Bimatoprost
(AQOKCDNYWBIDND-FTOWTWDKSA-N)
Structure
- SMILES
- CCNC(=O)CCC/C=C\C[C@H]1[C@@H](O)C[C@H]([C@@H]1/C=C/[C@H](CCc1ccccc1)O)O
- Type(s)
- Approved; Investigational
- ATC code(s)
- S01EE03
- Molecular Formula:
- C25H37NO4
- Molecular Weight:
- 415.566
- Log P:
- 3.5378
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 4
- TPSA:
- 89.79
- CAS Number(s):
- 155206-00-1
Synonym(s)
1.
Bimatoprost
2.
AGN 192024
3.
Latisse
4.
Lumigan
5.
192024, AGN
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 1567 Canada Vigilance: 96 | Canada Vigilance US FAERS | |
| 2 | Eye irritation | FAERS: 839 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 3 | Eyelids pruritus | FAERS: 354 | OFFSIDES SIDER US FAERS | |
| 4 | Inappropriate schedule of drug administration | FAERS: 317 | US FAERS | |
| 5 | Wrong technique in drug usage process | FAERS: 304 | US FAERS | |
| 6 | Eye pain | FAERS: 276 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 7 | Erythema | FAERS: 228 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Trichorrhexis | FAERS: 222 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 9 | Wrong technique in product usage process | FAERS: 211 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 10 | Incorrect dose administered | FAERS: 200 | US FAERS | |
| 11 | Eyelid irritation | FAERS: 190 | OFFSIDES SIDER US FAERS | |
| 12 | Hypersensitivity | FAERS: 188 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 13 | Growth of eyelashes | FAERS: 177 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 14 | Headache | FAERS: 136 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 15 | Pruritus | FAERS: 107 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 16 | Drug administered at inappropriate site | FAERS: 95 | US FAERS | |
| 17 | Visual Impairment | FAERS: 86 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 18 | Drug dose omission | FAERS: 83 | US FAERS | |
| 19 | Blepharitis | FAERS: 75 | OFFSIDES SIDER US FAERS | |
| 20 | Foreign body sensation in eyes | FAERS: 70 | OFFSIDES US FAERS | |
| 21 | Ocular discomfort | FAERS: 68 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Burning sensation | FAERS: 65 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 23 | Eyelid pain | FAERS: 63 | SIDER US FAERS | |
| 24 | Iris hyperpigmentation | FAERS: 61 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | Eye Infection | FAERS: 55 | OFFSIDES US FAERS | |
| 26 | Accidental exposure to product | FAERS: 53 | US FAERS | |
| 27 | Product quality issue | FAERS: 49 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Expired product administered | FAERS: 48 | US FAERS | |
| 29 | Hordeolum | FAERS: 47 | SIDER US FAERS | |
| 30 | Skin irritation | FAERS: 47 | US FAERS | |
| 31 | Cataract | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 32 | Dizziness | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 33 | Eyelid exfoliation | FAERS: 46 | US FAERS | |
| 34 | Product dose omission | FAERS: 45 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 35 | Dry skin | FAERS: 44 | SIDER US FAERS | |
| 36 | Photophobia | FAERS: 44 | SIDER US FAERS | |
| 37 | Application site erythema | FAERS: 42 | US FAERS | |
| 38 | Product packaging quantity issue | FAERS: 42 | US FAERS | |
| 39 | Drug administration error | FAERS: 41 | OFFSIDES US FAERS | |
| 40 | Eyelid margin crusting | FAERS: 40 | SIDER US FAERS | |
| 41 | Application site pain | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 42 | Dark circles under eyes | FAERS: 35 | US FAERS | |
| 43 | Conjunctivitis | FAERS: 34 | US FAERS | |
| 44 | Inappropriate schedule of product administration | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Product container issue | FAERS: 33 | US FAERS | |
| 46 | Product dropper issue | FAERS: 33 | US FAERS | |
| 47 | Asthenopia | FAERS: 31 | OFFSIDES SIDER US FAERS | |
| 48 | Trichiasis | FAERS: 30 | OFFSIDES US FAERS | |
| 49 | Application site pruritus | FAERS: 28 | US FAERS | |
| 50 | Blepharospasm | FAERS: 26 | OFFSIDES SIDER US FAERS | |
| 51 | Eye inflammation | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 52 | Eyelid rash | FAERS: 26 | US FAERS | |
| 53 | Glaucoma | FAERS: 25 Canada Vigilance: 2 | CTD OFFSIDES Canada Vigilance US FAERS | |
| 54 | Diplopia | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 55 | Pain | FAERS: 24 | OFFSIDES SIDER US FAERS | |
| 56 | Adverse event | FAERS: 23 | US FAERS | |
| 57 | Blindness | FAERS: 23 | US FAERS | |
| 58 | Swelling | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Eyelid skin dryness | FAERS: 21 | US FAERS | |
| 60 | Lid sulcus deepened | FAERS: 21 | US FAERS | |
| 61 | Nausea | FAERS: 21 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 62 | Drug ineffective for unapproved indication | FAERS: 20 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 63 | Malaise | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Urticaria | FAERS: 20 | US FAERS | |
| 65 | Blepharopachynsis | FAERS: 19 | US FAERS | |
| 66 | Therapeutic response unexpected | FAERS: 19 | US FAERS | |
| 67 | Intentional product misuse | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 68 | Retinal Detachment | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 69 | Acne | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 70 | Eyelash thickening | FAERS: 16 | OFFSIDES US FAERS | |
| 71 | Swelling of eyelid | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 72 | Vertigo | FAERS: 16 | SIDER US FAERS | |
| 73 | Alopecia | FAERS: 15 | US FAERS | |
| 74 | Cerebrovascular accident | FAERS: 14 | US FAERS | |
| 75 | Oropharyngeal pain | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 76 | Product administered at inappropriate site | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Product storage error | FAERS: 14 | US FAERS | |
| 78 | Application site irritation | FAERS: 13 | US FAERS | |
| 79 | Dermatitis | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 80 | Dysgeusia | FAERS: 13 | OFFSIDES US FAERS | |
| 81 | Eyelash changes | FAERS: 13 | US FAERS | |
| 82 | Product physical consistency issue | FAERS: 13 | US FAERS | |
| 83 | Throat irritation | FAERS: 13 | US FAERS | |
| 84 | Fatigue | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 85 | Feeling abnormal | FAERS: 12 | US FAERS | |
| 86 | Mydriasis | FAERS: 12 | US FAERS | |
| 87 | Nasopharyngitis | FAERS: 12 | SIDER US FAERS | |
| 88 | Eyelash hyperpigmentation | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 89 | Incorrect route of drug administration | FAERS: 11 | US FAERS | |
| 90 | Keratitis | FAERS: 11 | SIDER US FAERS | |
| 91 | No adverse event | FAERS: 10 | US FAERS | |
| 92 | Product use in unapproved indication | FAERS: 10 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 93 | Therapy cessation | FAERS: 10 | US FAERS | |
| 94 | Vitreous floaters | FAERS: 10 | SIDER US FAERS | |
| 95 | Anxiety | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 96 | Expired drug administered | FAERS: 9 | US FAERS | |
| 97 | Instillation site pain | FAERS: 9 | US FAERS | |
| 98 | Product complaint | FAERS: 9 | US FAERS | |
| 99 | Skin Wrinkling | FAERS: 9 | US FAERS | |
| 100 | Arthralgia | FAERS: 8 | US FAERS | |
| 101 | Bronchitis | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 102 | Eye allergy | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Palpitations | FAERS: 8 | SIDER US FAERS | |
| 104 | Periorbital fat atrophy | FAERS: 8 | US FAERS | |
| 105 | Product packaging issue | FAERS: 8 | US FAERS | |
| 106 | Uveitis | FAERS: 8 | 19403113 | CTD SIDER US FAERS |
| 107 | Viral upper respiratory tract infection | FAERS: 8 | US FAERS | |
| 108 | Abdominal discomfort | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 109 | Asthma | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 110 | Eyelash injury | FAERS: 7 | US FAERS | |
| 111 | Medication Error | FAERS: 7 | US FAERS | |
| 112 | Neck Pain | FAERS: 7 | US FAERS | |
| 113 | Product label issue | FAERS: 7 | US FAERS | |
| 114 | Product physical issue | FAERS: 7 | US FAERS | |
| 115 | Product use issue | FAERS: 7 | US FAERS | |
| 116 | Scab | FAERS: 7 | US FAERS | |
| 117 | Skin tightness | FAERS: 7 | US FAERS | |
| 118 | Wrong drug administered | FAERS: 7 | US FAERS | |
| 119 | Accidental exposure | FAERS: 6 | OFFSIDES US FAERS | |
| 120 | Asthenia | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 121 | Diabetes Mellitus | FAERS: 6 | US FAERS | |
| 122 | Drug effect incomplete | FAERS: 6 | US FAERS | |
| 123 | Dysphonia | FAERS: 6 | OFFSIDES US FAERS | |
| 124 | Eye Redness | FAERS: 6 | OFFSIDES US FAERS | |
| 125 | Eyelid infection | FAERS: 6 | US FAERS | |
| 126 | Facial Pain | FAERS: 6 | US FAERS | |
| 127 | Intentional dose omission | FAERS: 6 | US FAERS | |
| 128 | Lip swelling | FAERS: 6 | US FAERS | |
| 129 | Rash erythematous | FAERS: 6 | US FAERS | |
| 130 | Retinal Vein Occlusion | FAERS: 6 | OFFSIDES US FAERS | |
| 131 | Sinusitis | FAERS: 6 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 132 | Sneezing | FAERS: 6 | US FAERS | |
| 133 | Tinnitus | FAERS: 6 | US FAERS | |
| 134 | Vomiting | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Application site rash | FAERS: 5 | US FAERS | |
| 136 | Arthritis | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 137 | Basal cell carcinoma | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 138 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 139 | Cataract operation | FAERS: 5 | OFFSIDES US FAERS | |
| 140 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 141 | Enophthalmos | FAERS: 5 | SIDER US FAERS | |
| 142 | Exophthalmos | FAERS: 5 | US FAERS | |
| 143 | Eye Burns | FAERS: 5 | US FAERS | |
| 144 | Incorrect product storage | FAERS: 5 | US FAERS | |
| 145 | Influenza | FAERS: 5 | US FAERS | |
| 146 | Macular degeneration | FAERS: 5 | US FAERS | |
| 147 | Ocular icterus | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 148 | Paranasal sinus hypersecretion | FAERS: 5 | OFFSIDES US FAERS | |
| 149 | Product counterfeit | FAERS: 5 | US FAERS | |
| 150 | Product use complaint | FAERS: 5 | US FAERS | |
| 151 | Punctate keratitis | FAERS: 5 | SIDER US FAERS | |
| 152 | Rotator cuff syndrome | FAERS: 5 | US FAERS | |
| 153 | Tachycardia | FAERS: 5 | US FAERS | |
| 154 | Ageusia | FAERS: 4 | US FAERS | |
| 155 | Application site dryness | FAERS: 4 | US FAERS | |
| 156 | Application site reaction | FAERS: 4 | US FAERS | |
| 157 | Application site swelling | FAERS: 4 | US FAERS | |
| 158 | Atrial Fibrillation | FAERS: 4 | US FAERS | |
| 159 | Bradycardia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 160 | Chromaturia | FAERS: 4 | US FAERS | |
| 161 | Contact lens intolerance | FAERS: 4 | US FAERS | |
| 162 | Corneal epithelium defect | FAERS: 4 | US FAERS | |
| 163 | Epistaxis | FAERS: 4 | OFFSIDES US FAERS | |
| 164 | Facial Paresis | FAERS: 4 | US FAERS | |
| 165 | Flushing | FAERS: 4 | US FAERS | |
| 166 | Head discomfort | FAERS: 4 | US FAERS | |
| 167 | Hypertrichosis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 168 | Hypoaesthesia facial | FAERS: 4 | OFFSIDES US FAERS | |
| 169 | Hypotrichosis | FAERS: 4 | US FAERS | |
| 170 | Intraocular pressure fluctuation | FAERS: 4 | OFFSIDES US FAERS | |
| 171 | Iritis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 172 | Laceration | FAERS: 4 | US FAERS | |
| 173 | Medication residue present | FAERS: 4 | US FAERS | |
| 174 | Meibomian gland dysfunction | FAERS: 4 | US FAERS | |
| 175 | Meibomianitis | FAERS: 4 | US FAERS | |
| 176 | Migraine with Aura | FAERS: 4 | US FAERS | |
| 177 | Multiple use of single-use product | FAERS: 4 | US FAERS | |
| 178 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 179 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 180 | Nasal discomfort | FAERS: 4 | US FAERS | |
| 181 | Pregnancy | FAERS: 4 | US FAERS | |
| 182 | Prescription drug used without a prescription | FAERS: 4 | US FAERS | |
| 183 | Product container seal issue | FAERS: 4 | US FAERS | |
| 184 | Product prescribing issue | FAERS: 4 | US FAERS | |
| 185 | Reaction to preservatives | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 186 | Secretion discharge | FAERS: 4 | US FAERS | |
| 187 | Somnolence | FAERS: 4 | SIDER US FAERS | |
| 188 | Thrombosis | FAERS: 4 | US FAERS | |
| 189 | Tremor | FAERS: 4 | US FAERS | |
| 190 | Aphasia | FAERS: 3 | US FAERS | |
| 191 | Back Pain | FAERS: 3 | US FAERS | |
| 192 | Chest Pain | FAERS: 3 | SIDER US FAERS | |
| 193 | Corneal Opacity | FAERS: 3 | US FAERS | |
| 194 | Corneal dystrophy | FAERS: 3 | US FAERS | |
| 195 | Cyst | FAERS: 3 | OFFSIDES US FAERS | |
| 196 | Dacryostenosis acquired | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 197 | Dyspepsia | FAERS: 3 | SIDER US FAERS | |
| 198 | Ear discomfort | FAERS: 3 | US FAERS | |
| 199 | Excessive eye blinking | FAERS: 3 | US FAERS | |
| 200 | Frustration tolerance decreased | FAERS: 3 | US FAERS | |
| 201 | Hormone level abnormal | FAERS: 3 | US FAERS | |
| 202 | Hypotension | FAERS: 3 | US FAERS | |
| 203 | Infection | FAERS: 3 | SIDER US FAERS | |
| 204 | Instillation site pruritus | FAERS: 3 | US FAERS | |
| 205 | Intentional product use issue | FAERS: 3 | US FAERS | |
| 206 | Liquid product physical issue | FAERS: 3 | US FAERS | |
| 207 | Macular fibrosis | FAERS: 3 | US FAERS | |
| 208 | Mouth swelling | FAERS: 3 | US FAERS | |
| 209 | Muscle tightness | FAERS: 3 | US FAERS | |
| 210 | Myalgia | FAERS: 3 | US FAERS | |
| 211 | Nervousness | FAERS: 3 | SIDER US FAERS | |
| 212 | Overdose | FAERS: 3 | US FAERS | |
| 213 | Product formulation issue | FAERS: 3 | US FAERS | |
| 214 | Product substitution issue | FAERS: 3 | US FAERS | |
| 215 | Rosacea | FAERS: 3 | US FAERS | |
| 216 | Skin reaction | FAERS: 3 | US FAERS | |
| 217 | Swollen tear duct | FAERS: 3 | US FAERS | |
| 218 | Trigeminal Neuralgia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Wrong patient received medication | FAERS: 3 | US FAERS | |
| 220 | Wrong technique in device usage process | FAERS: 3 | US FAERS | |
| 221 | Accidental exposure to product by child | FAERS: 2 | US FAERS | |
| 222 | Adenoid Cystic Carcinoma | FAERS: 2 | OFFSIDES US FAERS | |
| 223 | Altered visual depth perception | FAERS: 2 | US FAERS | |
| 224 | Amnesia | FAERS: 2 | US FAERS | |
| 225 | Angina Pectoris | FAERS: 2 | US FAERS | |
| 226 | Anosmia | FAERS: 2 | US FAERS | |
| 227 | Application site exfoliation | FAERS: 2 | US FAERS | |
| 228 | Application site hypersensitivity | FAERS: 2 | US FAERS | |
| 229 | Atrophie blanche | FAERS: 2 | OFFSIDES US FAERS | |
| 230 | Back disorder | FAERS: 2 | US FAERS | |
| 231 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 232 | Blood creatinine increased | FAERS: 2 | US FAERS | |
| 233 | Bronchospasm | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 234 | Chest discomfort | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 235 | Chills | FAERS: 2 | US FAERS | |
| 236 | Chronotropic incompetence | FAERS: 2 | US FAERS | |
| 237 | Cluster Headache | FAERS: 2 | US FAERS | |
| 238 | Constipation | FAERS: 2 | US FAERS | |
| 239 | Corneal Endothelial Cell Loss | FAERS: 2 | US FAERS | |
| 240 | Corneal Infection | FAERS: 2 | US FAERS | |
| 241 | Corneal decompensation | FAERS: 2 | US FAERS | |
| 242 | Deafness | FAERS: 2 | OFFSIDES US FAERS | |
| 243 | Dehydration | FAERS: 2 | OFFSIDES US FAERS | |
| 244 | Depressed mood | FAERS: 2 | US FAERS | |
| 245 | Disability | FAERS: 2 | US FAERS | |
| 246 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 247 | Ear congestion | FAERS: 2 | US FAERS | |
| 248 | Emotional disorder | FAERS: 2 | US FAERS | |
| 249 | Emotional distress | FAERS: 2 | US FAERS | |
| 250 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 251 | Eye complication associated with device | FAERS: 2 | US FAERS | |
| 252 | Eye laser surgery | FAERS: 2 | OFFSIDES US FAERS | |
| 253 | Facial paralysis | FAERS: 2 | US FAERS | |
| 254 | Folliculitis | FAERS: 2 | US FAERS | |
| 255 | Hypopigmentation of eyelid | FAERS: 2 | US FAERS | |
| 256 | Impaired work ability | FAERS: 2 | US FAERS | |
| 257 | Incorrect route of product administration | FAERS: 2 | US FAERS | |
| 258 | Inflammation | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 259 | Intraocular pressure test abnormal | FAERS: 2 | US FAERS | |
| 260 | Intraocular pressure test | FAERS: 2 | OFFSIDES US FAERS | |
| 261 | Iridocyclitis | FAERS: 2 | OFFSIDES US FAERS | |
| 262 | Keratoconjunctivitis Sicca | FAERS: 2 | US FAERS | |
| 263 | Lagophthalmos | FAERS: 2 | US FAERS | |
| 264 | Laryngitis | FAERS: 2 | US FAERS | |
| 265 | Limb injury | FAERS: 2 | US FAERS | |
| 266 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 267 | Lung cyst | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 268 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 269 | Musculoskeletal stiffness | FAERS: 2 | US FAERS | |
| 270 | Myopia | FAERS: 2 | OFFSIDES US FAERS | |
| 271 | Nephrolithiasis | FAERS: 2 | OFFSIDES US FAERS | |
| 272 | Neuroma | FAERS: 2 | US FAERS | |
| 273 | Nonspecific reaction | FAERS: 2 | US FAERS | |
| 274 | Ocular Hypertension | FAERS: 2 Canada Vigilance: 1 | CTD OFFSIDES Canada Vigilance US FAERS | |
| 275 | Ocular vascular disorder | FAERS: 2 | US FAERS | |
| 276 | Pain of skin | FAERS: 2 | US FAERS | |
| 277 | Pneumonia | FAERS: 2 | US FAERS | |
| 278 | Prescribed underdose | FAERS: 2 | US FAERS | |
| 279 | Procedural complication | FAERS: 2 | US FAERS | |
| 280 | Product lot number issue | FAERS: 2 | US FAERS | |
| 281 | Product prescribing error | FAERS: 2 | US FAERS | |
| 282 | Product size issue | FAERS: 2 | US FAERS | |
| 283 | Purulent discharge | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 284 | Scleral pigmentation | FAERS: 2 | US FAERS | |
| 285 | Sinoatrial Block | FAERS: 2 | US FAERS | |
| 286 | Sinus headache | FAERS: 2 | US FAERS | |
| 287 | Sinus operation | FAERS: 2 | US FAERS | |
| 288 | Stress | FAERS: 2 | US FAERS | |
| 289 | Superficial injury of eye | FAERS: 2 | US FAERS | |
| 290 | Thermal burn | FAERS: 2 | US FAERS | |
| 291 | Trabeculectomy | FAERS: 2 | OFFSIDES US FAERS | |
| 292 | Upper respiratory tract irritation | FAERS: 2 | US FAERS | |
| 293 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 294 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 295 | Venous stasis | FAERS: 2 | US FAERS | |
| 296 | Visual brightness | FAERS: 2 | US FAERS | |
| 297 | Vulvovaginal pruritus | FAERS: 2 | US FAERS | |
| 298 | Wheezing | FAERS: 2 | US FAERS | |
| 299 | skin abrasion | FAERS: 2 | US FAERS | |
| 300 | Accidental overdose | FAERS: 1 | US FAERS | |
| 301 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 302 | Anal squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 303 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 304 | Angle Closure Glaucoma | FAERS: 1 | OFFSIDES US FAERS | |
| 305 | Aortic Aneurysm | FAERS: 1 | OFFSIDES US FAERS | |
| 306 | Application site discharge | FAERS: 1 | US FAERS | |
| 307 | Application site discomfort | FAERS: 1 | US FAERS | |
| 308 | Application site scab | FAERS: 1 | US FAERS | |
| 309 | Application site scar | FAERS: 1 | US FAERS | |
| 310 | Arcus lipoides | FAERS: 1 | US FAERS | |
| 311 | Arthropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 312 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 313 | Bacterial Vaginosis | FAERS: 1 | US FAERS | |
| 314 | Blepharophimosis | FAERS: 1 | US FAERS | |
| 315 | Borderline glaucoma | FAERS: 1 | US FAERS | |
| 316 | Burning Mouth Syndrome | FAERS: 1 | US FAERS | |
| 317 | Capillary Fragility | FAERS: 1 | US FAERS | |
| 318 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 319 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 320 | Chemical injury | FAERS: 1 | US FAERS | |
| 321 | Chloasma | FAERS: 1 | US FAERS | |
| 322 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 323 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 324 | Choroidal Detachment | FAERS: 1 | US FAERS | |
| 325 | Chromatopsia | FAERS: 1 | OFFSIDES US FAERS | |
| 326 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 327 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 328 | Conjunctival pigmentation | FAERS: 1 | US FAERS | |
| 329 | Corneal Scar | FAERS: 1 | US FAERS | |
| 330 | Corneal Ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 331 | Corneal degeneration | FAERS: 1 | US FAERS | |
| 332 | Corneal erosion | FAERS: 1 | SIDER US FAERS | |
| 333 | Corneal graft rejection | FAERS: 1 | US FAERS | |
| 334 | Corneal irritation | FAERS: 1 | US FAERS | |
| 335 | Corneal pigmentation | FAERS: 1 | US FAERS | |
| 336 | Corneal touch | FAERS: 1 | US FAERS | |
| 337 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 338 | Crying | FAERS: 1 | US FAERS | |
| 339 | Cutis Laxa | FAERS: 1 | US FAERS | |
| 340 | Cystitis | FAERS: 1 | SIDER US FAERS | |
| 341 | Dacryocanaliculitis | FAERS: 1 | US FAERS | |
| 342 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 343 | Deformity of orbit | FAERS: 1 | US FAERS | |
| 344 | Deformity | FAERS: 1 | US FAERS | |
| 345 | Delirium | FAERS: 1 | US FAERS | |
| 346 | Dermoid Cyst | FAERS: 1 | US FAERS | |
| 347 | Device malfunction | FAERS: 1 | US FAERS | |
| 348 | Discomfort | FAERS: 1 | US FAERS | |
| 349 | Disorientation | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 350 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 351 | Ectropion | FAERS: 1 | OFFSIDES US FAERS | |
| 352 | Eczema | FAERS: 1 | OFFSIDES US FAERS | |
| 353 | Endophthalmitis | FAERS: 1 | OFFSIDES US FAERS | |
| 354 | Enlarged uvula | FAERS: 1 | US FAERS | |
| 355 | Eosinophilic Fasciitis | FAERS: 1 | US FAERS | |
| 356 | Excessive skin | FAERS: 1 | US FAERS | |
| 357 | Extra dose administered | FAERS: 1 | US FAERS | |
| 358 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 359 | Eye prosthesis user | FAERS: 1 | US FAERS | |
| 360 | Eye ulcer | FAERS: 1 | US FAERS | |
| 361 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 362 | Eyelid erosion | FAERS: 1 | US FAERS | |
| 363 | Eyelid vellus hair changes | FAERS: 1 | US FAERS | |
| 364 | Face Lift | FAERS: 1 | US FAERS | |
| 365 | Feeling Cold | FAERS: 1 | US FAERS | |
| 366 | Flatulence | FAERS: 1 | OFFSIDES US FAERS | |
| 367 | Foaming at mouth | FAERS: 1 | US FAERS | |
| 368 | Food Allergy | FAERS: 1 | US FAERS | |
| 369 | Food Poisoning | FAERS: 1 | US FAERS | |
| 370 | Formication | FAERS: 1 | OFFSIDES US FAERS | |
| 371 | Fracture | FAERS: 1 | US FAERS | |
| 372 | Frustration | FAERS: 1 | US FAERS | |
| 373 | Glaucoma surgery | FAERS: 1 | US FAERS | |
| 374 | Hearing aid user | FAERS: 1 | US FAERS | |
| 375 | Heart alternation | FAERS: 1 | US FAERS | |
| 376 | Hirsutism | FAERS: 1 | SIDER US FAERS | |
| 377 | Hypersomnia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 378 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 379 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 380 | Inability to afford medication | FAERS: 1 | US FAERS | |
| 381 | Incorrect dose administered by product | FAERS: 1 | US FAERS | |
| 382 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 383 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 384 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 385 | Increased viscosity of upper respiratory secretion | FAERS: 1 | US FAERS | |
| 386 | Initial insomnia | FAERS: 1 | US FAERS | |
| 387 | Instillation site erythema | FAERS: 1 | US FAERS | |
| 388 | Instillation site lacrimation | FAERS: 1 | US FAERS | |
| 389 | Intentional device misuse | FAERS: 1 | US FAERS | |
| 390 | Intercepted product prescribing error | FAERS: 1 | US FAERS | |
| 391 | Joint injury | FAERS: 1 | OFFSIDES US FAERS | |
| 392 | Joint swelling | FAERS: 1 | US FAERS | |
| 393 | Keratomileusis | FAERS: 1 | US FAERS | |
| 394 | Keratopathy | FAERS: 1 | US FAERS | |
| 395 | Lethargy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 396 | Lid lag | FAERS: 1 | US FAERS | |
| 397 | Lid margin discharge | FAERS: 1 | US FAERS | |
| 398 | Limb discomfort | FAERS: 1 | US FAERS | |
| 399 | Limb operation | FAERS: 1 | US FAERS | |
| 400 | Lipoatrophy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 401 | Lipodystrophy acquired | FAERS: 1 | US FAERS | |
| 402 | Loss of visual contrast sensitivity | FAERS: 1 | US FAERS | |
| 403 | Lymphoma | FAERS: 1 | US FAERS | |
| 404 | Macule | FAERS: 1 | US FAERS | |
| 405 | Manufacturing product shipping issue | FAERS: 1 | US FAERS | |
| 406 | Melanosis | FAERS: 1 | US FAERS | |
| 407 | Memory impairment | FAERS: 1 | US FAERS | |
| 408 | Middle insomnia | FAERS: 1 | US FAERS | |
| 409 | Mood swings | FAERS: 1 | US FAERS | |
| 410 | Mucosal pain | FAERS: 1 | US FAERS | |
| 411 | Multiple Sclerosis | FAERS: 1 | US FAERS | |
| 412 | Nerve injury | FAERS: 1 | US FAERS | |
| 413 | Neuralgia | FAERS: 1 | US FAERS | |
| 414 | Neurilemmoma | FAERS: 1 | US FAERS | |
| 415 | Nodule | FAERS: 1 | US FAERS | |
| 416 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 417 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 418 | Oral pruritus | FAERS: 1 | US FAERS | |
| 419 | Orbital cyst | FAERS: 1 | US FAERS | |
| 420 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 421 | Otitis Media | FAERS: 1 | US FAERS | |
| 422 | Packaging design issue | FAERS: 1 | US FAERS | |
| 423 | Panic Disorder | FAERS: 1 | US FAERS | |
| 424 | Peptic Ulcer | FAERS: 1 | US FAERS | |
| 425 | Periorbital contusion | FAERS: 1 | US FAERS | |
| 426 | Periorbital disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 427 | Periorbital swelling | FAERS: 1 | US FAERS | |
| 428 | Pigmentation lip | FAERS: 1 | US FAERS | |
| 429 | Pinguecula | FAERS: 1 | US FAERS | |
| 430 | Poor quality product administered | FAERS: 1 | US FAERS | |
| 431 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 432 | Post procedural complication | FAERS: 1 | OFFSIDES US FAERS | |
| 433 | Product availability issue | FAERS: 1 | US FAERS | |
| 434 | Product contamination | FAERS: 1 | OFFSIDES US FAERS | |
| 435 | Product contamination microbial | FAERS: 1 | US FAERS | |
| 436 | Product design issue | FAERS: 1 | US FAERS | |
| 437 | Product dispensing error | FAERS: 1 | US FAERS | |
| 438 | Product distribution issue | FAERS: 1 | US FAERS | |
| 439 | Product label confusion | FAERS: 1 | US FAERS | |
| 440 | Product leakage | FAERS: 1 | US FAERS | |
| 441 | Product preparation error | FAERS: 1 | US FAERS | |
| 442 | Product shape issue | FAERS: 1 | US FAERS | |
| 443 | Product supply issue | FAERS: 1 | US FAERS | |
| 444 | Productive Cough | FAERS: 1 | US FAERS | |
| 445 | Pseudomyopia | FAERS: 1 | US FAERS | |
| 446 | Pterygium | FAERS: 1 | US FAERS | |
| 447 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 448 | Purpura | FAERS: 1 | US FAERS | |
| 449 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 450 | Respiratory distress | FAERS: 1 | US FAERS | |
| 451 | Retinal cyst | FAERS: 1 | US FAERS | |
| 452 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 453 | Sinobronchitis | FAERS: 1 | US FAERS | |
| 454 | Sinus pain | FAERS: 1 | US FAERS | |
| 455 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 456 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 457 | Skin laceration | FAERS: 1 | US FAERS | |
| 458 | Spinal column stenosis | FAERS: 1 | OFFSIDES US FAERS | |
| 459 | Stevens-Johnson Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 460 | Stomatitis | FAERS: 1 | US FAERS | |
| 461 | Sunburn | FAERS: 1 | US FAERS | |
| 462 | Superficial vein prominence | FAERS: 1 | US FAERS | |
| 463 | Syncope | FAERS: 1 | US FAERS | |
| 464 | Temporal Arteritis | FAERS: 1 | OFFSIDES US FAERS | |
| 465 | Therapeutic product ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 466 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 467 | Tongue pruritus | FAERS: 1 | US FAERS | |
| 468 | Tooth Loss | FAERS: 1 | OFFSIDES US FAERS | |
| 469 | Toothache | FAERS: 1 | US FAERS | |
| 470 | Toxic dilatation of intestine | FAERS: 1 | US FAERS | |
| 471 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 472 | Tracheitis | FAERS: 1 | US FAERS | |
| 473 | Trichomegaly | FAERS: 1 | US FAERS | |
| 474 | Tuberculosis | FAERS: 1 | US FAERS | |
| 475 | Ulcer | FAERS: 1 | US FAERS | |
| 476 | Unevaluable event | FAERS: 1 | US FAERS | |
| 477 | Unresponsive to stimuli | FAERS: 1 | OFFSIDES US FAERS | |
| 478 | Upper-airway cough syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 479 | Urine output increased | FAERS: 1 | US FAERS | |
| 480 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 481 | Visual disturbance | FAERS: 1 | SIDER US FAERS | |
| 482 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 483 | Vitreous loss | FAERS: 1 | US FAERS | |
| 484 | Weight decreased | FAERS: 1 | US FAERS | |
| 485 | Wrong product administered | FAERS: 1 | US FAERS | |
| 486 | cancer surgery | FAERS: 1 | US FAERS | |
| 487 | furuncle | FAERS: 1 | US FAERS | |
| 488 | treatment failure | FAERS: 1 | US FAERS | |
| 489 | Abnormal vision | OFFSIDES | ||
| 490 | Actinomycosis | OFFSIDES | ||
| 491 | Adenocarcinoma | OFFSIDES | ||
| 492 | Adenoma | OFFSIDES | ||
| 493 | Alcohol withdrawal syndrome | OFFSIDES | ||
| 494 | Alveoloplasty | OFFSIDES | ||
| 495 | Amphetamines | OFFSIDES | ||
| 496 | Anhedonia | OFFSIDES | ||
| 497 | Animal scratch | OFFSIDES | ||
| 498 | Ankle Fracture | OFFSIDES | ||
| 499 | Anorexia | OFFSIDES | ||
| 500 | Aphonia | OFFSIDES | ||
| 501 | Aphthous Stomatitis | OFFSIDES | ||
| 502 | Appendicitis | OFFSIDES | ||
| 503 | Ascites | OFFSIDES | ||
| 504 | Astigmatism | OFFSIDES | ||
| 505 | Ataxia | OFFSIDES | ||
| 506 | Atrial Flutter | OFFSIDES | ||
| 507 | Benign Prostatic Hyperplasia | OFFSIDES | ||
| 508 | Biopsy gingival | OFFSIDES | ||
| 509 | Bladder pain | SIDER | ||
| 510 | Blood Glucose | OFFSIDES | ||
| 511 | Blood blister | OFFSIDES | ||
| 512 | Blood chloride decreased | OFFSIDES | ||
| 513 | Blood potassium decreased | OFFSIDES | ||
| 514 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 515 | Blood zinc decreased | OFFSIDES | ||
| 516 | Blunted affect | OFFSIDES | ||
| 517 | Blurred vision | OFFSIDES | ||
| 518 | Body fat disorder | OFFSIDES | ||
| 519 | Bone density decreased | OFFSIDES | ||
| 520 | Bone lesion | OFFSIDES | ||
| 521 | Bone pain | OFFSIDES | ||
| 522 | Budd-Chiari Syndrome | OFFSIDES | ||
| 523 | Burning sensation in eye | SIDER | ||
| 524 | Bursal operation | OFFSIDES | ||
| 525 | COPD exacerbation | SIDER | ||
| 526 | Calcinosis | OFFSIDES | ||
| 527 | Cardioactive drug level increased | OFFSIDES | ||
| 528 | Central nervous system lesion | OFFSIDES | ||
| 529 | Clostridium difficile colitis | OFFSIDES | ||
| 530 | Clumsiness | OFFSIDES | ||
| 531 | Colectomy | OFFSIDES | ||
| 532 | Common Cold | SIDER | ||
| 533 | Confabulation | OFFSIDES | ||
| 534 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 535 | Conjunctival Diseases | 11448321 16252016 | CTD | |
| 536 | Conjunctival bleb | SIDER | ||
| 537 | Conjunctival deposit | OFFSIDES | ||
| 538 | Cor pulmonale | OFFSIDES | ||
| 539 | Corneal calcification | SIDER | ||
| 540 | Corneal thinning | OFFSIDES | ||
| 541 | Cutaneous Candidiasis | OFFSIDES | ||
| 542 | Cyst aspiration | OFFSIDES | ||
| 543 | Cystocele | OFFSIDES | ||
| 544 | Dental abscess | OFFSIDES | ||
| 545 | Dental caries | OFFSIDES | ||
| 546 | Device occlusion | OFFSIDES | ||
| 547 | Diabetic Nephropathy | OFFSIDES | ||
| 548 | Diabetic Retinopathy | OFFSIDES | ||
| 549 | Diarrhea | OFFSIDES | ||
| 550 | Diverticular perforation | OFFSIDES | ||
| 551 | Diverticulitis | OFFSIDES | ||
| 552 | Diverticulum | OFFSIDES | ||
| 553 | Drug toxicity | OFFSIDES | ||
| 554 | Drug withdrawal headache | OFFSIDES | ||
| 555 | Dyschezia | OFFSIDES | ||
| 556 | Dysuria | Canada Vigilance: 1 | Canada Vigilance | |
| 557 | Echocardiogram abnormal | OFFSIDES | ||
| 558 | Economic problem | OFFSIDES | ||
| 559 | Electrocardiogram change | OFFSIDES | ||
| 560 | Electrocardiogram poor R-wave progression | OFFSIDES | ||
| 561 | Endodontic procedure | OFFSIDES | ||
| 562 | Enterovesical Fistula | OFFSIDES | ||
| 563 | Entropion | OFFSIDES | ||
| 564 | Escherichia infection | OFFSIDES | ||
| 565 | Escherichia sepsis | OFFSIDES | ||
| 566 | Exacerbation of asthma | SIDER | ||
| 567 | Excoriation | OFFSIDES | ||
| 568 | Eyelash darkening | SIDER | ||
| 569 | Eyelid Diseases | OFFSIDES | ||
| 570 | Facial Neuralgia | OFFSIDES | ||
| 571 | Failure to Thrive | OFFSIDES | ||
| 572 | Femoral pulse decreased | OFFSIDES | ||
| 573 | Fistula discharge | OFFSIDES | ||
| 574 | Flat affect | OFFSIDES | ||
| 575 | Fluid overload | OFFSIDES | ||
| 576 | Foreign body trauma | OFFSIDES | ||
| 577 | Gastroenteritis | OFFSIDES | ||
| 578 | Genital discharge | OFFSIDES | ||
| 579 | Goiter | OFFSIDES | ||
| 580 | Gout | OFFSIDES | ||
| 581 | Graft infection | OFFSIDES | ||
| 582 | Hay fever | OFFSIDES | ||
| 583 | Head titubation | OFFSIDES | ||
| 584 | Hepatojugular reflux | OFFSIDES | ||
| 585 | Hepatosplenomegaly | OFFSIDES | ||
| 586 | Hyperemia | CTD | ||
| 587 | Hyperkeratosis | OFFSIDES | ||
| 588 | Hyperpigmentation | OFFSIDES | ||
| 589 | Hypertensive heart disease | OFFSIDES | ||
| 590 | Hypophagia | OFFSIDES | ||
| 591 | Incision site complication | OFFSIDES | ||
| 592 | Incision site infection | OFFSIDES | ||
| 593 | Instillation site irritation | OFFSIDES SIDER | ||
| 594 | Intention tremor | OFFSIDES | ||
| 595 | Intestinal Obstruction | OFFSIDES | ||
| 596 | Iron Overload | OFFSIDES | ||
| 597 | Keratitis sicca | OFFSIDES | ||
| 598 | Lacrimation | SIDER | ||
| 599 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 600 | Left atrial dilatation | OFFSIDES | ||
| 601 | Life expectancy shortened | OFFSIDES | ||
| 602 | Listeria sepsis | OFFSIDES | ||
| 603 | Loose tooth | OFFSIDES | ||
| 604 | Lumbar puncture abnormal | OFFSIDES | ||
| 605 | Lymphedema | OFFSIDES | ||
| 606 | Malignant neoplasm progression | OFFSIDES | ||
| 607 | Mastectomy | OFFSIDES | ||
| 608 | Maxillofacial operation | OFFSIDES | ||
| 609 | Medical device complication | OFFSIDES | ||
| 610 | Mental status changes | OFFSIDES | ||
| 611 | Microalbuminuria | OFFSIDES | ||
| 612 | Mixed hepatocellular-cholestatic injury | OFFSIDES | ||
| 613 | Muscle Weakness | OFFSIDES | ||
| 614 | Muscle abscess | OFFSIDES | ||
| 615 | Myasthenia Gravis | OFFSIDES | ||
| 616 | Myelodysplasia | OFFSIDES | ||
| 617 | Nervous tension | OFFSIDES | ||
| 618 | Ocular Hypotension | 15321024 | CTD | |
| 619 | Open wound | OFFSIDES | ||
| 620 | Optic Atrophy | OFFSIDES | ||
| 621 | Optic Neuropathy | OFFSIDES | ||
| 622 | Orthopnea | OFFSIDES | ||
| 623 | Osteomyelitis | OFFSIDES | ||
| 624 | Osteopenia | OFFSIDES | ||
| 625 | Osteoporosis | OFFSIDES | ||
| 626 | Oxygen supplementation | OFFSIDES | ||
| 627 | Pancreatic Cyst | OFFSIDES | ||
| 628 | Partner stress | OFFSIDES | ||
| 629 | Pelvic Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 630 | Pericardial effusion | OFFSIDES | ||
| 631 | Periodontal infection | OFFSIDES | ||
| 632 | Periodontal operation | OFFSIDES | ||
| 633 | Periodontitis | OFFSIDES | ||
| 634 | Pharmaceutical product complaint | OFFSIDES | ||
| 635 | Pharyngitis | SIDER | ||
| 636 | Physical disability | OFFSIDES | ||
| 637 | Plasmacytosis | OFFSIDES | ||
| 638 | Poor quality drug administered | OFFSIDES | ||
| 639 | Post procedural cellulitis | OFFSIDES | ||
| 640 | Presbyopia | OFFSIDES | ||
| 641 | Primary sequestrum | OFFSIDES | ||
| 642 | Pulmonary Hypertension | OFFSIDES | ||
| 643 | Rales | OFFSIDES | ||
| 644 | Reflux laryngitis | OFFSIDES | ||
| 645 | Renal mass | OFFSIDES | ||
| 646 | Renal tubular necrosis | OFFSIDES | ||
| 647 | Retinal scar | OFFSIDES | ||
| 648 | Rhinalgia | OFFSIDES | ||
| 649 | Rhinitis | SIDER | ||
| 650 | Rhinorrhea | OFFSIDES | ||
| 651 | Right atrial dilatation | OFFSIDES | ||
| 652 | Sciatica | Canada Vigilance: 1 | Canada Vigilance | |
| 653 | Scotoma | OFFSIDES SIDER | ||
| 654 | Sequestrectomy | OFFSIDES | ||
| 655 | Seroma | OFFSIDES | ||
| 656 | Sinus bradycardia | OFFSIDES | ||
| 657 | Skin graft failure | OFFSIDES | ||
| 658 | Splenic Infarction | OFFSIDES | ||
| 659 | Spondylolisthesis | OFFSIDES | ||
| 660 | Squamous cell carcinoma of skin | OFFSIDES | ||
| 661 | Subcutaneous Abscess | OFFSIDES | ||
| 662 | Sudden Cardiac Death | OFFSIDES | ||
| 663 | Synovial Cyst | OFFSIDES | ||
| 664 | Synovitis | OFFSIDES | ||
| 665 | Tenosynovitis | OFFSIDES | ||
| 666 | Tension | SIDER | ||
| 667 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 668 | Therapy change | Canada Vigilance: 1 | Canada Vigilance | |
| 669 | Thyroiditis | OFFSIDES | ||
| 670 | Tooth Extraction | OFFSIDES | ||
| 671 | Uterine Polyp | OFFSIDES | ||
| 672 | Vascular calcification | OFFSIDES | ||
| 673 | Vitamin A Deficiency | OFFSIDES | ||
| 674 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 675 | Vitamin K Deficiency | OFFSIDES | ||
| 676 | Vulvovaginal burning sensation | Canada Vigilance: 1 | Canada Vigilance | |
| 677 | Vulvovaginal pain | Canada Vigilance: 1 | Canada Vigilance | |
| 678 | Walking aid user | OFFSIDES | ||
| 679 | Wheelchair user | OFFSIDES | ||
| 680 | Wound Complication | OFFSIDES | ||
| 681 | diagnostic procedure | OFFSIDES | ||
| 682 | nervous system disorder | SIDER |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120235
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.