Pemetrexed
(WBXPDJSOTKVWSJ-ZDUSSCGKSA-N)
Structure
- SMILES
- OC(=O)CC[C@@H](C(=O)O)NC(=O)c1ccc(cc1)CCc1c[nH]c2c1c(=O)[nH]c(n2)N
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01BA04
- Molecular Formula:
- C20H21N5O6
- Molecular Weight:
- 427.411
- Log P:
- 1.6385
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 6
- TPSA:
- 191.26
- CAS Number(s):
- 137281-23-3
Synonym(s)
1.
Pemetrexed
2.
Alimta
3.
LY 231,514
4.
LY 231514
5.
LY-231,514
6.
LY-231514
7.
LY231514
8.
MTA
9.
N-(4-(2-(2-amino-3,4-dihydro-4-oxo-7H-pyrrolo(2,3-d)pyrimdin-5-yl)ethyl)benzoyl)glutamic acid
10.
Pemetrexed Disodium
11.
231,514, LY
12.
231514, LY
13.
Disodium, Pemetrexed
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Malignant neoplasm progression | FAERS: 168 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Pancytopenia | FAERS: 70 | SIDER US FAERS | |
| 3 | Fatigue | FAERS: 59 Canada Vigilance: 3 | 19433684 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 4 | Thrombocytopenia | FAERS: 56 Canada Vigilance: 1 | 19433684 19720897 | CTD SIDER Canada Vigilance US FAERS |
| 5 | Pneumonia | FAERS: 51 Canada Vigilance: 3 | 21415776 | CTD Canada Vigilance US FAERS |
| 6 | Nausea | FAERS: 49 | OFFSIDES SIDER US FAERS | |
| 7 | Febrile Neutropenia | FAERS: 45 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Neutropenia | FAERS: 43 | CTD SIDER US FAERS | |
| 9 | Asthenia | FAERS: 40 | SIDER US FAERS | |
| 10 | Vomiting | FAERS: 35 | SIDER US FAERS | |
| 11 | General physical health deterioration | FAERS: 32 | OFFSIDES US FAERS | |
| 12 | Acute kidney injury | FAERS: 31 | 14581433 | CTD US FAERS |
| 13 | Hospice Care | FAERS: 27 | OFFSIDES US FAERS | |
| 14 | Hypotension | FAERS: 27 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 15 | Blood creatinine increased | FAERS: 25 | OFFSIDES SIDER US FAERS | |
| 16 | Dehydration | FAERS: 24 | OFFSIDES SIDER US FAERS | |
| 17 | Malaise | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Pneumonitis | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Cerebrovascular accident | FAERS: 22 | SIDER US FAERS | |
| 20 | Disease Progression | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 21 | Respiratory Failure | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 22 | Infection | FAERS: 20 | 19433684 | CTD OFFSIDES SIDER US FAERS |
| 23 | Cellulitis | FAERS: 19 | US FAERS | |
| 24 | Pain | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 25 | Myocardial Infarction | FAERS: 18 | SIDER US FAERS | |
| 26 | Dizziness | FAERS: 17 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 27 | Erythema | FAERS: 17 | SIDER US FAERS | |
| 28 | Chills | FAERS: 16 | US FAERS | |
| 29 | Urticaria | FAERS: 16 | 16360237 | CTD SIDER US FAERS |
| 30 | White blood cell count decreased | FAERS: 16 | SIDER US FAERS | |
| 31 | Stomatitis | FAERS: 15 | SIDER US FAERS | |
| 32 | Chest Pain | FAERS: 14 | SIDER US FAERS | |
| 33 | Leukopenia | FAERS: 14 | 19720897 | CTD SIDER US FAERS |
| 34 | Pruritus | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 35 | Flushing | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 36 | Loss of personal independence in daily activities | FAERS: 12 | US FAERS | |
| 37 | Pulmonary Embolism | FAERS: 12 | SIDER US FAERS | |
| 38 | Toxicity to various agents | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Alanine Aminotransferase Increased | FAERS: 11 | SIDER US FAERS | |
| 40 | Atrial Fibrillation | FAERS: 11 | US FAERS | |
| 41 | Deep Vein Thrombosis | FAERS: 11 | US FAERS | |
| 42 | Pericardial effusion | FAERS: 11 | OFFSIDES US FAERS | |
| 43 | Abdominal Pain | FAERS: 10 | SIDER US FAERS | |
| 44 | Chest discomfort | FAERS: 10 | US FAERS | |
| 45 | Creatinine renal clearance decreased | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 46 | Hypersensitivity | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 47 | Joint swelling | FAERS: 10 | US FAERS | |
| 48 | Conjunctivitis | FAERS: 9 | SIDER US FAERS | |
| 49 | Constipation | FAERS: 9 | SIDER US FAERS | |
| 50 | Epistaxis | FAERS: 9 | OFFSIDES US FAERS | |
| 51 | Headache | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Aspartate Aminotransferase Increased | FAERS: 8 | SIDER US FAERS | |
| 53 | Blood count abnormal | FAERS: 8 | OFFSIDES US FAERS | |
| 54 | Colitis | FAERS: 8 | SIDER US FAERS | |
| 55 | Disseminated Intravascular Coagulation | FAERS: 8 | OFFSIDES US FAERS | |
| 56 | Drug ineffective | FAERS: 8 | US FAERS | |
| 57 | Haematotoxicity | FAERS: 8 | OFFSIDES US FAERS | |
| 58 | Sepsis | FAERS: 8 | SIDER US FAERS | |
| 59 | Tachycardia | FAERS: 8 | US FAERS | |
| 60 | Weight decreased | FAERS: 8 | US FAERS | |
| 61 | Anorexia | FAERS: 7 | OFFSIDES SIDER US FAERS | |
| 62 | Cardiac Arrest | FAERS: 7 | US FAERS | |
| 63 | Cerebral Infarction | FAERS: 7 | US FAERS | |
| 64 | Peripheral swelling | FAERS: 7 | US FAERS | |
| 65 | Recall phenomenon | FAERS: 7 | OFFSIDES US FAERS | |
| 66 | Respiratory distress | FAERS: 7 | US FAERS | |
| 67 | Septic Shock | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 68 | Syncope | FAERS: 7 | SIDER US FAERS | |
| 69 | Accidental exposure to product | FAERS: 6 | US FAERS | |
| 70 | Accidental exposure | FAERS: 6 | US FAERS | |
| 71 | Feeling abnormal | FAERS: 6 | US FAERS | |
| 72 | Gamma-Glutamyltransferase Increased | FAERS: 6 | SIDER US FAERS | |
| 73 | Hypophagia | FAERS: 6 | OFFSIDES US FAERS | |
| 74 | Intestinal Perforation | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 75 | Nephrogenic Diabetes Insipidus | FAERS: 6 | OFFSIDES US FAERS | |
| 76 | Pancreatitis | FAERS: 6 | SIDER US FAERS | |
| 77 | Pulmonary Fibrosis | FAERS: 6 | US FAERS | |
| 78 | Tremor | FAERS: 6 | US FAERS | |
| 79 | Vasculitis | FAERS: 6 | 16360237 | CTD US FAERS |
| 80 | Acute myocardial infarction | FAERS: 5 | US FAERS | |
| 81 | Arthralgia | FAERS: 5 | SIDER US FAERS | |
| 82 | Back Pain | FAERS: 5 | US FAERS | |
| 83 | Blood alkaline phosphatase increased | FAERS: 5 | US FAERS | |
| 84 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 85 | Dermatitis | FAERS: 5 | SIDER US FAERS | |
| 86 | Drug dose omission | FAERS: 5 | US FAERS | |
| 87 | Extravasation | FAERS: 5 | US FAERS | |
| 88 | Febrile bone marrow aplasia | FAERS: 5 | OFFSIDES US FAERS | |
| 89 | Inflammation | FAERS: 5 | US FAERS | |
| 90 | Neutropenic sepsis | FAERS: 5 | OFFSIDES US FAERS | |
| 91 | Performance status decreased | FAERS: 5 | OFFSIDES US FAERS | |
| 92 | Skin toxicity | FAERS: 5 | OFFSIDES US FAERS | |
| 93 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 94 | Agranulocytosis | FAERS: 4 | SIDER US FAERS | |
| 95 | Alopecia | FAERS: 4 | SIDER US FAERS | |
| 96 | Anaphylactic shock | FAERS: 4 | SIDER US FAERS | |
| 97 | Ascites | FAERS: 4 | US FAERS | |
| 98 | Atrial Flutter | FAERS: 4 | OFFSIDES US FAERS | |
| 99 | Blood magnesium decreased | FAERS: 4 | OFFSIDES US FAERS | |
| 100 | Blood urea increased | FAERS: 4 | OFFSIDES US FAERS | |
| 101 | Cholestasis | FAERS: 4 | US FAERS | |
| 102 | Dysarthria | FAERS: 4 | US FAERS | |
| 103 | Dysgeusia | FAERS: 4 | SIDER US FAERS | |
| 104 | Failure to Thrive | FAERS: 4 | OFFSIDES US FAERS | |
| 105 | Gastrointestinal toxicity | FAERS: 4 | OFFSIDES US FAERS | |
| 106 | Leukocytosis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 107 | Medication Error | FAERS: 4 | US FAERS | |
| 108 | Mental status changes | FAERS: 4 | OFFSIDES US FAERS | |
| 109 | Oropharyngeal pain | FAERS: 4 | US FAERS | |
| 110 | Pulmonary toxicity | FAERS: 4 | OFFSIDES US FAERS | |
| 111 | Purpura | FAERS: 4 | US FAERS | |
| 112 | Radiation Pneumonitis | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 113 | Rash erythematous | FAERS: 4 | US FAERS | |
| 114 | Scleroderma | FAERS: 4 | OFFSIDES US FAERS | |
| 115 | Skin reaction | FAERS: 4 | US FAERS | |
| 116 | Thrombosis | FAERS: 4 | SIDER US FAERS | |
| 117 | Toxic Epidermal Necrolysis | FAERS: 4 | SIDER US FAERS | |
| 118 | jaundice | FAERS: 4 | US FAERS | |
| 119 | Abasia | FAERS: 3 | US FAERS | |
| 120 | Anal Ulcer | FAERS: 3 | US FAERS | |
| 121 | Anxiety | FAERS: 3 | US FAERS | |
| 122 | Aphasia | FAERS: 3 | US FAERS | |
| 123 | Ataxia | FAERS: 3 | US FAERS | |
| 124 | Blindness | FAERS: 3 | US FAERS | |
| 125 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 126 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 127 | Bronchopneumonia | FAERS: 3 | OFFSIDES US FAERS | |
| 128 | Capillary Leak Syndrome | FAERS: 3 | US FAERS | |
| 129 | Carcinoembryonic antigen increased | FAERS: 3 | US FAERS | |
| 130 | Cytopenia | FAERS: 3 | US FAERS | |
| 131 | Deafness | FAERS: 3 | US FAERS | |
| 132 | Drug toxicity | FAERS: 3 | OFFSIDES US FAERS | |
| 133 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 134 | Escherichia urinary tract infection | FAERS: 3 | OFFSIDES US FAERS | |
| 135 | Hepatitis | FAERS: 3 | SIDER US FAERS | |
| 136 | Hepatotoxicity | FAERS: 3 | US FAERS | |
| 137 | Hydrocephalus | FAERS: 3 | US FAERS | |
| 138 | Hyperpyrexia | FAERS: 3 | US FAERS | |
| 139 | Hypoxia | FAERS: 3 | OFFSIDES US FAERS | |
| 140 | Lethargy | FAERS: 3 | US FAERS | |
| 141 | Lip swelling | FAERS: 3 | US FAERS | |
| 142 | MYELODYSPLASTIC SYNDROME | FAERS: 3 | US FAERS | |
| 143 | Nasopharyngitis | FAERS: 3 | US FAERS | |
| 144 | Oliguria | FAERS: 3 | US FAERS | |
| 145 | Oropharyngeal candidiasis | FAERS: 3 | OFFSIDES US FAERS | |
| 146 | Presyncope | FAERS: 3 | US FAERS | |
| 147 | Productive Cough | FAERS: 3 | US FAERS | |
| 148 | Stevens-Johnson Syndrome | FAERS: 3 | 25811541 | CTD SIDER US FAERS |
| 149 | Sudden death | FAERS: 3 | OFFSIDES US FAERS | |
| 150 | Supraventricular tachycardia | FAERS: 3 | OFFSIDES US FAERS | |
| 151 | Urinary tract infection | FAERS: 3 | US FAERS | |
| 152 | Vertigo | FAERS: 3 | US FAERS | |
| 153 | pseudomembranous colitis | FAERS: 3 | US FAERS | |
| 154 | Acute Coronary Syndrome | FAERS: 2 | SIDER US FAERS | |
| 155 | Acute respiratory failure | FAERS: 2 | US FAERS | |
| 156 | Adenocarcinoma | FAERS: 2 | US FAERS | |
| 157 | Adverse event | FAERS: 2 | US FAERS | |
| 158 | Agitation | FAERS: 2 | US FAERS | |
| 159 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 160 | Amnesia | FAERS: 2 | US FAERS | |
| 161 | Angioedema | FAERS: 2 | US FAERS | |
| 162 | Aphthous Stomatitis | FAERS: 2 | US FAERS | |
| 163 | Atelectasis | FAERS: 2 | OFFSIDES US FAERS | |
| 164 | Bedridden | FAERS: 2 | US FAERS | |
| 165 | Blood albumin decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 166 | Blood creatine increased | FAERS: 2 | OFFSIDES US FAERS | |
| 167 | Blood lactate dehydrogenase increased | FAERS: 2 | OFFSIDES US FAERS | |
| 168 | Bone pain | FAERS: 2 | US FAERS | |
| 169 | Bronchial Obstruction | FAERS: 2 | OFFSIDES US FAERS | |
| 170 | Bronchospasm | FAERS: 2 | US FAERS | |
| 171 | Campylobacter infection | FAERS: 2 | OFFSIDES US FAERS | |
| 172 | Candida pneumonia | FAERS: 2 | OFFSIDES US FAERS | |
| 173 | Candida sepsis | FAERS: 2 | US FAERS | |
| 174 | Candidiasis | FAERS: 2 | US FAERS | |
| 175 | Chromaturia | FAERS: 2 | US FAERS | |
| 176 | Creatinine renal clearance increased | FAERS: 2 | US FAERS | |
| 177 | Cyanosis | FAERS: 2 | US FAERS | |
| 178 | Cystitis | FAERS: 2 | US FAERS | |
| 179 | Cytolytic hepatitis | FAERS: 2 | US FAERS | |
| 180 | Dacryostenosis acquired | FAERS: 2 | US FAERS | |
| 181 | Dementia | FAERS: 2 | US FAERS | |
| 182 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 183 | Dermo-hypodermitis | FAERS: 2 | US FAERS | |
| 184 | Discomfort | FAERS: 2 | US FAERS | |
| 185 | Disease recurrence | FAERS: 2 | US FAERS | |
| 186 | Dysphasia | FAERS: 2 | OFFSIDES US FAERS | |
| 187 | Ejection Fraction Decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 188 | Enterocolitis | FAERS: 2 | OFFSIDES US FAERS | |
| 189 | Enzyme abnormality | FAERS: 2 | US FAERS | |
| 190 | Erysipelas | FAERS: 2 | OFFSIDES US FAERS | |
| 191 | Extremity necrosis | FAERS: 2 | OFFSIDES SIDER US FAERS | |
| 192 | Fracture | FAERS: 2 | US FAERS | |
| 193 | Gangrene | FAERS: 2 | OFFSIDES US FAERS | |
| 194 | Gastritis | FAERS: 2 | US FAERS | |
| 195 | Gout | FAERS: 2 | US FAERS | |
| 196 | Herpes Zoster Oticus | FAERS: 2 | US FAERS | |
| 197 | Hypersomnia | FAERS: 2 | US FAERS | |
| 198 | Incontinence | FAERS: 2 | US FAERS | |
| 199 | Incorrect dose administered | FAERS: 2 | US FAERS | |
| 200 | Incorrect drug administration duration | FAERS: 2 | US FAERS | |
| 201 | Infusion Site Extravasation | FAERS: 2 | US FAERS | |
| 202 | Intestinal Obstruction | FAERS: 2 | OFFSIDES US FAERS | |
| 203 | Keratitis | FAERS: 2 | US FAERS | |
| 204 | Leukoencephalopathy | FAERS: 2 | US FAERS | |
| 205 | Lung consolidation | FAERS: 2 | OFFSIDES US FAERS | |
| 206 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 207 | Memory impairment | FAERS: 2 | US FAERS | |
| 208 | Mixed hepatocellular-cholestatic injury | FAERS: 2 | US FAERS | |
| 209 | Myoclonus | FAERS: 2 | US FAERS | |
| 210 | Necrosis | FAERS: 2 | US FAERS | |
| 211 | Neutropenic infection | FAERS: 2 | OFFSIDES US FAERS | |
| 212 | Neutrophil count decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 213 | No adverse event | FAERS: 2 | US FAERS | |
| 214 | Occupational exposure to product | FAERS: 2 | US FAERS | |
| 215 | Overdose | FAERS: 2 | US FAERS | |
| 216 | Pallor | FAERS: 2 | US FAERS | |
| 217 | Pericarditis | FAERS: 2 | OFFSIDES US FAERS | |
| 218 | Personality Change | FAERS: 2 | US FAERS | |
| 219 | Platelet count abnormal | FAERS: 2 | OFFSIDES US FAERS | |
| 220 | Pleuritic pain | FAERS: 2 | US FAERS | |
| 221 | Quadriplegia | FAERS: 2 | US FAERS | |
| 222 | Radiation interaction | FAERS: 2 | OFFSIDES US FAERS | |
| 223 | Rales | FAERS: 2 | US FAERS | |
| 224 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 225 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 226 | Skin Ulcer | FAERS: 2 | US FAERS | |
| 227 | Skin necrosis | FAERS: 2 | US FAERS | |
| 228 | Somnolence | FAERS: 2 | US FAERS | |
| 229 | Suicide attempt | FAERS: 2 | US FAERS | |
| 230 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 231 | Thoracic cavity drainage | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 232 | Throat irritation | FAERS: 2 | US FAERS | |
| 233 | Thrombocytosis | FAERS: 2 | US FAERS | |
| 234 | Thrombophlebitis | FAERS: 2 | OFFSIDES US FAERS | |
| 235 | Tinnitus | FAERS: 2 | US FAERS | |
| 236 | Transaminases increased | FAERS: 2 | US FAERS | |
| 237 | Transmission of an infectious agent via a medicinal product | FAERS: 2 | US FAERS | |
| 238 | Urinary Incontinence | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 239 | Varicella Zoster Virus Infection | FAERS: 2 | US FAERS | |
| 240 | Wheezing | FAERS: 2 | US FAERS | |
| 241 | nervous system disorder | FAERS: 2 | SIDER US FAERS | |
| 242 | Abscess | FAERS: 1 | US FAERS | |
| 243 | Abulia | FAERS: 1 | US FAERS | |
| 244 | Accidental overdose | FAERS: 1 | US FAERS | |
| 245 | Alveolitis | FAERS: 1 | OFFSIDES US FAERS | |
| 246 | Ammonia increased | FAERS: 1 | US FAERS | |
| 247 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 248 | Angina Pectoris | FAERS: 1 | SIDER US FAERS | |
| 249 | Aortic Aneurysm | FAERS: 1 | US FAERS | |
| 250 | Arterial thrombosis | FAERS: 1 | OFFSIDES US FAERS | |
| 251 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 252 | Aspergillosis | FAERS: 1 | OFFSIDES US FAERS | |
| 253 | Asthenopia | FAERS: 1 | US FAERS | |
| 254 | Atypical mycobacterial pneumonia | FAERS: 1 | US FAERS | |
| 255 | Bacterial disease carrier | FAERS: 1 | US FAERS | |
| 256 | Blood chloride increased | FAERS: 1 | US FAERS | |
| 257 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 258 | Blood creatinine abnormal | FAERS: 1 | US FAERS | |
| 259 | Blood electrolytes abnormal | FAERS: 1 | US FAERS | |
| 260 | Blood electrolytes decreased | FAERS: 1 | US FAERS | |
| 261 | Blood folate abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 262 | Blood urea abnormal | FAERS: 1 | US FAERS | |
| 263 | Blood urine present | FAERS: 1 | US FAERS | |
| 264 | Bone marrow toxicity | FAERS: 1 | US FAERS | |
| 265 | Bronchitis fungal | FAERS: 1 | US FAERS | |
| 266 | Bronchoalveolar lavage abnormal | FAERS: 1 | US FAERS | |
| 267 | Cachexia | FAERS: 1 | US FAERS | |
| 268 | Cancer Pain | FAERS: 1 | OFFSIDES US FAERS | |
| 269 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 270 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 271 | Cataract | FAERS: 1 | US FAERS | |
| 272 | Catheter site abscess | FAERS: 1 | US FAERS | |
| 273 | Catheter site cellulitis | FAERS: 1 | US FAERS | |
| 274 | Catheter site phlebitis | FAERS: 1 | US FAERS | |
| 275 | Cerebral atrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 276 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 277 | Cervix carcinoma stage IV | FAERS: 1 | US FAERS | |
| 278 | Cheilitis | FAERS: 1 | US FAERS | |
| 279 | Choking sensation | FAERS: 1 | OFFSIDES US FAERS | |
| 280 | Chorea | FAERS: 1 | US FAERS | |
| 281 | Conjunctival irritation | FAERS: 1 | US FAERS | |
| 282 | Corneal Opacity | FAERS: 1 | US FAERS | |
| 283 | Corneal dystrophy | FAERS: 1 | US FAERS | |
| 284 | Corneal lesion | FAERS: 1 | US FAERS | |
| 285 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 286 | Culture wound positive | FAERS: 1 | US FAERS | |
| 287 | Cytology abnormal | FAERS: 1 | US FAERS | |
| 288 | Cytoreductive Surgery | FAERS: 1 | US FAERS | |
| 289 | Deafness Neurosensory | FAERS: 1 | US FAERS | |
| 290 | Delirium | FAERS: 1 | US FAERS | |
| 291 | Depressed mood | FAERS: 1 | US FAERS | |
| 292 | Device related infection | FAERS: 1 | US FAERS | |
| 293 | Diabetes Insipidus | FAERS: 1 | OFFSIDES US FAERS | |
| 294 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 295 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 296 | Diet refusal | FAERS: 1 | US FAERS | |
| 297 | Diffuse alveolar damage | FAERS: 1 | US FAERS | |
| 298 | Disease complication | FAERS: 1 | US FAERS | |
| 299 | Diverticular perforation | FAERS: 1 | OFFSIDES US FAERS | |
| 300 | Drooling | FAERS: 1 | US FAERS | |
| 301 | Dry gangrene | FAERS: 1 | US FAERS | |
| 302 | Dry skin | FAERS: 1 | US FAERS | |
| 303 | Duodenitis | FAERS: 1 | US FAERS | |
| 304 | Dysgraphia | FAERS: 1 | US FAERS | |
| 305 | Dyspepsia | FAERS: 1 | SIDER US FAERS | |
| 306 | Dysphonia | FAERS: 1 | US FAERS | |
| 307 | Dysuria | FAERS: 1 | US FAERS | |
| 308 | Early satiety | FAERS: 1 | US FAERS | |
| 309 | Emotional distress | FAERS: 1 | US FAERS | |
| 310 | Endocarditis | FAERS: 1 | OFFSIDES US FAERS | |
| 311 | Endothelial dysfunction | FAERS: 1 | US FAERS | |
| 312 | Enteritis | FAERS: 1 | OFFSIDES US FAERS | |
| 313 | Epidermal growth factor receptor decreased | FAERS: 1 | US FAERS | |
| 314 | Epidermolysis | FAERS: 1 | OFFSIDES US FAERS | |
| 315 | Erosive Duodenitis | FAERS: 1 | US FAERS | |
| 316 | Exfoliative rash | FAERS: 1 | US FAERS | |
| 317 | Eye irritation | FAERS: 1 | US FAERS | |
| 318 | Eye pain | FAERS: 1 | US FAERS | |
| 319 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 320 | Fibrosis | FAERS: 1 | US FAERS | |
| 321 | Full blood count decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 322 | Gastric ulcer | FAERS: 1 | US FAERS | |
| 323 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 324 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 325 | General symptom | FAERS: 1 | US FAERS | |
| 326 | Gingival Recession | FAERS: 1 | US FAERS | |
| 327 | Gingivitis | FAERS: 1 | US FAERS | |
| 328 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 329 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 330 | Helicobacter pylori identification test positive | FAERS: 1 | US FAERS | |
| 331 | Hemiparesis | FAERS: 1 | US FAERS | |
| 332 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 333 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 334 | Hydropneumothorax | FAERS: 1 | OFFSIDES US FAERS | |
| 335 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 336 | Hypertransaminasaemia | FAERS: 1 | US FAERS | |
| 337 | Hypertrichosis | FAERS: 1 | US FAERS | |
| 338 | Hypokinesia | FAERS: 1 | US FAERS | |
| 339 | Idiopathic Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 340 | Ileal Fistula | FAERS: 1 | US FAERS | |
| 341 | Ileus | FAERS: 1 | US FAERS | |
| 342 | Implant site inflammation | FAERS: 1 | US FAERS | |
| 343 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 344 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 345 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 346 | Infusion site pain | FAERS: 1 | US FAERS | |
| 347 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 348 | Injection Site Reaction | FAERS: 1 | US FAERS | |
| 349 | Injection site extravasation | FAERS: 1 | US FAERS | |
| 350 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 351 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 352 | Limb mass | FAERS: 1 | US FAERS | |
| 353 | Loose tooth | FAERS: 1 | US FAERS | |
| 354 | Lymphangiosis carcinomatosa | FAERS: 1 | OFFSIDES US FAERS | |
| 355 | Lymphoma | FAERS: 1 | US FAERS | |
| 356 | Malnutrition | FAERS: 1 | SIDER US FAERS | |
| 357 | Meningitis | FAERS: 1 | US FAERS | |
| 358 | Mesothelioma | FAERS: 1 | CTD OFFSIDES SIDER US FAERS | |
| 359 | Metastases to adrenals | FAERS: 1 | OFFSIDES US FAERS | |
| 360 | Metastasis | FAERS: 1 | US FAERS | |
| 361 | Mineral deficiency | FAERS: 1 | US FAERS | |
| 362 | Mitochondrial aspartate aminotransferase increased | FAERS: 1 | US FAERS | |
| 363 | Monoparesis | FAERS: 1 | US FAERS | |
| 364 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 365 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 366 | Myalgia | FAERS: 1 | SIDER US FAERS | |
| 367 | Mydriasis | FAERS: 1 | US FAERS | |
| 368 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 369 | Nephritis | FAERS: 1 | US FAERS | |
| 370 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 371 | Nerve injury | FAERS: 1 | US FAERS | |
| 372 | Neuralgia | FAERS: 1 | US FAERS | |
| 373 | Night sweats | FAERS: 1 | US FAERS | |
| 374 | Nodule | FAERS: 1 | US FAERS | |
| 375 | Non-cardiac chest pain | FAERS: 1 | OFFSIDES US FAERS | |
| 376 | Non-small cell lung cancer recurrent | FAERS: 1 | OFFSIDES US FAERS | |
| 377 | Nystagmus | FAERS: 1 | US FAERS | |
| 378 | Obstruction | FAERS: 1 | OFFSIDES US FAERS | |
| 379 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 380 | Oligodipsia | FAERS: 1 | US FAERS | |
| 381 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 382 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 383 | Oral fungal infection | FAERS: 1 | US FAERS | |
| 384 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 385 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 386 | Oropharyngitis fungal | FAERS: 1 | US FAERS | |
| 387 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 388 | Oxygen consumption increased | FAERS: 1 | OFFSIDES US FAERS | |
| 389 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 390 | Paracentesis | FAERS: 1 | US FAERS | |
| 391 | Pathological fracture | FAERS: 1 | US FAERS | |
| 392 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 393 | Pericarditis malignant | FAERS: 1 | US FAERS | |
| 394 | Peripheral arterial occlusive disease | FAERS: 1 | US FAERS | |
| 395 | Peripheral artery thrombosis | FAERS: 1 | US FAERS | |
| 396 | Perivascular dermatitis | FAERS: 1 | US FAERS | |
| 397 | Petechiae | FAERS: 1 | US FAERS | |
| 398 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 399 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 400 | Pneumocystis jiroveci pneumonia | FAERS: 1 | US FAERS | |
| 401 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 402 | Pneumothorax | FAERS: 1 | OFFSIDES US FAERS | |
| 403 | Poisoning | FAERS: 1 | US FAERS | |
| 404 | Polyneuropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 405 | Post procedural complication | FAERS: 1 | US FAERS | |
| 406 | Post procedural discomfort | FAERS: 1 | US FAERS | |
| 407 | Protein urine present | FAERS: 1 | US FAERS | |
| 408 | Proteinuria | FAERS: 1 | 19433684 | CTD US FAERS |
| 409 | Prothrombin time ratio decreased | FAERS: 1 | US FAERS | |
| 410 | Pseudomonal sepsis | FAERS: 1 | OFFSIDES US FAERS | |
| 411 | Psoriasis | FAERS: 1 | US FAERS | |
| 412 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 413 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 414 | Radiation injury | FAERS: 1 | US FAERS | |
| 415 | Radiation skin injury | FAERS: 1 | US FAERS | |
| 416 | Renal Artery Stenosis | FAERS: 1 | US FAERS | |
| 417 | Renal tubular acidosis | FAERS: 1 | US FAERS | |
| 418 | Renal tubular disorder | FAERS: 1 | US FAERS | |
| 419 | Renal tubular necrosis | FAERS: 1 | OFFSIDES US FAERS | |
| 420 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 421 | Retching | FAERS: 1 | US FAERS | |
| 422 | Rhinitis | FAERS: 1 | US FAERS | |
| 423 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 424 | Shock | FAERS: 1 | SIDER US FAERS | |
| 425 | Silicosis | FAERS: 1 | US FAERS | |
| 426 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 427 | Skin irritation | FAERS: 1 | US FAERS | |
| 428 | Skin lesion | FAERS: 1 | US FAERS | |
| 429 | Skin tightness | FAERS: 1 | US FAERS | |
| 430 | Sodium retention | FAERS: 1 | US FAERS | |
| 431 | Sputum culture positive | FAERS: 1 | OFFSIDES US FAERS | |
| 432 | Stent malfunction | FAERS: 1 | US FAERS | |
| 433 | Subileus | FAERS: 1 | US FAERS | |
| 434 | Swelling | FAERS: 1 | US FAERS | |
| 435 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 436 | Tetany | FAERS: 1 | US FAERS | |
| 437 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 438 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 439 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 440 | Tooth Loss | FAERS: 1 | US FAERS | |
| 441 | Toxic Shock Syndrome | FAERS: 1 | US FAERS | |
| 442 | Tumour haemorrhage | FAERS: 1 | US FAERS | |
| 443 | Unevaluable event | FAERS: 1 | US FAERS | |
| 444 | Unresponsive to stimuli | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 445 | Urinary Retention | FAERS: 1 | US FAERS | |
| 446 | Urticarial vasculitis | FAERS: 1 | US FAERS | |
| 447 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 448 | Uveitis | FAERS: 1 | US FAERS | |
| 449 | Varicophlebitis | FAERS: 1 | US FAERS | |
| 450 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 451 | Visual Impairment | FAERS: 1 | US FAERS | |
| 452 | Visual disturbance | FAERS: 1 | US FAERS | |
| 453 | Vitamin B12 abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 454 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 455 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 456 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 457 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 458 | prostatitis | FAERS: 1 | US FAERS | |
| 459 | treatment failure | FAERS: 1 | US FAERS | |
| 460 | venipuncture | FAERS: 1 | US FAERS | |
| 461 | Abdominal Abscess | OFFSIDES | ||
| 462 | Activated partial thromboplastin time shortened | OFFSIDES | ||
| 463 | Acute glomerulonephritis | OFFSIDES | ||
| 464 | Acute left ventricular failure | OFFSIDES | ||
| 465 | Amaurosis Fugax | OFFSIDES | ||
| 466 | Amyloidosis | OFFSIDES | ||
| 467 | Anal Fistula | OFFSIDES | ||
| 468 | Analgesic drug level increased | OFFSIDES | ||
| 469 | Anemia | 19433684 19720897 | CTD | |
| 470 | Aneurysm | OFFSIDES | ||
| 471 | Anisocoria | OFFSIDES | ||
| 472 | Arterial Occlusive Diseases | 19433684 | CTD | |
| 473 | Aspiration Pneumonia | OFFSIDES | ||
| 474 | Bacteria blood identified | OFFSIDES | ||
| 475 | Bacteria wound identified | OFFSIDES | ||
| 476 | Bacterial pyelonephritis | OFFSIDES | ||
| 477 | Blepharitis | OFFSIDES | ||
| 478 | Blood albumin abnormal | OFFSIDES | ||
| 479 | Blood and lymphatic system disorders | SIDER | ||
| 480 | Blood bilirubin abnormal | OFFSIDES | ||
| 481 | Blood chloride decreased | OFFSIDES | ||
| 482 | Blood cholinesterase decreased | OFFSIDES | ||
| 483 | Blood creatinine decreased | OFFSIDES SIDER | ||
| 484 | Blood fibrinogen increased | OFFSIDES | ||
| 485 | Blood pH decreased | OFFSIDES | ||
| 486 | Blood sodium | OFFSIDES | ||
| 487 | Bone Marrow Diseases | 14581433 | CTD | |
| 488 | Bone fragmentation | OFFSIDES | ||
| 489 | Bone marrow depression | OFFSIDES | ||
| 490 | Bone trimming | OFFSIDES | ||
| 491 | Bronchial Fistula | OFFSIDES | ||
| 492 | Bronchial secretion retention | OFFSIDES | ||
| 493 | Bronchopleural Fistula | OFFSIDES | ||
| 494 | Bullous conditions | SIDER | ||
| 495 | Carotid Artery Thrombosis | OFFSIDES | ||
| 496 | Catheter sepsis | OFFSIDES | ||
| 497 | Catheter site infection | OFFSIDES | ||
| 498 | Cerebellar Ataxia | OFFSIDES | ||
| 499 | Colonic Stenosis | OFFSIDES | ||
| 500 | Conjunctival deposit | OFFSIDES | ||
| 501 | Creatinine increased | SIDER | ||
| 502 | Creatinine low | SIDER | ||
| 503 | Cytokine Release Syndrome | OFFSIDES | ||
| 504 | Debridement | OFFSIDES | ||
| 505 | Diverticulitis | 19433684 | CTD OFFSIDES | |
| 506 | Diverticulosis | OFFSIDES | ||
| 507 | Electrocardiogram ST segment abnormal | OFFSIDES | ||
| 508 | Electrocardiogram poor R-wave progression | OFFSIDES | ||
| 509 | Embolic cerebral infarction | OFFSIDES | ||
| 510 | Embolism | OFFSIDES SIDER | ||
| 511 | Empyema | OFFSIDES | ||
| 512 | Endophthalmitis | OFFSIDES | ||
| 513 | Erythema Multiforme | SIDER | ||
| 514 | Esophagitis | 21415776 | CTD | |
| 515 | Exanthema | 16360237 | CTD | |
| 516 | Feeding tube complication | OFFSIDES | ||
| 517 | Foreign body aspiration | OFFSIDES | ||
| 518 | Gastrointestinal Pain | SIDER | ||
| 519 | Gastrointestinal amyloidosis | OFFSIDES | ||
| 520 | Gastrointestinal obstruction | SIDER | ||
| 521 | Gastrointestinal perforation | OFFSIDES | ||
| 522 | Granulocyte count decreased | OFFSIDES | ||
| 523 | Granulocyte count increased | OFFSIDES | ||
| 524 | Growth of eyelashes | OFFSIDES | ||
| 525 | Heartburn | SIDER | ||
| 526 | Hepatic cancer metastatic | SIDER | ||
| 527 | Herpes simplex serology positive | OFFSIDES | ||
| 528 | Hiccough | OFFSIDES | ||
| 529 | Hypercapnia | OFFSIDES | ||
| 530 | Hyperpigmentation | OFFSIDES | ||
| 531 | Hypertensive emergency | OFFSIDES | ||
| 532 | Ileitis | OFFSIDES | ||
| 533 | Infestation | SIDER | ||
| 534 | Intestinal necrosis | SIDER | ||
| 535 | Kidney Diseases | 19433684 | CTD | |
| 536 | Kidney Failure | OFFSIDES | ||
| 537 | Laboratory test interference | OFFSIDES | ||
| 538 | Lactobacillus infection | OFFSIDES | ||
| 539 | Large intestine perforation | OFFSIDES | ||
| 540 | Leukopenia neonatal | OFFSIDES | ||
| 541 | Lymphedema | OFFSIDES | ||
| 542 | Lymphocyte count decreased | OFFSIDES | ||
| 543 | Malignant Hypertension | OFFSIDES | ||
| 544 | Malignant neoplasm of spinal cord | OFFSIDES | ||
| 545 | Mallory-Weiss Syndrome | OFFSIDES | ||
| 546 | Malocclusion | OFFSIDES | ||
| 547 | Markedly reduced dietary intake | OFFSIDES | ||
| 548 | Mastication disorder | OFFSIDES | ||
| 549 | Mediastinal Fibrosis | OFFSIDES | ||
| 550 | Mediastinal mass | OFFSIDES | ||
| 551 | Mediastinitis | OFFSIDES | ||
| 552 | Mesothelioma malignant advanced | OFFSIDES | ||
| 553 | Mesothelioma malignant recurrent | OFFSIDES | ||
| 554 | Metastases to muscle | OFFSIDES | ||
| 555 | Metastatic pain | OFFSIDES | ||
| 556 | Monocyte percentage decreased | OFFSIDES | ||
| 557 | Mood swings | SIDER | ||
| 558 | Musculoskeletal discomfort | SIDER | ||
| 559 | Neuritis | SIDER | ||
| 560 | Neuropathic pain | OFFSIDES | ||
| 561 | Neuropathy | SIDER | ||
| 562 | Neutrophil count abnormal | OFFSIDES | ||
| 563 | No adverse effect | OFFSIDES | ||
| 564 | Ocular surface disease | SIDER | ||
| 565 | Oncologic complication | OFFSIDES | ||
| 566 | Optic nerve infarction | OFFSIDES | ||
| 567 | Ototoxicity | OFFSIDES | ||
| 568 | PCO2 increased | OFFSIDES | ||
| 569 | PO2 decreased | OFFSIDES | ||
| 570 | Panniculitis | OFFSIDES | ||
| 571 | Peridiverticular abscess | OFFSIDES | ||
| 572 | Peripheral embolism | OFFSIDES | ||
| 573 | Peripheral motor neuropathy | SIDER | ||
| 574 | Peritonitis | OFFSIDES | ||
| 575 | Pharyngitis | SIDER | ||
| 576 | Phlebitis | OFFSIDES | ||
| 577 | Photodermatosis | OFFSIDES | ||
| 578 | Pleural Mesothelioma | OFFSIDES | ||
| 579 | Pleurisy | OFFSIDES | ||
| 580 | Portal venous gas | OFFSIDES | ||
| 581 | Proctitis | OFFSIDES | ||
| 582 | Protein total decreased | OFFSIDES | ||
| 583 | Protein total increased | OFFSIDES | ||
| 584 | Pulmonary artery thrombosis | OFFSIDES | ||
| 585 | Pulmonary necrosis | OFFSIDES | ||
| 586 | Radiation Fibrosis | OFFSIDES | ||
| 587 | Respiratory Insufficiency | SIDER | ||
| 588 | Retroperitoneal lymphadenopathy | OFFSIDES | ||
| 589 | Scleromalacia | OFFSIDES | ||
| 590 | Septic embolus | OFFSIDES | ||
| 591 | Splenic Infarction | OFFSIDES | ||
| 592 | Staphylococcal abscess | OFFSIDES | ||
| 593 | Starvation | OFFSIDES | ||
| 594 | Stasis dermatitis | OFFSIDES | ||
| 595 | Status Epilepticus | OFFSIDES | ||
| 596 | Stomach Neoplasms | 15958060 | CTD | |
| 597 | Subcutaneous Emphysema | OFFSIDES | ||
| 598 | Superior Vena Cava Syndrome | OFFSIDES | ||
| 599 | Tracheobronchitis | OFFSIDES | ||
| 600 | Venous Thrombosis | 19433684 | CTD | |
| 601 | Ventricular Flutter | OFFSIDES | ||
| 602 | Vestibular Neuronitis | OFFSIDES | ||
| 603 | Wound abscess | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.