Dutasteride
(JWJOTENAMICLJG-QWBYCMEYSA-N)
Structure
- SMILES
- O=C1C=C[C@]2([C@H](N1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2C(=O)Nc1cc(ccc1C(F)(F)F)C(F)(F)F)C)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- G04CA52; G04CB02
- Molecular Formula:
- C27H30F6N2O2
- Molecular Weight:
- 528.530
- Log P:
- 6.9779
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 58.2
- CAS Number(s):
- 164656-23-9
Synonym(s)
1.
Dutasteride
2.
17beta-N-(2,5-bis(trifluoromethyl))phenyl-carbamoyl-4-aza-5alpha-androst-1-en-3-one
3.
Avodart
4.
GG 745
5.
GG-745
6.
GG745
7.
GI198745
8.
745, GG
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 216 Canada Vigilance: 15 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Erectile dysfunction | FAERS: 96 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 3 | Breast tenderness | FAERS: 58 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 4 | Semen volume decreased | FAERS: 49 | OFFSIDES SIDER US FAERS | |
| 5 | Dizziness | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 6 | Urinary Retention | FAERS: 41 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 7 | Dysuria | FAERS: 38 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 8 | Sexual Dysfunction | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 9 | Alopecia | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 10 | Nocturia | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 11 | Therapeutic response unexpected | FAERS: 34 | OFFSIDES US FAERS | |
| 12 | Fatigue | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 13 | Asthenia | FAERS: 29 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 14 | Chest Pain | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 15 | Pain | FAERS: 29 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 16 | Product quality issue | FAERS: 26 | OFFSIDES US FAERS | |
| 17 | Arthralgia | FAERS: 24 | US FAERS | |
| 18 | Nipple pain | FAERS: 24 | OFFSIDES SIDER US FAERS | |
| 19 | Urinary Incontinence | FAERS: 24 | US FAERS | |
| 20 | Drug administration error | FAERS: 23 | OFFSIDES US FAERS | |
| 21 | Drug exposure during pregnancy | FAERS: 23 | US FAERS | |
| 22 | Malaise | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Myocardial Infarction | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 24 | Pruritus | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 25 | Constipation | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 26 | Headache | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 27 | Pharmaceutical product complaint | FAERS: 21 | OFFSIDES US FAERS | |
| 28 | Adverse event | FAERS: 20 | US FAERS | |
| 29 | Product use issue | FAERS: 20 | US FAERS | |
| 30 | Accidental exposure to product | FAERS: 18 | US FAERS | |
| 31 | Accidental exposure | FAERS: 18 | OFFSIDES US FAERS | |
| 32 | Nausea | FAERS: 18 | US FAERS | |
| 33 | Cerebrovascular accident | FAERS: 17 | US FAERS | |
| 34 | Myalgia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Product substitution issue | FAERS: 15 Canada Vigilance: 10 | Canada Vigilance US FAERS | |
| 36 | Wrong technique in product usage process | FAERS: 15 | US FAERS | |
| 37 | Abdominal Pain | FAERS: 14 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 38 | Anxiety | FAERS: 14 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 39 | Feeling abnormal | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Urine flow decreased | FAERS: 13 | OFFSIDES US FAERS | |
| 41 | Blood glucose increased | FAERS: 12 | US FAERS | |
| 42 | Penile size reduced | FAERS: 12 | OFFSIDES US FAERS | |
| 43 | Pneumonia | FAERS: 12 | US FAERS | |
| 44 | Benign Prostatic Hyperplasia | FAERS: 11 | US FAERS | |
| 45 | jaundice | FAERS: 11 | US FAERS | |
| 46 | Back Pain | FAERS: 10 | US FAERS | |
| 47 | Blood testosterone decreased | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 48 | Cerebral Infarction | FAERS: 10 | US FAERS | |
| 49 | Dementia | FAERS: 10 | US FAERS | |
| 50 | Dyspepsia | FAERS: 10 | US FAERS | |
| 51 | Dysphonia | FAERS: 10 | OFFSIDES US FAERS | |
| 52 | Erythema | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Vomiting | FAERS: 10 | US FAERS | |
| 54 | prostatitis | FAERS: 10 | OFFSIDES US FAERS | |
| 55 | Amnesia | FAERS: 9 | US FAERS | |
| 56 | Atrial Fibrillation | FAERS: 9 | US FAERS | |
| 57 | Blood urine present | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 58 | Hypotension | FAERS: 9 | US FAERS | |
| 59 | Night sweats | FAERS: 9 | US FAERS | |
| 60 | Palpitations | FAERS: 9 | US FAERS | |
| 61 | Pancreatitis | FAERS: 9 | OFFSIDES US FAERS | |
| 62 | Urticaria | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 63 | Alanine Aminotransferase Increased | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Diabetes Mellitus | FAERS: 8 | US FAERS | |
| 65 | Hypersensitivity | FAERS: 8 | SIDER US FAERS | |
| 66 | Syncope | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Weight decreased | FAERS: 8 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 68 | Abdominal discomfort | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 69 | Angina Pectoris | FAERS: 7 | US FAERS | |
| 70 | Blindness | FAERS: 7 | US FAERS | |
| 71 | Burning sensation | FAERS: 7 | US FAERS | |
| 72 | Chest discomfort | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Deep Vein Thrombosis | FAERS: 7 | US FAERS | |
| 74 | Exposure via body fluid | FAERS: 7 | US FAERS | |
| 75 | Joint swelling | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Lip swelling | FAERS: 7 | US FAERS | |
| 77 | Middle insomnia | FAERS: 7 | OFFSIDES US FAERS | |
| 78 | Retrograde ejaculation | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 79 | Swelling | FAERS: 7 | US FAERS | |
| 80 | Thrombocytopenia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Thrombosis | FAERS: 7 | US FAERS | |
| 82 | Urinary tract infection | FAERS: 7 | US FAERS | |
| 83 | nervous system disorder | FAERS: 7 | US FAERS | |
| 84 | Blood testosterone increased | FAERS: 6 | OFFSIDES US FAERS | |
| 85 | Drug dose omission | FAERS: 6 | US FAERS | |
| 86 | Dry skin | FAERS: 6 | OFFSIDES US FAERS | |
| 87 | Emotional distress | FAERS: 6 | OFFSIDES US FAERS | |
| 88 | Gastric Fistula | FAERS: 6 | US FAERS | |
| 89 | Medication Error | FAERS: 6 | US FAERS | |
| 90 | Medication residue | FAERS: 6 | OFFSIDES US FAERS | |
| 91 | Nephrolithiasis | FAERS: 6 | OFFSIDES US FAERS | |
| 92 | Product preparation issue | FAERS: 6 | US FAERS | |
| 93 | Prostatic pain | FAERS: 6 | US FAERS | |
| 94 | Pulmonary Embolism | FAERS: 6 | US FAERS | |
| 95 | Transaminases increased | FAERS: 6 | OFFSIDES US FAERS | |
| 96 | Visual Impairment | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Acne | FAERS: 5 | US FAERS | |
| 98 | Anorgasmia | FAERS: 5 | SIDER US FAERS | |
| 99 | Aspartate Aminotransferase Increased | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Asthma | FAERS: 5 | US FAERS | |
| 101 | Bradycardia | FAERS: 5 | US FAERS | |
| 102 | Cholelithiasis | FAERS: 5 | US FAERS | |
| 103 | Chromaturia | FAERS: 5 | OFFSIDES US FAERS | |
| 104 | Disability | FAERS: 5 | US FAERS | |
| 105 | Eye pain | FAERS: 5 | OFFSIDES US FAERS | |
| 106 | Gastrointestinal Pain | FAERS: 5 | US FAERS | |
| 107 | Incorrect route of drug administration | FAERS: 5 | US FAERS | |
| 108 | Lethargy | FAERS: 5 | US FAERS | |
| 109 | Medication residue present | FAERS: 5 | US FAERS | |
| 110 | Mental impairment | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 112 | Musculoskeletal stiffness | FAERS: 5 | OFFSIDES US FAERS | |
| 113 | Overdose | FAERS: 5 | US FAERS | |
| 114 | Prostatic specific antigen decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 115 | Somnolence | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 116 | Tremor | FAERS: 5 | US FAERS | |
| 117 | Urine output increased | FAERS: 5 | OFFSIDES US FAERS | |
| 118 | Vertigo | FAERS: 5 | US FAERS | |
| 119 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 120 | Blood creatine phosphokinase increased | FAERS: 4 | US FAERS | |
| 121 | Blood testosterone free decreased | FAERS: 4 | US FAERS | |
| 122 | Coronary Artery Disease | FAERS: 4 | US FAERS | |
| 123 | Cystitis | FAERS: 4 | US FAERS | |
| 124 | Deafness | FAERS: 4 | US FAERS | |
| 125 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 126 | Dermatitis | FAERS: 4 | SIDER US FAERS | |
| 127 | Discomfort | FAERS: 4 | US FAERS | |
| 128 | Disease Progression | FAERS: 4 | US FAERS | |
| 129 | Flushing | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 130 | Gastric ulcer | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 131 | Hypertransaminasaemia | FAERS: 4 | US FAERS | |
| 132 | Oropharyngeal pain | FAERS: 4 | OFFSIDES US FAERS | |
| 133 | Residual urine | FAERS: 4 | US FAERS | |
| 134 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 135 | Skin irritation | FAERS: 4 | US FAERS | |
| 136 | Stevens-Johnson Syndrome | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 137 | Thermal burn | FAERS: 4 | US FAERS | |
| 138 | Abasia | FAERS: 3 | US FAERS | |
| 139 | Abdominal mass | FAERS: 3 | OFFSIDES US FAERS | |
| 140 | Acute myocardial infarction | FAERS: 3 | US FAERS | |
| 141 | Adenocarcinoma | FAERS: 3 | US FAERS | |
| 142 | Anaphylactic shock | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Anger | FAERS: 3 | US FAERS | |
| 144 | Ascites | FAERS: 3 | US FAERS | |
| 145 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 146 | Blood amylase increased | FAERS: 3 | US FAERS | |
| 147 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 148 | Cardiac Arrest | FAERS: 3 | US FAERS | |
| 149 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 150 | Dehydration | FAERS: 3 | US FAERS | |
| 151 | Depressed mood | FAERS: 3 | SIDER US FAERS | |
| 152 | Diabetes mellitus inadequate control | FAERS: 3 | OFFSIDES US FAERS | |
| 153 | Dihydrotestosterone decreased | FAERS: 3 | US FAERS | |
| 154 | Drug dispensing error | FAERS: 3 | OFFSIDES US FAERS | |
| 155 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 156 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 157 | Eczema | FAERS: 3 | OFFSIDES US FAERS | |
| 158 | Epididymitis | FAERS: 3 | OFFSIDES US FAERS | |
| 159 | Epilepsy | FAERS: 3 | US FAERS | |
| 160 | Eye irritation | FAERS: 3 | US FAERS | |
| 161 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 162 | Gastritis | FAERS: 3 | US FAERS | |
| 163 | Gastrostomy | FAERS: 3 | US FAERS | |
| 164 | High density lipoprotein increased | FAERS: 3 | OFFSIDES US FAERS | |
| 165 | Incontinence | FAERS: 3 | OFFSIDES US FAERS | |
| 166 | Inflammation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 167 | Initial insomnia | FAERS: 3 | OFFSIDES US FAERS | |
| 168 | Intercepted product prescribing error | FAERS: 3 | US FAERS | |
| 169 | Leukopenia | FAERS: 3 | US FAERS | |
| 170 | Lymphadenopathy | FAERS: 3 | US FAERS | |
| 171 | Memory impairment | FAERS: 3 | US FAERS | |
| 172 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 173 | Pancytopenia | FAERS: 3 | US FAERS | |
| 174 | Product preparation error | FAERS: 3 | US FAERS | |
| 175 | Quality of life decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 176 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 177 | Retinal Vein Occlusion | FAERS: 3 | OFFSIDES US FAERS | |
| 178 | Retinal vascular thrombosis | FAERS: 3 | US FAERS | |
| 179 | Rhinitis | FAERS: 3 | US FAERS | |
| 180 | Skin nodule | FAERS: 3 | US FAERS | |
| 181 | Sperm concentration decreased | FAERS: 3 | US FAERS | |
| 182 | Therapy cessation | FAERS: 3 | US FAERS | |
| 183 | Throat irritation | FAERS: 3 | US FAERS | |
| 184 | Unevaluable event | FAERS: 3 | US FAERS | |
| 185 | Anuria | FAERS: 2 | US FAERS | |
| 186 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 187 | Apathy | FAERS: 2 | US FAERS | |
| 188 | Aphasia | FAERS: 2 | US FAERS | |
| 189 | Arterial therapeutic procedure | FAERS: 2 | US FAERS | |
| 190 | Bilirubin conjugated increased | FAERS: 2 | US FAERS | |
| 191 | Bladder tamponade | FAERS: 2 | US FAERS | |
| 192 | Blood bilirubin unconjugated increased | FAERS: 2 | US FAERS | |
| 193 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 194 | Blood testosterone free increased | FAERS: 2 | OFFSIDES US FAERS | |
| 195 | Breast discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 196 | Cataract | FAERS: 2 | US FAERS | |
| 197 | Cellulitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 198 | Crying | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 199 | Delirium | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Disorientation | FAERS: 2 | US FAERS | |
| 201 | Emotional disorder | FAERS: 2 | US FAERS | |
| 202 | Epistaxis | FAERS: 2 | US FAERS | |
| 203 | Free prostate-specific antigen decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 204 | Frustration | FAERS: 2 | US FAERS | |
| 205 | General physical health deterioration | FAERS: 2 | OFFSIDES US FAERS | |
| 206 | Genital burning sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 207 | Glaucoma | FAERS: 2 | US FAERS | |
| 208 | Glossitis | FAERS: 2 | US FAERS | |
| 209 | Gout | FAERS: 2 | US FAERS | |
| 210 | Hepatitis | FAERS: 2 | US FAERS | |
| 211 | Hernia | FAERS: 2 | US FAERS | |
| 212 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 213 | Hypertrichosis | FAERS: 2 | US FAERS | |
| 214 | Immobile | FAERS: 2 | OFFSIDES US FAERS | |
| 215 | Increased upper airway secretion | FAERS: 2 | OFFSIDES US FAERS | |
| 216 | Infection | FAERS: 2 | OFFSIDES US FAERS | |
| 217 | Influenza | FAERS: 2 | US FAERS | |
| 218 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 219 | Joint stiffness | FAERS: 2 | US FAERS | |
| 220 | Keratoconus | FAERS: 2 | US FAERS | |
| 221 | Live Birth | FAERS: 2 | OFFSIDES US FAERS | |
| 222 | Lung consolidation | FAERS: 2 | US FAERS | |
| 223 | Lymphoma | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 224 | Malaria | FAERS: 2 | OFFSIDES US FAERS | |
| 225 | Male sexual dysfunction | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 226 | Nervousness | FAERS: 2 | US FAERS | |
| 227 | No adverse event | FAERS: 2 | US FAERS | |
| 228 | Nodule | FAERS: 2 | US FAERS | |
| 229 | Oral pain | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 230 | Oropharyngeal discomfort | FAERS: 2 | OFFSIDES US FAERS | |
| 231 | Pancreatic Fistula | FAERS: 2 | US FAERS | |
| 232 | Paternal exposure before pregnancy | FAERS: 2 | US FAERS | |
| 233 | Peripheral arterial occlusive disease | FAERS: 2 | OFFSIDES US FAERS | |
| 234 | Peripheral swelling | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 235 | Pharmaceutical product counterfeit | FAERS: 2 | OFFSIDES US FAERS | |
| 236 | Plasmacytoma | FAERS: 2 | OFFSIDES US FAERS | |
| 237 | Presyncope | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Product counterfeit | FAERS: 2 | US FAERS | |
| 239 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 240 | Productive Cough | FAERS: 2 | US FAERS | |
| 241 | Prostate induration | FAERS: 2 | US FAERS | |
| 242 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 243 | Rash erythematous | FAERS: 2 | US FAERS | |
| 244 | Rectal discharge | FAERS: 2 | US FAERS | |
| 245 | Respiratory Failure | FAERS: 2 | US FAERS | |
| 246 | Restlessness | FAERS: 2 | US FAERS | |
| 247 | Retinitis Pigmentosa | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 248 | Rhonchi | FAERS: 2 | OFFSIDES US FAERS | |
| 249 | Sepsis | FAERS: 2 | US FAERS | |
| 250 | Skeletal injury | FAERS: 2 | US FAERS | |
| 251 | Skin Wrinkling | FAERS: 2 | OFFSIDES US FAERS | |
| 252 | Skin reaction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 253 | Sperm count decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 254 | Tachycardia | FAERS: 2 | US FAERS | |
| 255 | Talipes | FAERS: 2 | OFFSIDES US FAERS | |
| 256 | Therapeutic response changed | FAERS: 2 | US FAERS | |
| 257 | Thyroid Neoplasm | FAERS: 2 | US FAERS | |
| 258 | Transmission of drug via semen | FAERS: 2 | US FAERS | |
| 259 | Trisomy 21 | FAERS: 2 | US FAERS | |
| 260 | Urethral Stenosis | FAERS: 2 | OFFSIDES US FAERS | |
| 261 | Urethral discharge | FAERS: 2 | OFFSIDES US FAERS | |
| 262 | Urinary bladder polyp | FAERS: 2 | OFFSIDES US FAERS | |
| 263 | Urinary tract obstruction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 264 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 265 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 266 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 267 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 268 | Abdominal symptom | FAERS: 1 | OFFSIDES US FAERS | |
| 269 | Abscess | FAERS: 1 | US FAERS | |
| 270 | Accidental overdose | FAERS: 1 | US FAERS | |
| 271 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 272 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 273 | Agitation | FAERS: 1 | US FAERS | |
| 274 | Aldolase increased | FAERS: 1 | US FAERS | |
| 275 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 276 | Androgenetic Alopecia | FAERS: 1 | US FAERS | |
| 277 | Aneurysm | FAERS: 1 | US FAERS | |
| 278 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 279 | Anorectal discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 280 | Anorexia | FAERS: 1 | US FAERS | |
| 281 | Anosmia | FAERS: 1 | US FAERS | |
| 282 | Antinuclear antibody increased | FAERS: 1 | US FAERS | |
| 283 | Aphonia | FAERS: 1 | OFFSIDES US FAERS | |
| 284 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 285 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 286 | Arthritis | FAERS: 1 | OFFSIDES US FAERS | |
| 287 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 288 | Aura | FAERS: 1 | US FAERS | |
| 289 | Autonomic nervous system imbalance | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 290 | Azoospermia | FAERS: 1 | US FAERS | |
| 291 | Bedridden | FAERS: 1 | US FAERS | |
| 292 | Biopsy prostate abnormal | FAERS: 1 | US FAERS | |
| 293 | Bladder neoplasm surgery | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 294 | Blood alcohol increased | FAERS: 1 | US FAERS | |
| 295 | Blood blister | FAERS: 1 | US FAERS | |
| 296 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 297 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 298 | Blood glucose abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 299 | Blood glucose decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 300 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 301 | Blood iron increased | FAERS: 1 | OFFSIDES US FAERS | |
| 302 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 303 | Blood prolactin increased | FAERS: 1 | US FAERS | |
| 304 | Blood prolactin | FAERS: 1 | US FAERS | |
| 305 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 306 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 307 | Bone lesion | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 308 | Bone pain | FAERS: 1 | US FAERS | |
| 309 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 310 | Breast Cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 311 | Breast engorgement | FAERS: 1 | US FAERS | |
| 312 | Breast hyperplasia | FAERS: 1 | OFFSIDES US FAERS | |
| 313 | Bronchospasm | FAERS: 1 | US FAERS | |
| 314 | Bursitis | FAERS: 1 | US FAERS | |
| 315 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 316 | Cardiac assistance device user | FAERS: 1 | US FAERS | |
| 317 | Cataract operation | FAERS: 1 | OFFSIDES US FAERS | |
| 318 | Catheter placement | FAERS: 1 | OFFSIDES US FAERS | |
| 319 | Cerebral atrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 320 | Cheilitis | FAERS: 1 | US FAERS | |
| 321 | Chills | FAERS: 1 | US FAERS | |
| 322 | Chloasma | FAERS: 1 | US FAERS | |
| 323 | Choking | FAERS: 1 | US FAERS | |
| 324 | Cholestasis | FAERS: 1 | US FAERS | |
| 325 | Colectomy | FAERS: 1 | US FAERS | |
| 326 | Dark circles under eyes | FAERS: 1 | OFFSIDES US FAERS | |
| 327 | Dengue Fever | FAERS: 1 | US FAERS | |
| 328 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 329 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 330 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 331 | Diet refusal | FAERS: 1 | US FAERS | |
| 332 | Diplopia | FAERS: 1 | US FAERS | |
| 333 | Dissociation | FAERS: 1 | US FAERS | |
| 334 | Diverticulitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 335 | Drug exposure via breast milk | FAERS: 1 | US FAERS | |
| 336 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 337 | Drug screen positive | FAERS: 1 | US FAERS | |
| 338 | Dysgeusia | FAERS: 1 | OFFSIDES US FAERS | |
| 339 | Dysgraphia | FAERS: 1 | US FAERS | |
| 340 | Embolic stroke | FAERS: 1 | US FAERS | |
| 341 | Emotional poverty | FAERS: 1 | US FAERS | |
| 342 | Enuresis | FAERS: 1 | US FAERS | |
| 343 | Eosinophilia | FAERS: 1 | US FAERS | |
| 344 | Erection increased | FAERS: 1 | US FAERS | |
| 345 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 346 | Erythropsia | FAERS: 1 | US FAERS | |
| 347 | Expired drug administered | FAERS: 1 | US FAERS | |
| 348 | Exposure during breast feeding | FAERS: 1 | US FAERS | |
| 349 | Eye inflammation | FAERS: 1 | US FAERS | |
| 350 | Eyelid irritation | FAERS: 1 | OFFSIDES US FAERS | |
| 351 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 352 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 353 | Feeling Cold | FAERS: 1 | US FAERS | |
| 354 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 355 | Fibroadenoma of breast | FAERS: 1 | US FAERS | |
| 356 | Fibromyalgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 357 | Floppy iris syndrome | FAERS: 1 | US FAERS | |
| 358 | Food Poisoning | FAERS: 1 | US FAERS | |
| 359 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 360 | Fracture | FAERS: 1 | US FAERS | |
| 361 | Gastrointestinal motility disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 362 | Genital pain | FAERS: 1 | OFFSIDES US FAERS | |
| 363 | Genital rash | FAERS: 1 | OFFSIDES US FAERS | |
| 364 | Gingival Recession | FAERS: 1 | US FAERS | |
| 365 | Growth retardation | FAERS: 1 | US FAERS | |
| 366 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 367 | Hormone level abnormal | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 368 | Hyperkeratosis | FAERS: 1 | US FAERS | |
| 369 | Hyperplasia | FAERS: 1 | US FAERS | |
| 370 | Hypersomnia | FAERS: 1 | US FAERS | |
| 371 | Hypogeusia | FAERS: 1 | OFFSIDES US FAERS | |
| 372 | Hypokinesia | FAERS: 1 | US FAERS | |
| 373 | Hypospadias | FAERS: 1 | OFFSIDES US FAERS | |
| 374 | Illiteracy | FAERS: 1 | US FAERS | |
| 375 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 376 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 377 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 378 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 379 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 380 | Infarction | FAERS: 1 | US FAERS | |
| 381 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 382 | Intercepted drug administration error | FAERS: 1 | US FAERS | |
| 383 | Intestinal infarction | FAERS: 1 | US FAERS | |
| 384 | Joint Range of Motion Decreased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 385 | Joint injury | FAERS: 1 | US FAERS | |
| 386 | Laceration | FAERS: 1 | US FAERS | |
| 387 | Larynx irritation | FAERS: 1 | US FAERS | |
| 388 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 389 | Ligament pain | FAERS: 1 | US FAERS | |
| 390 | Limb discomfort | FAERS: 1 | OFFSIDES US FAERS | |
| 391 | Limb operation | FAERS: 1 | US FAERS | |
| 392 | Lipoma | FAERS: 1 | US FAERS | |
| 393 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 394 | Lower Urinary Tract Symptoms | FAERS: 1 | US FAERS | |
| 395 | Lung Injury | FAERS: 1 | OFFSIDES US FAERS | |
| 396 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 397 | Lymphopenia | FAERS: 1 | US FAERS | |
| 398 | Macular degeneration | FAERS: 1 | US FAERS | |
| 399 | Male Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 400 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 401 | Meningioma | FAERS: 1 | US FAERS | |
| 402 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 403 | Mental status changes | FAERS: 1 | US FAERS | |
| 404 | Metaplasia | FAERS: 1 | US FAERS | |
| 405 | Metastasis | FAERS: 1 | US FAERS | |
| 406 | Metastatic Neoplasm | FAERS: 1 | OFFSIDES US FAERS | |
| 407 | Micturition frequency decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 408 | Monoplegia | FAERS: 1 | US FAERS | |
| 409 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 410 | Multiple allergies | FAERS: 1 | US FAERS | |
| 411 | Muscle strain | FAERS: 1 | OFFSIDES US FAERS | |
| 412 | Muscle tightness | FAERS: 1 | US FAERS | |
| 413 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 414 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 415 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 416 | Myoclonus | FAERS: 1 | US FAERS | |
| 417 | Myopia | FAERS: 1 | US FAERS | |
| 418 | Nephritis | FAERS: 1 | US FAERS | |
| 419 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 420 | Neuralgia | FAERS: 1 | US FAERS | |
| 421 | No adverse effect | FAERS: 1 | US FAERS | |
| 422 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 423 | Obesity | FAERS: 1 | US FAERS | |
| 424 | Ocular icterus | FAERS: 1 | US FAERS | |
| 425 | Orchitis | FAERS: 1 | OFFSIDES US FAERS | |
| 426 | Orgasmic sensation decreased | FAERS: 1 | SIDER US FAERS | |
| 427 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 428 | Osteopenia | FAERS: 1 | OFFSIDES US FAERS | |
| 429 | Painful ejaculation | FAERS: 1 | US FAERS | |
| 430 | Pallor | FAERS: 1 | US FAERS | |
| 431 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 432 | Paranasal sinus discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 433 | Pelvic discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 434 | Performance status decreased | FAERS: 1 | US FAERS | |
| 435 | Pericardial effusion | FAERS: 1 | US FAERS | |
| 436 | Personality Change | FAERS: 1 | US FAERS | |
| 437 | Petechiae | FAERS: 1 | US FAERS | |
| 438 | Pharyngitis | FAERS: 1 | US FAERS | |
| 439 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 440 | Photophobia | FAERS: 1 | US FAERS | |
| 441 | Pneumonectomy | FAERS: 1 | US FAERS | |
| 442 | Poisoning | FAERS: 1 | US FAERS | |
| 443 | Polydipsia | FAERS: 1 | US FAERS | |
| 444 | Polyglandular disorder | FAERS: 1 | US FAERS | |
| 445 | Polyhydramnios | FAERS: 1 | OFFSIDES US FAERS | |
| 446 | Polyuria | FAERS: 1 | US FAERS | |
| 447 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 448 | Premature Ejaculation | FAERS: 1 | SIDER US FAERS | |
| 449 | Procedural complication | FAERS: 1 | US FAERS | |
| 450 | Product complaint | FAERS: 1 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 451 | Product container issue | FAERS: 1 | US FAERS | |
| 452 | Product package associated injury | FAERS: 1 | US FAERS | |
| 453 | Product physical issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 454 | Product storage error | FAERS: 1 | US FAERS | |
| 455 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 456 | Prostatic dysplasia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 457 | Psoriasis | FAERS: 1 | US FAERS | |
| 458 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 459 | Purpura | FAERS: 1 | US FAERS | |
| 460 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 461 | Rectal examination abnormal | FAERS: 1 | US FAERS | |
| 462 | Rectal tenesmus | FAERS: 1 | US FAERS | |
| 463 | Renal cancer metastatic | FAERS: 1 | US FAERS | |
| 464 | Renal pain | FAERS: 1 | US FAERS | |
| 465 | Respiratory distress | FAERS: 1 | US FAERS | |
| 466 | Retinal artery embolism | FAERS: 1 | US FAERS | |
| 467 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 468 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 469 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 470 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 471 | Sarcoma | FAERS: 1 | US FAERS | |
| 472 | Screaming | FAERS: 1 | US FAERS | |
| 473 | Semen analysis abnormal | FAERS: 1 | US FAERS | |
| 474 | Semen volume increased | FAERS: 1 | US FAERS | |
| 475 | Sensation of blood flow | FAERS: 1 | US FAERS | |
| 476 | Sinusitis | FAERS: 1 | US FAERS | |
| 477 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 478 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 479 | Skin laceration | FAERS: 1 | US FAERS | |
| 480 | Skin lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 481 | Skin necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 482 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 483 | Sluggishness | FAERS: 1 | US FAERS | |
| 484 | Sneezing | FAERS: 1 | US FAERS | |
| 485 | Sperm concentration zero | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 486 | Spondylolisthesis | FAERS: 1 | US FAERS | |
| 487 | Stoma creation | FAERS: 1 | US FAERS | |
| 488 | Subcutaneous nodule | FAERS: 1 | US FAERS | |
| 489 | Sunburn | FAERS: 1 | US FAERS | |
| 490 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 491 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 492 | Terminal state | FAERS: 1 | US FAERS | |
| 493 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 494 | Throat cancer | FAERS: 1 | US FAERS | |
| 495 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 496 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 497 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 498 | Transmission of an infectious agent via a medicinal product | FAERS: 1 | US FAERS | |
| 499 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 500 | Ulcer | FAERS: 1 | US FAERS | |
| 501 | Ultrasound breast abnormal | FAERS: 1 | US FAERS | |
| 502 | Urethral Obstruction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 503 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 504 | Urine calcium increased | FAERS: 1 | US FAERS | |
| 505 | Varicose vein operation | FAERS: 1 | US FAERS | |
| 506 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 507 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 508 | Ventricular failure | FAERS: 1 | US FAERS | |
| 509 | Walking aid user | FAERS: 1 | OFFSIDES US FAERS | |
| 510 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 511 | Abscess management | OFFSIDES | ||
| 512 | Acid reflux | OFFSIDES | ||
| 513 | Alanine aminotransferase abnormal | OFFSIDES | ||
| 514 | Alpha-1 anti-trypsin increased | OFFSIDES | ||
| 515 | Alveoloplasty | OFFSIDES | ||
| 516 | Anal Fistula | OFFSIDES | ||
| 517 | Angioedema | SIDER | ||
| 518 | Angiogram abnormal | OFFSIDES | ||
| 519 | Anhedonia | OFFSIDES | ||
| 520 | Anhidrosis | OFFSIDES | ||
| 521 | Ankle brachial index decreased | OFFSIDES | ||
| 522 | Ankyloglossia acquired | OFFSIDES | ||
| 523 | Aphagia | OFFSIDES | ||
| 524 | Aspartate aminotransferase abnormal | OFFSIDES | ||
| 525 | Asthenopia | OFFSIDES | ||
| 526 | Atelectasis | OFFSIDES | ||
| 527 | Autologous bone marrow transplantation therapy | OFFSIDES | ||
| 528 | Band neutrophil percentage increased | OFFSIDES | ||
| 529 | Barbiturates positive | OFFSIDES | ||
| 530 | Basal cell carcinoma | OFFSIDES | ||
| 531 | Bladder discomfort | OFFSIDES | ||
| 532 | Bladder neck obstruction | OFFSIDES | ||
| 533 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 534 | Blood Glucose | OFFSIDES | ||
| 535 | Blood aldosterone increased | OFFSIDES | ||
| 536 | Blood amylase | OFFSIDES | ||
| 537 | Blood creatinine decreased | OFFSIDES | ||
| 538 | Blood triglycerides decreased | OFFSIDES | ||
| 539 | Body temperature fluctuation | OFFSIDES | ||
| 540 | Bone density decreased | OFFSIDES | ||
| 541 | Bone swelling | OFFSIDES | ||
| 542 | Breakthrough Pain | OFFSIDES | ||
| 543 | Bronchiolitis | OFFSIDES | ||
| 544 | Bulimia | OFFSIDES | ||
| 545 | Calcification pancreatic duct | OFFSIDES | ||
| 546 | Cardiac ablation | OFFSIDES | ||
| 547 | Cardiac stress test normal | Canada Vigilance: 1 | Canada Vigilance | |
| 548 | Central nervous system lesion | OFFSIDES | ||
| 549 | Cerebral disorder | Canada Vigilance: 1 | Canada Vigilance | |
| 550 | Cervical laser therapy | OFFSIDES | ||
| 551 | Cholecystitis infective | OFFSIDES | ||
| 552 | Clonus | OFFSIDES | ||
| 553 | Compression fracture | OFFSIDES | ||
| 554 | Cryptorchidism | OFFSIDES | ||
| 555 | Culture positive | OFFSIDES | ||
| 556 | Debridement | OFFSIDES | ||
| 557 | Decreased Libido | OFFSIDES | ||
| 558 | Demyelination | OFFSIDES | ||
| 559 | Dental abscess | OFFSIDES | ||
| 560 | Dental caries | OFFSIDES | ||
| 561 | Dental prosthesis placement | OFFSIDES | ||
| 562 | Dental prosthesis user | OFFSIDES | ||
| 563 | Denture wearer | OFFSIDES | ||
| 564 | Device breakage | OFFSIDES | ||
| 565 | Disturbance in sexual arousal | SIDER | ||
| 566 | Diverticulum | OFFSIDES | ||
| 567 | Dyspareunia | OFFSIDES | ||
| 568 | Ear discomfort | OFFSIDES | ||
| 569 | Echocardiogram abnormal | OFFSIDES | ||
| 570 | Ejection Fraction Decreased | OFFSIDES | ||
| 571 | Ejection fraction abnormal | OFFSIDES | ||
| 572 | Electrocardiogram poor R-wave progression | OFFSIDES | ||
| 573 | Encephalomalacia | OFFSIDES | ||
| 574 | Endodontic procedure | OFFSIDES | ||
| 575 | Enterococcal sepsis | OFFSIDES | ||
| 576 | Erosive gastritis | OFFSIDES | ||
| 577 | Erythema Nodosum | OFFSIDES | ||
| 578 | Exposure to chemical pollution | OFFSIDES | ||
| 579 | Eye Infection | OFFSIDES | ||
| 580 | Eyelid infection | OFFSIDES | ||
| 581 | Eyelids pruritus | OFFSIDES | ||
| 582 | Febrile Neutropenia | OFFSIDES | ||
| 583 | Femoral arterial stenosis | OFFSIDES | ||
| 584 | Fistula discharge | OFFSIDES | ||
| 585 | Fistula repair | OFFSIDES | ||
| 586 | Flank Pain | OFFSIDES | ||
| 587 | Foreign body aspiration | OFFSIDES | ||
| 588 | Formication | OFFSIDES | ||
| 589 | Genital discomfort | OFFSIDES | ||
| 590 | Gingival erythema | OFFSIDES | ||
| 591 | Gliosis | OFFSIDES | ||
| 592 | Head deformity | OFFSIDES | ||
| 593 | Heat Exhaustion | OFFSIDES | ||
| 594 | Hepatocellular Adenoma | SIDER | ||
| 595 | Hiccough | OFFSIDES | ||
| 596 | Hidradenitis | OFFSIDES | ||
| 597 | Hormone Therapy | OFFSIDES | ||
| 598 | Hydronephrosis | OFFSIDES | ||
| 599 | Hyperreflexia | OFFSIDES | ||
| 600 | Hyporeflexia | OFFSIDES | ||
| 601 | Ileitis | OFFSIDES | ||
| 602 | Iliac artery stenosis | OFFSIDES | ||
| 603 | Impaired self-care | OFFSIDES | ||
| 604 | Impaired work ability | OFFSIDES | ||
| 605 | Increased bronchial secretion | OFFSIDES | ||
| 606 | Infusion site erythema | OFFSIDES | ||
| 607 | Inguinal mass | OFFSIDES | ||
| 608 | Inhalation Therapy | OFFSIDES | ||
| 609 | Intermittent Claudication | OFFSIDES | ||
| 610 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 611 | Invasive Ductal Breast Carcinoma | Canada Vigilance: 1 | Canada Vigilance | |
| 612 | Lentigo | OFFSIDES | ||
| 613 | Libido disorder | OFFSIDES SIDER | ||
| 614 | Ligament rupture | OFFSIDES | ||
| 615 | Lipoprotein (a) abnormal | OFFSIDES | ||
| 616 | Loose tooth | OFFSIDES | ||
| 617 | Lung hyperinflation | OFFSIDES | ||
| 618 | Lysosomal Storage Diseases | 28551711 | CTD | |
| 619 | Malignant nipple neoplasm male | OFFSIDES | ||
| 620 | Malignant tumour excision | OFFSIDES | ||
| 621 | Medical device implantation | OFFSIDES | ||
| 622 | Mesenteric vascular insufficiency | OFFSIDES | ||
| 623 | Metastases to reproductive organ | OFFSIDES | ||
| 624 | Multi-organ disorder | OFFSIDES | ||
| 625 | Multiple Myeloma | OFFSIDES | ||
| 626 | Muscle Fatigue | OFFSIDES | ||
| 627 | Muscle Weakness | OFFSIDES | ||
| 628 | Muscle enzyme | OFFSIDES | ||
| 629 | Musculoskeletal discomfort | OFFSIDES | ||
| 630 | Myeloma recurrence | OFFSIDES | ||
| 631 | Onychalgia | OFFSIDES | ||
| 632 | Open reduction of fracture | OFFSIDES | ||
| 633 | Oral Cavity Fistula | OFFSIDES | ||
| 634 | Oral polypectomy | OFFSIDES | ||
| 635 | Osteolysis | OFFSIDES | ||
| 636 | Osteomyelitis | OFFSIDES | ||
| 637 | Osteoradionecrosis | OFFSIDES | ||
| 638 | Osteosclerosis | OFFSIDES | ||
| 639 | Oxygen supplementation | OFFSIDES | ||
| 640 | Pain of skin | OFFSIDES | ||
| 641 | Palliative Care | OFFSIDES | ||
| 642 | Paraparesis | OFFSIDES | ||
| 643 | Pelvic Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 644 | Penile curvature | Canada Vigilance: 1 | Canada Vigilance | |
| 645 | Periodontitis | OFFSIDES | ||
| 646 | Perirectal abscess | OFFSIDES | ||
| 647 | Phimosis | OFFSIDES | ||
| 648 | Physical disability | OFFSIDES | ||
| 649 | Polyneuropathy | OFFSIDES | ||
| 650 | Portal Vein Thrombosis | OFFSIDES | ||
| 651 | Post procedural infection | OFFSIDES | ||
| 652 | Post procedural pain | OFFSIDES | ||
| 653 | Posterior Capsulotomy | OFFSIDES | ||
| 654 | Posterior capsule opacification | OFFSIDES | ||
| 655 | Primary sequestrum | OFFSIDES | ||
| 656 | Product administration error | Canada Vigilance: 1 | Canada Vigilance | |
| 657 | Prostate examination abnormal | OFFSIDES | ||
| 658 | Prostatectomy | OFFSIDES | ||
| 659 | Prostatic Hyperplasia | 18500220 | CTD | |
| 660 | Prostatic Neoplasms, Castration-Resistant | 18500220 | CTD | |
| 661 | Prostatic Neoplasms | 24323034 28757136 | CTD | |
| 662 | Prostatic Obstruction | OFFSIDES | ||
| 663 | Protein total decreased | OFFSIDES | ||
| 664 | Prothrombin level decreased | OFFSIDES | ||
| 665 | Purulence | OFFSIDES | ||
| 666 | Purulent discharge | OFFSIDES | ||
| 667 | Rectal spasm | OFFSIDES | ||
| 668 | Renal cyst | OFFSIDES | ||
| 669 | Renal mass | OFFSIDES | ||
| 670 | Respiratory Therapy | OFFSIDES | ||
| 671 | Respiratory tract infection fungal | OFFSIDES | ||
| 672 | Retroperitoneal lymphadenopathy | OFFSIDES | ||
| 673 | Rhinorrhea | OFFSIDES | ||
| 674 | Secretion discharge | OFFSIDES | ||
| 675 | Semen viscosity abnormal | OFFSIDES | ||
| 676 | Sick Sinus Syndrome | OFFSIDES | ||
| 677 | Sinus bradycardia | OFFSIDES | ||
| 678 | Skin neoplasm excision | OFFSIDES | ||
| 679 | Small intestine carcinoma | OFFSIDES | ||
| 680 | Soft tissue inflammation | OFFSIDES | ||
| 681 | Spinal column stenosis | OFFSIDES | ||
| 682 | Spinal fusion surgery | OFFSIDES | ||
| 683 | Spinal haemangioma | OFFSIDES | ||
| 684 | Spondylolysis | OFFSIDES | ||
| 685 | Squamous cell carcinoma of skin | OFFSIDES | ||
| 686 | Stasis dermatitis | OFFSIDES | ||
| 687 | Stem cell transplant | OFFSIDES | ||
| 688 | Suture insertion | OFFSIDES | ||
| 689 | Sweat gland infection | OFFSIDES | ||
| 690 | Swelling of eyelid | Canada Vigilance: 1 | Canada Vigilance | |
| 691 | Testicular mass | OFFSIDES | ||
| 692 | Testis discomfort | OFFSIDES | ||
| 693 | Therapeutic procedure | OFFSIDES | ||
| 694 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 695 | Tinea cruris | OFFSIDES | ||
| 696 | Tinnitus | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 697 | Tooth Extraction | OFFSIDES | ||
| 698 | Tooth Infection | OFFSIDES | ||
| 699 | Tooth Loss | OFFSIDES | ||
| 700 | Urinary Tract Pain | OFFSIDES | ||
| 701 | Vasectomy | OFFSIDES | ||
| 702 | Vasospasm | OFFSIDES | ||
| 703 | Venoocclusive disease | OFFSIDES | ||
| 704 | Venous Insufficiency | OFFSIDES | ||
| 705 | Vertebroplasty | OFFSIDES | ||
| 706 | Wound Debridement | OFFSIDES | ||
| 707 | Wound closure | OFFSIDES | ||
| 708 | intensive care | OFFSIDES | ||
| 709 | keratoacanthoma | OFFSIDES | ||
| 710 | kyphosis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.