Latanoprost
(GGXICVAJURFBLW-CEYXHVGTSA-N)
Structure
- SMILES
- O[C@@H](CCc1ccccc1)CC[C@H]1[C@H](O)C[C@@H]([C@@H]1C/C=C\CCCC(=O)OC(C)C)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- S01EE01
- Molecular Formula:
- C26H40O5
- Molecular Weight:
- 432.593
- Log P:
- 4.1864
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 86.99
- CAS Number(s):
- 130209-82-4; 155551-81-8
Synonym(s)
1.
Latanoprost
2.
PHXA41
3.
PhXA34
4.
Xalatan
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Eye irritation | FAERS: 730 Canada Vigilance: 12 | Canada Vigilance SIDER US FAERS | |
| 2 | Drug ineffective | FAERS: 522 Canada Vigilance: 25 | Canada Vigilance US FAERS | |
| 3 | Cataract | FAERS: 478 Canada Vigilance: 9 | Canada Vigilance OFFSIDES US FAERS | |
| 4 | Eye pain | FAERS: 412 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 5 | Glaucoma | FAERS: 260 Canada Vigilance: 3 | CTD OFFSIDES Canada Vigilance US FAERS | |
| 6 | Visual Impairment | FAERS: 213 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 7 | Product quality issue | FAERS: 193 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Headache | FAERS: 163 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 9 | Incorrect dose administered | FAERS: 130 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Malaise | FAERS: 122 | US FAERS | |
| 11 | Blindness | FAERS: 121 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Hypersensitivity | FAERS: 112 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 13 | Dizziness | FAERS: 101 | OFFSIDES SIDER US FAERS | |
| 14 | Foreign body sensation in eyes | FAERS: 93 | US FAERS | |
| 15 | Cataract operation | FAERS: 81 Canada Vigilance: 8 | Canada Vigilance OFFSIDES US FAERS | |
| 16 | Product substitution issue | FAERS: 81 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 17 | Cerebrovascular accident | FAERS: 79 | US FAERS | |
| 18 | Pain | FAERS: 69 Canada Vigilance: 3 | 17102001 | CTD SIDER Canada Vigilance US FAERS |
| 19 | Pruritus | FAERS: 67 | 17102001 | CTD SIDER US FAERS |
| 20 | Product container issue | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Drug dose omission | FAERS: 51 | US FAERS | |
| 22 | Growth of eyelashes | FAERS: 51 | US FAERS | |
| 23 | Diabetes Mellitus | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Nasopharyngitis | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Intraocular pressure test abnormal | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Arthralgia | FAERS: 46 | SIDER US FAERS | |
| 27 | Eye Infection | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Fatigue | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 29 | Myocardial Infarction | FAERS: 44 | US FAERS | |
| 30 | Nausea | FAERS: 44 | OFFSIDES US FAERS | |
| 31 | Erythema | FAERS: 43 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 32 | Macular degeneration | FAERS: 43 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 33 | Feeling abnormal | FAERS: 42 | US FAERS | |
| 34 | Product dropper issue | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Deafness | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 36 | Incorrect product storage | FAERS: 39 | US FAERS | |
| 37 | Memory impairment | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Myalgia | FAERS: 38 | US FAERS | |
| 39 | Ocular discomfort | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 40 | Asthma | FAERS: 37 | OFFSIDES SIDER US FAERS | |
| 41 | Influenza | FAERS: 37 | US FAERS | |
| 42 | Palpitations | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Burning sensation | FAERS: 36 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Drug administration error | FAERS: 35 | US FAERS | |
| 45 | Photophobia | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 46 | Product use issue | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Anxiety | FAERS: 34 | US FAERS | |
| 48 | Arthritis | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 49 | Vertigo | FAERS: 34 | US FAERS | |
| 50 | Asthenia | FAERS: 33 | US FAERS | |
| 51 | Pharmaceutical product complaint | FAERS: 33 | US FAERS | |
| 52 | Asthenopia | FAERS: 32 | OFFSIDES US FAERS | |
| 53 | Conjunctivitis | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 54 | Eye inflammation | FAERS: 32 | US FAERS | |
| 55 | Arthropathy | FAERS: 31 | US FAERS | |
| 56 | Circumstance or information capable of leading to medication error | FAERS: 30 | US FAERS | |
| 57 | Product storage error | FAERS: 29 | US FAERS | |
| 58 | Chest Pain | FAERS: 28 | SIDER US FAERS | |
| 59 | Nervousness | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Diplopia | FAERS: 27 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 61 | No adverse event | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Expired drug administered | FAERS: 26 | OFFSIDES US FAERS | |
| 63 | Poor quality drug administered | FAERS: 25 | OFFSIDES US FAERS | |
| 64 | Chest discomfort | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Discomfort | FAERS: 24 | SIDER US FAERS | |
| 66 | Medication Error | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Overdose | FAERS: 22 | US FAERS | |
| 68 | Product packaging quantity issue | FAERS: 22 | US FAERS | |
| 69 | Reaction to preservatives | FAERS: 22 | US FAERS | |
| 70 | Retinal Detachment | FAERS: 22 | SIDER US FAERS | |
| 71 | Tremor | FAERS: 22 | US FAERS | |
| 72 | Dark circles under eyes | FAERS: 21 | US FAERS | |
| 73 | Pneumonia | FAERS: 21 | US FAERS | |
| 74 | Accidental exposure to product | FAERS: 20 | US FAERS | |
| 75 | Incorrect storage of drug | FAERS: 20 | US FAERS | |
| 76 | Product packaging issue | FAERS: 20 | US FAERS | |
| 77 | Weight decreased | FAERS: 20 | US FAERS | |
| 78 | Epistaxis | FAERS: 19 | US FAERS | |
| 79 | Eyelids pruritus | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 80 | Somnolence | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Tachycardia | FAERS: 19 | US FAERS | |
| 82 | Back Pain | FAERS: 18 | SIDER US FAERS | |
| 83 | Blood cholesterol increased | FAERS: 18 | US FAERS | |
| 84 | Bronchitis | FAERS: 18 | SIDER US FAERS | |
| 85 | Intraocular pressure fluctuation | FAERS: 18 | US FAERS | |
| 86 | Oropharyngeal pain | FAERS: 18 | US FAERS | |
| 87 | Drug effect incomplete | FAERS: 17 | US FAERS | |
| 88 | Dry skin | FAERS: 17 | US FAERS | |
| 89 | Dysphonia | FAERS: 17 | OFFSIDES US FAERS | |
| 90 | Inappropriate schedule of drug administration | FAERS: 17 | US FAERS | |
| 91 | Intentional product misuse | FAERS: 17 | US FAERS | |
| 92 | Abdominal discomfort | FAERS: 16 | US FAERS | |
| 93 | Accidental overdose | FAERS: 16 | US FAERS | |
| 94 | Angina Pectoris | FAERS: 16 | SIDER US FAERS | |
| 95 | Eye Burns | FAERS: 16 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 96 | Eye laser surgery | FAERS: 16 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 97 | Eyelid irritation | FAERS: 16 | US FAERS | |
| 98 | Instillation site pain | FAERS: 16 | US FAERS | |
| 99 | Unevaluable event | FAERS: 16 | US FAERS | |
| 100 | Eyelid margin crusting | FAERS: 15 | US FAERS | |
| 101 | Glaucoma surgery | FAERS: 15 | OFFSIDES US FAERS | |
| 102 | Product formulation issue | FAERS: 15 | US FAERS | |
| 103 | Throat irritation | FAERS: 15 | US FAERS | |
| 104 | Thrombosis | FAERS: 15 | US FAERS | |
| 105 | Urticaria | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Vomiting | FAERS: 15 | US FAERS | |
| 107 | treatment failure | FAERS: 15 | US FAERS | |
| 108 | Abasia | FAERS: 14 | US FAERS | |
| 109 | Disease Progression | FAERS: 14 | US FAERS | |
| 110 | Eyelash thickening | FAERS: 14 | US FAERS | |
| 111 | Swelling | FAERS: 14 | US FAERS | |
| 112 | Syncope | FAERS: 14 | US FAERS | |
| 113 | Tinnitus | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 114 | Atrial Fibrillation | FAERS: 13 | US FAERS | |
| 115 | Bedridden | FAERS: 13 | US FAERS | |
| 116 | Depressed mood | FAERS: 13 | US FAERS | |
| 117 | Infarction | FAERS: 13 | US FAERS | |
| 118 | Iris hyperpigmentation | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 119 | Joint injury | FAERS: 13 | US FAERS | |
| 120 | Keratitis | FAERS: 13 | SIDER US FAERS | |
| 121 | Product administration error | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 122 | Alopecia | FAERS: 12 | US FAERS | |
| 123 | Myopia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 124 | Ocular vascular disorder | FAERS: 12 | US FAERS | |
| 125 | Product use complaint | FAERS: 12 | US FAERS | |
| 126 | Amnesia | FAERS: 11 | US FAERS | |
| 127 | Bradycardia | FAERS: 11 | US FAERS | |
| 128 | Dementia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 129 | Dysgeusia | FAERS: 11 | US FAERS | |
| 130 | Hypothyroidism | FAERS: 11 | US FAERS | |
| 131 | Infection | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 132 | Inflammation | FAERS: 11 | SIDER US FAERS | |
| 133 | Stress | FAERS: 11 | US FAERS | |
| 134 | Uveitis | FAERS: 11 | 19403113 | CTD SIDER US FAERS |
| 135 | Visual disturbance | FAERS: 11 | US FAERS | |
| 136 | Vitreous floaters | FAERS: 11 | US FAERS | |
| 137 | Blepharitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 138 | Cardiac Arrest | FAERS: 10 | US FAERS | |
| 139 | Erectile dysfunction | FAERS: 10 | US FAERS | |
| 140 | Eye allergy | FAERS: 10 | US FAERS | |
| 141 | Nasal discomfort | FAERS: 10 | US FAERS | |
| 142 | Productive Cough | FAERS: 10 | US FAERS | |
| 143 | Reaction to drug excipients | FAERS: 10 | US FAERS | |
| 144 | Superficial injury of eye | FAERS: 10 | US FAERS | |
| 145 | Abdominal Pain | FAERS: 9 | US FAERS | |
| 146 | Blood creatine phosphokinase increased | FAERS: 9 | US FAERS | |
| 147 | Choroidal Detachment | FAERS: 9 | US FAERS | |
| 148 | Disease recurrence | FAERS: 9 | US FAERS | |
| 149 | General physical health deterioration | FAERS: 9 | US FAERS | |
| 150 | Hypotension | FAERS: 9 | US FAERS | |
| 151 | Iridocyclitis | FAERS: 9 | US FAERS | |
| 152 | Metamorphopsia | FAERS: 9 | US FAERS | |
| 153 | Ocular Hypertension | FAERS: 9 Canada Vigilance: 1 |
7819171
8489450 8628544 8694726 9640189 11071027 11755835 15002024 16644608 17102001 17459480 18166407 18721251 19403113 | CTD Canada Vigilance US FAERS |
| 154 | Product container seal issue | FAERS: 9 | US FAERS | |
| 155 | Anosmia | FAERS: 8 | US FAERS | |
| 156 | Back disorder | FAERS: 8 | US FAERS | |
| 157 | Hernia | FAERS: 8 | US FAERS | |
| 158 | Limb injury | FAERS: 8 | US FAERS | |
| 159 | Neck Pain | FAERS: 8 | US FAERS | |
| 160 | Poor quality product administered | FAERS: 8 | US FAERS | |
| 161 | Urinary tract infection | FAERS: 8 | SIDER US FAERS | |
| 162 | Wheezing | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 163 | nervous system disorder | FAERS: 8 | SIDER US FAERS | |
| 164 | Cerebral Infarction | FAERS: 7 | US FAERS | |
| 165 | Cyanopsia | FAERS: 7 | US FAERS | |
| 166 | Expired product administered | FAERS: 7 | US FAERS | |
| 167 | Eyelid exfoliation | FAERS: 7 | US FAERS | |
| 168 | Hemiplegia | FAERS: 7 | US FAERS | |
| 169 | Hordeolum | FAERS: 7 | US FAERS | |
| 170 | Lip swelling | FAERS: 7 | US FAERS | |
| 171 | Musculoskeletal Pain | FAERS: 7 | US FAERS | |
| 172 | Musculoskeletal stiffness | FAERS: 7 | US FAERS | |
| 173 | Osteoporosis | FAERS: 7 | US FAERS | |
| 174 | Post procedural complication | FAERS: 7 | US FAERS | |
| 175 | Respiratory Failure | FAERS: 7 | US FAERS | |
| 176 | Sinusitis | FAERS: 7 | US FAERS | |
| 177 | Upper-airway cough syndrome | FAERS: 7 | US FAERS | |
| 178 | Wrong drug administered | FAERS: 7 | US FAERS | |
| 179 | Acromegaly | FAERS: 6 | US FAERS | |
| 180 | Choking sensation | FAERS: 6 | US FAERS | |
| 181 | Chromaturia | FAERS: 6 | US FAERS | |
| 182 | Corneal Opacity | FAERS: 6 | US FAERS | |
| 183 | Drug Tolerance | FAERS: 6 | US FAERS | |
| 184 | Drug exposure during pregnancy | FAERS: 6 | US FAERS | |
| 185 | Gamma-Glutamyltransferase Increased | FAERS: 6 | US FAERS | |
| 186 | Hypertrichosis | FAERS: 6 Canada Vigilance: 1 | 17539800 18166407 | CTD Canada Vigilance US FAERS |
| 187 | Iritis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 188 | Labyrinthitis | FAERS: 6 | US FAERS | |
| 189 | Mental impairment | FAERS: 6 | US FAERS | |
| 190 | Muscle tightness | FAERS: 6 | US FAERS | |
| 191 | Musculoskeletal chest pain | FAERS: 6 | OFFSIDES US FAERS | |
| 192 | Mydriasis | FAERS: 6 | US FAERS | |
| 193 | Ocular surface disease | FAERS: 6 | US FAERS | |
| 194 | Product contamination | FAERS: 6 | US FAERS | |
| 195 | Product dose omission | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 196 | Product label issue | FAERS: 6 | US FAERS | |
| 197 | Punctate keratitis | FAERS: 6 | US FAERS | |
| 198 | Retinal Vein Occlusion | FAERS: 6 | US FAERS | |
| 199 | Rheumatoid Arthritis | FAERS: 6 | US FAERS | |
| 200 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 201 | Angioedema | FAERS: 5 | US FAERS | |
| 202 | Blepharospasm | FAERS: 5 | US FAERS | |
| 203 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 204 | Blood sodium decreased | FAERS: 5 | US FAERS | |
| 205 | Colitis | FAERS: 5 | US FAERS | |
| 206 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 207 | Ear discomfort | FAERS: 5 | US FAERS | |
| 208 | Emotional disorder | FAERS: 5 | US FAERS | |
| 209 | Increased upper airway secretion | FAERS: 5 | OFFSIDES US FAERS | |
| 210 | Middle insomnia | FAERS: 5 | US FAERS | |
| 211 | Pulmonary Embolism | FAERS: 5 | US FAERS | |
| 212 | Respiratory tract congestion | FAERS: 5 | US FAERS | |
| 213 | Scleritis | FAERS: 5 | US FAERS | |
| 214 | Senile dementia | FAERS: 5 | US FAERS | |
| 215 | Ulcer | FAERS: 5 | US FAERS | |
| 216 | Activities of daily living impaired | FAERS: 4 | OFFSIDES US FAERS | |
| 217 | Ageusia | FAERS: 4 | OFFSIDES US FAERS | |
| 218 | Aneurysm | FAERS: 4 | US FAERS | |
| 219 | Application site reaction | FAERS: 4 | US FAERS | |
| 220 | Atrioventricular Block | FAERS: 4 | OFFSIDES US FAERS | |
| 221 | Blood urine present | FAERS: 4 | US FAERS | |
| 222 | Bronchospasm | FAERS: 4 | US FAERS | |
| 223 | Cholelithiasis | FAERS: 4 | US FAERS | |
| 224 | Disability | FAERS: 4 | US FAERS | |
| 225 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 226 | Dysgraphia | FAERS: 4 | US FAERS | |
| 227 | Dysuria | FAERS: 4 | US FAERS | |
| 228 | Epilepsy | FAERS: 4 | US FAERS | |
| 229 | Extra dose administered | FAERS: 4 | US FAERS | |
| 230 | Eye operation complication | FAERS: 4 | US FAERS | |
| 231 | Flushing | FAERS: 4 | US FAERS | |
| 232 | Fracture | FAERS: 4 | US FAERS | |
| 233 | Gastritis | FAERS: 4 | US FAERS | |
| 234 | Hypokinesia | FAERS: 4 | US FAERS | |
| 235 | Intraocular pressure test | FAERS: 4 | OFFSIDES US FAERS | |
| 236 | Liquid product physical issue | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 237 | Medication residue present | FAERS: 4 | US FAERS | |
| 238 | Muscle Rigidity | FAERS: 4 | US FAERS | |
| 239 | Musculoskeletal discomfort | FAERS: 4 | SIDER US FAERS | |
| 240 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 241 | Peritonitis viral | FAERS: 4 | US FAERS | |
| 242 | Physical product label issue | FAERS: 4 | US FAERS | |
| 243 | Polyneuropathy | FAERS: 4 | US FAERS | |
| 244 | Product complaint | FAERS: 4 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 245 | Product deposit | FAERS: 4 | US FAERS | |
| 246 | Product dispensing error | FAERS: 4 | US FAERS | |
| 247 | Product package associated injury | FAERS: 4 | US FAERS | |
| 248 | Product physical issue | FAERS: 4 | US FAERS | |
| 249 | Product tampering | FAERS: 4 | US FAERS | |
| 250 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 251 | Pterygium | FAERS: 4 | US FAERS | |
| 252 | Restlessness | FAERS: 4 | US FAERS | |
| 253 | Secretion discharge | FAERS: 4 | US FAERS | |
| 254 | Sense of oppression | FAERS: 4 | US FAERS | |
| 255 | Skin Papilloma | FAERS: 4 | US FAERS | |
| 256 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 257 | Throat cancer | FAERS: 4 | US FAERS | |
| 258 | Underweight | FAERS: 4 | US FAERS | |
| 259 | Uterine Cancer | FAERS: 4 | US FAERS | |
| 260 | Vitreous Detachment | FAERS: 4 | US FAERS | |
| 261 | Vitreous adhesions | FAERS: 4 | US FAERS | |
| 262 | Wrong technique in drug usage process | FAERS: 4 | US FAERS | |
| 263 | Yawning | FAERS: 4 | US FAERS | |
| 264 | Acne | FAERS: 3 | US FAERS | |
| 265 | Angle Closure Glaucoma | FAERS: 3 | US FAERS | |
| 266 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 267 | Aphasia | FAERS: 3 | US FAERS | |
| 268 | Aphonia | FAERS: 3 | US FAERS | |
| 269 | Application site pain | FAERS: 3 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 270 | Astigmatism | FAERS: 3 | US FAERS | |
| 271 | Basal cell carcinoma | FAERS: 3 | US FAERS | |
| 272 | Blood catecholamines increased | FAERS: 3 | US FAERS | |
| 273 | Blood cholesterol abnormal | FAERS: 3 | US FAERS | |
| 274 | Blood potassium decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 275 | Cardiac Hypertrophy | FAERS: 3 | OFFSIDES US FAERS | |
| 276 | Carpal Tunnel Syndrome | FAERS: 3 | US FAERS | |
| 277 | Conjunctival irritation | FAERS: 3 | US FAERS | |
| 278 | Conjunctival primary acquired melanosis | FAERS: 3 | US FAERS | |
| 279 | Corneal Scar | FAERS: 3 | US FAERS | |
| 280 | Corneal epithelium disorder | FAERS: 3 | US FAERS | |
| 281 | Cyst | FAERS: 3 | US FAERS | |
| 282 | Dehydration | FAERS: 3 | US FAERS | |
| 283 | Dental caries | FAERS: 3 | OFFSIDES US FAERS | |
| 284 | Dermatitis | FAERS: 3 | SIDER US FAERS | |
| 285 | Diabetic Retinopathy | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 286 | Disorientation | FAERS: 3 | US FAERS | |
| 287 | Diverticulitis | FAERS: 3 | US FAERS | |
| 288 | Drug effect delayed | FAERS: 3 | US FAERS | |
| 289 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 290 | Drug toxicity | FAERS: 3 | OFFSIDES US FAERS | |
| 291 | Dyspepsia | FAERS: 3 | US FAERS | |
| 292 | Eczema | FAERS: 3 | SIDER US FAERS | |
| 293 | Excessive eye blinking | FAERS: 3 | US FAERS | |
| 294 | Eyelid pain | FAERS: 3 | US FAERS | |
| 295 | Eyelid skin dryness | FAERS: 3 | US FAERS | |
| 296 | Feeling Cold | FAERS: 3 | US FAERS | |
| 297 | Gait inability | FAERS: 3 | US FAERS | |
| 298 | Hemicephalalgia | FAERS: 3 | US FAERS | |
| 299 | Hirsutism | FAERS: 3 | US FAERS | |
| 300 | Instillation site erythema | FAERS: 3 | US FAERS | |
| 301 | Instillation site irritation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 302 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 303 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 304 | Joint swelling | FAERS: 3 | US FAERS | |
| 305 | Lethargy | FAERS: 3 | US FAERS | |
| 306 | Limb discomfort | FAERS: 3 | US FAERS | |
| 307 | Multiple allergies | FAERS: 3 | OFFSIDES US FAERS | |
| 308 | Nerve injury | FAERS: 3 | US FAERS | |
| 309 | Night sweats | FAERS: 3 | US FAERS | |
| 310 | No adverse effect | FAERS: 3 | US FAERS | |
| 311 | Oropharyngeal discomfort | FAERS: 3 | US FAERS | |
| 312 | Periorbital disorder | FAERS: 3 | US FAERS | |
| 313 | Peripheral swelling | FAERS: 3 | US FAERS | |
| 314 | Pharyngitis | FAERS: 3 | US FAERS | |
| 315 | Pharyngolaryngeal Pain | FAERS: 3 | US FAERS | |
| 316 | Pregnancy | FAERS: 3 | US FAERS | |
| 317 | Product closure removal difficult | FAERS: 3 | US FAERS | |
| 318 | Product physical consistency issue | FAERS: 3 | US FAERS | |
| 319 | Proteinuria | FAERS: 3 | US FAERS | |
| 320 | Psychiatric symptom | FAERS: 3 | US FAERS | |
| 321 | Pulmonary Fibrosis | FAERS: 3 | US FAERS | |
| 322 | Purulent discharge | FAERS: 3 | US FAERS | |
| 323 | Retinitis | FAERS: 3 | US FAERS | |
| 324 | Rhinalgia | FAERS: 3 | US FAERS | |
| 325 | Rhinitis | FAERS: 3 | US FAERS | |
| 326 | Sepsis | FAERS: 3 | US FAERS | |
| 327 | Sjogren's Syndrome | FAERS: 3 | US FAERS | |
| 328 | Sneezing | FAERS: 3 | US FAERS | |
| 329 | Strabismus | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 330 | Supraventricular tachycardia | FAERS: 3 | US FAERS | |
| 331 | Toothache | FAERS: 3 | US FAERS | |
| 332 | Transmission of an infectious agent via a medicinal product | FAERS: 3 | US FAERS | |
| 333 | Varicophlebitis | FAERS: 3 | US FAERS | |
| 334 | Venous Thrombosis | FAERS: 3 | US FAERS | |
| 335 | Accidental drug intake by child | FAERS: 2 | US FAERS | |
| 336 | Accidental exposure | FAERS: 2 | US FAERS | |
| 337 | Agitation | FAERS: 2 | US FAERS | |
| 338 | Allergic reaction to excipient | FAERS: 2 | US FAERS | |
| 339 | Alopecia Areata | FAERS: 2 | US FAERS | |
| 340 | Anaphylactic shock | FAERS: 2 | US FAERS | |
| 341 | Anger | FAERS: 2 | US FAERS | |
| 342 | Animal bite | FAERS: 2 | US FAERS | |
| 343 | Aniridia | FAERS: 2 | US FAERS | |
| 344 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 345 | Application site irritation | FAERS: 2 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 346 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 347 | Auricular swelling | FAERS: 2 | US FAERS | |
| 348 | Benign Prostatic Hyperplasia | FAERS: 2 | OFFSIDES US FAERS | |
| 349 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 350 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 351 | Blood testosterone increased | FAERS: 2 | US FAERS | |
| 352 | Bone pain | FAERS: 2 | US FAERS | |
| 353 | Bronchiectasis | FAERS: 2 | US FAERS | |
| 354 | Bursitis | FAERS: 2 | US FAERS | |
| 355 | Candidiasis | FAERS: 2 | US FAERS | |
| 356 | Cardiac stress test abnormal | FAERS: 2 | US FAERS | |
| 357 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 358 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 359 | Carotid artery occlusion | FAERS: 2 | US FAERS | |
| 360 | Cerumen removal | FAERS: 2 | US FAERS | |
| 361 | Cervix carcinoma | FAERS: 2 | US FAERS | |
| 362 | Choking | FAERS: 2 | US FAERS | |
| 363 | Chorioretinitis | FAERS: 2 | US FAERS | |
| 364 | Chromatopsia | FAERS: 2 | US FAERS | |
| 365 | Clumsiness | FAERS: 2 | US FAERS | |
| 366 | Constipation | FAERS: 2 | US FAERS | |
| 367 | Contact lens intolerance | FAERS: 2 | US FAERS | |
| 368 | Corneal Ulcer | FAERS: 2 | US FAERS | |
| 369 | Corneal decompensation | FAERS: 2 | US FAERS | |
| 370 | Corneal degeneration | FAERS: 2 | US FAERS | |
| 371 | Corneal dystrophy | FAERS: 2 | US FAERS | |
| 372 | Corneal epithelium defect | FAERS: 2 | US FAERS | |
| 373 | Corneal erosion | FAERS: 2 | US FAERS | |
| 374 | Corneal lesion | FAERS: 2 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 375 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 376 | Cystitis | FAERS: 2 | US FAERS | |
| 377 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 378 | Deposit eye | FAERS: 2 | US FAERS | |
| 379 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 380 | Device Failure | FAERS: 2 | US FAERS | |
| 381 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 382 | Dysarthria | FAERS: 2 | US FAERS | |
| 383 | Embolism | FAERS: 2 | SIDER US FAERS | |
| 384 | Episcleritis | FAERS: 2 | US FAERS | |
| 385 | Erythropsia | FAERS: 2 | US FAERS | |
| 386 | Eye prosthesis user | FAERS: 2 | US FAERS | |
| 387 | Eyelid infection | FAERS: 2 | US FAERS | |
| 388 | Facial Pain | FAERS: 2 | US FAERS | |
| 389 | Foreign body trauma | FAERS: 2 | US FAERS | |
| 390 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 391 | Gastrointestinal carcinoma | FAERS: 2 | US FAERS | |
| 392 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 393 | Gingivitis | FAERS: 2 | US FAERS | |
| 394 | Hepatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 395 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 396 | Incorrect dose administered by device | FAERS: 2 | US FAERS | |
| 397 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 398 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 399 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 400 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 401 | Keratoconus | FAERS: 2 | US FAERS | |
| 402 | Laceration | FAERS: 2 | US FAERS | |
| 403 | Lack of spontaneous speech | FAERS: 2 | US FAERS | |
| 404 | Laryngitis | FAERS: 2 | US FAERS | |
| 405 | Larynx irritation | FAERS: 2 | US FAERS | |
| 406 | Lip and/or oral cavity cancer | FAERS: 2 | US FAERS | |
| 407 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 408 | MYELODYSPLASTIC SYNDROME | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 409 | Malignant neoplasm progression | FAERS: 2 | US FAERS | |
| 410 | Medical device complication | FAERS: 2 | US FAERS | |
| 411 | Meibomianitis | FAERS: 2 | US FAERS | |
| 412 | Meningitis | FAERS: 2 | US FAERS | |
| 413 | Meniscus injury | FAERS: 2 | US FAERS | |
| 414 | Monoplegia | FAERS: 2 | US FAERS | |
| 415 | Myasthenia Gravis | FAERS: 2 | US FAERS | |
| 416 | Ocular icterus | FAERS: 2 | US FAERS | |
| 417 | Onychoclasis | FAERS: 2 | US FAERS | |
| 418 | Optic Nerve Hypoplasia | FAERS: 2 | US FAERS | |
| 419 | Oral mucosal exfoliation | FAERS: 2 | US FAERS | |
| 420 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 421 | Otosclerosis | FAERS: 2 | US FAERS | |
| 422 | Pancreatic Neoplasm | FAERS: 2 | US FAERS | |
| 423 | Periorbital contusion | FAERS: 2 | US FAERS | |
| 424 | Peripheral artery occlusion | FAERS: 2 | US FAERS | |
| 425 | Polymyalgia Rheumatica | FAERS: 2 | OFFSIDES US FAERS | |
| 426 | Polyuria | FAERS: 2 | US FAERS | |
| 427 | Poor peripheral circulation | FAERS: 2 | US FAERS | |
| 428 | Poor quality sleep | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 429 | Post procedural infection | FAERS: 2 | US FAERS | |
| 430 | Premature Ejaculation | FAERS: 2 | US FAERS | |
| 431 | Product closure issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 432 | Product design issue | FAERS: 2 | US FAERS | |
| 433 | Product leakage | FAERS: 2 | US FAERS | |
| 434 | Product lot number issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 435 | Product prescribing error | FAERS: 2 | US FAERS | |
| 436 | Purpura | FAERS: 2 | US FAERS | |
| 437 | Renal cyst | FAERS: 2 | US FAERS | |
| 438 | Renal pain | FAERS: 2 | US FAERS | |
| 439 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 440 | Retching | FAERS: 2 | US FAERS | |
| 441 | Retinal vascular thrombosis | FAERS: 2 | US FAERS | |
| 442 | Scab | FAERS: 2 | SIDER US FAERS | |
| 443 | Scleral thinning | FAERS: 2 | US FAERS | |
| 444 | Scotoma | FAERS: 2 | OFFSIDES US FAERS | |
| 445 | Shock | FAERS: 2 | US FAERS | |
| 446 | Sinus headache | FAERS: 2 | US FAERS | |
| 447 | Sinus pain | FAERS: 2 | US FAERS | |
| 448 | Skin lesion | FAERS: 2 | US FAERS | |
| 449 | Skin necrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 450 | Stomatitis | FAERS: 2 | US FAERS | |
| 451 | Suspected counterfeit product | FAERS: 2 | US FAERS | |
| 452 | Tarsal Tunnel Syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 453 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 454 | Tension Headache | FAERS: 2 | US FAERS | |
| 455 | Therapy cessation | FAERS: 2 | US FAERS | |
| 456 | Thermal burn | FAERS: 2 | US FAERS | |
| 457 | Thrombotic stroke | FAERS: 2 | US FAERS | |
| 458 | Transaminases increased | FAERS: 2 | US FAERS | |
| 459 | Trichomegaly | FAERS: 2 | US FAERS | |
| 460 | Vaginal Prolapse | FAERS: 2 | US FAERS | |
| 461 | Walking aid user | FAERS: 2 | US FAERS | |
| 462 | Wheelchair user | FAERS: 2 | US FAERS | |
| 463 | Xanthoma | FAERS: 2 | US FAERS | |
| 464 | furuncle | FAERS: 2 | US FAERS | |
| 465 | Achromotrichia acquired | FAERS: 1 | US FAERS | |
| 466 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 467 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 468 | Administration site rash | FAERS: 1 | US FAERS | |
| 469 | Administration site reaction | FAERS: 1 | US FAERS | |
| 470 | Adulterated product | FAERS: 1 | US FAERS | |
| 471 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 472 | Alpha 1 foetoprotein decreased | FAERS: 1 | US FAERS | |
| 473 | Amniotic fluid volume decreased | FAERS: 1 | US FAERS | |
| 474 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 475 | Analgesic asthma syndrome | FAERS: 1 | US FAERS | |
| 476 | Angioplasty | FAERS: 1 | US FAERS | |
| 477 | Ankylosing spondylitis | FAERS: 1 | US FAERS | |
| 478 | Aortic bypass | FAERS: 1 | US FAERS | |
| 479 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 480 | Apallic syndrome | FAERS: 1 | US FAERS | |
| 481 | Application site swelling | FAERS: 1 | US FAERS | |
| 482 | Atrial tachycardia | FAERS: 1 | OFFSIDES US FAERS | |
| 483 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 484 | Blepharosynechia | FAERS: 1 | US FAERS | |
| 485 | Blood cholesterol | FAERS: 1 | OFFSIDES US FAERS | |
| 486 | Blood pressure orthostatic abnormal | FAERS: 1 | US FAERS | |
| 487 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 488 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 489 | Bone contusion | FAERS: 1 | US FAERS | |
| 490 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 491 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 492 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 493 | Cataract operation complication | FAERS: 1 | US FAERS | |
| 494 | Cellulitis | FAERS: 1 | US FAERS | |
| 495 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 496 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 497 | Chemotherapy | FAERS: 1 | US FAERS | |
| 498 | Complication associated with device | FAERS: 1 | US FAERS | |
| 499 | Compression fracture | FAERS: 1 | US FAERS | |
| 500 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 501 | Corneal Infection | FAERS: 1 | US FAERS | |
| 502 | Corneal exfoliation | FAERS: 1 | US FAERS | |
| 503 | Corneal implant | FAERS: 1 | US FAERS | |
| 504 | Corneal striae | FAERS: 1 | US FAERS | |
| 505 | Corneal thinning | FAERS: 1 | US FAERS | |
| 506 | Corrective lens user | FAERS: 1 | US FAERS | |
| 507 | Crying | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 508 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 509 | Dacryostenosis acquired | FAERS: 1 | US FAERS | |
| 510 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 511 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 512 | Diabetic metabolic decompensation | FAERS: 1 | US FAERS | |
| 513 | Disease complication | FAERS: 1 | US FAERS | |
| 514 | Distichiasis | FAERS: 1 | US FAERS | |
| 515 | Drug Dependence | FAERS: 1 | US FAERS | |
| 516 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 517 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 518 | Dural fistula | FAERS: 1 | US FAERS | |
| 519 | Economic problem | FAERS: 1 | US FAERS | |
| 520 | Ectropion | FAERS: 1 | US FAERS | |
| 521 | Emotional distress | FAERS: 1 | OFFSIDES US FAERS | |
| 522 | Enophthalmos | FAERS: 1 | US FAERS | |
| 523 | Entropion | FAERS: 1 | US FAERS | |
| 524 | Escherichia infection | FAERS: 1 | OFFSIDES US FAERS | |
| 525 | Exophthalmos | FAERS: 1 | US FAERS | |
| 526 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 527 | Exposure via skin contact | FAERS: 1 | US FAERS | |
| 528 | Eye excision | FAERS: 1 | US FAERS | |
| 529 | Eyeball avulsion | FAERS: 1 | US FAERS | |
| 530 | Eyelash changes | FAERS: 1 | US FAERS | |
| 531 | Eyelash hyperpigmentation | FAERS: 1 | US FAERS | |
| 532 | Facial Neuralgia | FAERS: 1 | US FAERS | |
| 533 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 534 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 535 | Flatulence | FAERS: 1 | US FAERS | |
| 536 | Food Poisoning | FAERS: 1 | US FAERS | |
| 537 | Formication | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 538 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 539 | Frustration | FAERS: 1 | US FAERS | |
| 540 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 541 | Gastric infection | FAERS: 1 | US FAERS | |
| 542 | Gastroenteritis helicobacter | FAERS: 1 | US FAERS | |
| 543 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 544 | Gastrooesophageal cancer | FAERS: 1 | US FAERS | |
| 545 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 546 | Genital discharge | FAERS: 1 | US FAERS | |
| 547 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 548 | Glioblastoma | FAERS: 1 | US FAERS | |
| 549 | Gout | FAERS: 1 | OFFSIDES US FAERS | |
| 550 | Granulocyte count increased | FAERS: 1 | US FAERS | |
| 551 | Granuloma Annulare | FAERS: 1 | US FAERS | |
| 552 | Groin infection | FAERS: 1 | US FAERS | |
| 553 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 554 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 555 | Hip surgery | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 556 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 557 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 558 | Hypopigmentation of eyelid | FAERS: 1 | US FAERS | |
| 559 | Hypopyon | FAERS: 1 | US FAERS | |
| 560 | Immobile | FAERS: 1 | US FAERS | |
| 561 | Incision site complication | FAERS: 1 | US FAERS | |
| 562 | Incorrect dose administered by product | FAERS: 1 | US FAERS | |
| 563 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 564 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 565 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 566 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 567 | Induration | FAERS: 1 | US FAERS | |
| 568 | Instillation site abnormal sensation | FAERS: 1 | US FAERS | |
| 569 | Instillation site complication | FAERS: 1 | US FAERS | |
| 570 | Instillation site lacrimation | FAERS: 1 | US FAERS | |
| 571 | Instillation site reaction | FAERS: 1 | US FAERS | |
| 572 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 573 | Intestinal resection | FAERS: 1 | OFFSIDES US FAERS | |
| 574 | Intestinal ulcer perforation | FAERS: 1 | US FAERS | |
| 575 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 576 | Intraocular lens extraction | FAERS: 1 | US FAERS | |
| 577 | Iritic melanoma | FAERS: 1 | US FAERS | |
| 578 | Keratoconjunctivitis Sicca | FAERS: 1 | US FAERS | |
| 579 | Keratopathy | FAERS: 1 | SIDER US FAERS | |
| 580 | Keratorhexis | FAERS: 1 | OFFSIDES US FAERS | |
| 581 | Lacrimation decreased | FAERS: 1 | US FAERS | |
| 582 | Lenticular pigmentation | FAERS: 1 | US FAERS | |
| 583 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 584 | Lid sulcus deepened | FAERS: 1 | US FAERS | |
| 585 | Ligament rupture | FAERS: 1 | OFFSIDES US FAERS | |
| 586 | Limb asymmetry | FAERS: 1 | US FAERS | |
| 587 | Limb operation | FAERS: 1 | US FAERS | |
| 588 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 589 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 590 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 591 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 592 | Lymphoma | FAERS: 1 | US FAERS | |
| 593 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 594 | Macular rupture | FAERS: 1 | US FAERS | |
| 595 | Malignant melanoma of sites other than skin | FAERS: 1 | US FAERS | |
| 596 | Manufacturing product shipping issue | FAERS: 1 | US FAERS | |
| 597 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 598 | Medication tampering | FAERS: 1 | US FAERS | |
| 599 | Meibomian gland dysfunction | FAERS: 1 | US FAERS | |
| 600 | Melanosis | FAERS: 1 | US FAERS | |
| 601 | Meniscus removal | FAERS: 1 | US FAERS | |
| 602 | Mental Retardation | FAERS: 1 | US FAERS | |
| 603 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 604 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 605 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 606 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 607 | Myoglobin blood increased | FAERS: 1 | US FAERS | |
| 608 | Nasal inflammation | FAERS: 1 | US FAERS | |
| 609 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 610 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 611 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 612 | Nystagmus | FAERS: 1 | US FAERS | |
| 613 | Onycholysis | FAERS: 1 | US FAERS | |
| 614 | Ophthalmic vein thrombosis | FAERS: 1 | US FAERS | |
| 615 | Optic Atrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 616 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 617 | Oral pain | FAERS: 1 | US FAERS | |
| 618 | PO2 decreased | FAERS: 1 | US FAERS | |
| 619 | Pain of skin | FAERS: 1 | US FAERS | |
| 620 | Pallor | FAERS: 1 | US FAERS | |
| 621 | Pancreatitis | FAERS: 1 | US FAERS | |
| 622 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 623 | Paranasal sinus discomfort | FAERS: 1 | US FAERS | |
| 624 | Paraplegia | FAERS: 1 | US FAERS | |
| 625 | Peritonitis | FAERS: 1 | US FAERS | |
| 626 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 627 | Physical disability | FAERS: 1 | US FAERS | |
| 628 | Platelet Transfusion | FAERS: 1 | US FAERS | |
| 629 | Pneumothorax | FAERS: 1 | US FAERS | |
| 630 | Post procedural discomfort | FAERS: 1 | US FAERS | |
| 631 | Postoperative infection | FAERS: 1 | US FAERS | |
| 632 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 633 | Presyncope | FAERS: 1 | US FAERS | |
| 634 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 635 | Product distribution issue | FAERS: 1 | US FAERS | |
| 636 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 637 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 638 | Product selection error | FAERS: 1 | US FAERS | |
| 639 | Prostatectomy | FAERS: 1 | US FAERS | |
| 640 | Prosthesis user | FAERS: 1 | US FAERS | |
| 641 | Pruritus allergic | FAERS: 1 | US FAERS | |
| 642 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 643 | Pulmonary arterial pressure increased | FAERS: 1 | US FAERS | |
| 644 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 645 | Pulmonary thrombosis | FAERS: 1 | OFFSIDES US FAERS | |
| 646 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 647 | Rash erythematous | FAERS: 1 | US FAERS | |
| 648 | Reaction to excipient | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 649 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 650 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 651 | Respiratory distress | FAERS: 1 | US FAERS | |
| 652 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 653 | Retinal cyst | FAERS: 1 | US FAERS | |
| 654 | Retinal depigmentation | FAERS: 1 | US FAERS | |
| 655 | Retinitis Pigmentosa | FAERS: 1 | US FAERS | |
| 656 | Retinoschisis | FAERS: 1 | US FAERS | |
| 657 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 658 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 659 | Sciatica | FAERS: 1 | US FAERS | |
| 660 | Screaming | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 661 | Sight disability | FAERS: 1 | US FAERS | |
| 662 | Simplex virus test positive | FAERS: 1 | US FAERS | |
| 663 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 664 | Skin Wrinkling | FAERS: 1 | US FAERS | |
| 665 | Skin irritation | FAERS: 1 | US FAERS | |
| 666 | Skin reaction | FAERS: 1 | SIDER US FAERS | |
| 667 | Skin tightness | FAERS: 1 | US FAERS | |
| 668 | Stent occlusion | FAERS: 1 | US FAERS | |
| 669 | Stevens-Johnson Syndrome | FAERS: 1 | 25811541 | CTD OFFSIDES US FAERS |
| 670 | Stillbirth | FAERS: 1 | US FAERS | |
| 671 | Suicide attempt | FAERS: 1 | US FAERS | |
| 672 | Sunburn | FAERS: 1 | US FAERS | |
| 673 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 674 | Symblepharon | FAERS: 1 | US FAERS | |
| 675 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 676 | Tension | FAERS: 1 | US FAERS | |
| 677 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 678 | Therapeutic product effect incomplete | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 679 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 680 | Therapy non-responder | FAERS: 1 | OFFSIDES US FAERS | |
| 681 | Tick-borne fever | FAERS: 1 | US FAERS | |
| 682 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 683 | Tooth Infection | FAERS: 1 | US FAERS | |
| 684 | Toxic anterior segment syndrome | FAERS: 1 | US FAERS | |
| 685 | Trabeculectomy | FAERS: 1 | US FAERS | |
| 686 | Tracheitis | FAERS: 1 | US FAERS | |
| 687 | Trichiasis | FAERS: 1 | US FAERS | |
| 688 | Tuberculosis | FAERS: 1 | US FAERS | |
| 689 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 690 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 691 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 692 | Vascular bypass graft | FAERS: 1 | US FAERS | |
| 693 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 694 | Vasculitis | FAERS: 1 | US FAERS | |
| 695 | Vasospasm | FAERS: 1 | US FAERS | |
| 696 | Vein wall hypertrophy | FAERS: 1 | US FAERS | |
| 697 | Venous occlusion | FAERS: 1 | US FAERS | |
| 698 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 699 | Vertebral lesion | FAERS: 1 | US FAERS | |
| 700 | Vessel perforation | FAERS: 1 | US FAERS | |
| 701 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 702 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 703 | Vitiligo | FAERS: 1 | US FAERS | |
| 704 | Vitrectomy | FAERS: 1 | US FAERS | |
| 705 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 706 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 707 | Wrong product administered | FAERS: 1 | US FAERS | |
| 708 | Wrong technique in device usage process | FAERS: 1 | US FAERS | |
| 709 | muscle injury | FAERS: 1 | US FAERS | |
| 710 | ovarian neoplasm | FAERS: 1 | US FAERS | |
| 711 | Abdominal tenderness | OFFSIDES | ||
| 712 | Abnormal vision | OFFSIDES | ||
| 713 | Acute glomerulonephritis | OFFSIDES | ||
| 714 | Acute myocardial infarction | OFFSIDES | ||
| 715 | Acute prerenal failure | OFFSIDES | ||
| 716 | Adenocarcinoma | OFFSIDES | ||
| 717 | Allergic skin reaction | SIDER | ||
| 718 | Alveolitis | OFFSIDES | ||
| 719 | Anticonvulsant drug level increased | OFFSIDES | ||
| 720 | Application site dryness | Canada Vigilance: 1 | Canada Vigilance | |
| 721 | Application site erythema | Canada Vigilance: 2 | Canada Vigilance | |
| 722 | Application site hypersensitivity | Canada Vigilance: 1 | Canada Vigilance | |
| 723 | Aspartate aminotransferase decreased | OFFSIDES | ||
| 724 | Atelectasis | OFFSIDES | ||
| 725 | Atherosclerosis | OFFSIDES | ||
| 726 | Atrial thrombosis | OFFSIDES | ||
| 727 | Aura | OFFSIDES | ||
| 728 | Blood Glucose | OFFSIDES | ||
| 729 | Blood beta-D-glucan increased | OFFSIDES | ||
| 730 | Blood fibrinogen increased | OFFSIDES | ||
| 731 | Blood lactate dehydrogenase decreased | OFFSIDES | ||
| 732 | Blood potassium increased | OFFSIDES | ||
| 733 | Blood potassium | OFFSIDES | ||
| 734 | Blood sodium increased | OFFSIDES | ||
| 735 | Blood sodium | OFFSIDES | ||
| 736 | Blurred vision | OFFSIDES | ||
| 737 | Body Temperature | OFFSIDES | ||
| 738 | Bone lesion | OFFSIDES | ||
| 739 | Brain natriuretic peptide increased | OFFSIDES | ||
| 740 | Brain scan abnormal | OFFSIDES | ||
| 741 | Calcinosis | OFFSIDES | ||
| 742 | Cardiac Tamponade | OFFSIDES | ||
| 743 | Carotid bruit | OFFSIDES | ||
| 744 | Catheter placement | OFFSIDES | ||
| 745 | Cerebral artery stenosis | OFFSIDES | ||
| 746 | Cholecystitis infective | OFFSIDES | ||
| 747 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 748 | Clostridium difficile toxin test positive | OFFSIDES | ||
| 749 | Confabulation | OFFSIDES | ||
| 750 | Conjunctival deposit | OFFSIDES | ||
| 751 | Dental abscess | OFFSIDES | ||
| 752 | Dermatomyositis | OFFSIDES | ||
| 753 | Diabetes Insipidus | OFFSIDES | ||
| 754 | Disseminated Intravascular Coagulation | OFFSIDES | ||
| 755 | Diverticulum | OFFSIDES | ||
| 756 | Drug addict | OFFSIDES | ||
| 757 | Duodenitis | OFFSIDES | ||
| 758 | Embolus | SIDER | ||
| 759 | Empyema | OFFSIDES | ||
| 760 | Endophthalmitis | OFFSIDES | ||
| 761 | Exacerbation of asthma | SIDER | ||
| 762 | Exfoliation Syndrome | 15002024 | CTD | |
| 763 | Extremity necrosis | OFFSIDES | ||
| 764 | Eyelid Diseases | OFFSIDES | ||
| 765 | Fear of falling | OFFSIDES | ||
| 766 | Fluid overload | OFFSIDES | ||
| 767 | Gambling | OFFSIDES | ||
| 768 | Glaucoma, Open-Angle | CTD | ||
| 769 | Granulocytosis | OFFSIDES | ||
| 770 | Hallucinations, mixed | OFFSIDES | ||
| 771 | Hungry bone syndrome | OFFSIDES | ||
| 772 | Hyperemia | CTD | ||
| 773 | Hyperparathyroidism | OFFSIDES | ||
| 774 | Hypoxia | OFFSIDES | ||
| 775 | Hysterectomy | OFFSIDES | ||
| 776 | Ileitis | OFFSIDES | ||
| 777 | Intervertebral disc disorder | OFFSIDES | ||
| 778 | Intestinal Perforation | OFFSIDES | ||
| 779 | Kidney Failure | OFFSIDES | ||
| 780 | Laryngospasm | OFFSIDES | ||
| 781 | Left atrial dilatation | OFFSIDES | ||
| 782 | Leukoencephalopathy | OFFSIDES | ||
| 783 | Ligament injury | OFFSIDES | ||
| 784 | Localised skin reaction | SIDER | ||
| 785 | Lupus pneumonitis | OFFSIDES | ||
| 786 | Mental status changes | OFFSIDES | ||
| 787 | Metabolic acidosis | OFFSIDES | ||
| 788 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 789 | Occult blood positive | OFFSIDES | ||
| 790 | Optic Disc Edema | OFFSIDES | ||
| 791 | Optic Neuropathy | OFFSIDES | ||
| 792 | Osteolysis | OFFSIDES | ||
| 793 | Osteomyelitis | OFFSIDES | ||
| 794 | Osteopenia | OFFSIDES | ||
| 795 | Panophthalmitis | OFFSIDES | ||
| 796 | Papule | Canada Vigilance: 1 | Canada Vigilance | |
| 797 | Paranoia | OFFSIDES | ||
| 798 | Parophthalmia | OFFSIDES | ||
| 799 | Periarthritis | OFFSIDES | ||
| 800 | Pericarditis lupus | OFFSIDES | ||
| 801 | Pericarditis | OFFSIDES | ||
| 802 | Phlebitis | OFFSIDES | ||
| 803 | Plasmapheresis | OFFSIDES | ||
| 804 | Prescribed overdose | Canada Vigilance: 1 | Canada Vigilance | |
| 805 | Progesterone receptor assay | OFFSIDES | ||
| 806 | Pseudomonal sepsis | OFFSIDES | ||
| 807 | Quadriparesis | OFFSIDES | ||
| 808 | Rales | OFFSIDES | ||
| 809 | Red blood cell schistocytes present | OFFSIDES | ||
| 810 | Renal tubular necrosis | OFFSIDES | ||
| 811 | Sarcoidosis | OFFSIDES | ||
| 812 | Septic Shock | OFFSIDES | ||
| 813 | Shoulder Pain | OFFSIDES | ||
| 814 | Sopor | OFFSIDES | ||
| 815 | Spinal column stenosis | OFFSIDES | ||
| 816 | Spondylolysis | OFFSIDES | ||
| 817 | Superficial Thrombophlebitis | OFFSIDES | ||
| 818 | Superior Vena Cava Syndrome | OFFSIDES | ||
| 819 | Synovial Cyst | OFFSIDES | ||
| 820 | Therapeutic product effect delayed | Canada Vigilance: 1 | Canada Vigilance | |
| 821 | Toxic Epidermal Necrolysis | SIDER | ||
| 822 | Urinary tract infection fungal | OFFSIDES | ||
| 823 | Urine flow decreased | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.