Naltrexone
(DQCKKXVULJGBQN-XFWGSAIBSA-N)
Structure
- SMILES
- O=C1CC[C@@]2([C@@]34[C@H]1Oc1c4c(C[C@H]2N(CC3)CC2CC2)ccc1O)O
- Type(s)
- Approved; Investigational; Vet_approved
- ATC code(s)
- A08AA62; N02AA56; N07BB04
- Molecular Formula:
- C20H23NO4
- Molecular Weight:
- 341.401
- Log P:
- 1.4633
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 70
- CAS Number(s):
- 16590-41-3
Synonym(s)
1.
Naltrexone
2.
Antaxone
3.
Celupan
4.
EN-1639A
5.
Nalorex
6.
Naltrexone Hydrochloride
7.
Nemexin
8.
ReVia
9.
Trexan
10.
EN 1639A
11.
EN1639A
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Injection Site Reaction | FAERS: 1851 | SIDER US FAERS | |
| 2 | Injection site pain | FAERS: 1103 | SIDER US FAERS | |
| 3 | Injection site mass | FAERS: 682 | OFFSIDES US FAERS | |
| 4 | Drug Dependence | FAERS: 627 | SIDER US FAERS | |
| 5 | Nausea | FAERS: 614 Canada Vigilance: 1 | CTD OFFSIDES SIDER Canada Vigilance US FAERS | |
| 6 | Fatigue | FAERS: 580 | 15517116 17514344 | CTD SIDER US FAERS |
| 7 | Headache | FAERS: 509 Canada Vigilance: 1 | CTD SIDER Canada Vigilance US FAERS | |
| 8 | Feeling abnormal | FAERS: 445 | OFFSIDES SIDER US FAERS | |
| 9 | Pain | FAERS: 425 Canada Vigilance: 1 | 19453963 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 10 | Malaise | FAERS: 336 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 11 | Overdose | FAERS: 332 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Drug ineffective | FAERS: 323 Canada Vigilance: 6 | Canada Vigilance OFFSIDES US FAERS | |
| 13 | Anxiety | FAERS: 316 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | Drug dose omission | FAERS: 293 | US FAERS | |
| 15 | Vomiting | FAERS: 258 Canada Vigilance: 3 | 15517116 16534857 19453814 | CTD SIDER Canada Vigilance US FAERS |
| 16 | Drug abuse | FAERS: 251 | US FAERS | |
| 17 | Dizziness | FAERS: 233 Canada Vigilance: 2 | 15517116 16534857 19453814 | CTD SIDER Canada Vigilance US FAERS |
| 18 | Needle issue | FAERS: 185 | US FAERS | |
| 19 | Tremor | FAERS: 167 Canada Vigilance: 3 | 15912139 | CTD SIDER Canada Vigilance US FAERS |
| 20 | Drug administration error | FAERS: 159 | OFFSIDES US FAERS | |
| 21 | Drug screen positive | FAERS: 155 | OFFSIDES US FAERS | |
| 22 | Arthralgia | FAERS: 153 | SIDER US FAERS | |
| 23 | Asthenia | FAERS: 133 | OFFSIDES SIDER US FAERS | |
| 24 | Somnolence | FAERS: 125 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Drug withdrawal syndrome | FAERS: 112 | SIDER US FAERS | |
| 26 | Dependence | FAERS: 109 | US FAERS | |
| 27 | Product dose omission | FAERS: 104 | US FAERS | |
| 28 | Back Pain | FAERS: 99 | SIDER US FAERS | |
| 29 | Myalgia | FAERS: 97 | SIDER US FAERS | |
| 30 | Inappropriate schedule of product administration | FAERS: 96 | US FAERS | |
| 31 | Euphoric mood | FAERS: 93 | SIDER US FAERS | |
| 32 | Product administered at inappropriate site | FAERS: 92 | US FAERS | |
| 33 | Abdominal discomfort | FAERS: 91 | OFFSIDES SIDER US FAERS | |
| 34 | Depressed mood | FAERS: 90 | SIDER US FAERS | |
| 35 | Injection site erythema | FAERS: 90 | OFFSIDES US FAERS | |
| 36 | Inappropriate schedule of drug administration | FAERS: 88 | US FAERS | |
| 37 | Injection site abscess | FAERS: 81 | US FAERS | |
| 38 | Weight decreased | FAERS: 77 | SIDER US FAERS | |
| 39 | Wrong technique in product usage process | FAERS: 77 | US FAERS | |
| 40 | Pregnancy | FAERS: 76 | SIDER US FAERS | |
| 41 | Alcohol poisoning | FAERS: 70 | OFFSIDES US FAERS | |
| 42 | Injection site bruising | FAERS: 70 | SIDER US FAERS | |
| 43 | Nasopharyngitis | FAERS: 67 | OFFSIDES SIDER US FAERS | |
| 44 | Restlessness | FAERS: 67 | US FAERS | |
| 45 | Lethargy | FAERS: 64 | 16534857 | CTD SIDER US FAERS |
| 46 | Injection site warmth | FAERS: 62 | US FAERS | |
| 47 | Product quality issue | FAERS: 62 | US FAERS | |
| 48 | Injection site pruritus | FAERS: 61 | OFFSIDES SIDER US FAERS | |
| 49 | Apathy | FAERS: 59 | US FAERS | |
| 50 | Anger | FAERS: 57 | US FAERS | |
| 51 | Chills | FAERS: 57 | SIDER US FAERS | |
| 52 | Unevaluable event | FAERS: 55 | OFFSIDES US FAERS | |
| 53 | Hypersensitivity | FAERS: 53 | SIDER US FAERS | |
| 54 | Injection site discomfort | FAERS: 52 | US FAERS | |
| 55 | Stress | FAERS: 50 | US FAERS | |
| 56 | Toothache | FAERS: 50 | SIDER US FAERS | |
| 57 | Abdominal Pain | FAERS: 49 | 999987 16195116 16534857 | CTD SIDER US FAERS |
| 58 | Alcohol abuse | FAERS: 49 | SIDER US FAERS | |
| 59 | Pneumonia | FAERS: 49 | SIDER US FAERS | |
| 60 | Restless Legs Syndrome | FAERS: 49 | US FAERS | |
| 61 | Pruritus | FAERS: 48 | CTD SIDER US FAERS | |
| 62 | Chest Pain | FAERS: 47 | SIDER US FAERS | |
| 63 | Crying | FAERS: 47 | SIDER US FAERS | |
| 64 | Dehydration | FAERS: 46 | OFFSIDES SIDER US FAERS | |
| 65 | Infection | FAERS: 46 | SIDER US FAERS | |
| 66 | Agitation | FAERS: 45 | SIDER US FAERS | |
| 67 | Syncope | FAERS: 45 | SIDER US FAERS | |
| 68 | Emotional distress | FAERS: 42 | US FAERS | |
| 69 | Hypersomnia | FAERS: 42 | US FAERS | |
| 70 | Injection site nodule | FAERS: 42 | OFFSIDES US FAERS | |
| 71 | Mood swings | FAERS: 41 | US FAERS | |
| 72 | Product administration error | FAERS: 41 | US FAERS | |
| 73 | Acne | FAERS: 39 | US FAERS | |
| 74 | Loss of personal independence in daily activities | FAERS: 39 | US FAERS | |
| 75 | Memory impairment | FAERS: 38 | US FAERS | |
| 76 | Drug screen false positive | FAERS: 37 | US FAERS | |
| 77 | Constipation | FAERS: 36 | SIDER US FAERS | |
| 78 | Nervousness | FAERS: 36 | SIDER US FAERS | |
| 79 | Peripheral swelling | FAERS: 35 | US FAERS | |
| 80 | Inadequate analgesia | FAERS: 34 | US FAERS | |
| 81 | Musculoskeletal stiffness | FAERS: 34 | SIDER US FAERS | |
| 82 | Chromaturia | FAERS: 33 | US FAERS | |
| 83 | Completed Suicide | FAERS: 33 | SIDER US FAERS | |
| 84 | Musculoskeletal Pain | FAERS: 33 | US FAERS | |
| 85 | Discomfort | FAERS: 32 | SIDER US FAERS | |
| 86 | Palpitations | FAERS: 32 | SIDER US FAERS | |
| 87 | Swelling | FAERS: 32 | SIDER US FAERS | |
| 88 | Alopecia | FAERS: 31 | SIDER US FAERS | |
| 89 | Influenza | FAERS: 31 | SIDER US FAERS | |
| 90 | Urticaria | FAERS: 31 | SIDER US FAERS | |
| 91 | Cold sweat | FAERS: 30 | US FAERS | |
| 92 | Drug administered at inappropriate site | FAERS: 30 | US FAERS | |
| 93 | Injection site infection | FAERS: 30 | OFFSIDES US FAERS | |
| 94 | Hepatitis C | FAERS: 29 | SIDER US FAERS | |
| 95 | Adverse event | FAERS: 28 | US FAERS | |
| 96 | Dysgeusia | FAERS: 28 | SIDER US FAERS | |
| 97 | Emotional disorder | FAERS: 28 | US FAERS | |
| 98 | Sciatica | FAERS: 28 | US FAERS | |
| 99 | Feeling jittery | FAERS: 27 | US FAERS | |
| 100 | Infestation | FAERS: 27 | SIDER US FAERS | |
| 101 | Injection site inflammation | FAERS: 27 | OFFSIDES US FAERS | |
| 102 | Injection site necrosis | FAERS: 27 | US FAERS | |
| 103 | Amnesia | FAERS: 26 | US FAERS | |
| 104 | Joint swelling | FAERS: 26 | US FAERS | |
| 105 | Poisoning | FAERS: 26 | US FAERS | |
| 106 | Neck Pain | FAERS: 24 | US FAERS | |
| 107 | Dyspepsia | FAERS: 23 | US FAERS | |
| 108 | Injection site cellulitis | FAERS: 23 | US FAERS | |
| 109 | Procedural complication | FAERS: 23 | US FAERS | |
| 110 | nervous system disorder | FAERS: 23 | SIDER US FAERS | |
| 111 | Poor quality sleep | FAERS: 22 | SIDER US FAERS | |
| 112 | Tachycardia | FAERS: 22 | SIDER US FAERS | |
| 113 | Feeling Cold | FAERS: 21 | US FAERS | |
| 114 | Lack of injection site rotation | FAERS: 21 | US FAERS | |
| 115 | Sneezing | FAERS: 21 | SIDER US FAERS | |
| 116 | Tinnitus | FAERS: 21 | SIDER US FAERS | |
| 117 | Chest discomfort | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 118 | Nephrolithiasis | FAERS: 20 | US FAERS | |
| 119 | Sluggishness | FAERS: 20 | SIDER US FAERS | |
| 120 | Syringe issue | FAERS: 20 | US FAERS | |
| 121 | Tooth Extraction | FAERS: 20 | US FAERS | |
| 122 | Bedridden | FAERS: 19 | US FAERS | |
| 123 | Burning sensation | FAERS: 19 | OFFSIDES US FAERS | |
| 124 | Disorientation | FAERS: 19 | SIDER US FAERS | |
| 125 | Impaired work ability | FAERS: 19 | US FAERS | |
| 126 | Alcohol withdrawal syndrome | FAERS: 18 | OFFSIDES SIDER US FAERS | |
| 127 | Erythema | FAERS: 18 | 7340503 | CTD US FAERS |
| 128 | Frustration tolerance decreased | FAERS: 18 | US FAERS | |
| 129 | Joint injury | FAERS: 18 | US FAERS | |
| 130 | Limb injury | FAERS: 18 | OFFSIDES US FAERS | |
| 131 | Musculoskeletal discomfort | FAERS: 18 | SIDER US FAERS | |
| 132 | Product use issue | FAERS: 18 | US FAERS | |
| 133 | Visual Impairment | FAERS: 18 | US FAERS | |
| 134 | Muscle tightness | FAERS: 17 | US FAERS | |
| 135 | Night sweats | FAERS: 17 | SIDER US FAERS | |
| 136 | Suicide attempt | FAERS: 17 | SIDER US FAERS | |
| 137 | Abscess | FAERS: 16 | OFFSIDES US FAERS | |
| 138 | Activities of daily living impaired | FAERS: 16 | OFFSIDES US FAERS | |
| 139 | Bone pain | FAERS: 16 | US FAERS | |
| 140 | Paranoia | FAERS: 16 | SIDER US FAERS | |
| 141 | Product preparation error | FAERS: 16 | US FAERS | |
| 142 | Renal pain | FAERS: 16 | US FAERS | |
| 143 | Vertigo | FAERS: 16 | US FAERS | |
| 144 | Yawning | FAERS: 16 | SIDER US FAERS | |
| 145 | Erectile dysfunction | FAERS: 15 | US FAERS | |
| 146 | Incorrect route of drug administration | FAERS: 15 | US FAERS | |
| 147 | Injection site irritation | FAERS: 15 | US FAERS | |
| 148 | No adverse event | FAERS: 15 | US FAERS | |
| 149 | Oropharyngeal pain | FAERS: 15 | OFFSIDES SIDER US FAERS | |
| 150 | Presyncope | FAERS: 15 | US FAERS | |
| 151 | Ankle Fracture | FAERS: 14 | US FAERS | |
| 152 | Cardiac Arrest | FAERS: 14 | US FAERS | |
| 153 | Dysphonia | FAERS: 14 | OFFSIDES SIDER US FAERS | |
| 154 | Rehabilitation therapy | FAERS: 14 | US FAERS | |
| 155 | Anhedonia | FAERS: 13 | US FAERS | |
| 156 | Dental caries | FAERS: 13 | US FAERS | |
| 157 | Injection site urticaria | FAERS: 13 | US FAERS | |
| 158 | Lack of administration site rotation | FAERS: 13 | US FAERS | |
| 159 | Mental status changes | FAERS: 13 | US FAERS | |
| 160 | Cerebrovascular accident | FAERS: 12 | US FAERS | |
| 161 | Dry skin | FAERS: 12 | US FAERS | |
| 162 | Dysarthria | FAERS: 12 | US FAERS | |
| 163 | Hernia | FAERS: 12 | US FAERS | |
| 164 | Hypotension | FAERS: 12 | CTD US FAERS | |
| 165 | Injection site cyst | FAERS: 12 | US FAERS | |
| 166 | Limb discomfort | FAERS: 12 | US FAERS | |
| 167 | Oral pain | FAERS: 12 | US FAERS | |
| 168 | Pancreatitis | FAERS: 12 | OFFSIDES US FAERS | |
| 169 | Bronchitis | FAERS: 11 | SIDER US FAERS | |
| 170 | Feeling of body temperature change | FAERS: 11 | US FAERS | |
| 171 | Hepatitis | FAERS: 11 | OFFSIDES SIDER US FAERS | |
| 172 | Neuralgia | FAERS: 11 | OFFSIDES US FAERS | |
| 173 | Pallor | FAERS: 11 | US FAERS | |
| 174 | Personality Change | FAERS: 11 | US FAERS | |
| 175 | Wheezing | FAERS: 11 | US FAERS | |
| 176 | Aspartate Aminotransferase Increased | FAERS: 10 | SIDER US FAERS | |
| 177 | Cellulitis | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 178 | Emotional poverty | FAERS: 10 | US FAERS | |
| 179 | Eosinophilic Pneumonia | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 180 | Hunger | FAERS: 10 | US FAERS | |
| 181 | Mental impairment | FAERS: 10 | OFFSIDES US FAERS | |
| 182 | Product prescribing error | FAERS: 10 | US FAERS | |
| 183 | Thirst | FAERS: 10 | SIDER US FAERS | |
| 184 | Unresponsive to stimuli | FAERS: 10 | US FAERS | |
| 185 | Accidental overdose | FAERS: 9 | OFFSIDES US FAERS | |
| 186 | Alanine Aminotransferase Increased | FAERS: 9 | SIDER US FAERS | |
| 187 | Arthropathy | FAERS: 9 | US FAERS | |
| 188 | Back disorder | FAERS: 9 | US FAERS | |
| 189 | Incorrect route of product administration | FAERS: 9 | US FAERS | |
| 190 | Injection site nerve damage | FAERS: 9 | US FAERS | |
| 191 | Lower respiratory tract infection | FAERS: 9 | US FAERS | |
| 192 | Mydriasis | FAERS: 9 | US FAERS | |
| 193 | Myocardial Infarction | FAERS: 9 | SIDER US FAERS | |
| 194 | Ocular icterus | FAERS: 9 | US FAERS | |
| 195 | Opiates positive | FAERS: 9 | US FAERS | |
| 196 | Priapism | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Productive Cough | FAERS: 9 | US FAERS | |
| 198 | Rhabdomyolysis | FAERS: 9 | US FAERS | |
| 199 | Screaming | FAERS: 9 | US FAERS | |
| 200 | Sexual Dysfunction | FAERS: 9 | SIDER US FAERS | |
| 201 | Urinary tract infection | FAERS: 9 | SIDER US FAERS | |
| 202 | Abasia | FAERS: 8 | US FAERS | |
| 203 | Aphasia | FAERS: 8 | US FAERS | |
| 204 | Bipolar Disorder | FAERS: 8 | OFFSIDES US FAERS | |
| 205 | Carpal Tunnel Syndrome | FAERS: 8 | US FAERS | |
| 206 | Delirium | FAERS: 8 | 10506865 | CTD SIDER US FAERS |
| 207 | Diplopia | FAERS: 8 | OFFSIDES US FAERS | |
| 208 | Drug prescribing error | FAERS: 8 | US FAERS | |
| 209 | Dysuria | FAERS: 8 | US FAERS | |
| 210 | Flat affect | FAERS: 8 | US FAERS | |
| 211 | Flushing | FAERS: 8 | US FAERS | |
| 212 | General physical health deterioration | FAERS: 8 | US FAERS | |
| 213 | Head discomfort | FAERS: 8 | US FAERS | |
| 214 | Hypokinesia | FAERS: 8 | US FAERS | |
| 215 | Impaired driving ability | FAERS: 8 | US FAERS | |
| 216 | Incorrect product storage | FAERS: 8 | US FAERS | |
| 217 | Medication Error | FAERS: 8 | US FAERS | |
| 218 | Muscle strain | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 219 | Piloerection | FAERS: 8 | US FAERS | |
| 220 | Product storage error | FAERS: 8 | US FAERS | |
| 221 | Retching | FAERS: 8 | US FAERS | |
| 222 | Sinusitis | FAERS: 8 | SIDER US FAERS | |
| 223 | Therapeutic product effect decreased | FAERS: 8 | US FAERS | |
| 224 | Therapy cessation | FAERS: 8 | US FAERS | |
| 225 | Viral upper respiratory tract infection | FAERS: 8 | US FAERS | |
| 226 | jaundice | FAERS: 8 | US FAERS | |
| 227 | Appendicitis | FAERS: 7 | US FAERS | |
| 228 | Arthropod bite | FAERS: 7 | US FAERS | |
| 229 | Asthma | FAERS: 7 | US FAERS | |
| 230 | Blood creatinine increased | FAERS: 7 | US FAERS | |
| 231 | Diverticulitis | FAERS: 7 | US FAERS | |
| 232 | Eye pain | FAERS: 7 | US FAERS | |
| 233 | Flank Pain | FAERS: 7 | US FAERS | |
| 234 | Formication | FAERS: 7 | US FAERS | |
| 235 | Fracture pain | FAERS: 7 | US FAERS | |
| 236 | Hypoxia | FAERS: 7 | US FAERS | |
| 237 | Joint stiffness | FAERS: 7 | SIDER US FAERS | |
| 238 | Liquid product physical issue | FAERS: 7 | US FAERS | |
| 239 | Malabsorption from injection site | FAERS: 7 | US FAERS | |
| 240 | Middle insomnia | FAERS: 7 | US FAERS | |
| 241 | Necrosis | FAERS: 7 | US FAERS | |
| 242 | Negative thoughts | FAERS: 7 | US FAERS | |
| 243 | Photophobia | FAERS: 7 | US FAERS | |
| 244 | Product preparation issue | FAERS: 7 | US FAERS | |
| 245 | Pulmonary Embolism | FAERS: 7 | SIDER US FAERS | |
| 246 | Sepsis | FAERS: 7 | US FAERS | |
| 247 | Apparent death | FAERS: 6 | US FAERS | |
| 248 | Blood alcohol increased | FAERS: 6 | US FAERS | |
| 249 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 250 | Blood testosterone decreased | FAERS: 6 | US FAERS | |
| 251 | Blood urine present | FAERS: 6 | US FAERS | |
| 252 | Eye irritation | FAERS: 6 | US FAERS | |
| 253 | Food craving | FAERS: 6 | US FAERS | |
| 254 | Gait inability | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 255 | Hypophagia | FAERS: 6 | US FAERS | |
| 256 | Injection site injury | FAERS: 6 | US FAERS | |
| 257 | Injection site scar | FAERS: 6 | US FAERS | |
| 258 | Injection site vesicles | FAERS: 6 | OFFSIDES US FAERS | |
| 259 | Limb operation | FAERS: 6 | US FAERS | |
| 260 | Menorrhagia | FAERS: 6 | US FAERS | |
| 261 | Morbid thoughts | FAERS: 6 | US FAERS | |
| 262 | Skin reaction | FAERS: 6 | US FAERS | |
| 263 | Tachyphrenia | FAERS: 6 | US FAERS | |
| 264 | Tobacco user | FAERS: 6 | OFFSIDES US FAERS | |
| 265 | Tooth Loss | FAERS: 6 | US FAERS | |
| 266 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 267 | Acute kidney injury | FAERS: 5 | US FAERS | |
| 268 | Ageusia | FAERS: 5 | US FAERS | |
| 269 | Aphonia | FAERS: 5 | US FAERS | |
| 270 | Blood creatine phosphokinase increased | FAERS: 5 | US FAERS | |
| 271 | Bowel movement irregularity | FAERS: 5 | OFFSIDES US FAERS | |
| 272 | Cyst | FAERS: 5 | US FAERS | |
| 273 | Dissociation | FAERS: 5 | US FAERS | |
| 274 | Ecchymosis | FAERS: 5 | US FAERS | |
| 275 | Hepatitis C virus test positive | FAERS: 5 | US FAERS | |
| 276 | Initial insomnia | FAERS: 5 | US FAERS | |
| 277 | Laziness | FAERS: 5 | US FAERS | |
| 278 | Ligament rupture | FAERS: 5 | US FAERS | |
| 279 | Motion Sickness | FAERS: 5 | US FAERS | |
| 280 | Nerve injury | FAERS: 5 | US FAERS | |
| 281 | Open wound | FAERS: 5 | OFFSIDES US FAERS | |
| 282 | Sleep disorder due to general medical condition, insomnia type | FAERS: 5 | US FAERS | |
| 283 | Throat irritation | FAERS: 5 | US FAERS | |
| 284 | Tooth Infection | FAERS: 5 | US FAERS | |
| 285 | Urinary Incontinence | FAERS: 5 | US FAERS | |
| 286 | Urinary Retention | FAERS: 5 | US FAERS | |
| 287 | Alcohol Intolerance | FAERS: 4 | US FAERS | |
| 288 | Angioedema | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 289 | Binge Drinking | FAERS: 4 | US FAERS | |
| 290 | Blood potassium decreased | FAERS: 4 | US FAERS | |
| 291 | Blood sodium decreased | FAERS: 4 | US FAERS | |
| 292 | Bruxism | FAERS: 4 | OFFSIDES US FAERS | |
| 293 | Cholelithiasis | FAERS: 4 | SIDER US FAERS | |
| 294 | Death of relative | FAERS: 4 | US FAERS | |
| 295 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 296 | Eosinophilia | FAERS: 4 | US FAERS | |
| 297 | Epilepsy | FAERS: 4 | US FAERS | |
| 298 | Facial Pain | FAERS: 4 | US FAERS | |
| 299 | Feelings of worthlessness | FAERS: 4 | US FAERS | |
| 300 | Flatulence | FAERS: 4 | SIDER US FAERS | |
| 301 | Food Poisoning | FAERS: 4 | US FAERS | |
| 302 | Fracture | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 303 | General physical condition abnormal | FAERS: 4 | US FAERS | |
| 304 | Hallucinations, mixed | FAERS: 4 | US FAERS | |
| 305 | Inflammation | FAERS: 4 | US FAERS | |
| 306 | Injection site extravasation | FAERS: 4 | US FAERS | |
| 307 | Injection site hypersensitivity | FAERS: 4 | US FAERS | |
| 308 | Injection site papule | FAERS: 4 | US FAERS | |
| 309 | Injection site pustule | FAERS: 4 | US FAERS | |
| 310 | Injection site scab | FAERS: 4 | US FAERS | |
| 311 | Libido disorder | FAERS: 4 | US FAERS | |
| 312 | Lip swelling | FAERS: 4 | US FAERS | |
| 313 | Monoplegia | FAERS: 4 | US FAERS | |
| 314 | Product physical consistency issue | FAERS: 4 | US FAERS | |
| 315 | Product reconstitution quality issue | FAERS: 4 | US FAERS | |
| 316 | Pulmonary congestion | FAERS: 4 | OFFSIDES US FAERS | |
| 317 | Rash erythematous | FAERS: 4 | US FAERS | |
| 318 | Respiratory Failure | FAERS: 4 | US FAERS | |
| 319 | Respiratory arrest | FAERS: 4 | US FAERS | |
| 320 | Rotator cuff syndrome | FAERS: 4 | US FAERS | |
| 321 | Single component of a two-component product administered | FAERS: 4 | US FAERS | |
| 322 | Sleep disorder due to a general medical condition | FAERS: 4 | US FAERS | |
| 323 | Spontaneous penile erection | FAERS: 4 | US FAERS | |
| 324 | Tension | FAERS: 4 | SIDER US FAERS | |
| 325 | Thermal burn | FAERS: 4 | US FAERS | |
| 326 | Thrombosis | FAERS: 4 | US FAERS | |
| 327 | Tooth repair | FAERS: 4 | US FAERS | |
| 328 | Upper-airway cough syndrome | FAERS: 4 | US FAERS | |
| 329 | Blepharospasm | FAERS: 3 | US FAERS | |
| 330 | Blood alkaline phosphatase increased | FAERS: 3 | US FAERS | |
| 331 | Blood glucose decreased | FAERS: 3 | US FAERS | |
| 332 | Breath alcohol test positive | FAERS: 3 | US FAERS | |
| 333 | Deep Vein Thrombosis | FAERS: 3 | SIDER US FAERS | |
| 334 | Dermatitis acneiform | FAERS: 3 | US FAERS | |
| 335 | Disability | FAERS: 3 | US FAERS | |
| 336 | Drug administered in wrong device | FAERS: 3 | US FAERS | |
| 337 | Drug screen negative | FAERS: 3 | US FAERS | |
| 338 | Dysphemia | FAERS: 3 | US FAERS | |
| 339 | Ear discomfort | FAERS: 3 | US FAERS | |
| 340 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 341 | Endocarditis | FAERS: 3 | US FAERS | |
| 342 | Eructation | FAERS: 3 | US FAERS | |
| 343 | Exposure via father | FAERS: 3 | US FAERS | |
| 344 | Food aversion | FAERS: 3 | US FAERS | |
| 345 | Gastritis | FAERS: 3 | US FAERS | |
| 346 | Gastrointestinal inflammation | FAERS: 3 | US FAERS | |
| 347 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 348 | Hip surgery | FAERS: 3 | US FAERS | |
| 349 | Hyperacusis | FAERS: 3 | US FAERS | |
| 350 | Hyperphagia | FAERS: 3 | US FAERS | |
| 351 | Hypothyroidism | FAERS: 3 | US FAERS | |
| 352 | Hysterectomy | FAERS: 3 | US FAERS | |
| 353 | Implant site abscess | FAERS: 3 | US FAERS | |
| 354 | Incoherent | FAERS: 3 | US FAERS | |
| 355 | Injection site atrophy | FAERS: 3 | US FAERS | |
| 356 | Injection site indentation | FAERS: 3 | US FAERS | |
| 357 | Injection site ulcer | FAERS: 3 | US FAERS | |
| 358 | Injury associated with device | FAERS: 3 | US FAERS | |
| 359 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 360 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 361 | Intracranial Aneurysm | FAERS: 3 | SIDER US FAERS | |
| 362 | Laceration | FAERS: 3 | US FAERS | |
| 363 | Lyme Disease | FAERS: 3 | US FAERS | |
| 364 | Moaning | FAERS: 3 | US FAERS | |
| 365 | Monoparesis | FAERS: 3 | US FAERS | |
| 366 | Multiple Sclerosis | FAERS: 3 | 15694688 | CTD OFFSIDES US FAERS |
| 367 | Muscle abscess | FAERS: 3 | US FAERS | |
| 368 | Myositis | FAERS: 3 | US FAERS | |
| 369 | Nonspecific reaction | FAERS: 3 | US FAERS | |
| 370 | Onychoclasis | FAERS: 3 | US FAERS | |
| 371 | Papule | FAERS: 3 | US FAERS | |
| 372 | Product compounding quality issue | FAERS: 3 | US FAERS | |
| 373 | Product contamination | FAERS: 3 | US FAERS | |
| 374 | Product gel formation | FAERS: 3 | US FAERS | |
| 375 | Product intolerance | FAERS: 3 | US FAERS | |
| 376 | Product physical issue | FAERS: 3 | US FAERS | |
| 377 | Psoriasis | FAERS: 3 | US FAERS | |
| 378 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 379 | Skin lesion | FAERS: 3 | US FAERS | |
| 380 | Soft tissue necrosis | FAERS: 3 | US FAERS | |
| 381 | Spinal cord abscess | FAERS: 3 | US FAERS | |
| 382 | Stress at work | FAERS: 3 | US FAERS | |
| 383 | Sunburn | FAERS: 3 | US FAERS | |
| 384 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 385 | Trismus | FAERS: 3 | US FAERS | |
| 386 | Violence-related symptom | FAERS: 3 | US FAERS | |
| 387 | Wrong device used | FAERS: 3 | US FAERS | |
| 388 | muscle injury | FAERS: 3 | US FAERS | |
| 389 | Abdominal mass | FAERS: 2 | US FAERS | |
| 390 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 391 | Acarodermatitis | FAERS: 2 | US FAERS | |
| 392 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 393 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 394 | Anaphylactic shock | FAERS: 2 | SIDER US FAERS | |
| 395 | Angina Pectoris | FAERS: 2 | SIDER US FAERS | |
| 396 | Anorgasmia | FAERS: 2 | US FAERS | |
| 397 | Arthritis | FAERS: 2 | SIDER US FAERS | |
| 398 | Ascites | FAERS: 2 | US FAERS | |
| 399 | Ataxia | FAERS: 2 | US FAERS | |
| 400 | Atrial Fibrillation | FAERS: 2 | SIDER US FAERS | |
| 401 | Autoscopy | FAERS: 2 | US FAERS | |
| 402 | Aversion | FAERS: 2 | US FAERS | |
| 403 | Bacterial sepsis | FAERS: 2 | US FAERS | |
| 404 | Bipolar I disorder | FAERS: 2 | OFFSIDES US FAERS | |
| 405 | Blood phosphorus abnormal | FAERS: 2 | US FAERS | |
| 406 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 407 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 408 | Body fat disorder | FAERS: 2 | US FAERS | |
| 409 | Borderline Personality Disorder | FAERS: 2 | US FAERS | |
| 410 | Bursitis | FAERS: 2 | US FAERS | |
| 411 | Caffeine consumption | FAERS: 2 | US FAERS | |
| 412 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 413 | Central nervous system mass | FAERS: 2 | US FAERS | |
| 414 | Cholecystitis | FAERS: 2 | US FAERS | |
| 415 | Clostridium difficile infection | FAERS: 2 | US FAERS | |
| 416 | Colitis | FAERS: 2 | SIDER US FAERS | |
| 417 | Complication associated with device | FAERS: 2 | US FAERS | |
| 418 | Contraindicated product prescribed | FAERS: 2 | US FAERS | |
| 419 | Death of companion | FAERS: 2 | US FAERS | |
| 420 | Dental discomfort | FAERS: 2 | US FAERS | |
| 421 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 422 | Device Failure | FAERS: 2 | US FAERS | |
| 423 | Device breakage | FAERS: 2 | US FAERS | |
| 424 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 425 | Disease recurrence | FAERS: 2 | US FAERS | |
| 426 | Drug administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 427 | Drug withdrawal convulsions | FAERS: 2 | US FAERS | |
| 428 | Economic problem | FAERS: 2 | US FAERS | |
| 429 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 430 | Enteritis | FAERS: 2 | US FAERS | |
| 431 | Epistaxis | FAERS: 2 | SIDER US FAERS | |
| 432 | Eschar | FAERS: 2 | OFFSIDES US FAERS | |
| 433 | Fasciitis | FAERS: 2 | US FAERS | |
| 434 | Foaming at mouth | FAERS: 2 | US FAERS | |
| 435 | Food Allergy | FAERS: 2 | US FAERS | |
| 436 | Frustration | FAERS: 2 | US FAERS | |
| 437 | Gallbladder pain | FAERS: 2 | US FAERS | |
| 438 | Gastroenteritis | FAERS: 2 | SIDER US FAERS | |
| 439 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 440 | Gastrointestinal sounds abnormal | FAERS: 2 | US FAERS | |
| 441 | General symptom | FAERS: 2 | US FAERS | |
| 442 | Gout | FAERS: 2 | US FAERS | |
| 443 | Hepatic enzyme decreased | FAERS: 2 | US FAERS | |
| 444 | Histamine level increased | FAERS: 2 | US FAERS | |
| 445 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 446 | Hypermetabolism | FAERS: 2 | US FAERS | |
| 447 | Hypogeusia | FAERS: 2 | US FAERS | |
| 448 | Immobile | FAERS: 2 | US FAERS | |
| 449 | Impaired reasoning | FAERS: 2 | US FAERS | |
| 450 | Impatience | FAERS: 2 | US FAERS | |
| 451 | Incision site complication | FAERS: 2 | US FAERS | |
| 452 | Incorrect dose administered by device | FAERS: 2 | US FAERS | |
| 453 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 454 | Incorrect drug administration rate | FAERS: 2 | US FAERS | |
| 455 | Induration | FAERS: 2 | SIDER US FAERS | |
| 456 | Infusion site reaction | FAERS: 2 | US FAERS | |
| 457 | Injection site coldness | FAERS: 2 | US FAERS | |
| 458 | Injection site discharge | FAERS: 2 | US FAERS | |
| 459 | Injection site movement impairment | FAERS: 2 | US FAERS | |
| 460 | Intentional product use issue | FAERS: 2 | US FAERS | |
| 461 | Intercepted medication error | FAERS: 2 | US FAERS | |
| 462 | Irregular sleep phase | FAERS: 2 | US FAERS | |
| 463 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 464 | Lack of application site rotation | FAERS: 2 | US FAERS | |
| 465 | Lack of spontaneous speech | FAERS: 2 | US FAERS | |
| 466 | Limb crushing injury | FAERS: 2 | US FAERS | |
| 467 | Lung Abscess | FAERS: 2 | US FAERS | |
| 468 | Lymphoma | FAERS: 2 | US FAERS | |
| 469 | Malabsorption | FAERS: 2 | US FAERS | |
| 470 | Male Orgasmic Disorder | FAERS: 2 | US FAERS | |
| 471 | Malnutrition | FAERS: 2 | SIDER US FAERS | |
| 472 | Maternal exposure during pregnancy | FAERS: 2 | US FAERS | |
| 473 | Medical device implantation | FAERS: 2 | US FAERS | |
| 474 | Medical procedure | FAERS: 2 | US FAERS | |
| 475 | Meniscus injury | FAERS: 2 | US FAERS | |
| 476 | Muscle hypertrophy | FAERS: 2 | US FAERS | |
| 477 | Nasal discomfort | FAERS: 2 | US FAERS | |
| 478 | Neuroleptic Malignant Syndrome | FAERS: 2 | US FAERS | |
| 479 | Neurotransmitter level altered | FAERS: 2 | US FAERS | |
| 480 | Nicotine Dependence | FAERS: 2 | US FAERS | |
| 481 | No reaction on previous exposure to drug | FAERS: 2 | US FAERS | |
| 482 | Paranasal sinus discomfort | FAERS: 2 | US FAERS | |
| 483 | Partner stress | FAERS: 2 | US FAERS | |
| 484 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 485 | Physical assault | FAERS: 2 | US FAERS | |
| 486 | Pneumothorax | FAERS: 2 | US FAERS | |
| 487 | Poor quality product administered | FAERS: 2 | US FAERS | |
| 488 | Post-traumatic pain | FAERS: 2 | US FAERS | |
| 489 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 490 | Psychiatric decompensation | FAERS: 2 | US FAERS | |
| 491 | Psychogenic seizure | FAERS: 2 | US FAERS | |
| 492 | Respiratory tract congestion | FAERS: 2 | US FAERS | |
| 493 | Seizure like phenomena | FAERS: 2 | US FAERS | |
| 494 | Skin Induration | FAERS: 2 | US FAERS | |
| 495 | Skin irritation | FAERS: 2 | US FAERS | |
| 496 | Skin tightness | FAERS: 2 | US FAERS | |
| 497 | Sleep Paralysis | FAERS: 2 | US FAERS | |
| 498 | Sleep Talking | FAERS: 2 | US FAERS | |
| 499 | Slow speech | FAERS: 2 | US FAERS | |
| 500 | Spinal column injury | FAERS: 2 | US FAERS | |
| 501 | Staphylococcal abscess | FAERS: 2 | US FAERS | |
| 502 | Subcutaneous Abscess | FAERS: 2 | US FAERS | |
| 503 | Substance Dependence | FAERS: 2 | US FAERS | |
| 504 | Tension Headache | FAERS: 2 | US FAERS | |
| 505 | Therapeutic product effect delayed | FAERS: 2 | US FAERS | |
| 506 | Therapeutic product effect incomplete | FAERS: 2 | US FAERS | |
| 507 | Tongue biting | FAERS: 2 | US FAERS | |
| 508 | Traumatic liver injury | FAERS: 2 | US FAERS | |
| 509 | Ulcer | FAERS: 2 | SIDER US FAERS | |
| 510 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 511 | prostatitis | FAERS: 2 | US FAERS | |
| 512 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 513 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 514 | Acquired cardiac septal defect | FAERS: 1 | US FAERS | |
| 515 | Acute hepatitis C | FAERS: 1 | US FAERS | |
| 516 | Administration related reaction | FAERS: 1 | US FAERS | |
| 517 | Affective ambivalence | FAERS: 1 | US FAERS | |
| 518 | Agoraphobia | FAERS: 1 | US FAERS | |
| 519 | Akathisia | FAERS: 1 | US FAERS | |
| 520 | Allergy to animal | FAERS: 1 | US FAERS | |
| 521 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 522 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 523 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 524 | Anorexia | FAERS: 1 | 6120359 | CTD OFFSIDES SIDER US FAERS |
| 525 | Anosmia | FAERS: 1 | US FAERS | |
| 526 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 527 | Application site reaction | FAERS: 1 | US FAERS | |
| 528 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 529 | Arthropod sting | FAERS: 1 | US FAERS | |
| 530 | Asthenopia | FAERS: 1 | US FAERS | |
| 531 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 532 | Autoimmune Pancreatitis | FAERS: 1 | US FAERS | |
| 533 | Autophobia | FAERS: 1 | US FAERS | |
| 534 | Bed rest | FAERS: 1 | US FAERS | |
| 535 | Belligerence | FAERS: 1 | US FAERS | |
| 536 | Benign bone neoplasm | FAERS: 1 | US FAERS | |
| 537 | Blister rupture | FAERS: 1 | US FAERS | |
| 538 | Blood bilirubin abnormal | FAERS: 1 | US FAERS | |
| 539 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 540 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 541 | Blood count abnormal | FAERS: 1 | US FAERS | |
| 542 | Blood creatine increased | FAERS: 1 | US FAERS | |
| 543 | Blood folate decreased | FAERS: 1 | US FAERS | |
| 544 | Blood iron increased | FAERS: 1 | US FAERS | |
| 545 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 546 | Blood pressure fluctuation | FAERS: 1 | SIDER US FAERS | |
| 547 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 548 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 549 | Blood triglycerides decreased | FAERS: 1 | US FAERS | |
| 550 | Blunted affect | FAERS: 1 | US FAERS | |
| 551 | Body temperature fluctuation | FAERS: 1 | US FAERS | |
| 552 | Bone fragmentation | FAERS: 1 | US FAERS | |
| 553 | Bradycardia | FAERS: 1 | CTD US FAERS | |
| 554 | Bradykinesia | FAERS: 1 | US FAERS | |
| 555 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 556 | Brain Death | FAERS: 1 | US FAERS | |
| 557 | Breast tenderness | FAERS: 1 | US FAERS | |
| 558 | Bronchospasm | FAERS: 1 | US FAERS | |
| 559 | Bunion operation | FAERS: 1 | US FAERS | |
| 560 | Cachexia | FAERS: 1 | US FAERS | |
| 561 | Cancer Pain | FAERS: 1 | US FAERS | |
| 562 | Carbohydrate deficient transferrin increased | FAERS: 1 | US FAERS | |
| 563 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 564 | Cataract | FAERS: 1 | US FAERS | |
| 565 | Catatonia | FAERS: 1 | US FAERS | |
| 566 | Cervical cord compression | FAERS: 1 | US FAERS | |
| 567 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 568 | Change in sustained attention | FAERS: 1 | US FAERS | |
| 569 | Chronic cheek biting | FAERS: 1 | US FAERS | |
| 570 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 571 | Claustrophobia | FAERS: 1 | US FAERS | |
| 572 | Cluster Headache | FAERS: 1 | US FAERS | |
| 573 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 574 | Consciousness fluctuating | FAERS: 1 | US FAERS | |
| 575 | Contraindicated product administered | FAERS: 1 | US FAERS | |
| 576 | Creatinine urine abnormal | FAERS: 1 | US FAERS | |
| 577 | Cyanosis | FAERS: 1 | US FAERS | |
| 578 | Cystitis | FAERS: 1 | US FAERS | |
| 579 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 580 | Deafness | FAERS: 1 | US FAERS | |
| 581 | Debridement | FAERS: 1 | US FAERS | |
| 582 | Delusional disorder, unspecified type | FAERS: 1 | US FAERS | |
| 583 | Delusional perception | FAERS: 1 | US FAERS | |
| 584 | Dementia | FAERS: 1 | US FAERS | |
| 585 | Dental cyst | FAERS: 1 | US FAERS | |
| 586 | Depression suicidal | FAERS: 1 | US FAERS | |
| 587 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 588 | Device damage | FAERS: 1 | US FAERS | |
| 589 | Device expulsion | FAERS: 1 | US FAERS | |
| 590 | Device intolerance | FAERS: 1 | US FAERS | |
| 591 | Device malfunction | FAERS: 1 | US FAERS | |
| 592 | Drug abuser | FAERS: 1 | US FAERS | |
| 593 | Drug clearance decreased | FAERS: 1 | US FAERS | |
| 594 | Drug diversion | FAERS: 1 | US FAERS | |
| 595 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 596 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 597 | Drug resistance | FAERS: 1 | US FAERS | |
| 598 | Drug withdrawal maintenance therapy | FAERS: 1 | US FAERS | |
| 599 | Dumping Syndrome | FAERS: 1 | US FAERS | |
| 600 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 601 | Ear, nose and throat examination abnormal | FAERS: 1 | US FAERS | |
| 602 | Eczema | FAERS: 1 | US FAERS | |
| 603 | Elective procedure | FAERS: 1 | US FAERS | |
| 604 | Electrocardiogram ST-T segment abnormal | FAERS: 1 | US FAERS | |
| 605 | Elevated mood | FAERS: 1 | US FAERS | |
| 606 | Emergency Care | FAERS: 1 | US FAERS | |
| 607 | Emergency care examination | FAERS: 1 | US FAERS | |
| 608 | Encapsulation reaction | FAERS: 1 | US FAERS | |
| 609 | Endodontic procedure | FAERS: 1 | US FAERS | |
| 610 | Environmental Exposure | FAERS: 1 | US FAERS | |
| 611 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 612 | Enzyme level increased | FAERS: 1 | US FAERS | |
| 613 | Epididymitis | FAERS: 1 | US FAERS | |
| 614 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 615 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 616 | Escherichia infection | FAERS: 1 | US FAERS | |
| 617 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 618 | Expired product administered | FAERS: 1 | US FAERS | |
| 619 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 620 | Exposure via body fluid | FAERS: 1 | US FAERS | |
| 621 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 622 | Extra dose administered | FAERS: 1 | US FAERS | |
| 623 | Extremity contracture | FAERS: 1 | US FAERS | |
| 624 | Eye Infection | FAERS: 1 | US FAERS | |
| 625 | Eye inflammation | FAERS: 1 | US FAERS | |
| 626 | Facial paralysis | FAERS: 1 | US FAERS | |
| 627 | False positive investigation result | FAERS: 1 | US FAERS | |
| 628 | Female sexual dysfunction | FAERS: 1 | US FAERS | |
| 629 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 630 | Gangrene | FAERS: 1 | US FAERS | |
| 631 | Gastric infection | FAERS: 1 | US FAERS | |
| 632 | Gastric ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 633 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 634 | Gastrointestinal bacterial infection | FAERS: 1 | US FAERS | |
| 635 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 636 | Gastrointestinal motility disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 637 | Genital pain | FAERS: 1 | US FAERS | |
| 638 | Genital swelling | FAERS: 1 | US FAERS | |
| 639 | Gingival erythema | FAERS: 1 | US FAERS | |
| 640 | Gingivitis | FAERS: 1 | US FAERS | |
| 641 | Glossitis | FAERS: 1 | US FAERS | |
| 642 | Hemiparesis | FAERS: 1 | US FAERS | |
| 643 | Hemiplegia | FAERS: 1 | US FAERS | |
| 644 | Hepatic cancer stage I | FAERS: 1 | US FAERS | |
| 645 | Hepatitis B core antibody negative | FAERS: 1 | US FAERS | |
| 646 | Hepatitis B surface antibody positive | FAERS: 1 | US FAERS | |
| 647 | Hepatitis B | FAERS: 1 | US FAERS | |
| 648 | Hepatitis C RNA increased | FAERS: 1 | US FAERS | |
| 649 | Hepatitis C antibody positive | FAERS: 1 | US FAERS | |
| 650 | Homicide | FAERS: 1 | US FAERS | |
| 651 | Hostility | FAERS: 1 | US FAERS | |
| 652 | Human chorionic gonadotropin decreased | FAERS: 1 | US FAERS | |
| 653 | Human chorionic gonadotropin negative | FAERS: 1 | US FAERS | |
| 654 | Hyperkeratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 655 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 656 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 657 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 658 | Implant site extravasation | FAERS: 1 | US FAERS | |
| 659 | Implant site reaction | FAERS: 1 | US FAERS | |
| 660 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 661 | Inadequate housing | FAERS: 1 | US FAERS | |
| 662 | Incision site abscess | FAERS: 1 | US FAERS | |
| 663 | Incorrect dose administered | FAERS: 1 | OFFSIDES US FAERS | |
| 664 | Infected bite | FAERS: 1 | US FAERS | |
| 665 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 666 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 667 | Infusion site erythema | FAERS: 1 | US FAERS | |
| 668 | Infusion site swelling | FAERS: 1 | US FAERS | |
| 669 | Infusion site warmth | FAERS: 1 | US FAERS | |
| 670 | Inhibitory drug interaction | FAERS: 1 | OFFSIDES US FAERS | |
| 671 | Injection site joint pain | FAERS: 1 | US FAERS | |
| 672 | Insurance issue | FAERS: 1 | US FAERS | |
| 673 | Intentional self-injury | FAERS: 1 | OFFSIDES US FAERS | |
| 674 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 675 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 676 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 677 | Intestinal resection | FAERS: 1 | US FAERS | |
| 678 | Intrusive thoughts | FAERS: 1 | US FAERS | |
| 679 | Iron deficiency | FAERS: 1 | US FAERS | |
| 680 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 681 | Joint destruction | FAERS: 1 | US FAERS | |
| 682 | Lactobacillus test positive | FAERS: 1 | US FAERS | |
| 683 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 684 | Laryngitis | FAERS: 1 | SIDER US FAERS | |
| 685 | Latent Tuberculosis | FAERS: 1 | US FAERS | |
| 686 | Leukocytosis | FAERS: 1 | US FAERS | |
| 687 | Lid sulcus deepened | FAERS: 1 | US FAERS | |
| 688 | Lip and/or oral cavity cancer | FAERS: 1 | US FAERS | |
| 689 | Lipase increased | FAERS: 1 | US FAERS | |
| 690 | Livedo Reticularis | FAERS: 1 | US FAERS | |
| 691 | Liver Abscess | FAERS: 1 | US FAERS | |
| 692 | Liver function test decreased | FAERS: 1 | US FAERS | |
| 693 | Liver induration | FAERS: 1 | US FAERS | |
| 694 | Macule | FAERS: 1 | US FAERS | |
| 695 | Malabsorption from administration site | FAERS: 1 | US FAERS | |
| 696 | Male sexual dysfunction | FAERS: 1 | US FAERS | |
| 697 | Medical device site pain | FAERS: 1 | US FAERS | |
| 698 | Medication monitoring error | FAERS: 1 | US FAERS | |
| 699 | Mental Fatigue | FAERS: 1 | US FAERS | |
| 700 | Metapneumovirus infection | FAERS: 1 | US FAERS | |
| 701 | Metrorrhagia | FAERS: 1 | US FAERS | |
| 702 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 703 | Mouth swelling | FAERS: 1 | US FAERS | |
| 704 | Multiple sclerosis relapse | FAERS: 1 | OFFSIDES US FAERS | |
| 705 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 706 | Muscle Rigidity | FAERS: 1 | SIDER US FAERS | |
| 707 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 708 | Myoclonus | FAERS: 1 | US FAERS | |
| 709 | Myoglobinuria | FAERS: 1 | US FAERS | |
| 710 | Narcolepsy | FAERS: 1 | US FAERS | |
| 711 | Negativism | FAERS: 1 | US FAERS | |
| 712 | Neonatal complications of substance abuse | FAERS: 1 | US FAERS | |
| 713 | Nephritis | FAERS: 1 | US FAERS | |
| 714 | Nerve Block | FAERS: 1 | US FAERS | |
| 715 | Nocturia | FAERS: 1 | US FAERS | |
| 716 | Nodule | FAERS: 1 | SIDER US FAERS | |
| 717 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 718 | Nuchal Rigidity | FAERS: 1 | US FAERS | |
| 719 | Nystagmus | FAERS: 1 | US FAERS | |
| 720 | Obsessive thoughts | FAERS: 1 | US FAERS | |
| 721 | Obsessive-Compulsive Disorder | FAERS: 1 | SIDER US FAERS | |
| 722 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 723 | Oropharyngeal discomfort | FAERS: 1 | SIDER US FAERS | |
| 724 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 725 | Pain of skin | FAERS: 1 | US FAERS | |
| 726 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 727 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 728 | Parasomnia | FAERS: 1 | US FAERS | |
| 729 | Performance status decreased | FAERS: 1 | US FAERS | |
| 730 | Pericarditis | FAERS: 1 | US FAERS | |
| 731 | Peritoneal perforation | FAERS: 1 | US FAERS | |
| 732 | Personal relationship issue | FAERS: 1 | US FAERS | |
| 733 | Phantom pain | FAERS: 1 | US FAERS | |
| 734 | Pharmaceutical product complaint | FAERS: 1 | US FAERS | |
| 735 | Pharyngitis | FAERS: 1 | SIDER US FAERS | |
| 736 | Pilonidal Cyst | FAERS: 1 | US FAERS | |
| 737 | Pleurisy | FAERS: 1 | US FAERS | |
| 738 | Pneumonitis | FAERS: 1 | US FAERS | |
| 739 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 740 | Polydipsia | FAERS: 1 | US FAERS | |
| 741 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 742 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 743 | Post procedural complication | FAERS: 1 | US FAERS | |
| 744 | Prescribed underdose | FAERS: 1 | US FAERS | |
| 745 | Product container seal issue | FAERS: 1 | US FAERS | |
| 746 | Product formulation issue | FAERS: 1 | US FAERS | |
| 747 | Product packaging issue | FAERS: 1 | US FAERS | |
| 748 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 749 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 750 | Product substitution issue | FAERS: 1 | US FAERS | |
| 751 | Pseudologia | FAERS: 1 | US FAERS | |
| 752 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 753 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 754 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 755 | Purpura | FAERS: 1 | SIDER US FAERS | |
| 756 | Purulence | FAERS: 1 | US FAERS | |
| 757 | Pyomyositis | FAERS: 1 | US FAERS | |
| 758 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 759 | Renal mass | FAERS: 1 | US FAERS | |
| 760 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 761 | Respiratory distress | FAERS: 1 | US FAERS | |
| 762 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 763 | Rhinitis | FAERS: 1 | US FAERS | |
| 764 | Rubber sensitivity | FAERS: 1 | US FAERS | |
| 765 | Saliva altered | FAERS: 1 | US FAERS | |
| 766 | Salpingectomy | FAERS: 1 | US FAERS | |
| 767 | Scab | FAERS: 1 | US FAERS | |
| 768 | Scarlet Fever | FAERS: 1 | US FAERS | |
| 769 | Schizophrenia | FAERS: 1 | OFFSIDES US FAERS | |
| 770 | Secretion discharge | FAERS: 1 | US FAERS | |
| 771 | Sensitive skin | FAERS: 1 | US FAERS | |
| 772 | Shunt malfunction | FAERS: 1 | US FAERS | |
| 773 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 774 | Sinus headache | FAERS: 1 | SIDER US FAERS | |
| 775 | Sinus operation | FAERS: 1 | US FAERS | |
| 776 | Skeletal injury | FAERS: 1 | US FAERS | |
| 777 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 778 | Skin laceration | FAERS: 1 | US FAERS | |
| 779 | Skin necrosis | FAERS: 1 | US FAERS | |
| 780 | Snoring | FAERS: 1 | US FAERS | |
| 781 | Soft tissue inflammation | FAERS: 1 | US FAERS | |
| 782 | Soliloquy | FAERS: 1 | US FAERS | |
| 783 | Specific gravity urine abnormal | FAERS: 1 | US FAERS | |
| 784 | Sperm concentration decreased | FAERS: 1 | US FAERS | |
| 785 | Spinal Stenosis | FAERS: 1 | US FAERS | |
| 786 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 787 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 788 | Splenic Rupture | FAERS: 1 | US FAERS | |
| 789 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 790 | Stomatitis | FAERS: 1 | US FAERS | |
| 791 | Strabismus | FAERS: 1 | US FAERS | |
| 792 | Stubbornness | FAERS: 1 | US FAERS | |
| 793 | Sudden death | FAERS: 1 | US FAERS | |
| 794 | Suicide threat | FAERS: 1 | US FAERS | |
| 795 | Surgical skin tear | FAERS: 1 | US FAERS | |
| 796 | Suture rupture | FAERS: 1 | US FAERS | |
| 797 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 798 | Talipes | FAERS: 1 | US FAERS | |
| 799 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 800 | Therapeutic product effect variable | FAERS: 1 | US FAERS | |
| 801 | Throat cancer | FAERS: 1 | US FAERS | |
| 802 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 803 | Tissue rupture | FAERS: 1 | US FAERS | |
| 804 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 805 | Traumatic renal injury | FAERS: 1 | US FAERS | |
| 806 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 807 | Unemployment | FAERS: 1 | US FAERS | |
| 808 | Urinary sediment present | FAERS: 1 | US FAERS | |
| 809 | Urine amphetamine positive | FAERS: 1 | US FAERS | |
| 810 | Urine cannabinoids increased | FAERS: 1 | US FAERS | |
| 811 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 812 | Vasculitis gastrointestinal | FAERS: 1 | US FAERS | |
| 813 | Viral load decreased | FAERS: 1 | US FAERS | |
| 814 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 815 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 816 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 817 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 818 | Wound Complication | FAERS: 1 | US FAERS | |
| 819 | Wrong dose | FAERS: 1 | US FAERS | |
| 820 | Wrong drug administered | FAERS: 1 | OFFSIDES US FAERS | |
| 821 | colonoscopy | FAERS: 1 | US FAERS | |
| 822 | skin abrasion | FAERS: 1 | US FAERS | |
| 823 | Abdominal Cramps | SIDER | ||
| 824 | Abdominal adhesions | OFFSIDES | ||
| 825 | Abdominal tenderness | OFFSIDES | ||
| 826 | Abnormal vision | OFFSIDES | ||
| 827 | Ache | SIDER | ||
| 828 | Acute Coronary Syndrome | SIDER | ||
| 829 | Air Embolism | OFFSIDES | ||
| 830 | Alcohol consumption | OFFSIDES | ||
| 831 | Alcohol-Induced Disorders | 17664051 | CTD | |
| 832 | Alcohol-Related Disorders | 17664051 | CTD | |
| 833 | Alpha-1 anti-trypsin increased | OFFSIDES | ||
| 834 | Alveolitis | OFFSIDES | ||
| 835 | Amphetamine-Related Disorders | CTD | ||
| 836 | Analgesia | OFFSIDES | ||
| 837 | Ankylosing spondylitis | OFFSIDES | ||
| 838 | Anticholinergic Syndrome | OFFSIDES | ||
| 839 | Antipsychotic drug level increased | OFFSIDES | ||
| 840 | Anxiety aggravated | SIDER | ||
| 841 | Asthenic conditions | SIDER | ||
| 842 | Autistic Disorder | 8570775 9028057 19393386 | CTD | |
| 843 | Bad dreams | SIDER | ||
| 844 | Blood albumin decreased | OFFSIDES | ||
| 845 | Blood and lymphatic system disorders | SIDER | ||
| 846 | Blood creatinine normal | SIDER | ||
| 847 | Blood glucose abnormal | OFFSIDES | ||
| 848 | Brain Concussion | OFFSIDES | ||
| 849 | Bronchial Hyperreactivity | SIDER | ||
| 850 | Bronchiectasis | OFFSIDES | ||
| 851 | CD4 Lymphocytes Decreased | OFFSIDES | ||
| 852 | Candida sepsis | OFFSIDES | ||
| 853 | Catalepsy | 6682490 | CTD | |
| 854 | Cerebellar infarction | OFFSIDES | ||
| 855 | Cerebral arterial aneurysm | SIDER | ||
| 856 | Cerebral calcification | OFFSIDES | ||
| 857 | Ceruloplasmin increased | OFFSIDES | ||
| 858 | Chemical and Drug Induced Liver Injury | 24085192 | CTD | |
| 859 | Chest tightness | SIDER | ||
| 860 | Cholecystitis infective | OFFSIDES | ||
| 861 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 862 | Circumstance or information capable of leading to medication error | OFFSIDES | ||
| 863 | Cocaine-Related Disorders | CTD | ||
| 864 | Cold feet | SIDER | ||
| 865 | Confabulation | OFFSIDES | ||
| 866 | Conjunctivitis | SIDER | ||
| 867 | Creatinine normal | SIDER | ||
| 868 | Culture wound positive | OFFSIDES | ||
| 869 | Demyelination | OFFSIDES | ||
| 870 | Depressive disorder | 12851023 | CTD | |
| 871 | Diarrhea | 15517116 | CTD OFFSIDES | |
| 872 | Difficulty sleeping | SIDER | ||
| 873 | Disturbance in sexual arousal | SIDER | ||
| 874 | Drowsiness | OFFSIDES | ||
| 875 | Drug Eruptions | 7340503 | CTD | |
| 876 | Drug Tolerance | OFFSIDES | ||
| 877 | Drug dispensing error | OFFSIDES | ||
| 878 | Duodenitis | OFFSIDES | ||
| 879 | Dyskinesia, Drug-Induced | CTD | ||
| 880 | Electromechanical dissociation | OFFSIDES | ||
| 881 | Erosive gastritis | OFFSIDES | ||
| 882 | Erythrodermic psoriasis | OFFSIDES | ||
| 883 | Exanthema | 7340503 | CTD | |
| 884 | Fibromyalgia | 19453963 | CTD | |
| 885 | Foreign body aspiration | OFFSIDES | ||
| 886 | Galactorrhea | OFFSIDES | ||
| 887 | Gambling | OFFSIDES | ||
| 888 | Gamma-Glutamyltransferase Increased | SIDER | ||
| 889 | Gastrointestinal erosion | OFFSIDES | ||
| 890 | General physical condition | OFFSIDES | ||
| 891 | Granulocyte count increased | OFFSIDES | ||
| 892 | Hallucinations | 7583704 | CTD | |
| 893 | Heat Exhaustion | SIDER | ||
| 894 | Heat Stroke | SIDER | ||
| 895 | Hemisensory Neglect | OFFSIDES | ||
| 896 | Hepatic congestion | OFFSIDES | ||
| 897 | Hepatotoxicity | SIDER | ||
| 898 | Heroin Dependence | CTD | ||
| 899 | Herpes Labialis | SIDER | ||
| 900 | Hoarseness | SIDER | ||
| 901 | Hyperalgesia | 7464456 | CTD | |
| 902 | Hyperinsulinism | 16901484 | CTD | |
| 903 | Hyperkinesia | SIDER | ||
| 904 | Hyporeflexia | OFFSIDES | ||
| 905 | Implant site pain | OFFSIDES | ||
| 906 | Increased thirst | SIDER | ||
| 907 | Infection in an immunocompromised host | OFFSIDES | ||
| 908 | Injection site tenderness | SIDER | ||
| 909 | Intestinal congestion | OFFSIDES | ||
| 910 | Lipase | OFFSIDES | ||
| 911 | Lymphadenitis | SIDER | ||
| 912 | Lymphadenopathy | SIDER | ||
| 913 | Mental Retardation | SIDER | ||
| 914 | Miliaria Rubra | SIDER | ||
| 915 | Miliaria | SIDER | ||
| 916 | Mood disorder due to a general medical condition | OFFSIDES | ||
| 917 | Morphine Dependence | 6120359 6300721 10208762 | CTD | |
| 918 | Multiple Myeloma | OFFSIDES | ||
| 919 | Multiple drug overdose intentional | OFFSIDES | ||
| 920 | Muscle necrosis | OFFSIDES | ||
| 921 | Obesity | SIDER | ||
| 922 | Occult blood positive | OFFSIDES | ||
| 923 | Opioid-Related Disorders | CTD | ||
| 924 | Optic Neuritis | OFFSIDES | ||
| 925 | Ossicle disorder | OFFSIDES | ||
| 926 | Panic Disorder | 9501763 | CTD | |
| 927 | Perirectal abscess | SIDER | ||
| 928 | Pharyngolaryngeal Pain | SIDER | ||
| 929 | Phlebitis | SIDER | ||
| 930 | Platelet count abnormal | OFFSIDES | ||
| 931 | Prenatal Exposure Delayed Effects | 9078589 | CTD | |
| 932 | Psychoses, Substance-Induced | 10506865 | CTD | |
| 933 | Regurgitation | OFFSIDES | ||
| 934 | Retinal Artery Occlusion | SIDER | ||
| 935 | Sacroiliitis | OFFSIDES | ||
| 936 | Schizoaffective Disorder | OFFSIDES | ||
| 937 | Seizures | 3011487 15582832 | CTD | |
| 938 | Shock | SIDER | ||
| 939 | Sjogren's Syndrome | OFFSIDES | ||
| 940 | Sleep Initiation and Maintenance Disorders | 16534857 19453963 | CTD | |
| 941 | Stiff back | SIDER | ||
| 942 | Stiffness | SIDER | ||
| 943 | Substance Withdrawal Syndrome |
56139
1487626 1528400 4433085 7340503 7675970 10529020 11316375 11829123 12144610 15380837 15912139 16534857 17136399 17335644 19270623 | CTD | |
| 944 | Suicide | SIDER | ||
| 945 | Tardive Dyskinesia | OFFSIDES | ||
| 946 | Tinea Pedis | SIDER | ||
| 947 | Tobacco Use Disorder | 15939519 | CTD | |
| 948 | Transmission of an infectious agent via a medicinal product | OFFSIDES | ||
| 949 | Unresponsive to verbal stimuli | OFFSIDES | ||
| 950 | Upset stomach | SIDER | ||
| 951 | Vertebral artery occlusion | OFFSIDES | ||
| 952 | Vocal Cord Paralysis | OFFSIDES | ||
| 953 | Walking aid user | OFFSIDES | ||
| 954 | Wound infection pseudomonas | OFFSIDES | ||
| 955 | Xerostomia | 16534857 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.