Arthrotec
(KPHWPUGNDIVLNH-UHFFFAOYSA-M)
Structure
- SMILES
- [O-]C(=O)Cc1ccccc1Nc1c(Cl)cccc1Cl.[Na+]
- Molecular Formula:
- C14H10Cl2NNaO2
- Molecular Weight:
- 318.130
- Log P:
- 3.1024
- Hydrogen Bond Acceptor:
- 2
- Hydrogen Bond Donor:
- 1
- TPSA:
- 52.16
- CAS Number(s):
- 15307-79-6
Synonym(s)
1.
Arthrotec
External Link(s)
| MeSH | C078133 |
| PubChem Compound | 5018304 |
| ChEBI | 4509 |
| CHEMBL | CHEMBL1034 |
| KEGG | dr:D00904 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug administered at inappropriate site | FAERS: 127 | US FAERS | |
| 2 | Drug ineffective | FAERS: 127 Canada Vigilance: 23 | Canada Vigilance US FAERS | |
| 3 | Pain | FAERS: 90 Canada Vigilance: 3 | 9474998 | CTD Canada Vigilance US FAERS |
| 4 | Nausea | FAERS: 81 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 5 | Malaise | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Vomiting | FAERS: 69 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 7 | Pruritus | FAERS: 66 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 8 | Therapeutic response unexpected | FAERS: 66 | US FAERS | |
| 9 | Wrong technique in drug usage process | FAERS: 61 | US FAERS | |
| 10 | Abdominal Pain | FAERS: 56 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 11 | Erythema | FAERS: 52 | US FAERS | |
| 12 | Abdominal discomfort | FAERS: 51 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 13 | Dizziness | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Hypersensitivity | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Urticaria | FAERS: 46 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 16 | Arthralgia | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Anaphylactic shock | FAERS: 42 | US FAERS | |
| 18 | Weight decreased | FAERS: 37 | US FAERS | |
| 19 | Arthritis | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Chest Pain | FAERS: 36 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 21 | Feeling abnormal | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Headache | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Hypotension | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Angioedema | FAERS: 31 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 25 | Fatigue | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Asthenia | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Drug ineffective for unapproved indication | FAERS: 26 | US FAERS | |
| 28 | Gastric ulcer | FAERS: 26 | US FAERS | |
| 29 | Back Pain | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 30 | Oligohydramnios | FAERS: 25 | US FAERS | |
| 31 | Swelling | FAERS: 25 | US FAERS | |
| 32 | Musculoskeletal Pain | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Dyspepsia | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Atrial Fibrillation | FAERS: 22 | US FAERS | |
| 35 | Peritonitis | FAERS: 22 | US FAERS | |
| 36 | Acute kidney injury | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 37 | Gastritis | FAERS: 21 | US FAERS | |
| 38 | Injection site pain | FAERS: 21 | US FAERS | |
| 39 | Product use in unapproved indication | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Duodenal Ulcer | FAERS: 19 | US FAERS | |
| 41 | Inflammation | FAERS: 19 | US FAERS | |
| 42 | Product administered at inappropriate site | FAERS: 19 | US FAERS | |
| 43 | Small Intestinal Stenosis | FAERS: 19 | US FAERS | |
| 44 | Burning sensation | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Kounis Syndrome | FAERS: 18 | US FAERS | |
| 46 | Metabolic acidosis | FAERS: 18 | US FAERS | |
| 47 | Inappropriate schedule of drug administration | FAERS: 17 | US FAERS | |
| 48 | Necrosis | FAERS: 17 | US FAERS | |
| 49 | Somnolence | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Anorexia | FAERS: 16 | US FAERS | |
| 51 | Colonic Stenosis | FAERS: 16 | US FAERS | |
| 52 | Palpitations | FAERS: 16 | US FAERS | |
| 53 | Pericarditis | FAERS: 16 | US FAERS | |
| 54 | Pneumonia | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 55 | Therapeutic response changed | FAERS: 16 | US FAERS | |
| 56 | Cardiac Arrest | FAERS: 15 | US FAERS | |
| 57 | Infection | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 58 | Large intestinal stenosis | FAERS: 15 | US FAERS | |
| 59 | Large intestine perforation | FAERS: 15 | US FAERS | |
| 60 | Medication Error | FAERS: 15 | US FAERS | |
| 61 | Renal failure neonatal | FAERS: 15 | US FAERS | |
| 62 | Arthropathy | FAERS: 14 | US FAERS | |
| 63 | Blood creatinine increased | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Chest discomfort | FAERS: 14 | US FAERS | |
| 65 | Injection site necrosis | FAERS: 14 | US FAERS | |
| 66 | Joint swelling | FAERS: 14 | US FAERS | |
| 67 | Overdose | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Angina Pectoris | FAERS: 13 | US FAERS | |
| 69 | Cerebrovascular accident | FAERS: 13 | US FAERS | |
| 70 | Drug exposure during pregnancy | FAERS: 13 | US FAERS | |
| 71 | Lymphadenopathy | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 72 | Memory impairment | FAERS: 13 | US FAERS | |
| 73 | Myocardial Infarction | FAERS: 13 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 74 | Neutropenia | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 75 | Product quality issue | FAERS: 13 | US FAERS | |
| 76 | Rash erythematous | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Sepsis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 78 | Thrombosis | FAERS: 13 | US FAERS | |
| 79 | jaundice | FAERS: 13 | US FAERS | |
| 80 | Abasia | FAERS: 12 | US FAERS | |
| 81 | Blood urea increased | FAERS: 12 | US FAERS | |
| 82 | Ductus arteriosus premature closure | FAERS: 12 | US FAERS | |
| 83 | Intentional product misuse | FAERS: 12 | US FAERS | |
| 84 | Maternal exposure during pregnancy | FAERS: 12 | US FAERS | |
| 85 | Syncope | FAERS: 12 | US FAERS | |
| 86 | Chills | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 87 | Disseminated Intravascular Coagulation | FAERS: 11 | US FAERS | |
| 88 | Flatulence | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 89 | Joint injury | FAERS: 11 | US FAERS | |
| 90 | Meniscus injury | FAERS: 11 | US FAERS | |
| 91 | Musculoskeletal stiffness | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Shock | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Wrong technique in product usage process | FAERS: 11 | US FAERS | |
| 94 | Application site erythema | FAERS: 10 | US FAERS | |
| 95 | Blood alkaline phosphatase increased | FAERS: 10 | US FAERS | |
| 96 | Bradycardia | FAERS: 10 | US FAERS | |
| 97 | Diplopia | FAERS: 10 | US FAERS | |
| 98 | Disorientation | FAERS: 10 | US FAERS | |
| 99 | Ecthyma | FAERS: 10 | US FAERS | |
| 100 | Expired drug administered | FAERS: 10 | US FAERS | |
| 101 | Gastrointestinal erosion | FAERS: 10 | US FAERS | |
| 102 | Jejunal ulcer | FAERS: 10 | US FAERS | |
| 103 | Lethargy | FAERS: 10 | US FAERS | |
| 104 | Peripheral swelling | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 105 | Pulmonary Hypertension | FAERS: 10 | US FAERS | |
| 106 | Retinal toxicity | FAERS: 10 | US FAERS | |
| 107 | Rhabdomyolysis | FAERS: 10 | US FAERS | |
| 108 | Ulcer | FAERS: 10 | US FAERS | |
| 109 | Abscess | FAERS: 9 | US FAERS | |
| 110 | Accidental exposure to product | FAERS: 9 | US FAERS | |
| 111 | Application site pain | FAERS: 9 | US FAERS | |
| 112 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 113 | Blood urine present | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Fibrosis | FAERS: 9 | US FAERS | |
| 115 | Ileal Stenosis | FAERS: 9 | US FAERS | |
| 116 | Incorrect dose administered | FAERS: 9 | US FAERS | |
| 117 | Leukocytoclastic vasculitis | FAERS: 9 | US FAERS | |
| 118 | Macular fibrosis | FAERS: 9 | US FAERS | |
| 119 | Myalgia | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 120 | Product use issue | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Pulmonary Embolism | FAERS: 9 | US FAERS | |
| 122 | Retinal Degeneration | FAERS: 9 | US FAERS | |
| 123 | Skin necrosis | FAERS: 9 | US FAERS | |
| 124 | Application site rash | FAERS: 8 | US FAERS | |
| 125 | Blood lactate dehydrogenase increased | FAERS: 8 | US FAERS | |
| 126 | Constipation | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Contraindicated product administered | FAERS: 8 | US FAERS | |
| 128 | Disease recurrence | FAERS: 8 | US FAERS | |
| 129 | Diverticulitis | FAERS: 8 | US FAERS | |
| 130 | Drug dispensing error | FAERS: 8 | US FAERS | |
| 131 | Dysphonia | FAERS: 8 | US FAERS | |
| 132 | Eschar | FAERS: 8 | US FAERS | |
| 133 | Injection site infection | FAERS: 8 | US FAERS | |
| 134 | Nasopharyngitis | FAERS: 8 | US FAERS | |
| 135 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 136 | Renal tubular necrosis | FAERS: 8 | US FAERS | |
| 137 | Septic Shock | FAERS: 8 | US FAERS | |
| 138 | Skin Ulcer | FAERS: 8 | US FAERS | |
| 139 | Stevens-Johnson Syndrome | FAERS: 8 | US FAERS | |
| 140 | Tachycardia | FAERS: 8 | US FAERS | |
| 141 | Thrombocytopenia | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 142 | Abdominal tenderness | FAERS: 7 | US FAERS | |
| 143 | Agranulocytosis | FAERS: 7 | US FAERS | |
| 144 | Asthma | FAERS: 7 | US FAERS | |
| 145 | Blood cholesterol increased | FAERS: 7 | US FAERS | |
| 146 | Diabetes Mellitus | FAERS: 7 | US FAERS | |
| 147 | Drug dispensed to wrong patient | FAERS: 7 | US FAERS | |
| 148 | Endoscopy abnormal | FAERS: 7 | US FAERS | |
| 149 | Gamma-Glutamyltransferase Increased | FAERS: 7 | US FAERS | |
| 150 | Gangrene | FAERS: 7 | US FAERS | |
| 151 | Injection site scar | FAERS: 7 | US FAERS | |
| 152 | Leukocytosis | FAERS: 7 | US FAERS | |
| 153 | Lichen Planus | FAERS: 7 | US FAERS | |
| 154 | Mydriasis | FAERS: 7 | US FAERS | |
| 155 | No adverse event | FAERS: 7 | US FAERS | |
| 156 | Oliguria | FAERS: 7 | US FAERS | |
| 157 | Pallor | FAERS: 7 | US FAERS | |
| 158 | Pancreatitis | FAERS: 7 | US FAERS | |
| 159 | Protein urine present | FAERS: 7 | US FAERS | |
| 160 | Urinary Incontinence | FAERS: 7 | US FAERS | |
| 161 | Visual Impairment | FAERS: 7 | US FAERS | |
| 162 | Activities of daily living impaired | FAERS: 6 | US FAERS | |
| 163 | Anuria | FAERS: 6 | US FAERS | |
| 164 | Application site vesicles | FAERS: 6 | US FAERS | |
| 165 | Bronchitis | FAERS: 6 | US FAERS | |
| 166 | Bronchospasm | FAERS: 6 | US FAERS | |
| 167 | Cellulitis | FAERS: 6 | US FAERS | |
| 168 | Cholelithiasis | FAERS: 6 | US FAERS | |
| 169 | Coronary Artery Disease | FAERS: 6 | US FAERS | |
| 170 | Diabetes Insipidus | FAERS: 6 | US FAERS | |
| 171 | Drug effect incomplete | FAERS: 6 | US FAERS | |
| 172 | Dry skin | FAERS: 6 | US FAERS | |
| 173 | Duodenal ulcer perforation | FAERS: 6 | US FAERS | |
| 174 | Ectropion | FAERS: 6 | US FAERS | |
| 175 | Epistaxis | FAERS: 6 | US FAERS | |
| 176 | Erectile dysfunction | FAERS: 6 | US FAERS | |
| 177 | Hepatitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 178 | Ileus | FAERS: 6 | US FAERS | |
| 179 | Internal limiting membrane peeling | FAERS: 6 | US FAERS | |
| 180 | Jejunal Stenosis | FAERS: 6 | US FAERS | |
| 181 | Joint stiffness | FAERS: 6 | US FAERS | |
| 182 | Limb discomfort | FAERS: 6 | US FAERS | |
| 183 | Lip swelling | FAERS: 6 | US FAERS | |
| 184 | Musculoskeletal discomfort | FAERS: 6 | US FAERS | |
| 185 | Myoclonus | FAERS: 6 | US FAERS | |
| 186 | Nephrotic Syndrome | FAERS: 6 | US FAERS | |
| 187 | Product substitution issue | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 188 | Purpura | FAERS: 6 | US FAERS | |
| 189 | Respiratory Failure | FAERS: 6 | US FAERS | |
| 190 | Rheumatoid Arthritis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Right Ventricular Hypertrophy | FAERS: 6 | US FAERS | |
| 192 | Skin lesion | FAERS: 6 | US FAERS | |
| 193 | Soft Tissue Infection | FAERS: 6 | US FAERS | |
| 194 | Tinnitus | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 195 | Toxic Epidermal Necrolysis | FAERS: 6 | US FAERS | |
| 196 | Abdominal rigidity | FAERS: 5 | US FAERS | |
| 197 | Accidental overdose | FAERS: 5 | US FAERS | |
| 198 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 199 | Alanine Aminotransferase Increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Application site swelling | FAERS: 5 | US FAERS | |
| 201 | Ascites | FAERS: 5 | US FAERS | |
| 202 | Aspartate Aminotransferase Increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Blepharitis | FAERS: 5 | US FAERS | |
| 204 | Blindness | FAERS: 5 | US FAERS | |
| 205 | Cataract | FAERS: 5 | US FAERS | |
| 206 | Cholestasis | FAERS: 5 | US FAERS | |
| 207 | Colitis | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 208 | Drug dose omission | FAERS: 5 | US FAERS | |
| 209 | Expired product administered | FAERS: 5 | US FAERS | |
| 210 | Eye irritation | FAERS: 5 | US FAERS | |
| 211 | Ileal ulcer | FAERS: 5 | US FAERS | |
| 212 | Influenza | FAERS: 5 | US FAERS | |
| 213 | Infusion site pain | FAERS: 5 | US FAERS | |
| 214 | Injection Site Reaction | FAERS: 5 | US FAERS | |
| 215 | Injection site abscess | FAERS: 5 | US FAERS | |
| 216 | Injection site ulcer | FAERS: 5 | US FAERS | |
| 217 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 218 | Laryngospasm | FAERS: 5 | US FAERS | |
| 219 | Leukopenia | FAERS: 5 | US FAERS | |
| 220 | Neck Pain | FAERS: 5 | US FAERS | |
| 221 | Neonatal disorder | FAERS: 5 | US FAERS | |
| 222 | Osteomyelitis | FAERS: 5 | US FAERS | |
| 223 | Papule | FAERS: 5 | US FAERS | |
| 224 | Patent ductus arteriosus | FAERS: 5 | US FAERS | |
| 225 | Pneumothorax | FAERS: 5 | US FAERS | |
| 226 | Post procedural complication | FAERS: 5 | US FAERS | |
| 227 | Presyncope | FAERS: 5 | US FAERS | |
| 228 | Pyloric Stenosis | FAERS: 5 | US FAERS | |
| 229 | Rotator cuff syndrome | FAERS: 5 | US FAERS | |
| 230 | Skin reaction | FAERS: 5 | US FAERS | |
| 231 | Tooth Extraction | FAERS: 5 | US FAERS | |
| 232 | Unevaluable event | FAERS: 5 | US FAERS | |
| 233 | Urinary Retention | FAERS: 5 | US FAERS | |
| 234 | Urinary tract infection | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 235 | Vertigo | FAERS: 5 | US FAERS | |
| 236 | Wheezing | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 237 | Alopecia | FAERS: 4 | US FAERS | |
| 238 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 239 | Amnesia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 240 | Arteriosclerosis | FAERS: 4 | US FAERS | |
| 241 | Autoimmune hepatitis | FAERS: 4 | US FAERS | |
| 242 | Blood sodium decreased | FAERS: 4 | US FAERS | |
| 243 | Brain Abscess | FAERS: 4 | US FAERS | |
| 244 | Dehydration | FAERS: 4 | US FAERS | |
| 245 | Drug effective for unapproved indication | FAERS: 4 | US FAERS | |
| 246 | Duodenal Obstruction | FAERS: 4 | US FAERS | |
| 247 | Dysgeusia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Dysmorphism | FAERS: 4 | US FAERS | |
| 249 | Electrocardiogram abnormal | FAERS: 4 | US FAERS | |
| 250 | Enteritis | FAERS: 4 | US FAERS | |
| 251 | Epigastric discomfort | FAERS: 4 | US FAERS | |
| 252 | Eye pain | FAERS: 4 | US FAERS | |
| 253 | Feeling Cold | FAERS: 4 | US FAERS | |
| 254 | Gastrointestinal endoscopic therapy | FAERS: 4 | US FAERS | |
| 255 | Gastrointestinal ulcer | FAERS: 4 | US FAERS | |
| 256 | General physical health deterioration | FAERS: 4 | US FAERS | |
| 257 | Glaucoma | FAERS: 4 | US FAERS | |
| 258 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 259 | Hysterectomy | FAERS: 4 | US FAERS | |
| 260 | Incorrect drug administration duration | FAERS: 4 | US FAERS | |
| 261 | Incorrect route of drug administration | FAERS: 4 | US FAERS | |
| 262 | Injection site erythema | FAERS: 4 | US FAERS | |
| 263 | Intestinal Perforation | FAERS: 4 | US FAERS | |
| 264 | Limb injury | FAERS: 4 | US FAERS | |
| 265 | Lower respiratory tract infection | FAERS: 4 | US FAERS | |
| 266 | Menorrhagia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 267 | Multiple Sclerosis | FAERS: 4 | US FAERS | |
| 268 | Neonatal anuria | FAERS: 4 | US FAERS | |
| 269 | Oral pruritus | FAERS: 4 | US FAERS | |
| 270 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 271 | Peptic Ulcer | FAERS: 4 | US FAERS | |
| 272 | Purulent discharge | FAERS: 4 | US FAERS | |
| 273 | Renal tubular acidosis | FAERS: 4 | US FAERS | |
| 274 | Respiratory arrest | FAERS: 4 | US FAERS | |
| 275 | Salpingo-oophorectomy | FAERS: 4 | US FAERS | |
| 276 | Scab | FAERS: 4 | US FAERS | |
| 277 | Single functional kidney | FAERS: 4 | US FAERS | |
| 278 | Stomatitis | FAERS: 4 | US FAERS | |
| 279 | Stridor | FAERS: 4 | US FAERS | |
| 280 | Systemic Inflammatory Response Syndrome | FAERS: 4 | US FAERS | |
| 281 | Transaminases increased | FAERS: 4 | US FAERS | |
| 282 | Wound dehiscence | FAERS: 4 | US FAERS | |
| 283 | Adverse event | FAERS: 3 | US FAERS | |
| 284 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 285 | Anxiety | FAERS: 3 | US FAERS | |
| 286 | Aphagia | FAERS: 3 | US FAERS | |
| 287 | Application site burn | FAERS: 3 | US FAERS | |
| 288 | Application site exfoliation | FAERS: 3 | US FAERS | |
| 289 | Application site pruritus | FAERS: 3 | US FAERS | |
| 290 | Arteriogram coronary abnormal | FAERS: 3 | US FAERS | |
| 291 | Back disorder | FAERS: 3 | US FAERS | |
| 292 | Blood potassium increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 293 | Bone pain | FAERS: 3 | US FAERS | |
| 294 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 295 | Carpal Tunnel Syndrome | FAERS: 3 | US FAERS | |
| 296 | Choking | FAERS: 3 | US FAERS | |
| 297 | Concomitant disease aggravated | FAERS: 3 | US FAERS | |
| 298 | Crying | FAERS: 3 | US FAERS | |
| 299 | Deafness | FAERS: 3 | US FAERS | |
| 300 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 301 | Dermatitis | FAERS: 3 | US FAERS | |
| 302 | Disability | FAERS: 3 | US FAERS | |
| 303 | Discomfort | FAERS: 3 | US FAERS | |
| 304 | Drug abuse | FAERS: 3 | US FAERS | |
| 305 | Dysarthria | FAERS: 3 | US FAERS | |
| 306 | Dysuria | FAERS: 3 | US FAERS | |
| 307 | Endometrial Hyperplasia | FAERS: 3 | US FAERS | |
| 308 | Erythema Multiforme | FAERS: 3 | US FAERS | |
| 309 | Extremity necrosis | FAERS: 3 | US FAERS | |
| 310 | Flushing | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 311 | Fragile X Syndrome | FAERS: 3 | US FAERS | |
| 312 | Gastrointestinal Pain | FAERS: 3 | US FAERS | |
| 313 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 314 | Gout | FAERS: 3 | US FAERS | |
| 315 | Hepatic necrosis | FAERS: 3 | US FAERS | |
| 316 | Impaired work ability | FAERS: 3 | US FAERS | |
| 317 | Infectious peritonitis | FAERS: 3 | US FAERS | |
| 318 | Injection site inflammation | FAERS: 3 | US FAERS | |
| 319 | Injection site mass | FAERS: 3 | US FAERS | |
| 320 | Interleukin level increased | FAERS: 3 | US FAERS | |
| 321 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 322 | Laceration | FAERS: 3 | US FAERS | |
| 323 | Leucine aminopeptidase increased | FAERS: 3 | US FAERS | |
| 324 | Macular degeneration | FAERS: 3 | US FAERS | |
| 325 | Medium-chain acyl-coenzyme A dehydrogenase deficiency | FAERS: 3 | US FAERS | |
| 326 | Morganella infection | FAERS: 3 | US FAERS | |
| 327 | Myositis | FAERS: 3 | US FAERS | |
| 328 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 329 | Nerve injury | FAERS: 3 | US FAERS | |
| 330 | Nervousness | FAERS: 3 | US FAERS | |
| 331 | Occult blood positive | FAERS: 3 | US FAERS | |
| 332 | Perforated ulcer | FAERS: 3 | US FAERS | |
| 333 | Periodontitis | FAERS: 3 | US FAERS | |
| 334 | Petechiae | FAERS: 3 | US FAERS | |
| 335 | Photophobia | FAERS: 3 | US FAERS | |
| 336 | Placental Insufficiency | FAERS: 3 | US FAERS | |
| 337 | Platelet function test abnormal | FAERS: 3 | US FAERS | |
| 338 | Protein-losing gastroenteropathy | FAERS: 3 | US FAERS | |
| 339 | Proteinuria | FAERS: 3 | US FAERS | |
| 340 | Psoriasis | FAERS: 3 | US FAERS | |
| 341 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 342 | Rectal Stenosis | FAERS: 3 | US FAERS | |
| 343 | Reflux gastritis | FAERS: 3 | US FAERS | |
| 344 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 345 | Respiratory distress | FAERS: 3 | US FAERS | |
| 346 | Sinus Tachycardia | FAERS: 3 | US FAERS | |
| 347 | Sinusitis | FAERS: 3 | US FAERS | |
| 348 | Skin hypertrophy | FAERS: 3 | US FAERS | |
| 349 | Skin irritation | FAERS: 3 | US FAERS | |
| 350 | Status Asthmaticus | FAERS: 3 | US FAERS | |
| 351 | Sudden death | FAERS: 3 | US FAERS | |
| 352 | Suicide attempt | FAERS: 3 | US FAERS | |
| 353 | Therapeutic response unexpected with drug substitution | FAERS: 3 | US FAERS | |
| 354 | Toxicity to various agents | FAERS: 3 | US FAERS | |
| 355 | Tremor | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 356 | Troponin I increased | FAERS: 3 | US FAERS | |
| 357 | Tryptase increased | FAERS: 3 | US FAERS | |
| 358 | Vasculitis | FAERS: 3 | US FAERS | |
| 359 | nervous system disorder | FAERS: 3 | US FAERS | |
| 360 | Abdominal Abscess | FAERS: 2 | US FAERS | |
| 361 | Abdominal adhesions | FAERS: 2 | US FAERS | |
| 362 | Accidental exposure | FAERS: 2 | US FAERS | |
| 363 | Acidosis | FAERS: 2 | US FAERS | |
| 364 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 365 | Agitation | FAERS: 2 | US FAERS | |
| 366 | Anal Fistula | FAERS: 2 | US FAERS | |
| 367 | Anal Ulcer | FAERS: 2 | US FAERS | |
| 368 | Anastomotic Leak | FAERS: 2 | US FAERS | |
| 369 | Antinuclear antibody increased | FAERS: 2 | US FAERS | |
| 370 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 371 | Aplasia Cutis Congenita | FAERS: 2 | US FAERS | |
| 372 | Application site dryness | FAERS: 2 | US FAERS | |
| 373 | Asphyxia | FAERS: 2 | US FAERS | |
| 374 | Asthenopia | FAERS: 2 | US FAERS | |
| 375 | Atrioventricular Block | FAERS: 2 | US FAERS | |
| 376 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 377 | Bedridden | FAERS: 2 | US FAERS | |
| 378 | Beta-N-acetyl-D-glucosaminidase increased | FAERS: 2 | US FAERS | |
| 379 | Bladder pain | FAERS: 2 | US FAERS | |
| 380 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 381 | Blood blister | FAERS: 2 | US FAERS | |
| 382 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 383 | Blood immunoglobulin E increased | FAERS: 2 | US FAERS | |
| 384 | Blood immunoglobulin G increased | FAERS: 2 | US FAERS | |
| 385 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 386 | Blood pH decreased | FAERS: 2 | US FAERS | |
| 387 | Blood sodium increased | FAERS: 2 | US FAERS | |
| 388 | Bone marrow necrosis | FAERS: 2 | US FAERS | |
| 389 | Bursitis | FAERS: 2 | US FAERS | |
| 390 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 391 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 392 | Chromaturia | FAERS: 2 | US FAERS | |
| 393 | Clonus | FAERS: 2 | US FAERS | |
| 394 | Coma scale abnormal | FAERS: 2 | US FAERS | |
| 395 | Corneal Infection | FAERS: 2 | US FAERS | |
| 396 | Cyanosis | FAERS: 2 | US FAERS | |
| 397 | Cystitis | FAERS: 2 | US FAERS | |
| 398 | Debridement | FAERS: 2 | US FAERS | |
| 399 | Delirium | FAERS: 2 | US FAERS | |
| 400 | Dementia | FAERS: 2 | US FAERS | |
| 401 | Dengue Fever | FAERS: 2 | US FAERS | |
| 402 | Documented hypersensitivity to administered product | FAERS: 2 | US FAERS | |
| 403 | Drug administration error | FAERS: 2 | US FAERS | |
| 404 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 405 | Drug toxicity | FAERS: 2 | US FAERS | |
| 406 | Duodenal perforation | FAERS: 2 | US FAERS | |
| 407 | Ecchymosis | FAERS: 2 | US FAERS | |
| 408 | Eosinophilia | FAERS: 2 | US FAERS | |
| 409 | Epilepsy | FAERS: 2 | US FAERS | |
| 410 | Erosive Duodenitis | FAERS: 2 | US FAERS | |
| 411 | Escherichia infection | FAERS: 2 | US FAERS | |
| 412 | Essential Hypertension | FAERS: 2 | US FAERS | |
| 413 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 414 | Fat necrosis | FAERS: 2 | US FAERS | |
| 415 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 416 | Formication | FAERS: 2 | US FAERS | |
| 417 | Gastrointestinal inflammation | FAERS: 2 | US FAERS | |
| 418 | Gastrointestinal obstruction | FAERS: 2 | US FAERS | |
| 419 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 420 | Haptoglobin Decreased | FAERS: 2 | US FAERS | |
| 421 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 422 | Hunger | FAERS: 2 | US FAERS | |
| 423 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 424 | Inadequate analgesia | FAERS: 2 | US FAERS | |
| 425 | Induration | FAERS: 2 | US FAERS | |
| 426 | Injection site cellulitis | FAERS: 2 | US FAERS | |
| 427 | Injection site pallor | FAERS: 2 | US FAERS | |
| 428 | Interferon gamma level | FAERS: 2 | US FAERS | |
| 429 | Intestinal diaphragm disease | FAERS: 2 | US FAERS | |
| 430 | Intestinal infarction | FAERS: 2 | US FAERS | |
| 431 | Intestinal ulcer perforation | FAERS: 2 | US FAERS | |
| 432 | Japan coma scale abnormal | FAERS: 2 | US FAERS | |
| 433 | Left Ventricular Hypertrophy | FAERS: 2 | US FAERS | |
| 434 | Ligament rupture | FAERS: 2 | US FAERS | |
| 435 | Lividity | FAERS: 2 | US FAERS | |
| 436 | Mental impairment | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 437 | Mental status changes | FAERS: 2 | US FAERS | |
| 438 | Middle insomnia | FAERS: 2 | US FAERS | |
| 439 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 440 | Mood swings | FAERS: 2 | US FAERS | |
| 441 | Mucosal erosion | FAERS: 2 | US FAERS | |
| 442 | Muscle necrosis | FAERS: 2 | US FAERS | |
| 443 | Muscle strain | FAERS: 2 | US FAERS | |
| 444 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 445 | Myocarditis | FAERS: 2 | US FAERS | |
| 446 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 447 | Ocular icterus | FAERS: 2 | US FAERS | |
| 448 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 449 | Osteochondrosis | FAERS: 2 | US FAERS | |
| 450 | Osteoporosis | FAERS: 2 | US FAERS | |
| 451 | PCO2 decreased | FAERS: 2 | US FAERS | |
| 452 | Pancytopenia | FAERS: 2 | US FAERS | |
| 453 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 454 | Pharyngitis | FAERS: 2 | US FAERS | |
| 455 | Pilonidal Cyst | FAERS: 2 | US FAERS | |
| 456 | Platelet aggregation decreased | FAERS: 2 | US FAERS | |
| 457 | Pneumoperitoneum | FAERS: 2 | US FAERS | |
| 458 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 459 | Porphyria non-acute | FAERS: 2 | US FAERS | |
| 460 | Post procedural bile leak | FAERS: 2 | US FAERS | |
| 461 | Product preparation error | FAERS: 2 | US FAERS | |
| 462 | Pulmonary arterial hypertension | FAERS: 2 | US FAERS | |
| 463 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 464 | Regurgitation | FAERS: 2 | US FAERS | |
| 465 | Renal impairment neonatal | FAERS: 2 | US FAERS | |
| 466 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 467 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 468 | Rheumatoid factor increased | FAERS: 2 | US FAERS | |
| 469 | Right Ventricular Dysfunction | FAERS: 2 | US FAERS | |
| 470 | Right ventricular failure | FAERS: 2 | US FAERS | |
| 471 | Sneezing | FAERS: 2 | US FAERS | |
| 472 | Suppressed lactation | FAERS: 2 | US FAERS | |
| 473 | Synovial Cyst | FAERS: 2 | US FAERS | |
| 474 | Throat irritation | FAERS: 2 | US FAERS | |
| 475 | Troponin T increased | FAERS: 2 | US FAERS | |
| 476 | Visual disturbance | FAERS: 2 | US FAERS | |
| 477 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 478 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 479 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 480 | Wrong product administered | FAERS: 2 | US FAERS | |
| 481 | pseudomembranous colitis | FAERS: 2 | US FAERS | |
| 482 | Abdominal mass | FAERS: 1 | US FAERS | |
| 483 | Acanthosis | FAERS: 1 | US FAERS | |
| 484 | Acne | FAERS: 1 | US FAERS | |
| 485 | Actinic cheilitis | FAERS: 1 | US FAERS | |
| 486 | Actinic keratosis | FAERS: 1 | US FAERS | |
| 487 | Administration site rash | FAERS: 1 | US FAERS | |
| 488 | Adnexa uteri pain | FAERS: 1 | US FAERS | |
| 489 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 490 | Amputation | FAERS: 1 | US FAERS | |
| 491 | Anal Fissure | FAERS: 1 | US FAERS | |
| 492 | Anaphylactoid Reaction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 493 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 494 | Anti-erythrocyte antibody positive | FAERS: 1 | US FAERS | |
| 495 | Application site atrophy | FAERS: 1 | US FAERS | |
| 496 | Application site discharge | FAERS: 1 | US FAERS | |
| 497 | Application site erosion | FAERS: 1 | US FAERS | |
| 498 | Application site hypersensitivity | FAERS: 1 | US FAERS | |
| 499 | Application site infection | FAERS: 1 | US FAERS | |
| 500 | Application site inflammation | FAERS: 1 | US FAERS | |
| 501 | Application site reaction | FAERS: 1 | US FAERS | |
| 502 | Application site scab | FAERS: 1 | US FAERS | |
| 503 | Application site ulcer | FAERS: 1 | US FAERS | |
| 504 | Arachnoiditis | FAERS: 1 | US FAERS | |
| 505 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 506 | Arthropod bite | FAERS: 1 | US FAERS | |
| 507 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 508 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 509 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 510 | Beta 2 microglobulin increased | FAERS: 1 | US FAERS | |
| 511 | Biliary cirrhosis | FAERS: 1 | US FAERS | |
| 512 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 513 | Biopsy lung abnormal | FAERS: 1 | US FAERS | |
| 514 | Biopsy skin abnormal | FAERS: 1 | US FAERS | |
| 515 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 516 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 517 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 518 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 519 | Blood fibrinogen increased | FAERS: 1 | US FAERS | |
| 520 | Blood fibrinogen | FAERS: 1 | US FAERS | |
| 521 | Blood glucose decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 522 | Blood iron abnormal | FAERS: 1 | US FAERS | |
| 523 | Blood iron increased | FAERS: 1 | US FAERS | |
| 524 | Blood lactate dehydrogenase abnormal | FAERS: 1 | US FAERS | |
| 525 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 526 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 527 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 528 | Bone fragmentation | FAERS: 1 | US FAERS | |
| 529 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 530 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 531 | C-reactive protein | FAERS: 1 | US FAERS | |
| 532 | Capillary Leak Syndrome | FAERS: 1 | US FAERS | |
| 533 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 534 | Cartilage injury | FAERS: 1 | US FAERS | |
| 535 | Chloropsia | FAERS: 1 | US FAERS | |
| 536 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 537 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 538 | Citrobacter infection | FAERS: 1 | US FAERS | |
| 539 | Coagulation test abnormal | FAERS: 1 | US FAERS | |
| 540 | Colectomy | FAERS: 1 | US FAERS | |
| 541 | Completed Suicide | FAERS: 1 | US FAERS | |
| 542 | Compression fracture | FAERS: 1 | US FAERS | |
| 543 | Congenital neurological disorder | FAERS: 1 | US FAERS | |
| 544 | Congenital pulmonary hypertension | FAERS: 1 | US FAERS | |
| 545 | Congenital tricuspid valve incompetence | FAERS: 1 | US FAERS | |
| 546 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 547 | Coombs test positive | FAERS: 1 | US FAERS | |
| 548 | Corneal degeneration | FAERS: 1 | US FAERS | |
| 549 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 550 | Culture urine positive | FAERS: 1 | US FAERS | |
| 551 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 552 | Delusional perception | FAERS: 1 | US FAERS | |
| 553 | Dental caries | FAERS: 1 | US FAERS | |
| 554 | Depressed mood | FAERS: 1 | US FAERS | |
| 555 | Depression suicidal | FAERS: 1 | US FAERS | |
| 556 | Dermo-hypodermitis | FAERS: 1 | US FAERS | |
| 557 | Device dislocation | FAERS: 1 | US FAERS | |
| 558 | Device occlusion | FAERS: 1 | US FAERS | |
| 559 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 560 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 561 | Disease Progression | FAERS: 1 | US FAERS | |
| 562 | Dissociation | FAERS: 1 | US FAERS | |
| 563 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 564 | Diverticulum | FAERS: 1 | US FAERS | |
| 565 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 566 | Drooling | FAERS: 1 | US FAERS | |
| 567 | Drug Dependence | FAERS: 1 | US FAERS | |
| 568 | Drug resistance | FAERS: 1 | US FAERS | |
| 569 | Drug specific antibody | FAERS: 1 | US FAERS | |
| 570 | Dry gangrene | FAERS: 1 | US FAERS | |
| 571 | Duodenitis | FAERS: 1 | US FAERS | |
| 572 | Echography abnormal | FAERS: 1 | US FAERS | |
| 573 | Economic problem | FAERS: 1 | US FAERS | |
| 574 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 575 | Embolism | FAERS: 1 | US FAERS | |
| 576 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 577 | Eructation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 578 | Euphoric mood | FAERS: 1 | US FAERS | |
| 579 | Excoriation | FAERS: 1 | US FAERS | |
| 580 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 581 | Eye Infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 582 | Facial Pain | FAERS: 1 | US FAERS | |
| 583 | Facial asymmetry | FAERS: 1 | US FAERS | |
| 584 | Factor VIII Deficiency | FAERS: 1 | US FAERS | |
| 585 | Fasciotomy | FAERS: 1 | US FAERS | |
| 586 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 587 | Feeling jittery | FAERS: 1 | US FAERS | |
| 588 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 589 | Flank Pain | FAERS: 1 | US FAERS | |
| 590 | Fracture | FAERS: 1 | US FAERS | |
| 591 | Gait inability | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 592 | Gammopathy | FAERS: 1 | US FAERS | |
| 593 | Gas Gangrene | FAERS: 1 | US FAERS | |
| 594 | Gastrectomy | FAERS: 1 | US FAERS | |
| 595 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 596 | Gastric mucosa erythema | FAERS: 1 | US FAERS | |
| 597 | Gastric mucosal lesion | FAERS: 1 | US FAERS | |
| 598 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 599 | Gastric ulcer helicobacter | FAERS: 1 | US FAERS | |
| 600 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 601 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 602 | Gastrointestinal mucosal disorder | FAERS: 1 | US FAERS | |
| 603 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 604 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 605 | Granuloma | FAERS: 1 | US FAERS | |
| 606 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 607 | Head discomfort | FAERS: 1 | US FAERS | |
| 608 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 609 | Helicobacter pylori identification test positive | FAERS: 1 | US FAERS | |
| 610 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 611 | Hepatitis A | FAERS: 1 | US FAERS | |
| 612 | Hepatosplenomegaly | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 613 | Hernia | FAERS: 1 | US FAERS | |
| 614 | Histiocytosis haematophagic | FAERS: 1 | US FAERS | |
| 615 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 616 | Human epidermal growth factor receptor negative | FAERS: 1 | US FAERS | |
| 617 | Hypercapnia | FAERS: 1 | US FAERS | |
| 618 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 619 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 620 | Hypertrophy | FAERS: 1 | US FAERS | |
| 621 | Hyperventilation | FAERS: 1 | US FAERS | |
| 622 | Hypophagia | FAERS: 1 | US FAERS | |
| 623 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 624 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 625 | Iatrogenic infection | FAERS: 1 | US FAERS | |
| 626 | Ileectomy | FAERS: 1 | US FAERS | |
| 627 | Immobile | FAERS: 1 | US FAERS | |
| 628 | Immunology test abnormal | FAERS: 1 | US FAERS | |
| 629 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 630 | Incisional hernia | FAERS: 1 | US FAERS | |
| 631 | Incontinence | FAERS: 1 | US FAERS | |
| 632 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 633 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 634 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 635 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 636 | Infertility | FAERS: 1 | US FAERS | |
| 637 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 638 | Injection site cyst | FAERS: 1 | US FAERS | |
| 639 | Injection site nodule | FAERS: 1 | US FAERS | |
| 640 | Injection site pruritus | FAERS: 1 | US FAERS | |
| 641 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 642 | Injury associated with device | FAERS: 1 | US FAERS | |
| 643 | Instillation site pain | FAERS: 1 | US FAERS | |
| 644 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 645 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 646 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 647 | Intracranial mass | FAERS: 1 | US FAERS | |
| 648 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 649 | Iris vascular disorder | FAERS: 1 | US FAERS | |
| 650 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 651 | Joint destruction | FAERS: 1 | US FAERS | |
| 652 | Keratitis | FAERS: 1 | US FAERS | |
| 653 | Kernig's sign | FAERS: 1 | US FAERS | |
| 654 | Laparotomy | FAERS: 1 | US FAERS | |
| 655 | Laryngeal Obstruction | FAERS: 1 | US FAERS | |
| 656 | Left atrial hypertrophy | FAERS: 1 | US FAERS | |
| 657 | Ligament injury | FAERS: 1 | US FAERS | |
| 658 | Ligament pain | FAERS: 1 | US FAERS | |
| 659 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 660 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 661 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 662 | Low set ears | FAERS: 1 | US FAERS | |
| 663 | Lung infection pseudomonal | FAERS: 1 | US FAERS | |
| 664 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 665 | Malabsorption | FAERS: 1 | US FAERS | |
| 666 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 667 | Malignant Fibrous Histiocytoma | FAERS: 1 | US FAERS | |
| 668 | Malnutrition | FAERS: 1 | US FAERS | |
| 669 | Manufacturing materials issue | FAERS: 1 | US FAERS | |
| 670 | Medication residue present | FAERS: 1 | US FAERS | |
| 671 | Meningitis | FAERS: 1 | US FAERS | |
| 672 | Metrorrhagia | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 673 | Mononucleosis syndrome | FAERS: 1 | US FAERS | |
| 674 | Monoparesis | FAERS: 1 | US FAERS | |
| 675 | Monoplegia | FAERS: 1 | US FAERS | |
| 676 | Multiple allergies | FAERS: 1 | US FAERS | |
| 677 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 678 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 679 | Muscle abscess | FAERS: 1 | US FAERS | |
| 680 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 681 | Myopathy | FAERS: 1 | US FAERS | |
| 682 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 683 | Nephrectomy | FAERS: 1 | US FAERS | |
| 684 | Neuralgia | FAERS: 1 | US FAERS | |
| 685 | Nodule | FAERS: 1 | US FAERS | |
| 686 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 687 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 688 | Obesity | FAERS: 1 | US FAERS | |
| 689 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 690 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 691 | Oral pain | FAERS: 1 | US FAERS | |
| 692 | Overweight | FAERS: 1 | US FAERS | |
| 693 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 694 | PO2 decreased | FAERS: 1 | US FAERS | |
| 695 | Pain of skin | FAERS: 1 | US FAERS | |
| 696 | Palpable purpura | FAERS: 1 | US FAERS | |
| 697 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 698 | Pemphigus | FAERS: 1 | US FAERS | |
| 699 | Penile erythema | FAERS: 1 | US FAERS | |
| 700 | Performance status decreased | FAERS: 1 | US FAERS | |
| 701 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 702 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 703 | Peritoneal fluid analysis abnormal | FAERS: 1 | US FAERS | |
| 704 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 705 | Pneumonitis | FAERS: 1 | US FAERS | |
| 706 | Polyarthritis | FAERS: 1 | US FAERS | |
| 707 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 708 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 709 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 710 | Post procedural swelling | FAERS: 1 | US FAERS | |
| 711 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 712 | Postoperative wound complication | FAERS: 1 | US FAERS | |
| 713 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 714 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 715 | Premature Ejaculation | FAERS: 1 | US FAERS | |
| 716 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 717 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 718 | Priapism | FAERS: 1 | US FAERS | |
| 719 | Product complaint | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 720 | Product contamination | FAERS: 1 | US FAERS | |
| 721 | Product deposit | FAERS: 1 | US FAERS | |
| 722 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 723 | Product prescribing error | FAERS: 1 | US FAERS | |
| 724 | Product storage error | FAERS: 1 | US FAERS | |
| 725 | Pseudomonas test positive | FAERS: 1 | US FAERS | |
| 726 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 727 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 728 | Punctate keratitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 729 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 730 | Pyonephrosis | FAERS: 1 | US FAERS | |
| 731 | Quadriplegia | FAERS: 1 | US FAERS | |
| 732 | Rebound effect | FAERS: 1 | US FAERS | |
| 733 | Rectal discharge | FAERS: 1 | US FAERS | |
| 734 | Renal artery stent placement | FAERS: 1 | US FAERS | |
| 735 | Renal tubular atrophy | FAERS: 1 | US FAERS | |
| 736 | Residual urine | FAERS: 1 | US FAERS | |
| 737 | Restlessness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 738 | Retching | FAERS: 1 | US FAERS | |
| 739 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 740 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 741 | Schizophrenia | FAERS: 1 | US FAERS | |
| 742 | Sciatica | FAERS: 1 | US FAERS | |
| 743 | Secretion discharge | FAERS: 1 | US FAERS | |
| 744 | Selenium deficiency | FAERS: 1 | US FAERS | |
| 745 | Septic arthritis staphylococcal | FAERS: 1 | US FAERS | |
| 746 | Septic necrosis | FAERS: 1 | US FAERS | |
| 747 | Serum Sickness | FAERS: 1 | US FAERS | |
| 748 | Shock symptom | FAERS: 1 | US FAERS | |
| 749 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 750 | Skin Erosion | FAERS: 1 | US FAERS | |
| 751 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 752 | Skin discomfort | FAERS: 1 | US FAERS | |
| 753 | Skin laceration | FAERS: 1 | US FAERS | |
| 754 | Skin nodule | FAERS: 1 | US FAERS | |
| 755 | Spinal column injury | FAERS: 1 | US FAERS | |
| 756 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 757 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 758 | Splenomegaly | FAERS: 1 | US FAERS | |
| 759 | Spondylitis | FAERS: 1 | US FAERS | |
| 760 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 761 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 762 | Stool analysis abnormal | FAERS: 1 | US FAERS | |
| 763 | Stress ulcer | FAERS: 1 | US FAERS | |
| 764 | Stress | FAERS: 1 | US FAERS | |
| 765 | Sudden Cardiac Death | FAERS: 1 | US FAERS | |
| 766 | Superficial injury of eye | FAERS: 1 | US FAERS | |
| 767 | Suprapubic pain | FAERS: 1 | US FAERS | |
| 768 | Tablet issue | FAERS: 1 | US FAERS | |
| 769 | Tetany | FAERS: 1 | US FAERS | |
| 770 | Thalamic infarction | FAERS: 1 | US FAERS | |
| 771 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 772 | Thermal burn | FAERS: 1 | US FAERS | |
| 773 | Thirst | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 774 | Thoracic cavity drainage | FAERS: 1 | US FAERS | |
| 775 | Thyroiditis | FAERS: 1 | US FAERS | |
| 776 | Toe operation | FAERS: 1 | US FAERS | |
| 777 | Tongue eruption | FAERS: 1 | US FAERS | |
| 778 | Tonic clonic movements | FAERS: 1 | US FAERS | |
| 779 | Total complement activity increased | FAERS: 1 | US FAERS | |
| 780 | Tracheal fistula | FAERS: 1 | US FAERS | |
| 781 | Typhoid Fever | FAERS: 1 | US FAERS | |
| 782 | Ulnar Neuritis | FAERS: 1 | US FAERS | |
| 783 | Ultrasound scan abnormal | FAERS: 1 | US FAERS | |
| 784 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 785 | Urinary casts present | FAERS: 1 | US FAERS | |
| 786 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 787 | Urine albumin/creatinine ratio abnormal | FAERS: 1 | US FAERS | |
| 788 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 789 | Uterine spasm | FAERS: 1 | US FAERS | |
| 790 | Violent ideation | FAERS: 1 | US FAERS | |
| 791 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 792 | Vitreous degeneration | FAERS: 1 | US FAERS | |
| 793 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 794 | Walking aid user | FAERS: 1 | US FAERS | |
| 795 | Wound Complication | FAERS: 1 | US FAERS | |
| 796 | Wound Debridement | FAERS: 1 | US FAERS | |
| 797 | Wound Infection | FAERS: 1 | US FAERS | |
| 798 | effusion | FAERS: 1 | US FAERS | |
| 799 | muscle injury | FAERS: 1 | US FAERS | |
| 800 | skin abrasion | FAERS: 1 | US FAERS | |
| 801 | Ageusia | Canada Vigilance: 1 | Canada Vigilance | |
| 802 | Feeling of body temperature change | Canada Vigilance: 1 | Canada Vigilance | |
| 803 | Multiple sclerosis relapse | Canada Vigilance: 1 | Canada Vigilance | |
| 804 | Pelvic Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 805 | Respiratory tract congestion | Canada Vigilance: 1 | Canada Vigilance | |
| 806 | Therapeutic product effect incomplete | Canada Vigilance: 1 | Canada Vigilance | |
| 807 | treatment failure | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.