Modafinil
(YFGHCGITMMYXAQ-UHFFFAOYSA-N)
Structure
- SMILES
- NC(=O)CS(=O)C(c1ccccc1)c1ccccc1
- Type(s)
- Approved; Investigational
- ATC code(s)
- N06BA07
- Molecular Formula:
- C15H15NO2S
- Molecular Weight:
- 273.350
- Log P:
- 3.5760
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 1
- TPSA:
- 79.37
- CAS Number(s):
- 68693-11-8; 112111-47-4
Synonym(s)
1.
Modafinil
2.
2-((Diphenylmethyl)sulfinyl)acetamide
3.
2-((R)-(Diphenylmethyl)sulfinyl)acetamide
4.
Alertec
5.
Armodafinil
6.
Benzhydrylsulfinylacetamide
7.
CRL 40476
8.
CRL-40476
9.
Modiodal
10.
Nuvigil
11.
Provigil
12.
R-Modafinil
13.
Sparlon
14.
Vigil
15.
R Modafinil
External Link(s)
| MeSH | D000077408 |
| PubChem Compound | 4236 |
| BindingDB | 50156055 |
| ChEBI | 77585 |
| CHEMBL | CHEMBL1373 |
| DrugBank | DB00745 |
| DrugCentral | 1826 |
| IUPHAR/BPS Guide to PHARMACOLOGY | 7555 |
| KEGG | dr:D01832 |
| Therapeutic Target Database | D07HQC |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 213 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Fatigue | FAERS: 76 | 12791341 16520686 21064019 | CTD OFFSIDES SIDER US FAERS |
| 3 | Somnolence | FAERS: 74 | SIDER US FAERS | |
| 4 | Headache | FAERS: 70 Canada Vigilance: 2 | 16520686 18329221 | CTD SIDER Canada Vigilance US FAERS |
| 5 | Product substitution issue | FAERS: 64 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 6 | Anxiety | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 7 | Nausea | FAERS: 42 Canada Vigilance: 1 | 16520686 18381922 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 8 | Feeling abnormal | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 9 | Therapeutic response unexpected | FAERS: 33 | US FAERS | |
| 10 | Malaise | FAERS: 31 | SIDER US FAERS | |
| 11 | Suicide attempt | FAERS: 29 | SIDER US FAERS | |
| 12 | Asthenia | FAERS: 28 | OFFSIDES SIDER US FAERS | |
| 13 | Dizziness | FAERS: 28 Canada Vigilance: 1 | 16520686 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 14 | Product use issue | FAERS: 28 | US FAERS | |
| 15 | Agitation | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 16 | Urticaria | FAERS: 23 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 17 | Back Pain | FAERS: 21 | SIDER US FAERS | |
| 18 | Drug prescribing error | FAERS: 21 | OFFSIDES US FAERS | |
| 19 | Pruritus | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 20 | Pain | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 21 | Stevens-Johnson Syndrome | FAERS: 19 | 25811541 | CTD OFFSIDES SIDER US FAERS |
| 22 | Hypersensitivity | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 23 | Incorrect dose administered | FAERS: 17 | US FAERS | |
| 24 | Paranoia | FAERS: 17 | US FAERS | |
| 25 | Tachycardia | FAERS: 17 | SIDER US FAERS | |
| 26 | Chest Pain | FAERS: 16 | 18381922 | CTD OFFSIDES SIDER US FAERS |
| 27 | Nervousness | FAERS: 16 | SIDER US FAERS | |
| 28 | Palpitations | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 29 | Product quality issue | FAERS: 16 | US FAERS | |
| 30 | Adverse event | FAERS: 15 | US FAERS | |
| 31 | Drug ineffective for unapproved indication | FAERS: 15 | US FAERS | |
| 32 | Syncope | FAERS: 15 | SIDER US FAERS | |
| 33 | Tremor | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 34 | Product use in unapproved indication | FAERS: 14 | US FAERS | |
| 35 | Hypotension | FAERS: 13 | SIDER US FAERS | |
| 36 | Myocardial Infarction | FAERS: 13 | US FAERS | |
| 37 | Overdose | FAERS: 13 | US FAERS | |
| 38 | Vomiting | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 39 | Hypersomnia | FAERS: 12 | US FAERS | |
| 40 | Lethargy | FAERS: 12 | OFFSIDES US FAERS | |
| 41 | Atrial Fibrillation | FAERS: 11 | US FAERS | |
| 42 | Maternal exposure during pregnancy | FAERS: 11 | US FAERS | |
| 43 | Crying | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 44 | Drug exposure during pregnancy | FAERS: 10 | US FAERS | |
| 45 | Activities of daily living impaired | FAERS: 9 | US FAERS | |
| 46 | Amnesia | FAERS: 9 | OFFSIDES SIDER US FAERS | |
| 47 | Anger | FAERS: 9 | OFFSIDES US FAERS | |
| 48 | Depressed mood | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 49 | Vertigo | FAERS: 9 | SIDER US FAERS | |
| 50 | Weight decreased | FAERS: 9 | SIDER US FAERS | |
| 51 | Arthralgia | FAERS: 8 | SIDER US FAERS | |
| 52 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 53 | Completed Suicide | FAERS: 8 | US FAERS | |
| 54 | Drug abuse | FAERS: 8 | US FAERS | |
| 55 | Inappropriate schedule of drug administration | FAERS: 8 | US FAERS | |
| 56 | Memory impairment | FAERS: 8 | US FAERS | |
| 57 | Poisoning | FAERS: 8 | US FAERS | |
| 58 | Bruxism | FAERS: 7 | OFFSIDES US FAERS | |
| 59 | Drug dose omission | FAERS: 7 | US FAERS | |
| 60 | Dysgeusia | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 61 | Feeling jittery | FAERS: 7 | US FAERS | |
| 62 | Medication Error | FAERS: 7 | US FAERS | |
| 63 | Mental impairment | FAERS: 7 | OFFSIDES US FAERS | |
| 64 | Myalgia | FAERS: 7 | SIDER US FAERS | |
| 65 | Stomatitis | FAERS: 7 | SIDER US FAERS | |
| 66 | Stress | FAERS: 7 | OFFSIDES US FAERS | |
| 67 | Visual Impairment | FAERS: 7 | SIDER US FAERS | |
| 68 | Wrong technique in product usage process | FAERS: 7 | US FAERS | |
| 69 | Constipation | FAERS: 6 | SIDER US FAERS | |
| 70 | Drug Dependence | FAERS: 6 | US FAERS | |
| 71 | Dysphonia | FAERS: 6 | US FAERS | |
| 72 | Emotional disorder | FAERS: 6 | US FAERS | |
| 73 | Impaired driving ability | FAERS: 6 | OFFSIDES US FAERS | |
| 74 | Mood swings | FAERS: 6 | SIDER US FAERS | |
| 75 | Narcolepsy | FAERS: 6 | CTD US FAERS | |
| 76 | Oropharyngeal pain | FAERS: 6 | US FAERS | |
| 77 | Pneumonia | FAERS: 6 | SIDER US FAERS | |
| 78 | Product taste abnormal | FAERS: 6 | US FAERS | |
| 79 | Restlessness | FAERS: 6 | US FAERS | |
| 80 | Tardive Dyskinesia | FAERS: 6 | SIDER US FAERS | |
| 81 | Abdominal Pain | FAERS: 5 | SIDER US FAERS | |
| 82 | Accidental drug intake by child | FAERS: 5 | US FAERS | |
| 83 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 84 | Depressed Level of Consciousness | FAERS: 5 | US FAERS | |
| 85 | Drug abuser | FAERS: 5 | US FAERS | |
| 86 | Drug dispensing error | FAERS: 5 | OFFSIDES US FAERS | |
| 87 | Drug effect incomplete | FAERS: 5 | US FAERS | |
| 88 | Drug withdrawal syndrome | FAERS: 5 | US FAERS | |
| 89 | Dysarthria | FAERS: 5 | US FAERS | |
| 90 | Dyspepsia | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 91 | Intentional drug misuse | FAERS: 5 | OFFSIDES US FAERS | |
| 92 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 93 | Lip swelling | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Visual disturbance | FAERS: 5 | OFFSIDES US FAERS | |
| 95 | nervous system disorder | FAERS: 5 | SIDER US FAERS | |
| 96 | Alopecia | FAERS: 4 | US FAERS | |
| 97 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 98 | Blindness | FAERS: 4 | US FAERS | |
| 99 | Blood creatine phosphokinase increased | FAERS: 4 | US FAERS | |
| 100 | Burning sensation | FAERS: 4 | US FAERS | |
| 101 | Cataplexy | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 102 | Chills | FAERS: 4 | SIDER US FAERS | |
| 103 | Conversion disorder | FAERS: 4 | US FAERS | |
| 104 | Dehydration | FAERS: 4 | US FAERS | |
| 105 | Delirium | FAERS: 4 | US FAERS | |
| 106 | Dependence | FAERS: 4 | OFFSIDES US FAERS | |
| 107 | Disorientation | FAERS: 4 | US FAERS | |
| 108 | Dissociation | FAERS: 4 | US FAERS | |
| 109 | Drug screen positive | FAERS: 4 | US FAERS | |
| 110 | Economic problem | FAERS: 4 | US FAERS | |
| 111 | Erythema | FAERS: 4 | OFFSIDES US FAERS | |
| 112 | Gastrointestinal Pain | FAERS: 4 | SIDER US FAERS | |
| 113 | Hypomania | FAERS: 4 | US FAERS | |
| 114 | Intestinal Obstruction | FAERS: 4 | US FAERS | |
| 115 | Mental status changes | FAERS: 4 | US FAERS | |
| 116 | Neck Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 117 | Pharmaceutical product complaint | FAERS: 4 | US FAERS | |
| 118 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 119 | Sudden onset of sleep | FAERS: 4 | US FAERS | |
| 120 | Thrombosis | FAERS: 4 | US FAERS | |
| 121 | Tinnitus | FAERS: 4 | US FAERS | |
| 122 | Toxicity to various agents | FAERS: 4 | US FAERS | |
| 123 | Urinary tract infection | FAERS: 4 | SIDER US FAERS | |
| 124 | Abasia | FAERS: 3 | US FAERS | |
| 125 | Abdominal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 126 | Anaphylactic shock | FAERS: 3 | SIDER US FAERS | |
| 127 | Apathy | FAERS: 3 | US FAERS | |
| 128 | Aphthous Stomatitis | FAERS: 3 | US FAERS | |
| 129 | Ataxia | FAERS: 3 | SIDER US FAERS | |
| 130 | Cardiomegaly | FAERS: 3 | US FAERS | |
| 131 | Cheilitis | FAERS: 3 | US FAERS | |
| 132 | Chest discomfort | FAERS: 3 | US FAERS | |
| 133 | Choking | FAERS: 3 | US FAERS | |
| 134 | Congenital torticollis | FAERS: 3 | US FAERS | |
| 135 | Diplopia | FAERS: 3 | US FAERS | |
| 136 | Drug Tolerance | FAERS: 3 | US FAERS | |
| 137 | Drug screen false positive | FAERS: 3 | US FAERS | |
| 138 | Erythema Multiforme | FAERS: 3 | SIDER US FAERS | |
| 139 | Expired product administered | FAERS: 3 | US FAERS | |
| 140 | Fibromyalgia | FAERS: 3 | OFFSIDES US FAERS | |
| 141 | Gestational Diabetes | FAERS: 3 | US FAERS | |
| 142 | Hypertensive crisis | FAERS: 3 | US FAERS | |
| 143 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 144 | Inflammation | FAERS: 3 | US FAERS | |
| 145 | Joint stiffness | FAERS: 3 | US FAERS | |
| 146 | Multiple sclerosis relapse | FAERS: 3 | OFFSIDES US FAERS | |
| 147 | Myoclonic Epilepsy | FAERS: 3 | US FAERS | |
| 148 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 149 | Oral pain | FAERS: 3 | US FAERS | |
| 150 | Pancreatitis | FAERS: 3 | OFFSIDES US FAERS | |
| 151 | Product formulation issue | FAERS: 3 | US FAERS | |
| 152 | Product physical issue | FAERS: 3 | US FAERS | |
| 153 | Product solubility abnormal | FAERS: 3 | US FAERS | |
| 154 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 155 | Schizophrenia | FAERS: 3 | 21064019 | CTD US FAERS |
| 156 | Sepsis | FAERS: 3 | US FAERS | |
| 157 | Sinusitis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 158 | Somnambulism | FAERS: 3 | US FAERS | |
| 159 | Status Epilepticus | FAERS: 3 | US FAERS | |
| 160 | Tongue blistering | FAERS: 3 | US FAERS | |
| 161 | Toxic Epidermal Necrolysis | FAERS: 3 | SIDER US FAERS | |
| 162 | Transaminases increased | FAERS: 3 | US FAERS | |
| 163 | Unevaluable event | FAERS: 3 | US FAERS | |
| 164 | jaundice | FAERS: 3 | US FAERS | |
| 165 | Abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 166 | Ammonia increased | FAERS: 2 | US FAERS | |
| 167 | Amniotic fluid volume decreased | FAERS: 2 | US FAERS | |
| 168 | Aneurysm | FAERS: 2 | US FAERS | |
| 169 | Angioedema | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 170 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 171 | Aphasia | FAERS: 2 | US FAERS | |
| 172 | Arteriosclerosis | FAERS: 2 | US FAERS | |
| 173 | Asthma | FAERS: 2 | SIDER US FAERS | |
| 174 | Bedridden | FAERS: 2 | US FAERS | |
| 175 | Blepharospasm | FAERS: 2 | US FAERS | |
| 176 | Blood cholesterol abnormal | FAERS: 2 | US FAERS | |
| 177 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 178 | Blood pressure inadequately controlled | FAERS: 2 | US FAERS | |
| 179 | Blood triglycerides abnormal | FAERS: 2 | US FAERS | |
| 180 | Brachycephaly | FAERS: 2 | US FAERS | |
| 181 | Bronchitis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 182 | Deafness Neurosensory | FAERS: 2 | US FAERS | |
| 183 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 184 | Diabetic Retinopathy | FAERS: 2 | US FAERS | |
| 185 | Discomfort | FAERS: 2 | SIDER US FAERS | |
| 186 | Drug administration error | FAERS: 2 | US FAERS | |
| 187 | Drug diversion | FAERS: 2 | US FAERS | |
| 188 | Drug toxicity | FAERS: 2 | US FAERS | |
| 189 | Dry skin | FAERS: 2 | SIDER US FAERS | |
| 190 | Emotional distress | FAERS: 2 | OFFSIDES US FAERS | |
| 191 | Epilepsy | FAERS: 2 | US FAERS | |
| 192 | Euphoric mood | FAERS: 2 | US FAERS | |
| 193 | Extra dose administered | FAERS: 2 | US FAERS | |
| 194 | Eye irritation | FAERS: 2 | US FAERS | |
| 195 | Eye pain | FAERS: 2 | SIDER US FAERS | |
| 196 | Female Orgasmic Disorder | FAERS: 2 | US FAERS | |
| 197 | Flatulence | FAERS: 2 | SIDER US FAERS | |
| 198 | Flushing | FAERS: 2 | US FAERS | |
| 199 | Gamma-Glutamyltransferase Increased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 200 | Gastritis | FAERS: 2 | US FAERS | |
| 201 | Gastrostomy | FAERS: 2 | US FAERS | |
| 202 | Gout | FAERS: 2 | US FAERS | |
| 203 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 204 | Hallucinations, mixed | FAERS: 2 | US FAERS | |
| 205 | Hemiparesis | FAERS: 2 | OFFSIDES US FAERS | |
| 206 | Hyperventilation | FAERS: 2 | US FAERS | |
| 207 | Impaired self-care | FAERS: 2 | US FAERS | |
| 208 | Inappropriate schedule of product administration | FAERS: 2 | US FAERS | |
| 209 | Influenza | FAERS: 2 | SIDER US FAERS | |
| 210 | Initial insomnia | FAERS: 2 | US FAERS | |
| 211 | Insurance issue | FAERS: 2 | US FAERS | |
| 212 | Joint swelling | FAERS: 2 | US FAERS | |
| 213 | Leukopenia | FAERS: 2 | US FAERS | |
| 214 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 215 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 216 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 217 | Multiple Sclerosis | FAERS: 2 | OFFSIDES US FAERS | |
| 218 | Nephrolithiasis | FAERS: 2 | OFFSIDES US FAERS | |
| 219 | Neuroleptic Malignant Syndrome | FAERS: 2 | US FAERS | |
| 220 | Onychoclasis | FAERS: 2 | US FAERS | |
| 221 | Panic Disorder | FAERS: 2 | US FAERS | |
| 222 | Peripheral arterial occlusive disease | FAERS: 2 | US FAERS | |
| 223 | Peripheral swelling | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 224 | Pharmaceutical product counterfeit | FAERS: 2 | US FAERS | |
| 225 | Pharyngolaryngeal Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 226 | Phimosis | FAERS: 2 | US FAERS | |
| 227 | Photophobia | FAERS: 2 | US FAERS | |
| 228 | Physical assault | FAERS: 2 | OFFSIDES US FAERS | |
| 229 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 230 | Potentiating drug interaction | FAERS: 2 | US FAERS | |
| 231 | Pregnancy | FAERS: 2 | US FAERS | |
| 232 | Prolactinoma | FAERS: 2 | US FAERS | |
| 233 | Pulmonary Hypertension | FAERS: 2 | US FAERS | |
| 234 | Skin lesion | FAERS: 2 | OFFSIDES US FAERS | |
| 235 | Sleep Paralysis | FAERS: 2 | US FAERS | |
| 236 | Sluggishness | FAERS: 2 | US FAERS | |
| 237 | Staring | FAERS: 2 | US FAERS | |
| 238 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 239 | Swelling | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 240 | Talipes | FAERS: 2 | US FAERS | |
| 241 | Therapeutic product effect incomplete | FAERS: 2 | US FAERS | |
| 242 | Thirst | FAERS: 2 | SIDER US FAERS | |
| 243 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 244 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 245 | Wrong technique in drug usage process | FAERS: 2 | OFFSIDES US FAERS | |
| 246 | Accidental death | FAERS: 1 | US FAERS | |
| 247 | Accidental overdose | FAERS: 1 | US FAERS | |
| 248 | Acidosis | FAERS: 1 | OFFSIDES US FAERS | |
| 249 | Acne | FAERS: 1 | US FAERS | |
| 250 | Acute kidney injury | FAERS: 1 | US FAERS | |
| 251 | Acute psychosis | FAERS: 1 | US FAERS | |
| 252 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 253 | Alanine Aminotransferase Increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 254 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 255 | Allodynia | FAERS: 1 | US FAERS | |
| 256 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 257 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 258 | Anhedonia | FAERS: 1 | OFFSIDES US FAERS | |
| 259 | Anorgasmia | FAERS: 1 | US FAERS | |
| 260 | Antiphospholipid Antibodies | FAERS: 1 | US FAERS | |
| 261 | Arterial bypass operation | FAERS: 1 | US FAERS | |
| 262 | Arthritis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 263 | Arthropathy | FAERS: 1 | SIDER US FAERS | |
| 264 | Arthropod bite | FAERS: 1 | US FAERS | |
| 265 | Aspartate Aminotransferase Increased | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 266 | Asphyxia | FAERS: 1 | US FAERS | |
| 267 | Asthenopia | FAERS: 1 | OFFSIDES US FAERS | |
| 268 | Athetosis | FAERS: 1 | US FAERS | |
| 269 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 270 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 271 | Bed rest | FAERS: 1 | US FAERS | |
| 272 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 273 | Bipolar Disorder | FAERS: 1 | 20163392 | CTD OFFSIDES US FAERS |
| 274 | Bipolar I disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 275 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 276 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 277 | Blood human chorionic gonadotropin positive | FAERS: 1 | US FAERS | |
| 278 | Blood magnesium decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 279 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 280 | Boredom | FAERS: 1 | US FAERS | |
| 281 | Bradycardia | FAERS: 1 | SIDER US FAERS | |
| 282 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 283 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 284 | Carbon dioxide decreased | FAERS: 1 | US FAERS | |
| 285 | Cardiac Arrest | FAERS: 1 | SIDER US FAERS | |
| 286 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 287 | Cataract | FAERS: 1 | US FAERS | |
| 288 | Catatonia | FAERS: 1 | US FAERS | |
| 289 | Cell Death | FAERS: 1 | US FAERS | |
| 290 | Cellulitis | FAERS: 1 | OFFSIDES US FAERS | |
| 291 | Cerebral ventricle dilatation | FAERS: 1 | US FAERS | |
| 292 | Change in sustained attention | FAERS: 1 | US FAERS | |
| 293 | Chorea | FAERS: 1 | 17403991 | CTD US FAERS |
| 294 | Chorioretinitis | FAERS: 1 | US FAERS | |
| 295 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 296 | Chronic respiratory failure | FAERS: 1 | US FAERS | |
| 297 | Cleft Palate | FAERS: 1 | US FAERS | |
| 298 | Coagulation factor V level abnormal | FAERS: 1 | US FAERS | |
| 299 | Coagulation time shortened | FAERS: 1 | US FAERS | |
| 300 | Compulsive shopping | FAERS: 1 | OFFSIDES US FAERS | |
| 301 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 302 | Craniofacial Dysostosis | FAERS: 1 | US FAERS | |
| 303 | Craniorachischisis | FAERS: 1 | US FAERS | |
| 304 | Culture wound positive | FAERS: 1 | US FAERS | |
| 305 | Cystitis | FAERS: 1 | SIDER US FAERS | |
| 306 | Deafness | FAERS: 1 | US FAERS | |
| 307 | Death of relative | FAERS: 1 | US FAERS | |
| 308 | Delusion of reference | FAERS: 1 | US FAERS | |
| 309 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 310 | Dental examination abnormal | FAERS: 1 | US FAERS | |
| 311 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 312 | Disease recurrence | FAERS: 1 | US FAERS | |
| 313 | Diverticulitis | FAERS: 1 | US FAERS | |
| 314 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 315 | Drug dispensed to wrong patient | FAERS: 1 | US FAERS | |
| 316 | Drug effect variable | FAERS: 1 | US FAERS | |
| 317 | Drug level decreased | FAERS: 1 | US FAERS | |
| 318 | Drug resistance | FAERS: 1 | US FAERS | |
| 319 | Duodenal atresia | FAERS: 1 | US FAERS | |
| 320 | Dysgraphia | FAERS: 1 | US FAERS | |
| 321 | Dyslexia | FAERS: 1 | US FAERS | |
| 322 | Dysmorphism | FAERS: 1 | US FAERS | |
| 323 | Dysuria | FAERS: 1 | OFFSIDES US FAERS | |
| 324 | Ecchymosis | FAERS: 1 | SIDER US FAERS | |
| 325 | Echocardiogram abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 326 | Educational problem | FAERS: 1 | US FAERS | |
| 327 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 328 | Electrocardiogram ST-T segment depression | FAERS: 1 | US FAERS | |
| 329 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 330 | Enterocolitis | FAERS: 1 | US FAERS | |
| 331 | Enzyme level abnormal | FAERS: 1 | US FAERS | |
| 332 | Epileptic psychosis | FAERS: 1 | US FAERS | |
| 333 | Erectile dysfunction | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 334 | Expired drug administered | FAERS: 1 | US FAERS | |
| 335 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 336 | Facial Paresis | FAERS: 1 | US FAERS | |
| 337 | Flight of ideas | FAERS: 1 | US FAERS | |
| 338 | Folliculitis | FAERS: 1 | US FAERS | |
| 339 | Fracture | FAERS: 1 | US FAERS | |
| 340 | Frustration | FAERS: 1 | US FAERS | |
| 341 | Gambling | FAERS: 1 | 18583430 | CTD OFFSIDES US FAERS |
| 342 | Gastrointestinal sounds abnormal | FAERS: 1 | US FAERS | |
| 343 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 344 | Genital burning sensation | FAERS: 1 | US FAERS | |
| 345 | Gingival blister | FAERS: 1 | US FAERS | |
| 346 | Glaucoma | FAERS: 1 | US FAERS | |
| 347 | Glossitis | FAERS: 1 | US FAERS | |
| 348 | Glucocorticoid deficiency | FAERS: 1 | US FAERS | |
| 349 | Hepatitis | FAERS: 1 | US FAERS | |
| 350 | Hidradenitis | FAERS: 1 | US FAERS | |
| 351 | Hospice Care | FAERS: 1 | US FAERS | |
| 352 | Hyperacusis | FAERS: 1 | SIDER US FAERS | |
| 353 | Hypervigilance | FAERS: 1 | US FAERS | |
| 354 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 355 | Hypopituitarism | FAERS: 1 | US FAERS | |
| 356 | Hypospadias | FAERS: 1 | US FAERS | |
| 357 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 358 | Impaired gastric emptying | FAERS: 1 | OFFSIDES US FAERS | |
| 359 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 360 | Impaired work ability | FAERS: 1 | US FAERS | |
| 361 | Impatience | FAERS: 1 | US FAERS | |
| 362 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 363 | Incoherent | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 364 | Incontinence | FAERS: 1 | OFFSIDES US FAERS | |
| 365 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 366 | Infertility | FAERS: 1 | US FAERS | |
| 367 | Injection site abscess | FAERS: 1 | US FAERS | |
| 368 | Insulin Resistance | FAERS: 1 | US FAERS | |
| 369 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 370 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 371 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 372 | Intermittent Explosive Disorder | FAERS: 1 | US FAERS | |
| 373 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 374 | Joint injury | FAERS: 1 | OFFSIDES US FAERS | |
| 375 | Laceration | FAERS: 1 | US FAERS | |
| 376 | Left ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 377 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 378 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 379 | Live Birth | FAERS: 1 | US FAERS | |
| 380 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 381 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 382 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 383 | Microcephaly | FAERS: 1 | US FAERS | |
| 384 | Middle insomnia | FAERS: 1 | US FAERS | |
| 385 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 386 | Multiple allergies | FAERS: 1 | US FAERS | |
| 387 | Muscle tightness | FAERS: 1 | US FAERS | |
| 388 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 389 | Myoclonus | FAERS: 1 | US FAERS | |
| 390 | Negative thoughts | FAERS: 1 | US FAERS | |
| 391 | Negativism | FAERS: 1 | US FAERS | |
| 392 | Neonatal disorder | FAERS: 1 | US FAERS | |
| 393 | Nerve injury | FAERS: 1 | US FAERS | |
| 394 | Neuralgia | FAERS: 1 | OFFSIDES US FAERS | |
| 395 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 396 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 397 | Obsessive-Compulsive Disorder | FAERS: 1 | US FAERS | |
| 398 | Opiates positive | FAERS: 1 | US FAERS | |
| 399 | Oppositional Defiant Disorder | FAERS: 1 | US FAERS | |
| 400 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 401 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 402 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 403 | Pallor | FAERS: 1 | US FAERS | |
| 404 | Pancytopenia | FAERS: 1 | SIDER US FAERS | |
| 405 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 406 | Pericarditis | FAERS: 1 | US FAERS | |
| 407 | Personality Change | FAERS: 1 | US FAERS | |
| 408 | Phlebitis | FAERS: 1 | US FAERS | |
| 409 | Pityriasis | FAERS: 1 | US FAERS | |
| 410 | Polyhydramnios | FAERS: 1 | US FAERS | |
| 411 | Polysubstance dependence | FAERS: 1 | US FAERS | |
| 412 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 413 | Post procedural complication | FAERS: 1 | US FAERS | |
| 414 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 415 | Posterior reversible encephalopathy syndrome | FAERS: 1 | US FAERS | |
| 416 | Pregnancy on contraceptive | FAERS: 1 | US FAERS | |
| 417 | Prescription drug used without a prescription | FAERS: 1 | US FAERS | |
| 418 | Presyncope | FAERS: 1 | US FAERS | |
| 419 | Product commingling | FAERS: 1 | US FAERS | |
| 420 | Product counterfeit | FAERS: 1 | US FAERS | |
| 421 | Product dispensing issue | FAERS: 1 | US FAERS | |
| 422 | Product friable | FAERS: 1 | US FAERS | |
| 423 | Product label issue | FAERS: 1 | US FAERS | |
| 424 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 425 | Product packaging issue | FAERS: 1 | US FAERS | |
| 426 | Product preparation error | FAERS: 1 | US FAERS | |
| 427 | Prurigo | FAERS: 1 | US FAERS | |
| 428 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 429 | Pulmonary malformation | FAERS: 1 | US FAERS | |
| 430 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 431 | Rash erythematous | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 432 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 433 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 434 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 435 | Resting Tremor | FAERS: 1 | US FAERS | |
| 436 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 437 | Rhinitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 438 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 439 | Scab | FAERS: 1 | OFFSIDES US FAERS | |
| 440 | Sense of oppression | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 441 | Septic Shock | FAERS: 1 | US FAERS | |
| 442 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 443 | Simple Partial Seizures | FAERS: 1 | US FAERS | |
| 444 | Single functional kidney | FAERS: 1 | US FAERS | |
| 445 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 446 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 447 | Skeletal injury | FAERS: 1 | OFFSIDES US FAERS | |
| 448 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 449 | Skin necrosis | FAERS: 1 | US FAERS | |
| 450 | Skin reaction | FAERS: 1 | US FAERS | |
| 451 | Spina Bifida | FAERS: 1 | US FAERS | |
| 452 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 453 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 454 | Sudden death | FAERS: 1 | US FAERS | |
| 455 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 456 | Temporal Arteritis | FAERS: 1 | US FAERS | |
| 457 | Tension | FAERS: 1 | SIDER US FAERS | |
| 458 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 459 | Therapeutic product effect variable | FAERS: 1 | US FAERS | |
| 460 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 461 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 462 | Therapy cessation | FAERS: 1 | US FAERS | |
| 463 | Therapy change | FAERS: 1 | US FAERS | |
| 464 | Thermal burn | FAERS: 1 | US FAERS | |
| 465 | Tongue biting | FAERS: 1 | US FAERS | |
| 466 | Tongue spasm | FAERS: 1 | US FAERS | |
| 467 | Tooth Loss | FAERS: 1 | US FAERS | |
| 468 | Toothache | FAERS: 1 | US FAERS | |
| 469 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 470 | Trichotillomania | FAERS: 1 | US FAERS | |
| 471 | Ultrasound antenatal screen | FAERS: 1 | US FAERS | |
| 472 | Unemployment | FAERS: 1 | US FAERS | |
| 473 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 474 | Urinary Retention | FAERS: 1 | SIDER US FAERS | |
| 475 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 476 | Vaginal lesion | FAERS: 1 | US FAERS | |
| 477 | Venous Insufficiency | FAERS: 1 | US FAERS | |
| 478 | Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 479 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 480 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 481 | Wheezing | FAERS: 1 | US FAERS | |
| 482 | Wound infection bacterial | FAERS: 1 | US FAERS | |
| 483 | Wound infection staphylococcal | FAERS: 1 | OFFSIDES US FAERS | |
| 484 | Yawning | FAERS: 1 | US FAERS | |
| 485 | treatment failure | FAERS: 1 | US FAERS | |
| 486 | Abdominal sepsis | OFFSIDES | ||
| 487 | Abnormal ejaculation | SIDER | ||
| 488 | Abnormal vision | SIDER | ||
| 489 | Abuse | OFFSIDES | ||
| 490 | Accidental exposure | OFFSIDES | ||
| 491 | Acid reflux | OFFSIDES | ||
| 492 | Acute Coronary Syndrome | OFFSIDES | ||
| 493 | Adenoma | OFFSIDES | ||
| 494 | Adnexitis | OFFSIDES | ||
| 495 | Agranulocytosis | SIDER | ||
| 496 | Agraphia | OFFSIDES | ||
| 497 | Albuminuria | SIDER | ||
| 498 | Alveolitis | OFFSIDES | ||
| 499 | Amblyopia | SIDER | ||
| 500 | Amphetamine-Related Disorders | CTD | ||
| 501 | Analgesia | OFFSIDES | ||
| 502 | Anaphylactoid Reaction | SIDER | ||
| 503 | Anorexia | OFFSIDES SIDER | ||
| 504 | Antiphospholipid antibodies positive | OFFSIDES | ||
| 505 | Anxiety Disorders | 18381922 | CTD | |
| 506 | Apnea | OFFSIDES | ||
| 507 | Appendectomy | OFFSIDES | ||
| 508 | Appendicitis | OFFSIDES | ||
| 509 | Application site erythema | OFFSIDES | ||
| 510 | Application site pustules | OFFSIDES | ||
| 511 | Application site rash | OFFSIDES | ||
| 512 | Application site reaction | OFFSIDES | ||
| 513 | Application site vesicles | OFFSIDES | ||
| 514 | Aseptic Meningitis | OFFSIDES | ||
| 515 | Asterixis | OFFSIDES | ||
| 516 | Benign neoplasm of thyroid gland | OFFSIDES | ||
| 517 | Bereavement | OFFSIDES | ||
| 518 | Bladder pain | SIDER | ||
| 519 | Blepharoptosis | OFFSIDES | ||
| 520 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 521 | Blood albumin decreased | OFFSIDES | ||
| 522 | Blood alkaline phosphatase increased | Canada Vigilance: 1 | Canada Vigilance | |
| 523 | Blood chloride decreased | OFFSIDES | ||
| 524 | Blood chloride increased | OFFSIDES | ||
| 525 | Blood cortisol abnormal | OFFSIDES | ||
| 526 | Blood homocysteine | OFFSIDES | ||
| 527 | Blood potassium increased | OFFSIDES | ||
| 528 | Blood testosterone increased | OFFSIDES | ||
| 529 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 530 | Blood thyroid stimulating hormone increased | OFFSIDES | ||
| 531 | Blurred vision | OFFSIDES | ||
| 532 | Bone Resorption | 29649498 | CTD | |
| 533 | Bone density decreased | OFFSIDES | ||
| 534 | Bone erosion | OFFSIDES | ||
| 535 | Bone fragmentation | OFFSIDES | ||
| 536 | Bone lesion | OFFSIDES | ||
| 537 | Bone pain | OFFSIDES | ||
| 538 | Bowel movement irregularity | OFFSIDES | ||
| 539 | Breakthrough Pain | OFFSIDES | ||
| 540 | Bronchopneumonia | OFFSIDES | ||
| 541 | Bronchopneumopathy | OFFSIDES | ||
| 542 | Bursitis | OFFSIDES | ||
| 543 | Cardiac enzymes increased | OFFSIDES | ||
| 544 | Cardiac stress test abnormal | OFFSIDES | ||
| 545 | Cataract operation | OFFSIDES | ||
| 546 | Cerebral Thrombosis | OFFSIDES | ||
| 547 | Choking sensation | OFFSIDES | ||
| 548 | Chromatopsia | OFFSIDES | ||
| 549 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 550 | Chronic tonsillitis | OFFSIDES | ||
| 551 | Chronic ulcerative colitis | OFFSIDES | ||
| 552 | Claustrophobia | OFFSIDES | ||
| 553 | Coagulation factor VIII level increased | OFFSIDES | ||
| 554 | Cocaine-Related Disorders | CTD | ||
| 555 | Cognition Disorders | 12791341 | CTD | |
| 556 | Cold sweat | OFFSIDES | ||
| 557 | Confabulation | OFFSIDES | ||
| 558 | Confusion | 17403991 | CTD | |
| 559 | Congenital cystic kidney disease | OFFSIDES | ||
| 560 | Conjunctivitis | SIDER | ||
| 561 | Cramps of lower extremities | SIDER | ||
| 562 | Culture positive | OFFSIDES | ||
| 563 | Cyanosis | OFFSIDES | ||
| 564 | Cytolytic hepatitis | OFFSIDES | ||
| 565 | Decreased Libido | OFFSIDES | ||
| 566 | Demyelination | OFFSIDES | ||
| 567 | Dental abscess | OFFSIDES | ||
| 568 | Dental caries | OFFSIDES | ||
| 569 | Depression aggravated | SIDER | ||
| 570 | Depression suicidal | OFFSIDES | ||
| 571 | Depressive disorder | 12657914 21064019 | CTD | |
| 572 | Device Failure | OFFSIDES | ||
| 573 | Diabetes | OFFSIDES | ||
| 574 | Diarrhea | OFFSIDES | ||
| 575 | Disorders of Excessive Somnolence | 11879175 14763681 16520686 | CTD | |
| 576 | Disturbance in sexual arousal | SIDER | ||
| 577 | Diverticulum | OFFSIDES | ||
| 578 | Drowsiness | OFFSIDES SIDER | ||
| 579 | Drug administered at inappropriate site | OFFSIDES | ||
| 580 | Drug effect delayed | OFFSIDES | ||
| 581 | Drug withdrawal headache | OFFSIDES | ||
| 582 | Dysthymic Disorder | 17606668 | CTD OFFSIDES | |
| 583 | Ear congestion | OFFSIDES | ||
| 584 | Eczema | SIDER | ||
| 585 | Electrocardiogram abnormal | SIDER | ||
| 586 | Encephalomalacia | OFFSIDES | ||
| 587 | Endodontic procedure | OFFSIDES | ||
| 588 | Enteritis | OFFSIDES | ||
| 589 | Enterococcal infection | OFFSIDES | ||
| 590 | Eosinophilia | SIDER | ||
| 591 | Eosinophilic myocarditis | OFFSIDES | ||
| 592 | Epistaxis | SIDER | ||
| 593 | Escherichia infection | OFFSIDES | ||
| 594 | Eye laser surgery | OFFSIDES | ||
| 595 | Facial Neuralgia | OFFSIDES | ||
| 596 | Fever | 17403991 | CTD | |
| 597 | Formication | OFFSIDES | ||
| 598 | Gastric ulcer | OFFSIDES | ||
| 599 | Gastroduodenitis | OFFSIDES | ||
| 600 | Gastroenteritis | SIDER | ||
| 601 | General symptom | OFFSIDES | ||
| 602 | Gingivitis | SIDER | ||
| 603 | Gliosis | OFFSIDES | ||
| 604 | Goiter | OFFSIDES | ||
| 605 | Granuloma | OFFSIDES | ||
| 606 | Hallucinations | 11879175 | CTD | |
| 607 | Heat Exhaustion | OFFSIDES | ||
| 608 | Hip surgery | OFFSIDES | ||
| 609 | Histamine level increased | Canada Vigilance: 1 | Canada Vigilance | |
| 610 | Hyperkinesia | SIDER | ||
| 611 | Hyperparathyroidism | OFFSIDES | ||
| 612 | Hypogeusia | OFFSIDES | ||
| 613 | Immune-mediated adverse reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 614 | Implantable defibrillator insertion | OFFSIDES | ||
| 615 | Infection | SIDER | ||
| 616 | Infusion site mobility decreased | OFFSIDES | ||
| 617 | Injection site discomfort | OFFSIDES | ||
| 618 | Intention tremor | OFFSIDES | ||
| 619 | Intervertebral disc injury | OFFSIDES | ||
| 620 | Leukocytosis | SIDER | ||
| 621 | Leukoencephalopathy | OFFSIDES | ||
| 622 | Leukopenia neonatal | OFFSIDES | ||
| 623 | Liver Failure, Acute | 16045030 | CTD | |
| 624 | Loose tooth | OFFSIDES | ||
| 625 | Lymphocyte count decreased | OFFSIDES | ||
| 626 | Malignant fibrous histiocytoma metastatic | OFFSIDES | ||
| 627 | Malnutrition | SIDER | ||
| 628 | Malocclusion | OFFSIDES | ||
| 629 | Meniscus removal | OFFSIDES | ||
| 630 | Metastases to thorax | OFFSIDES | ||
| 631 | Metastatic Neoplasm | OFFSIDES | ||
| 632 | Mucoepidermoid Carcinoma | OFFSIDES | ||
| 633 | Muscle Weakness | OFFSIDES | ||
| 634 | Musculoskeletal discomfort | SIDER | ||
| 635 | Musculoskeletal stiffness | OFFSIDES SIDER | ||
| 636 | Myoglobin blood increased | OFFSIDES | ||
| 637 | Neck stiffness | SIDER | ||
| 638 | Nervous tension | OFFSIDES | ||
| 639 | Neuroma | OFFSIDES | ||
| 640 | Nodule | OFFSIDES | ||
| 641 | Nuchal Rigidity | SIDER | ||
| 642 | Obesity | SIDER | ||
| 643 | Oliguria | OFFSIDES | ||
| 644 | Open reduction of fracture | OFFSIDES | ||
| 645 | Optic Neuritis | OFFSIDES | ||
| 646 | Optic Neuropathy | OFFSIDES | ||
| 647 | Oral infection | OFFSIDES | ||
| 648 | Oropharyngeal spasm | OFFSIDES | ||
| 649 | Osteitis Deformans | OFFSIDES | ||
| 650 | Osteolysis | OFFSIDES | ||
| 651 | Osteomyelitis | OFFSIDES | ||
| 652 | Osteopenia | OFFSIDES | ||
| 653 | Osteoporosis | OFFSIDES | ||
| 654 | Periarthritis | OFFSIDES | ||
| 655 | Pericardial effusion | OFFSIDES | ||
| 656 | Periodontitis | OFFSIDES | ||
| 657 | Phantom pain | OFFSIDES | ||
| 658 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 659 | Pharyngitis | SIDER | ||
| 660 | Pleurisy | OFFSIDES | ||
| 661 | Polyuria | SIDER | ||
| 662 | Poor dental condition | OFFSIDES | ||
| 663 | Primary sequestrum | OFFSIDES | ||
| 664 | Protein total decreased | OFFSIDES | ||
| 665 | Psoriasis | SIDER | ||
| 666 | Psychiatric symptom | SIDER | ||
| 667 | Psychomotor Agitation | 11879175 | CTD | |
| 668 | Pulmonary arterial pressure increased | OFFSIDES | ||
| 669 | Pulmonary congestion | OFFSIDES | ||
| 670 | Pyuria | OFFSIDES SIDER | ||
| 671 | Radiotherapy to brain | OFFSIDES | ||
| 672 | Rectal Prolapse | OFFSIDES | ||
| 673 | Renal cyst | OFFSIDES | ||
| 674 | Rocky Mountain Spotted Fever | OFFSIDES | ||
| 675 | Salmonella | OFFSIDES | ||
| 676 | Scleroderma | OFFSIDES | ||
| 677 | Secretion discharge | Canada Vigilance: 1 | Canada Vigilance | |
| 678 | Seizures | 15260124 | CTD | |
| 679 | Shock | SIDER | ||
| 680 | Skin laceration | OFFSIDES | ||
| 681 | Skin tightness | OFFSIDES | ||
| 682 | Sleep Deprivation | 17484308 | CTD | |
| 683 | Sleep Talking | OFFSIDES | ||
| 684 | Sleep Wake Disorders | 20080983 | CTD | |
| 685 | Snoring | OFFSIDES | ||
| 686 | Spinal haemangioma | OFFSIDES | ||
| 687 | Splenic vein thrombosis | OFFSIDES | ||
| 688 | Substance Withdrawal Syndrome | 18329221 | CTD | |
| 689 | Sweating | SIDER | ||
| 690 | Tendinitis | OFFSIDES | ||
| 691 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 692 | Therapeutic response unexpected with drug substitution | OFFSIDES | ||
| 693 | Thoracic vertebral fracture | OFFSIDES | ||
| 694 | Tonic clonic movements | OFFSIDES | ||
| 695 | Tooth Extraction | OFFSIDES | ||
| 696 | Tooth repair | OFFSIDES | ||
| 697 | Troponin I increased | OFFSIDES | ||
| 698 | Urine output increased | SIDER | ||
| 699 | Vascular anomaly | OFFSIDES | ||
| 700 | Vascular resistance systemic increased | OFFSIDES | ||
| 701 | Vasodilation procedure | SIDER | ||
| 702 | Vasodilation | SIDER | ||
| 703 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 704 | Vitreous Detachment | OFFSIDES | ||
| 705 | Vulvovaginal dryness | OFFSIDES | ||
| 706 | Weight Gain | OFFSIDES | ||
| 707 | liposarcoma | OFFSIDES | ||
| 708 | muscle injury | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120295
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.