
| 131 | Myopathy | FAERS: 4 | US FAERS | |
| 132 | Pityriasis | FAERS: 4 | US FAERS | |
| 133 | Prerenal failure | FAERS: 4 | US FAERS | |
| 134 | Scab | FAERS: 4 | US FAERS | |
| 135 | Sepsis | FAERS: 4 | US FAERS | |
| 136 | Swelling | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 137 | Tachycardia | FAERS: 4 | 9038987 | CTD SIDER US FAERS |
| 138 | Thyroid Neoplasm | FAERS: 4 | US FAERS | |
| 139 | Unevaluable event | FAERS: 4 | US FAERS | |
| 140 | Wrong drug administered | FAERS: 4 | US FAERS | |
| 141 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 142 | Allergy to arthropod sting | FAERS: 3 | US FAERS | |
| 143 | Amnesia | FAERS: 3 | US FAERS | |
| 144 | Anorexia | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 145 | Bone pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 146 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 147 | Cerebellar infarction | FAERS: 3 | US FAERS | |
| 148 | Circumstance or information capable of leading to medication error | FAERS: 3 | OFFSIDES US FAERS | |
| 149 | Colitis | FAERS: 3 | OFFSIDES US FAERS | |
| 150 | Disease complication | FAERS: 3 | US FAERS | |
| 151 | Drug dispensed to wrong patient | FAERS: 3 | US FAERS | |
| 152 | Dysuria | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 153 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 154 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 155 | Gastric ulcer | FAERS: 3 | US FAERS | |
| 156 | Head discomfort | FAERS: 3 | US FAERS | |
| 157 | Hypoxia | FAERS: 3 | US FAERS | |
| 158 | Impaired work ability | FAERS: 3 | US FAERS | |
| 159 | Inappropriate schedule of drug administration | FAERS: 3 | US FAERS | |
| 160 | Microcephaly | FAERS: 3 | US FAERS | |
| 161 | Nervousness | FAERS: 3 | SIDER US FAERS | |
| 162 | Oral pain | FAERS: 3 | US FAERS | |
| 163 | Overdose | FAERS: 3 | US FAERS | |
| 164 | Pain of skin | FAERS: 3 | US FAERS | |
| 165 | Petechiae | FAERS: 3 | US FAERS | |
| 166 | Presyncope | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Product formulation issue | FAERS: 3 | US FAERS | |
| 168 | Productive Cough | FAERS: 3 | US FAERS | |
| 169 | Reaction to excipient | FAERS: 3 | US FAERS | |
| 170 | Restlessness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 171 | Squamous cell carcinoma of skin | FAERS: 3 | OFFSIDES US FAERS | |
| 172 | jaundice | FAERS: 3 | SIDER US FAERS | |
| 173 | Abscess | FAERS: 2 | US FAERS | |
| 174 | Arthritis | FAERS: 2 | SIDER US FAERS | |
| 175 | Arthropathy | FAERS: 2 | OFFSIDES US FAERS | |
| 176 | Arthropod sting | FAERS: 2 | US FAERS | |
| 177 | Atrial Flutter | FAERS: 2 | OFFSIDES US FAERS | |
| 178 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 179 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 180 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 181 | Blood urine present | FAERS: 2 | US FAERS | |
| 182 | Burning sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 183 | Cataract | FAERS: 2 | 30958922 | CTD OFFSIDES SIDER US FAERS |
| 184 | Cholestasis | FAERS: 2 | US FAERS | |
| 185 | Cold sweat | FAERS: 2 | US FAERS | |
| 186 | Congenital cystic kidney disease | FAERS: 2 | US FAERS | |
| 187 | Congenital renal disorder | FAERS: 2 | US FAERS | |
| 188 | Crying | FAERS: 2 | OFFSIDES US FAERS | |
| 189 | Diplopia | FAERS: 2 | OFFSIDES US FAERS | |
| 190 | Dry skin | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 191 | Dysarthria | FAERS: 2 | 9342587 | CTD US FAERS |
| 192 | Eye pain | FAERS: 2 | US FAERS | |
| 193 | Gait inability | FAERS: 2 | US FAERS | |
| 194 | General physical health deterioration | FAERS: 2 | OFFSIDES US FAERS | |
| 195 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 196 | Infection | FAERS: 2 | SIDER US FAERS | |
| 197 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 198 | Joint stiffness | FAERS: 2 | OFFSIDES US FAERS | |
| 199 | Limb discomfort | FAERS: 2 | US FAERS | |
| 200 | Lip and/or oral cavity cancer | FAERS: 2 | US FAERS | |
| 201 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 202 | Megakaryocytes increased | FAERS: 2 | US FAERS | |
| 203 | Mental impairment | FAERS: 2 | OFFSIDES US FAERS | |
| 204 | Mouth swelling | FAERS: 2 | US FAERS | |
| 205 | Neck Pain | FAERS: 2 | US FAERS | |
| 206 | Nocturia | FAERS: 2 | SIDER US FAERS | |
| 207 | Noninfectious peritonitis | FAERS: 2 | US FAERS | |
| 208 | Oral pruritus | FAERS: 2 | US FAERS | |
| 209 | Osteoporosis | FAERS: 2 | 18847324 | CTD US FAERS |
| 210 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 211 | Pericarditis | FAERS: 2 | US FAERS | |
| 212 | Peripheral occlusive disease | FAERS: 2 | US FAERS | |
| 213 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 214 | Phlebitis | FAERS: 2 | US FAERS | |
| 215 | Photodermatosis | FAERS: 2 | US FAERS | |
| 216 | Polyneuropathy | FAERS: 2 | US FAERS | |
| 217 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 218 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 219 | Product use complaint | FAERS: 2 | US FAERS | |
| 220 | Product use issue | FAERS: 2 | US FAERS | |
| 221 | Rash erythematous | FAERS: 2 | US FAERS | |
| 222 | Renal impairment neonatal | FAERS: 2 | US FAERS | |
| 223 | Renal pain | FAERS: 2 | US FAERS | |
| 224 | Respiratory distress | FAERS: 2 | SIDER US FAERS | |
| 225 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 226 | Skin reaction | FAERS: 2 | US FAERS | |
| 227 | Splenomegaly | FAERS: 2 | US FAERS | |
| 228 | Sudden death | FAERS: 2 | US FAERS | |
| 229 | Thrombosis | FAERS: 2 | 11881036 | CTD US FAERS |
| 230 | Transaminases increased | FAERS: 2 | US FAERS | |
| 231 | Viral upper respiratory tract infection | FAERS: 2 | US FAERS | |
| 232 | White blood cell count abnormal | FAERS: 2 | US FAERS | |
| 233 | Wrong product administered | FAERS: 2 | US FAERS | |
| 234 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 235 | Acantholysis | FAERS: 1 | US FAERS | |
| 236 | Accidental exposure to product packaging | FAERS: 1 | US FAERS | |
| 237 | Accidental exposure | FAERS: 1 | US FAERS | |
| 238 | Actinic keratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 239 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 240 | Adrenal mass | FAERS: 1 | OFFSIDES US FAERS | |
| 241 | Ageusia | FAERS: 1 | 11985643 | CTD OFFSIDES US FAERS |
| 242 | Agitation | FAERS: 1 | SIDER US FAERS | |
| 243 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 244 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 245 | Angina Pectoris | FAERS: 1 | SIDER US FAERS | |
| 246 | Angioplasty | FAERS: 1 | US FAERS | |
| 247 | Anuria | FAERS: 1 | 11256525 14685757 | CTD US FAERS |
| 248 | Apathy | FAERS: 1 | OFFSIDES US FAERS | |
| 249 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 250 | Application site irritation | FAERS: 1 | US FAERS | |
| 251 | Ascites | FAERS: 1 | US FAERS | |
| 252 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 253 | Asthma | FAERS: 1 | US FAERS | |
| 254 | Ataxia | FAERS: 1 | 9342587 | CTD OFFSIDES SIDER US FAERS |
| 255 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 256 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 257 | Back disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 258 | Bedridden | FAERS: 1 | US FAERS | |
| 259 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 260 | Bile duct adenocarcinoma | FAERS: 1 | US FAERS | |
| 261 | Biliary Colic | FAERS: 1 | US FAERS | |
| 262 | Blepharospasm | FAERS: 1 | US FAERS | |
| 263 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 264 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 265 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 266 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 267 | Blood phosphorus decreased | FAERS: 1 | US FAERS | |
| 268 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 269 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 270 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 271 | Brain Death | FAERS: 1 | US FAERS | |
| 272 | Breast cancer stage III | FAERS: 1 | US FAERS | |
| 273 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 274 | Bursitis | FAERS: 1 | US FAERS | |
| 275 | Cardiac Death | FAERS: 1 | US FAERS | |
| 276 | Cardiac Flutter | FAERS: 1 | OFFSIDES US FAERS | |
| 277 | Cardiomegaly | FAERS: 1 |
7524366
7564367 8238566 8583479 9336375 9869009 10424880 11175471 12013499 12411096 12586211 14602500 15969258 18800450 | CTD US FAERS |
| 278 | Cataract operation | FAERS: 1 | US FAERS | |
| 279 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 280 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 281 | Cerebral salt-wasting syndrome | FAERS: 1 | US FAERS | |
| 282 | Cholangitis | FAERS: 1 | US FAERS | |
| 283 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 284 | Completed Suicide | FAERS: 1 | US FAERS | |
| 285 | Congenital hepatobiliary anomaly | FAERS: 1 | US FAERS | |
| 286 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 287 | Cyanosis | FAERS: 1 | US FAERS | |
| 288 | Cystitis | FAERS: 1 | US FAERS | |
| 289 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 290 | Dental caries | FAERS: 1 | US FAERS | |
| 291 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 292 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 293 | Diplegia | FAERS: 1 | US FAERS | |
| 294 | Disability | FAERS: 1 | US FAERS | |
| 295 | Disease Progression | FAERS: 1 | US FAERS | |
| 296 | Disease recurrence | FAERS: 1 | US FAERS | |
| 297 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 298 | Drug administration error | FAERS: 1 | US FAERS | |
| 299 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 300 | Ecchymosis | FAERS: 1 | SIDER US FAERS | |
| 301 | Economic problem | FAERS: 1 | US FAERS | |
| 302 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 303 | Electrocardiogram T wave peaked | FAERS: 1 | US FAERS | |
| 304 | Encephalitis | FAERS: 1 | US FAERS | |
| 305 | Enteritis | FAERS: 1 | US FAERS | |
| 306 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 307 | Epiglottitis | FAERS: 1 | US FAERS | |
| 308 | Erectile dysfunction | FAERS: 1 | SIDER US FAERS | |
| 309 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 310 | Exophthalmos | FAERS: 1 | US FAERS | |
| 311 | Eye irritation | FAERS: 1 | US FAERS | |
| 312 | Familial Periodic Paralysis | FAERS: 1 | US FAERS | |
| 313 | Feeling jittery | FAERS: 1 | US FAERS | |
| 314 | Flank Pain | FAERS: 1 | US FAERS | |
| 315 | Fracture | FAERS: 1 | US FAERS | |
| 316 | Gastrointestinal Pain | FAERS: 1 | SIDER US FAERS | |
| 317 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 318 | Gingival erythema | FAERS: 1 | US FAERS | |
| 319 | Glioblastoma | FAERS: 1 | US FAERS | |
| 320 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 321 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 322 | Hemiparesis | FAERS: 1 | OFFSIDES US FAERS | |
| 323 | Hemiplegia | FAERS: 1 | US FAERS | |
| 324 | Hepatic cancer metastatic | FAERS: 1 | US FAERS | |
| 325 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 326 | Hernia | FAERS: 1 | US FAERS | |
| 327 | Herpes simplex serology positive | FAERS: 1 | US FAERS | |
| 328 | Hirsutism | FAERS: 1 | US FAERS | |
| 329 | Hypogeusia | FAERS: 1 | US FAERS | |
| 330 | Hypomania | FAERS: 1 | US FAERS | |
| 331 | Hypophagia | FAERS: 1 | US FAERS | |
| 332 | Hysterectomy | FAERS: 1 | US FAERS | |
| 333 | Immobile | FAERS: 1 | US FAERS | |
| 334 | Impaired driving ability | FAERS: 1 | OFFSIDES US FAERS | |
| 335 | Impaired self-care | FAERS: 1 | US FAERS | |
| 336 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 337 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 338 | Inflammatory carcinoma of breast stage IV | FAERS: 1 | US FAERS | |
| 339 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 340 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 341 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 342 | Intercepted product dispensing error | FAERS: 1 | US FAERS | |
| 343 | Intermittent Claudication | FAERS: 1 | US FAERS | |
| 344 | Intestinal villi atrophy | FAERS: 1 | US FAERS | |
| 345 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 346 | Joint injury | FAERS: 1 | US FAERS | |
| 347 | Kounis Syndrome | FAERS: 1 | US FAERS | |
| 348 | Limb injury | FAERS: 1 | US FAERS | |
| 349 | Lithiasis | FAERS: 1 | US FAERS | |
| 350 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 351 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 352 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 353 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 354 | Macular degeneration | FAERS: 1 | US FAERS | |
| 355 | Mastectomy | FAERS: 1 | OFFSIDES US FAERS | |
| 356 | Mental status changes | FAERS: 1 | OFFSIDES US FAERS | |
| 357 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 358 | Middle insomnia | FAERS: 1 | US FAERS | |
| 359 | Mood swings | FAERS: 1 | US FAERS | |
| 360 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 361 | Muscle tightness | FAERS: 1 | US FAERS | |
| 362 | Musculoskeletal discomfort | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 363 | Nephritis | FAERS: 1 | 22822941 | CTD US FAERS |
| 364 | Nephrotic Syndrome | FAERS: 1 | 8319760 | CTD US FAERS |
| 365 | Nystagmus | FAERS: 1 | OFFSIDES US FAERS | |
| 366 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 367 | Ocular icterus | FAERS: 1 | US FAERS | |
| 368 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 369 | Oropharyngeal plaque | FAERS: 1 | US FAERS | |
| 370 | PO2 increased | FAERS: 1 | US FAERS | |
| 371 | Palpable purpura | FAERS: 1 | US FAERS | |
| 372 | Pancytopenia | FAERS: 1 | US FAERS | |
| 373 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 374 | Pelvic mass | FAERS: 1 | US FAERS | |
| 375 | Pemphigus | FAERS: 1 | US FAERS | |
| 376 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 377 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 378 | Photophobia | FAERS: 1 | US FAERS | |
| 379 | Poisoning | FAERS: 1 | US FAERS | |
| 380 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 381 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 382 | Pregnancy | FAERS: 1 | US FAERS | |
| 383 | Product appearance confusion | FAERS: 1 | US FAERS | |
| 384 | Product commingling | FAERS: 1 | US FAERS | |
| 385 | Product contamination | FAERS: 1 | US FAERS | |
| 386 | Product contamination physical | FAERS: 1 | US FAERS | |
| 387 | Product dose omission | FAERS: 1 | US FAERS | |
| 388 | Product label issue | FAERS: 1 | US FAERS | |
| 389 | Product lot number issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 390 | Product package associated injury | FAERS: 1 | US FAERS | |
| 391 | Product packaging issue | FAERS: 1 | US FAERS | |
| 392 | Product shape issue | FAERS: 1 | US FAERS | |
| 393 | Product size issue | FAERS: 1 | US FAERS | |
| 394 | Product storage error | FAERS: 1 | US FAERS | |
| 395 | Product supply issue | FAERS: 1 | US FAERS | |
| 396 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 397 | Protein total abnormal | FAERS: 1 | US FAERS | |
| 398 | Prurigo | FAERS: 1 | US FAERS | |
| 399 | Psoriasis | FAERS: 1 | OFFSIDES US FAERS | |
| 400 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 401 | Purpura | FAERS: 1 | SIDER US FAERS | |
| 402 | Quadriplegia | FAERS: 1 | US FAERS | |
| 403 | Quality of life decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 404 | Raoultella test positive | FAERS: 1 | US FAERS | |
| 405 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 406 | Renal cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 407 | Renal dysplasia | FAERS: 1 | US FAERS | |
| 408 | Renal failure neonatal | FAERS: 1 | US FAERS | |
| 409 | Renin increased | FAERS: 1 | US FAERS | |
| 410 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 411 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 412 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 413 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 414 | Shock | FAERS: 1 | SIDER US FAERS | |
| 415 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 416 | Sinusitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 417 | Skin lesion | FAERS: 1 | US FAERS | |
| 418 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 419 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 420 | Stress | FAERS: 1 | US FAERS | |
| 421 | Stridor | FAERS: 1 | US FAERS | |
| 422 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 423 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 424 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 425 | Talipes | FAERS: 1 | US FAERS | |
| 426 | Tension | FAERS: 1 | SIDER US FAERS | |
| 427 | Therapeutic product effect increased | FAERS: 1 | US FAERS | |
| 428 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 429 | Therapy cessation | FAERS: 1 | US FAERS | |
| 430 | Thirst | FAERS: 1 | US FAERS | |
| 431 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 432 | Thrombocytopenia | FAERS: 1 | SIDER US FAERS | |
| 433 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 434 | Thyroid calcification | FAERS: 1 | US FAERS | |
| 435 | Thyroid cancer stage III | FAERS: 1 | US FAERS | |
| 436 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 437 | Toxic Epidermal Necrolysis | FAERS: 1 | SIDER US FAERS | |
| 438 | Transcription medication error | FAERS: 1 | US FAERS | |
| 439 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 440 | Vasospasm | FAERS: 1 | US FAERS | |
| 441 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 442 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 443 | muscle injury | FAERS: 1 | US FAERS | |
| 444 | prostatitis | FAERS: 1 | OFFSIDES US FAERS | |
| 445 | Abdominal Infection | OFFSIDES | ||
| 446 | Abdominal wall infection | OFFSIDES | ||
| 447 | Acid reflux | OFFSIDES | ||
| 448 | Acidosis | OFFSIDES | ||
| 449 | Acute otitis media | OFFSIDES | ||
| 450 | Adenocarcinoma | OFFSIDES | ||
| 451 | Agranulocytosis | SIDER | ||
| 452 | Agraphia | OFFSIDES | ||
| 453 | Albuminuria | CTD | ||
| 454 | Alcohol abuse | OFFSIDES | ||
| 455 | Alveolitis | OFFSIDES | ||
| 456 | Amniotic fluid volume | OFFSIDES | ||
| 457 | Anemia | CTD | ||
| 458 | Anger | Canada Vigilance: 1 | Canada Vigilance | |
| 459 | Anisometropia | OFFSIDES | ||
| 460 | Aortic Aneurysm | OFFSIDES | ||
| 461 | Aortic Diseases | 12623880 | CTD | |
| 462 | Arteriosclerosis | OFFSIDES | ||
| 463 | Aspartate aminotransferase decreased | OFFSIDES | ||
| 464 | Atelectasis | OFFSIDES | ||
| 465 | Atherosclerosis | CTD | ||
| 466 | Atrial tachycardia | OFFSIDES | ||
| 467 | Bacterial Infections | 12669766 | CTD | |
| 468 | Blood Glucose | OFFSIDES | ||
| 469 | Blood cholesterol | OFFSIDES | ||
| 470 | Blood glucose decreased | OFFSIDES | ||
| 471 | Blood immunoglobulin G | OFFSIDES | ||
| 472 | Blood lactate dehydrogenase increased | OFFSIDES | ||
| 473 | Blood phosphorus increased | OFFSIDES | ||
| 474 | Blood sodium | OFFSIDES | ||
| 475 | Blood uric acid | OFFSIDES | ||
| 476 | Blood zinc abnormal | OFFSIDES | ||
| 477 | Blurred vision | OFFSIDES | ||
| 478 | Bone lesion | OFFSIDES | ||
| 479 | Breast Microcalcification | OFFSIDES | ||
| 480 | Bronchial irritation | OFFSIDES | ||
| 481 | Bruxism | OFFSIDES | ||
| 482 | Calcinosis | OFFSIDES | ||
| 483 | Cardioactive drug level increased | OFFSIDES | ||
| 484 | Cardiomyopathy, Dilated | 18593848 18971572 | CTD | |
| 485 | Cellulitis | SIDER | ||
| 486 | Chemical and Drug Induced Liver Injury | CTD | ||
| 487 | Chest wall pain | OFFSIDES | ||
| 488 | Choking sensation | OFFSIDES | ||
| 489 | Choroidal Detachment | OFFSIDES | ||
| 490 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 491 | Chronic sinusitis | OFFSIDES | ||
| 492 | Clostridium colitis | OFFSIDES | ||
| 493 | Cocaine-Related Disorders | 19879859 | CTD | |
| 494 | Cognition Disorders | 22982863 | CTD | |
| 495 | Compulsive shopping | OFFSIDES | ||
| 496 | Confabulation | OFFSIDES | ||
| 497 | Confusion | 9342587 | CTD | |
| 498 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 499 | Conjunctival deposit | OFFSIDES | ||
| 500 | Conjunctivitis | SIDER | ||
| 501 | Demyelination | OFFSIDES | ||
| 502 | Device related infection | OFFSIDES | ||
| 503 | Diabetes | OFFSIDES | ||
| 504 | Diabetes Mellitus, Experimental | 15362513 | CTD | |
| 505 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 506 | Diabetic Foot | OFFSIDES | ||
| 507 | Diaphragmatic Hernia | OFFSIDES | ||
| 508 | Diarrhea | OFFSIDES | ||
| 509 | Diastolic dysfunction | OFFSIDES | ||
| 510 | Disturbance in sexual arousal | SIDER | ||
| 511 | Diverticulitis | OFFSIDES | ||
| 512 | Diverticulum | OFFSIDES | ||
| 513 | Drowsiness | OFFSIDES | ||
| 514 | Drug toxicity | OFFSIDES | ||
| 515 | Drug-induced cough | SIDER | ||
| 516 | Dry cough | SIDER | ||
| 517 | Duodenal Ulcer | OFFSIDES | ||
| 518 | Dural tear | OFFSIDES | ||
| 519 | Dyslalia | OFFSIDES | ||
| 520 | Dyspnea | 20726206 | CTD | |
| 521 | Echocardiogram abnormal | OFFSIDES | ||
| 522 | Electrocardiogram ST-T change | OFFSIDES | ||
| 523 | Emotional distress | OFFSIDES | ||
| 524 | Endodontic procedure | OFFSIDES | ||
| 525 | Endomyocardial Fibrosis | 18971572 | CTD | |
| 526 | Enterocutaneous Fistula | OFFSIDES | ||
| 527 | Entropion | OFFSIDES | ||
| 528 | Eosinophilia | SIDER | ||
| 529 | Epigastric discomfort | SIDER | ||
| 530 | Erythema Multiforme | SIDER | ||
| 531 | Essential Hypertension | SIDER | ||
| 532 | Ethmoid sinus surgery | OFFSIDES | ||
| 533 | Eye laser surgery | OFFSIDES | ||
| 534 | Facial rash | SIDER | ||
| 535 | Fatty Liver | OFFSIDES | ||
| 536 | Febrile bone marrow aplasia | OFFSIDES | ||
| 537 | Fetal Diseases | 16029066 | CTD | |
| 538 | Fever | 9038987 | CTD | |
| 539 | Fibromyalgia | SIDER | ||
| 540 | Fibrosis | CTD | ||
| 541 | Fistula discharge | OFFSIDES | ||
| 542 | Fluid imbalance | SIDER | ||
| 543 | Foreign body trauma | OFFSIDES | ||
| 544 | Gambling | OFFSIDES | ||
| 545 | Gastric irritation | SIDER | ||
| 546 | Gastrointestinal stoma complication | OFFSIDES | ||
| 547 | Gingival Hyperplasia | OFFSIDES | ||
| 548 | Glaucoma | OFFSIDES | ||
| 549 | Glomerulonephritis | 18400868 | CTD | |
| 550 | Glossoptosis | OFFSIDES | ||
| 551 | Glycosuria | SIDER | ||
| 552 | Granulocytosis | OFFSIDES | ||
| 553 | Haptoglobin Decreased | OFFSIDES | ||
| 554 | Hay fever | OFFSIDES | ||
| 555 | Head titubation | OFFSIDES | ||
| 556 | Heart Diseases | 17984673 | CTD | |
| 557 | Heart failure |
8583479
10404354 10516413 10615017 10803861 10821361 10955375 10979640 11131930 12676739 14524653 14602500 14674695 15320851 15576437 15681692 15991937 16028461 16084158 17546280 18068613 18214293 18800450 | CTD | |
| 558 | Hepatitis B positive | OFFSIDES | ||
| 559 | Hepatitis | SIDER | ||
| 560 | Hormone level abnormal | OFFSIDES | ||
| 561 | Hostility | OFFSIDES | ||
| 562 | Hypercholesterolemia | 8319760 18070995 | CTD | |
| 563 | Hyperglycemia | 30958922 | CTD | |
| 564 | Hyperinsulinism | 7498971 | CTD | |
| 565 | Hyperkalemia | 14646368 19708228 | CTD | |
| 566 | Hyperkeratosis | OFFSIDES | ||
| 567 | Hypertensive heart disease | OFFSIDES | ||
| 568 | Hypertrophy | 17048199 18400868 20178811 | CTD SIDER | |
| 569 | Hypoalbuminemia | 8319760 | CTD | |
| 570 | Hypokinesia | OFFSIDES | ||
| 571 | Hypotension, Orthostatic | 10580372 15685215 18193073 | CTD | |
| 572 | Icterus index increased | OFFSIDES | ||
| 573 | Idiosyncratic drug reaction | OFFSIDES | ||
| 574 | Impetigo | OFFSIDES | ||
| 575 | Incisional hernia | OFFSIDES | ||
| 576 | Incoherent | OFFSIDES | ||
| 577 | Inflammation | 12586211 18765277 | CTD | |
| 578 | Infusion site mobility decreased | OFFSIDES | ||
| 579 | Injection site inflammation | OFFSIDES | ||
| 580 | Intestinal Diseases | 15464190 | CTD | |
| 581 | Intestinal Perforation | OFFSIDES | ||
| 582 | Joint Instability | OFFSIDES | ||
| 583 | Joint Range of Motion Decreased | OFFSIDES | ||
| 584 | Kidney Diseases | CTD | ||
| 585 | Kidney Failure, Chronic | CTD | ||
| 586 | Kidney Failure | OFFSIDES | ||
| 587 | Knee pain | SIDER | ||
| 588 | Leukopenia | SIDER | ||
| 589 | Ligament injury | OFFSIDES | ||
| 590 | Ligament rupture | OFFSIDES | ||
| 591 | Limb operation | OFFSIDES | ||
| 592 | Livedo Reticularis | OFFSIDES | ||
| 593 | Liver Cirrhosis, Experimental | 12445418 15573910 17900296 | CTD | |
| 594 | Liver Cirrhosis | 18765277 | CTD | |
| 595 | Loose tooth | OFFSIDES | ||
| 596 | Lymphangiosis carcinomatosa | OFFSIDES | ||
| 597 | Lymphocyte stimulation test positive | OFFSIDES | ||
| 598 | Marfan Syndrome | 19430350 | CTD | |
| 599 | Melanoma, Experimental | 19771429 | CTD | |
| 600 | Memory Disorders | 14578918 | CTD | |
| 601 | Meningeal disorder | OFFSIDES | ||
| 602 | Migraine Disorders | 9876824 | CTD | |
| 603 | Mitral valve sclerosis | OFFSIDES | ||
| 604 | Multiple allergies | OFFSIDES | ||
| 605 | Muscle Weakness | OFFSIDES | ||
| 606 | Muscular Dystrophy, Duchenne | 21641384 | CTD | |
| 607 | Myocardial Reperfusion Injury | 11893553 | CTD | |
| 608 | Myopia | OFFSIDES | ||
| 609 | Myositis | SIDER | ||
| 610 | Necrosis | 9238761 | CTD | |
| 611 | Neointima | 11967799 19258495 19619526 | CTD | |
| 612 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 613 | Nephrosclerosis | 8382237 11883791 | CTD | |
| 614 | Nervous tension | OFFSIDES | ||
| 615 | Neuroleptic Malignant Syndrome | OFFSIDES | ||
| 616 | Neutropenic sepsis | OFFSIDES | ||
| 617 | Orchitis | OFFSIDES | ||
| 618 | Osteopenia | OFFSIDES | ||
| 619 | Pancreatic Diseases | 15502641 | CTD | |
| 620 | Panic Disorder | SIDER | ||
| 621 | Parotitis | OFFSIDES | ||
| 622 | Performance status decreased | OFFSIDES | ||
| 623 | Persistent dry cough | SIDER | ||
| 624 | Personality Change | Canada Vigilance: 1 | Canada Vigilance | |
| 625 | Polycythemia | 15964363 | CTD | |
| 626 | Post inflammatory pigmentation change | OFFSIDES | ||
| 627 | Post procedural nausea | OFFSIDES | ||
| 628 | Postural Orthostatic Tachycardia Syndrome | 17993594 | CTD | |
| 629 | Prostate examination abnormal | OFFSIDES | ||
| 630 | Proteinuria |
8196289
8319760 8382237 8400068 8583479 11227361 11369837 11518857 12937228 14586719 14646368 14750091 15331931 16303729 16945058 17227571 17365932 17494885 17666919 18400868 18800450 18987260 19147669 19698011 20089489 | CTD | |
| 631 | Pulmonary Fibrosis | 12747577 25233898 | CTD | |
| 632 | Pulmonary Infarction | OFFSIDES | ||
| 633 | Pulmonary vascular disorder | OFFSIDES | ||
| 634 | Pyelonephritis | OFFSIDES | ||
| 635 | Renal Artery Obstruction | 9122087 18049033 | CTD | |
| 636 | Renal Insufficiency | CTD | ||
| 637 | Renal tubular disorder | OFFSIDES | ||
| 638 | Reperfusion Injury | 23875703 | CTD | |
| 639 | Reticulocyte count decreased | OFFSIDES | ||
| 640 | Retinal Vasculitis | OFFSIDES | ||
| 641 | Rhinitis | SIDER | ||
| 642 | Rhinorrhea | OFFSIDES | ||
| 643 | Scleroderma | OFFSIDES | ||
| 644 | Sclerosis | 8583479 | CTD | |
| 645 | Shoulder Pain | SIDER | ||
| 646 | Shunt occlusion | OFFSIDES | ||
| 647 | Signs and Symptoms, Digestive | 9653007 | CTD | |
| 648 | Sinus antrostomy | OFFSIDES | ||
| 649 | Sinus bradycardia | SIDER | ||
| 650 | Skin Induration | OFFSIDES | ||
| 651 | Skin hypertrophy | OFFSIDES | ||
| 652 | Skin tightness | OFFSIDES | ||
| 653 | Soft tissue inflammation | OFFSIDES | ||
| 654 | Staphylococcal osteomyelitis | OFFSIDES | ||
| 655 | Stem cell transplant | OFFSIDES | ||
| 656 | Stevens-Johnson Syndrome | 17425932 | CTD OFFSIDES SIDER | |
| 657 | Stiffness | SIDER | ||
| 658 | Subcutaneous nodule | OFFSIDES | ||
| 659 | Substance Withdrawal Syndrome | 20428619 | CTD | |
| 660 | Suspected product contamination | Canada Vigilance: 1 | Canada Vigilance | |
| 661 | Sweating | SIDER | ||
| 662 | Taste Disorders | SIDER | ||
| 663 | Tenosynovitis | OFFSIDES | ||
| 664 | Toothache | SIDER | ||
| 665 | Trauma | SIDER | ||
| 666 | Umbilical hernia | OFFSIDES | ||
| 667 | Underweight | OFFSIDES | ||
| 668 | Unresponsive to stimuli | OFFSIDES | ||
| 669 | Upper-airway cough syndrome | Canada Vigilance: 1 | Canada Vigilance | |
| 670 | Uremia | 18987260 | CTD | |
| 671 | Vascular calcification | OFFSIDES | ||
| 672 | Vascular purpura | SIDER | ||
| 673 | Vasculitis, Leukocytoclastic, Cutaneous | 11907966 | CTD | |
| 674 | Vasculitis | SIDER | ||
| 675 | Venous Insufficiency | OFFSIDES | ||
| 676 | Venous Thrombosis | 11881035 | CTD | |
| 677 | Venous occlusion | OFFSIDES | ||
| 678 | Ventricular Dysfunction, Left | CTD | ||
| 679 | Ventricular Fibrillation | OFFSIDES SIDER | ||
| 680 | Ventricular Remodeling | CTD | ||
| 681 | Vertebrobasilar Insufficiency | OFFSIDES | ||
| 682 | Wound Infection | OFFSIDES | ||
| 683 | Wound dehiscence | OFFSIDES | ||
| 684 | Xanthopsia | SIDER | ||
| 685 | anaphylaxis | 20726206 | CTD | |
| 686 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.