Crizotinib
(KTEIFNKAUNYNJU-GFCCVEGCSA-N)
Structure
- SMILES
- Nc1ncc(cc1O[C@@H](c1c(Cl)ccc(c1Cl)F)C)c1cnn(c1)C1CCNCC1
- Type(s)
- Approved
- ATC code(s)
- L01XE16
- Molecular Formula:
- C21H22Cl2FN5O
- Molecular Weight:
- 450.337
- Log P:
- 5.9477
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 2
- TPSA:
- 77.99
- CAS Number(s):
- 877399-52-5
Synonym(s)
1.
Crizotinib
2.
PF 02341066
3.
PF-02341066
4.
PF-2341066
5.
PF02341066
6.
Xalkori
7.
PF 2341066
8.
PF2341066
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Disease Progression | FAERS: 804 Canada Vigilance: 20 | Canada Vigilance SIDER US FAERS | |
| 2 | Nausea | FAERS: 572 Canada Vigilance: 7 | CTD SIDER Canada Vigilance US FAERS | |
| 3 | Vomiting | FAERS: 356 Canada Vigilance: 5 | 21823889 22954507 23686600 | CTD SIDER Canada Vigilance US FAERS |
| 4 | Fatigue | FAERS: 269 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 5 | Constipation | FAERS: 244 Canada Vigilance: 2 | 22954507 | CTD SIDER Canada Vigilance US FAERS |
| 6 | Visual Impairment | FAERS: 242 | SIDER US FAERS | |
| 7 | Dizziness | FAERS: 159 Canada Vigilance: 1 | 21345110 | CTD SIDER Canada Vigilance US FAERS |
| 8 | Malaise | FAERS: 132 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Peripheral swelling | FAERS: 125 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 10 | Pneumonia | FAERS: 125 Canada Vigilance: 7 | 23686600 | CTD SIDER Canada Vigilance US FAERS |
| 11 | Dysgeusia | FAERS: 121 | SIDER US FAERS | |
| 12 | Asthenia | FAERS: 107 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 13 | Product use issue | FAERS: 76 | US FAERS | |
| 14 | Pneumonitis | FAERS: 65 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 15 | Pulmonary Embolism | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 16 | Dyspepsia | FAERS: 63 | SIDER US FAERS | |
| 17 | Vitreous floaters | FAERS: 60 | SIDER US FAERS | |
| 18 | Abdominal discomfort | FAERS: 56 | US FAERS | |
| 19 | Pain | FAERS: 56 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Bradycardia | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 21 | Weight decreased | FAERS: 54 | SIDER US FAERS | |
| 22 | Headache | FAERS: 50 | US FAERS | |
| 23 | Neutropenia | FAERS: 50 Canada Vigilance: 1 | 22954507 | CTD SIDER Canada Vigilance US FAERS |
| 24 | Joint swelling | FAERS: 49 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Thrombosis | FAERS: 48 | US FAERS | |
| 26 | Dehydration | FAERS: 45 | US FAERS | |
| 27 | Product use in unapproved indication | FAERS: 45 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 28 | Respiratory Failure | FAERS: 44 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 29 | Back Pain | FAERS: 43 | US FAERS | |
| 30 | Blood creatinine increased | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Aspartate Aminotransferase Increased | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 32 | Deep Vein Thrombosis | FAERS: 39 | US FAERS | |
| 33 | Hypotension | FAERS: 38 | US FAERS | |
| 34 | Pericardial effusion | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Alanine Aminotransferase Increased | FAERS: 37 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Chest Pain | FAERS: 37 | US FAERS | |
| 37 | Abdominal Pain | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 38 | Arthralgia | FAERS: 31 | US FAERS | |
| 39 | Diplopia | FAERS: 31 | SIDER US FAERS | |
| 40 | Photophobia | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 41 | Transaminases increased | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 42 | Cerebrovascular accident | FAERS: 28 | US FAERS | |
| 43 | General physical health deterioration | FAERS: 28 | US FAERS | |
| 44 | Infection | FAERS: 27 | SIDER US FAERS | |
| 45 | Hepatitis | FAERS: 25 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 46 | Drug dose omission | FAERS: 24 | US FAERS | |
| 47 | Swelling | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Syncope | FAERS: 23 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 49 | Pruritus | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Alopecia | FAERS: 20 | US FAERS | |
| 51 | Feeling abnormal | FAERS: 20 | US FAERS | |
| 52 | Blood creatine phosphokinase increased | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Memory impairment | FAERS: 19 | US FAERS | |
| 54 | Nasopharyngitis | FAERS: 19 | US FAERS | |
| 55 | Renal abscess | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Hepatotoxicity | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 57 | Leukopenia | FAERS: 18 | SIDER US FAERS | |
| 58 | Renal cyst | FAERS: 18 | SIDER US FAERS | |
| 59 | Ageusia | FAERS: 17 | US FAERS | |
| 60 | Atrial Fibrillation | FAERS: 17 | US FAERS | |
| 61 | Blindness | FAERS: 17 | US FAERS | |
| 62 | Hypersensitivity | FAERS: 17 | US FAERS | |
| 63 | Urinary tract infection | FAERS: 17 | US FAERS | |
| 64 | Embolism | FAERS: 16 | US FAERS | |
| 65 | Flatulence | FAERS: 16 | US FAERS | |
| 66 | Myalgia | FAERS: 16 | US FAERS | |
| 67 | Oropharyngeal pain | FAERS: 16 | US FAERS | |
| 68 | Sepsis | FAERS: 16 | SIDER US FAERS | |
| 69 | Somnolence | FAERS: 16 | US FAERS | |
| 70 | Stomatitis | FAERS: 16 | US FAERS | |
| 71 | Tremor | FAERS: 16 | US FAERS | |
| 72 | Acute kidney injury | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Hypoxia | FAERS: 15 | US FAERS | |
| 74 | Lower respiratory tract infection | FAERS: 15 | US FAERS | |
| 75 | Myocardial Infarction | FAERS: 15 | US FAERS | |
| 76 | White blood cell count decreased | FAERS: 15 | US FAERS | |
| 77 | Cardiac Arrest | FAERS: 14 | US FAERS | |
| 78 | Cellulitis | FAERS: 14 | US FAERS | |
| 79 | Pancreatitis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Throat irritation | FAERS: 13 | US FAERS | |
| 81 | Amnesia | FAERS: 12 | US FAERS | |
| 82 | Dysphonia | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Influenza | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 84 | Pneumothorax | FAERS: 12 | US FAERS | |
| 85 | nervous system disorder | FAERS: 12 | SIDER US FAERS | |
| 86 | Ascites | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Carcinoembryonic antigen increased | FAERS: 11 | US FAERS | |
| 88 | Cerebral Infarction | FAERS: 11 | US FAERS | |
| 89 | Chills | FAERS: 11 | US FAERS | |
| 90 | Intentional product misuse | FAERS: 11 | US FAERS | |
| 91 | Lethargy | FAERS: 11 | US FAERS | |
| 92 | Therapy cessation | FAERS: 11 | US FAERS | |
| 93 | Thrombocytopenia | FAERS: 11 | US FAERS | |
| 94 | Abscess | FAERS: 10 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 95 | Anxiety | FAERS: 10 | US FAERS | |
| 96 | Blood alkaline phosphatase increased | FAERS: 10 | SIDER US FAERS | |
| 97 | Chest discomfort | FAERS: 10 | US FAERS | |
| 98 | Drug ineffective | FAERS: 10 | US FAERS | |
| 99 | Productive Cough | FAERS: 10 | US FAERS | |
| 100 | Abasia | FAERS: 9 | US FAERS | |
| 101 | Erythema | FAERS: 9 | US FAERS | |
| 102 | Rash erythematous | FAERS: 9 | US FAERS | |
| 103 | Septic Shock | FAERS: 9 | US FAERS | |
| 104 | Urinary Retention | FAERS: 9 | US FAERS | |
| 105 | Bronchitis | FAERS: 8 | US FAERS | |
| 106 | Inflammation | FAERS: 8 | US FAERS | |
| 107 | Intestinal Obstruction | FAERS: 8 | US FAERS | |
| 108 | Musculoskeletal chest pain | FAERS: 8 | US FAERS | |
| 109 | Respiratory distress | FAERS: 8 | US FAERS | |
| 110 | Retching | FAERS: 8 | US FAERS | |
| 111 | Toxicity to various agents | FAERS: 8 | US FAERS | |
| 112 | Vertigo | FAERS: 8 | US FAERS | |
| 113 | Vitreous Detachment | FAERS: 8 | US FAERS | |
| 114 | Appendicitis | FAERS: 7 | US FAERS | |
| 115 | Blood albumin decreased | FAERS: 7 | US FAERS | |
| 116 | Blood glucose increased | FAERS: 7 | US FAERS | |
| 117 | Blood potassium decreased | FAERS: 7 | US FAERS | |
| 118 | Blood testosterone decreased | FAERS: 7 | US FAERS | |
| 119 | Burning sensation | FAERS: 7 | SIDER US FAERS | |
| 120 | Cataract | FAERS: 7 | US FAERS | |
| 121 | Dry skin | FAERS: 7 | US FAERS | |
| 122 | Hypophagia | FAERS: 7 | US FAERS | |
| 123 | Limb discomfort | FAERS: 7 | US FAERS | |
| 124 | No adverse event | FAERS: 7 | US FAERS | |
| 125 | Palpitations | FAERS: 7 | US FAERS | |
| 126 | Performance status decreased | FAERS: 7 | US FAERS | |
| 127 | Product quality issue | FAERS: 7 | US FAERS | |
| 128 | Tachycardia | FAERS: 7 | US FAERS | |
| 129 | Urinary Incontinence | FAERS: 7 | US FAERS | |
| 130 | Acne | FAERS: 6 | US FAERS | |
| 131 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 132 | Disorientation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Eructation | FAERS: 6 | US FAERS | |
| 134 | Febrile Neutropenia | FAERS: 6 | SIDER US FAERS | |
| 135 | Gastric ulcer | FAERS: 6 | US FAERS | |
| 136 | Hypercreatininaemia | FAERS: 6 | US FAERS | |
| 137 | Intestinal Perforation | FAERS: 6 | US FAERS | |
| 138 | Leukocytosis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Lymphadenopathy | FAERS: 6 | US FAERS | |
| 140 | Malnutrition | FAERS: 6 | SIDER US FAERS | |
| 141 | Wheezing | FAERS: 6 | US FAERS | |
| 142 | jaundice | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 143 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 144 | Alveolitis | FAERS: 5 | US FAERS | |
| 145 | Cerebral Thrombosis | FAERS: 5 | US FAERS | |
| 146 | Deafness | FAERS: 5 | US FAERS | |
| 147 | Decreased immune responsiveness | FAERS: 5 | US FAERS | |
| 148 | Dementia | FAERS: 5 | US FAERS | |
| 149 | Diverticular perforation | FAERS: 5 | US FAERS | |
| 150 | Dysuria | FAERS: 5 | US FAERS | |
| 151 | Early satiety | FAERS: 5 | US FAERS | |
| 152 | Electrolyte imbalance | FAERS: 5 | US FAERS | |
| 153 | Gamma-Glutamyltransferase Increased | FAERS: 5 | SIDER US FAERS | |
| 154 | Gastrointestinal toxicity | FAERS: 5 | US FAERS | |
| 155 | Large intestine perforation | FAERS: 5 | US FAERS | |
| 156 | Liver Abscess | FAERS: 5 | US FAERS | |
| 157 | Mental status changes | FAERS: 5 | US FAERS | |
| 158 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 159 | Night sweats | FAERS: 5 | US FAERS | |
| 160 | Pleurisy | FAERS: 5 | US FAERS | |
| 161 | Pneumocystis jiroveci pneumonia | FAERS: 5 | US FAERS | |
| 162 | Product dose omission | FAERS: 5 | US FAERS | |
| 163 | Pulmonary thrombosis | FAERS: 5 | US FAERS | |
| 164 | Tinnitus | FAERS: 5 | US FAERS | |
| 165 | Visual brightness | FAERS: 5 | US FAERS | |
| 166 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 167 | Aphagia | FAERS: 4 | US FAERS | |
| 168 | Ataxia | FAERS: 4 | US FAERS | |
| 169 | Blood urine present | FAERS: 4 | US FAERS | |
| 170 | Cardiac Tamponade | FAERS: 4 | US FAERS | |
| 171 | Colitis | FAERS: 4 | US FAERS | |
| 172 | Completed Suicide | FAERS: 4 | US FAERS | |
| 173 | Cytopenia | FAERS: 4 | US FAERS | |
| 174 | Delirium | FAERS: 4 | US FAERS | |
| 175 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 176 | Discomfort | FAERS: 4 | US FAERS | |
| 177 | Eczema | FAERS: 4 | US FAERS | |
| 178 | Epilepsy | FAERS: 4 | US FAERS | |
| 179 | Erythema Multiforme | FAERS: 4 | US FAERS | |
| 180 | Fracture | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 181 | Gastritis | FAERS: 4 | US FAERS | |
| 182 | Gastroenteritis | FAERS: 4 | US FAERS | |
| 183 | Haematotoxicity | FAERS: 4 | US FAERS | |
| 184 | Hemiparesis | FAERS: 4 | US FAERS | |
| 185 | Hydrothorax | FAERS: 4 | US FAERS | |
| 186 | Hypersomnia | FAERS: 4 | US FAERS | |
| 187 | Ileus | FAERS: 4 | US FAERS | |
| 188 | Inappropriate schedule of drug administration | FAERS: 4 | US FAERS | |
| 189 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 190 | Lymphopenia | FAERS: 4 | 22954507 | CTD SIDER US FAERS |
| 191 | Malignant neoplasm progression | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 192 | Meningitis | FAERS: 4 | US FAERS | |
| 193 | Myocardial necrosis marker increased | FAERS: 4 | US FAERS | |
| 194 | Myocardial strain | FAERS: 4 | US FAERS | |
| 195 | Myopathy | FAERS: 4 | US FAERS | |
| 196 | Nervousness | FAERS: 4 | US FAERS | |
| 197 | Neuralgia | FAERS: 4 | SIDER US FAERS | |
| 198 | Neutrophil count decreased | FAERS: 4 | SIDER US FAERS | |
| 199 | Ocular discomfort | FAERS: 4 | US FAERS | |
| 200 | Peritonitis | FAERS: 4 | US FAERS | |
| 201 | Radiation Pneumonitis | FAERS: 4 | US FAERS | |
| 202 | Renal hydrocele | FAERS: 4 | US FAERS | |
| 203 | Respiratory arrest | FAERS: 4 | US FAERS | |
| 204 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 205 | Rhabdomyolysis | FAERS: 4 | US FAERS | |
| 206 | Sinus bradycardia | FAERS: 4 | SIDER US FAERS | |
| 207 | Sinusitis | FAERS: 4 | US FAERS | |
| 208 | Sudden death | FAERS: 4 | US FAERS | |
| 209 | Toothache | FAERS: 4 | US FAERS | |
| 210 | Urticaria | FAERS: 4 | US FAERS | |
| 211 | Agitation | FAERS: 3 | US FAERS | |
| 212 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 213 | Angioedema | FAERS: 3 | US FAERS | |
| 214 | Ankle Fracture | FAERS: 3 | US FAERS | |
| 215 | Asphyxia | FAERS: 3 | US FAERS | |
| 216 | Back disorder | FAERS: 3 | US FAERS | |
| 217 | Blood count abnormal | FAERS: 3 | US FAERS | |
| 218 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 219 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 220 | Cachexia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 221 | Central nervous system lesion | FAERS: 3 | US FAERS | |
| 222 | Choking sensation | FAERS: 3 | US FAERS | |
| 223 | Cholestasis | FAERS: 3 | US FAERS | |
| 224 | Chromatopsia | FAERS: 3 | US FAERS | |
| 225 | Cyst | FAERS: 3 | US FAERS | |
| 226 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 227 | Disease recurrence | FAERS: 3 | US FAERS | |
| 228 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 229 | Dreamy state | FAERS: 3 | US FAERS | |
| 230 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 231 | Epigastric discomfort | FAERS: 3 | US FAERS | |
| 232 | Epistaxis | FAERS: 3 | US FAERS | |
| 233 | Eye irritation | FAERS: 3 | US FAERS | |
| 234 | Eye pain | FAERS: 3 | US FAERS | |
| 235 | Facial paralysis | FAERS: 3 | US FAERS | |
| 236 | Foreign body in respiratory tract | FAERS: 3 | US FAERS | |
| 237 | Gait inability | FAERS: 3 | US FAERS | |
| 238 | Gastrointestinal amyloidosis | FAERS: 3 | US FAERS | |
| 239 | Hepatic Encephalopathy | FAERS: 3 | US FAERS | |
| 240 | Hyperpyrexia | FAERS: 3 | US FAERS | |
| 241 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 242 | Impaired driving ability | FAERS: 3 | US FAERS | |
| 243 | Intentional drug misuse | FAERS: 3 | US FAERS | |
| 244 | Joint injury | FAERS: 3 | US FAERS | |
| 245 | Lip swelling | FAERS: 3 | US FAERS | |
| 246 | Muscle strain | FAERS: 3 | US FAERS | |
| 247 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 248 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 249 | Neuroblastoma | FAERS: 3 | 22266870 22588779 22789543 | CTD US FAERS |
| 250 | Optic Atrophy | FAERS: 3 | US FAERS | |
| 251 | Pancytopenia | FAERS: 3 | US FAERS | |
| 252 | Pericarditis | FAERS: 3 | US FAERS | |
| 253 | Poor quality product administered | FAERS: 3 | US FAERS | |
| 254 | Presyncope | FAERS: 3 | US FAERS | |
| 255 | Product size issue | FAERS: 3 | US FAERS | |
| 256 | Product use complaint | FAERS: 3 | US FAERS | |
| 257 | Proteinuria | FAERS: 3 | US FAERS | |
| 258 | Psoas Abscess | FAERS: 3 | US FAERS | |
| 259 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 260 | Pulmonary toxicity | FAERS: 3 | US FAERS | |
| 261 | Sciatica | FAERS: 3 | US FAERS | |
| 262 | Skin lesion | FAERS: 3 | US FAERS | |
| 263 | Suicide attempt | FAERS: 3 | US FAERS | |
| 264 | Vocal Cord Paralysis | FAERS: 3 | US FAERS | |
| 265 | Abdominal Abscess | FAERS: 2 | US FAERS | |
| 266 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 267 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 268 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 269 | Adverse event | FAERS: 2 | US FAERS | |
| 270 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 271 | Aphasia | FAERS: 2 | US FAERS | |
| 272 | Aphonia | FAERS: 2 | US FAERS | |
| 273 | Asthenopia | FAERS: 2 | US FAERS | |
| 274 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 275 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 276 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 277 | Blood lactate dehydrogenase | FAERS: 2 | US FAERS | |
| 278 | Blood pressure fluctuation | FAERS: 2 | US FAERS | |
| 279 | Blood thyroid stimulating hormone increased | FAERS: 2 | US FAERS | |
| 280 | Bone pain | FAERS: 2 | US FAERS | |
| 281 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 282 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 283 | Bronchopulmonary Aspergillosis | FAERS: 2 | US FAERS | |
| 284 | Candidiasis | FAERS: 2 | US FAERS | |
| 285 | Cardiac stress test abnormal | FAERS: 2 | US FAERS | |
| 286 | Chemical injury | FAERS: 2 | US FAERS | |
| 287 | Choking | FAERS: 2 | US FAERS | |
| 288 | Cholangitis | FAERS: 2 | US FAERS | |
| 289 | Chromaturia | FAERS: 2 | US FAERS | |
| 290 | Clubbing | FAERS: 2 | US FAERS | |
| 291 | Cold sweat | FAERS: 2 | US FAERS | |
| 292 | Conjunctival irritation | FAERS: 2 | US FAERS | |
| 293 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 294 | Cystitis | FAERS: 2 | US FAERS | |
| 295 | Cytolytic hepatitis | FAERS: 2 | US FAERS | |
| 296 | Depressed mood | FAERS: 2 | US FAERS | |
| 297 | Dermatitis acneiform | FAERS: 2 | US FAERS | |
| 298 | Diffuse alveolar damage | FAERS: 2 | US FAERS | |
| 299 | Diverticulitis | FAERS: 2 | US FAERS | |
| 300 | Drooling | FAERS: 2 | US FAERS | |
| 301 | Dysarthria | FAERS: 2 | US FAERS | |
| 302 | Dysgraphia | FAERS: 2 | US FAERS | |
| 303 | Emotional disorder | FAERS: 2 | US FAERS | |
| 304 | Endocarditis | FAERS: 2 | US FAERS | |
| 305 | Eosinophilia | FAERS: 2 | US FAERS | |
| 306 | Erysipelas | FAERS: 2 | US FAERS | |
| 307 | Febrile infection | FAERS: 2 | US FAERS | |
| 308 | Feeling Cold | FAERS: 2 | US FAERS | |
| 309 | Fibrosis | FAERS: 2 | US FAERS | |
| 310 | Flank Pain | FAERS: 2 | US FAERS | |
| 311 | Flushing | FAERS: 2 | US FAERS | |
| 312 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 313 | Gastrointestinal motility disorder | FAERS: 2 | US FAERS | |
| 314 | Gastrointestinal perforation | FAERS: 2 | SIDER US FAERS | |
| 315 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 316 | Gout | FAERS: 2 | US FAERS | |
| 317 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 318 | Hepatic necrosis | FAERS: 2 | US FAERS | |
| 319 | Hernia | FAERS: 2 | US FAERS | |
| 320 | Hyperphagia | FAERS: 2 | US FAERS | |
| 321 | Hypertransaminasaemia | FAERS: 2 | US FAERS | |
| 322 | Impaired gastric emptying | FAERS: 2 | US FAERS | |
| 323 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 324 | Increased bronchial secretion | FAERS: 2 | US FAERS | |
| 325 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 326 | Intervertebral Disc Degeneration | FAERS: 2 | US FAERS | |
| 327 | Keratopathy | FAERS: 2 | US FAERS | |
| 328 | Laryngitis | FAERS: 2 | US FAERS | |
| 329 | Leukoencephalopathy | FAERS: 2 | US FAERS | |
| 330 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 331 | Lymphoma | FAERS: 2 | US FAERS | |
| 332 | Mental impairment | FAERS: 2 | US FAERS | |
| 333 | Monoplegia | FAERS: 2 | US FAERS | |
| 334 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 335 | Neck Pain | FAERS: 2 | US FAERS | |
| 336 | Neoplasm swelling | FAERS: 2 | US FAERS | |
| 337 | Nodule | FAERS: 2 | US FAERS | |
| 338 | Non-cardiac chest pain | FAERS: 2 | US FAERS | |
| 339 | Optic Neuropathy | FAERS: 2 | US FAERS | |
| 340 | Oropharyngeal blistering | FAERS: 2 | US FAERS | |
| 341 | Overdose | FAERS: 2 | US FAERS | |
| 342 | Oxygen saturation abnormal | FAERS: 2 | US FAERS | |
| 343 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 344 | Perinephric collection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 345 | Polyneuropathy | FAERS: 2 | SIDER US FAERS | |
| 346 | Portal Vein Thrombosis | FAERS: 2 | US FAERS | |
| 347 | Post procedural complication | FAERS: 2 | US FAERS | |
| 348 | Product physical issue | FAERS: 2 | US FAERS | |
| 349 | Protein total decreased | FAERS: 2 | US FAERS | |
| 350 | Protein urine present | FAERS: 2 | US FAERS | |
| 351 | Psychiatric decompensation | FAERS: 2 | US FAERS | |
| 352 | Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 353 | Pyopneumothorax | FAERS: 2 | US FAERS | |
| 354 | Radiation injury | FAERS: 2 | US FAERS | |
| 355 | Reflux gastritis | FAERS: 2 | US FAERS | |
| 356 | Retinal vascular occlusion | FAERS: 2 | US FAERS | |
| 357 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 358 | Rhinitis | FAERS: 2 | US FAERS | |
| 359 | Shock | FAERS: 2 | SIDER US FAERS | |
| 360 | Skin irritation | FAERS: 2 | US FAERS | |
| 361 | Sluggishness | FAERS: 2 | US FAERS | |
| 362 | Sneezing | FAERS: 2 | US FAERS | |
| 363 | Soft Tissue Infection | FAERS: 2 | US FAERS | |
| 364 | Splenic abscess | FAERS: 2 | US FAERS | |
| 365 | Stevens-Johnson Syndrome | FAERS: 2 | US FAERS | |
| 366 | Stupor | FAERS: 2 | US FAERS | |
| 367 | Therapeutic response unexpected | FAERS: 2 | US FAERS | |
| 368 | Tongue blistering | FAERS: 2 | US FAERS | |
| 369 | Ulcer | FAERS: 2 | US FAERS | |
| 370 | Upper respiratory tract inflammation | FAERS: 2 | US FAERS | |
| 371 | Uveitis | FAERS: 2 | US FAERS | |
| 372 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 373 | Abdominal sepsis | FAERS: 1 | US FAERS | |
| 374 | Accidental death | FAERS: 1 | US FAERS | |
| 375 | Accidental overdose | FAERS: 1 | US FAERS | |
| 376 | Acidosis | FAERS: 1 | US FAERS | |
| 377 | Acute Coronary Syndrome | FAERS: 1 | US FAERS | |
| 378 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 379 | Acute polyneuropathy | FAERS: 1 | US FAERS | |
| 380 | Adenocarcinoma | FAERS: 1 | 22042947 | CTD US FAERS |
| 381 | Adenosquamous cell lung cancer | FAERS: 1 | US FAERS | |
| 382 | Administration site bruise | FAERS: 1 | US FAERS | |
| 383 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 384 | Amaurosis | FAERS: 1 | US FAERS | |
| 385 | Amylase increased | FAERS: 1 | US FAERS | |
| 386 | Anaplastic astrocytoma | FAERS: 1 | US FAERS | |
| 387 | Anaplastic large cell lymphoma T- and null-cell types refractory | FAERS: 1 | US FAERS | |
| 388 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 389 | Anti-thyroid antibody positive | FAERS: 1 | US FAERS | |
| 390 | Anuria | FAERS: 1 | US FAERS | |
| 391 | Aortic Injury | FAERS: 1 | US FAERS | |
| 392 | Apparent death | FAERS: 1 | US FAERS | |
| 393 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 394 | Arthritis | FAERS: 1 | US FAERS | |
| 395 | Asthma | FAERS: 1 | US FAERS | |
| 396 | Atelectasis | FAERS: 1 | US FAERS | |
| 397 | Aura | FAERS: 1 | US FAERS | |
| 398 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 399 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 400 | Biliary tract infection | FAERS: 1 | US FAERS | |
| 401 | Bladder pain | FAERS: 1 | US FAERS | |
| 402 | Blood alkaline phosphatase abnormal | FAERS: 1 | US FAERS | |
| 403 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 404 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 405 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 406 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 407 | Blood fibrinogen decreased | FAERS: 1 | US FAERS | |
| 408 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 409 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 410 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 411 | Blood thyroid stimulating hormone abnormal | FAERS: 1 | US FAERS | |
| 412 | Blood urea increased | FAERS: 1 | US FAERS | |
| 413 | Bone lesion | FAERS: 1 | US FAERS | |
| 414 | Bone marrow necrosis | FAERS: 1 | US FAERS | |
| 415 | Brachiocephalic vein thrombosis | FAERS: 1 | US FAERS | |
| 416 | Brain Death | FAERS: 1 | US FAERS | |
| 417 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 418 | Bronchial Fistula | FAERS: 1 | US FAERS | |
| 419 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 420 | Capsule physical issue | FAERS: 1 | US FAERS | |
| 421 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 422 | Cardiac Hypertrophy | FAERS: 1 | US FAERS | |
| 423 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 424 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 425 | Cell marker increased | FAERS: 1 | US FAERS | |
| 426 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 427 | Cerebral congestion | FAERS: 1 | US FAERS | |
| 428 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 429 | Cholangiocarcinoma | FAERS: 1 | US FAERS | |
| 430 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 431 | Chylothorax | FAERS: 1 | US FAERS | |
| 432 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 433 | Compression fracture | FAERS: 1 | US FAERS | |
| 434 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 435 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 436 | Cyanopsia | FAERS: 1 | US FAERS | |
| 437 | Delusional perception | FAERS: 1 | US FAERS | |
| 438 | Device Failure | FAERS: 1 | US FAERS | |
| 439 | Device dislocation | FAERS: 1 | US FAERS | |
| 440 | Device occlusion | FAERS: 1 | US FAERS | |
| 441 | Device related infection | FAERS: 1 | US FAERS | |
| 442 | Device related thrombosis | FAERS: 1 | US FAERS | |
| 443 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 444 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 445 | Dropped head syndrome | FAERS: 1 | US FAERS | |
| 446 | Drug administered to patient of inappropriate age | FAERS: 1 | US FAERS | |
| 447 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 448 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 449 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 450 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 451 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 452 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 453 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 454 | Dyslalia | FAERS: 1 | US FAERS | |
| 455 | Dystonia | FAERS: 1 | US FAERS | |
| 456 | Ecchymosis | FAERS: 1 | US FAERS | |
| 457 | Electrocardiogram QT interval abnormal | FAERS: 1 | US FAERS | |
| 458 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 459 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 460 | Embolic stroke | FAERS: 1 | US FAERS | |
| 461 | Empyema | FAERS: 1 | US FAERS | |
| 462 | Encephalitis | FAERS: 1 | US FAERS | |
| 463 | Encephalomalacia | FAERS: 1 | US FAERS | |
| 464 | Endophthalmitis | FAERS: 1 | US FAERS | |
| 465 | Enteritis | FAERS: 1 | US FAERS | |
| 466 | Enterocolitis | FAERS: 1 | US FAERS | |
| 467 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 468 | Eschar | FAERS: 1 | US FAERS | |
| 469 | Escherichia sepsis | FAERS: 1 | US FAERS | |
| 470 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 471 | Euphoric mood | FAERS: 1 | US FAERS | |
| 472 | Exposure via partner | FAERS: 1 | US FAERS | |
| 473 | Extra dose administered | FAERS: 1 | US FAERS | |
| 474 | Eye Infection | FAERS: 1 | US FAERS | |
| 475 | Eye symptom | FAERS: 1 | US FAERS | |
| 476 | Feeling jittery | FAERS: 1 | US FAERS | |
| 477 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 478 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 479 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 480 | Gastrointestinal carcinoma | FAERS: 1 | US FAERS | |
| 481 | Gastrointestinal wall thickening | FAERS: 1 | US FAERS | |
| 482 | Gene Mutation | FAERS: 1 | US FAERS | |
| 483 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 484 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 485 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 486 | Head discomfort | FAERS: 1 | US FAERS | |
| 487 | Hemiplegia | FAERS: 1 | US FAERS | |
| 488 | Hepatitis B | FAERS: 1 | US FAERS | |
| 489 | Hepatitis E | FAERS: 1 | US FAERS | |
| 490 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 491 | Hirsutism | FAERS: 1 | US FAERS | |
| 492 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 493 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 494 | Hygroma colli | FAERS: 1 | US FAERS | |
| 495 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 496 | Hypokinesia | FAERS: 1 | US FAERS | |
| 497 | Ileal ulcer | FAERS: 1 | US FAERS | |
| 498 | Incision site infection | FAERS: 1 | US FAERS | |
| 499 | Incoherent | FAERS: 1 | US FAERS | |
| 500 | Incontinence | FAERS: 1 | US FAERS | |
| 501 | Incorrect route of product administration | FAERS: 1 | US FAERS | |
| 502 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 503 | Infarction | FAERS: 1 | US FAERS | |
| 504 | Insurance issue | FAERS: 1 | US FAERS | |
| 505 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 506 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 507 | Joint Instability | FAERS: 1 | US FAERS | |
| 508 | Keratitis | FAERS: 1 | US FAERS | |
| 509 | Keratoconus | FAERS: 1 | US FAERS | |
| 510 | Long QT Syndrome | FAERS: 1 | US FAERS | |
| 511 | Lung cyst | FAERS: 1 | US FAERS | |
| 512 | Lymphangitis | FAERS: 1 | US FAERS | |
| 513 | Lymphatic duct injury | FAERS: 1 | US FAERS | |
| 514 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 515 | Mastoiditis | FAERS: 1 | US FAERS | |
| 516 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 517 | Meningioma | FAERS: 1 | US FAERS | |
| 518 | Meningorrhagia | FAERS: 1 | US FAERS | |
| 519 | Metamorphopsia | FAERS: 1 | US FAERS | |
| 520 | Metastasis | FAERS: 1 | US FAERS | |
| 521 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 522 | Metastatic salivary gland cancer | FAERS: 1 | US FAERS | |
| 523 | Microcytosis | FAERS: 1 | US FAERS | |
| 524 | Miliaria | FAERS: 1 | US FAERS | |
| 525 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 526 | Muscle abscess | FAERS: 1 | US FAERS | |
| 527 | Muscle tightness | FAERS: 1 | US FAERS | |
| 528 | Mutism | FAERS: 1 | US FAERS | |
| 529 | Myelitis | FAERS: 1 | US FAERS | |
| 530 | Myoglobinuria | FAERS: 1 | US FAERS | |
| 531 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 532 | Necrosis | FAERS: 1 | US FAERS | |
| 533 | Nephritis | FAERS: 1 | US FAERS | |
| 534 | Nerve injury | FAERS: 1 | US FAERS | |
| 535 | Non-small cell lung cancer stage IIIA | FAERS: 1 | US FAERS | |
| 536 | Ocular Toxicity | FAERS: 1 | US FAERS | |
| 537 | Ocular icterus | FAERS: 1 | US FAERS | |
| 538 | Oliguria | FAERS: 1 | US FAERS | |
| 539 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 540 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 541 | Oral discharge | FAERS: 1 | US FAERS | |
| 542 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 543 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 544 | Oral pain | FAERS: 1 | US FAERS | |
| 545 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 546 | Oropharyngeal swelling | FAERS: 1 | US FAERS | |
| 547 | Osteolysis | FAERS: 1 | US FAERS | |
| 548 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 549 | Osteoporosis | FAERS: 1 | US FAERS | |
| 550 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 551 | Pain of skin | FAERS: 1 | US FAERS | |
| 552 | Pallor | FAERS: 1 | US FAERS | |
| 553 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 554 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 555 | Paraplegia | FAERS: 1 | US FAERS | |
| 556 | Parenteral Nutrition | FAERS: 1 | US FAERS | |
| 557 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 558 | Pelvic venous thrombosis | FAERS: 1 | US FAERS | |
| 559 | Perineal pain | FAERS: 1 | US FAERS | |
| 560 | Perinephritis | FAERS: 1 | US FAERS | |
| 561 | Personality Change | FAERS: 1 | US FAERS | |
| 562 | Pharyngitis | FAERS: 1 | US FAERS | |
| 563 | Phlebitis | FAERS: 1 | US FAERS | |
| 564 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 565 | Polyuria | FAERS: 1 | US FAERS | |
| 566 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 567 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 568 | Poverty of speech | FAERS: 1 | US FAERS | |
| 569 | Prerenal failure | FAERS: 1 | US FAERS | |
| 570 | Presbyopia | FAERS: 1 | US FAERS | |
| 571 | Primary Hypothyroidism | FAERS: 1 | US FAERS | |
| 572 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 573 | Product storage error | FAERS: 1 | US FAERS | |
| 574 | Protein Deficiency | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 575 | Prothrombin time ratio decreased | FAERS: 1 | US FAERS | |
| 576 | Psoriasis | FAERS: 1 | US FAERS | |
| 577 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 578 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 579 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 580 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 581 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 582 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 583 | Radiation interaction | FAERS: 1 | US FAERS | |
| 584 | Regurgitation | FAERS: 1 | US FAERS | |
| 585 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 586 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 587 | Restlessness | FAERS: 1 | US FAERS | |
| 588 | Retinal deposits | FAERS: 1 | US FAERS | |
| 589 | Rhinalgia | FAERS: 1 | US FAERS | |
| 590 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 591 | Sarcoma | FAERS: 1 | US FAERS | |
| 592 | Scab | FAERS: 1 | US FAERS | |
| 593 | Scleroderma | FAERS: 1 | US FAERS | |
| 594 | Secretion discharge | FAERS: 1 | US FAERS | |
| 595 | Senile dementia | FAERS: 1 | US FAERS | |
| 596 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 597 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 598 | Sinus headache | FAERS: 1 | US FAERS | |
| 599 | Skin Induration | FAERS: 1 | US FAERS | |
| 600 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 601 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 602 | Skin texture abnormal | FAERS: 1 | US FAERS | |
| 603 | Skin toxicity | FAERS: 1 | US FAERS | |
| 604 | Soft tissue inflammation | FAERS: 1 | US FAERS | |
| 605 | Soft tissue necrosis | FAERS: 1 | US FAERS | |
| 606 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 607 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 608 | Stress | FAERS: 1 | US FAERS | |
| 609 | Superinfection | FAERS: 1 | US FAERS | |
| 610 | Therapy change | FAERS: 1 | US FAERS | |
| 611 | Thyroid cancer metastatic | FAERS: 1 | US FAERS | |
| 612 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 613 | Tonsillitis | FAERS: 1 | US FAERS | |
| 614 | Tooth Loss | FAERS: 1 | US FAERS | |
| 615 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 616 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 617 | Trismus | FAERS: 1 | US FAERS | |
| 618 | Tuberculosis | FAERS: 1 | US FAERS | |
| 619 | Unevaluable event | FAERS: 1 | US FAERS | |
| 620 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 621 | Urethritis | FAERS: 1 | US FAERS | |
| 622 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 623 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 624 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 625 | Vasculitic ulcer | FAERS: 1 | US FAERS | |
| 626 | Venous thrombosis limb | FAERS: 1 | US FAERS | |
| 627 | Ventricular Fibrillation | FAERS: 1 | US FAERS | |
| 628 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 629 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 630 | Wound dehiscence | FAERS: 1 | US FAERS | |
| 631 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 632 | Zinc deficiency | FAERS: 1 | US FAERS | |
| 633 | skin abrasion | FAERS: 1 | US FAERS | |
| 634 | treatment failure | FAERS: 1 | US FAERS | |
| 635 | Blood and lymphatic system disorders | SIDER | ||
| 636 | Chemical and Drug Induced Liver Injury | 23686600 | CTD | |
| 637 | Congenital renal cyst | SIDER | ||
| 638 | Dermatitis | SIDER | ||
| 639 | Diarrhea | 21757253 22954507 23686600 | CTD | |
| 640 | Edema | 22954507 | CTD | |
| 641 | Esophageal Neoplasms | 22042947 | CTD | |
| 642 | Gastrointestinal Diseases | 20979469 23020724 | CTD | |
| 643 | Glioblastoma | 22162573 | CTD | |
| 644 | Granuloma, Plasma Cell | 20979472 | CTD | |
| 645 | Heart Diseases | 23707608 | CTD | |
| 646 | Hypogonadism | 22488744 23686600 | CTD | |
| 647 | Hypophosphatemia | 22954507 | CTD | |
| 648 | Infestation | SIDER | ||
| 649 | Lymphatic Metastasis | 21757253 | CTD | |
| 650 | Meningeal Carcinomatosis | 22385925 | CTD | |
| 651 | Neoplasm Metastasis | 22999080 | CTD | |
| 652 | Neoplasms, Experimental | CTD | ||
| 653 | Neoplasms | 21812414 | CTD | |
| 654 | Neuropathy | SIDER | ||
| 655 | Stomach Neoplasms | 22042947 22729845 | CTD | |
| 656 | Vision Disorders | CTD | ||
| 657 | Visual disturbance | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.