paricalcitol
(BPKAHTKRCLCHEA-UBFJEZKGSA-N)
Structure
- SMILES
- O[C@H]1C[C@H](O)CC(=C/C=C/2\CCC[C@]3([C@H]2CC[C@@H]3[C@@H](/C=C/[C@@H](C(O)(C)C)C)C)C)C1
- Type(s)
- Approved; Investigational
- ATC code(s)
- H05BX02
- Molecular Formula:
- C27H44O3
- Molecular Weight:
- 416.636
- Log P:
- 5.5606
- Hydrogen Bond Acceptor:
- 3
- Hydrogen Bond Donor:
- 3
- TPSA:
- 60.69
- CAS Number(s):
- 131918-61-1
Synonym(s)
1.
paricalcitol
2.
19-nor-1,25-(OH)2D2
3.
19-nor-1alpha,25-dihydroxyvitamin D2
4.
Zemplar
5.
paricalcitol-d6
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Myocardial Infarction | FAERS: 405 | US FAERS | |
| 2 | Sepsis | FAERS: 321 | SIDER US FAERS | |
| 3 | Infarction | FAERS: 243 | US FAERS | |
| 4 | Adverse event | FAERS: 201 | US FAERS | |
| 5 | Cerebrovascular accident | FAERS: 185 | SIDER US FAERS | |
| 6 | Respiratory arrest | FAERS: 169 | US FAERS | |
| 7 | Infection | FAERS: 159 | OFFSIDES SIDER US FAERS | |
| 8 | Cardiac Arrest | FAERS: 132 | SIDER US FAERS | |
| 9 | Pneumonia | FAERS: 100 | SIDER US FAERS | |
| 10 | General physical health deterioration | FAERS: 85 | OFFSIDES US FAERS | |
| 11 | Unevaluable event | FAERS: 81 | US FAERS | |
| 12 | Transplant | FAERS: 52 | US FAERS | |
| 13 | Acute myocardial infarction | FAERS: 48 | OFFSIDES US FAERS | |
| 14 | Respiratory Failure | FAERS: 42 | OFFSIDES US FAERS | |
| 15 | Chest Pain | FAERS: 41 | SIDER US FAERS | |
| 16 | Malaise | FAERS: 40 | SIDER US FAERS | |
| 17 | Vomiting | FAERS: 40 | SIDER US FAERS | |
| 18 | Device related infection | FAERS: 39 | OFFSIDES US FAERS | |
| 19 | Sudden death | FAERS: 39 | OFFSIDES US FAERS | |
| 20 | Nausea | FAERS: 36 | OFFSIDES SIDER US FAERS | |
| 21 | Headache | FAERS: 35 | SIDER US FAERS | |
| 22 | Hypotension | FAERS: 35 | SIDER US FAERS | |
| 23 | Abdominal Pain | FAERS: 34 | OFFSIDES SIDER US FAERS | |
| 24 | Pain | FAERS: 34 | SIDER US FAERS | |
| 25 | Asthenia | FAERS: 33 | OFFSIDES SIDER US FAERS | |
| 26 | Dizziness | FAERS: 33 | SIDER US FAERS | |
| 27 | Pruritus | FAERS: 28 | SIDER US FAERS | |
| 28 | Blood parathyroid hormone increased | FAERS: 27 | OFFSIDES US FAERS | |
| 29 | Urinary tract infection | FAERS: 27 | SIDER US FAERS | |
| 30 | Device related sepsis | FAERS: 26 | US FAERS | |
| 31 | Fatigue | FAERS: 24 | OFFSIDES SIDER US FAERS | |
| 32 | Bone pain | FAERS: 22 | OFFSIDES SIDER US FAERS | |
| 33 | Pulmonary Embolism | FAERS: 22 | US FAERS | |
| 34 | Peritonitis | FAERS: 20 | OFFSIDES SIDER US FAERS | |
| 35 | Septic Shock | FAERS: 20 | OFFSIDES US FAERS | |
| 36 | Arthralgia | FAERS: 19 | SIDER US FAERS | |
| 37 | Diabetic Foot | FAERS: 19 | OFFSIDES US FAERS | |
| 38 | Disease complication | FAERS: 18 | US FAERS | |
| 39 | Respiratory distress | FAERS: 18 | US FAERS | |
| 40 | Arteriovenous fistula occlusion | FAERS: 16 | OFFSIDES US FAERS | |
| 41 | Dysgeusia | FAERS: 16 | OFFSIDES SIDER US FAERS | |
| 42 | Hypertensive crisis | FAERS: 16 | US FAERS | |
| 43 | Diabetes Mellitus | FAERS: 15 | US FAERS | |
| 44 | Parathyroidectomy | FAERS: 15 | OFFSIDES US FAERS | |
| 45 | Drug ineffective | FAERS: 14 | US FAERS | |
| 46 | Skin Ulcer | FAERS: 14 | SIDER US FAERS | |
| 47 | Syncope | FAERS: 14 | SIDER US FAERS | |
| 48 | Thrombosis | FAERS: 13 | US FAERS | |
| 49 | Back Pain | FAERS: 12 | SIDER US FAERS | |
| 50 | Cataract | FAERS: 11 | US FAERS | |
| 51 | Constipation | FAERS: 11 | SIDER US FAERS | |
| 52 | Coronary Artery Disease | FAERS: 11 | US FAERS | |
| 53 | Device occlusion | FAERS: 11 | US FAERS | |
| 54 | Gangrene | FAERS: 11 | OFFSIDES US FAERS | |
| 55 | Abdominal sepsis | FAERS: 10 | US FAERS | |
| 56 | Arteriovenous fistula thrombosis | FAERS: 10 | OFFSIDES US FAERS | |
| 57 | Blood creatinine increased | FAERS: 10 | US FAERS | |
| 58 | Bronchitis | FAERS: 10 | US FAERS | |
| 59 | Cholelithiasis | FAERS: 10 | US FAERS | |
| 60 | Myalgia | FAERS: 10 | SIDER US FAERS | |
| 61 | Pulmonary sepsis | FAERS: 10 | US FAERS | |
| 62 | Angina Pectoris | FAERS: 9 | US FAERS | |
| 63 | Arteriovenous fistula site infection | FAERS: 9 | OFFSIDES US FAERS | |
| 64 | Atrial Fibrillation | FAERS: 9 | US FAERS | |
| 65 | Cellulitis | FAERS: 9 | OFFSIDES US FAERS | |
| 66 | Disorientation | FAERS: 9 | US FAERS | |
| 67 | Bronchopneumonia | FAERS: 8 | OFFSIDES US FAERS | |
| 68 | Discomfort | FAERS: 8 | SIDER US FAERS | |
| 69 | Endocarditis | FAERS: 8 | OFFSIDES US FAERS | |
| 70 | Hypersensitivity | FAERS: 8 | SIDER US FAERS | |
| 71 | Osteomyelitis | FAERS: 8 | US FAERS | |
| 72 | Supraventricular tachycardia | FAERS: 8 | US FAERS | |
| 73 | Tachycardia | FAERS: 8 | US FAERS | |
| 74 | Weight decreased | FAERS: 8 | SIDER US FAERS | |
| 75 | Angiosclerosis | FAERS: 7 | US FAERS | |
| 76 | Arteriovenous fistula site complication | FAERS: 7 | OFFSIDES US FAERS | |
| 77 | Arthritis | FAERS: 7 | SIDER US FAERS | |
| 78 | Blood parathyroid hormone abnormal | FAERS: 7 | US FAERS | |
| 79 | Chills | FAERS: 7 | SIDER US FAERS | |
| 80 | Choking sensation | FAERS: 7 | OFFSIDES US FAERS | |
| 81 | Device damage | FAERS: 7 | US FAERS | |
| 82 | Peripheral arterial occlusive disease | FAERS: 7 | OFFSIDES US FAERS | |
| 83 | Shunt occlusion | FAERS: 7 | OFFSIDES US FAERS | |
| 84 | Somnolence | FAERS: 7 | SIDER US FAERS | |
| 85 | Abscess | FAERS: 6 | US FAERS | |
| 86 | Anxiety | FAERS: 6 | SIDER US FAERS | |
| 87 | Asthma | FAERS: 6 | SIDER US FAERS | |
| 88 | Diabetic foot infection | FAERS: 6 | US FAERS | |
| 89 | Hypertensive cardiomyopathy | FAERS: 6 | OFFSIDES US FAERS | |
| 90 | Incorrect route of drug administration | FAERS: 6 | US FAERS | |
| 91 | Inflammation | FAERS: 6 | US FAERS | |
| 92 | Intestinal Obstruction | FAERS: 6 | US FAERS | |
| 93 | Pericardial effusion | FAERS: 6 | OFFSIDES US FAERS | |
| 94 | Soft Tissue Infection | FAERS: 6 | US FAERS | |
| 95 | Swelling | FAERS: 6 | SIDER US FAERS | |
| 96 | Tremor | FAERS: 6 | US FAERS | |
| 97 | Uterine Cancer | FAERS: 6 | US FAERS | |
| 98 | Vascular Access Complication | FAERS: 6 | OFFSIDES US FAERS | |
| 99 | Arthropod bite | FAERS: 5 | US FAERS | |
| 100 | Asphyxia | FAERS: 5 | OFFSIDES US FAERS | |
| 101 | Blood phosphorus increased | FAERS: 5 | OFFSIDES US FAERS | |
| 102 | Bradycardia | FAERS: 5 | US FAERS | |
| 103 | Cardiac Death | FAERS: 5 | US FAERS | |
| 104 | Chest discomfort | FAERS: 5 | SIDER US FAERS | |
| 105 | Choking | FAERS: 5 | US FAERS | |
| 106 | Complication associated with device | FAERS: 5 | US FAERS | |
| 107 | Drowning | FAERS: 5 | US FAERS | |
| 108 | Extremity necrosis | FAERS: 5 | US FAERS | |
| 109 | Flatulence | FAERS: 5 | US FAERS | |
| 110 | Fluid overload | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 111 | Ileus | FAERS: 5 | US FAERS | |
| 112 | Infected fistula | FAERS: 5 | US FAERS | |
| 113 | Influenza | FAERS: 5 | SIDER US FAERS | |
| 114 | Joint swelling | FAERS: 5 | US FAERS | |
| 115 | Lower respiratory tract infection | FAERS: 5 | US FAERS | |
| 116 | Malnutrition | FAERS: 5 | SIDER US FAERS | |
| 117 | Menorrhagia | FAERS: 5 | US FAERS | |
| 118 | Oxygen saturation abnormal | FAERS: 5 | OFFSIDES US FAERS | |
| 119 | Post procedural complication | FAERS: 5 | US FAERS | |
| 120 | Productive Cough | FAERS: 5 | US FAERS | |
| 121 | Skin necrosis | FAERS: 5 | OFFSIDES US FAERS | |
| 122 | Tuberculosis | FAERS: 5 | US FAERS | |
| 123 | Vertigo | FAERS: 5 | SIDER US FAERS | |
| 124 | nervous system disorder | FAERS: 5 | SIDER US FAERS | |
| 125 | Abdominal discomfort | FAERS: 4 | SIDER US FAERS | |
| 126 | Acute Coronary Syndrome | FAERS: 4 | OFFSIDES US FAERS | |
| 127 | Aortic Valve Stenosis | FAERS: 4 | US FAERS | |
| 128 | Appendicitis | FAERS: 4 | US FAERS | |
| 129 | Arteriovenous fistula | FAERS: 4 | OFFSIDES US FAERS | |
| 130 | Arthropathy | FAERS: 4 | SIDER US FAERS | |
| 131 | Ascites | FAERS: 4 | OFFSIDES US FAERS | |
| 132 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 133 | Blood phosphorus abnormal | FAERS: 4 | US FAERS | |
| 134 | Blood urea increased | FAERS: 4 | SIDER US FAERS | |
| 135 | Brain Death | FAERS: 4 | US FAERS | |
| 136 | Bronchospasm | FAERS: 4 | US FAERS | |
| 137 | Calcinosis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 138 | Calciphylaxis | FAERS: 4 | OFFSIDES US FAERS | |
| 139 | Cataract operation | FAERS: 4 | US FAERS | |
| 140 | Catheter placement | FAERS: 4 | US FAERS | |
| 141 | Catheter site infection | FAERS: 4 | US FAERS | |
| 142 | Catheter site pain | FAERS: 4 | OFFSIDES US FAERS | |
| 143 | Cervix carcinoma | FAERS: 4 | US FAERS | |
| 144 | Delirium | FAERS: 4 | SIDER US FAERS | |
| 145 | Dengue Fever | FAERS: 4 | US FAERS | |
| 146 | Electrolyte imbalance | FAERS: 4 | US FAERS | |
| 147 | Embolism | FAERS: 4 | OFFSIDES US FAERS | |
| 148 | Fracture | FAERS: 4 | US FAERS | |
| 149 | Gastric ulcer | FAERS: 4 | US FAERS | |
| 150 | Gastrointestinal carcinoma | FAERS: 4 | US FAERS | |
| 151 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 152 | Nephrectomy | FAERS: 4 | OFFSIDES US FAERS | |
| 153 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 154 | Peripheral swelling | FAERS: 4 | US FAERS | |
| 155 | Procedural complication | FAERS: 4 | OFFSIDES US FAERS | |
| 156 | Pulmonary Infarction | FAERS: 4 | US FAERS | |
| 157 | Shunt thrombosis | FAERS: 4 | OFFSIDES US FAERS | |
| 158 | Tachyarrhythmia | FAERS: 4 | US FAERS | |
| 159 | Vascular calcification | FAERS: 4 | OFFSIDES US FAERS | |
| 160 | Venous occlusion | FAERS: 4 | US FAERS | |
| 161 | jaundice | FAERS: 4 | US FAERS | |
| 162 | Altered state of consciousness | FAERS: 3 | US FAERS | |
| 163 | Basal cell carcinoma | FAERS: 3 | US FAERS | |
| 164 | Bedridden | FAERS: 3 | US FAERS | |
| 165 | Blood creatinine abnormal | FAERS: 3 | US FAERS | |
| 166 | Blood glucose decreased | FAERS: 3 | OFFSIDES US FAERS | |
| 167 | Blood potassium increased | FAERS: 3 | OFFSIDES US FAERS | |
| 168 | Cachexia | FAERS: 3 | US FAERS | |
| 169 | Cardiomegaly | FAERS: 3 | 21565836 | CTD US FAERS |
| 170 | Cholecystitis | FAERS: 3 | OFFSIDES US FAERS | |
| 171 | Colitis | FAERS: 3 | SIDER US FAERS | |
| 172 | Cystitis | FAERS: 3 | US FAERS | |
| 173 | Dehydration | FAERS: 3 | SIDER US FAERS | |
| 174 | Diabetic Retinopathy | FAERS: 3 | US FAERS | |
| 175 | Dialysis related complication | FAERS: 3 | US FAERS | |
| 176 | Disease Progression | FAERS: 3 | US FAERS | |
| 177 | Dysarthria | FAERS: 3 | US FAERS | |
| 178 | Erythema | FAERS: 3 | OFFSIDES US FAERS | |
| 179 | Feeling abnormal | FAERS: 3 | SIDER US FAERS | |
| 180 | Flank Pain | FAERS: 3 | US FAERS | |
| 181 | Glaucoma | FAERS: 3 | SIDER US FAERS | |
| 182 | Hepatomegaly | FAERS: 3 | US FAERS | |
| 183 | Hernia | FAERS: 3 | US FAERS | |
| 184 | Hypertensive heart disease | FAERS: 3 | US FAERS | |
| 185 | Hypophagia | FAERS: 3 | US FAERS | |
| 186 | Limb mass | FAERS: 3 | US FAERS | |
| 187 | Lymphadenopathy | FAERS: 3 | SIDER US FAERS | |
| 188 | Lymphoma | FAERS: 3 | US FAERS | |
| 189 | Memory impairment | FAERS: 3 | US FAERS | |
| 190 | Metabolic acidosis | FAERS: 3 | OFFSIDES US FAERS | |
| 191 | Oropharyngeal pain | FAERS: 3 | SIDER US FAERS | |
| 192 | Osteoporosis | FAERS: 3 | US FAERS | |
| 193 | Palpitations | FAERS: 3 | SIDER US FAERS | |
| 194 | Pancreatitis | FAERS: 3 | SIDER US FAERS | |
| 195 | Pathological fracture | FAERS: 3 | US FAERS | |
| 196 | Phlebitis | FAERS: 3 | US FAERS | |
| 197 | Post procedural sepsis | FAERS: 3 | OFFSIDES US FAERS | |
| 198 | Rehabilitation therapy | FAERS: 3 | US FAERS | |
| 199 | Respiratory tract congestion | FAERS: 3 | US FAERS | |
| 200 | Sacroiliitis | FAERS: 3 | US FAERS | |
| 201 | Sudden Cardiac Death | FAERS: 3 | OFFSIDES US FAERS | |
| 202 | Thirst | FAERS: 3 | SIDER US FAERS | |
| 203 | Thrombosis in device | FAERS: 3 | OFFSIDES US FAERS | |
| 204 | Thyroidectomy | FAERS: 3 | US FAERS | |
| 205 | Urticaria | FAERS: 3 | SIDER US FAERS | |
| 206 | Visual Impairment | FAERS: 3 | US FAERS | |
| 207 | Waist circumference increased | FAERS: 3 | US FAERS | |
| 208 | Wound Complication | FAERS: 3 | US FAERS | |
| 209 | Abasia | FAERS: 2 | US FAERS | |
| 210 | Abdominal mass | FAERS: 2 | US FAERS | |
| 211 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 212 | Acute kidney injury | FAERS: 2 | US FAERS | |
| 213 | Alopecia | FAERS: 2 | SIDER US FAERS | |
| 214 | Amnesia | FAERS: 2 | US FAERS | |
| 215 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 216 | Arteriosclerosis | FAERS: 2 | OFFSIDES US FAERS | |
| 217 | Arteriovenous fistula aneurysm | FAERS: 2 | US FAERS | |
| 218 | Aspiration pleural cavity abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 219 | Bacterial sepsis | FAERS: 2 | US FAERS | |
| 220 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 221 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 222 | Blood parathyroid hormone decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 223 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 224 | Candidiasis | FAERS: 2 | US FAERS | |
| 225 | Cardiac Tamponade | FAERS: 2 | US FAERS | |
| 226 | Catheter sepsis | FAERS: 2 | OFFSIDES US FAERS | |
| 227 | Catheter site abscess | FAERS: 2 | US FAERS | |
| 228 | Catheter site discharge | FAERS: 2 | US FAERS | |
| 229 | Catheter site erythema | FAERS: 2 | US FAERS | |
| 230 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 231 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 232 | Cholangitis | FAERS: 2 | US FAERS | |
| 233 | Congenital cystic kidney disease | FAERS: 2 | OFFSIDES US FAERS | |
| 234 | Deafness | FAERS: 2 | US FAERS | |
| 235 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 236 | Dementia | FAERS: 2 | US FAERS | |
| 237 | Depressed Level of Consciousness | FAERS: 2 | SIDER US FAERS | |
| 238 | Device malfunction | FAERS: 2 | US FAERS | |
| 239 | Diabetic Ketoacidosis | FAERS: 2 | US FAERS | |
| 240 | Drug dose omission | FAERS: 2 | US FAERS | |
| 241 | Dyspepsia | FAERS: 2 | SIDER US FAERS | |
| 242 | Electrocardiogram change | FAERS: 2 | US FAERS | |
| 243 | Enterocolitis | FAERS: 2 | US FAERS | |
| 244 | Epilepsy | FAERS: 2 | US FAERS | |
| 245 | Epistaxis | FAERS: 2 | SIDER US FAERS | |
| 246 | Erysipelas | FAERS: 2 | US FAERS | |
| 247 | Escherichia infection | FAERS: 2 | US FAERS | |
| 248 | Extrinsic vascular compression | FAERS: 2 | OFFSIDES US FAERS | |
| 249 | Eye laser surgery | FAERS: 2 | US FAERS | |
| 250 | Flushing | FAERS: 2 | US FAERS | |
| 251 | Fungal peritonitis | FAERS: 2 | OFFSIDES US FAERS | |
| 252 | Gastroenteritis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 253 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 254 | Gout | FAERS: 2 | OFFSIDES US FAERS | |
| 255 | Hemiparesis | FAERS: 2 | US FAERS | |
| 256 | Hip surgery | FAERS: 2 | US FAERS | |
| 257 | Hormone level abnormal | FAERS: 2 | US FAERS | |
| 258 | Hypoventilation | FAERS: 2 | US FAERS | |
| 259 | Inappropriate schedule of drug administration | FAERS: 2 | US FAERS | |
| 260 | Incontinence | FAERS: 2 | US FAERS | |
| 261 | Injection site pain | FAERS: 2 | SIDER US FAERS | |
| 262 | Intestinal sepsis | FAERS: 2 | US FAERS | |
| 263 | Intracranial Aneurysm | FAERS: 2 | US FAERS | |
| 264 | Joint injury | FAERS: 2 | US FAERS | |
| 265 | Laryngitis | FAERS: 2 | US FAERS | |
| 266 | Lethargy | FAERS: 2 | US FAERS | |
| 267 | Ligament rupture | FAERS: 2 | US FAERS | |
| 268 | Limb injury | FAERS: 2 | US FAERS | |
| 269 | Limb operation | FAERS: 2 | US FAERS | |
| 270 | Liver Abscess | FAERS: 2 | US FAERS | |
| 271 | Lyme Disease | FAERS: 2 | US FAERS | |
| 272 | Medical device change | FAERS: 2 | US FAERS | |
| 273 | Medical device complication | FAERS: 2 | OFFSIDES US FAERS | |
| 274 | Muscle abscess | FAERS: 2 | OFFSIDES US FAERS | |
| 275 | Musculoskeletal chest pain | FAERS: 2 | US FAERS | |
| 276 | Mycobacterium test positive | FAERS: 2 | US FAERS | |
| 277 | Nasopharyngitis | FAERS: 2 | SIDER US FAERS | |
| 278 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 279 | Peripheral artery occlusion | FAERS: 2 | US FAERS | |
| 280 | Peripheral embolism | FAERS: 2 | OFFSIDES US FAERS | |
| 281 | Peritoneal Dialysis | FAERS: 2 | OFFSIDES US FAERS | |
| 282 | Pneumothorax | FAERS: 2 | US FAERS | |
| 283 | Poisoning | FAERS: 2 | SIDER US FAERS | |
| 284 | Presenile dementia | FAERS: 2 | US FAERS | |
| 285 | Presyncope | FAERS: 2 | US FAERS | |
| 286 | Product physical issue | FAERS: 2 | US FAERS | |
| 287 | Purulent discharge | FAERS: 2 | US FAERS | |
| 288 | Rales | FAERS: 2 | OFFSIDES US FAERS | |
| 289 | Rash erythematous | FAERS: 2 | US FAERS | |
| 290 | Rhonchi | FAERS: 2 | OFFSIDES US FAERS | |
| 291 | Septic vasculitis | FAERS: 2 | US FAERS | |
| 292 | Skin lesion | FAERS: 2 | OFFSIDES US FAERS | |
| 293 | Subileus | FAERS: 2 | OFFSIDES US FAERS | |
| 294 | Synovial Cyst | FAERS: 2 | US FAERS | |
| 295 | Therapy cessation | FAERS: 2 | OFFSIDES US FAERS | |
| 296 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 297 | Thrombophlebitis | FAERS: 2 | US FAERS | |
| 298 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 299 | Underweight | FAERS: 2 | US FAERS | |
| 300 | Unresponsive to stimuli | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 301 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 302 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 303 | Vascular rupture | FAERS: 2 | OFFSIDES US FAERS | |
| 304 | Ventricular Fibrillation | FAERS: 2 | OFFSIDES US FAERS | |
| 305 | Wound necrosis | FAERS: 2 | OFFSIDES US FAERS | |
| 306 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 307 | Abdominal Infection | FAERS: 1 | US FAERS | |
| 308 | Abdominal adhesions | FAERS: 1 | US FAERS | |
| 309 | Acute endocarditis | FAERS: 1 | US FAERS | |
| 310 | Acute respiratory failure | FAERS: 1 | OFFSIDES US FAERS | |
| 311 | Agitation | FAERS: 1 | SIDER US FAERS | |
| 312 | Amaurosis | FAERS: 1 | US FAERS | |
| 313 | Anaplastic astrocytoma | FAERS: 1 | OFFSIDES US FAERS | |
| 314 | Anorexia | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 315 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 316 | Aphasia | FAERS: 1 | US FAERS | |
| 317 | Application site pruritus | FAERS: 1 | US FAERS | |
| 318 | Arteriosclerosis Obliterans | FAERS: 1 | OFFSIDES US FAERS | |
| 319 | Arteriovenous fistula maturation failure | FAERS: 1 | US FAERS | |
| 320 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 321 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 322 | Biopsy | FAERS: 1 | US FAERS | |
| 323 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 324 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 325 | Blindness | FAERS: 1 | US FAERS | |
| 326 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 327 | Blood calcium abnormal | FAERS: 1 | US FAERS | |
| 328 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 329 | Blood phosphorus decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 330 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 331 | Bone erosion | FAERS: 1 | US FAERS | |
| 332 | Bunion operation | FAERS: 1 | US FAERS | |
| 333 | Burn infection | FAERS: 1 | US FAERS | |
| 334 | Burning sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 335 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 336 | Cardiac infection | FAERS: 1 | US FAERS | |
| 337 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 338 | Cardiac valve vegetation | FAERS: 1 | US FAERS | |
| 339 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 340 | Catheter site swelling | FAERS: 1 | US FAERS | |
| 341 | Central venous catheter removal | FAERS: 1 | US FAERS | |
| 342 | Cerebral Arteriosclerosis | FAERS: 1 | US FAERS | |
| 343 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 344 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 345 | Chromaturia | FAERS: 1 | US FAERS | |
| 346 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 347 | Completed Suicide | FAERS: 1 | US FAERS | |
| 348 | Complication of device insertion | FAERS: 1 | US FAERS | |
| 349 | Conjunctivitis | FAERS: 1 | SIDER US FAERS | |
| 350 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 351 | Coronary artery embolism | FAERS: 1 | US FAERS | |
| 352 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 353 | Crying | FAERS: 1 | US FAERS | |
| 354 | Cyanosis | FAERS: 1 | US FAERS | |
| 355 | Cystocele | FAERS: 1 | US FAERS | |
| 356 | Deposit eye | FAERS: 1 | US FAERS | |
| 357 | Depressed mood | FAERS: 1 | US FAERS | |
| 358 | Device Failure | FAERS: 1 | US FAERS | |
| 359 | Device dislocation | FAERS: 1 | OFFSIDES US FAERS | |
| 360 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 361 | Diabetic blindness | FAERS: 1 | US FAERS | |
| 362 | Diabetic metabolic decompensation | FAERS: 1 | US FAERS | |
| 363 | Diplopia | FAERS: 1 | US FAERS | |
| 364 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 365 | Drug level increased | FAERS: 1 | US FAERS | |
| 366 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 367 | Dry skin | FAERS: 1 | OFFSIDES US FAERS | |
| 368 | Dysphasia | FAERS: 1 | US FAERS | |
| 369 | Dysphonia | FAERS: 1 | US FAERS | |
| 370 | Dysuria | FAERS: 1 | US FAERS | |
| 371 | Emotional disorder | FAERS: 1 | US FAERS | |
| 372 | Endophthalmitis | FAERS: 1 | SIDER US FAERS | |
| 373 | Expired drug administered | FAERS: 1 | US FAERS | |
| 374 | Expired product administered | FAERS: 1 | US FAERS | |
| 375 | Extravasation | FAERS: 1 | US FAERS | |
| 376 | Eye pain | FAERS: 1 | US FAERS | |
| 377 | Fat necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 378 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 379 | Gastritis | FAERS: 1 | SIDER US FAERS | |
| 380 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 381 | Gastrointestinal inflammation | FAERS: 1 | US FAERS | |
| 382 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 383 | Genital neoplasm malignant female | FAERS: 1 | US FAERS | |
| 384 | Genital pain | FAERS: 1 | US FAERS | |
| 385 | Head discomfort | FAERS: 1 | US FAERS | |
| 386 | Heart valve calcification | FAERS: 1 | US FAERS | |
| 387 | Heart valve stenosis | FAERS: 1 | US FAERS | |
| 388 | Hemiplegia | FAERS: 1 | US FAERS | |
| 389 | Hepatic infection bacterial | FAERS: 1 | US FAERS | |
| 390 | Hepatitis B | FAERS: 1 | US FAERS | |
| 391 | Hernial eventration | FAERS: 1 | US FAERS | |
| 392 | Homicide | FAERS: 1 | US FAERS | |
| 393 | Hyperkeratosis | FAERS: 1 | OFFSIDES US FAERS | |
| 394 | Hyperparathyroidism | FAERS: 1 | 24039193 | CTD OFFSIDES SIDER US FAERS |
| 395 | Hypertensive emergency | FAERS: 1 | US FAERS | |
| 396 | Hypervitaminosis | FAERS: 1 | US FAERS | |
| 397 | Hypokinesia | FAERS: 1 | US FAERS | |
| 398 | Hyporesponsive to stimuli | FAERS: 1 | US FAERS | |
| 399 | Hypoxia | FAERS: 1 | US FAERS | |
| 400 | Immunosuppression | FAERS: 1 | US FAERS | |
| 401 | Implant site necrosis | FAERS: 1 | US FAERS | |
| 402 | Implantable defibrillator insertion | FAERS: 1 | OFFSIDES US FAERS | |
| 403 | Incision site pain | FAERS: 1 | US FAERS | |
| 404 | Incisional hernia | FAERS: 1 | US FAERS | |
| 405 | Incorrect product storage | FAERS: 1 | US FAERS | |
| 406 | Infusion site pain | FAERS: 1 | OFFSIDES US FAERS | |
| 407 | Injection site necrosis | FAERS: 1 | US FAERS | |
| 408 | Intestinal infarction | FAERS: 1 | OFFSIDES US FAERS | |
| 409 | Iodine allergy | FAERS: 1 | US FAERS | |
| 410 | Iron deficiency | FAERS: 1 | US FAERS | |
| 411 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 412 | Joint Range of Motion Decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 413 | Joint abscess | FAERS: 1 | US FAERS | |
| 414 | Joint neoplasm | FAERS: 1 | US FAERS | |
| 415 | Joint stiffness | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 416 | Laceration | FAERS: 1 | US FAERS | |
| 417 | Large intestine perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Leukocytosis | FAERS: 1 | US FAERS | |
| 419 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 420 | Limb discomfort | FAERS: 1 | US FAERS | |
| 421 | Lip swelling | FAERS: 1 | US FAERS | |
| 422 | Lipomatosis | FAERS: 1 | US FAERS | |
| 423 | Low Cardiac Output Syndrome | FAERS: 1 | US FAERS | |
| 424 | Low turnover osteopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 425 | Lower respiratory tract infection viral | FAERS: 1 | OFFSIDES US FAERS | |
| 426 | Lumbar hernia | FAERS: 1 | US FAERS | |
| 427 | Lupus Nephritis | FAERS: 1 | US FAERS | |
| 428 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 429 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 430 | Malabsorption | FAERS: 1 | US FAERS | |
| 431 | Medical device implantation | FAERS: 1 | US FAERS | |
| 432 | Medication Error | FAERS: 1 | US FAERS | |
| 433 | Meningitis | FAERS: 1 | US FAERS | |
| 434 | Mental impairment | FAERS: 1 | US FAERS | |
| 435 | Metastases to pelvis | FAERS: 1 | US FAERS | |
| 436 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 437 | Metastatic bronchial carcinoma | FAERS: 1 | OFFSIDES US FAERS | |
| 438 | Monoplegia | FAERS: 1 | US FAERS | |
| 439 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 440 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 441 | Musculoskeletal Pain | FAERS: 1 | US FAERS | |
| 442 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 443 | Myocarditis | FAERS: 1 | US FAERS | |
| 444 | Neck Pain | FAERS: 1 | US FAERS | |
| 445 | Necrosis | FAERS: 1 | US FAERS | |
| 446 | Nephritis | FAERS: 1 | US FAERS | |
| 447 | Neuralgia | FAERS: 1 | US FAERS | |
| 448 | Night sweats | FAERS: 1 | SIDER US FAERS | |
| 449 | Nocturia | FAERS: 1 | US FAERS | |
| 450 | Nodule | FAERS: 1 | US FAERS | |
| 451 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 452 | Oliguria | FAERS: 1 | US FAERS | |
| 453 | Oral infection | FAERS: 1 | US FAERS | |
| 454 | Orchitis | FAERS: 1 | US FAERS | |
| 455 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 456 | Osteoma | FAERS: 1 | US FAERS | |
| 457 | Osteopenia | FAERS: 1 | US FAERS | |
| 458 | PO2 decreased | FAERS: 1 | US FAERS | |
| 459 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 460 | Pancytopenia | FAERS: 1 | US FAERS | |
| 461 | Paracentesis | FAERS: 1 | US FAERS | |
| 462 | Parotidectomy | FAERS: 1 | US FAERS | |
| 463 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 464 | Pelvic cyst | FAERS: 1 | US FAERS | |
| 465 | Pericarditis | FAERS: 1 | US FAERS | |
| 466 | Peripheral pulse decreased | FAERS: 1 | US FAERS | |
| 467 | Peripheral venous disease | FAERS: 1 | US FAERS | |
| 468 | Peritoneal fluid analysis abnormal | FAERS: 1 | US FAERS | |
| 469 | Photophobia | FAERS: 1 | SIDER US FAERS | |
| 470 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 471 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 472 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 473 | Post procedural fistula | FAERS: 1 | US FAERS | |
| 474 | Post procedural infection | FAERS: 1 | US FAERS | |
| 475 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 476 | Procedural site reaction | FAERS: 1 | US FAERS | |
| 477 | Product counterfeit | FAERS: 1 | US FAERS | |
| 478 | Product quality issue | FAERS: 1 | US FAERS | |
| 479 | Product substitution issue | FAERS: 1 | US FAERS | |
| 480 | Product supply issue | FAERS: 1 | US FAERS | |
| 481 | Product tampering | FAERS: 1 | US FAERS | |
| 482 | Product use complaint | FAERS: 1 | US FAERS | |
| 483 | Protein urine present | FAERS: 1 | US FAERS | |
| 484 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 485 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 486 | Refractory cytopenia with unilineage dysplasia | FAERS: 1 | US FAERS | |
| 487 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 488 | Renal Osteodystrophy | FAERS: 1 | US FAERS | |
| 489 | Renal cancer metastatic | FAERS: 1 | US FAERS | |
| 490 | Renal hypertension | FAERS: 1 | US FAERS | |
| 491 | Renal transplant failure | FAERS: 1 | US FAERS | |
| 492 | Restlessness | FAERS: 1 | US FAERS | |
| 493 | Retching | FAERS: 1 | US FAERS | |
| 494 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 495 | Retrograde amnesia | FAERS: 1 | US FAERS | |
| 496 | Senile dementia | FAERS: 1 | US FAERS | |
| 497 | Septic embolus | FAERS: 1 | US FAERS | |
| 498 | Septic necrosis | FAERS: 1 | US FAERS | |
| 499 | Shock | FAERS: 1 | SIDER US FAERS | |
| 500 | Shoulder deformity | FAERS: 1 | US FAERS | |
| 501 | Sigmoiditis | FAERS: 1 | US FAERS | |
| 502 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 503 | Skin laceration | FAERS: 1 | OFFSIDES US FAERS | |
| 504 | Skin nodule | FAERS: 1 | US FAERS | |
| 505 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 506 | Stenosis | FAERS: 1 | US FAERS | |
| 507 | Strangulated umbilical hernia | FAERS: 1 | US FAERS | |
| 508 | Stress | FAERS: 1 | US FAERS | |
| 509 | Subclavian artery occlusion | FAERS: 1 | US FAERS | |
| 510 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 511 | Systolic hypertension | FAERS: 1 | US FAERS | |
| 512 | Terminal state | FAERS: 1 | US FAERS | |
| 513 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 514 | Thermal burn | FAERS: 1 | US FAERS | |
| 515 | Throat cancer | FAERS: 1 | US FAERS | |
| 516 | Thyroid Neoplasm | FAERS: 1 | US FAERS | |
| 517 | Tooth Infection | FAERS: 1 | US FAERS | |
| 518 | Tracheal mass | FAERS: 1 | US FAERS | |
| 519 | Transfusion related complication | FAERS: 1 | US FAERS | |
| 520 | Trypanosoma serology positive | FAERS: 1 | US FAERS | |
| 521 | Tympanic Membrane Perforation | FAERS: 1 | US FAERS | |
| 522 | Ulcer | FAERS: 1 | US FAERS | |
| 523 | Umbilical hernia | FAERS: 1 | OFFSIDES US FAERS | |
| 524 | Unevaluable investigation | FAERS: 1 | US FAERS | |
| 525 | Urinary bladder polyp | FAERS: 1 | US FAERS | |
| 526 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 527 | Venous Injury | FAERS: 1 | US FAERS | |
| 528 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 529 | Venous valve ruptured | FAERS: 1 | US FAERS | |
| 530 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 531 | White blood cell count decreased | FAERS: 1 | US FAERS | |
| 532 | Wound Infection | FAERS: 1 | OFFSIDES US FAERS | |
| 533 | X-ray abnormal | FAERS: 1 | US FAERS | |
| 534 | furuncle | FAERS: 1 | US FAERS | |
| 535 | prostatitis | FAERS: 1 | US FAERS | |
| 536 | treatment failure | FAERS: 1 | OFFSIDES US FAERS | |
| 537 | Acne | SIDER | ||
| 538 | Ageusia | SIDER | ||
| 539 | Angioedema | SIDER | ||
| 540 | Anhedonia | OFFSIDES | ||
| 541 | Anoxia | OFFSIDES | ||
| 542 | Anti-erythropoietin antibody positive | OFFSIDES | ||
| 543 | Arteriovenous graft site infection | OFFSIDES | ||
| 544 | Aspartate Aminotransferase Increased | SIDER | ||
| 545 | Atrial Flutter | SIDER | ||
| 546 | Atrial thrombosis | OFFSIDES | ||
| 547 | Autonomic neuropathy | OFFSIDES | ||
| 548 | Axillary vein thrombosis | OFFSIDES | ||
| 549 | Blood 1,25-dihydroxycholecalciferol decreased | OFFSIDES | ||
| 550 | Blood albumin decreased | OFFSIDES | ||
| 551 | Blood and lymphatic system disorders | SIDER | ||
| 552 | Blood iron increased | OFFSIDES | ||
| 553 | Blood lactate dehydrogenase decreased | OFFSIDES | ||
| 554 | Blood parathyroid hormone | OFFSIDES | ||
| 555 | Bloody peritoneal effluent | OFFSIDES | ||
| 556 | Bone abscess | OFFSIDES | ||
| 557 | Bone callus excessive | OFFSIDES | ||
| 558 | Breast discomfort | OFFSIDES | ||
| 559 | Breast tenderness | SIDER | ||
| 560 | Calcium phosphate product increased | OFFSIDES | ||
| 561 | Cardiothoracic ratio increased | OFFSIDES | ||
| 562 | Catheter related complication | OFFSIDES | ||
| 563 | Catheter related infection | OFFSIDES | ||
| 564 | Chronic left ventricular failure | OFFSIDES | ||
| 565 | Clostridium difficile colitis | OFFSIDES | ||
| 566 | Colon adenoma | OFFSIDES | ||
| 567 | Compression fracture | OFFSIDES | ||
| 568 | Contracture | OFFSIDES | ||
| 569 | Coronary artery insufficiency | OFFSIDES | ||
| 570 | Dermatitis | SIDER | ||
| 571 | Diabetic ulcer | OFFSIDES | ||
| 572 | Dialysis device complication | OFFSIDES | ||
| 573 | Dialysis device insertion | OFFSIDES | ||
| 574 | Dialysis disequilibrium syndrome | OFFSIDES | ||
| 575 | Diarrhea | OFFSIDES | ||
| 576 | Disturbance in sexual arousal | SIDER | ||
| 577 | Diverticulosis | OFFSIDES | ||
| 578 | Dry gangrene | OFFSIDES | ||
| 579 | Duodenal Ulcer | OFFSIDES | ||
| 580 | Ear and labyrinth disorders | SIDER | ||
| 581 | Ear discomfort | SIDER | ||
| 582 | Electromechanical dissociation | OFFSIDES | ||
| 583 | Emotional distress | OFFSIDES | ||
| 584 | Enterococcal infection | OFFSIDES | ||
| 585 | Enzyme abnormality | OFFSIDES | ||
| 586 | Epidural lipomatosis | OFFSIDES | ||
| 587 | Episcleritis | OFFSIDES | ||
| 588 | Erectile dysfunction | SIDER | ||
| 589 | Eructation | SIDER | ||
| 590 | Erythema Induratum | OFFSIDES | ||
| 591 | Excoriation | OFFSIDES | ||
| 592 | Exfoliative rash | OFFSIDES | ||
| 593 | Extremity contracture | OFFSIDES | ||
| 594 | Failure to Thrive | OFFSIDES | ||
| 595 | Febrile infection | OFFSIDES | ||
| 596 | Femoral arterial stenosis | OFFSIDES | ||
| 597 | Femoral artery occlusion | OFFSIDES | ||
| 598 | Fibrosis | 21565836 | CTD | |
| 599 | Food Poisoning | OFFSIDES | ||
| 600 | Full blood count decreased | OFFSIDES | ||
| 601 | Gastrointestinal Pain | SIDER | ||
| 602 | Glasgow coma scale | OFFSIDES | ||
| 603 | Granulocytosis | OFFSIDES | ||
| 604 | Heart failure | 21565836 | CTD | |
| 605 | Hirsutism | SIDER | ||
| 606 | Hydrothorax | OFFSIDES | ||
| 607 | Hypercapnia | OFFSIDES | ||
| 608 | Hyperosmolar state | OFFSIDES | ||
| 609 | Hyperparathyroidism, Secondary | 12618899 | CTD | |
| 610 | Hyperpigmentation | OFFSIDES | ||
| 611 | Hypoparathyroidism | SIDER | ||
| 612 | Impaired gastric emptying | OFFSIDES | ||
| 613 | Impaired self-care | OFFSIDES | ||
| 614 | Infestation | SIDER | ||
| 615 | Infusion site mobility decreased | OFFSIDES | ||
| 616 | Injection site extravasation | SIDER | ||
| 617 | Injection site nodule | OFFSIDES | ||
| 618 | Intoxication | SIDER | ||
| 619 | Kidney Failure | OFFSIDES | ||
| 620 | Lightheadedness | SIDER | ||
| 621 | Livedo Reticularis | OFFSIDES | ||
| 622 | Lymphedema | OFFSIDES | ||
| 623 | Malignant Hypertension | OFFSIDES | ||
| 624 | Mental status changes | OFFSIDES | ||
| 625 | Mesenteric vascular insufficiency | SIDER | ||
| 626 | Micturition frequency decreased | OFFSIDES | ||
| 627 | Mononucleosis syndrome | OFFSIDES | ||
| 628 | Muscle Weakness | OFFSIDES | ||
| 629 | Muscle tightness | OFFSIDES | ||
| 630 | Musculoskeletal stiffness | OFFSIDES | ||
| 631 | Myelodysplasia | OFFSIDES | ||
| 632 | Myocardial fibrosis | OFFSIDES | ||
| 633 | Myoclonus | SIDER | ||
| 634 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 635 | Nervousness | SIDER | ||
| 636 | Neurodermatitis | OFFSIDES | ||
| 637 | Ocular icterus | OFFSIDES | ||
| 638 | Orthopnea | OFFSIDES | ||
| 639 | Pain of skin | OFFSIDES | ||
| 640 | Pallor | OFFSIDES | ||
| 641 | Palpatory finding abnormal | OFFSIDES | ||
| 642 | Pancreatic Pseudocyst | OFFSIDES | ||
| 643 | Panniculitis | OFFSIDES | ||
| 644 | Parvovirus B19 serology positive | OFFSIDES | ||
| 645 | Pharyngitis | SIDER | ||
| 646 | Pinguecula | OFFSIDES | ||
| 647 | Pityriasis | OFFSIDES | ||
| 648 | Plaque, Atherosclerotic | 20720404 | CTD | |
| 649 | Plasmacytosis | OFFSIDES | ||
| 650 | Pneumatic compression therapy | OFFSIDES | ||
| 651 | Post inflammatory pigmentation change | OFFSIDES | ||
| 652 | Prostatic Neoplasms | 12618899 | CTD | |
| 653 | Prurigo | SIDER | ||
| 654 | Pulmonary congestion | OFFSIDES | ||
| 655 | Pulmonary vascular disorder | OFFSIDES | ||
| 656 | Quality of life decreased | OFFSIDES | ||
| 657 | Reaction aggravation | SIDER | ||
| 658 | Reticulocyte count decreased | OFFSIDES | ||
| 659 | Salmonella | OFFSIDES | ||
| 660 | Scleroderma | OFFSIDES | ||
| 661 | Shunt malfunction | OFFSIDES | ||
| 662 | Sinusitis | SIDER | ||
| 663 | Skin Erosion | OFFSIDES | ||
| 664 | Skin Induration | OFFSIDES | ||
| 665 | Skin Wrinkling | OFFSIDES | ||
| 666 | Skin hypertrophy | OFFSIDES | ||
| 667 | Skin tightness | OFFSIDES | ||
| 668 | Soft tissue necrosis | OFFSIDES | ||
| 669 | Spinal haemangioma | OFFSIDES | ||
| 670 | Stenosis of vesicourethral anastomosis | OFFSIDES | ||
| 671 | Stupor | SIDER | ||
| 672 | Surgical vascular shunt | OFFSIDES | ||
| 673 | Sweating | SIDER | ||
| 674 | Tension | SIDER | ||
| 675 | Vascular bypass graft | OFFSIDES | ||
| 676 | Vascular graft complication | OFFSIDES | ||
| 677 | Vasodilation procedure | SIDER | ||
| 678 | Vasodilation | SIDER | ||
| 679 | Venous Insufficiency | OFFSIDES | ||
| 680 | Venous stenosis | OFFSIDES | ||
| 681 | Vertebral artery occlusion | OFFSIDES | ||
| 682 | Vesiculobullous rash | SIDER | ||
| 683 | Wheezing | SIDER | ||
| 684 | Wound infection staphylococcal | OFFSIDES | ||
| 685 | Xerosis | OFFSIDES | ||
| 686 | Yawning | OFFSIDES | ||
| 687 | colonoscopy | OFFSIDES | ||
| 688 | effusion | OFFSIDES | ||
| 689 | leukemia | 12618899 | CTD |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.