Pioglitazone
(HYAFETHFCAUJAY-UHFFFAOYSA-N)
Structure
- SMILES
- CCc1ccc(nc1)CCOc1ccc(cc1)CC1SC(=O)NC1=O
- Type(s)
- Approved; Investigational
- ATC code(s)
- A10BD05; A10BD06; A10BD09; A10BD12; A10BG03
- Molecular Formula:
- C19H20N2O3S
- Molecular Weight:
- 356.439
- Log P:
- 3.4884
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 93.59
- CAS Number(s):
- 105355-27-9; 105390-47-4; 111025-46-8
Synonym(s)
1.
Pioglitazone
2.
5-(4-(2-(5-Ethyl-2-pyridyl)ethoxy)benzyl)-2,4-thiazolidinedione
3.
AD 4833
4.
AD-4833
5.
Actos
6.
Poglitazone Hydrochloride
7.
U 72107A
8.
U-72107A
9.
U72,107A
10.
AD4833
11.
U72107A
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myocardial Infarction | FAERS: 122 | 12087064 | CTD SIDER US FAERS |
| 2 | Fatigue | FAERS: 52 | SIDER US FAERS | |
| 3 | Bladder cancer recurrent | FAERS: 51 | US FAERS | |
| 4 | Blood glucose increased | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Joint swelling | FAERS: 40 | US FAERS | |
| 6 | Blood urine present | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 7 | Bladder Neoplasm | FAERS: 36 | SIDER US FAERS | |
| 8 | Chest Pain | FAERS: 36 | OFFSIDES SIDER US FAERS | |
| 9 | Cerebrovascular accident | FAERS: 34 | SIDER US FAERS | |
| 10 | Dizziness | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 11 | Pharmaceutical product complaint | FAERS: 32 | US FAERS | |
| 12 | Weight decreased | FAERS: 32 | SIDER US FAERS | |
| 13 | Drug ineffective | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 14 | Myalgia | FAERS: 30 | SIDER US FAERS | |
| 15 | Swelling | FAERS: 30 | US FAERS | |
| 16 | Nausea | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 17 | Back Pain | FAERS: 27 | SIDER US FAERS | |
| 18 | Asthenia | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 19 | Dysuria | FAERS: 23 | US FAERS | |
| 20 | Headache | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 21 | Malaise | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Pain | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Peripheral swelling | FAERS: 21 | US FAERS | |
| 24 | Medication Error | FAERS: 20 | US FAERS | |
| 25 | Urinary tract infection | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 26 | Abdominal Pain | FAERS: 19 | US FAERS | |
| 27 | Feeling abnormal | FAERS: 19 | SIDER US FAERS | |
| 28 | Drug dispensing error | FAERS: 18 | US FAERS | |
| 29 | Pneumonia | FAERS: 18 | US FAERS | |
| 30 | Arthralgia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 31 | Blood glucose decreased | FAERS: 17 | OFFSIDES US FAERS | |
| 32 | Ascites | FAERS: 16 | OFFSIDES US FAERS | |
| 33 | Pericardial effusion | FAERS: 16 | US FAERS | |
| 34 | Vomiting | FAERS: 15 | US FAERS | |
| 35 | Acute myocardial infarction | FAERS: 14 | US FAERS | |
| 36 | Atrial Fibrillation | FAERS: 14 | US FAERS | |
| 37 | Incorrect dose administered | FAERS: 14 | US FAERS | |
| 38 | Adverse event | FAERS: 13 | US FAERS | |
| 39 | Diabetes mellitus inadequate control | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 40 | Pancreatic carcinoma | FAERS: 13 | US FAERS | |
| 41 | Angina Pectoris | FAERS: 12 | SIDER US FAERS | |
| 42 | Cardiac Arrest | FAERS: 12 | US FAERS | |
| 43 | Chest discomfort | FAERS: 12 | US FAERS | |
| 44 | Palpitations | FAERS: 12 | US FAERS | |
| 45 | Visual Impairment | FAERS: 12 | SIDER US FAERS | |
| 46 | Oropharyngeal pain | FAERS: 11 | US FAERS | |
| 47 | Pancreatitis | FAERS: 11 | OFFSIDES US FAERS | |
| 48 | Sinusitis | FAERS: 11 | SIDER US FAERS | |
| 49 | Gamma-Glutamyltransferase Increased | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Pruritus | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Sepsis | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 52 | Cardiomegaly | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Poor quality drug administered | FAERS: 9 | US FAERS | |
| 54 | Activities of daily living impaired | FAERS: 8 | US FAERS | |
| 55 | Coronary Artery Disease | FAERS: 8 | US FAERS | |
| 56 | Product substitution issue | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Right ventricular failure | FAERS: 8 | US FAERS | |
| 58 | Abasia | FAERS: 7 | US FAERS | |
| 59 | Bladder cancer stage 0, with cancer in situ | FAERS: 7 | US FAERS | |
| 60 | Blood creatinine decreased | FAERS: 7 | US FAERS | |
| 61 | Cystitis | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 62 | Economic problem | FAERS: 7 | US FAERS | |
| 63 | Erythema | FAERS: 7 | US FAERS | |
| 64 | Fracture | FAERS: 7 | SIDER US FAERS | |
| 65 | Nasopharyngitis | FAERS: 7 | US FAERS | |
| 66 | No adverse event | FAERS: 7 | US FAERS | |
| 67 | Overdose | FAERS: 7 | US FAERS | |
| 68 | Pulmonary Hypertension | FAERS: 7 | OFFSIDES US FAERS | |
| 69 | Respiratory Failure | FAERS: 7 | OFFSIDES US FAERS | |
| 70 | Tremor | FAERS: 7 | US FAERS | |
| 71 | Ankle Fracture | FAERS: 6 | US FAERS | |
| 72 | Anxiety | FAERS: 6 | US FAERS | |
| 73 | Blood alkaline phosphatase increased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Blood creatine phosphokinase increased | FAERS: 6 | SIDER US FAERS | |
| 75 | General physical health deterioration | FAERS: 6 | US FAERS | |
| 76 | Nephrolithiasis | FAERS: 6 | US FAERS | |
| 77 | Osteopenia | FAERS: 6 | US FAERS | |
| 78 | Pulmonary Fibrosis | FAERS: 6 | 24161914 | CTD US FAERS |
| 79 | Renal Cell Carcinoma | FAERS: 6 | US FAERS | |
| 80 | Syncope | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 81 | Tachycardia | FAERS: 6 | US FAERS | |
| 82 | Thrombosis | FAERS: 6 | US FAERS | |
| 83 | Uterine Cancer | FAERS: 6 | US FAERS | |
| 84 | Vertigo | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 85 | Abdominal discomfort | FAERS: 5 | OFFSIDES US FAERS | |
| 86 | Acute kidney injury | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Anorexia | FAERS: 5 | US FAERS | |
| 88 | Bladder adenocarcinoma stage unspecified | FAERS: 5 | US FAERS | |
| 89 | Bladder pain | FAERS: 5 | US FAERS | |
| 90 | Bladder transitional cell carcinoma stage III | FAERS: 5 | US FAERS | |
| 91 | Blindness | FAERS: 5 | US FAERS | |
| 92 | Blood albumin decreased | FAERS: 5 | US FAERS | |
| 93 | Blood glucose abnormal | FAERS: 5 | OFFSIDES US FAERS | |
| 94 | Blood lactate dehydrogenase increased | FAERS: 5 | US FAERS | |
| 95 | Chills | FAERS: 5 | US FAERS | |
| 96 | Chromaturia | FAERS: 5 | US FAERS | |
| 97 | Dehydration | FAERS: 5 | OFFSIDES US FAERS | |
| 98 | Dry skin | FAERS: 5 | US FAERS | |
| 99 | Dyspepsia | FAERS: 5 | US FAERS | |
| 100 | Hunger | FAERS: 5 | US FAERS | |
| 101 | Impaired work ability | FAERS: 5 | US FAERS | |
| 102 | Infection | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 103 | Pathological fracture | FAERS: 5 | US FAERS | |
| 104 | Pericarditis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 105 | Pulmonary Embolism | FAERS: 5 | US FAERS | |
| 106 | Retinal Detachment | FAERS: 5 | US FAERS | |
| 107 | Skin Ulcer | FAERS: 5 | US FAERS | |
| 108 | Urinary Retention | FAERS: 5 | US FAERS | |
| 109 | Urine cytology abnormal | FAERS: 5 | US FAERS | |
| 110 | Visual disturbance | FAERS: 5 | SIDER US FAERS | |
| 111 | Accidental overdose | FAERS: 4 | US FAERS | |
| 112 | Alanine Aminotransferase Increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 113 | Alopecia | FAERS: 4 | US FAERS | |
| 114 | Arthropathy | FAERS: 4 | US FAERS | |
| 115 | Aspartate Aminotransferase Increased | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Asthma | FAERS: 4 | OFFSIDES US FAERS | |
| 117 | Bladder cancer stage IV | FAERS: 4 | US FAERS | |
| 118 | Bladder transitional cell carcinoma stage I | FAERS: 4 | US FAERS | |
| 119 | Blood creatinine increased | FAERS: 4 | OFFSIDES US FAERS | |
| 120 | Blood glucose fluctuation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 121 | Bone pain | FAERS: 4 | US FAERS | |
| 122 | Brain natriuretic peptide increased | FAERS: 4 | US FAERS | |
| 123 | Burning sensation | FAERS: 4 | US FAERS | |
| 124 | Cerebral Infarction | FAERS: 4 | US FAERS | |
| 125 | Constipation | FAERS: 4 | US FAERS | |
| 126 | Disability | FAERS: 4 | US FAERS | |
| 127 | Disease recurrence | FAERS: 4 | US FAERS | |
| 128 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 129 | Epistaxis | FAERS: 4 | US FAERS | |
| 130 | Flatulence | FAERS: 4 | SIDER US FAERS | |
| 131 | Hepatitis B | FAERS: 4 | US FAERS | |
| 132 | Hepatitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 133 | Hypersensitivity | FAERS: 4 | SIDER US FAERS | |
| 134 | Intercepted drug dispensing error | FAERS: 4 | US FAERS | |
| 135 | Leukocytoclastic vasculitis | FAERS: 4 | US FAERS | |
| 136 | MYELODYSPLASTIC SYNDROME | FAERS: 4 | US FAERS | |
| 137 | Macular fibrosis | FAERS: 4 | US FAERS | |
| 138 | Neck Pain | FAERS: 4 | US FAERS | |
| 139 | Proteinuria | FAERS: 4 | 16687628 18448808 | CTD SIDER US FAERS |
| 140 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 141 | Septic Shock | FAERS: 4 | US FAERS | |
| 142 | Sudden death | FAERS: 4 | US FAERS | |
| 143 | Tooth Loss | FAERS: 4 | US FAERS | |
| 144 | Toothache | FAERS: 4 | US FAERS | |
| 145 | Unevaluable event | FAERS: 4 | US FAERS | |
| 146 | Vitreous adhesions | FAERS: 4 | US FAERS | |
| 147 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 148 | Arteriosclerosis | FAERS: 3 | OFFSIDES US FAERS | |
| 149 | Atrial Flutter | FAERS: 3 | OFFSIDES US FAERS | |
| 150 | Benign Prostatic Hyperplasia | FAERS: 3 | US FAERS | |
| 151 | Bladder dysplasia | FAERS: 3 | US FAERS | |
| 152 | Bladder papilloma | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Bladder squamous cell carcinoma stage unspecified | FAERS: 3 | US FAERS | |
| 154 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 155 | Bradycardia | FAERS: 3 | US FAERS | |
| 156 | Cardiac Tamponade | FAERS: 3 | US FAERS | |
| 157 | Cholangitis | FAERS: 3 | US FAERS | |
| 158 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 159 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 160 | Deafness | FAERS: 3 | US FAERS | |
| 161 | Deep Vein Thrombosis | FAERS: 3 | US FAERS | |
| 162 | Diabetic Ketoacidosis | FAERS: 3 | US FAERS | |
| 163 | Diabetic Retinopathy | FAERS: 3 | 17063547 | CTD OFFSIDES US FAERS |
| 164 | Disease Progression | FAERS: 3 | US FAERS | |
| 165 | Erectile dysfunction | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 166 | Feeling Cold | FAERS: 3 | US FAERS | |
| 167 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 168 | Macular degeneration | FAERS: 3 | US FAERS | |
| 169 | Metastasis | FAERS: 3 | US FAERS | |
| 170 | Metastatic Neoplasm | FAERS: 3 | US FAERS | |
| 171 | Product use in unapproved indication | FAERS: 3 | US FAERS | |
| 172 | Quality of life decreased | FAERS: 3 | US FAERS | |
| 173 | Retching | FAERS: 3 | US FAERS | |
| 174 | Stevens-Johnson Syndrome | FAERS: 3 | US FAERS | |
| 175 | Therapeutic product contamination | FAERS: 3 | US FAERS | |
| 176 | Urticaria | FAERS: 3 | SIDER US FAERS | |
| 177 | Ventricular Fibrillation | FAERS: 3 | US FAERS | |
| 178 | Wheezing | FAERS: 3 | US FAERS | |
| 179 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 180 | Amnesia | FAERS: 2 | US FAERS | |
| 181 | Angioedema | FAERS: 2 | SIDER US FAERS | |
| 182 | Apathy | FAERS: 2 | US FAERS | |
| 183 | Apparent death | FAERS: 2 | US FAERS | |
| 184 | Benign neoplasm of bladder | FAERS: 2 | US FAERS | |
| 185 | Blood thyroid stimulating hormone decreased | FAERS: 2 | US FAERS | |
| 186 | Bone density decreased | FAERS: 2 | US FAERS | |
| 187 | Cellulitis | FAERS: 2 | OFFSIDES US FAERS | |
| 188 | Cyst | FAERS: 2 | SIDER US FAERS | |
| 189 | Depressed mood | FAERS: 2 | US FAERS | |
| 190 | Diabetes Mellitus | FAERS: 2 | 20860658 | CTD SIDER US FAERS |
| 191 | Diplopia | FAERS: 2 | US FAERS | |
| 192 | Discomfort | FAERS: 2 | SIDER US FAERS | |
| 193 | Disease complication | FAERS: 2 | US FAERS | |
| 194 | Disorientation | FAERS: 2 | US FAERS | |
| 195 | Drug administration error | FAERS: 2 | US FAERS | |
| 196 | Drug dose omission | FAERS: 2 | US FAERS | |
| 197 | Drug exposure during pregnancy | FAERS: 2 | US FAERS | |
| 198 | Dysphonia | FAERS: 2 | US FAERS | |
| 199 | Emotional disorder | FAERS: 2 | US FAERS | |
| 200 | Emotional distress | FAERS: 2 | OFFSIDES US FAERS | |
| 201 | Eosinophilia | FAERS: 2 | US FAERS | |
| 202 | Expired drug administered | FAERS: 2 | OFFSIDES US FAERS | |
| 203 | Fluid overload | FAERS: 2 | US FAERS | |
| 204 | Gallbladder necrosis | FAERS: 2 | US FAERS | |
| 205 | Gastritis | FAERS: 2 | US FAERS | |
| 206 | Glaucoma | FAERS: 2 | US FAERS | |
| 207 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 208 | Hypersomnia | FAERS: 2 | US FAERS | |
| 209 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 210 | Hypotension | FAERS: 2 | US FAERS | |
| 211 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 212 | Hypoxia | FAERS: 2 | US FAERS | |
| 213 | Hysterectomy | FAERS: 2 | US FAERS | |
| 214 | Large intestine perforation | FAERS: 2 | US FAERS | |
| 215 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 216 | Mood swings | FAERS: 2 | US FAERS | |
| 217 | Musculoskeletal stiffness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 218 | Mydriasis | FAERS: 2 | US FAERS | |
| 219 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 2 | US FAERS | |
| 220 | Nephritis allergic | FAERS: 2 | US FAERS | |
| 221 | No adverse reaction | FAERS: 2 | US FAERS | |
| 222 | Nocturia | FAERS: 2 | US FAERS | |
| 223 | Nystagmus | FAERS: 2 | US FAERS | |
| 224 | Obesity | FAERS: 2 | 18448808 25679220 | CTD US FAERS |
| 225 | Ocular icterus | FAERS: 2 | US FAERS | |
| 226 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 227 | Osteoporosis | FAERS: 2 | US FAERS | |
| 228 | Pallor | FAERS: 2 | OFFSIDES US FAERS | |
| 229 | Pharyngolaryngeal Pain | FAERS: 2 | US FAERS | |
| 230 | Polyuria | FAERS: 2 | US FAERS | |
| 231 | Post procedural complication | FAERS: 2 | US FAERS | |
| 232 | Pregnancy | FAERS: 2 | SIDER US FAERS | |
| 233 | Protein urine present | FAERS: 2 | SIDER US FAERS | |
| 234 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 235 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 236 | Pyelonephritis | FAERS: 2 | US FAERS | |
| 237 | Pyuria | FAERS: 2 | US FAERS | |
| 238 | Rales | FAERS: 2 | US FAERS | |
| 239 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 240 | Sleep Talking | FAERS: 2 | US FAERS | |
| 241 | Somnolence | FAERS: 2 | US FAERS | |
| 242 | Squamous cell carcinoma | FAERS: 2 | US FAERS | |
| 243 | Suicide attempt | FAERS: 2 | US FAERS | |
| 244 | Throat cancer | FAERS: 2 | OFFSIDES US FAERS | |
| 245 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 246 | Urinary Incontinence | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 247 | Urinary bladder polyp | FAERS: 2 | US FAERS | |
| 248 | Walking aid user | FAERS: 2 | US FAERS | |
| 249 | jaundice | FAERS: 2 | 11866308 | CTD US FAERS |
| 250 | treatment failure | FAERS: 2 | OFFSIDES US FAERS | |
| 251 | Abdominal mass | FAERS: 1 | OFFSIDES US FAERS | |
| 252 | Abnormal weight gain | FAERS: 1 | US FAERS | |
| 253 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 254 | Acne | FAERS: 1 | US FAERS | |
| 255 | Acute Coronary Syndrome | FAERS: 1 | SIDER US FAERS | |
| 256 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 257 | Akinesia | FAERS: 1 | US FAERS | |
| 258 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 259 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 260 | Aneurysm | FAERS: 1 | US FAERS | |
| 261 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 262 | Aphasia | FAERS: 1 | US FAERS | |
| 263 | Aphonia | FAERS: 1 | US FAERS | |
| 264 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 265 | Ataxia | FAERS: 1 | US FAERS | |
| 266 | Atelectasis | FAERS: 1 | OFFSIDES US FAERS | |
| 267 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 268 | Back disorder | FAERS: 1 | US FAERS | |
| 269 | Barrel chest | FAERS: 1 | US FAERS | |
| 270 | Bedridden | FAERS: 1 | US FAERS | |
| 271 | Bladder cancer stage I, without cancer in situ | FAERS: 1 | US FAERS | |
| 272 | Bladder tamponade | FAERS: 1 | US FAERS | |
| 273 | Bladder transitional cell carcinoma metastatic | FAERS: 1 | US FAERS | |
| 274 | Bladder transitional cell carcinoma stage 0 | FAERS: 1 | US FAERS | |
| 275 | Bladder transitional cell carcinoma stage IV | FAERS: 1 | US FAERS | |
| 276 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 277 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 278 | Blood magnesium decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 279 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 280 | Blood pressure inadequately controlled | FAERS: 1 | OFFSIDES US FAERS | |
| 281 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 282 | Blood urea increased | FAERS: 1 | OFFSIDES US FAERS | |
| 283 | Bone fissure | FAERS: 1 | US FAERS | |
| 284 | Bone lesion | FAERS: 1 | US FAERS | |
| 285 | Bone marrow toxicity | FAERS: 1 | US FAERS | |
| 286 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 287 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 288 | Bronchitis | FAERS: 1 | SIDER US FAERS | |
| 289 | Campylobacter infection | FAERS: 1 | US FAERS | |
| 290 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 291 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 292 | Cardiothoracic ratio increased | FAERS: 1 | US FAERS | |
| 293 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 294 | Cataract | FAERS: 1 | US FAERS | |
| 295 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 296 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 297 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 298 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 299 | Cholestasis | FAERS: 1 | US FAERS | |
| 300 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 301 | Colonic fistula | FAERS: 1 | US FAERS | |
| 302 | Completed Suicide | FAERS: 1 | US FAERS | |
| 303 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | US FAERS | |
| 304 | Cor pulmonale | FAERS: 1 | US FAERS | |
| 305 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 306 | Cystoscopy | FAERS: 1 | US FAERS | |
| 307 | Cystostomy | FAERS: 1 | US FAERS | |
| 308 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 309 | Dermatitis | FAERS: 1 | US FAERS | |
| 310 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 311 | Drug toxicity | FAERS: 1 | US FAERS | |
| 312 | Dysarthria | FAERS: 1 | US FAERS | |
| 313 | Dyspareunia | FAERS: 1 | US FAERS | |
| 314 | Eczema | FAERS: 1 | OFFSIDES US FAERS | |
| 315 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 316 | Electrocardiogram abnormal | FAERS: 1 | SIDER US FAERS | |
| 317 | Erythropenia | FAERS: 1 | US FAERS | |
| 318 | Escherichia infection | FAERS: 1 | US FAERS | |
| 319 | Escherichia urinary tract infection | FAERS: 1 | US FAERS | |
| 320 | Eye irritation | FAERS: 1 | US FAERS | |
| 321 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 322 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 323 | Fungal cystitis | FAERS: 1 | US FAERS | |
| 324 | Gangrene | FAERS: 1 | OFFSIDES US FAERS | |
| 325 | Gastric Bypass | FAERS: 1 | OFFSIDES US FAERS | |
| 326 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 327 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 328 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 329 | Gout | FAERS: 1 | OFFSIDES US FAERS | |
| 330 | Granulocytosis | FAERS: 1 | US FAERS | |
| 331 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 332 | Hepatic Encephalopathy | FAERS: 1 | 11866308 | CTD US FAERS |
| 333 | Hepatic Vein Thrombosis | FAERS: 1 | US FAERS | |
| 334 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 335 | Hernia | FAERS: 1 | US FAERS | |
| 336 | Hyperphagia | FAERS: 1 | US FAERS | |
| 337 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 338 | Hypokinesia | FAERS: 1 | OFFSIDES US FAERS | |
| 339 | Hypophagia | FAERS: 1 | OFFSIDES US FAERS | |
| 340 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 341 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 342 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 343 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 344 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 345 | Joint sprain | FAERS: 1 | US FAERS | |
| 346 | Jugular vein distension | FAERS: 1 | US FAERS | |
| 347 | Laziness | FAERS: 1 | US FAERS | |
| 348 | Lethargy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 349 | Leukocytosis | FAERS: 1 | US FAERS | |
| 350 | Leukopenia | FAERS: 1 | US FAERS | |
| 351 | Lid sulcus deepened | FAERS: 1 | US FAERS | |
| 352 | Lip swelling | FAERS: 1 | US FAERS | |
| 353 | Lipomatosis | FAERS: 1 | US FAERS | |
| 354 | Loose tooth | FAERS: 1 | US FAERS | |
| 355 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 356 | Lung squamous cell carcinoma stage I | FAERS: 1 | US FAERS | |
| 357 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 358 | Lymphoma | FAERS: 1 | OFFSIDES US FAERS | |
| 359 | Lymphopenia | FAERS: 1 | US FAERS | |
| 360 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 361 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 362 | Memory impairment | FAERS: 1 | US FAERS | |
| 363 | Mental status changes | FAERS: 1 | OFFSIDES US FAERS | |
| 364 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 365 | Microalbuminuria | FAERS: 1 | US FAERS | |
| 366 | Middle insomnia | FAERS: 1 | US FAERS | |
| 367 | Monoplegia | FAERS: 1 | US FAERS | |
| 368 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 369 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 370 | Muscle strain | FAERS: 1 | US FAERS | |
| 371 | Muscle tightness | FAERS: 1 | US FAERS | |
| 372 | Musculoskeletal Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 373 | Musculoskeletal discomfort | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 374 | Myocardial strain | FAERS: 1 | US FAERS | |
| 375 | Myopathy | FAERS: 1 | US FAERS | |
| 376 | Myopia | FAERS: 1 | US FAERS | |
| 377 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 378 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 379 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 380 | Neuromuscular pain | FAERS: 1 | US FAERS | |
| 381 | No adverse drug reaction | FAERS: 1 | US FAERS | |
| 382 | No adverse effect | FAERS: 1 | US FAERS | |
| 383 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 384 | Open wound | FAERS: 1 | US FAERS | |
| 385 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 386 | Oral pain | FAERS: 1 | US FAERS | |
| 387 | Osteomalacia | FAERS: 1 | US FAERS | |
| 388 | Pancreatic Pseudocyst | FAERS: 1 | US FAERS | |
| 389 | Pancytopenia | FAERS: 1 | US FAERS | |
| 390 | Panic Disorder | FAERS: 1 | US FAERS | |
| 391 | Paranoia | FAERS: 1 | OFFSIDES US FAERS | |
| 392 | Parotitis | FAERS: 1 | US FAERS | |
| 393 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 394 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 395 | Peritonitis | FAERS: 1 | US FAERS | |
| 396 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 397 | Phimosis | FAERS: 1 | US FAERS | |
| 398 | Phlebitis | FAERS: 1 | OFFSIDES US FAERS | |
| 399 | Plasmacytoma | FAERS: 1 | US FAERS | |
| 400 | Pneumothorax | FAERS: 1 | US FAERS | |
| 401 | Poisoning | FAERS: 1 | US FAERS | |
| 402 | Polydipsia | FAERS: 1 | US FAERS | |
| 403 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 404 | Prescribed overdose | FAERS: 1 | US FAERS | |
| 405 | Presyncope | FAERS: 1 | US FAERS | |
| 406 | Procedural complication | FAERS: 1 | US FAERS | |
| 407 | Product formulation issue | FAERS: 1 | US FAERS | |
| 408 | Product prescribing error | FAERS: 1 | US FAERS | |
| 409 | Product quality issue | FAERS: 1 | US FAERS | |
| 410 | Product use issue | FAERS: 1 | US FAERS | |
| 411 | Productive Cough | FAERS: 1 | US FAERS | |
| 412 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 413 | Purulent discharge | FAERS: 1 | US FAERS | |
| 414 | Radiation injury | FAERS: 1 | US FAERS | |
| 415 | Radiation skin injury | FAERS: 1 | US FAERS | |
| 416 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 417 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 418 | Renal cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 419 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 420 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 421 | Respiratory distress | FAERS: 1 | US FAERS | |
| 422 | Restlessness | FAERS: 1 | US FAERS | |
| 423 | Right ventricular systolic pressure increased | FAERS: 1 | US FAERS | |
| 424 | Scab | FAERS: 1 | US FAERS | |
| 425 | Schizophrenia | FAERS: 1 | US FAERS | |
| 426 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 427 | Serum Sickness | FAERS: 1 | US FAERS | |
| 428 | Shock | FAERS: 1 | US FAERS | |
| 429 | Sinus headache | FAERS: 1 | OFFSIDES US FAERS | |
| 430 | Skin lesion | FAERS: 1 | US FAERS | |
| 431 | Sluggishness | FAERS: 1 | US FAERS | |
| 432 | Snoring | FAERS: 1 | US FAERS | |
| 433 | Sodium retention | FAERS: 1 | US FAERS | |
| 434 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 435 | Spondylitis | FAERS: 1 | US FAERS | |
| 436 | Stomatitis | FAERS: 1 | US FAERS | |
| 437 | Streptococcal urinary tract infection | FAERS: 1 | US FAERS | |
| 438 | Stress | FAERS: 1 | US FAERS | |
| 439 | Stupor | FAERS: 1 | US FAERS | |
| 440 | Supraventricular tachycardia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 441 | Teeth brittle | FAERS: 1 | US FAERS | |
| 442 | Therapeutic product effect decreased | FAERS: 1 | US FAERS | |
| 443 | Therapy cessation | FAERS: 1 | US FAERS | |
| 444 | Thirst | FAERS: 1 | US FAERS | |
| 445 | Thoracic vertebral fracture | FAERS: 1 | US FAERS | |
| 446 | Tinnitus | FAERS: 1 | US FAERS | |
| 447 | Tooth Extraction | FAERS: 1 | US FAERS | |
| 448 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 449 | Transaminases increased | FAERS: 1 | US FAERS | |
| 450 | Transitional cell carcinoma metastatic | FAERS: 1 | US FAERS | |
| 451 | Triple vessel bypass graft | FAERS: 1 | US FAERS | |
| 452 | Ulcer | FAERS: 1 | US FAERS | |
| 453 | Ureteric cancer metastatic | FAERS: 1 | US FAERS | |
| 454 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 455 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 456 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 457 | Viral upper respiratory tract infection | FAERS: 1 | OFFSIDES US FAERS | |
| 458 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 459 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 460 | Wheelchair user | FAERS: 1 | US FAERS | |
| 461 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 462 | Wound Infection | FAERS: 1 | US FAERS | |
| 463 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 464 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 465 | kyphosis | FAERS: 1 | US FAERS | |
| 466 | muscle injury | FAERS: 1 | US FAERS | |
| 467 | nervous system disorder | FAERS: 1 | SIDER US FAERS | |
| 468 | Abnormal vision | SIDER | ||
| 469 | Abuse | OFFSIDES | ||
| 470 | Acquired diaphragmatic eventration | OFFSIDES | ||
| 471 | Acromegaly | OFFSIDES | ||
| 472 | Acute sinusitis | OFFSIDES | ||
| 473 | Albuminuria | 11912544 | CTD | |
| 474 | Altered state of consciousness | OFFSIDES | ||
| 475 | Alveoloplasty | OFFSIDES | ||
| 476 | Amnestic Disorder | OFFSIDES | ||
| 477 | Anal Fistula | OFFSIDES | ||
| 478 | Anaphylactic shock | SIDER | ||
| 479 | Anhedonia | OFFSIDES | ||
| 480 | Anti-insulin antibody positive | OFFSIDES | ||
| 481 | Anxiety Disorders | 31348919 | CTD | |
| 482 | Aortic valve sclerosis | OFFSIDES | ||
| 483 | Application site erythema | OFFSIDES | ||
| 484 | Application site pruritus | OFFSIDES | ||
| 485 | Application site reaction | OFFSIDES | ||
| 486 | Arthropod bite | OFFSIDES | ||
| 487 | Artificial crown procedure | OFFSIDES | ||
| 488 | Atrial tachycardia | OFFSIDES | ||
| 489 | Autistic Disorder | 17207275 | CTD | |
| 490 | Basal cell carcinoma | OFFSIDES | ||
| 491 | Blood Glucose | OFFSIDES | ||
| 492 | Blood and lymphatic system disorders | SIDER | ||
| 493 | Blood cholesterol | OFFSIDES | ||
| 494 | Blood electrolytes decreased | OFFSIDES | ||
| 495 | Blood potassium decreased | OFFSIDES | ||
| 496 | Blood testosterone decreased | OFFSIDES | ||
| 497 | Bone erosion | OFFSIDES | ||
| 498 | Brain Edema | 30130594 | CTD | |
| 499 | Brain Injuries | 20450929 | CTD | |
| 500 | Breast Feeding | SIDER | ||
| 501 | Bruxism | OFFSIDES | ||
| 502 | Cancer Pain | OFFSIDES | ||
| 503 | Carcinoma | 21255596 | CTD | |
| 504 | Cardiac ventricular disorder | OFFSIDES | ||
| 505 | Cartilage injury | OFFSIDES | ||
| 506 | Cataract operation | OFFSIDES | ||
| 507 | Cerebral cyst | OFFSIDES | ||
| 508 | Chemical and Drug Induced Liver Injury | CTD | ||
| 509 | Clubbing | OFFSIDES | ||
| 510 | Clumsiness | OFFSIDES | ||
| 511 | Cognition Disorders | 23795773 | CTD | |
| 512 | Colitis | Canada Vigilance: 1 | Canada Vigilance | |
| 513 | Colonic Neoplasms | 20540935 | CTD | |
| 514 | Color blindness | OFFSIDES | ||
| 515 | Compulsive shopping | OFFSIDES | ||
| 516 | Congenital cystic kidney disease | OFFSIDES | ||
| 517 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 518 | Cramps of lower extremities | SIDER | ||
| 519 | Cystic Fibrosis | 19747007 | CTD | |
| 520 | Dental abscess | OFFSIDES | ||
| 521 | Dental prosthesis placement | OFFSIDES | ||
| 522 | Depressed Level of Consciousness | OFFSIDES | ||
| 523 | Dermatomyositis | OFFSIDES | ||
| 524 | Device related infection | OFFSIDES | ||
| 525 | Diabetes | OFFSIDES | ||
| 526 | Diabetes Mellitus, Experimental | 16979161 23811337 28242381 | CTD | |
| 527 | Diabetes mellitus exacerbated | SIDER | ||
| 528 | Diabetic Angiopathies | 22456468 | CTD | |
| 529 | Diabetic Foot | OFFSIDES | ||
| 530 | Diabetic Nephropathy | OFFSIDES | ||
| 531 | Diabetic | SIDER | ||
| 532 | Diarrhea | OFFSIDES | ||
| 533 | Disseminated Intravascular Coagulation | OFFSIDES | ||
| 534 | Diverticular perforation | OFFSIDES | ||
| 535 | Diverticulitis | OFFSIDES | ||
| 536 | Dysgeusia | OFFSIDES | ||
| 537 | Dyslipidemias | 21484566 25679220 | CTD | |
| 538 | Dyspnea, Paroxysmal | 15629744 | CTD | |
| 539 | Ear and labyrinth disorders | SIDER | ||
| 540 | Edema | 22070604 | CTD | |
| 541 | Electrocardiogram change | OFFSIDES | ||
| 542 | Endodontic procedure | OFFSIDES | ||
| 543 | Enterovesical Fistula | OFFSIDES | ||
| 544 | Eustachian tube disorder | OFFSIDES | ||
| 545 | Excoriation | OFFSIDES | ||
| 546 | Facial Neuralgia | OFFSIDES | ||
| 547 | Factor V Leiden mutation | OFFSIDES | ||
| 548 | Fat necrosis | OFFSIDES | ||
| 549 | Gastroenteritis | SIDER | ||
| 550 | Gastrointestinal ulcer | OFFSIDES | ||
| 551 | Gestational Diabetes | OFFSIDES | ||
| 552 | Glycosuria | SIDER | ||
| 553 | Goiter | OFFSIDES | ||
| 554 | Heart failure | 15629744 22070604 | CTD | |
| 555 | Hepatic enzyme decreased | SIDER | ||
| 556 | Hepatic impairment | SIDER | ||
| 557 | Hostility | OFFSIDES | ||
| 558 | Hyperglycemia | CTD | ||
| 559 | Hyperinsulinism | 18448808 25679220 25796170 | CTD | |
| 560 | Hyperplasia | 19858066 21255596 | CTD | |
| 561 | Hypertensive emergency | OFFSIDES | ||
| 562 | Hypertrichosis | OFFSIDES | ||
| 563 | Hyperuricemia | 25679220 | CTD | |
| 564 | Immobile | OFFSIDES | ||
| 565 | Impaired self-care | OFFSIDES | ||
| 566 | Implantable defibrillator malfunction | OFFSIDES | ||
| 567 | Infarction, Middle Cerebral Artery | 17394460 | CTD | |
| 568 | Infected cyst | OFFSIDES | ||
| 569 | Infestation | SIDER | ||
| 570 | Inflammation | 16908763 24622831 | CTD | |
| 571 | Influenza | SIDER | ||
| 572 | Infusion site mobility decreased | OFFSIDES | ||
| 573 | Insulin Resistance | CTD OFFSIDES | ||
| 574 | Intentional misuse | OFFSIDES | ||
| 575 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 576 | Joint injury | OFFSIDES | ||
| 577 | Kidney Diseases | 22989705 | CTD | |
| 578 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 579 | Life expectancy shortened | OFFSIDES | ||
| 580 | Limb discomfort | Canada Vigilance: 1 | Canada Vigilance | |
| 581 | Limb injury | OFFSIDES | ||
| 582 | Liver Cirrhosis, Experimental | 15052691 16484506 | CTD | |
| 583 | Liver Failure, Acute | 11866308 | CTD | |
| 584 | Liver Neoplasms, Experimental | 15526359 | CTD | |
| 585 | Lymph node abscess | OFFSIDES | ||
| 586 | Lymphangitis | OFFSIDES | ||
| 587 | Markedly reduced dietary intake | OFFSIDES | ||
| 588 | Memory Disorders | 20951129 23795773 | CTD | |
| 589 | Mental disorders | 23795773 | CTD | |
| 590 | Mitral Valve Stenosis | OFFSIDES | ||
| 591 | Multi-organ disorder | OFFSIDES | ||
| 592 | Myocardial Reperfusion Injury | 28744220 | CTD | |
| 593 | Nasal discomfort | OFFSIDES | ||
| 594 | Necrosis | CTD | ||
| 595 | Nephrogenic Diabetes Insipidus | OFFSIDES | ||
| 596 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 597 | Nerve Degeneration | 30130594 | CTD | |
| 598 | Nervous tension | OFFSIDES | ||
| 599 | Nervousness | Canada Vigilance: 1 | Canada Vigilance | |
| 600 | Neurobehavioral Manifestations | 17394460 | CTD | |
| 601 | Neurotoxicity Syndromes | 20450929 | CTD | |
| 602 | Occult blood positive | OFFSIDES | ||
| 603 | Osteochondrosis | OFFSIDES | ||
| 604 | Pancreatic Neoplasm | OFFSIDES | ||
| 605 | Papilloma | 21255596 | CTD | |
| 606 | Parkinson Disease | 22282722 | CTD | |
| 607 | Pemphigus | OFFSIDES | ||
| 608 | Periodontal operation | OFFSIDES | ||
| 609 | Pharyngeal lesion | OFFSIDES | ||
| 610 | Physical disability | OFFSIDES | ||
| 611 | Pitting edema | SIDER | ||
| 612 | Pneumocystis jiroveci pneumonia | OFFSIDES | ||
| 613 | Polymyalgia Rheumatica | OFFSIDES | ||
| 614 | Polyneuropathy | OFFSIDES | ||
| 615 | Progesterone receptor assay | OFFSIDES | ||
| 616 | Pseudomonal sepsis | OFFSIDES | ||
| 617 | Psychomotor Agitation | 31348919 | CTD | |
| 618 | Pulmonary Edema | 15629744 | CTD | |
| 619 | Rectal tenesmus | OFFSIDES | ||
| 620 | Renal Insufficiency | 22987311 | CTD | |
| 621 | Scleroderma | OFFSIDES | ||
| 622 | Serratia sepsis | OFFSIDES | ||
| 623 | Shoplifting | OFFSIDES | ||
| 624 | Sinoatrial Block | OFFSIDES | ||
| 625 | Sinus bradycardia | OFFSIDES | ||
| 626 | Sinus polyp | OFFSIDES | ||
| 627 | Skin laceration | OFFSIDES | ||
| 628 | Spondylolisthesis | OFFSIDES | ||
| 629 | Staphylococcal abscess | OFFSIDES | ||
| 630 | Stereotypic Movement Disorder | 31348919 | CTD | |
| 631 | Subcutaneous nodule | OFFSIDES | ||
| 632 | Sweating | SIDER | ||
| 633 | Synovial Cyst | OFFSIDES | ||
| 634 | Temperature intolerance | OFFSIDES | ||
| 635 | Therapeutic response changed | Canada Vigilance: 2 | Canada Vigilance | |
| 636 | Therapeutic response unexpected | OFFSIDES | ||
| 637 | Tinea cruris | OFFSIDES | ||
| 638 | Tonsillitis | OFFSIDES | ||
| 639 | Tooth Infection | OFFSIDES | ||
| 640 | Tooth repair | OFFSIDES | ||
| 641 | Trichorrhexis | OFFSIDES | ||
| 642 | Unresponsive to stimuli | OFFSIDES | ||
| 643 | Vascular calcification | OFFSIDES | ||
| 644 | Venous Insufficiency | OFFSIDES | ||
| 645 | Venous stasis | OFFSIDES | ||
| 646 | Venous thrombosis limb | OFFSIDES | ||
| 647 | Ventricular Dysfunction, Left | 23555749 | CTD | |
| 648 | Visual brightness | OFFSIDES | ||
| 649 | Vocal Cord Paralysis | OFFSIDES | ||
| 650 | Weight Gain | CTD OFFSIDES | ||
| 651 | Worsening of diabetes | SIDER | ||
| 652 | Wound infection staphylococcal | OFFSIDES | ||
| 653 | Wound necrosis | OFFSIDES | ||
| 654 | Xerosis | OFFSIDES | ||
| 655 | carbuncle | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.