macitentan
(JGCMEBMXRHSZKX-UHFFFAOYSA-N)
Structure
- SMILES
- CCCNS(=O)(=O)Nc1ncnc(c1c1ccc(cc1)Br)OCCOc1ncc(cn1)Br
- Type(s)
- Approved
- ATC code(s)
- C02KX04
- Molecular Formula:
- C19H20Br2N6O4S
- Molecular Weight:
- 588.273
- Log P:
- 5.1174
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 2
- TPSA:
- 136.6
- CAS Number(s):
- 441798-33-0
Synonym(s)
1.
macitentan
2.
ACT 064992
3.
ACT-064992
4.
ACT064992
5.
Actelion-1
6.
N-(5-(4-bromophenyl)-6-(2-(5-bromopyrimidin-2-yloxy)ethoxy)pyrimidin-4-yl)-N'-propylaminosulfonamide
7.
opsumit
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Pneumonia | FAERS: 657 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 2 | Fatigue | FAERS: 303 | US FAERS | |
| 3 | Malaise | FAERS: 293 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Headache | FAERS: 276 | SIDER US FAERS | |
| 5 | Pulmonary arterial hypertension | FAERS: 242 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Nausea | FAERS: 205 | US FAERS | |
| 7 | Drug dose omission | FAERS: 204 | US FAERS | |
| 8 | Peripheral swelling | FAERS: 188 | US FAERS | |
| 9 | Dizziness | FAERS: 184 | US FAERS | |
| 10 | Pain | FAERS: 175 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Asthenia | FAERS: 170 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Hypotension | FAERS: 162 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 13 | Product dose omission | FAERS: 156 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Pulmonary Hypertension | FAERS: 154 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 15 | Chest Pain | FAERS: 141 | US FAERS | |
| 16 | Vomiting | FAERS: 136 | US FAERS | |
| 17 | Disease Progression | FAERS: 135 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 18 | Nasopharyngitis | FAERS: 133 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 19 | Respiratory Failure | FAERS: 132 | US FAERS | |
| 20 | Urinary tract infection | FAERS: 130 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 21 | Influenza | FAERS: 113 | SIDER US FAERS | |
| 22 | Unevaluable event | FAERS: 109 | US FAERS | |
| 23 | Syncope | FAERS: 94 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Back Pain | FAERS: 89 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Swelling | FAERS: 86 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Bronchitis | FAERS: 85 | SIDER US FAERS | |
| 27 | Sepsis | FAERS: 84 | US FAERS | |
| 28 | Dehydration | FAERS: 82 | US FAERS | |
| 29 | Hypoxia | FAERS: 80 | US FAERS | |
| 30 | Fluid overload | FAERS: 78 | US FAERS | |
| 31 | Atrial Fibrillation | FAERS: 77 | US FAERS | |
| 32 | Chest discomfort | FAERS: 76 | US FAERS | |
| 33 | Feeling abnormal | FAERS: 76 | US FAERS | |
| 34 | Infection | FAERS: 74 | SIDER US FAERS | |
| 35 | Cerebrovascular accident | FAERS: 72 | US FAERS | |
| 36 | Right ventricular failure | FAERS: 71 | SIDER US FAERS | |
| 37 | Productive Cough | FAERS: 69 | US FAERS | |
| 38 | Myocardial Infarction | FAERS: 66 | US FAERS | |
| 39 | Pruritus | FAERS: 66 | US FAERS | |
| 40 | Therapy non-responder | FAERS: 66 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Sinusitis | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Arthralgia | FAERS: 64 | US FAERS | |
| 43 | Oropharyngeal pain | FAERS: 63 | US FAERS | |
| 44 | Epistaxis | FAERS: 56 | US FAERS | |
| 45 | Weight decreased | FAERS: 56 | US FAERS | |
| 46 | Abdominal Pain | FAERS: 55 | US FAERS | |
| 47 | Cellulitis | FAERS: 55 | US FAERS | |
| 48 | Palpitations | FAERS: 51 | US FAERS | |
| 49 | General physical health deterioration | FAERS: 50 | US FAERS | |
| 50 | Constipation | FAERS: 48 | US FAERS | |
| 51 | Memory impairment | FAERS: 48 | US FAERS | |
| 52 | Cardiac Arrest | FAERS: 44 | US FAERS | |
| 53 | Chills | FAERS: 44 | US FAERS | |
| 54 | Acute respiratory failure | FAERS: 41 | US FAERS | |
| 55 | Anxiety | FAERS: 41 | US FAERS | |
| 56 | Tremor | FAERS: 41 | US FAERS | |
| 57 | Acute kidney injury | FAERS: 39 | US FAERS | |
| 58 | Myalgia | FAERS: 39 | US FAERS | |
| 59 | Blood potassium decreased | FAERS: 37 | US FAERS | |
| 60 | Pericardial effusion | FAERS: 37 | US FAERS | |
| 61 | Abdominal discomfort | FAERS: 36 | US FAERS | |
| 62 | Somnolence | FAERS: 36 | US FAERS | |
| 63 | Adverse event | FAERS: 34 | US FAERS | |
| 64 | Ascites | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 65 | Pulmonary Fibrosis | FAERS: 34 | US FAERS | |
| 66 | Drug ineffective | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Alanine Aminotransferase Increased | FAERS: 32 | US FAERS | |
| 68 | Aspartate Aminotransferase Increased | FAERS: 32 | US FAERS | |
| 69 | Visual Impairment | FAERS: 32 | US FAERS | |
| 70 | Dyspepsia | FAERS: 31 | US FAERS | |
| 71 | Gout | FAERS: 31 | US FAERS | |
| 72 | Septic Shock | FAERS: 31 | US FAERS | |
| 73 | Thrombosis | FAERS: 30 | US FAERS | |
| 74 | Asthma | FAERS: 29 | US FAERS | |
| 75 | Erythema | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Joint swelling | FAERS: 28 | US FAERS | |
| 77 | Arthritis | FAERS: 27 | US FAERS | |
| 78 | Flushing | FAERS: 27 | US FAERS | |
| 79 | Hypersensitivity | FAERS: 27 | US FAERS | |
| 80 | Terminal state | FAERS: 27 | US FAERS | |
| 81 | Blood creatinine increased | FAERS: 26 | US FAERS | |
| 82 | Throat irritation | FAERS: 26 | US FAERS | |
| 83 | Concomitant disease aggravated | FAERS: 25 | US FAERS | |
| 84 | Disease complication | FAERS: 25 | US FAERS | |
| 85 | Therapy cessation | FAERS: 25 | US FAERS | |
| 86 | Blood count abnormal | FAERS: 24 | US FAERS | |
| 87 | Scleroderma | FAERS: 24 | US FAERS | |
| 88 | Inflammation | FAERS: 23 | US FAERS | |
| 89 | Mental status changes | FAERS: 23 | US FAERS | |
| 90 | Respiratory tract congestion | FAERS: 23 | US FAERS | |
| 91 | Wheezing | FAERS: 23 | US FAERS | |
| 92 | Oxygen consumption increased | FAERS: 21 | US FAERS | |
| 93 | Pulmonary Embolism | FAERS: 20 | US FAERS | |
| 94 | Blood glucose increased | FAERS: 19 | US FAERS | |
| 95 | Blood sodium decreased | FAERS: 19 | US FAERS | |
| 96 | Dysphonia | FAERS: 19 | US FAERS | |
| 97 | Hepatic Encephalopathy | FAERS: 19 | US FAERS | |
| 98 | Lethargy | FAERS: 19 | US FAERS | |
| 99 | Presyncope | FAERS: 19 | US FAERS | |
| 100 | Asphyxia | FAERS: 18 | US FAERS | |
| 101 | Cholelithiasis | FAERS: 18 | US FAERS | |
| 102 | Cystitis | FAERS: 18 | US FAERS | |
| 103 | Intestinal Obstruction | FAERS: 18 | US FAERS | |
| 104 | Stress | FAERS: 18 | US FAERS | |
| 105 | Tachycardia | FAERS: 18 | US FAERS | |
| 106 | Extra dose administered | FAERS: 17 | US FAERS | |
| 107 | Pulmonary congestion | FAERS: 17 | US FAERS | |
| 108 | Chemotherapy | FAERS: 16 | US FAERS | |
| 109 | Deafness | FAERS: 16 | US FAERS | |
| 110 | Hysterectomy | FAERS: 16 | US FAERS | |
| 111 | Limb discomfort | FAERS: 16 | US FAERS | |
| 112 | Pulmonary arterial pressure increased | FAERS: 16 | US FAERS | |
| 113 | Transplant evaluation | FAERS: 16 | US FAERS | |
| 114 | Unresponsive to stimuli | FAERS: 16 | US FAERS | |
| 115 | Ankle Fracture | FAERS: 15 | US FAERS | |
| 116 | Atrial Flutter | FAERS: 15 | US FAERS | |
| 117 | Chromaturia | FAERS: 15 | US FAERS | |
| 118 | Clostridium difficile infection | FAERS: 15 | US FAERS | |
| 119 | Diabetes Mellitus | FAERS: 15 | US FAERS | |
| 120 | Gait inability | FAERS: 15 | US FAERS | |
| 121 | Pneumothorax | FAERS: 15 | US FAERS | |
| 122 | Product supply issue | FAERS: 15 | US FAERS | |
| 123 | Vertigo | FAERS: 15 | US FAERS | |
| 124 | Choking sensation | FAERS: 14 | US FAERS | |
| 125 | Diverticulitis | FAERS: 14 | US FAERS | |
| 126 | Gastritis | FAERS: 14 | US FAERS | |
| 127 | Hospice Care | FAERS: 14 | US FAERS | |
| 128 | Pancreatitis | FAERS: 14 | US FAERS | |
| 129 | Amnesia | FAERS: 13 | US FAERS | |
| 130 | Choking | FAERS: 13 | US FAERS | |
| 131 | Feeling Cold | FAERS: 13 | US FAERS | |
| 132 | Hernia | FAERS: 13 | US FAERS | |
| 133 | Hip surgery | FAERS: 13 | US FAERS | |
| 134 | Incorrect dose administered | FAERS: 13 | US FAERS | |
| 135 | Musculoskeletal Pain | FAERS: 13 | US FAERS | |
| 136 | Neck Pain | FAERS: 13 | US FAERS | |
| 137 | White blood cell count decreased | FAERS: 13 | US FAERS | |
| 138 | Blood magnesium decreased | FAERS: 12 | US FAERS | |
| 139 | Cyanosis | FAERS: 12 | US FAERS | |
| 140 | Dry skin | FAERS: 12 | US FAERS | |
| 141 | Limb injury | FAERS: 12 | US FAERS | |
| 142 | Multiple allergies | FAERS: 12 | US FAERS | |
| 143 | Nephrolithiasis | FAERS: 12 | US FAERS | |
| 144 | No adverse event | FAERS: 12 | US FAERS | |
| 145 | Rehabilitation therapy | FAERS: 12 | US FAERS | |
| 146 | Respiratory arrest | FAERS: 12 | US FAERS | |
| 147 | Secretion discharge | FAERS: 12 | US FAERS | |
| 148 | Skin Ulcer | FAERS: 12 | US FAERS | |
| 149 | Tinnitus | FAERS: 12 | US FAERS | |
| 150 | Agitation | FAERS: 11 | US FAERS | |
| 151 | Arthropathy | FAERS: 11 | US FAERS | |
| 152 | Blood potassium increased | FAERS: 11 | US FAERS | |
| 153 | Bone pain | FAERS: 11 | US FAERS | |
| 154 | Burning sensation | FAERS: 11 | US FAERS | |
| 155 | Lower respiratory tract infection | FAERS: 11 | US FAERS | |
| 156 | Menorrhagia | FAERS: 11 | US FAERS | |
| 157 | Rheumatoid Arthritis | FAERS: 11 | US FAERS | |
| 158 | Tooth Extraction | FAERS: 11 | US FAERS | |
| 159 | Blindness | FAERS: 10 | US FAERS | |
| 160 | Blood alkaline phosphatase increased | FAERS: 10 | US FAERS | |
| 161 | Blood glucose decreased | FAERS: 10 | US FAERS | |
| 162 | Blood urine present | FAERS: 10 | US FAERS | |
| 163 | Deep Vein Thrombosis | FAERS: 10 | US FAERS | |
| 164 | Dementia | FAERS: 10 | US FAERS | |
| 165 | Loss of personal independence in daily activities | FAERS: 10 | US FAERS | |
| 166 | Pancytopenia | FAERS: 10 | US FAERS | |
| 167 | Paranasal sinus discomfort | FAERS: 10 | US FAERS | |
| 168 | Respiratory distress | FAERS: 10 | US FAERS | |
| 169 | Sudden death | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 170 | Thrombocytopenia | FAERS: 10 | US FAERS | |
| 171 | Upper respiratory tract congestion | FAERS: 10 | US FAERS | |
| 172 | Urticaria | FAERS: 10 | US FAERS | |
| 173 | Accidental overdose | FAERS: 9 | US FAERS | |
| 174 | Aphonia | FAERS: 9 | US FAERS | |
| 175 | Colitis | FAERS: 9 | US FAERS | |
| 176 | Depressed mood | FAERS: 9 | US FAERS | |
| 177 | Nervousness | FAERS: 9 | US FAERS | |
| 178 | Osteomyelitis | FAERS: 9 | US FAERS | |
| 179 | Pancreatic carcinoma | FAERS: 9 | US FAERS | |
| 180 | Pulmonary thrombosis | FAERS: 9 | US FAERS | |
| 181 | Sneezing | FAERS: 9 | US FAERS | |
| 182 | Blood pressure fluctuation | FAERS: 8 | US FAERS | |
| 183 | Cardiac Flutter | FAERS: 8 | US FAERS | |
| 184 | Concomitant disease progression | FAERS: 8 | US FAERS | |
| 185 | Cor pulmonale | FAERS: 8 | US FAERS | |
| 186 | Coronary Artery Disease | FAERS: 8 | US FAERS | |
| 187 | Delirium | FAERS: 8 | US FAERS | |
| 188 | Dysarthria | FAERS: 8 | US FAERS | |
| 189 | Dysuria | FAERS: 8 | US FAERS | |
| 190 | Eye irritation | FAERS: 8 | US FAERS | |
| 191 | Flatulence | FAERS: 8 | US FAERS | |
| 192 | Full blood count decreased | FAERS: 8 | US FAERS | |
| 193 | Hypercapnia | FAERS: 8 | US FAERS | |
| 194 | Limb operation | FAERS: 8 | US FAERS | |
| 195 | Osteoporosis | FAERS: 8 | US FAERS | |
| 196 | Pneumonitis | FAERS: 8 | US FAERS | |
| 197 | Respiratory tract infection viral | FAERS: 8 | US FAERS | |
| 198 | skin abrasion | FAERS: 8 | US FAERS | |
| 199 | Abasia | FAERS: 7 | US FAERS | |
| 200 | Angina Pectoris | FAERS: 7 | US FAERS | |
| 201 | Blood iron decreased | FAERS: 7 | US FAERS | |
| 202 | Bradycardia | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 203 | Cholecystitis | FAERS: 7 | US FAERS | |
| 204 | Clostridium difficile colitis | FAERS: 7 | US FAERS | |
| 205 | Device related infection | FAERS: 7 | US FAERS | |
| 206 | Eye pain | FAERS: 7 | US FAERS | |
| 207 | Gastric infection | FAERS: 7 | US FAERS | |
| 208 | Joint injury | FAERS: 7 | US FAERS | |
| 209 | Lower respiratory tract congestion | FAERS: 7 | US FAERS | |
| 210 | Mechanical ventilation | FAERS: 7 | US FAERS | |
| 211 | Neuralgia | FAERS: 7 | US FAERS | |
| 212 | Pharyngitis | FAERS: 7 | SIDER US FAERS | |
| 213 | Pulmonary pain | FAERS: 7 | US FAERS | |
| 214 | Rales | FAERS: 7 | US FAERS | |
| 215 | Shock | FAERS: 7 | US FAERS | |
| 216 | Tooth Infection | FAERS: 7 | US FAERS | |
| 217 | Transplant | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 218 | Urinary Retention | FAERS: 7 | US FAERS | |
| 219 | Acne | FAERS: 6 | US FAERS | |
| 220 | Altered state of consciousness | FAERS: 6 | US FAERS | |
| 221 | Ammonia increased | FAERS: 6 | US FAERS | |
| 222 | Aphasia | FAERS: 6 | US FAERS | |
| 223 | Arthropod bite | FAERS: 6 | US FAERS | |
| 224 | Back disorder | FAERS: 6 | US FAERS | |
| 225 | Blood urea increased | FAERS: 6 | US FAERS | |
| 226 | Bronchospasm | FAERS: 6 | US FAERS | |
| 227 | Bursitis | FAERS: 6 | US FAERS | |
| 228 | Cardiac ablation | FAERS: 6 | US FAERS | |
| 229 | Cataract | FAERS: 6 | US FAERS | |
| 230 | Complication associated with device | FAERS: 6 | US FAERS | |
| 231 | Discomfort | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 232 | Ear congestion | FAERS: 6 | US FAERS | |
| 233 | Endarterectomy | FAERS: 6 | US FAERS | |
| 234 | Eye Infection | FAERS: 6 | US FAERS | |
| 235 | Facial paralysis | FAERS: 6 | US FAERS | |
| 236 | Flank Pain | FAERS: 6 | US FAERS | |
| 237 | Head discomfort | FAERS: 6 | US FAERS | |
| 238 | Ileus | FAERS: 6 | US FAERS | |
| 239 | Implantable defibrillator insertion | FAERS: 6 | US FAERS | |
| 240 | Laceration | FAERS: 6 | US FAERS | |
| 241 | Lymphadenopathy | FAERS: 6 | US FAERS | |
| 242 | Musculoskeletal discomfort | FAERS: 6 | US FAERS | |
| 243 | Oxygen saturation abnormal | FAERS: 6 | US FAERS | |
| 244 | Pallor | FAERS: 6 | US FAERS | |
| 245 | Pulmonary endarterectomy | FAERS: 6 | US FAERS | |
| 246 | Retching | FAERS: 6 | US FAERS | |
| 247 | Sarcoidosis | FAERS: 6 | US FAERS | |
| 248 | Sluggishness | FAERS: 6 | US FAERS | |
| 249 | Suture insertion | FAERS: 6 | US FAERS | |
| 250 | Transaminases increased | FAERS: 6 | US FAERS | |
| 251 | Troponin increased | FAERS: 6 | US FAERS | |
| 252 | Upper-airway cough syndrome | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 253 | Wound Infection | FAERS: 6 | US FAERS | |
| 254 | cancer surgery | FAERS: 6 | US FAERS | |
| 255 | Alopecia | FAERS: 5 | US FAERS | |
| 256 | Anuria | FAERS: 5 | US FAERS | |
| 257 | Bedridden | FAERS: 5 | US FAERS | |
| 258 | Blood glucose abnormal | FAERS: 5 | US FAERS | |
| 259 | Cardiac assistance device user | FAERS: 5 | US FAERS | |
| 260 | Cardiomegaly | FAERS: 5 | US FAERS | |
| 261 | Critical Illness | FAERS: 5 | US FAERS | |
| 262 | Device malfunction | FAERS: 5 | US FAERS | |
| 263 | Disorientation | FAERS: 5 | US FAERS | |
| 264 | Dysgeusia | FAERS: 5 | US FAERS | |
| 265 | Eating disorder symptom | FAERS: 5 | US FAERS | |
| 266 | Ejection Fraction Decreased | FAERS: 5 | US FAERS | |
| 267 | Elbow operation | FAERS: 5 | US FAERS | |
| 268 | Gangrene | FAERS: 5 | US FAERS | |
| 269 | Gastric Bypass | FAERS: 5 | US FAERS | |
| 270 | Hemiparesis | FAERS: 5 | US FAERS | |
| 271 | Hepatomegaly | FAERS: 5 | US FAERS | |
| 272 | Hypersomnia | FAERS: 5 | US FAERS | |
| 273 | Idiopathic Pulmonary Fibrosis | FAERS: 5 | US FAERS | |
| 274 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 275 | Intestinal Perforation | FAERS: 5 | US FAERS | |
| 276 | Laryngitis | FAERS: 5 | US FAERS | |
| 277 | Musculoskeletal stiffness | FAERS: 5 | US FAERS | |
| 278 | Ocular icterus | FAERS: 5 | US FAERS | |
| 279 | Oxygen supplementation | FAERS: 5 | US FAERS | |
| 280 | Post procedural complication | FAERS: 5 | US FAERS | |
| 281 | Post procedural infection | FAERS: 5 | US FAERS | |
| 282 | Sinus Tachycardia | FAERS: 5 | US FAERS | |
| 283 | Skin neoplasm excision | FAERS: 5 | US FAERS | |
| 284 | Staphylococcus test positive | FAERS: 5 | US FAERS | |
| 285 | Supraventricular tachycardia | FAERS: 5 | US FAERS | |
| 286 | Ulcer | FAERS: 5 | US FAERS | |
| 287 | Urinary Incontinence | FAERS: 5 | US FAERS | |
| 288 | Wheelchair user | FAERS: 5 | US FAERS | |
| 289 | Abdominal cavity drainage | FAERS: 4 | US FAERS | |
| 290 | Abscess | FAERS: 4 | US FAERS | |
| 291 | Accidental exposure to product by child | FAERS: 4 | US FAERS | |
| 292 | Acute myocardial infarction | FAERS: 4 | US FAERS | |
| 293 | Atelectasis | FAERS: 4 | US FAERS | |
| 294 | Atypical pneumonia | FAERS: 4 | US FAERS | |
| 295 | Biliary Colic | FAERS: 4 | US FAERS | |
| 296 | Biopsy | FAERS: 4 | US FAERS | |
| 297 | Blood albumin decreased | FAERS: 4 | US FAERS | |
| 298 | Blood bilirubin abnormal | FAERS: 4 | US FAERS | |
| 299 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 300 | Bowel movement irregularity | FAERS: 4 | US FAERS | |
| 301 | Cataract operation | FAERS: 4 | US FAERS | |
| 302 | Catheter placement | FAERS: 4 | US FAERS | |
| 303 | Catheter site erythema | FAERS: 4 | US FAERS | |
| 304 | Catheter site pain | FAERS: 4 | US FAERS | |
| 305 | Drug administration error | FAERS: 4 | US FAERS | |
| 306 | Drug withdrawal syndrome | FAERS: 4 | US FAERS | |
| 307 | Ear discomfort | FAERS: 4 | US FAERS | |
| 308 | Electrolyte imbalance | FAERS: 4 | US FAERS | |
| 309 | Embolism | FAERS: 4 | US FAERS | |
| 310 | Emergency Care | FAERS: 4 | US FAERS | |
| 311 | Escherichia infection | FAERS: 4 | US FAERS | |
| 312 | Euthanasia | FAERS: 4 | US FAERS | |
| 313 | Food Poisoning | FAERS: 4 | US FAERS | |
| 314 | Gastric ulcer | FAERS: 4 | US FAERS | |
| 315 | Hepatic congestion | FAERS: 4 | US FAERS | |
| 316 | Hypothyroidism | FAERS: 4 | US FAERS | |
| 317 | Incoherent | FAERS: 4 | US FAERS | |
| 318 | Increased tendency to bruise | FAERS: 4 | US FAERS | |
| 319 | Infusion site infection | FAERS: 4 | US FAERS | |
| 320 | Iron deficiency | FAERS: 4 | US FAERS | |
| 321 | Liver Abscess | FAERS: 4 | US FAERS | |
| 322 | Macular degeneration | FAERS: 4 | US FAERS | |
| 323 | Nail Infection | FAERS: 4 | US FAERS | |
| 324 | Neutropenia | FAERS: 4 | US FAERS | |
| 325 | Night sweats | FAERS: 4 | US FAERS | |
| 326 | Onychomycosis | FAERS: 4 | US FAERS | |
| 327 | Palliative Care | FAERS: 4 | US FAERS | |
| 328 | Polyuria | FAERS: 4 | US FAERS | |
| 329 | Product prescribing error | FAERS: 4 | US FAERS | |
| 330 | Psoriasis | FAERS: 4 | US FAERS | |
| 331 | Psychiatric symptom | FAERS: 4 | US FAERS | |
| 332 | Renal pain | FAERS: 4 | US FAERS | |
| 333 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 334 | Right Ventricular Dysfunction | FAERS: 4 | US FAERS | |
| 335 | Sensitivity to weather change | FAERS: 4 | US FAERS | |
| 336 | Sinus headache | FAERS: 4 | US FAERS | |
| 337 | Stomatitis | FAERS: 4 | US FAERS | |
| 338 | Uterine Cancer | FAERS: 4 | US FAERS | |
| 339 | Ventilation perfusion mismatch | FAERS: 4 | US FAERS | |
| 340 | Vulvovaginal discomfort | FAERS: 4 | US FAERS | |
| 341 | Vulvovaginal pruritus | FAERS: 4 | US FAERS | |
| 342 | Walking distance test abnormal | FAERS: 4 | US FAERS | |
| 343 | colonoscopy | FAERS: 4 | US FAERS | |
| 344 | jaundice | FAERS: 4 | US FAERS | |
| 345 | Abnormal weight gain | FAERS: 3 | US FAERS | |
| 346 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 347 | Ammonia abnormal | FAERS: 3 | US FAERS | |
| 348 | Aneurysm | FAERS: 3 | US FAERS | |
| 349 | Angioplasty | FAERS: 3 | US FAERS | |
| 350 | Apathy | FAERS: 3 | US FAERS | |
| 351 | Appendicitis | FAERS: 3 | US FAERS | |
| 352 | Atrial tachycardia | FAERS: 3 | US FAERS | |
| 353 | Blood cholesterol abnormal | FAERS: 3 | US FAERS | |
| 354 | Brain natriuretic peptide increased | FAERS: 3 | US FAERS | |
| 355 | Bronchoscopy | FAERS: 3 | US FAERS | |
| 356 | CREST Syndrome | FAERS: 3 | US FAERS | |
| 357 | Cardiac procedure complication | FAERS: 3 | US FAERS | |
| 358 | Carotid artery occlusion | FAERS: 3 | US FAERS | |
| 359 | Cerebral Infarction | FAERS: 3 | US FAERS | |
| 360 | Chronic respiratory failure | FAERS: 3 | US FAERS | |
| 361 | Clubbing | FAERS: 3 | US FAERS | |
| 362 | Colectomy | FAERS: 3 | US FAERS | |
| 363 | Culture urine positive | FAERS: 3 | US FAERS | |
| 364 | Dental caries | FAERS: 3 | US FAERS | |
| 365 | Dialysis related complication | FAERS: 3 | US FAERS | |
| 366 | Dyslexia | FAERS: 3 | US FAERS | |
| 367 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 368 | Enterocolitis | FAERS: 3 | US FAERS | |
| 369 | Failure to Thrive | FAERS: 3 | US FAERS | |
| 370 | Fibromyalgia | FAERS: 3 | US FAERS | |
| 371 | Fibrosis | FAERS: 3 | US FAERS | |
| 372 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 373 | General physical condition abnormal | FAERS: 3 | US FAERS | |
| 374 | Hepatorenal Syndrome | FAERS: 3 | US FAERS | |
| 375 | High frequency ablation | FAERS: 3 | US FAERS | |
| 376 | Impaired gastric emptying | FAERS: 3 | US FAERS | |
| 377 | Intentional dose omission | FAERS: 3 | US FAERS | |
| 378 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 379 | Intestinal resection | FAERS: 3 | US FAERS | |
| 380 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 381 | Lip swelling | FAERS: 3 | US FAERS | |
| 382 | Malnutrition | FAERS: 3 | US FAERS | |
| 383 | Metapneumovirus infection | FAERS: 3 | US FAERS | |
| 384 | Multimorbidity | FAERS: 3 | US FAERS | |
| 385 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 386 | Overdose | FAERS: 3 | US FAERS | |
| 387 | Oxygen Consumption | FAERS: 3 | US FAERS | |
| 388 | Paracentesis | FAERS: 3 | US FAERS | |
| 389 | Paranasal sinus hypersecretion | FAERS: 3 | US FAERS | |
| 390 | Photophobia | FAERS: 3 | US FAERS | |
| 391 | Pleurisy | FAERS: 3 | US FAERS | |
| 392 | Pregnancy | FAERS: 3 | US FAERS | |
| 393 | Procedural complication | FAERS: 3 | US FAERS | |
| 394 | Product use issue | FAERS: 3 | US FAERS | |
| 395 | Respiratory tract irritation | FAERS: 3 | US FAERS | |
| 396 | Restless Legs Syndrome | FAERS: 3 | US FAERS | |
| 397 | Sense of oppression | FAERS: 3 | US FAERS | |
| 398 | Stem cell transplant | FAERS: 3 | US FAERS | |
| 399 | Steroid therapy | FAERS: 3 | US FAERS | |
| 400 | Therapeutic product ineffective | FAERS: 3 | US FAERS | |
| 401 | Thirst | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 402 | Thoracostomy | FAERS: 3 | US FAERS | |
| 403 | Toothache | FAERS: 3 | US FAERS | |
| 404 | Vascular occlusion | FAERS: 3 | US FAERS | |
| 405 | Venous occlusion | FAERS: 3 | US FAERS | |
| 406 | Viral upper respiratory tract infection | FAERS: 3 | US FAERS | |
| 407 | Abdominal Infection | FAERS: 2 | US FAERS | |
| 408 | Abdominal adhesions | FAERS: 2 | US FAERS | |
| 409 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 410 | Abulia | FAERS: 2 | US FAERS | |
| 411 | Acidosis | FAERS: 2 | US FAERS | |
| 412 | Acute Coronary Syndrome | FAERS: 2 | US FAERS | |
| 413 | Adjustment disorder with depressed mood | FAERS: 2 | US FAERS | |
| 414 | Alcohol abuse | FAERS: 2 | US FAERS | |
| 415 | Allergic cough | FAERS: 2 | US FAERS | |
| 416 | Anger | FAERS: 2 | US FAERS | |
| 417 | Animal scratch | FAERS: 2 | US FAERS | |
| 418 | Ankle impingement | FAERS: 2 | US FAERS | |
| 419 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 420 | Arterial Injury | FAERS: 2 | US FAERS | |
| 421 | Arterial therapeutic procedure | FAERS: 2 | US FAERS | |
| 422 | Arteriovenous fistula site infection | FAERS: 2 | US FAERS | |
| 423 | Arteriovenous fistula thrombosis | FAERS: 2 | US FAERS | |
| 424 | Atherectomy | FAERS: 2 | US FAERS | |
| 425 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 426 | Bilirubin conjugated increased | FAERS: 2 | US FAERS | |
| 427 | Bipolar Disorder | FAERS: 2 | US FAERS | |
| 428 | Bladder Neoplasm | FAERS: 2 | US FAERS | |
| 429 | Blood gases abnormal | FAERS: 2 | US FAERS | |
| 430 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 431 | Bone density decreased | FAERS: 2 | US FAERS | |
| 432 | Brain Abscess | FAERS: 2 | US FAERS | |
| 433 | Brain natriuretic peptide abnormal | FAERS: 2 | US FAERS | |
| 434 | Bronchial secretion retention | FAERS: 2 | US FAERS | |
| 435 | Calcinosis | FAERS: 2 | US FAERS | |
| 436 | Carbon dioxide increased | FAERS: 2 | US FAERS | |
| 437 | Cardiac Tamponade | FAERS: 2 | US FAERS | |
| 438 | Cardiac discomfort | FAERS: 2 | US FAERS | |
| 439 | Cardiac dysfunction | FAERS: 2 | US FAERS | |
| 440 | Cardiac infection | FAERS: 2 | US FAERS | |
| 441 | Cardiac ventricular disorder | FAERS: 2 | US FAERS | |
| 442 | Cardioactive drug level increased | FAERS: 2 | US FAERS | |
| 443 | Cardiovascular insufficiency | FAERS: 2 | US FAERS | |
| 444 | Catheter management | FAERS: 2 | US FAERS | |
| 445 | Catheter site infection | FAERS: 2 | US FAERS | |
| 446 | Catheter site pruritus | FAERS: 2 | US FAERS | |
| 447 | Catheter site swelling | FAERS: 2 | US FAERS | |
| 448 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 449 | Cholecystitis infective | FAERS: 2 | US FAERS | |
| 450 | Cholelithotomy | FAERS: 2 | US FAERS | |
| 451 | Cholestasis | FAERS: 2 | US FAERS | |
| 452 | Chronic disease | FAERS: 2 | US FAERS | |
| 453 | Completed Suicide | FAERS: 2 | US FAERS | |
| 454 | Compression fracture | FAERS: 2 | US FAERS | |
| 455 | Continuous Positive Airway Pressure | FAERS: 2 | US FAERS | |
| 456 | Dengue Fever | FAERS: 2 | US FAERS | |
| 457 | Dependence on oxygen therapy | FAERS: 2 | US FAERS | |
| 458 | Device damage | FAERS: 2 | US FAERS | |
| 459 | Disease recurrence | FAERS: 2 | US FAERS | |
| 460 | Diverticulum | FAERS: 2 | US FAERS | |
| 461 | Ecchymosis | FAERS: 2 | US FAERS | |
| 462 | Eczema | FAERS: 2 | US FAERS | |
| 463 | Electrocardiogram ST-T segment abnormal | FAERS: 2 | US FAERS | |
| 464 | Epilepsy | FAERS: 2 | US FAERS | |
| 465 | Eructation | FAERS: 2 | US FAERS | |
| 466 | Escherichia urinary tract infection | FAERS: 2 | US FAERS | |
| 467 | Facial Pain | FAERS: 2 | US FAERS | |
| 468 | Feeling jittery | FAERS: 2 | US FAERS | |
| 469 | Fluid imbalance | FAERS: 2 | US FAERS | |
| 470 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 471 | Fracture infection | FAERS: 2 | US FAERS | |
| 472 | Fracture treatment | FAERS: 2 | US FAERS | |
| 473 | Fracture | FAERS: 2 | US FAERS | |
| 474 | Gallbladder pain | FAERS: 2 | US FAERS | |
| 475 | Gastric Lavage | FAERS: 2 | US FAERS | |
| 476 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 477 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 478 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 479 | Gingivitis | FAERS: 2 | US FAERS | |
| 480 | Hemiplegia | FAERS: 2 | US FAERS | |
| 481 | Hepatitis C | FAERS: 2 | US FAERS | |
| 482 | Hypertrophic osteoarthropathy | FAERS: 2 | US FAERS | |
| 483 | Hyperventilation | FAERS: 2 | US FAERS | |
| 484 | Hypogeusia | FAERS: 2 | US FAERS | |
| 485 | Hypophagia | FAERS: 2 | US FAERS | |
| 486 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 487 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 488 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 489 | Incarcerated hernia | FAERS: 2 | US FAERS | |
| 490 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 491 | Insurance issue | FAERS: 2 | US FAERS | |
| 492 | Intervertebral disc disorder | FAERS: 2 | US FAERS | |
| 493 | Intra-abdominal fluid collection | FAERS: 2 | US FAERS | |
| 494 | Intracardiac pressure increased | FAERS: 2 | US FAERS | |
| 495 | Joint Range of Motion Decreased | FAERS: 2 | US FAERS | |
| 496 | Klebsiella test positive | FAERS: 2 | US FAERS | |
| 497 | Lipids | FAERS: 2 | US FAERS | |
| 498 | Lyme Disease | FAERS: 2 | US FAERS | |
| 499 | Mastitis | FAERS: 2 | US FAERS | |
| 500 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 501 | Medical procedure | FAERS: 2 | US FAERS | |
| 502 | Medication Error | FAERS: 2 | US FAERS | |
| 503 | Metastatic Neoplasm | FAERS: 2 | US FAERS | |
| 504 | Micrographic skin surgery | FAERS: 2 | US FAERS | |
| 505 | Migraine with Aura | FAERS: 2 | US FAERS | |
| 506 | Monoplegia | FAERS: 2 | US FAERS | |
| 507 | Mood swings | FAERS: 2 | US FAERS | |
| 508 | Mouth swelling | FAERS: 2 | US FAERS | |
| 509 | Muscle strain | FAERS: 2 | US FAERS | |
| 510 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 511 | Nephrectomy | FAERS: 2 | US FAERS | |
| 512 | Nuchal Rigidity | FAERS: 2 | US FAERS | |
| 513 | Obesity | FAERS: 2 | US FAERS | |
| 514 | Onychoclasis | FAERS: 2 | US FAERS | |
| 515 | Open reduction of fracture | FAERS: 2 | US FAERS | |
| 516 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 517 | Otitis Media | FAERS: 2 | US FAERS | |
| 518 | PCO2 increased | FAERS: 2 | US FAERS | |
| 519 | Pain of skin | FAERS: 2 | US FAERS | |
| 520 | Pancreatic Cyst | FAERS: 2 | US FAERS | |
| 521 | Pancreatic operation | FAERS: 2 | US FAERS | |
| 522 | Pathological fracture | FAERS: 2 | US FAERS | |
| 523 | Peripheral venous disease | FAERS: 2 | US FAERS | |
| 524 | Perirectal abscess | FAERS: 2 | US FAERS | |
| 525 | Peritonitis | FAERS: 2 | US FAERS | |
| 526 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 527 | Portal hypertensive gastropathy | FAERS: 2 | US FAERS | |
| 528 | Procedural hypotension | FAERS: 2 | US FAERS | |
| 529 | Product administration error | FAERS: 2 | US FAERS | |
| 530 | Product availability issue | FAERS: 2 | US FAERS | |
| 531 | Purpura | FAERS: 2 | US FAERS | |
| 532 | Radiation pericarditis | FAERS: 2 | US FAERS | |
| 533 | Reflux gastritis | FAERS: 2 | US FAERS | |
| 534 | Regurgitation | FAERS: 2 | US FAERS | |
| 535 | Restlessness | FAERS: 2 | US FAERS | |
| 536 | Rhinalgia | FAERS: 2 | US FAERS | |
| 537 | Rhinovirus infection | FAERS: 2 | US FAERS | |
| 538 | Right ventricular systolic pressure increased | FAERS: 2 | US FAERS | |
| 539 | Rotator cuff syndrome | FAERS: 2 | US FAERS | |
| 540 | Scab | FAERS: 2 | US FAERS | |
| 541 | Sciatica | FAERS: 2 | US FAERS | |
| 542 | Skin irritation | FAERS: 2 | US FAERS | |
| 543 | Skin lesion | FAERS: 2 | US FAERS | |
| 544 | Skin tightness | FAERS: 2 | US FAERS | |
| 545 | Squamous cell carcinoma of skin | FAERS: 2 | US FAERS | |
| 546 | Stasis dermatitis | FAERS: 2 | US FAERS | |
| 547 | Subileus | FAERS: 2 | US FAERS | |
| 548 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 549 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 550 | Therapeutic procedure | FAERS: 2 | US FAERS | |
| 551 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 552 | Thrombectomy | FAERS: 2 | US FAERS | |
| 553 | Thrombosis in device | FAERS: 2 | US FAERS | |
| 554 | Tympanic Membrane Perforation | FAERS: 2 | US FAERS | |
| 555 | Urinary tract infection pseudomonal | FAERS: 2 | US FAERS | |
| 556 | Urinary tract obstruction | FAERS: 2 | US FAERS | |
| 557 | Vaginal Discharge | FAERS: 2 | US FAERS | |
| 558 | Vasculitis | FAERS: 2 | US FAERS | |
| 559 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 560 | Vulvovaginal pain | FAERS: 2 | US FAERS | |
| 561 | Weaning failure | FAERS: 2 | US FAERS | |
| 562 | Wound closure | FAERS: 2 | US FAERS | |
| 563 | diagnostic procedure | FAERS: 2 | US FAERS | |
| 564 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 565 | ovarian neoplasm | FAERS: 2 | US FAERS | |
| 566 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 567 | Abdominal sepsis | FAERS: 1 | US FAERS | |
| 568 | Abscess soft tissue | FAERS: 1 | US FAERS | |
| 569 | Accidental death | FAERS: 1 | US FAERS | |
| 570 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 571 | Acute Chest Syndrome | FAERS: 1 | US FAERS | |
| 572 | Acute left ventricular failure | FAERS: 1 | US FAERS | |
| 573 | Acute right ventricular failure | FAERS: 1 | US FAERS | |
| 574 | Acute sinusitis | FAERS: 1 | US FAERS | |
| 575 | Ageusia | FAERS: 1 | US FAERS | |
| 576 | Alanine aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 577 | Alcohol problem | FAERS: 1 | US FAERS | |
| 578 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 579 | Amputation | FAERS: 1 | US FAERS | |
| 580 | Anal Fissure | FAERS: 1 | US FAERS | |
| 581 | Angioedema | FAERS: 1 | US FAERS | |
| 582 | Animal bite | FAERS: 1 | US FAERS | |
| 583 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 1 | US FAERS | |
| 584 | Antiphospholipid Syndrome | FAERS: 1 | US FAERS | |
| 585 | Aortic surgery | FAERS: 1 | US FAERS | |
| 586 | Application site rash | FAERS: 1 | US FAERS | |
| 587 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 588 | Arteriovenous fistula aneurysm | FAERS: 1 | US FAERS | |
| 589 | Arteriovenous graft | FAERS: 1 | US FAERS | |
| 590 | Arthropod sting | FAERS: 1 | US FAERS | |
| 591 | Aspartate aminotransferase abnormal | FAERS: 1 | US FAERS | |
| 592 | Asthenopia | FAERS: 1 | US FAERS | |
| 593 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 594 | Atrioventricular Block | FAERS: 1 | US FAERS | |
| 595 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 596 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 597 | Benign Neoplasm | FAERS: 1 | US FAERS | |
| 598 | Bile Duct Stenosis | FAERS: 1 | US FAERS | |
| 599 | Biliary dilatation | FAERS: 1 | US FAERS | |
| 600 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 601 | Blood creatine decreased | FAERS: 1 | US FAERS | |
| 602 | Blood culture negative | FAERS: 1 | US FAERS | |
| 603 | Blood gastrin increased | FAERS: 1 | US FAERS | |
| 604 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 605 | Blood magnesium abnormal | FAERS: 1 | US FAERS | |
| 606 | Blood phosphorus increased | FAERS: 1 | US FAERS | |
| 607 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 608 | Bone density abnormal | FAERS: 1 | US FAERS | |
| 609 | Breast cancer recurrent | FAERS: 1 | US FAERS | |
| 610 | Breast discomfort | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 611 | Breast tenderness | FAERS: 1 | US FAERS | |
| 612 | Bronchopulmonary Aspergillosis | FAERS: 1 | US FAERS | |
| 613 | Bunion operation | FAERS: 1 | US FAERS | |
| 614 | Calcium deficiency | FAERS: 1 | US FAERS | |
| 615 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 616 | Carbon dioxide abnormal | FAERS: 1 | US FAERS | |
| 617 | Cardiac asthma | FAERS: 1 | US FAERS | |
| 618 | Cardiac valve rupture | FAERS: 1 | US FAERS | |
| 619 | Cardio-respiratory distress | FAERS: 1 | US FAERS | |
| 620 | Cardiovascular evaluation | FAERS: 1 | US FAERS | |
| 621 | Carotid Endarterectomy | FAERS: 1 | US FAERS | |
| 622 | Catheter site cellulitis | FAERS: 1 | US FAERS | |
| 623 | Catheter site discharge | FAERS: 1 | US FAERS | |
| 624 | Catheter site induration | FAERS: 1 | US FAERS | |
| 625 | Catheter site inflammation | FAERS: 1 | US FAERS | |
| 626 | Catheter site nodule | FAERS: 1 | US FAERS | |
| 627 | Catheter site related reaction | FAERS: 1 | US FAERS | |
| 628 | Catheter site vesicles | FAERS: 1 | US FAERS | |
| 629 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 630 | Central nervous system mass | FAERS: 1 | US FAERS | |
| 631 | Cerebellar Ataxia | FAERS: 1 | US FAERS | |
| 632 | Cerebral cyst | FAERS: 1 | US FAERS | |
| 633 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 634 | Cholangitis | FAERS: 1 | US FAERS | |
| 635 | Choledocholithotomy | FAERS: 1 | US FAERS | |
| 636 | Chromatopsia | FAERS: 1 | US FAERS | |
| 637 | Cranial operation | FAERS: 1 | US FAERS | |
| 638 | Craniotomy | FAERS: 1 | US FAERS | |
| 639 | Crying | FAERS: 1 | US FAERS | |
| 640 | Cyst removal | FAERS: 1 | US FAERS | |
| 641 | Cystopexy | FAERS: 1 | US FAERS | |
| 642 | Cyst | FAERS: 1 | US FAERS | |
| 643 | Debridement | FAERS: 1 | US FAERS | |
| 644 | Dehiscence | FAERS: 1 | US FAERS | |
| 645 | Dental Restoration Failure | FAERS: 1 | US FAERS | |
| 646 | Dental discomfort | FAERS: 1 | US FAERS | |
| 647 | Dental disorder prophylaxis | FAERS: 1 | US FAERS | |
| 648 | Device dislocation | FAERS: 1 | US FAERS | |
| 649 | Device kink | FAERS: 1 | US FAERS | |
| 650 | Device occlusion | FAERS: 1 | US FAERS | |
| 651 | Device related sepsis | FAERS: 1 | US FAERS | |
| 652 | Diabetic Foot | FAERS: 1 | US FAERS | |
| 653 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 654 | Diabetic gastropathy | FAERS: 1 | US FAERS | |
| 655 | Diabetic ulcer | FAERS: 1 | US FAERS | |
| 656 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 657 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 658 | Diplopia | FAERS: 1 | US FAERS | |
| 659 | Disability | FAERS: 1 | US FAERS | |
| 660 | Disseminated Intravascular Coagulation | FAERS: 1 | US FAERS | |
| 661 | Disturbance in sexual arousal | FAERS: 1 | US FAERS | |
| 662 | Diuretic therapy | FAERS: 1 | US FAERS | |
| 663 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 664 | Drowning | FAERS: 1 | US FAERS | |
| 665 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 666 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 667 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 668 | Dysgraphia | FAERS: 1 | US FAERS | |
| 669 | Dysphemia | FAERS: 1 | US FAERS | |
| 670 | Dystonia | FAERS: 1 | US FAERS | |
| 671 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 672 | Electrolyte depletion | FAERS: 1 | US FAERS | |
| 673 | Elephantiasis | FAERS: 1 | US FAERS | |
| 674 | Embolic stroke | FAERS: 1 | US FAERS | |
| 675 | Emotional disorder | FAERS: 1 | US FAERS | |
| 676 | Emotional distress | FAERS: 1 | US FAERS | |
| 677 | Endocarditis | FAERS: 1 | US FAERS | |
| 678 | Endovenous ablation | FAERS: 1 | US FAERS | |
| 679 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 680 | Eosinophilia | FAERS: 1 | US FAERS | |
| 681 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 682 | Epiglottitis | FAERS: 1 | US FAERS | |
| 683 | Eye operation complication | FAERS: 1 | US FAERS | |
| 684 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 685 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 686 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 687 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 688 | Gastrectomy | FAERS: 1 | US FAERS | |
| 689 | Gastric Antral Vascular Ectasia | FAERS: 1 | US FAERS | |
| 690 | Gastric fluid analysis abnormal | FAERS: 1 | US FAERS | |
| 691 | Gastrointestinal angiectasia | FAERS: 1 | US FAERS | |
| 692 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 693 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 694 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 695 | Gastrointestinal perforation | FAERS: 1 | US FAERS | |
| 696 | Gastrointestinal stoma complication | FAERS: 1 | US FAERS | |
| 697 | Gastrointestinal ulcer perforation | FAERS: 1 | US FAERS | |
| 698 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 699 | Gastroplasty | FAERS: 1 | US FAERS | |
| 700 | Gastrostomy | FAERS: 1 | US FAERS | |
| 701 | Genital rash | FAERS: 1 | US FAERS | |
| 702 | Glaucoma | FAERS: 1 | US FAERS | |
| 703 | Glioblastoma | FAERS: 1 | US FAERS | |
| 704 | Head titubation | FAERS: 1 | US FAERS | |
| 705 | Hearing aid user | FAERS: 1 | US FAERS | |
| 706 | Hepatic Infection | FAERS: 1 | US FAERS | |
| 707 | Hordeolum | FAERS: 1 | US FAERS | |
| 708 | Human metapneumovirus test | FAERS: 1 | US FAERS | |
| 709 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 710 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 711 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 712 | Hypokinesia | FAERS: 1 | US FAERS | |
| 713 | Impaired work ability | FAERS: 1 | US FAERS | |
| 714 | Implantable defibrillator replacement | FAERS: 1 | US FAERS | |
| 715 | Incision site pain | FAERS: 1 | US FAERS | |
| 716 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 717 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 718 | Increased bronchial secretion | FAERS: 1 | US FAERS | |
| 719 | Infection prophylaxis | FAERS: 1 | US FAERS | |
| 720 | Infective exacerbation of bronchiectasis | FAERS: 1 | US FAERS | |
| 721 | Infective exacerbation of chronic obstructive airways disease | FAERS: 1 | US FAERS | |
| 722 | Infusion site abscess | FAERS: 1 | US FAERS | |
| 723 | Infusion site cellulitis | FAERS: 1 | US FAERS | |
| 724 | Infusion site discomfort | FAERS: 1 | US FAERS | |
| 725 | Infusion site pustule | FAERS: 1 | US FAERS | |
| 726 | Injection site abscess | FAERS: 1 | US FAERS | |
| 727 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 728 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 729 | Interventional procedure | FAERS: 1 | US FAERS | |
| 730 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 731 | Intervertebral disc compression | FAERS: 1 | US FAERS | |
| 732 | Intestinal polypectomy | FAERS: 1 | US FAERS | |
| 733 | Intra-cerebral aneurysm operation | FAERS: 1 | US FAERS | |
| 734 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 735 | Joint stiffness | FAERS: 1 | US FAERS | |
| 736 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 737 | Large intestinal stenosis | FAERS: 1 | US FAERS | |
| 738 | Left ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 739 | Leukocytosis | FAERS: 1 | US FAERS | |
| 740 | Life expectancy shortened | FAERS: 1 | US FAERS | |
| 741 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 742 | Lipase increased | FAERS: 1 | US FAERS | |
| 743 | Liver function test decreased | FAERS: 1 | US FAERS | |
| 744 | Lividity | FAERS: 1 | US FAERS | |
| 745 | Living in residential institution | FAERS: 1 | US FAERS | |
| 746 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 747 | Loop electrosurgical excision procedure | FAERS: 1 | US FAERS | |
| 748 | Low Cardiac Output Syndrome | FAERS: 1 | US FAERS | |
| 749 | Lower respiratory tract infection fungal | FAERS: 1 | US FAERS | |
| 750 | Lung consolidation | FAERS: 1 | US FAERS | |
| 751 | Lung transplant rejection | FAERS: 1 | US FAERS | |
| 752 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 753 | Lupus encephalitis | FAERS: 1 | US FAERS | |
| 754 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 755 | Magnesium Deficiency | FAERS: 1 | US FAERS | |
| 756 | Mass excision | FAERS: 1 | US FAERS | |
| 757 | Medical device site abscess | FAERS: 1 | US FAERS | |
| 758 | Meningitis | FAERS: 1 | US FAERS | |
| 759 | Mental impairment | FAERS: 1 | US FAERS | |
| 760 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 761 | Middle insomnia | FAERS: 1 | US FAERS | |
| 762 | Mineral supplementation | FAERS: 1 | US FAERS | |
| 763 | Mixed Connective Tissue Disease | FAERS: 1 | US FAERS | |
| 764 | Mole excision | FAERS: 1 | US FAERS | |
| 765 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 766 | Muscle tightness | FAERS: 1 | US FAERS | |
| 767 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 768 | Mycobacterium tuberculosis complex test positive | FAERS: 1 | US FAERS | |
| 769 | Myocardial necrosis marker normal | FAERS: 1 | US FAERS | |
| 770 | Myocarditis | FAERS: 1 | US FAERS | |
| 771 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 772 | Myoclonus | FAERS: 1 | US FAERS | |
| 773 | Myofascial spasm | FAERS: 1 | US FAERS | |
| 774 | Myositis | FAERS: 1 | US FAERS | |
| 775 | N-terminal prohormone brain natriuretic peptide abnormal | FAERS: 1 | US FAERS | |
| 776 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 777 | Necrosis | FAERS: 1 | US FAERS | |
| 778 | Nerve Block | FAERS: 1 | US FAERS | |
| 779 | Nerve injury | FAERS: 1 | US FAERS | |
| 780 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 781 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 782 | Norovirus test positive | FAERS: 1 | US FAERS | |
| 783 | Occult blood positive | FAERS: 1 | US FAERS | |
| 784 | Ocular sarcoidosis | FAERS: 1 | US FAERS | |
| 785 | Oliguria | FAERS: 1 | US FAERS | |
| 786 | Oral discharge | FAERS: 1 | US FAERS | |
| 787 | Oral pain | FAERS: 1 | US FAERS | |
| 788 | Oral pruritus | FAERS: 1 | US FAERS | |
| 789 | Oropharyngeal surgery | FAERS: 1 | US FAERS | |
| 790 | Osteochondrosis | FAERS: 1 | US FAERS | |
| 791 | Pancreaticoduodenectomy | FAERS: 1 | US FAERS | |
| 792 | Parathyroidectomy | FAERS: 1 | US FAERS | |
| 793 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 794 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 795 | Pemphigus | FAERS: 1 | US FAERS | |
| 796 | Percutaneous Coronary Intervention | FAERS: 1 | US FAERS | |
| 797 | Pericarditis | FAERS: 1 | US FAERS | |
| 798 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 799 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 800 | Peripheral artery angioplasty | FAERS: 1 | US FAERS | |
| 801 | Peripheral artery bypass | FAERS: 1 | US FAERS | |
| 802 | Peripheral nerve palsy | FAERS: 1 | US FAERS | |
| 803 | Peritoneal Dialysis | FAERS: 1 | US FAERS | |
| 804 | Perivascular dermatitis | FAERS: 1 | US FAERS | |
| 805 | Personality Change | FAERS: 1 | US FAERS | |
| 806 | Petechiae | FAERS: 1 | US FAERS | |
| 807 | Phimosis | FAERS: 1 | US FAERS | |
| 808 | Physical Examination | FAERS: 1 | US FAERS | |
| 809 | Platelet Transfusion | FAERS: 1 | US FAERS | |
| 810 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 811 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 812 | Pneumococcal sepsis | FAERS: 1 | US FAERS | |
| 813 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 814 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 815 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 816 | Post procedural discharge | FAERS: 1 | US FAERS | |
| 817 | Postoperative respiratory failure | FAERS: 1 | US FAERS | |
| 818 | Postoperative thrombosis | FAERS: 1 | US FAERS | |
| 819 | Potentiating drug interaction | FAERS: 1 | US FAERS | |
| 820 | Pre-existing condition improved | FAERS: 1 | US FAERS | |
| 821 | Precancerous skin lesion | FAERS: 1 | US FAERS | |
| 822 | Procedural pneumothorax | FAERS: 1 | US FAERS | |
| 823 | Product container seal issue | FAERS: 1 | US FAERS | |
| 824 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 825 | Product use in unapproved indication | FAERS: 1 | US FAERS | |
| 826 | Prosthesis Implantation | FAERS: 1 | US FAERS | |
| 827 | Proteinuria | FAERS: 1 | US FAERS | |
| 828 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 829 | Prurigo | FAERS: 1 | US FAERS | |
| 830 | Pulmonary artery therapeutic procedure | FAERS: 1 | US FAERS | |
| 831 | Pulmonary artery thrombosis | FAERS: 1 | US FAERS | |
| 832 | Pulmonary function test decreased | FAERS: 1 | US FAERS | |
| 833 | Pulmonary hypertensive crisis | FAERS: 1 | US FAERS | |
| 834 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 835 | Purulence | FAERS: 1 | US FAERS | |
| 836 | Quadranopia | FAERS: 1 | US FAERS | |
| 837 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 838 | Radial nerve palsy | FAERS: 1 | US FAERS | |
| 839 | Radiation Pneumonitis | FAERS: 1 | US FAERS | |
| 840 | Radicular pain | FAERS: 1 | US FAERS | |
| 841 | Radiotherapy to thyroid | FAERS: 1 | US FAERS | |
| 842 | Rash erythematous | FAERS: 1 | US FAERS | |
| 843 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 844 | Rectal polyp | FAERS: 1 | US FAERS | |
| 845 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 846 | Renal artery stent placement | FAERS: 1 | US FAERS | |
| 847 | Renal mass | FAERS: 1 | US FAERS | |
| 848 | Respiratory tract infection bacterial | FAERS: 1 | US FAERS | |
| 849 | Respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 850 | Respiratory tract procedural complication | FAERS: 1 | US FAERS | |
| 851 | Restrictive pulmonary disease | FAERS: 1 | US FAERS | |
| 852 | Retinopexy | FAERS: 1 | US FAERS | |
| 853 | Rhinitis | FAERS: 1 | US FAERS | |
| 854 | Right atrial enlargement | FAERS: 1 | US FAERS | |
| 855 | Roux loop conversion | FAERS: 1 | US FAERS | |
| 856 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 857 | Sarcoma | FAERS: 1 | US FAERS | |
| 858 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 859 | Skin reaction | FAERS: 1 | US FAERS | |
| 860 | Sleep Talking | FAERS: 1 | US FAERS | |
| 861 | Snoring | FAERS: 1 | US FAERS | |
| 862 | Soft Tissue Infection | FAERS: 1 | US FAERS | |
| 863 | Soft tissue mass | FAERS: 1 | US FAERS | |
| 864 | Spinal fusion surgery | FAERS: 1 | US FAERS | |
| 865 | Splenectomy | FAERS: 1 | US FAERS | |
| 866 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 867 | Splenic vein thrombosis | FAERS: 1 | US FAERS | |
| 868 | Splenomegaly | FAERS: 1 | US FAERS | |
| 869 | Sputum retention | FAERS: 1 | US FAERS | |
| 870 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 871 | Strangulated hernia | FAERS: 1 | US FAERS | |
| 872 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 873 | Suicide attempt | FAERS: 1 | US FAERS | |
| 874 | Suicide threat | FAERS: 1 | US FAERS | |
| 875 | Sunburn | FAERS: 1 | US FAERS | |
| 876 | Synovial cyst removal | FAERS: 1 | US FAERS | |
| 877 | Systemic Scleroderma | FAERS: 1 | US FAERS | |
| 878 | Tension | FAERS: 1 | US FAERS | |
| 879 | Tetanus | FAERS: 1 | US FAERS | |
| 880 | Thalamic infarction | FAERS: 1 | US FAERS | |
| 881 | Thermal burn | FAERS: 1 | US FAERS | |
| 882 | Thyroid hormones decreased | FAERS: 1 | US FAERS | |
| 883 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 884 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 885 | Tissue injury | FAERS: 1 | US FAERS | |
| 886 | Toe operation | FAERS: 1 | US FAERS | |
| 887 | Tooth Erosion | FAERS: 1 | US FAERS | |
| 888 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 889 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 890 | Trismus | FAERS: 1 | US FAERS | |
| 891 | Tuberculosis | FAERS: 1 | US FAERS | |
| 892 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 893 | Unevaluable investigation | FAERS: 1 | US FAERS | |
| 894 | Unevaluable therapy | FAERS: 1 | US FAERS | |
| 895 | Urethritis | FAERS: 1 | US FAERS | |
| 896 | Varicose vein operation | FAERS: 1 | US FAERS | |
| 897 | Vascular device infection | FAERS: 1 | US FAERS | |
| 898 | Vascular device user | FAERS: 1 | US FAERS | |
| 899 | Vascular encephalopathy | FAERS: 1 | US FAERS | |
| 900 | Vascular insufficiency | FAERS: 1 | US FAERS | |
| 901 | Vascular pain | FAERS: 1 | US FAERS | |
| 902 | Vascular rupture | FAERS: 1 | US FAERS | |
| 903 | Vasoplegia syndrome | FAERS: 1 | US FAERS | |
| 904 | Vein collapse | FAERS: 1 | US FAERS | |
| 905 | Venoocclusive disease | FAERS: 1 | US FAERS | |
| 906 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 907 | Ventricular failure | FAERS: 1 | US FAERS | |
| 908 | Vertebroplasty | FAERS: 1 | US FAERS | |
| 909 | Visual brightness | FAERS: 1 | US FAERS | |
| 910 | Vital functions abnormal | FAERS: 1 | US FAERS | |
| 911 | Walking aid user | FAERS: 1 | US FAERS | |
| 912 | Wound Complication | FAERS: 1 | US FAERS | |
| 913 | Wound infection staphylococcal | FAERS: 1 | US FAERS | |
| 914 | Wrong dose | FAERS: 1 | US FAERS | |
| 915 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 916 | effusion | FAERS: 1 | US FAERS | |
| 917 | muscle injury | FAERS: 1 | US FAERS | |
| 918 | prostatitis | FAERS: 1 | US FAERS | |
| 919 | treatment failure | FAERS: 1 | US FAERS | |
| 920 | Blood and lymphatic system disorders | SIDER | ||
| 921 | Hepatotoxicity | SIDER | ||
| 922 | Infestation | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.