Mometasone Furoate
(WOFMFGQZHJDGCX-ZULDAHANSA-N)
Structure
- SMILES
- ClCC(=O)[C@@]1(OC(=O)c2ccco2)[C@H](C)C[C@@H]2[C@]1(C)C[C@H](O)[C@]1([C@H]2CCC2=CC(=O)C=C[C@]12C)Cl
- Type(s)
- Approved; Investigational; Vet_approved
- Molecular Formula:
- C27H30Cl2O6
- Molecular Weight:
- 521.429
- Log P:
- 4.8692
- Hydrogen Bond Acceptor:
- 6
- Hydrogen Bond Donor:
- 1
- TPSA:
- 93.81
- CAS Number(s):
- 83919-23-7
Synonym(s)
1.
Mometasone Furoate
2.
Asmanex
3.
Asmanex Twisthaler
4.
Elocon
5.
Mometasone
6.
Mometasone Furoate Monohydrate
7.
Nasonex
8.
Rinelon
9.
Sch 32088
10.
Sch-32088
11.
Furoate Monohydrate, Mometasone
12.
Furoate, Mometasone
13.
Monohydrate, Mometasone Furoate
14.
Sch32088
15.
Twisthaler, Asmanex
External Link(s)
| MeSH | D000068656 |
| PubChem Compound | 441336 |
| BindingDB | 50148733 |
| ChEBI | 47564 |
| CHEMBL | CHEMBL1161 |
| DrugBank | DB14512 |
| DrugCentral | 1832 |
| KEGG | cpd:C07817 dr:D00690 |
| ZINC | 3938677 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Product quality issue | FAERS: 3857 Canada Vigilance: 9 | Canada Vigilance US FAERS | |
| 2 | No adverse event | FAERS: 3540 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Drug dose omission | FAERS: 3226 | US FAERS | |
| 4 | Product container issue | FAERS: 473 | US FAERS | |
| 5 | Poor quality device used | FAERS: 316 | US FAERS | |
| 6 | Drug ineffective | FAERS: 288 Canada Vigilance: 23 | Canada Vigilance OFFSIDES US FAERS | |
| 7 | Incorrect dose administered | FAERS: 277 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 8 | Circumstance or information capable of leading to medication error | FAERS: 260 | US FAERS | |
| 9 | Product dose omission | FAERS: 214 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 10 | Inappropriate schedule of drug administration | FAERS: 143 | US FAERS | |
| 11 | Device malfunction | FAERS: 118 | OFFSIDES US FAERS | |
| 12 | Product use issue | FAERS: 114 | US FAERS | |
| 13 | Accidental exposure to product | FAERS: 113 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Headache | FAERS: 104 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 15 | Asthma | FAERS: 92 Canada Vigilance: 2 | 19441609 | CTD OFFSIDES Canada Vigilance US FAERS |
| 16 | Epistaxis | FAERS: 92 Canada Vigilance: 10 | Canada Vigilance OFFSIDES US FAERS | |
| 17 | Anosmia | FAERS: 72 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 18 | Drug administration error | FAERS: 72 | US FAERS | |
| 19 | Adverse event | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 20 | Wheezing | FAERS: 65 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Cataract | FAERS: 57 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 22 | Hypersensitivity | FAERS: 56 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 23 | Chest discomfort | FAERS: 51 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Nausea | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 25 | Poor quality drug administered | FAERS: 50 | US FAERS | |
| 26 | Nasal discomfort | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 27 | Malaise | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Product use in unapproved indication | FAERS: 47 | US FAERS | |
| 29 | Dizziness | FAERS: 45 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 30 | Overdose | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Expired product administered | FAERS: 44 | US FAERS | |
| 32 | Incorrect route of drug administration | FAERS: 42 | US FAERS | |
| 33 | Dysgeusia | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 34 | Ageusia | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 35 | Feeling abnormal | FAERS: 40 | OFFSIDES US FAERS | |
| 36 | Poor quality product administered | FAERS: 40 | US FAERS | |
| 37 | Wrong technique in drug usage process | FAERS: 40 | US FAERS | |
| 38 | Glaucoma | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 39 | Oropharyngeal pain | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 40 | Dysphonia | FAERS: 37 | US FAERS | |
| 41 | Fatigue | FAERS: 36 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 42 | Sinusitis | FAERS: 34 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 43 | Anxiety | FAERS: 32 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 44 | Product taste abnormal | FAERS: 32 | US FAERS | |
| 45 | Urticaria | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Wrong technique in product usage process | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 47 | Pneumonia | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Pruritus | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 49 | Palpitations | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 50 | Pain | FAERS: 26 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 51 | Pharmaceutical product complaint | FAERS: 26 | US FAERS | |
| 52 | Drug prescribing error | FAERS: 25 | US FAERS | |
| 53 | Chest Pain | FAERS: 24 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 54 | Product availability issue | FAERS: 24 | US FAERS | |
| 55 | Bronchitis | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 56 | Expired drug administered | FAERS: 23 | US FAERS | |
| 57 | Erythema | FAERS: 22 | 8408793 | CTD OFFSIDES US FAERS |
| 58 | Nasopharyngitis | FAERS: 22 | OFFSIDES US FAERS | |
| 59 | Throat irritation | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 60 | Drug ineffective for unapproved indication | FAERS: 21 | US FAERS | |
| 61 | Incorrect dose administered by device | FAERS: 21 | US FAERS | |
| 62 | Visual Impairment | FAERS: 21 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 63 | Vomiting | FAERS: 21 | US FAERS | |
| 64 | Sneezing | FAERS: 20 | US FAERS | |
| 65 | Aphonia | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 66 | Drug administered to patient of inappropriate age | FAERS: 19 | US FAERS | |
| 67 | Product quality control issue | FAERS: 18 | US FAERS | |
| 68 | Burning sensation | FAERS: 17 | US FAERS | |
| 69 | Intentional product misuse | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Myalgia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 71 | Product physical issue | FAERS: 17 | US FAERS | |
| 72 | Product packaging issue | FAERS: 16 | US FAERS | |
| 73 | Product substitution issue | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 74 | Discomfort | FAERS: 14 | US FAERS | |
| 75 | Eye pain | FAERS: 14 | US FAERS | |
| 76 | Incorrect dose administered by product | FAERS: 14 | US FAERS | |
| 77 | Product leakage | FAERS: 14 | US FAERS | |
| 78 | Product lot number issue | FAERS: 14 | US FAERS | |
| 79 | Respiratory tract congestion | FAERS: 14 | US FAERS | |
| 80 | Tremor | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Arthralgia | FAERS: 13 | US FAERS | |
| 82 | Incorrect product storage | FAERS: 13 | US FAERS | |
| 83 | Stress | FAERS: 12 | OFFSIDES US FAERS | |
| 84 | Anaphylactic shock | FAERS: 11 | US FAERS | |
| 85 | Asthenia | FAERS: 11 Canada Vigilance: 4 | Canada Vigilance OFFSIDES US FAERS | |
| 86 | Bronchospasm | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 87 | Eye irritation | FAERS: 11 | US FAERS | |
| 88 | Product supply issue | FAERS: 11 | US FAERS | |
| 89 | Upper-airway cough syndrome | FAERS: 11 | US FAERS | |
| 90 | Drug effect incomplete | FAERS: 10 | US FAERS | |
| 91 | Influenza | FAERS: 10 | US FAERS | |
| 92 | Lip swelling | FAERS: 10 | US FAERS | |
| 93 | Medical device complication | FAERS: 10 | OFFSIDES US FAERS | |
| 94 | Medication Error | FAERS: 10 | US FAERS | |
| 95 | Oral candidiasis | FAERS: 10 | US FAERS | |
| 96 | Product packaging quantity issue | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Productive Cough | FAERS: 10 | OFFSIDES US FAERS | |
| 98 | Rhinalgia | FAERS: 10 | OFFSIDES US FAERS | |
| 99 | Tinnitus | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Abdominal discomfort | FAERS: 9 | OFFSIDES US FAERS | |
| 101 | Accidental overdose | FAERS: 9 | US FAERS | |
| 102 | Alopecia | FAERS: 9 | US FAERS | |
| 103 | Application site irritation | FAERS: 9 | US FAERS | |
| 104 | Application site pain | FAERS: 9 | US FAERS | |
| 105 | Back Pain | FAERS: 9 | US FAERS | |
| 106 | Cerebrovascular accident | FAERS: 9 | US FAERS | |
| 107 | Device Failure | FAERS: 9 | OFFSIDES US FAERS | |
| 108 | Myocardial Infarction | FAERS: 9 | US FAERS | |
| 109 | Product administered to patient of inappropriate age | FAERS: 9 | US FAERS | |
| 110 | Chills | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 111 | Circumstance or information capable of leading to device use error | FAERS: 8 | US FAERS | |
| 112 | Device breakage | FAERS: 8 | OFFSIDES US FAERS | |
| 113 | Device difficult to use | FAERS: 8 | US FAERS | |
| 114 | Mood swings | FAERS: 8 | US FAERS | |
| 115 | Poor quality sleep | FAERS: 8 | US FAERS | |
| 116 | Product contamination microbial | FAERS: 8 | US FAERS | |
| 117 | Product distribution issue | FAERS: 8 | US FAERS | |
| 118 | Syncope | FAERS: 8 | US FAERS | |
| 119 | Abdominal Pain | FAERS: 7 | OFFSIDES US FAERS | |
| 120 | Extra dose administered | FAERS: 7 | US FAERS | |
| 121 | Inappropriate schedule of product administration | FAERS: 7 | US FAERS | |
| 122 | Pharyngolaryngeal Pain | FAERS: 7 | OFFSIDES US FAERS | |
| 123 | Prescribed overdose | FAERS: 7 | US FAERS | |
| 124 | Product closure issue | FAERS: 7 | US FAERS | |
| 125 | Product dosage form issue | FAERS: 7 | US FAERS | |
| 126 | Secretion discharge | FAERS: 7 | US FAERS | |
| 127 | Skin irritation | FAERS: 7 | US FAERS | |
| 128 | Somnolence | FAERS: 7 | US FAERS | |
| 129 | Swelling | FAERS: 7 | US FAERS | |
| 130 | Toothache | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 131 | Weight decreased | FAERS: 7 | US FAERS | |
| 132 | Anger | FAERS: 6 | US FAERS | |
| 133 | Atrial Fibrillation | FAERS: 6 | US FAERS | |
| 134 | Deafness | FAERS: 6 | US FAERS | |
| 135 | Device defective | FAERS: 6 | US FAERS | |
| 136 | Device dislocation | FAERS: 6 | US FAERS | |
| 137 | Dry skin | FAERS: 6 | OFFSIDES US FAERS | |
| 138 | Ear discomfort | FAERS: 6 | OFFSIDES US FAERS | |
| 139 | Exposure via skin contact | FAERS: 6 | US FAERS | |
| 140 | Hypotension | FAERS: 6 | US FAERS | |
| 141 | Intentional product use issue | FAERS: 6 | US FAERS | |
| 142 | Memory impairment | FAERS: 6 | US FAERS | |
| 143 | Menorrhagia | FAERS: 6 | US FAERS | |
| 144 | Nervousness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Oropharyngeal discomfort | FAERS: 6 | US FAERS | |
| 146 | Paranoia | FAERS: 6 | US FAERS | |
| 147 | Product prescribing error | FAERS: 6 | US FAERS | |
| 148 | Rhinitis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 149 | Agitation | FAERS: 5 | US FAERS | |
| 150 | Choking | FAERS: 5 | US FAERS | |
| 151 | Disability | FAERS: 5 | US FAERS | |
| 152 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 153 | Drug exposure during pregnancy | FAERS: 5 | OFFSIDES US FAERS | |
| 154 | Growth retardation | FAERS: 5 | US FAERS | |
| 155 | Hypothalamic pituitary adrenal axis suppression | FAERS: 5 | US FAERS | |
| 156 | Increased upper airway secretion | FAERS: 5 | OFFSIDES US FAERS | |
| 157 | Nasal inflammation | FAERS: 5 | US FAERS | |
| 158 | Product label issue | FAERS: 5 | US FAERS | |
| 159 | Product physical consistency issue | FAERS: 5 | US FAERS | |
| 160 | Sinus headache | FAERS: 5 | US FAERS | |
| 161 | Tachycardia | FAERS: 5 | US FAERS | |
| 162 | Unevaluable event | FAERS: 5 | US FAERS | |
| 163 | Vertigo | FAERS: 5 | US FAERS | |
| 164 | Accidental exposure | FAERS: 4 | OFFSIDES US FAERS | |
| 165 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 166 | Angioedema | FAERS: 4 | US FAERS | |
| 167 | Application site pruritus | FAERS: 4 | US FAERS | |
| 168 | Candidiasis | FAERS: 4 | US FAERS | |
| 169 | Chronic sinusitis | FAERS: 4 | US FAERS | |
| 170 | Diplopia | FAERS: 4 | US FAERS | |
| 171 | Disorientation | FAERS: 4 | US FAERS | |
| 172 | Drug Dependence | FAERS: 4 | US FAERS | |
| 173 | Drug dose omission by device | FAERS: 4 | US FAERS | |
| 174 | Dyspepsia | FAERS: 4 | US FAERS | |
| 175 | Eczema | FAERS: 4 | OFFSIDES US FAERS | |
| 176 | Epilepsy | FAERS: 4 | US FAERS | |
| 177 | Exposure via direct contact | FAERS: 4 | US FAERS | |
| 178 | Food Allergy | FAERS: 4 | US FAERS | |
| 179 | Head discomfort | FAERS: 4 | US FAERS | |
| 180 | Impaired work ability | FAERS: 4 | OFFSIDES US FAERS | |
| 181 | Incorrect drug administration duration | FAERS: 4 | US FAERS | |
| 182 | Infection | FAERS: 4 | US FAERS | |
| 183 | Laryngitis | FAERS: 4 | US FAERS | |
| 184 | Limb injury | FAERS: 4 | OFFSIDES US FAERS | |
| 185 | Macular degeneration | FAERS: 4 | US FAERS | |
| 186 | Middle insomnia | FAERS: 4 | US FAERS | |
| 187 | Musculoskeletal Pain | FAERS: 4 | OFFSIDES US FAERS | |
| 188 | Myopathy | FAERS: 4 | US FAERS | |
| 189 | Myopia | FAERS: 4 | OFFSIDES US FAERS | |
| 190 | Nasal Polyps | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 191 | Oral pain | FAERS: 4 | US FAERS | |
| 192 | Paranasal sinus discomfort | FAERS: 4 | US FAERS | |
| 193 | Peripheral swelling | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 194 | Pneumonitis | FAERS: 4 | US FAERS | |
| 195 | Prescription drug used without a prescription | FAERS: 4 | US FAERS | |
| 196 | Product administration error | FAERS: 4 | US FAERS | |
| 197 | Product contamination | FAERS: 4 | OFFSIDES US FAERS | |
| 198 | Product expiration date issue | FAERS: 4 | US FAERS | |
| 199 | Product label confusion | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 200 | Product prescribing issue | FAERS: 4 | US FAERS | |
| 201 | Sinus operation | FAERS: 4 | US FAERS | |
| 202 | Sinus pain | FAERS: 4 | US FAERS | |
| 203 | Skin Ulcer | FAERS: 4 | US FAERS | |
| 204 | Steroid withdrawal syndrome | FAERS: 4 | US FAERS | |
| 205 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 206 | Therapeutic response unexpected with drug substitution | FAERS: 4 | US FAERS | |
| 207 | Visual disturbance | FAERS: 4 | US FAERS | |
| 208 | treatment failure | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 209 | Accidental exposure to product by child | FAERS: 3 | US FAERS | |
| 210 | Accidental underdose | FAERS: 3 | US FAERS | |
| 211 | Acne | FAERS: 3 | US FAERS | |
| 212 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 213 | Application site erythema | FAERS: 3 | US FAERS | |
| 214 | Blindness | FAERS: 3 | US FAERS | |
| 215 | Blood cortisol decreased | FAERS: 3 | US FAERS | |
| 216 | Blood glucose increased | FAERS: 3 | US FAERS | |
| 217 | Cataract operation | FAERS: 3 | US FAERS | |
| 218 | Cheilitis | FAERS: 3 | US FAERS | |
| 219 | Constipation | FAERS: 3 | US FAERS | |
| 220 | Crying | FAERS: 3 | US FAERS | |
| 221 | Dermatitis | FAERS: 3 | 17697148 | CTD US FAERS |
| 222 | Device expulsion | FAERS: 3 | US FAERS | |
| 223 | Device use error | FAERS: 3 | US FAERS | |
| 224 | Disease Progression | FAERS: 3 | US FAERS | |
| 225 | Drug effective for unapproved indication | FAERS: 3 | US FAERS | |
| 226 | Ear congestion | FAERS: 3 | US FAERS | |
| 227 | Emotional distress | FAERS: 3 | US FAERS | |
| 228 | Eructation | FAERS: 3 | US FAERS | |
| 229 | Euphoric mood | FAERS: 3 | US FAERS | |
| 230 | Exposure to contaminated device | FAERS: 3 | US FAERS | |
| 231 | Facial Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 232 | Feeling Cold | FAERS: 3 | US FAERS | |
| 233 | Flatulence | FAERS: 3 | US FAERS | |
| 234 | Fungal disease carrier | FAERS: 3 | US FAERS | |
| 235 | Genital erythema | FAERS: 3 | US FAERS | |
| 236 | Incorrect route of product administration | FAERS: 3 | US FAERS | |
| 237 | Intercepted medication error | FAERS: 3 | US FAERS | |
| 238 | Joint swelling | FAERS: 3 | US FAERS | |
| 239 | Lymphadenopathy | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 240 | Medication residue present | FAERS: 3 | US FAERS | |
| 241 | Meningioma | FAERS: 3 | US FAERS | |
| 242 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 243 | Nasal pruritus | FAERS: 3 | US FAERS | |
| 244 | Nephrolithiasis | FAERS: 3 | US FAERS | |
| 245 | Neuralgia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 246 | Occupational exposure to product | FAERS: 3 | US FAERS | |
| 247 | Oral fungal infection | FAERS: 3 | US FAERS | |
| 248 | Oral pruritus | FAERS: 3 | US FAERS | |
| 249 | Osteoporosis | FAERS: 3 | US FAERS | |
| 250 | Physical product label issue | FAERS: 3 | US FAERS | |
| 251 | Prescribed underdose | FAERS: 3 | US FAERS | |
| 252 | Presyncope | FAERS: 3 | US FAERS | |
| 253 | Product contamination physical | FAERS: 3 | US FAERS | |
| 254 | Product impurity | FAERS: 3 | US FAERS | |
| 255 | Pulmonary congestion | FAERS: 3 | OFFSIDES US FAERS | |
| 256 | Respiratory Depression | FAERS: 3 | US FAERS | |
| 257 | Restlessness | FAERS: 3 | US FAERS | |
| 258 | Retinal Detachment | FAERS: 3 | US FAERS | |
| 259 | Scab | FAERS: 3 | US FAERS | |
| 260 | Tension Headache | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 261 | nervous system disorder | FAERS: 3 | US FAERS | |
| 262 | Abasia | FAERS: 2 | OFFSIDES US FAERS | |
| 263 | Accidental device ingestion | FAERS: 2 | US FAERS | |
| 264 | Adenoidal disorder | FAERS: 2 | US FAERS | |
| 265 | Adenoiditis | FAERS: 2 | US FAERS | |
| 266 | Amnesia | FAERS: 2 | US FAERS | |
| 267 | Anaphylactoid Reaction | FAERS: 2 | US FAERS | |
| 268 | Appendicitis | FAERS: 2 | US FAERS | |
| 269 | Application site swelling | FAERS: 2 | US FAERS | |
| 270 | Arthritis | FAERS: 2 | OFFSIDES US FAERS | |
| 271 | Asthenopia | FAERS: 2 | OFFSIDES US FAERS | |
| 272 | Blood Corticotrophin Decreased | FAERS: 2 | US FAERS | |
| 273 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 274 | Blood cortisol increased | FAERS: 2 | US FAERS | |
| 275 | Blood pH increased | FAERS: 2 | US FAERS | |
| 276 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 277 | Borderline glaucoma | FAERS: 2 | US FAERS | |
| 278 | Cellulitis | FAERS: 2 | OFFSIDES US FAERS | |
| 279 | Chromaturia | FAERS: 2 | US FAERS | |
| 280 | Complication associated with device | FAERS: 2 | US FAERS | |
| 281 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 282 | Dehydration | FAERS: 2 | OFFSIDES US FAERS | |
| 283 | Dementia | FAERS: 2 | US FAERS | |
| 284 | Device ineffective | FAERS: 2 | US FAERS | |
| 285 | Device occlusion | FAERS: 2 | OFFSIDES US FAERS | |
| 286 | Disease recurrence | FAERS: 2 | US FAERS | |
| 287 | Disease susceptibility | FAERS: 2 | US FAERS | |
| 288 | Drug delivery system malfunction | FAERS: 2 | OFFSIDES US FAERS | |
| 289 | Drug label confusion | FAERS: 2 | US FAERS | |
| 290 | Dysarthria | FAERS: 2 | US FAERS | |
| 291 | Economic problem | FAERS: 2 | OFFSIDES US FAERS | |
| 292 | Educational problem | FAERS: 2 | US FAERS | |
| 293 | Enuresis | FAERS: 2 | US FAERS | |
| 294 | Flushing | FAERS: 2 | US FAERS | |
| 295 | Foreign body sensation in eyes | FAERS: 2 | US FAERS | |
| 296 | Fracture | FAERS: 2 | US FAERS | |
| 297 | Fungal rhinitis | FAERS: 2 | US FAERS | |
| 298 | Glaucoma surgery | FAERS: 2 | US FAERS | |
| 299 | Glossitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 300 | Guillain-Barre Syndrome | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 301 | Hearing disability | FAERS: 2 | US FAERS | |
| 302 | Hip surgery | FAERS: 2 | US FAERS | |
| 303 | Hypertrichosis | FAERS: 2 | US FAERS | |
| 304 | Hypogeusia | FAERS: 2 | US FAERS | |
| 305 | Hypokinesia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 306 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 307 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 308 | Inflammation | FAERS: 2 | US FAERS | |
| 309 | Laboratory test interference | FAERS: 2 | US FAERS | |
| 310 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 311 | Mouth swelling | FAERS: 2 | US FAERS | |
| 312 | Nasal mucosal disorder | FAERS: 2 | US FAERS | |
| 313 | Nasal mucosal ulcer | FAERS: 2 | US FAERS | |
| 314 | Negative thoughts | FAERS: 2 | US FAERS | |
| 315 | Nerve injury | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 316 | Night sweats | FAERS: 2 | US FAERS | |
| 317 | Nodule | FAERS: 2 | OFFSIDES US FAERS | |
| 318 | Ocular discomfort | FAERS: 2 | US FAERS | |
| 319 | Oropharyngeal swelling | FAERS: 2 | US FAERS | |
| 320 | Pain of skin | FAERS: 2 | US FAERS | |
| 321 | Paranasal sinus hypersecretion | FAERS: 2 | US FAERS | |
| 322 | Peritonsillar Abscess | FAERS: 2 | US FAERS | |
| 323 | Personality Change | FAERS: 2 | US FAERS | |
| 324 | Pharyngitis | FAERS: 2 | US FAERS | |
| 325 | Product complaint | FAERS: 2 | US FAERS | |
| 326 | Product dispensing error | FAERS: 2 | US FAERS | |
| 327 | Product shape issue | FAERS: 2 | US FAERS | |
| 328 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 329 | Quality of life decreased | FAERS: 2 | US FAERS | |
| 330 | Rales | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 331 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 332 | Rebound effect | FAERS: 2 | US FAERS | |
| 333 | Respiratory tract irritation | FAERS: 2 | OFFSIDES US FAERS | |
| 334 | Retching | FAERS: 2 | US FAERS | |
| 335 | Retinal Vein Occlusion | FAERS: 2 | US FAERS | |
| 336 | Sepsis | FAERS: 2 | US FAERS | |
| 337 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 338 | Stomatitis | FAERS: 2 | US FAERS | |
| 339 | Sudden death | FAERS: 2 | OFFSIDES US FAERS | |
| 340 | Suicide attempt | FAERS: 2 | US FAERS | |
| 341 | Therapeutic product ineffective | FAERS: 2 | US FAERS | |
| 342 | Therapy change | FAERS: 2 | US FAERS | |
| 343 | Thirst | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 344 | Thrombosis | FAERS: 2 | US FAERS | |
| 345 | Tongue blistering | FAERS: 2 | US FAERS | |
| 346 | VIIth nerve paralysis | FAERS: 2 | US FAERS | |
| 347 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 348 | Vulvovaginal mycotic infection | FAERS: 2 | US FAERS | |
| 349 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 350 | Wrong technique in device usage process | FAERS: 2 | US FAERS | |
| 351 | Administration site laceration | FAERS: 1 | US FAERS | |
| 352 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 353 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 354 | Aortic Aneurysm | FAERS: 1 | OFFSIDES US FAERS | |
| 355 | Aphasia | FAERS: 1 | US FAERS | |
| 356 | Application site burn | FAERS: 1 | US FAERS | |
| 357 | Application site exfoliation | FAERS: 1 | US FAERS | |
| 358 | Application site folliculitis | FAERS: 1 | US FAERS | |
| 359 | Application site hypersensitivity | FAERS: 1 | US FAERS | |
| 360 | Application site inflammation | FAERS: 1 | US FAERS | |
| 361 | Application site papules | FAERS: 1 | OFFSIDES US FAERS | |
| 362 | Application site rash | FAERS: 1 | OFFSIDES US FAERS | |
| 363 | Application site reaction | FAERS: 1 | US FAERS | |
| 364 | Application site vesicles | FAERS: 1 | US FAERS | |
| 365 | Arthropathy | FAERS: 1 | US FAERS | |
| 366 | Ascites | FAERS: 1 | US FAERS | |
| 367 | Aspergillosis | FAERS: 1 | OFFSIDES US FAERS | |
| 368 | Asphyxia | FAERS: 1 | US FAERS | |
| 369 | Atopy | FAERS: 1 | US FAERS | |
| 370 | Atrial tachycardia | FAERS: 1 | US FAERS | |
| 371 | Auricular swelling | FAERS: 1 | US FAERS | |
| 372 | Autoimmune thyroiditis | FAERS: 1 | OFFSIDES US FAERS | |
| 373 | Back disorder | FAERS: 1 | US FAERS | |
| 374 | Benign Prostatic Hyperplasia | FAERS: 1 | OFFSIDES US FAERS | |
| 375 | Blepharitis | FAERS: 1 | OFFSIDES US FAERS | |
| 376 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 377 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 378 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 379 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 380 | Blood urine present | FAERS: 1 | US FAERS | |
| 381 | Body height below normal | FAERS: 1 | US FAERS | |
| 382 | Bone density decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 383 | Brain Death | FAERS: 1 | US FAERS | |
| 384 | Breath alcohol test positive | FAERS: 1 | US FAERS | |
| 385 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 386 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 387 | Bronchial irritation | FAERS: 1 | OFFSIDES US FAERS | |
| 388 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 389 | Carcinoma | FAERS: 1 | US FAERS | |
| 390 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 391 | Cardiac Flutter | FAERS: 1 | OFFSIDES US FAERS | |
| 392 | Chemical burns of eye | FAERS: 1 | US FAERS | |
| 393 | Cold sweat | FAERS: 1 | US FAERS | |
| 394 | Croup noninfectious | FAERS: 1 | US FAERS | |
| 395 | Cystitis | FAERS: 1 | US FAERS | |
| 396 | Deformity | FAERS: 1 | US FAERS | |
| 397 | Dengue Fever | FAERS: 1 | US FAERS | |
| 398 | Dental discomfort | FAERS: 1 | US FAERS | |
| 399 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 400 | Detachment of retinal pigment epithelium | FAERS: 1 | US FAERS | |
| 401 | Device capturing issue | FAERS: 1 | US FAERS | |
| 402 | Device component issue | FAERS: 1 | US FAERS | |
| 403 | Device kink | FAERS: 1 | US FAERS | |
| 404 | Device leakage | FAERS: 1 | US FAERS | |
| 405 | Device physical property issue | FAERS: 1 | US FAERS | |
| 406 | Device related infection | FAERS: 1 | US FAERS | |
| 407 | Device use issue | FAERS: 1 | US FAERS | |
| 408 | Diaphragmatic Hernia | FAERS: 1 | US FAERS | |
| 409 | Diverticulitis | FAERS: 1 | US FAERS | |
| 410 | Drug administered at inappropriate site | FAERS: 1 | US FAERS | |
| 411 | Drug effect delayed | FAERS: 1 | US FAERS | |
| 412 | Drug effect faster than expected | FAERS: 1 | US FAERS | |
| 413 | Drug resistance | FAERS: 1 | US FAERS | |
| 414 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 415 | Dysbacteriosis | FAERS: 1 | US FAERS | |
| 416 | Dyscalculia | FAERS: 1 | US FAERS | |
| 417 | Dysphemia | FAERS: 1 | OFFSIDES US FAERS | |
| 418 | Dystonia | FAERS: 1 | US FAERS | |
| 419 | Eclampsia | FAERS: 1 | US FAERS | |
| 420 | Embedded device | FAERS: 1 | US FAERS | |
| 421 | Emergency care examination | FAERS: 1 | US FAERS | |
| 422 | Erysipelas | FAERS: 1 | US FAERS | |
| 423 | Eustachian tube disorder | FAERS: 1 | US FAERS | |
| 424 | Exposure via eye contact | FAERS: 1 | US FAERS | |
| 425 | External ear pain | FAERS: 1 | US FAERS | |
| 426 | Extraocular Muscle Paresis | FAERS: 1 | US FAERS | |
| 427 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 428 | False positive laboratory result | FAERS: 1 | US FAERS | |
| 429 | Fatty acid deficiency | FAERS: 1 | US FAERS | |
| 430 | Feeling jittery | FAERS: 1 | US FAERS | |
| 431 | Feelings of worthlessness | FAERS: 1 | US FAERS | |
| 432 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 433 | Full blood count increased | FAERS: 1 | US FAERS | |
| 434 | Fungal pharyngitis | FAERS: 1 | US FAERS | |
| 435 | Gastric infection | FAERS: 1 | US FAERS | |
| 436 | Gastric ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 437 | Gastritis | FAERS: 1 | US FAERS | |
| 438 | General physical health deterioration | FAERS: 1 | OFFSIDES US FAERS | |
| 439 | General symptom | FAERS: 1 | US FAERS | |
| 440 | Genital Herpes | FAERS: 1 | US FAERS | |
| 441 | Gingival Recession | FAERS: 1 | US FAERS | |
| 442 | Hallucinations, mixed | FAERS: 1 | OFFSIDES US FAERS | |
| 443 | Hepatitis B | FAERS: 1 | US FAERS | |
| 444 | High density lipoprotein increased | FAERS: 1 | US FAERS | |
| 445 | Holoprosencephaly | FAERS: 1 | US FAERS | |
| 446 | Hyperacusis | FAERS: 1 | US FAERS | |
| 447 | Hypersomnia | FAERS: 1 | US FAERS | |
| 448 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 449 | Hyperventilation | FAERS: 1 | US FAERS | |
| 450 | Hypophagia | FAERS: 1 | US FAERS | |
| 451 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 452 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 453 | Immune thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 454 | Impaired gastric emptying | FAERS: 1 | OFFSIDES US FAERS | |
| 455 | Impatience | FAERS: 1 | US FAERS | |
| 456 | Impetigo | FAERS: 1 | OFFSIDES US FAERS | |
| 457 | Implant site infection | FAERS: 1 | US FAERS | |
| 458 | Incontinence | FAERS: 1 | US FAERS | |
| 459 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 460 | Incorrect product formulation administered | FAERS: 1 | US FAERS | |
| 461 | Incorrect storage of drug | FAERS: 1 | US FAERS | |
| 462 | Increased tendency to bruise | FAERS: 1 | US FAERS | |
| 463 | Intentional dose omission | FAERS: 1 | US FAERS | |
| 464 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 465 | Intercepted drug dispensing error | FAERS: 1 | US FAERS | |
| 466 | Intervertebral disc injury | FAERS: 1 | US FAERS | |
| 467 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 468 | Joint injury | FAERS: 1 | US FAERS | |
| 469 | Lethargy | FAERS: 1 | OFFSIDES US FAERS | |
| 470 | Limb discomfort | FAERS: 1 | US FAERS | |
| 471 | Lipoatrophy | FAERS: 1 | US FAERS | |
| 472 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 473 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 474 | Lung neoplasm surgery | FAERS: 1 | US FAERS | |
| 475 | Lyme Disease | FAERS: 1 | US FAERS | |
| 476 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 477 | Macular fibrosis | FAERS: 1 | US FAERS | |
| 478 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 479 | Maternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 480 | Meniscus injury | FAERS: 1 | US FAERS | |
| 481 | Metastatic Neoplasm | FAERS: 1 | US FAERS | |
| 482 | Metastatic uterine cancer | FAERS: 1 | US FAERS | |
| 483 | Molluscum Contagiosum | FAERS: 1 | US FAERS | |
| 484 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 485 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 486 | Muscle strain | FAERS: 1 | US FAERS | |
| 487 | Muscle tightness | FAERS: 1 | US FAERS | |
| 488 | Musculoskeletal chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 489 | Myomectomy | FAERS: 1 | US FAERS | |
| 490 | Myositis | FAERS: 1 | US FAERS | |
| 491 | Nasopharyngeal surgery | FAERS: 1 | US FAERS | |
| 492 | Neck Pain | FAERS: 1 | US FAERS | |
| 493 | Nephrectomy | FAERS: 1 | US FAERS | |
| 494 | Nephritis | FAERS: 1 | US FAERS | |
| 495 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 496 | Neutropenia | FAERS: 1 | US FAERS | |
| 497 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 498 | Nocturia | FAERS: 1 | US FAERS | |
| 499 | Obesity | FAERS: 1 | US FAERS | |
| 500 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 501 | Oppositional Defiant Disorder | FAERS: 1 | US FAERS | |
| 502 | Oral mucosal eruption | FAERS: 1 | US FAERS | |
| 503 | Oral mucosal erythema | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 504 | Oral papule | FAERS: 1 | US FAERS | |
| 505 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 506 | Oropharyngeal spasm | FAERS: 1 | US FAERS | |
| 507 | Osteopenia | FAERS: 1 | US FAERS | |
| 508 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 509 | Paranasal sinus mucosal hypertrophy | FAERS: 1 | US FAERS | |
| 510 | Periarthritis | FAERS: 1 | US FAERS | |
| 511 | Peripheral embolism | FAERS: 1 | US FAERS | |
| 512 | Pharyngotonsillitis | FAERS: 1 | US FAERS | |
| 513 | Photophobia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 514 | Pigmentation lip | FAERS: 1 | US FAERS | |
| 515 | Pneumothorax | FAERS: 1 | OFFSIDES US FAERS | |
| 516 | Post procedural complication | FAERS: 1 | US FAERS | |
| 517 | Post-traumatic pain | FAERS: 1 | US FAERS | |
| 518 | Pregnancy of partner | FAERS: 1 | US FAERS | |
| 519 | Pregnancy with advanced maternal age | FAERS: 1 | US FAERS | |
| 520 | Pregnancy | FAERS: 1 | US FAERS | |
| 521 | Product administered at inappropriate site | FAERS: 1 | US FAERS | |
| 522 | Product cleaning inadequate | FAERS: 1 | US FAERS | |
| 523 | Product closure removal difficult | FAERS: 1 | US FAERS | |
| 524 | Product commingling | FAERS: 1 | US FAERS | |
| 525 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 526 | Product container seal issue | FAERS: 1 | US FAERS | |
| 527 | Product dosage form confusion | FAERS: 1 | US FAERS | |
| 528 | Product dropper issue | FAERS: 1 | US FAERS | |
| 529 | Product formulation issue | FAERS: 1 | US FAERS | |
| 530 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 531 | Product outer packaging issue | FAERS: 1 | US FAERS | |
| 532 | Product package associated injury | FAERS: 1 | US FAERS | |
| 533 | Product packaging confusion | FAERS: 1 | US FAERS | |
| 534 | Product selection error | FAERS: 1 | US FAERS | |
| 535 | Product size issue | FAERS: 1 | US FAERS | |
| 536 | Product storage error | FAERS: 1 | US FAERS | |
| 537 | Product tampering | FAERS: 1 | US FAERS | |
| 538 | Product use complaint | FAERS: 1 | US FAERS | |
| 539 | Psychiatric symptom | FAERS: 1 | OFFSIDES US FAERS | |
| 540 | Psychomotor skills impaired | FAERS: 1 | OFFSIDES US FAERS | |
| 541 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 542 | Pulmonary function test decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 543 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 544 | Purpura | FAERS: 1 | US FAERS | |
| 545 | Rash erythematous | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 546 | Rebound eczema | FAERS: 1 | US FAERS | |
| 547 | Rectal polyp | FAERS: 1 | US FAERS | |
| 548 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 549 | Respiratory distress | FAERS: 1 | US FAERS | |
| 550 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 551 | Retinal artery spasm | FAERS: 1 | US FAERS | |
| 552 | Scotoma | FAERS: 1 | US FAERS | |
| 553 | Screaming | FAERS: 1 | US FAERS | |
| 554 | Sensory level abnormal | FAERS: 1 | US FAERS | |
| 555 | Septic Shock | FAERS: 1 | US FAERS | |
| 556 | Septic vasculitis | FAERS: 1 | US FAERS | |
| 557 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 558 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 559 | Skin laceration | FAERS: 1 | US FAERS | |
| 560 | Skin lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 561 | Skin reaction | FAERS: 1 | US FAERS | |
| 562 | Solar urticaria | FAERS: 1 | US FAERS | |
| 563 | Staphylococcus test | FAERS: 1 | US FAERS | |
| 564 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 565 | Stillbirth | FAERS: 1 | US FAERS | |
| 566 | Stridor | FAERS: 1 | US FAERS | |
| 567 | Stupor | FAERS: 1 | US FAERS | |
| 568 | Swelling of eyelid | FAERS: 1 | US FAERS | |
| 569 | Tension | FAERS: 1 | US FAERS | |
| 570 | Therapeutic product contamination | FAERS: 1 | US FAERS | |
| 571 | Therapeutic product effective for unapproved indication | FAERS: 1 | US FAERS | |
| 572 | Therapeutic response changed | FAERS: 1 | US FAERS | |
| 573 | Therapy cessation | FAERS: 1 | US FAERS | |
| 574 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 575 | Thermal burn | FAERS: 1 | US FAERS | |
| 576 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 577 | Tongue biting | FAERS: 1 | US FAERS | |
| 578 | Tongue discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 579 | Tonsillectomy | FAERS: 1 | US FAERS | |
| 580 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 581 | Tracheitis | FAERS: 1 | US FAERS | |
| 582 | Trisomy 21 | FAERS: 1 | US FAERS | |
| 583 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 584 | Upper airway obstruction | FAERS: 1 | US FAERS | |
| 585 | Upper respiratory fungal infection | FAERS: 1 | US FAERS | |
| 586 | Upper respiratory tract congestion | FAERS: 1 | US FAERS | |
| 587 | Urinary Retention | FAERS: 1 | US FAERS | |
| 588 | Urinary bladder polyp | FAERS: 1 | US FAERS | |
| 589 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 590 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 591 | Viral upper respiratory tract infection | FAERS: 1 | US FAERS | |
| 592 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 593 | Walking aid user | FAERS: 1 | OFFSIDES US FAERS | |
| 594 | Weight | FAERS: 1 | US FAERS | |
| 595 | Wrong strength | FAERS: 1 | US FAERS | |
| 596 | Xeroderma | FAERS: 1 | US FAERS | |
| 597 | furuncle | FAERS: 1 | US FAERS | |
| 598 | jaundice | FAERS: 1 | US FAERS | |
| 599 | rhinoplasty | FAERS: 1 | US FAERS | |
| 600 | Abdominal mass | OFFSIDES | ||
| 601 | Abnormal vision | OFFSIDES | ||
| 602 | Abuse | OFFSIDES | ||
| 603 | Acid reflux | OFFSIDES | ||
| 604 | Acute bronchitis | OFFSIDES | ||
| 605 | Acute myocardial infarction | OFFSIDES | ||
| 606 | Acute sinusitis | OFFSIDES | ||
| 607 | Adenitis | OFFSIDES | ||
| 608 | Adnexa uteri mass | OFFSIDES | ||
| 609 | Alveolitis | OFFSIDES | ||
| 610 | Anal Fissure | OFFSIDES | ||
| 611 | Anal sphincter atony | OFFSIDES | ||
| 612 | Aneurysm | OFFSIDES | ||
| 613 | Anhidrosis | OFFSIDES | ||
| 614 | Anorexia | OFFSIDES | ||
| 615 | Anoxic Encephalopathy | OFFSIDES | ||
| 616 | Antiphospholipid antibodies positive | OFFSIDES | ||
| 617 | Apparent death | OFFSIDES | ||
| 618 | Arterial Injury | OFFSIDES | ||
| 619 | Arterial thrombosis | OFFSIDES | ||
| 620 | Astigmatism | OFFSIDES | ||
| 621 | Ataxia | Canada Vigilance: 1 | Canada Vigilance | |
| 622 | Atelectasis | OFFSIDES | ||
| 623 | Aura | OFFSIDES | ||
| 624 | Autoimmune hepatitis | OFFSIDES | ||
| 625 | Bipolar Disorder | OFFSIDES | ||
| 626 | Bladder Neoplasm | OFFSIDES | ||
| 627 | Blood Glucose | OFFSIDES | ||
| 628 | Blood chloride decreased | OFFSIDES | ||
| 629 | Blood cholesterol | OFFSIDES | ||
| 630 | Blood count abnormal | OFFSIDES | ||
| 631 | Blood creatine phosphokinase increased | OFFSIDES | ||
| 632 | Blood immunoglobulin G increased | OFFSIDES | ||
| 633 | Blood pressure orthostatic decreased | OFFSIDES | ||
| 634 | Blurred vision | OFFSIDES | ||
| 635 | Bone lesion | OFFSIDES | ||
| 636 | Bowen's Disease | OFFSIDES | ||
| 637 | Brain Concussion | OFFSIDES | ||
| 638 | Breast cancer recurrent | OFFSIDES | ||
| 639 | Bronchiolitis | OFFSIDES | ||
| 640 | Bruxism | OFFSIDES | ||
| 641 | Cardiac infection | OFFSIDES | ||
| 642 | Carotid artery occlusion | OFFSIDES | ||
| 643 | Catheter placement | OFFSIDES | ||
| 644 | Central line infection | OFFSIDES | ||
| 645 | Central venous catheter removal | OFFSIDES | ||
| 646 | Cerebral Arteriosclerosis | OFFSIDES | ||
| 647 | Cervical dysplasia | OFFSIDES | ||
| 648 | Choking sensation | OFFSIDES | ||
| 649 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 650 | Chronic ulcerative colitis | OFFSIDES | ||
| 651 | Clostridium difficile colitis | OFFSIDES | ||
| 652 | Clostridium difficile toxin test positive | OFFSIDES | ||
| 653 | Compression fracture | OFFSIDES | ||
| 654 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 655 | Conjunctival scar | OFFSIDES | ||
| 656 | Contact Dermatitis | OFFSIDES | ||
| 657 | Corneal dystrophy | OFFSIDES | ||
| 658 | Croup infectious | Canada Vigilance: 1 | Canada Vigilance | |
| 659 | Deafness Neurosensory | OFFSIDES | ||
| 660 | Demyelination | OFFSIDES | ||
| 661 | Dental Plaque | OFFSIDES | ||
| 662 | Diffuse Large B-Cell Lymphoma | OFFSIDES | ||
| 663 | Disease complication | OFFSIDES | ||
| 664 | Diverticulosis | OFFSIDES | ||
| 665 | Diverticulum | OFFSIDES | ||
| 666 | Drug screen positive | OFFSIDES | ||
| 667 | Drug withdrawal headache | OFFSIDES | ||
| 668 | Dysuria | OFFSIDES | ||
| 669 | Ear discharge | OFFSIDES | ||
| 670 | Ear tube insertion | OFFSIDES | ||
| 671 | Echolalia | OFFSIDES | ||
| 672 | Ejection Fraction Decreased | OFFSIDES | ||
| 673 | Electromechanical dissociation | OFFSIDES | ||
| 674 | Electromyogram abnormal | OFFSIDES | ||
| 675 | Embolism | OFFSIDES | ||
| 676 | Endocarditis | OFFSIDES | ||
| 677 | Epiglottitis | OFFSIDES | ||
| 678 | Erectile dysfunction | Canada Vigilance: 1 | Canada Vigilance | |
| 679 | Erythema Nodosum | OFFSIDES | ||
| 680 | Eschar | OFFSIDES | ||
| 681 | Escherichia sepsis | OFFSIDES | ||
| 682 | Excoriation | OFFSIDES | ||
| 683 | Eye Infection | OFFSIDES | ||
| 684 | Facial paralysis | Canada Vigilance: 2 | Canada Vigilance | |
| 685 | Fatty Liver | OFFSIDES | ||
| 686 | Foaming at mouth | Canada Vigilance: 1 | Canada Vigilance | |
| 687 | Focal glomerulosclerosis | OFFSIDES | ||
| 688 | Frustration | OFFSIDES | ||
| 689 | Fungus sputum test positive | OFFSIDES | ||
| 690 | Gammopathy | OFFSIDES | ||
| 691 | Gastroenteritis | OFFSIDES | ||
| 692 | Gastrointestinal Diseases | 21885873 | CTD | |
| 693 | Granuloma | OFFSIDES | ||
| 694 | Haematotoxicity | OFFSIDES | ||
| 695 | Hearing aid user | OFFSIDES | ||
| 696 | Hemiparesis | OFFSIDES | ||
| 697 | Histoplasmosis | OFFSIDES | ||
| 698 | Hydrocephalus | OFFSIDES | ||
| 699 | Hypertrophic Cardiomyopathy | OFFSIDES | ||
| 700 | Hypoaesthesia facial | OFFSIDES | ||
| 701 | Hysterectomy | OFFSIDES | ||
| 702 | Ileitis | OFFSIDES | ||
| 703 | Immune reconstitution syndrome | OFFSIDES | ||
| 704 | Implantable defibrillator malfunction | OFFSIDES | ||
| 705 | Incision site complication | OFFSIDES | ||
| 706 | Infectious Mononucleosis | OFFSIDES | ||
| 707 | Infusion site pruritus | OFFSIDES | ||
| 708 | Initial insomnia | OFFSIDES | ||
| 709 | Injection site burning | OFFSIDES | ||
| 710 | Injection site erythema | OFFSIDES | ||
| 711 | Injection site irritation | OFFSIDES | ||
| 712 | Injection site macule | OFFSIDES | ||
| 713 | Injection site pruritus | OFFSIDES | ||
| 714 | Intercostal neuralgia | OFFSIDES | ||
| 715 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 716 | Intussusception | OFFSIDES | ||
| 717 | Keratitis sicca | OFFSIDES | ||
| 718 | Kidney Neoplasm | OFFSIDES | ||
| 719 | Kleptomania | OFFSIDES | ||
| 720 | Lentigo | OFFSIDES | ||
| 721 | Leukoencephalopathy | OFFSIDES | ||
| 722 | Lichen Planus | OFFSIDES | ||
| 723 | Loose tooth | OFFSIDES | ||
| 724 | Lumbar puncture abnormal | OFFSIDES | ||
| 725 | Lumbar radiculopathy | OFFSIDES | ||
| 726 | Lymphoma | OFFSIDES | ||
| 727 | Malignant melanoma in situ | OFFSIDES | ||
| 728 | Mass excision | OFFSIDES | ||
| 729 | Mastication disorder | OFFSIDES | ||
| 730 | Mental status changes | OFFSIDES | ||
| 731 | Multiple Myeloma | OFFSIDES | ||
| 732 | Multiple drug overdose intentional | OFFSIDES | ||
| 733 | Muscle Weakness | OFFSIDES | ||
| 734 | Muscle fibrosis | OFFSIDES | ||
| 735 | Muscle necrosis | OFFSIDES | ||
| 736 | Musculoskeletal discomfort | OFFSIDES | ||
| 737 | Myeloma recurrence | OFFSIDES | ||
| 738 | Myocardial fibrosis | OFFSIDES | ||
| 739 | Myoglobinaemia | OFFSIDES | ||
| 740 | Nephrogenic Diabetes Insipidus | OFFSIDES | ||
| 741 | Neurological examination abnormal | OFFSIDES | ||
| 742 | Neuroma | OFFSIDES | ||
| 743 | Ocular icterus | OFFSIDES | ||
| 744 | Oculogyration | OFFSIDES | ||
| 745 | Open wound | OFFSIDES | ||
| 746 | Optic nerve cupping | OFFSIDES | ||
| 747 | Oral polypectomy | OFFSIDES | ||
| 748 | Osteochondrosis | OFFSIDES | ||
| 749 | Osteomyelitis | OFFSIDES | ||
| 750 | Pancreatitis | OFFSIDES | ||
| 751 | Paraplegia | OFFSIDES | ||
| 752 | Pericardial effusion | OFFSIDES | ||
| 753 | Perivascular dermatitis | OFFSIDES | ||
| 754 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 755 | Phlebitis | OFFSIDES | ||
| 756 | Pilonidal cyst congenital | OFFSIDES | ||
| 757 | Plasmacytosis | OFFSIDES | ||
| 758 | Pneumatosis Cystoides Intestinalis | OFFSIDES | ||
| 759 | Polysubstance abuse | OFFSIDES | ||
| 760 | Polyuria | OFFSIDES | ||
| 761 | Post procedural infection | OFFSIDES | ||
| 762 | Postoperative adhesion | OFFSIDES | ||
| 763 | Pre-Eclampsia | OFFSIDES | ||
| 764 | Primary sequestrum | OFFSIDES | ||
| 765 | Procedural complication | OFFSIDES | ||
| 766 | Proctitis | OFFSIDES | ||
| 767 | Proctocolitis | OFFSIDES | ||
| 768 | Product substitution | Canada Vigilance: 1 | Canada Vigilance | |
| 769 | Pseudomonal sepsis | OFFSIDES | ||
| 770 | Psoriasis | OFFSIDES | ||
| 771 | Pulmonary Hypertension | OFFSIDES | ||
| 772 | Pulmonary Infarction | OFFSIDES | ||
| 773 | Pulmonary radiation injury | OFFSIDES | ||
| 774 | Renal abscess | OFFSIDES | ||
| 775 | Renal mass | OFFSIDES | ||
| 776 | Respiratory Failure | OFFSIDES | ||
| 777 | Retroperitoneal lymphadenopathy | OFFSIDES | ||
| 778 | Rhabdomyolysis | OFFSIDES | ||
| 779 | Rhinitis, Allergic, Perennial | 19233485 | CTD | |
| 780 | Rhonchi | OFFSIDES | ||
| 781 | Sarcoidosis | OFFSIDES | ||
| 782 | Schizoid Personality Disorder | OFFSIDES | ||
| 783 | Serum Sickness | OFFSIDES | ||
| 784 | Skeletal injury | OFFSIDES | ||
| 785 | Skin Manifestations | 19422381 | CTD | |
| 786 | Skin necrosis | OFFSIDES | ||
| 787 | Sleep disorder due to a general medical condition | OFFSIDES | ||
| 788 | Small intestine carcinoma | OFFSIDES | ||
| 789 | Somatoform Disorder | OFFSIDES | ||
| 790 | Spinal column stenosis | OFFSIDES | ||
| 791 | Spinal fusion surgery | OFFSIDES | ||
| 792 | Splenic Infarction | OFFSIDES | ||
| 793 | Spondylolisthesis | OFFSIDES | ||
| 794 | Squamous cell carcinoma of skin | OFFSIDES | ||
| 795 | Stool analysis abnormal | OFFSIDES | ||
| 796 | Subcutaneous Abscess | OFFSIDES | ||
| 797 | Superficial Thrombophlebitis | OFFSIDES | ||
| 798 | Supraventricular tachycardia | OFFSIDES | ||
| 799 | Synovial Cyst | OFFSIDES | ||
| 800 | Talipes | OFFSIDES | ||
| 801 | Tarsal Tunnel Syndrome | OFFSIDES | ||
| 802 | Telangiectasis | 8408793 17697148 | CTD | |
| 803 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 804 | Therapy regimen changed | OFFSIDES | ||
| 805 | Tongue eruption | Canada Vigilance: 1 | Canada Vigilance | |
| 806 | Tooth Extraction | OFFSIDES | ||
| 807 | Transaminases increased | OFFSIDES | ||
| 808 | Troponin I increased | OFFSIDES | ||
| 809 | Unresponsive to stimuli | OFFSIDES | ||
| 810 | Unresponsive to verbal stimuli | OFFSIDES | ||
| 811 | Urine flow decreased | OFFSIDES | ||
| 812 | Venous Injury | OFFSIDES | ||
| 813 | Venous Insufficiency | OFFSIDES | ||
| 814 | Ventricular Fibrillation | OFFSIDES | ||
| 815 | Vertebroplasty | OFFSIDES | ||
| 816 | Viral pharyngitis | OFFSIDES | ||
| 817 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 818 | Vitamin K | OFFSIDES | ||
| 819 | Wheelchair user | OFFSIDES | ||
| 820 | kyphosis | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.