Clomiphene
(PYTMYKVIJXPNBD-OQKDUQJOSA-N)
Structure
- SMILES
- OC(=O)C(CC(=O)O)(CC(=O)O)O.CCN(CCOc1ccc(cc1)/C(=C(/c1ccccc1)\Cl)/c1ccccc1)CC
- Molecular Formula:
- C32H36ClNO8
- Molecular Weight:
- 598.083
- Log P:
- 5.3141
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 4
- TPSA:
- 144.6
- CAS Number(s):
- 50-41-9; 7619-53-6
Synonym(s)
1.
Clomiphene
2.
Chloramiphene
3.
Clomifene
4.
Clomid
5.
Clomide
6.
Clomifen
7.
Clomiphene Citrate
8.
Clomiphene Hydrochloride
9.
Clostilbegit
10.
Dyneric
11.
Gravosan
12.
Klostilbegit
13.
Serophene
14.
Citrate, Clomiphene
15.
Hydrochloride, Clomiphene
External Link(s)
| MeSH | D002996 |
| PubChem Compound | 3033832 |
| CHEMBL | CHEMBL1213137 |
| KEGG | cpd:C08161 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug exposure during pregnancy | FAERS: 48 | OFFSIDES US FAERS | |
| 2 | Ectopic Pregnancy | FAERS: 29 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 3 | Headache | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Nausea | FAERS: 15 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 5 | Ovarian Hyperstimulation Syndrome | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 6 | Visual Impairment | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Vomiting | FAERS: 10 | US FAERS | |
| 8 | Maternal exposure during pregnancy | FAERS: 9 | US FAERS | |
| 9 | Pregnancy | FAERS: 9 | US FAERS | |
| 10 | Product use issue | FAERS: 8 | US FAERS | |
| 11 | Drug ineffective | FAERS: 7 | OFFSIDES US FAERS | |
| 12 | Multiple Pregnancy | FAERS: 7 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 13 | Pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Blood testosterone increased | FAERS: 6 | US FAERS | |
| 15 | Retinal Vein Occlusion | FAERS: 6 | OFFSIDES US FAERS | |
| 16 | Tremor | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Visual disturbance | FAERS: 6 | OFFSIDES US FAERS | |
| 18 | Deep Vein Thrombosis | FAERS: 5 | US FAERS | |
| 19 | Dizziness | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 20 | Fatigue | FAERS: 5 | US FAERS | |
| 21 | Feeling abnormal | FAERS: 5 | US FAERS | |
| 22 | Low birth weight baby | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Ruptured ectopic pregnancy | FAERS: 5 | OFFSIDES US FAERS | |
| 24 | Abdominal Pain | FAERS: 4 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 25 | Alopecia | FAERS: 4 | OFFSIDES US FAERS | |
| 26 | Chest Pain | FAERS: 4 | US FAERS | |
| 27 | Drug exposure before pregnancy | FAERS: 4 | OFFSIDES US FAERS | |
| 28 | Eye pain | FAERS: 4 | OFFSIDES US FAERS | |
| 29 | Iridocyclitis | FAERS: 4 | OFFSIDES US FAERS | |
| 30 | Malaise | FAERS: 4 | US FAERS | |
| 31 | Maternal exposure before pregnancy | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 32 | Metrorrhagia | FAERS: 4 | US FAERS | |
| 33 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 34 | No adverse event | FAERS: 4 | US FAERS | |
| 35 | Ocular icterus | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 36 | Optic Neuritis | FAERS: 4 | OFFSIDES US FAERS | |
| 37 | Osteopenia | FAERS: 4 | US FAERS | |
| 38 | Retinopathy of Prematurity | FAERS: 4 | US FAERS | |
| 39 | Vitreous floaters | FAERS: 4 | US FAERS | |
| 40 | Abdominal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 41 | Agitation | FAERS: 3 | US FAERS | |
| 42 | Anxiety | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Breech Presentation | FAERS: 3 | US FAERS | |
| 44 | Cerebrovascular accident | FAERS: 3 | US FAERS | |
| 45 | Chest discomfort | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Delirium | FAERS: 3 | US FAERS | |
| 47 | Emotional distress | FAERS: 3 | OFFSIDES US FAERS | |
| 48 | Invasive Ductal Breast Carcinoma | FAERS: 3 | US FAERS | |
| 49 | Palpitations | FAERS: 3 | US FAERS | |
| 50 | Patent ductus arteriosus | FAERS: 3 | US FAERS | |
| 51 | Photophobia | FAERS: 3 | US FAERS | |
| 52 | Sepsis | FAERS: 3 | US FAERS | |
| 53 | Tachycardia | FAERS: 3 | US FAERS | |
| 54 | Thrombosis | FAERS: 3 | US FAERS | |
| 55 | jaundice | FAERS: 3 | US FAERS | |
| 56 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 57 | Adnexa uteri pain | FAERS: 2 | US FAERS | |
| 58 | Adverse event | FAERS: 2 | US FAERS | |
| 59 | Blood human chorionic gonadotropin decreased | FAERS: 2 | US FAERS | |
| 60 | Breast tenderness | FAERS: 2 | OFFSIDES US FAERS | |
| 61 | Cerebral Palsy | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 62 | Cervix carcinoma stage I | FAERS: 2 | US FAERS | |
| 63 | Congenital brain damage | FAERS: 2 | OFFSIDES US FAERS | |
| 64 | Congenital vitreous anomaly | FAERS: 2 | OFFSIDES US FAERS | |
| 65 | Crying | FAERS: 2 | OFFSIDES US FAERS | |
| 66 | Cyst | FAERS: 2 | OFFSIDES US FAERS | |
| 67 | Deafness | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Drug abuse | FAERS: 2 | US FAERS | |
| 69 | Dyschromatopsia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Emotional disorder | FAERS: 2 | US FAERS | |
| 71 | Endometriosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Erythema | FAERS: 2 | US FAERS | |
| 73 | Eye inflammation | FAERS: 2 | OFFSIDES US FAERS | |
| 74 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 75 | Hypokinesia | FAERS: 2 | OFFSIDES US FAERS | |
| 76 | Hypophysitis | FAERS: 2 | US FAERS | |
| 77 | Hypothyroidism | FAERS: 2 | US FAERS | |
| 78 | Ideas of reference | FAERS: 2 | OFFSIDES US FAERS | |
| 79 | Lymphoma | FAERS: 2 | OFFSIDES US FAERS | |
| 80 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 81 | Macular degeneration | FAERS: 2 | US FAERS | |
| 82 | Microphthalmos | FAERS: 2 | OFFSIDES US FAERS | |
| 83 | Mood swings | FAERS: 2 | US FAERS | |
| 84 | Ovarian enlargement | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 85 | Overdose | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 86 | Paranoia | FAERS: 2 | OFFSIDES US FAERS | |
| 87 | Precocious Puberty | FAERS: 2 | US FAERS | |
| 88 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 89 | Rectal abscess | FAERS: 2 | US FAERS | |
| 90 | Retinal Artery Occlusion | FAERS: 2 | OFFSIDES US FAERS | |
| 91 | Retinal exudates | FAERS: 2 | OFFSIDES US FAERS | |
| 92 | Somnolence | FAERS: 2 | US FAERS | |
| 93 | Vertigo | FAERS: 2 | US FAERS | |
| 94 | Abasia | FAERS: 1 | US FAERS | |
| 95 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 96 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 97 | Abortion early | FAERS: 1 | US FAERS | |
| 98 | Abortion of ectopic pregnancy | FAERS: 1 | US FAERS | |
| 99 | Adnexa uteri mass | FAERS: 1 | US FAERS | |
| 100 | Alanine Aminotransferase Increased | FAERS: 1 | OFFSIDES US FAERS | |
| 101 | Amaurosis Fugax | FAERS: 1 | US FAERS | |
| 102 | Anencephaly | FAERS: 1 | US FAERS | |
| 103 | Anger | FAERS: 1 | US FAERS | |
| 104 | Apathy | FAERS: 1 | US FAERS | |
| 105 | Arthralgia | FAERS: 1 | US FAERS | |
| 106 | Arthropathy | FAERS: 1 | US FAERS | |
| 107 | Ascites | FAERS: 1 | OFFSIDES US FAERS | |
| 108 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 109 | Asthma | FAERS: 1 | US FAERS | |
| 110 | Atrioventricular Septal Defect | FAERS: 1 | US FAERS | |
| 111 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 112 | Back Pain | FAERS: 1 | US FAERS | |
| 113 | Bicuspid aortic valve | FAERS: 1 | US FAERS | |
| 114 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 115 | Blindness | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 117 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 118 | Blood testosterone abnormal | FAERS: 1 | US FAERS | |
| 119 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 120 | Breast cancer stage III | FAERS: 1 | US FAERS | |
| 121 | Burning sensation | FAERS: 1 | US FAERS | |
| 122 | Calcinosis | FAERS: 1 | US FAERS | |
| 123 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 124 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 125 | Cholecystitis | FAERS: 1 | OFFSIDES US FAERS | |
| 126 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 127 | Chromaturia | FAERS: 1 | US FAERS | |
| 128 | Clubbing | FAERS: 1 | US FAERS | |
| 129 | Completed Suicide | FAERS: 1 | OFFSIDES US FAERS | |
| 130 | Complications of maternal exposure to therapeutic drugs | FAERS: 1 | OFFSIDES US FAERS | |
| 131 | Congenital anomaly in offspring | FAERS: 1 | US FAERS | |
| 132 | Congenital hydronephrosis | FAERS: 1 | US FAERS | |
| 133 | Constipation | FAERS: 1 | US FAERS | |
| 134 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 135 | Craniorachischisis | FAERS: 1 | US FAERS | |
| 136 | Creutzfeldt-Jakob disease | FAERS: 1 | US FAERS | |
| 137 | Death of relative | FAERS: 1 | US FAERS | |
| 138 | Depressed mood | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 139 | Double ureter | FAERS: 1 | US FAERS | |
| 140 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 141 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 142 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 143 | Drug toxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 144 | Dry skin | FAERS: 1 | US FAERS | |
| 145 | Duodenitis | FAERS: 1 | US FAERS | |
| 146 | Dural Arteriovenous Fistula | FAERS: 1 | US FAERS | |
| 147 | Dwarfism | FAERS: 1 | US FAERS | |
| 148 | Dysplasia | FAERS: 1 | US FAERS | |
| 149 | Ectopia Cordis | FAERS: 1 | US FAERS | |
| 150 | Euphoric mood | FAERS: 1 | US FAERS | |
| 151 | Exposure via father | FAERS: 1 | US FAERS | |
| 152 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 153 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 154 | Gastroschisis | FAERS: 1 | US FAERS | |
| 155 | Gestational Diabetes | FAERS: 1 | OFFSIDES US FAERS | |
| 156 | Glaucoma | FAERS: 1 | US FAERS | |
| 157 | Head deformity | FAERS: 1 | US FAERS | |
| 158 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 159 | Hernia | FAERS: 1 | US FAERS | |
| 160 | Holoprosencephaly | FAERS: 1 | US FAERS | |
| 161 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 162 | Hypersensitivity | FAERS: 1 | US FAERS | |
| 163 | Hypoplastic Left Heart Syndrome | FAERS: 1 | US FAERS | |
| 164 | Hypotension | FAERS: 1 | US FAERS | |
| 165 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 166 | Impaired work ability | FAERS: 1 | US FAERS | |
| 167 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 168 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 169 | Intracranial meningioma malignant | FAERS: 1 | US FAERS | |
| 170 | Joint stiffness | FAERS: 1 | US FAERS | |
| 171 | Lymphadenitis | FAERS: 1 | US FAERS | |
| 172 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 173 | Lymphangioleiomyomatosis | FAERS: 1 | US FAERS | |
| 174 | Malignant ovarian cyst | FAERS: 1 | US FAERS | |
| 175 | Medulloblastoma | FAERS: 1 | US FAERS | |
| 176 | Meningitis | FAERS: 1 | US FAERS | |
| 177 | Metastasis | FAERS: 1 | US FAERS | |
| 178 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 179 | Murphy's sign positive | FAERS: 1 | US FAERS | |
| 180 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 181 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 182 | Myalgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Mydriasis | FAERS: 1 | US FAERS | |
| 184 | Neonatal pneumonia | FAERS: 1 | US FAERS | |
| 185 | Nerve injury | FAERS: 1 | US FAERS | |
| 186 | Nodule | FAERS: 1 | US FAERS | |
| 187 | Obsessive-Compulsive Disorder | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 188 | Occult blood positive | FAERS: 1 | US FAERS | |
| 189 | Oligohydramnios | FAERS: 1 | US FAERS | |
| 190 | Optic Atrophy | FAERS: 1 | US FAERS | |
| 191 | Pancreatitis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 192 | Pancytopenia | FAERS: 1 | US FAERS | |
| 193 | Panic Disorder | FAERS: 1 | US FAERS | |
| 194 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 195 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 196 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 197 | Personality Change | FAERS: 1 | US FAERS | |
| 198 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 199 | Pityriasis Rosea | FAERS: 1 | US FAERS | |
| 200 | Placenta Accreta | FAERS: 1 | US FAERS | |
| 201 | Pneumonia | FAERS: 1 | US FAERS | |
| 202 | Pneumothorax | FAERS: 1 | US FAERS | |
| 203 | Post procedural complication | FAERS: 1 | US FAERS | |
| 204 | Pregnancy test negative | FAERS: 1 | US FAERS | |
| 205 | Product complaint | FAERS: 1 | US FAERS | |
| 206 | Product contamination physical | FAERS: 1 | US FAERS | |
| 207 | Product dispensing error | FAERS: 1 | US FAERS | |
| 208 | Protein urine present | FAERS: 1 | US FAERS | |
| 209 | Pruritus | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 210 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 211 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 212 | Pulmonary arterial hypertension | FAERS: 1 | US FAERS | |
| 213 | Pyelocaliectasis | FAERS: 1 | US FAERS | |
| 214 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 215 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 216 | Retinal pigment epitheliopathy | FAERS: 1 | US FAERS | |
| 217 | Scotoma | FAERS: 1 | US FAERS | |
| 218 | Seminoma | FAERS: 1 | US FAERS | |
| 219 | Shock | FAERS: 1 | US FAERS | |
| 220 | Spina Bifida | FAERS: 1 | OFFSIDES US FAERS | |
| 221 | Stillbirth | FAERS: 1 | US FAERS | |
| 222 | Suicide attempt | FAERS: 1 | US FAERS | |
| 223 | Swelling | FAERS: 1 | US FAERS | |
| 224 | Syncope | FAERS: 1 | US FAERS | |
| 225 | Tachyphrenia | FAERS: 1 | US FAERS | |
| 226 | Talipes | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 227 | Tenosynovitis | FAERS: 1 | US FAERS | |
| 228 | Throat irritation | FAERS: 1 | US FAERS | |
| 229 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 230 | Tinnitus | FAERS: 1 | US FAERS | |
| 231 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 232 | Transaminases increased | FAERS: 1 | US FAERS | |
| 233 | Tubal rupture | FAERS: 1 | US FAERS | |
| 234 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 235 | Urinary Retention | FAERS: 1 | US FAERS | |
| 236 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 237 | Urticaria | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Wrong technique in product usage process | FAERS: 1 | US FAERS | |
| 239 | hypertensive nephropathy | FAERS: 1 | US FAERS | |
| 240 | Abnormal vision | OFFSIDES | ||
| 241 | Adenocarcinoma | OFFSIDES | ||
| 242 | Alanine aminotransferase abnormal | Canada Vigilance: 1 | Canada Vigilance | |
| 243 | Alveolitis | OFFSIDES | ||
| 244 | Amenorrhea | OFFSIDES | ||
| 245 | Angioedema | Canada Vigilance: 1 | Canada Vigilance | |
| 246 | Anticholinergic Syndrome | OFFSIDES | ||
| 247 | Blighted ovum | OFFSIDES | ||
| 248 | Blood cholesterol | OFFSIDES | ||
| 249 | Blood follicle stimulating hormone decreased | OFFSIDES | ||
| 250 | Blood growth hormone increased | OFFSIDES | ||
| 251 | Blood prolactin increased | OFFSIDES | ||
| 252 | Blurred vision | OFFSIDES | ||
| 253 | Bronchitis | OFFSIDES | ||
| 254 | Cataract | Canada Vigilance: 3 | Canada Vigilance | |
| 255 | Chills | Canada Vigilance: 1 | Canada Vigilance | |
| 256 | Circumstance or information capable of leading to medication error | OFFSIDES | ||
| 257 | Claustrophobia | OFFSIDES | ||
| 258 | Cleft Palate | OFFSIDES | ||
| 259 | Craniosynostosis | OFFSIDES | ||
| 260 | Dermatofibrosarcoma | OFFSIDES | ||
| 261 | Device Failure | OFFSIDES | ||
| 262 | Device related infection | OFFSIDES | ||
| 263 | Dysmorphism | OFFSIDES | ||
| 264 | Dysthymic Disorder | OFFSIDES | ||
| 265 | Economic problem | OFFSIDES | ||
| 266 | Electrocardiogram ST-T change | OFFSIDES | ||
| 267 | Electrocardiogram repolarisation abnormality | OFFSIDES | ||
| 268 | Encephalitis | Canada Vigilance: 1 | Canada Vigilance | |
| 269 | Endometrial Hyperplasia | OFFSIDES | ||
| 270 | Epstein-Barr virus antibody positive | OFFSIDES | ||
| 271 | Flank Pain | OFFSIDES | ||
| 272 | Gait inability | Canada Vigilance: 1 | Canada Vigilance | |
| 273 | Galactorrhea | OFFSIDES | ||
| 274 | Gambling | OFFSIDES | ||
| 275 | Gangrene | OFFSIDES | ||
| 276 | General physical health deterioration | OFFSIDES | ||
| 277 | Haemoconcentration | OFFSIDES | ||
| 278 | Hyperemesis Gravidarum | OFFSIDES | ||
| 279 | Infertility | OFFSIDES | ||
| 280 | Intention tremor | OFFSIDES | ||
| 281 | Kidney Failure | OFFSIDES | ||
| 282 | Mediastinitis | OFFSIDES | ||
| 283 | Nystagmus | Canada Vigilance: 1 | Canada Vigilance | |
| 284 | Optic Disc Edema | OFFSIDES | ||
| 285 | Orthopnea | OFFSIDES | ||
| 286 | Ovarian cyst torsion | OFFSIDES | ||
| 287 | Pericardial effusion | OFFSIDES | ||
| 288 | Plagiocephaly | OFFSIDES | ||
| 289 | Polyhydramnios | OFFSIDES | ||
| 290 | Progesterone decreased | OFFSIDES | ||
| 291 | Pulmonary congestion | OFFSIDES | ||
| 292 | Purpura | Canada Vigilance: 1 | Canada Vigilance | |
| 293 | Sinusitis | OFFSIDES | ||
| 294 | Supraventricular tachycardia | OFFSIDES | ||
| 295 | Syndactyly | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 296 | Trisomy 21 | Canada Vigilance: 1 | Canada Vigilance | |
| 297 | Uterine Cancer | OFFSIDES | ||
| 298 | Wound Infection | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.