Fluticasone
(WMWTYOKRWGGJOA-CENSZEJFSA-N)
Structure
- SMILES
- FCSC(=O)[C@@]1(OC(=O)CC)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2C[C@@H](C2=CC(=O)C=C[C@]12C)F)F
- Type(s)
- Approved
- Molecular Formula:
- C25H31F3O5S
- Molecular Weight:
- 500.571
- Log P:
- 4.4300
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 105.97
- CAS Number(s):
- 80474-14-2
Synonym(s)
1.
Fluticasone
2.
Cutivate
3.
Flixonase
4.
Flixotide
5.
Flonase
6.
Flovent
7.
Flovent HFA
8.
Fluticasone Propionate
9.
HFA, Flovent
10.
Propionate, Fluticasone
External Link(s)
| MeSH | D000068298 |
| PubChem Compound | 444036 |
| BindingDB | 50354849 |
| ChEBI | 31441 |
| CHEMBL | CHEMBL1473 |
| DrugBank | DB00588 |
| DrugCentral | 1225 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7080 |
| KEGG | dr:D01708 |
| ZINC | 3920027 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 2099 Canada Vigilance: 116 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Epistaxis | FAERS: 1066 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 3 | Product quality issue | FAERS: 644 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 4 | Device use error | FAERS: 598 | US FAERS | |
| 5 | Headache | FAERS: 554 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 6 | Wrong technique in product usage process | FAERS: 531 | US FAERS | |
| 7 | Anosmia | FAERS: 351 | US FAERS | |
| 8 | Wrong technique in device usage process | FAERS: 335 | US FAERS | |
| 9 | Nasal discomfort | FAERS: 331 | US FAERS | |
| 10 | Product use issue | FAERS: 319 | US FAERS | |
| 11 | Product use in unapproved indication | FAERS: 276 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Hypersensitivity | FAERS: 245 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 13 | Malaise | FAERS: 240 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 14 | Drug dose omission | FAERS: 238 | US FAERS | |
| 15 | Dizziness | FAERS: 237 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 16 | Pharmaceutical product complaint | FAERS: 236 | OFFSIDES US FAERS | |
| 17 | Asthma | FAERS: 208 Canada Vigilance: 23 | Canada Vigilance OFFSIDES US FAERS | |
| 18 | Ageusia | FAERS: 206 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 19 | Accidental exposure to product | FAERS: 198 | US FAERS | |
| 20 | Drug administration error | FAERS: 180 | US FAERS | |
| 21 | Oropharyngeal pain | FAERS: 178 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 22 | Nausea | FAERS: 154 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 23 | Dysphonia | FAERS: 151 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 24 | Sneezing | FAERS: 145 | US FAERS | |
| 25 | Dysgeusia | FAERS: 141 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 26 | Overdose | FAERS: 140 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Incorrect dose administered | FAERS: 138 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Product cleaning inadequate | FAERS: 135 | US FAERS | |
| 29 | Inappropriate schedule of drug administration | FAERS: 133 | US FAERS | |
| 30 | Feeling abnormal | FAERS: 129 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 31 | Therapeutic response unexpected | FAERS: 129 | US FAERS | |
| 32 | Anxiety | FAERS: 127 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 33 | Product complaint | FAERS: 127 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 34 | Throat irritation | FAERS: 125 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 35 | Sinusitis | FAERS: 122 | OFFSIDES US FAERS | |
| 36 | Medication Error | FAERS: 114 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Adverse event | FAERS: 113 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 38 | Drug administered to patient of inappropriate age | FAERS: 110 | US FAERS | |
| 39 | Expired product administered | FAERS: 108 | US FAERS | |
| 40 | Product package associated injury | FAERS: 105 | US FAERS | |
| 41 | Product dose omission | FAERS: 104 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Vomiting | FAERS: 99 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 43 | Cataract | FAERS: 96 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 44 | Fatigue | FAERS: 94 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 45 | Pain | FAERS: 85 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 46 | Rhinalgia | FAERS: 83 | US FAERS | |
| 47 | Pruritus | FAERS: 82 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Intentional product misuse | FAERS: 81 | US FAERS | |
| 49 | Incorrect drug administration duration | FAERS: 75 | US FAERS | |
| 50 | Pneumonia | FAERS: 75 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 51 | Wheezing | FAERS: 75 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 52 | Drug ineffective for unapproved indication | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Incorrect route of drug administration | FAERS: 70 | US FAERS | |
| 54 | Urticaria | FAERS: 66 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 55 | Extra dose administered | FAERS: 65 | US FAERS | |
| 56 | Burning sensation | FAERS: 64 | OFFSIDES US FAERS | |
| 57 | Chest discomfort | FAERS: 64 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 58 | Palpitations | FAERS: 64 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 59 | Chest Pain | FAERS: 62 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 60 | Erythema | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Product storage error | FAERS: 61 | US FAERS | |
| 62 | Nasopharyngitis | FAERS: 59 | US FAERS | |
| 63 | Inappropriate schedule of product administration | FAERS: 56 | US FAERS | |
| 64 | Drug effect incomplete | FAERS: 53 | US FAERS | |
| 65 | Eye pain | FAERS: 51 | US FAERS | |
| 66 | Intentional product use issue | FAERS: 50 | US FAERS | |
| 67 | Visual Impairment | FAERS: 50 | US FAERS | |
| 68 | Somnolence | FAERS: 48 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Asthenia | FAERS: 45 | OFFSIDES US FAERS | |
| 70 | Laceration | FAERS: 45 | US FAERS | |
| 71 | Drug effective for unapproved indication | FAERS: 44 | US FAERS | |
| 72 | Drug prescribing error | FAERS: 43 | US FAERS | |
| 73 | Inability to afford medication | FAERS: 43 | US FAERS | |
| 74 | Nervousness | FAERS: 41 | US FAERS | |
| 75 | Vertigo | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Productive Cough | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 77 | Aphonia | FAERS: 39 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 78 | Bronchitis | FAERS: 39 | OFFSIDES US FAERS | |
| 79 | Recalled product administered | FAERS: 39 | US FAERS | |
| 80 | Tremor | FAERS: 39 | US FAERS | |
| 81 | Upper-airway cough syndrome | FAERS: 39 | US FAERS | |
| 82 | Drug dispensing error | FAERS: 38 | US FAERS | |
| 83 | Oral candidiasis | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Glaucoma | FAERS: 37 | OFFSIDES US FAERS | |
| 85 | Tinnitus | FAERS: 37 | US FAERS | |
| 86 | Circumstance or information capable of leading to medication error | FAERS: 36 | US FAERS | |
| 87 | Influenza | FAERS: 36 | US FAERS | |
| 88 | Drug Dependence | FAERS: 34 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 89 | Sinus headache | FAERS: 34 | US FAERS | |
| 90 | Contraindicated product administered | FAERS: 33 | US FAERS | |
| 91 | Eye irritation | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Nonspecific reaction | FAERS: 33 | US FAERS | |
| 93 | Discomfort | FAERS: 32 | US FAERS | |
| 94 | Back Pain | FAERS: 31 | US FAERS | |
| 95 | Product substitution issue | FAERS: 30 | US FAERS | |
| 96 | Abdominal discomfort | FAERS: 29 | OFFSIDES US FAERS | |
| 97 | Product administered to patient of inappropriate age | FAERS: 29 | US FAERS | |
| 98 | Arthralgia | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 99 | Growth retardation | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Multiple allergies | FAERS: 28 | US FAERS | |
| 101 | Retching | FAERS: 28 | US FAERS | |
| 102 | Facial Pain | FAERS: 27 | US FAERS | |
| 103 | Product label confusion | FAERS: 27 | US FAERS | |
| 104 | Choking | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 105 | Device malfunction | FAERS: 26 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 106 | Ear discomfort | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 107 | Accidental underdose | FAERS: 25 | US FAERS | |
| 108 | Pharyngolaryngeal Pain | FAERS: 25 | OFFSIDES US FAERS | |
| 109 | Incorrect product administration duration | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Scab | FAERS: 24 | US FAERS | |
| 111 | Stomatitis | FAERS: 24 | US FAERS | |
| 112 | Alopecia | FAERS: 23 | OFFSIDES US FAERS | |
| 113 | Anger | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 114 | Euphoric mood | FAERS: 22 | US FAERS | |
| 115 | Accidental overdose | FAERS: 21 | US FAERS | |
| 116 | Myalgia | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 117 | Oral pain | FAERS: 21 | US FAERS | |
| 118 | Rhinitis | FAERS: 21 | US FAERS | |
| 119 | Incorrect product storage | FAERS: 20 | US FAERS | |
| 120 | Middle insomnia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 121 | Peripheral swelling | FAERS: 20 | US FAERS | |
| 122 | Skin laceration | FAERS: 20 | OFFSIDES US FAERS | |
| 123 | Abdominal Pain | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 124 | Blood glucose increased | FAERS: 19 | US FAERS | |
| 125 | Crying | FAERS: 19 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 126 | Infection | FAERS: 19 | US FAERS | |
| 127 | Nasal pruritus | FAERS: 19 | US FAERS | |
| 128 | Paranasal sinus discomfort | FAERS: 19 | US FAERS | |
| 129 | Poor quality sleep | FAERS: 19 | US FAERS | |
| 130 | Prescribed underdose | FAERS: 19 | US FAERS | |
| 131 | Blindness | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 132 | Cerebrovascular accident | FAERS: 18 | US FAERS | |
| 133 | Increased upper airway secretion | FAERS: 18 | US FAERS | |
| 134 | Lip swelling | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Swelling | FAERS: 18 | US FAERS | |
| 136 | Drug exposure during pregnancy | FAERS: 17 | US FAERS | |
| 137 | Feeling jittery | FAERS: 17 | US FAERS | |
| 138 | Laryngitis | FAERS: 17 | US FAERS | |
| 139 | Nasal inflammation | FAERS: 17 | US FAERS | |
| 140 | Suspected product contamination | FAERS: 17 | US FAERS | |
| 141 | Head discomfort | FAERS: 16 | US FAERS | |
| 142 | Prescribed overdose | FAERS: 16 | OFFSIDES US FAERS | |
| 143 | Pulmonary congestion | FAERS: 16 | US FAERS | |
| 144 | Weight decreased | FAERS: 16 | US FAERS | |
| 145 | Agitation | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 146 | Chills | FAERS: 15 | US FAERS | |
| 147 | Dyspepsia | FAERS: 15 | OFFSIDES US FAERS | |
| 148 | Product contamination physical | FAERS: 15 | US FAERS | |
| 149 | Product taste abnormal | FAERS: 15 | US FAERS | |
| 150 | Acne | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Mood swings | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 152 | Personality Change | FAERS: 14 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 153 | Sinus pain | FAERS: 14 | US FAERS | |
| 154 | Syncope | FAERS: 14 | US FAERS | |
| 155 | Choking sensation | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 156 | Inflammation | FAERS: 13 | US FAERS | |
| 157 | Lymphadenopathy | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 158 | Neck Pain | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 159 | Oropharyngeal discomfort | FAERS: 13 | US FAERS | |
| 160 | Toothache | FAERS: 13 | US FAERS | |
| 161 | Blood cortisol decreased | FAERS: 12 | US FAERS | |
| 162 | Candidiasis | FAERS: 12 | US FAERS | |
| 163 | Cataract operation | FAERS: 12 | OFFSIDES US FAERS | |
| 164 | Expired drug administered | FAERS: 12 | US FAERS | |
| 165 | Myocardial Infarction | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 166 | Nasal mucosal disorder | FAERS: 12 | US FAERS | |
| 167 | Ocular discomfort | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 168 | Rash erythematous | FAERS: 12 | US FAERS | |
| 169 | Respiratory tract congestion | FAERS: 12 | US FAERS | |
| 170 | Secretion discharge | FAERS: 12 | OFFSIDES US FAERS | |
| 171 | Bronchospasm | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 172 | Device Failure | FAERS: 11 | OFFSIDES US FAERS | |
| 173 | Emergency care examination | FAERS: 11 | US FAERS | |
| 174 | Hypotension | FAERS: 11 | US FAERS | |
| 175 | Incorrect route of product administration | FAERS: 11 | US FAERS | |
| 176 | Joint swelling | FAERS: 11 | US FAERS | |
| 177 | Therapeutic response unexpected with drug substitution | FAERS: 11 | US FAERS | |
| 178 | Visual disturbance | FAERS: 11 | US FAERS | |
| 179 | Dry skin | FAERS: 10 | US FAERS | |
| 180 | Flushing | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 181 | Thermal burn | FAERS: 10 | US FAERS | |
| 182 | Accidental exposure to product by child | FAERS: 9 | US FAERS | |
| 183 | Cheilitis | FAERS: 9 | US FAERS | |
| 184 | Conjunctivitis | FAERS: 9 | US FAERS | |
| 185 | Deafness | FAERS: 9 | US FAERS | |
| 186 | Emotional disorder | FAERS: 9 | US FAERS | |
| 187 | Exposure via skin contact | FAERS: 9 | US FAERS | |
| 188 | Foreign body in respiratory tract | FAERS: 9 | US FAERS | |
| 189 | Impaired driving ability | FAERS: 9 | US FAERS | |
| 190 | Impaired work ability | FAERS: 9 | US FAERS | |
| 191 | Lethargy | FAERS: 9 | OFFSIDES US FAERS | |
| 192 | Mydriasis | FAERS: 9 | US FAERS | |
| 193 | Pharyngitis | FAERS: 9 | US FAERS | |
| 194 | Product packaging issue | FAERS: 9 | US FAERS | |
| 195 | Amnesia | FAERS: 8 | US FAERS | |
| 196 | Atrial Fibrillation | FAERS: 8 | US FAERS | |
| 197 | Bone pain | FAERS: 8 | US FAERS | |
| 198 | Dental caries | FAERS: 8 | US FAERS | |
| 199 | Device defective | FAERS: 8 | US FAERS | |
| 200 | Diabetes Mellitus | FAERS: 8 | US FAERS | |
| 201 | Diplopia | FAERS: 8 | OFFSIDES US FAERS | |
| 202 | Disability | FAERS: 8 | US FAERS | |
| 203 | Drug screen positive | FAERS: 8 | OFFSIDES US FAERS | |
| 204 | Eczema | FAERS: 8 | US FAERS | |
| 205 | Eye Infection | FAERS: 8 | US FAERS | |
| 206 | Hypogeusia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 207 | Initial insomnia | FAERS: 8 | OFFSIDES US FAERS | |
| 208 | Intercepted medication error | FAERS: 8 | US FAERS | |
| 209 | Nasal Polyps | FAERS: 8 | US FAERS | |
| 210 | Paranasal sinus hypersecretion | FAERS: 8 | US FAERS | |
| 211 | Product container issue | FAERS: 8 | US FAERS | |
| 212 | Product prescribing error | FAERS: 8 | US FAERS | |
| 213 | Therapeutic product effect incomplete | FAERS: 8 | US FAERS | |
| 214 | Thrombosis | FAERS: 8 | US FAERS | |
| 215 | Unevaluable event | FAERS: 8 | US FAERS | |
| 216 | Abasia | FAERS: 7 | US FAERS | |
| 217 | Aphasia | FAERS: 7 | US FAERS | |
| 218 | Blood glucose decreased | FAERS: 7 | US FAERS | |
| 219 | Constipation | FAERS: 7 | US FAERS | |
| 220 | Dependence | FAERS: 7 | OFFSIDES US FAERS | |
| 221 | Dysuria | FAERS: 7 | US FAERS | |
| 222 | Exposure via ingestion | FAERS: 7 | US FAERS | |
| 223 | General physical health deterioration | FAERS: 7 | US FAERS | |
| 224 | Hypersomnia | FAERS: 7 | US FAERS | |
| 225 | Lower respiratory tract infection | FAERS: 7 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 226 | Memory impairment | FAERS: 7 | US FAERS | |
| 227 | Pallor | FAERS: 7 | US FAERS | |
| 228 | Product contamination | FAERS: 7 | US FAERS | |
| 229 | Respiratory tract irritation | FAERS: 7 | US FAERS | |
| 230 | Tachycardia | FAERS: 7 | US FAERS | |
| 231 | Tension | FAERS: 7 | US FAERS | |
| 232 | Thirst | FAERS: 7 | US FAERS | |
| 233 | Urinary tract infection | FAERS: 7 | US FAERS | |
| 234 | treatment failure | FAERS: 7 | US FAERS | |
| 235 | Apparent death | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 236 | Arthritis | FAERS: 6 | US FAERS | |
| 237 | Arthropathy | FAERS: 6 | OFFSIDES US FAERS | |
| 238 | Blepharospasm | FAERS: 6 | US FAERS | |
| 239 | Bronchiolitis | FAERS: 6 | OFFSIDES US FAERS | |
| 240 | Circumstance or information capable of leading to device use error | FAERS: 6 | US FAERS | |
| 241 | Dehydration | FAERS: 6 | US FAERS | |
| 242 | Depressed Level of Consciousness | FAERS: 6 | US FAERS | |
| 243 | Dermatitis | FAERS: 6 | US FAERS | |
| 244 | Disorientation | FAERS: 6 | US FAERS | |
| 245 | Drug effect delayed | FAERS: 6 | US FAERS | |
| 246 | Drug effect variable | FAERS: 6 | US FAERS | |
| 247 | Ear congestion | FAERS: 6 | US FAERS | |
| 248 | Glossitis | FAERS: 6 | US FAERS | |
| 249 | Intercepted drug administration error | FAERS: 6 | US FAERS | |
| 250 | Musculoskeletal stiffness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 251 | Paranasal sinus hyposecretion | FAERS: 6 | US FAERS | |
| 252 | Photophobia | FAERS: 6 | US FAERS | |
| 253 | Product use complaint | FAERS: 6 | US FAERS | |
| 254 | Rebound effect | FAERS: 6 | US FAERS | |
| 255 | Skin irritation | FAERS: 6 | US FAERS | |
| 256 | Therapy cessation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 257 | Vitreous floaters | FAERS: 6 | US FAERS | |
| 258 | Accidental exposure | FAERS: 5 | US FAERS | |
| 259 | Anorexia | FAERS: 5 | OFFSIDES US FAERS | |
| 260 | Application site pain | FAERS: 5 | US FAERS | |
| 261 | Borderline glaucoma | FAERS: 5 | US FAERS | |
| 262 | Device breakage | FAERS: 5 | US FAERS | |
| 263 | Device leakage | FAERS: 5 | OFFSIDES US FAERS | |
| 264 | Drug Tolerance | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 265 | Erectile dysfunction | FAERS: 5 | US FAERS | |
| 266 | Eye Redness | FAERS: 5 | US FAERS | |
| 267 | Feeling Cold | FAERS: 5 | US FAERS | |
| 268 | Hoarseness | FAERS: 5 | US FAERS | |
| 269 | Incorrect dose administered by device | FAERS: 5 | US FAERS | |
| 270 | Increased bronchial secretion | FAERS: 5 | OFFSIDES US FAERS | |
| 271 | Increased viscosity of upper respiratory secretion | FAERS: 5 | US FAERS | |
| 272 | Intercepted drug dispensing error | FAERS: 5 | US FAERS | |
| 273 | Mental impairment | FAERS: 5 | US FAERS | |
| 274 | Ocular Hypertension | FAERS: 5 | US FAERS | |
| 275 | Osteoporosis | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 276 | Paranoia | FAERS: 5 | US FAERS | |
| 277 | Poisoning | FAERS: 5 | US FAERS | |
| 278 | Prescription drug used without a prescription | FAERS: 5 | US FAERS | |
| 279 | Product dispensing error | FAERS: 5 | US FAERS | |
| 280 | Restlessness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 281 | Stress | FAERS: 5 | OFFSIDES US FAERS | |
| 282 | Thrombocytosis | FAERS: 5 | US FAERS | |
| 283 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 284 | Angioedema | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 285 | Bedridden | FAERS: 4 | US FAERS | |
| 286 | Blood Corticotrophin Decreased | FAERS: 4 | US FAERS | |
| 287 | Blood pressure fluctuation | FAERS: 4 | US FAERS | |
| 288 | Cardiac Flutter | FAERS: 4 | US FAERS | |
| 289 | Drug abuse | FAERS: 4 | US FAERS | |
| 290 | Dysarthria | FAERS: 4 | US FAERS | |
| 291 | Dysphemia | FAERS: 4 | US FAERS | |
| 292 | Emergency Care | FAERS: 4 | US FAERS | |
| 293 | Emotional distress | FAERS: 4 | OFFSIDES US FAERS | |
| 294 | Enuresis | FAERS: 4 | US FAERS | |
| 295 | Exposure during breast feeding | FAERS: 4 | US FAERS | |
| 296 | Eyelid margin crusting | FAERS: 4 | US FAERS | |
| 297 | Eyelids pruritus | FAERS: 4 | US FAERS | |
| 298 | Flatulence | FAERS: 4 | US FAERS | |
| 299 | Hepatitis | FAERS: 4 | US FAERS | |
| 300 | Hyperventilation | FAERS: 4 | US FAERS | |
| 301 | Immunosuppression | FAERS: 4 | US FAERS | |
| 302 | Intentional drug misuse | FAERS: 4 | US FAERS | |
| 303 | Maternal exposure during pregnancy | FAERS: 4 | US FAERS | |
| 304 | Myopathy | FAERS: 4 | US FAERS | |
| 305 | Nasal mucosa atrophy | FAERS: 4 | US FAERS | |
| 306 | No adverse event | FAERS: 4 | US FAERS | |
| 307 | Oral mucosal eruption | FAERS: 4 | US FAERS | |
| 308 | Pleurisy | FAERS: 4 | US FAERS | |
| 309 | Pneumonitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 310 | Product prescribing issue | FAERS: 4 | US FAERS | |
| 311 | Rehabilitation therapy | FAERS: 4 | US FAERS | |
| 312 | Rheumatoid Arthritis | FAERS: 4 | US FAERS | |
| 313 | Screaming | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 314 | Sepsis | FAERS: 4 | US FAERS | |
| 315 | Stevens-Johnson Syndrome | FAERS: 4 | US FAERS | |
| 316 | Tongue blistering | FAERS: 4 | US FAERS | |
| 317 | Tongue discomfort | FAERS: 4 | US FAERS | |
| 318 | Tonsillitis | FAERS: 4 | US FAERS | |
| 319 | Urinary Incontinence | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 320 | Anaphylactic shock | FAERS: 3 | US FAERS | |
| 321 | Angina Pectoris | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 322 | Asphyxia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 323 | Autoimmune thyroiditis | FAERS: 3 | US FAERS | |
| 324 | Blood growth hormone decreased | FAERS: 3 | US FAERS | |
| 325 | Bone density decreased | FAERS: 3 | US FAERS | |
| 326 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 327 | Cellulitis | FAERS: 3 | OFFSIDES US FAERS | |
| 328 | Cyanosis | FAERS: 3 | US FAERS | |
| 329 | Dark circles under eyes | FAERS: 3 | US FAERS | |
| 330 | Device ineffective | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 331 | Device use issue | FAERS: 3 | US FAERS | |
| 332 | Disease recurrence | FAERS: 3 | US FAERS | |
| 333 | Drug resistance | FAERS: 3 | US FAERS | |
| 334 | Dysgraphia | FAERS: 3 | US FAERS | |
| 335 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 336 | Eosinophilia | FAERS: 3 | US FAERS | |
| 337 | Exposure via eye contact | FAERS: 3 | US FAERS | |
| 338 | Foreign body sensation in eyes | FAERS: 3 | US FAERS | |
| 339 | Gait inability | FAERS: 3 | US FAERS | |
| 340 | Hunger | FAERS: 3 | US FAERS | |
| 341 | Hyperinsulinism | FAERS: 3 | US FAERS | |
| 342 | Hypothalamic pituitary adrenal axis suppression | FAERS: 3 | US FAERS | |
| 343 | Hypothalamo-pituitary disorder | FAERS: 3 | US FAERS | |
| 344 | Incontinence | FAERS: 3 | US FAERS | |
| 345 | Insurance issue | FAERS: 3 | US FAERS | |
| 346 | Intentional device misuse | FAERS: 3 | US FAERS | |
| 347 | Intercepted drug prescribing error | FAERS: 3 | US FAERS | |
| 348 | Intraocular pressure test | FAERS: 3 | US FAERS | |
| 349 | Joint stiffness | FAERS: 3 | US FAERS | |
| 350 | Limb injury | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 351 | Limb operation | FAERS: 3 | US FAERS | |
| 352 | Live Birth | FAERS: 3 | US FAERS | |
| 353 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 354 | Mechanical ventilation | FAERS: 3 | US FAERS | |
| 355 | Medical device complication | FAERS: 3 | US FAERS | |
| 356 | Monoplegia | FAERS: 3 | US FAERS | |
| 357 | Muscle strain | FAERS: 3 | US FAERS | |
| 358 | Myopia | FAERS: 3 | US FAERS | |
| 359 | Night sweats | FAERS: 3 | US FAERS | |
| 360 | Noninfective gingivitis | FAERS: 3 | US FAERS | |
| 361 | Pain of skin | FAERS: 3 | US FAERS | |
| 362 | Presyncope | FAERS: 3 | US FAERS | |
| 363 | Product administered at inappropriate site | FAERS: 3 | US FAERS | |
| 364 | Product dispensing issue | FAERS: 3 | US FAERS | |
| 365 | Product measured potency issue | FAERS: 3 | US FAERS | |
| 366 | Product packaging quantity issue | FAERS: 3 | US FAERS | |
| 367 | Product preparation error | FAERS: 3 | US FAERS | |
| 368 | Product selection error | FAERS: 3 | US FAERS | |
| 369 | Pulmonary pain | FAERS: 3 | US FAERS | |
| 370 | Quality of life decreased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 371 | Reaction to drug excipients | FAERS: 3 | US FAERS | |
| 372 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 373 | Retinitis | FAERS: 3 | US FAERS | |
| 374 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 375 | Rosacea | FAERS: 3 | US FAERS | |
| 376 | Sinonasal obstruction | FAERS: 3 | US FAERS | |
| 377 | Skin Ulcer | FAERS: 3 | US FAERS | |
| 378 | Skin reaction | FAERS: 3 | US FAERS | |
| 379 | Somnambulism | FAERS: 3 | US FAERS | |
| 380 | Supraventricular tachycardia | FAERS: 3 | US FAERS | |
| 381 | Therapeutic product effect decreased | FAERS: 3 | US FAERS | |
| 382 | Therapeutic response changed | FAERS: 3 | US FAERS | |
| 383 | Therapeutic response delayed | FAERS: 3 | US FAERS | |
| 384 | Tongue erythema | FAERS: 3 | US FAERS | |
| 385 | Tooth Extraction | FAERS: 3 | US FAERS | |
| 386 | Viral upper respiratory tract infection | FAERS: 3 | US FAERS | |
| 387 | Vulvovaginal mycotic infection | FAERS: 3 | US FAERS | |
| 388 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 389 | Adrenal atrophy | FAERS: 2 | US FAERS | |
| 390 | Allergic sinusitis | FAERS: 2 | US FAERS | |
| 391 | Angle Closure Glaucoma | FAERS: 2 | OFFSIDES US FAERS | |
| 392 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 393 | Anorectal discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 394 | Application site irritation | FAERS: 2 | US FAERS | |
| 395 | Application site scab | FAERS: 2 | US FAERS | |
| 396 | Aspergillosis | FAERS: 2 | US FAERS | |
| 397 | Asthenopia | FAERS: 2 | US FAERS | |
| 398 | Atypical pneumonia | FAERS: 2 | US FAERS | |
| 399 | Back disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 400 | Blepharitis | FAERS: 2 | US FAERS | |
| 401 | Blood alcohol increased | FAERS: 2 | US FAERS | |
| 402 | Blood blister | FAERS: 2 | US FAERS | |
| 403 | Blood corticotrophin increased | FAERS: 2 | US FAERS | |
| 404 | Blood cortisol abnormal | FAERS: 2 | US FAERS | |
| 405 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 406 | Blood urine present | FAERS: 2 | US FAERS | |
| 407 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 408 | Carpal Tunnel Syndrome | FAERS: 2 | US FAERS | |
| 409 | Cold sweat | FAERS: 2 | US FAERS | |
| 410 | Colitis | FAERS: 2 | US FAERS | |
| 411 | Congenital brain damage | FAERS: 2 | US FAERS | |
| 412 | Cutis Laxa | FAERS: 2 | US FAERS | |
| 413 | Cystic Fibrosis | FAERS: 2 | US FAERS | |
| 414 | Cyst | FAERS: 2 | OFFSIDES US FAERS | |
| 415 | Decreased immune responsiveness | FAERS: 2 | US FAERS | |
| 416 | Dementia | FAERS: 2 | US FAERS | |
| 417 | Denys-Drash Syndrome | FAERS: 2 | US FAERS | |
| 418 | Depressed mood | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 419 | Device deployment issue | FAERS: 2 | US FAERS | |
| 420 | Device priming | FAERS: 2 | US FAERS | |
| 421 | Diabetes mellitus inadequate control | FAERS: 2 | OFFSIDES US FAERS | |
| 422 | Dissociation | FAERS: 2 | US FAERS | |
| 423 | Drug administered at inappropriate site | FAERS: 2 | US FAERS | |
| 424 | Drug screen false positive | FAERS: 2 | US FAERS | |
| 425 | Economic problem | FAERS: 2 | OFFSIDES US FAERS | |
| 426 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 427 | Epilepsy | FAERS: 2 | US FAERS | |
| 428 | Eructation | FAERS: 2 | US FAERS | |
| 429 | Excessive eye blinking | FAERS: 2 | US FAERS | |
| 430 | Eye allergy | FAERS: 2 | US FAERS | |
| 431 | Eye inflammation | FAERS: 2 | US FAERS | |
| 432 | Eyelid Function Disorder | FAERS: 2 | US FAERS | |
| 433 | Food Allergy | FAERS: 2 | US FAERS | |
| 434 | Frustration | FAERS: 2 | US FAERS | |
| 435 | Fungal pharyngitis | FAERS: 2 | US FAERS | |
| 436 | Gastritis | FAERS: 2 | US FAERS | |
| 437 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 438 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 439 | Gene Mutation | FAERS: 2 | US FAERS | |
| 440 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 441 | Gingivitis | FAERS: 2 | US FAERS | |
| 442 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 443 | Hemiparesis | FAERS: 2 | OFFSIDES US FAERS | |
| 444 | Hip Dysplasia | FAERS: 2 | US FAERS | |
| 445 | Hip surgery | FAERS: 2 | US FAERS | |
| 446 | Hyperacusis | FAERS: 2 | US FAERS | |
| 447 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 448 | Hypophagia | FAERS: 2 | US FAERS | |
| 449 | Hypospadias | FAERS: 2 | US FAERS | |
| 450 | Immobile | FAERS: 2 | US FAERS | |
| 451 | Increased viscosity of bronchial secretion | FAERS: 2 | US FAERS | |
| 452 | Inhalation Therapy | FAERS: 2 | US FAERS | |
| 453 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 454 | Intentional self-injury | FAERS: 2 | US FAERS | |
| 455 | Intercepted product dispensing error | FAERS: 2 | US FAERS | |
| 456 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 457 | Intraocular pressure test abnormal | FAERS: 2 | US FAERS | |
| 458 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 459 | Leukocytosis | FAERS: 2 | US FAERS | |
| 460 | Limb discomfort | FAERS: 2 | US FAERS | |
| 461 | Lip pruritus | FAERS: 2 | US FAERS | |
| 462 | Liquid product physical issue | FAERS: 2 | US FAERS | |
| 463 | Lymphadenitis | FAERS: 2 | US FAERS | |
| 464 | Macular degeneration | FAERS: 2 | US FAERS | |
| 465 | Mastication disorder | FAERS: 2 | US FAERS | |
| 466 | Mental status changes | FAERS: 2 | US FAERS | |
| 467 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 468 | Muscle tightness | FAERS: 2 | US FAERS | |
| 469 | Musculoskeletal Pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 470 | Musculoskeletal chest pain | FAERS: 2 | OFFSIDES US FAERS | |
| 471 | Musculoskeletal discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 472 | Nephroblastoma | FAERS: 2 | US FAERS | |
| 473 | Nerve injury | FAERS: 2 | US FAERS | |
| 474 | Nocturia | FAERS: 2 | US FAERS | |
| 475 | Obsessive-Compulsive Disorder | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 476 | Off label use of device | FAERS: 2 | US FAERS | |
| 477 | Olfactory Nerve Disorder | FAERS: 2 | US FAERS | |
| 478 | Onychoclasis | FAERS: 2 | US FAERS | |
| 479 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 480 | Oral pruritus | FAERS: 2 | US FAERS | |
| 481 | Oropharyngeal candidiasis | FAERS: 2 | US FAERS | |
| 482 | Oropharyngitis fungal | FAERS: 2 | US FAERS | |
| 483 | Otitis Media | FAERS: 2 | US FAERS | |
| 484 | Papule | FAERS: 2 | US FAERS | |
| 485 | Performance status decreased | FAERS: 2 | US FAERS | |
| 486 | Pertussis | FAERS: 2 | US FAERS | |
| 487 | Poor quality drug administered | FAERS: 2 | US FAERS | |
| 488 | Product availability issue | FAERS: 2 | US FAERS | |
| 489 | Product counterfeit | FAERS: 2 | US FAERS | |
| 490 | Product dropper issue | FAERS: 2 | US FAERS | |
| 491 | Product label issue | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 492 | Product physical issue | FAERS: 2 | US FAERS | |
| 493 | Product supply issue | FAERS: 2 | US FAERS | |
| 494 | Product tampering | FAERS: 2 | US FAERS | |
| 495 | Psoriasis | FAERS: 2 | US FAERS | |
| 496 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 497 | Purpura | FAERS: 2 | US FAERS | |
| 498 | Renal mass | FAERS: 2 | US FAERS | |
| 499 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 500 | Shock | FAERS: 2 | US FAERS | |
| 501 | Sinus operation | FAERS: 2 | OFFSIDES US FAERS | |
| 502 | Snoring | FAERS: 2 | US FAERS | |
| 503 | Sputum retention | FAERS: 2 | US FAERS | |
| 504 | Sudden death | FAERS: 2 | US FAERS | |
| 505 | Superficial injury of eye | FAERS: 2 | US FAERS | |
| 506 | Tenosynovitis | FAERS: 2 | US FAERS | |
| 507 | Therapy change | FAERS: 2 | US FAERS | |
| 508 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 509 | Tooth Erosion | FAERS: 2 | US FAERS | |
| 510 | Tooth Loss | FAERS: 2 | US FAERS | |
| 511 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 512 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 513 | Vascular rupture | FAERS: 2 | US FAERS | |
| 514 | Vasculitis | FAERS: 2 | US FAERS | |
| 515 | Vocal Cord Paralysis | FAERS: 2 | US FAERS | |
| 516 | Walking aid user | FAERS: 2 | US FAERS | |
| 517 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 518 | Wrong patient received product | FAERS: 2 | US FAERS | |
| 519 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 520 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 521 | Abscess | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 522 | Actinomycosis | FAERS: 1 | OFFSIDES US FAERS | |
| 523 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 524 | Acute sinusitis | FAERS: 1 | OFFSIDES US FAERS | |
| 525 | Adams-Stokes Syndrome | FAERS: 1 | US FAERS | |
| 526 | Administration site discomfort | FAERS: 1 | US FAERS | |
| 527 | Administration site rash | FAERS: 1 | US FAERS | |
| 528 | Adrenal insufficiency neonatal | FAERS: 1 | US FAERS | |
| 529 | Aldolase increased | FAERS: 1 | US FAERS | |
| 530 | Alopecia Areata | FAERS: 1 | US FAERS | |
| 531 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 532 | Amyloidosis | FAERS: 1 | US FAERS | |
| 533 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 534 | Anencephaly | FAERS: 1 | US FAERS | |
| 535 | Aneurysm | FAERS: 1 | US FAERS | |
| 536 | Antibiotic therapy | FAERS: 1 | US FAERS | |
| 537 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 538 | Application site dryness | FAERS: 1 | US FAERS | |
| 539 | Application site erythema | FAERS: 1 | US FAERS | |
| 540 | Application site papules | FAERS: 1 | US FAERS | |
| 541 | Application site reaction | FAERS: 1 | OFFSIDES US FAERS | |
| 542 | Application site ulcer | FAERS: 1 | US FAERS | |
| 543 | Arteritis | FAERS: 1 | US FAERS | |
| 544 | Aspergillosis oral | FAERS: 1 | US FAERS | |
| 545 | Aura | FAERS: 1 | US FAERS | |
| 546 | Autoscopy | FAERS: 1 | US FAERS | |
| 547 | Benign Prostatic Hyperplasia | FAERS: 1 | OFFSIDES US FAERS | |
| 548 | Bilateral breast buds | FAERS: 1 | US FAERS | |
| 549 | Biopsy | FAERS: 1 | US FAERS | |
| 550 | Blood arsenic increased | FAERS: 1 | US FAERS | |
| 551 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 552 | Blood cortisol increased | FAERS: 1 | US FAERS | |
| 553 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 554 | Blood glucose normal | FAERS: 1 | US FAERS | |
| 555 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 556 | Blood pH abnormal | FAERS: 1 | US FAERS | |
| 557 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 558 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 559 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 560 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 561 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 562 | Blood uric acid abnormal | FAERS: 1 | US FAERS | |
| 563 | Body fat disorder | FAERS: 1 | US FAERS | |
| 564 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 565 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 566 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 567 | Breathing-related sleep disorder | FAERS: 1 | US FAERS | |
| 568 | Bronchial irritation | FAERS: 1 | US FAERS | |
| 569 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 570 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 571 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 572 | Bruxism | FAERS: 1 | OFFSIDES US FAERS | |
| 573 | Buccal mucosal roughening | FAERS: 1 | US FAERS | |
| 574 | Bursitis | FAERS: 1 | OFFSIDES US FAERS | |
| 575 | Cachexia | FAERS: 1 | US FAERS | |
| 576 | Cardiac assistance device user | FAERS: 1 | US FAERS | |
| 577 | Cartilage injury | FAERS: 1 | US FAERS | |
| 578 | Central Nervous System Infection | FAERS: 1 | US FAERS | |
| 579 | Central pain syndrome | FAERS: 1 | US FAERS | |
| 580 | Cervix carcinoma recurrent | FAERS: 1 | US FAERS | |
| 581 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 582 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 583 | Chronic sinusitis | FAERS: 1 | OFFSIDES US FAERS | |
| 584 | Completed Suicide | FAERS: 1 | US FAERS | |
| 585 | Complication associated with device | FAERS: 1 | US FAERS | |
| 586 | Concomitant disease aggravated | FAERS: 1 | US FAERS | |
| 587 | Contraindicated drug prescribed | FAERS: 1 | US FAERS | |
| 588 | Conversion disorder | FAERS: 1 | US FAERS | |
| 589 | Corneal Ulcer | FAERS: 1 | US FAERS | |
| 590 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 591 | Cross Infection | FAERS: 1 | US FAERS | |
| 592 | Croup infectious | FAERS: 1 | US FAERS | |
| 593 | Dacryocystitis | FAERS: 1 | US FAERS | |
| 594 | Dehydroepiandrosterone decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 595 | Delirium | FAERS: 1 | US FAERS | |
| 596 | Dependence on oxygen therapy | FAERS: 1 | US FAERS | |
| 597 | Dermatitis acneiform | FAERS: 1 | US FAERS | |
| 598 | Device damage | FAERS: 1 | US FAERS | |
| 599 | Device deposit issue | FAERS: 1 | US FAERS | |
| 600 | Device difficult to use | FAERS: 1 | US FAERS | |
| 601 | Device operational issue | FAERS: 1 | US FAERS | |
| 602 | Diplegia | FAERS: 1 | US FAERS | |
| 603 | Discontinued product administered | FAERS: 1 | US FAERS | |
| 604 | Disease Progression | FAERS: 1 | US FAERS | |
| 605 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 606 | Diverticulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 607 | Documented hypersensitivity to administered product | FAERS: 1 | US FAERS | |
| 608 | Drug administered in wrong device | FAERS: 1 | US FAERS | |
| 609 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 610 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 611 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 612 | Drug-disease interaction | FAERS: 1 | US FAERS | |
| 613 | Dyspnoea exacerbated | FAERS: 1 | US FAERS | |
| 614 | Educational problem | FAERS: 1 | US FAERS | |
| 615 | Enamel anomaly | FAERS: 1 | US FAERS | |
| 616 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 617 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 618 | Epidural lipomatosis | FAERS: 1 | US FAERS | |
| 619 | Epiphyseal injury | FAERS: 1 | US FAERS | |
| 620 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 621 | Excessive cerumen production | FAERS: 1 | US FAERS | |
| 622 | Expired device used | FAERS: 1 | US FAERS | |
| 623 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 624 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 625 | Exposure via inhalation | FAERS: 1 | US FAERS | |
| 626 | Eye opacity | FAERS: 1 | US FAERS | |
| 627 | Eye ulcer | FAERS: 1 | US FAERS | |
| 628 | Fat redistribution | FAERS: 1 | US FAERS | |
| 629 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 630 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 631 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 632 | Full blood count increased | FAERS: 1 | US FAERS | |
| 633 | Fumbling | FAERS: 1 | US FAERS | |
| 634 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 635 | Gastroenteritis | FAERS: 1 | US FAERS | |
| 636 | Gastrointestinal candidiasis | FAERS: 1 | US FAERS | |
| 637 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 638 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 639 | Gestational Diabetes | FAERS: 1 | US FAERS | |
| 640 | Gingival Recession | FAERS: 1 | US FAERS | |
| 641 | Gingival erythema | FAERS: 1 | US FAERS | |
| 642 | Glucocorticoid deficiency | FAERS: 1 | US FAERS | |
| 643 | Granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 644 | Granuloma | FAERS: 1 | US FAERS | |
| 645 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 646 | Heart sounds abnormal | FAERS: 1 | US FAERS | |
| 647 | Heat Stroke | FAERS: 1 | US FAERS | |
| 648 | Hernia | FAERS: 1 | US FAERS | |
| 649 | Homicide | FAERS: 1 | US FAERS | |
| 650 | Hordeolum | FAERS: 1 | US FAERS | |
| 651 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 652 | Hospice Care | FAERS: 1 | US FAERS | |
| 653 | Hypervigilance | FAERS: 1 | US FAERS | |
| 654 | Hypokinesia | FAERS: 1 | OFFSIDES US FAERS | |
| 655 | Hypomania | FAERS: 1 | US FAERS | |
| 656 | Hypopituitarism | FAERS: 1 | US FAERS | |
| 657 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 658 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 659 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 660 | Impatience | FAERS: 1 | US FAERS | |
| 661 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 662 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 663 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 664 | Increased viscosity of nasal secretion | FAERS: 1 | US FAERS | |
| 665 | Infection prophylaxis | FAERS: 1 | US FAERS | |
| 666 | Infective exacerbation of chronic obstructive airways disease | FAERS: 1 | US FAERS | |
| 667 | Infective tenosynovitis | FAERS: 1 | US FAERS | |
| 668 | Influenza B virus test positive | FAERS: 1 | US FAERS | |
| 669 | Instillation site pain | FAERS: 1 | US FAERS | |
| 670 | Intentional misuse | FAERS: 1 | US FAERS | |
| 671 | Intercepted product administration error | FAERS: 1 | US FAERS | |
| 672 | Intercepted product selection error | FAERS: 1 | US FAERS | |
| 673 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 674 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 675 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 676 | Irregular breathing | FAERS: 1 | US FAERS | |
| 677 | Joint injury | FAERS: 1 | US FAERS | |
| 678 | Keratitis | FAERS: 1 | US FAERS | |
| 679 | Lack of satiety | FAERS: 1 | US FAERS | |
| 680 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 681 | Laryngeal neoplasm | FAERS: 1 | US FAERS | |
| 682 | Latex allergy | FAERS: 1 | US FAERS | |
| 683 | Lichen Planus | FAERS: 1 | US FAERS | |
| 684 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 685 | Lung perforation | FAERS: 1 | US FAERS | |
| 686 | Lupus pleurisy | FAERS: 1 | US FAERS | |
| 687 | Lymphadenitis bacterial | FAERS: 1 | US FAERS | |
| 688 | Lymphocyte percentage decreased | FAERS: 1 | US FAERS | |
| 689 | Malabsorption from administration site | FAERS: 1 | US FAERS | |
| 690 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 691 | Mastectomy | FAERS: 1 | US FAERS | |
| 692 | Measles | FAERS: 1 | US FAERS | |
| 693 | Medication residue | FAERS: 1 | US FAERS | |
| 694 | Menopause | FAERS: 1 | US FAERS | |
| 695 | Metamorphopsia | FAERS: 1 | OFFSIDES US FAERS | |
| 696 | Metastasis | FAERS: 1 | US FAERS | |
| 697 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 698 | Mineral deficiency | FAERS: 1 | US FAERS | |
| 699 | Mole excision | FAERS: 1 | US FAERS | |
| 700 | Monoparesis | FAERS: 1 | US FAERS | |
| 701 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 702 | Mouth swelling | FAERS: 1 | US FAERS | |
| 703 | Mucosal pain | FAERS: 1 | US FAERS | |
| 704 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 705 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 706 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 707 | Myocarditis | FAERS: 1 | US FAERS | |
| 708 | Nasal mucosal hypertrophy | FAERS: 1 | US FAERS | |
| 709 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 710 | Nephrolithiasis | FAERS: 1 | OFFSIDES US FAERS | |
| 711 | Nephrotic Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 712 | Neuralgia | FAERS: 1 | OFFSIDES US FAERS | |
| 713 | Neutrophil percentage increased | FAERS: 1 | US FAERS | |
| 714 | Nipple pain | FAERS: 1 | US FAERS | |
| 715 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 716 | Nodule | FAERS: 1 | OFFSIDES US FAERS | |
| 717 | Non-cardiac chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 718 | Nystagmus | FAERS: 1 | US FAERS | |
| 719 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 720 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 721 | Ocular icterus | FAERS: 1 | OFFSIDES US FAERS | |
| 722 | Oncologic complication | FAERS: 1 | US FAERS | |
| 723 | Open reduction of fracture | FAERS: 1 | US FAERS | |
| 724 | Oppositional Defiant Disorder | FAERS: 1 | US FAERS | |
| 725 | Optic Neuritis | FAERS: 1 | OFFSIDES US FAERS | |
| 726 | Oral administration complication | FAERS: 1 | US FAERS | |
| 727 | Oral infection | FAERS: 1 | US FAERS | |
| 728 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 729 | Osteitis | FAERS: 1 | US FAERS | |
| 730 | Osteolysis | FAERS: 1 | US FAERS | |
| 731 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 732 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 733 | Osteopenia | FAERS: 1 | US FAERS | |
| 734 | Overweight | FAERS: 1 | US FAERS | |
| 735 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 736 | PO2 decreased | FAERS: 1 | US FAERS | |
| 737 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 738 | Parotitis | FAERS: 1 | US FAERS | |
| 739 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 740 | Perioral Dermatitis | FAERS: 1 | US FAERS | |
| 741 | Periorbital disorder | FAERS: 1 | US FAERS | |
| 742 | Pharyngitis bacterial | FAERS: 1 | US FAERS | |
| 743 | Physical abuse | FAERS: 1 | US FAERS | |
| 744 | Pityriasis Rosea | FAERS: 1 | US FAERS | |
| 745 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 746 | Pneumothorax | FAERS: 1 | US FAERS | |
| 747 | Polyarthritis | FAERS: 1 | US FAERS | |
| 748 | Polychondritis | FAERS: 1 | US FAERS | |
| 749 | Poor quality device used | FAERS: 1 | US FAERS | |
| 750 | Precocious Puberty | FAERS: 1 | US FAERS | |
| 751 | Pregnancy | FAERS: 1 | US FAERS | |
| 752 | Product administration error | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 753 | Product communication issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 754 | Product container seal issue | FAERS: 1 | US FAERS | |
| 755 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 756 | Product expiration date issue | FAERS: 1 | US FAERS | |
| 757 | Product lot number issue | FAERS: 1 | US FAERS | |
| 758 | Product name confusion | FAERS: 1 | US FAERS | |
| 759 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 760 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 761 | Product preparation issue | FAERS: 1 | US FAERS | |
| 762 | Product shape issue | FAERS: 1 | US FAERS | |
| 763 | Product substitution error | FAERS: 1 | US FAERS | |
| 764 | Protein urine present | FAERS: 1 | US FAERS | |
| 765 | Prurigo | FAERS: 1 | US FAERS | |
| 766 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 767 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 768 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 769 | Pyoderma | FAERS: 1 | US FAERS | |
| 770 | Pyogenic granuloma | FAERS: 1 | US FAERS | |
| 771 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 772 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 773 | Rectal discharge | FAERS: 1 | US FAERS | |
| 774 | Reflux laryngitis | FAERS: 1 | US FAERS | |
| 775 | Removal of foreign body from eye | FAERS: 1 | US FAERS | |
| 776 | Renal pain | FAERS: 1 | US FAERS | |
| 777 | Respiratory Failure | FAERS: 1 | OFFSIDES US FAERS | |
| 778 | Respiratory distress | FAERS: 1 | US FAERS | |
| 779 | Respiratory tract infection viral | FAERS: 1 | US FAERS | |
| 780 | Retinal pigmentation | FAERS: 1 | US FAERS | |
| 781 | Retinal vascular occlusion | FAERS: 1 | US FAERS | |
| 782 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 783 | Sarcoidosis | FAERS: 1 | OFFSIDES US FAERS | |
| 784 | Sarcoma | FAERS: 1 | US FAERS | |
| 785 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 786 | School refusal | FAERS: 1 | US FAERS | |
| 787 | Scleritis | FAERS: 1 | US FAERS | |
| 788 | Sensitive skin | FAERS: 1 | US FAERS | |
| 789 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 790 | Sensory level abnormal | FAERS: 1 | US FAERS | |
| 791 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 792 | Skin Erosion | FAERS: 1 | US FAERS | |
| 793 | Skin Induration | FAERS: 1 | US FAERS | |
| 794 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 795 | Skin lesion | FAERS: 1 | US FAERS | |
| 796 | Soft tissue swelling | FAERS: 1 | US FAERS | |
| 797 | Spinal column injury | FAERS: 1 | US FAERS | |
| 798 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 799 | Spirometry abnormal | FAERS: 1 | US FAERS | |
| 800 | Steroid activity | FAERS: 1 | US FAERS | |
| 801 | Stroke in evolution | FAERS: 1 | US FAERS | |
| 802 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 803 | Suicide attempt | FAERS: 1 | US FAERS | |
| 804 | Sunburn | FAERS: 1 | US FAERS | |
| 805 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 806 | Suspected transmission of an infectious agent via product | FAERS: 1 | US FAERS | |
| 807 | Swollen tear duct | FAERS: 1 | US FAERS | |
| 808 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 809 | Tachyphylaxis | FAERS: 1 | US FAERS | |
| 810 | Talipes | FAERS: 1 | US FAERS | |
| 811 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 812 | Therapeutic product effect delayed | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 813 | Therapeutic product effective for unapproved indication | FAERS: 1 | US FAERS | |
| 814 | Thought insertion | FAERS: 1 | US FAERS | |
| 815 | Throat clearing | FAERS: 1 | US FAERS | |
| 816 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 817 | Tooth Infection | FAERS: 1 | US FAERS | |
| 818 | Tooth Resorption | FAERS: 1 | US FAERS | |
| 819 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 820 | Tracheal Stenosis | FAERS: 1 | US FAERS | |
| 821 | Tracheomalacia | FAERS: 1 | US FAERS | |
| 822 | Trichotillomania | FAERS: 1 | US FAERS | |
| 823 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 824 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 825 | Tuberculosis | FAERS: 1 | US FAERS | |
| 826 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 827 | Ulnar tunnel syndrome | FAERS: 1 | US FAERS | |
| 828 | Unemployment | FAERS: 1 | US FAERS | |
| 829 | Upper respiratory fungal infection | FAERS: 1 | US FAERS | |
| 830 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 831 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 832 | Vagal nerve stimulator implantation | FAERS: 1 | US FAERS | |
| 833 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 834 | Vena cava injury | FAERS: 1 | US FAERS | |
| 835 | Viral pharyngitis | FAERS: 1 | US FAERS | |
| 836 | Vitritis | FAERS: 1 | US FAERS | |
| 837 | Wound Infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 838 | Wrong dose | FAERS: 1 | US FAERS | |
| 839 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 840 | Yawning | FAERS: 1 | US FAERS | |
| 841 | angiogram | FAERS: 1 | US FAERS | |
| 842 | cancer surgery | FAERS: 1 | US FAERS | |
| 843 | colonoscopy | FAERS: 1 | OFFSIDES US FAERS | |
| 844 | intensive care | FAERS: 1 | US FAERS | |
| 845 | muscle injury | FAERS: 1 | US FAERS | |
| 846 | nervous system disorder | FAERS: 1 | US FAERS | |
| 847 | skin abrasion | FAERS: 1 | US FAERS | |
| 848 | Abdominal Infection | OFFSIDES | ||
| 849 | Acid reflux | OFFSIDES | ||
| 850 | Actinic keratosis | OFFSIDES | ||
| 851 | Acute Coronary Syndrome | OFFSIDES | ||
| 852 | Acute bronchitis | OFFSIDES | ||
| 853 | Acute myocardial infarction | OFFSIDES | ||
| 854 | Acute prerenal failure | OFFSIDES | ||
| 855 | Acute respiratory failure | OFFSIDES | ||
| 856 | Adenocarcinoma | OFFSIDES | ||
| 857 | Agraphia | OFFSIDES | ||
| 858 | Alcoholic Intoxication | OFFSIDES | ||
| 859 | Alveolitis | OFFSIDES | ||
| 860 | Amenorrhea | OFFSIDES | ||
| 861 | Ammonia increased | OFFSIDES | ||
| 862 | Anhedonia | OFFSIDES | ||
| 863 | Anhidrosis | OFFSIDES | ||
| 864 | Apathy | OFFSIDES | ||
| 865 | Apnea | OFFSIDES | ||
| 866 | Appendectomy | OFFSIDES | ||
| 867 | Appendicitis | OFFSIDES | ||
| 868 | Application site rash | Canada Vigilance: 1 | Canada Vigilance | |
| 869 | Application site swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 870 | Arteriosclerosis | OFFSIDES | ||
| 871 | Arthrodesis | OFFSIDES | ||
| 872 | Ascites | OFFSIDES | ||
| 873 | Aspartate aminotransferase abnormal | OFFSIDES | ||
| 874 | Aspiration Pneumonia | OFFSIDES | ||
| 875 | Atelectasis | OFFSIDES | ||
| 876 | Avascular necrosis | OFFSIDES | ||
| 877 | Bacterial test positive | OFFSIDES | ||
| 878 | Bed rest | Canada Vigilance: 1 | Canada Vigilance | |
| 879 | Bereavement | OFFSIDES | ||
| 880 | Biopsy breast abnormal | OFFSIDES | ||
| 881 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 882 | Blood Glucose | OFFSIDES | ||
| 883 | Blood cholesterol | OFFSIDES | ||
| 884 | Blood triglycerides increased | OFFSIDES | ||
| 885 | Blurred vision | OFFSIDES | ||
| 886 | Bone marrow depression | OFFSIDES | ||
| 887 | Brain Concussion | OFFSIDES | ||
| 888 | Breakthrough Pain | OFFSIDES | ||
| 889 | Breast Cyst | OFFSIDES | ||
| 890 | Breast fibroma | OFFSIDES | ||
| 891 | Bronchial Obstruction | OFFSIDES | ||
| 892 | Bronchoalveolar lavage abnormal | OFFSIDES | ||
| 893 | CD4 Lymphocytes Decreased | OFFSIDES | ||
| 894 | Calcinosis | OFFSIDES | ||
| 895 | Cardioactive drug level | OFFSIDES | ||
| 896 | Cerebral Thrombosis | OFFSIDES | ||
| 897 | Cerebral artery occlusion | OFFSIDES | ||
| 898 | Cervicobrachial syndrome | OFFSIDES | ||
| 899 | Chest wall pain | OFFSIDES | ||
| 900 | Cholecystitis | OFFSIDES | ||
| 901 | Chromaturia | OFFSIDES | ||
| 902 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 903 | Cirrhosis | OFFSIDES | ||
| 904 | Cluster Headache | OFFSIDES | ||
| 905 | Color blindness | OFFSIDES | ||
| 906 | Complications of transplant surgery | OFFSIDES | ||
| 907 | Compression fracture | OFFSIDES | ||
| 908 | Confabulation | OFFSIDES | ||
| 909 | Demyelination | OFFSIDES | ||
| 910 | Dental abscess | OFFSIDES | ||
| 911 | Device related infection | OFFSIDES | ||
| 912 | Diabetes | OFFSIDES | ||
| 913 | Diaphragmatic Hernia | OFFSIDES | ||
| 914 | Dissociative Identity Disorder | OFFSIDES | ||
| 915 | Diverticular perforation | OFFSIDES | ||
| 916 | Dysphasia | OFFSIDES | ||
| 917 | Ejection Fraction Decreased | OFFSIDES | ||
| 918 | Endocarditis | OFFSIDES | ||
| 919 | Endocervical curettage | OFFSIDES | ||
| 920 | Endometrial disorder | OFFSIDES | ||
| 921 | Epinephrine increased | OFFSIDES | ||
| 922 | Essential Hypertension | OFFSIDES | ||
| 923 | Excoriation | OFFSIDES | ||
| 924 | Feeding problem in child | OFFSIDES | ||
| 925 | Feeling of body temperature change | Canada Vigilance: 1 | Canada Vigilance | |
| 926 | Femoral artery occlusion | OFFSIDES | ||
| 927 | Fibromyalgia | OFFSIDES | ||
| 928 | Flank Pain | OFFSIDES | ||
| 929 | Formication | OFFSIDES | ||
| 930 | Gambling | OFFSIDES | ||
| 931 | Gangrene | OFFSIDES | ||
| 932 | Gout | OFFSIDES | ||
| 933 | Granulocytosis | OFFSIDES | ||
| 934 | Hemicephalalgia | OFFSIDES | ||
| 935 | Hepatitis C | OFFSIDES | ||
| 936 | Hypercapnia | OFFSIDES | ||
| 937 | Hyperparathyroidism | OFFSIDES | ||
| 938 | Hypertensive heart disease | OFFSIDES | ||
| 939 | Hypocoagulable state | OFFSIDES | ||
| 940 | Hypoxia | OFFSIDES | ||
| 941 | Hysteroscopy | OFFSIDES | ||
| 942 | Idiosyncratic drug reaction | OFFSIDES | ||
| 943 | Intention tremor | OFFSIDES | ||
| 944 | Kidney Failure | OFFSIDES | ||
| 945 | Laryngospasm | Canada Vigilance: 1 | Canada Vigilance | |
| 946 | Legionella | OFFSIDES | ||
| 947 | Liver transplant rejection | OFFSIDES | ||
| 948 | Long QT Syndrome | OFFSIDES | ||
| 949 | Lymphedema | OFFSIDES | ||
| 950 | Malignant neoplasm of spinal cord | OFFSIDES | ||
| 951 | Markedly reduced dietary intake | OFFSIDES | ||
| 952 | Mass excision | OFFSIDES | ||
| 953 | Modified radical mastectomy | OFFSIDES | ||
| 954 | Multiple sclerosis relapse | OFFSIDES | ||
| 955 | Muscle Weakness | OFFSIDES | ||
| 956 | Negative thoughts | Canada Vigilance: 2 | Canada Vigilance | |
| 957 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 958 | Nervous tension | OFFSIDES | ||
| 959 | Neutropenic sepsis | OFFSIDES | ||
| 960 | Nodal osteoarthritis | OFFSIDES | ||
| 961 | Obesity | Canada Vigilance: 1 | Canada Vigilance | |
| 962 | Orthopnea | OFFSIDES | ||
| 963 | Panic Disorder | OFFSIDES | ||
| 964 | Periarthritis | OFFSIDES | ||
| 965 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 966 | Platybasia | OFFSIDES | ||
| 967 | Poor peripheral circulation | OFFSIDES | ||
| 968 | Post lumbar puncture syndrome | OFFSIDES | ||
| 969 | Post procedural nausea | OFFSIDES | ||
| 970 | Postmenopausal bleeding | OFFSIDES | ||
| 971 | Postoperative wound complication | OFFSIDES | ||
| 972 | Priapism | OFFSIDES | ||
| 973 | Procedural site reaction | OFFSIDES | ||
| 974 | Progesterone receptor assay | OFFSIDES | ||
| 975 | Protein total increased | OFFSIDES | ||
| 976 | Pseudocyst | OFFSIDES | ||
| 977 | Pyelonephritis | OFFSIDES | ||
| 978 | Rebound nasal congestion | Canada Vigilance: 1 | Canada Vigilance | |
| 979 | Rectal examination abnormal | OFFSIDES | ||
| 980 | Renal cyst | OFFSIDES | ||
| 981 | Renal tubular necrosis | OFFSIDES | ||
| 982 | Rhinorrhea | OFFSIDES | ||
| 983 | Serositis | OFFSIDES | ||
| 984 | Shoulder Pain | OFFSIDES | ||
| 985 | Sinus bradycardia | OFFSIDES | ||
| 986 | Spinal column stenosis | OFFSIDES | ||
| 987 | Spinal rod insertion | OFFSIDES | ||
| 988 | Stress at work | OFFSIDES | ||
| 989 | Superinfection lung | OFFSIDES | ||
| 990 | Tension Headache | OFFSIDES | ||
| 991 | Therapy non-responder | OFFSIDES | ||
| 992 | Tinea Pedis | OFFSIDES | ||
| 993 | Tracheobronchitis | OFFSIDES | ||
| 994 | Ulcer | OFFSIDES | ||
| 995 | Umbilical hernia perforation | OFFSIDES | ||
| 996 | Umbilical hernia | OFFSIDES | ||
| 997 | Uterine Polyp | OFFSIDES | ||
| 998 | Vaginal lesion | OFFSIDES | ||
| 999 | Venous stasis | OFFSIDES | ||
| 1000 | Ventricular Fibrillation | OFFSIDES | ||
| 1001 | Violence-related symptom | Canada Vigilance: 1 | Canada Vigilance | |
| 1002 | Wound infection bacterial | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.