zolmitriptan
(ULSDMUVEXKOYBU-ZDUSSCGKSA-N)
Structure
- SMILES
- CN(CCc1c[nH]c2c1cc(C[C@H]1COC(=O)N1)cc2)C
- Type(s)
- Approved; Investigational
- ATC code(s)
- N02CC03
- Molecular Formula:
- C16H21N3O2
- Molecular Weight:
- 287.357
- Log P:
- 2.2517
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 2
- TPSA:
- 57.36
- CAS Number(s):
- 139264-17-8; 139264-25-8
Synonym(s)
1.
zolmitriptan
2.
311C90
3.
4-((3-(2-(dimethylamino)ethyl)-1H-indol-5-yl)methyl)-2-oxazolidinone
4.
AscoTop
5.
Flezol
6.
Zomig
7.
Zomigoro
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug dose omission | FAERS: 240 | OFFSIDES US FAERS | |
| 2 | Headache | FAERS: 166 | SIDER US FAERS | |
| 3 | Drug ineffective | FAERS: 90 Canada Vigilance: 28 | Canada Vigilance US FAERS | |
| 4 | Malaise | FAERS: 81 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 5 | Vomiting | FAERS: 77 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 6 | Intentional drug misuse | FAERS: 58 | US FAERS | |
| 7 | Nausea | FAERS: 48 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 8 | Pain | FAERS: 48 | 15836966 16239765 | CTD OFFSIDES SIDER US FAERS |
| 9 | Feeling abnormal | FAERS: 32 | SIDER US FAERS | |
| 10 | Nasopharyngitis | FAERS: 29 | US FAERS | |
| 11 | Dizziness | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 12 | Fatigue | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 13 | Dysgeusia | FAERS: 19 | OFFSIDES SIDER US FAERS | |
| 14 | Incorrect dose administered | FAERS: 19 | US FAERS | |
| 15 | Chest discomfort | FAERS: 18 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 16 | Product quality issue | FAERS: 18 | US FAERS | |
| 17 | Arthralgia | FAERS: 17 | SIDER US FAERS | |
| 18 | Influenza | FAERS: 17 | SIDER US FAERS | |
| 19 | Intentional product misuse | FAERS: 17 | US FAERS | |
| 20 | Adverse event | FAERS: 16 | US FAERS | |
| 21 | Somnolence | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 22 | Myocardial Infarction | FAERS: 13 Canada Vigilance: 1 | 16464313 20159412 | CTD SIDER Canada Vigilance US FAERS |
| 23 | Activities of daily living impaired | FAERS: 12 | US FAERS | |
| 24 | Chest Pain | FAERS: 12 Canada Vigilance: 3 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 25 | Oropharyngeal pain | FAERS: 12 | SIDER US FAERS | |
| 26 | Sinusitis | FAERS: 12 | OFFSIDES SIDER US FAERS | |
| 27 | Stress | FAERS: 12 | OFFSIDES US FAERS | |
| 28 | Myalgia | FAERS: 11 | SIDER US FAERS | |
| 29 | Throat irritation | FAERS: 11 | US FAERS | |
| 30 | Cerebrovascular accident | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 31 | Memory impairment | FAERS: 10 | US FAERS | |
| 32 | Abdominal discomfort | FAERS: 9 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 33 | Product substitution issue | FAERS: 9 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 34 | Retching | FAERS: 9 | US FAERS | |
| 35 | Weight decreased | FAERS: 9 | US FAERS | |
| 36 | Asthenia | FAERS: 8 | SIDER US FAERS | |
| 37 | Cerebral Infarction | FAERS: 8 | US FAERS | |
| 38 | Hypersensitivity | FAERS: 8 | SIDER US FAERS | |
| 39 | Impaired work ability | FAERS: 8 | US FAERS | |
| 40 | Overdose | FAERS: 8 | US FAERS | |
| 41 | Toothache | FAERS: 8 | US FAERS | |
| 42 | Bronchitis | FAERS: 7 | SIDER US FAERS | |
| 43 | Cluster Headache | FAERS: 7 | US FAERS | |
| 44 | Palpitations | FAERS: 7 | SIDER US FAERS | |
| 45 | Atrial Fibrillation | FAERS: 6 | SIDER US FAERS | |
| 46 | Depressed mood | FAERS: 6 | OFFSIDES US FAERS | |
| 47 | Drug Dependence | FAERS: 6 | US FAERS | |
| 48 | Lip swelling | FAERS: 6 | US FAERS | |
| 49 | Multiple Sclerosis | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 50 | Muscle tightness | FAERS: 6 | OFFSIDES SIDER US FAERS | |
| 51 | Tachycardia | FAERS: 6 | SIDER US FAERS | |
| 52 | Toxicity to various agents | FAERS: 6 | US FAERS | |
| 53 | nervous system disorder | FAERS: 6 | SIDER US FAERS | |
| 54 | Burning sensation | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 55 | Disorientation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Drug administration error | FAERS: 5 | US FAERS | |
| 57 | Drug exposure during pregnancy | FAERS: 5 | OFFSIDES US FAERS | |
| 58 | Hypotension | FAERS: 5 | 9489607 | CTD US FAERS |
| 59 | Limb injury | FAERS: 5 | US FAERS | |
| 60 | Musculoskeletal stiffness | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 61 | Pruritus | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 62 | Therapeutic response unexpected | FAERS: 5 | US FAERS | |
| 63 | Tremor | FAERS: 5 | SIDER US FAERS | |
| 64 | Wrong drug administered | FAERS: 5 | US FAERS | |
| 65 | Wrong technique in drug usage process | FAERS: 5 | US FAERS | |
| 66 | Amnesia | FAERS: 4 | SIDER US FAERS | |
| 67 | Angina Pectoris | FAERS: 4 | SIDER US FAERS | |
| 68 | Aphasia | FAERS: 4 | US FAERS | |
| 69 | Bedridden | FAERS: 4 | OFFSIDES US FAERS | |
| 70 | Chills | FAERS: 4 | SIDER US FAERS | |
| 71 | Dehydration | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 72 | Discomfort | FAERS: 4 | SIDER US FAERS | |
| 73 | Drug dispensing error | FAERS: 4 | US FAERS | |
| 74 | Eye pain | FAERS: 4 | SIDER US FAERS | |
| 75 | Facial Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Fibromyalgia | FAERS: 4 | OFFSIDES US FAERS | |
| 77 | Flatulence | FAERS: 4 | US FAERS | |
| 78 | Joint injury | FAERS: 4 | US FAERS | |
| 79 | Lethargy | FAERS: 4 | US FAERS | |
| 80 | Maternal exposure during pregnancy | FAERS: 4 | US FAERS | |
| 81 | Medication overuse headache | FAERS: 4 | SIDER US FAERS | |
| 82 | Microphthalmos | FAERS: 4 | US FAERS | |
| 83 | Migraine with Aura | FAERS: 4 | US FAERS | |
| 84 | Nasal discomfort | FAERS: 4 | US FAERS | |
| 85 | Neck Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 86 | Nephrolithiasis | FAERS: 4 | OFFSIDES US FAERS | |
| 87 | Nervousness | FAERS: 4 | SIDER US FAERS | |
| 88 | Pneumonia | FAERS: 4 | SIDER US FAERS | |
| 89 | Product dose omission | FAERS: 4 | US FAERS | |
| 90 | Sinus headache | FAERS: 4 | US FAERS | |
| 91 | Sleep disorder due to general medical condition, insomnia type | FAERS: 4 | US FAERS | |
| 92 | Sneezing | FAERS: 4 | US FAERS | |
| 93 | Transaminases increased | FAERS: 4 | US FAERS | |
| 94 | Urticaria | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 95 | Vasospasm | FAERS: 4 | OFFSIDES SIDER US FAERS | |
| 96 | Abdominal Pain | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 97 | Anxiety | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 98 | Aphagia | FAERS: 3 | US FAERS | |
| 99 | Asthma | FAERS: 3 | OFFSIDES US FAERS | |
| 100 | Back Pain | FAERS: 3 | SIDER US FAERS | |
| 101 | Carotid artery occlusion | FAERS: 3 | OFFSIDES US FAERS | |
| 102 | Circumstance or information capable of leading to medication error | FAERS: 3 | US FAERS | |
| 103 | Disability | FAERS: 3 | US FAERS | |
| 104 | Drug abuse | FAERS: 3 | US FAERS | |
| 105 | Drug effect incomplete | FAERS: 3 | US FAERS | |
| 106 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 107 | Epilepsy | FAERS: 3 | US FAERS | |
| 108 | Epistaxis | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 109 | Expired product administered | FAERS: 3 | US FAERS | |
| 110 | Head discomfort | FAERS: 3 | US FAERS | |
| 111 | Hyperacusis | FAERS: 3 | SIDER US FAERS | |
| 112 | Hypokinesia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 113 | Impaired driving ability | FAERS: 3 | OFFSIDES US FAERS | |
| 114 | Incorrect route of drug administration | FAERS: 3 | US FAERS | |
| 115 | Intervertebral Disc Degeneration | FAERS: 3 | OFFSIDES US FAERS | |
| 116 | Joint swelling | FAERS: 3 | US FAERS | |
| 117 | Limb discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 118 | Medication Error | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 119 | Multiple Myeloma | FAERS: 3 | US FAERS | |
| 120 | Optic Neuritis | FAERS: 3 | US FAERS | |
| 121 | Pericardial effusion | FAERS: 3 | US FAERS | |
| 122 | Photophobia | FAERS: 3 | SIDER US FAERS | |
| 123 | Product use issue | FAERS: 3 | US FAERS | |
| 124 | Rebound effect | FAERS: 3 | OFFSIDES US FAERS | |
| 125 | Suicide attempt | FAERS: 3 | US FAERS | |
| 126 | Syncope | FAERS: 3 | SIDER US FAERS | |
| 127 | Thrombosis | FAERS: 3 | US FAERS | |
| 128 | Thyroiditis | FAERS: 3 | US FAERS | |
| 129 | Ventricular Fibrillation | FAERS: 3 | SIDER US FAERS | |
| 130 | Visual Impairment | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 131 | Accidental overdose | FAERS: 2 | OFFSIDES US FAERS | |
| 132 | Acne | FAERS: 2 | US FAERS | |
| 133 | Acute myocardial infarction | FAERS: 2 | US FAERS | |
| 134 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 135 | Animal bite | FAERS: 2 | US FAERS | |
| 136 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 137 | Autonomic nervous system imbalance | FAERS: 2 | US FAERS | |
| 138 | Biliary Dyskinesia | FAERS: 2 | US FAERS | |
| 139 | Blood creatine phosphokinase increased | FAERS: 2 | OFFSIDES US FAERS | |
| 140 | Blood lactate dehydrogenase increased | FAERS: 2 | US FAERS | |
| 141 | Cardiac Arrest | FAERS: 2 | US FAERS | |
| 142 | Cerebellar infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 143 | Cerebral artery occlusion | FAERS: 2 | US FAERS | |
| 144 | Choking sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 145 | Cholestasis | FAERS: 2 | US FAERS | |
| 146 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 147 | Crying | FAERS: 2 | US FAERS | |
| 148 | Deep Vein Thrombosis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 149 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 150 | Drug abuser | FAERS: 2 | OFFSIDES US FAERS | |
| 151 | Drug effect delayed | FAERS: 2 | US FAERS | |
| 152 | Dysarthria | FAERS: 2 | US FAERS | |
| 153 | Dysphonia | FAERS: 2 | US FAERS | |
| 154 | Embolism | FAERS: 2 | OFFSIDES US FAERS | |
| 155 | Emotional disorder | FAERS: 2 | US FAERS | |
| 156 | Epigastric discomfort | FAERS: 2 | US FAERS | |
| 157 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 158 | Flushing | FAERS: 2 | US FAERS | |
| 159 | Gamma-Glutamyltransferase Increased | FAERS: 2 | US FAERS | |
| 160 | General physical health deterioration | FAERS: 2 | US FAERS | |
| 161 | Hemiplegia | FAERS: 2 | US FAERS | |
| 162 | Hepatitis | FAERS: 2 | OFFSIDES US FAERS | |
| 163 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 164 | Intercepted drug prescribing error | FAERS: 2 | US FAERS | |
| 165 | Joint stiffness | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 166 | Lymphadenopathy | FAERS: 2 | SIDER US FAERS | |
| 167 | Meningorrhagia | FAERS: 2 | OFFSIDES US FAERS | |
| 168 | Meniscus injury | FAERS: 2 | US FAERS | |
| 169 | Multiple sclerosis relapse | FAERS: 2 | US FAERS | |
| 170 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 171 | Neuralgia | FAERS: 2 | OFFSIDES US FAERS | |
| 172 | Osteoporosis | FAERS: 2 | SIDER US FAERS | |
| 173 | Pallor | FAERS: 2 | OFFSIDES US FAERS | |
| 174 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 175 | Pharyngolaryngeal Pain | FAERS: 2 | OFFSIDES US FAERS | |
| 176 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 177 | Pulmonary Embolism | FAERS: 2 | US FAERS | |
| 178 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 179 | Retinal Vein Occlusion | FAERS: 2 | OFFSIDES US FAERS | |
| 180 | Rheumatoid Arthritis | FAERS: 2 | US FAERS | |
| 181 | Serotonin Syndrome | FAERS: 2 | SIDER US FAERS | |
| 182 | Spondylitis | FAERS: 2 | US FAERS | |
| 183 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 184 | Urinary tract infection | FAERS: 2 | SIDER US FAERS | |
| 185 | Vertebral Artery Dissection | FAERS: 2 | US FAERS | |
| 186 | Vertigo | FAERS: 2 | SIDER US FAERS | |
| 187 | Wrong patient received medication | FAERS: 2 | US FAERS | |
| 188 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 189 | jaundice | FAERS: 2 | SIDER US FAERS | |
| 190 | Abasia | FAERS: 1 | US FAERS | |
| 191 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 192 | Accidental exposure to product by child | FAERS: 1 | US FAERS | |
| 193 | Accidental exposure | FAERS: 1 | US FAERS | |
| 194 | Acute Coronary Syndrome | FAERS: 1 | 19538745 | CTD SIDER US FAERS |
| 195 | Adenoidal disorder | FAERS: 1 | US FAERS | |
| 196 | Allergic reaction to excipient | FAERS: 1 | US FAERS | |
| 197 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 198 | Amphetamines positive | FAERS: 1 | US FAERS | |
| 199 | Anal Fissure | FAERS: 1 | US FAERS | |
| 200 | Anaphylactic shock | FAERS: 1 | SIDER US FAERS | |
| 201 | Angiodysplasia | FAERS: 1 | US FAERS | |
| 202 | Angioedema | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 203 | Angle Closure Glaucoma | FAERS: 1 | US FAERS | |
| 204 | Anhedonia | FAERS: 1 | US FAERS | |
| 205 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 206 | Anosmia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 207 | Arthritis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 208 | Arthropathy | FAERS: 1 | SIDER US FAERS | |
| 209 | Aura | FAERS: 1 | US FAERS | |
| 210 | Back disorder | FAERS: 1 | US FAERS | |
| 211 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 212 | Biopsy | FAERS: 1 | US FAERS | |
| 213 | Bladder discomfort | FAERS: 1 | US FAERS | |
| 214 | Blindness | FAERS: 1 | US FAERS | |
| 215 | Blood alkaline phosphatase increased | FAERS: 1 | SIDER US FAERS | |
| 216 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 217 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 218 | Blood potassium decreased | FAERS: 1 | US FAERS | |
| 219 | Breast Cyst | FAERS: 1 | US FAERS | |
| 220 | Bronchospasm | FAERS: 1 | SIDER US FAERS | |
| 221 | Cataplexy | FAERS: 1 | US FAERS | |
| 222 | Cataract | FAERS: 1 | US FAERS | |
| 223 | Cellulitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 224 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 225 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 226 | Cheilitis | FAERS: 1 | US FAERS | |
| 227 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 228 | Clumsiness | FAERS: 1 | US FAERS | |
| 229 | Cold sweat | FAERS: 1 | US FAERS | |
| 230 | Congenital diaphragmatic hernia | FAERS: 1 | US FAERS | |
| 231 | Diastolic dysfunction | FAERS: 1 | US FAERS | |
| 232 | Disease recurrence | FAERS: 1 | US FAERS | |
| 233 | Dissociation | FAERS: 1 | US FAERS | |
| 234 | Drug resistance | FAERS: 1 | US FAERS | |
| 235 | Dry skin | FAERS: 1 | OFFSIDES US FAERS | |
| 236 | Dysgraphia | FAERS: 1 | US FAERS | |
| 237 | Dyspepsia | FAERS: 1 | SIDER US FAERS | |
| 238 | Dysuria | FAERS: 1 | OFFSIDES US FAERS | |
| 239 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 240 | Economic problem | FAERS: 1 | US FAERS | |
| 241 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 242 | Electrocardiogram change | FAERS: 1 | US FAERS | |
| 243 | Emotional distress | FAERS: 1 | OFFSIDES US FAERS | |
| 244 | Endodontic procedure | FAERS: 1 | OFFSIDES US FAERS | |
| 245 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 246 | Euphoric mood | FAERS: 1 | SIDER US FAERS | |
| 247 | Expired drug administered | FAERS: 1 | US FAERS | |
| 248 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 249 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 250 | Feeling Cold | FAERS: 1 | SIDER US FAERS | |
| 251 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 252 | Flank Pain | FAERS: 1 | US FAERS | |
| 253 | Food Poisoning | FAERS: 1 | US FAERS | |
| 254 | Frustration | FAERS: 1 | US FAERS | |
| 255 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 256 | Gastrointestinal hypermotility | FAERS: 1 | US FAERS | |
| 257 | Glaucoma | FAERS: 1 | US FAERS | |
| 258 | Hemiparesis | FAERS: 1 | US FAERS | |
| 259 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 260 | Hernia | FAERS: 1 | US FAERS | |
| 261 | Hormone level abnormal | FAERS: 1 | US FAERS | |
| 262 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 263 | Hypoxia | FAERS: 1 | US FAERS | |
| 264 | Immobile | FAERS: 1 | OFFSIDES US FAERS | |
| 265 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 266 | Impatience | FAERS: 1 | US FAERS | |
| 267 | Inappropriate affect | FAERS: 1 | US FAERS | |
| 268 | Inappropriate schedule of drug administration | FAERS: 1 | OFFSIDES US FAERS | |
| 269 | Incision site complication | FAERS: 1 | US FAERS | |
| 270 | Infertility | FAERS: 1 | US FAERS | |
| 271 | Insurance issue | FAERS: 1 | US FAERS | |
| 272 | Intervertebral disc disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 273 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 274 | Joint Instability | FAERS: 1 | US FAERS | |
| 275 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 276 | Labile hypertension | FAERS: 1 | US FAERS | |
| 277 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 278 | Leukopenia | FAERS: 1 | SIDER US FAERS | |
| 279 | Ligament rupture | FAERS: 1 | US FAERS | |
| 280 | Lyme Disease | FAERS: 1 | US FAERS | |
| 281 | Lymphoma | FAERS: 1 | US FAERS | |
| 282 | Macular degeneration | FAERS: 1 | US FAERS | |
| 283 | Mediastinal Fibrosis | FAERS: 1 | US FAERS | |
| 284 | Menopause | FAERS: 1 | US FAERS | |
| 285 | Menorrhagia | FAERS: 1 | SIDER US FAERS | |
| 286 | Motion Sickness | FAERS: 1 | US FAERS | |
| 287 | Musculoskeletal discomfort | FAERS: 1 | SIDER US FAERS | |
| 288 | Mydriasis | FAERS: 1 | US FAERS | |
| 289 | Myoclonic Epilepsy | FAERS: 1 | US FAERS | |
| 290 | Myosclerosis | FAERS: 1 | US FAERS | |
| 291 | Narcolepsy | FAERS: 1 | US FAERS | |
| 292 | Nephrotic Syndrome | FAERS: 1 | US FAERS | |
| 293 | Nerve injury | FAERS: 1 | US FAERS | |
| 294 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 295 | Opiates positive | FAERS: 1 | US FAERS | |
| 296 | Optic Neuropathy | FAERS: 1 | US FAERS | |
| 297 | Oral pain | FAERS: 1 | US FAERS | |
| 298 | Oropharyngeal discomfort | FAERS: 1 | SIDER US FAERS | |
| 299 | Osmolar gap increased | FAERS: 1 | US FAERS | |
| 300 | Pancreatitis | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 301 | Panic Disorder | FAERS: 1 | US FAERS | |
| 302 | Paradoxical drug reaction | FAERS: 1 | US FAERS | |
| 303 | Pelvic Pain | FAERS: 1 | US FAERS | |
| 304 | Pelvic mass | FAERS: 1 | US FAERS | |
| 305 | Peripheral swelling | FAERS: 1 | US FAERS | |
| 306 | Phonophobia | FAERS: 1 | OFFSIDES US FAERS | |
| 307 | Physical disability | FAERS: 1 | US FAERS | |
| 308 | Polyuria | FAERS: 1 | SIDER US FAERS | |
| 309 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 310 | Post-traumatic pain | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 311 | Precancerous cells present | FAERS: 1 | US FAERS | |
| 312 | Presyncope | FAERS: 1 | US FAERS | |
| 313 | Product formulation issue | FAERS: 1 | US FAERS | |
| 314 | Product packaging quantity issue | FAERS: 1 | US FAERS | |
| 315 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 316 | Proteinuria | FAERS: 1 | US FAERS | |
| 317 | Pseudomyopia | FAERS: 1 | US FAERS | |
| 318 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 319 | Reaction to food additive | FAERS: 1 | US FAERS | |
| 320 | Regurgitation | FAERS: 1 | US FAERS | |
| 321 | Respiratory Failure | FAERS: 1 | OFFSIDES US FAERS | |
| 322 | Respiratory distress | FAERS: 1 | US FAERS | |
| 323 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 324 | Rhinalgia | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 325 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 326 | Schizophrenia | FAERS: 1 | OFFSIDES US FAERS | |
| 327 | Secretion discharge | FAERS: 1 | US FAERS | |
| 328 | Septic Shock | FAERS: 1 | OFFSIDES US FAERS | |
| 329 | Shock | FAERS: 1 | SIDER US FAERS | |
| 330 | Sinus pain | FAERS: 1 | US FAERS | |
| 331 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 332 | Skin reaction | FAERS: 1 | US FAERS | |
| 333 | Sleep disorder due to a general medical condition | FAERS: 1 | US FAERS | |
| 334 | Somatoform Disorder | FAERS: 1 | US FAERS | |
| 335 | Somnambulism | FAERS: 1 | US FAERS | |
| 336 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 337 | Stomatitis | FAERS: 1 | SIDER US FAERS | |
| 338 | Stress at work | FAERS: 1 | US FAERS | |
| 339 | Supraventricular tachycardia | FAERS: 1 | US FAERS | |
| 340 | Swelling | FAERS: 1 | US FAERS | |
| 341 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 342 | Tension Headache | FAERS: 1 | US FAERS | |
| 343 | Therapeutic response delayed | FAERS: 1 | US FAERS | |
| 344 | Tinnitus | FAERS: 1 | OFFSIDES SIDER US FAERS | |
| 345 | Tooth Infection | FAERS: 1 | US FAERS | |
| 346 | Torticollis | FAERS: 1 | US FAERS | |
| 347 | Trismus | FAERS: 1 | US FAERS | |
| 348 | Troponin I increased | FAERS: 1 | US FAERS | |
| 349 | Ultrasound antenatal screen | FAERS: 1 | OFFSIDES US FAERS | |
| 350 | Unevaluable event | FAERS: 1 | US FAERS | |
| 351 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 352 | Urinary Retention | FAERS: 1 | US FAERS | |
| 353 | Vertebral artery thrombosis | FAERS: 1 | US FAERS | |
| 354 | Violence-related symptom | FAERS: 1 | US FAERS | |
| 355 | Visual disturbance | FAERS: 1 | OFFSIDES US FAERS | |
| 356 | Abdominal adhesions | OFFSIDES | ||
| 357 | Acid reflux | OFFSIDES | ||
| 358 | Acute migraine | SIDER | ||
| 359 | Acute sinusitis | OFFSIDES | ||
| 360 | Agitation | SIDER | ||
| 361 | Akathisia | SIDER | ||
| 362 | Amblyopia | SIDER | ||
| 363 | Amenorrhea | OFFSIDES | ||
| 364 | Ammonia increased | OFFSIDES | ||
| 365 | Anaphylactoid Reaction | SIDER | ||
| 366 | Anhidrosis | OFFSIDES | ||
| 367 | Anorexia | SIDER | ||
| 368 | Anorgasmia | OFFSIDES | ||
| 369 | Anoxic Encephalopathy | OFFSIDES | ||
| 370 | Antiphospholipid antibodies positive | OFFSIDES | ||
| 371 | Aortic Aneurysm | OFFSIDES | ||
| 372 | Apallic syndrome | OFFSIDES | ||
| 373 | Apathy | SIDER | ||
| 374 | Ataxia | OFFSIDES SIDER | ||
| 375 | Atelectasis | OFFSIDES | ||
| 376 | Autoimmune hepatitis | OFFSIDES | ||
| 377 | Automatism | OFFSIDES | ||
| 378 | Bipolar Disorder | OFFSIDES | ||
| 379 | Bipolar II disorder | OFFSIDES | ||
| 380 | Bladder pain | SIDER | ||
| 381 | Blood Glucose | OFFSIDES | ||
| 382 | Blood cholesterol | OFFSIDES | ||
| 383 | Blood homocysteine | OFFSIDES | ||
| 384 | Blood sodium | OFFSIDES | ||
| 385 | Blood triglycerides increased | OFFSIDES | ||
| 386 | Bone marrow depression | OFFSIDES | ||
| 387 | Bone pain | SIDER | ||
| 388 | Bradycardia | SIDER | ||
| 389 | Bronchial Obstruction | OFFSIDES | ||
| 390 | Bruxism | OFFSIDES | ||
| 391 | Cerebrovascular Insufficiency | OFFSIDES | ||
| 392 | Ceruloplasmin increased | OFFSIDES | ||
| 393 | Chemical and Drug Induced Liver Injury | 31129132 | CTD | |
| 394 | Chest heaviness | SIDER | ||
| 395 | Chest pressure | SIDER | ||
| 396 | Chest tightness | SIDER | ||
| 397 | Chest wall pain | OFFSIDES | ||
| 398 | Cholecystitis | OFFSIDES | ||
| 399 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 400 | Chronic sinusitis | OFFSIDES | ||
| 401 | Chronic ulcerative colitis | OFFSIDES | ||
| 402 | Circumoral paresthesia | SIDER | ||
| 403 | Colitis | SIDER | ||
| 404 | Complications of maternal exposure to therapeutic drugs | OFFSIDES | ||
| 405 | Congenital intestinal malformation | OFFSIDES | ||
| 406 | Conjunctivitis | SIDER | ||
| 407 | Constipation | SIDER | ||
| 408 | Contact Dermatitis | OFFSIDES | ||
| 409 | Contracture | OFFSIDES | ||
| 410 | Cramps of lower extremities | SIDER | ||
| 411 | Culture wound positive | OFFSIDES | ||
| 412 | Cyanosis | SIDER | ||
| 413 | Cystitis | SIDER | ||
| 414 | Cyst | OFFSIDES | ||
| 415 | Delusional disorder, unspecified type | OFFSIDES | ||
| 416 | Depressive disorder | 11167903 | CTD | |
| 417 | Dermatitis | SIDER | ||
| 418 | Diabetes Insipidus | OFFSIDES | ||
| 419 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 420 | Diplopia | SIDER | ||
| 421 | Dissociative disorder | OFFSIDES | ||
| 422 | Drug addict | OFFSIDES | ||
| 423 | Drug ineffective for unapproved indication | Canada Vigilance: 1 | Canada Vigilance | |
| 424 | Drug withdrawal headache | OFFSIDES | ||
| 425 | Ear discomfort | OFFSIDES | ||
| 426 | Ecchymosis | SIDER | ||
| 427 | Eczema | SIDER | ||
| 428 | Electrocardiogram QT interval abnormal | OFFSIDES | ||
| 429 | Electrocardiogram ST segment abnormal | OFFSIDES | ||
| 430 | Electrocardiogram abnormal | SIDER | ||
| 431 | Electromyogram abnormal | OFFSIDES | ||
| 432 | Encephalitis | OFFSIDES | ||
| 433 | Eosinophilia | SIDER | ||
| 434 | Eructation | SIDER | ||
| 435 | Erythema | SIDER | ||
| 436 | Esophageal Stenosis | OFFSIDES | ||
| 437 | Eustachian tube disorder | OFFSIDES | ||
| 438 | Eye Infection | OFFSIDES | ||
| 439 | Flat affect | SIDER | ||
| 440 | Gastric ulcer | OFFSIDES | ||
| 441 | Gastritis | SIDER | ||
| 442 | Gastroenteritis | SIDER | ||
| 443 | Gastrointestinal Pain | SIDER | ||
| 444 | Gastrointestinal carcinoma | SIDER | ||
| 445 | Gingivitis | SIDER | ||
| 446 | Granulomatous liver disease | OFFSIDES | ||
| 447 | Heat Stroke | OFFSIDES | ||
| 448 | Heparin-induced thrombocytopenia | OFFSIDES | ||
| 449 | Hepatic Vein Thrombosis | OFFSIDES | ||
| 450 | Hepatic necrosis | OFFSIDES | ||
| 451 | Hepatitis C | OFFSIDES | ||
| 452 | Hepatomegaly | 31129132 | CTD | |
| 453 | Hidradenitis | OFFSIDES | ||
| 454 | Histoplasmosis | OFFSIDES | ||
| 455 | Hyperkinesia | SIDER | ||
| 456 | Hyperthyroidism | SIDER | ||
| 457 | Hyperventilation | SIDER | ||
| 458 | Hypospadias | OFFSIDES | ||
| 459 | Infarction | 16615676 | CTD SIDER | |
| 460 | Infection | SIDER | ||
| 461 | Injection site infection | OFFSIDES | ||
| 462 | Insulin Resistance | OFFSIDES | ||
| 463 | Intestinal Obstruction | SIDER | ||
| 464 | Kidney Diseases | 16615676 | CTD | |
| 465 | Lacrimation | SIDER | ||
| 466 | Laryngitis | SIDER | ||
| 467 | Liver neoplasms | 31129132 | CTD | |
| 468 | Lymphocyte percentage decreased | OFFSIDES | ||
| 469 | Lymphoid tissue hyperplasia | OFFSIDES | ||
| 470 | Manic psychosis | SIDER | ||
| 471 | Medical device complication | OFFSIDES | ||
| 472 | Mental status changes | OFFSIDES | ||
| 473 | Mesenteric artery stenosis | OFFSIDES | ||
| 474 | Metrorrhagia | SIDER | ||
| 475 | Microalbuminuria | OFFSIDES | ||
| 476 | Middle insomnia | OFFSIDES | ||
| 477 | Migraine Disorders | CTD | ||
| 478 | Mixed Connective Tissue Disease | OFFSIDES | ||
| 479 | Mood swings | SIDER | ||
| 480 | Muscle Cramp | 16239765 | CTD | |
| 481 | Muscle necrosis | OFFSIDES | ||
| 482 | Muscle relaxant therapy | SIDER | ||
| 483 | Muscle strain | OFFSIDES | ||
| 484 | Musculoskeletal Pain | Canada Vigilance: 1 | Canada Vigilance | |
| 485 | Myasthenia Gravis | OFFSIDES | ||
| 486 | Myokymia | OFFSIDES | ||
| 487 | Nasal sinus drainage | OFFSIDES | ||
| 488 | Neck tightness | SIDER | ||
| 489 | Necrosis | SIDER | ||
| 490 | Neonatal respiratory depression | Canada Vigilance: 1 | Canada Vigilance | |
| 491 | Neuropathy | SIDER | ||
| 492 | Nodule | OFFSIDES | ||
| 493 | Oligohydramnios | OFFSIDES | ||
| 494 | Osteomyelitis | OFFSIDES | ||
| 495 | Pancreatic Pseudocyst | OFFSIDES | ||
| 496 | Patellofemoral Pain Syndrome | OFFSIDES | ||
| 497 | Pharyngitis | SIDER | ||
| 498 | Phlebitis | OFFSIDES | ||
| 499 | Pilonidal cyst congenital | OFFSIDES | ||
| 500 | Placental Insufficiency | OFFSIDES | ||
| 501 | Pneumothorax | OFFSIDES | ||
| 502 | Post procedural discomfort | OFFSIDES | ||
| 503 | Prinzmetal's variant angina | 20159412 | CTD | |
| 504 | Proctitis herpes | OFFSIDES | ||
| 505 | Proctocolitis | OFFSIDES | ||
| 506 | Product complaint | Canada Vigilance: 1 | Canada Vigilance | |
| 507 | Product dispensing error | Canada Vigilance: 1 | Canada Vigilance | |
| 508 | Product physical issue | Canada Vigilance: 1 | Canada Vigilance | |
| 509 | Pseudocyst | OFFSIDES | ||
| 510 | Pulmonary malformation | OFFSIDES | ||
| 511 | Purulent discharge | OFFSIDES | ||
| 512 | Pyelonephritis | SIDER | ||
| 513 | Reaction aggravation | SIDER | ||
| 514 | Rectal tenesmus | OFFSIDES | ||
| 515 | Renal pain | SIDER | ||
| 516 | Retinal Vasculitis | OFFSIDES | ||
| 517 | Retroperitoneal fibrosis | OFFSIDES | ||
| 518 | Rhinitis | SIDER | ||
| 519 | Rocky Mountain Spotted Fever | OFFSIDES | ||
| 520 | Scotoma | SIDER | ||
| 521 | Secondary hypothyroidism | OFFSIDES | ||
| 522 | Splenic Infarction | SIDER | ||
| 523 | Stevens-Johnson Syndrome | OFFSIDES | ||
| 524 | Stiffness | SIDER | ||
| 525 | Subcutaneous Abscess | OFFSIDES | ||
| 526 | Sweat gland infection | OFFSIDES | ||
| 527 | Sweating | SIDER | ||
| 528 | Synovitis | OFFSIDES | ||
| 529 | Takotsubo Cardiomyopathy | 24100257 | CTD | |
| 530 | Tardive Dyskinesia | SIDER | ||
| 531 | Tenosynovitis | SIDER | ||
| 532 | Tension | SIDER | ||
| 533 | Tetany | SIDER | ||
| 534 | Therapy non-responder | OFFSIDES | ||
| 535 | Thirst | SIDER | ||
| 536 | Thrombocytopenia | SIDER | ||
| 537 | Thrombophlebitis | OFFSIDES SIDER | ||
| 538 | Tinea cruris | OFFSIDES | ||
| 539 | Tooth Extraction | OFFSIDES | ||
| 540 | Transient Cerebral Ischemia | SIDER | ||
| 541 | Ulcer | SIDER | ||
| 542 | Ultrasound abdomen abnormal | OFFSIDES | ||
| 543 | Unexpected therapeutic drug effect | OFFSIDES | ||
| 544 | Urine output increased | SIDER | ||
| 545 | Uterine fibroids enlarged | SIDER | ||
| 546 | VIIth nerve paralysis | OFFSIDES | ||
| 547 | Vasodilation procedure | SIDER | ||
| 548 | Vasodilation | SIDER | ||
| 549 | Vocal cord cyst | OFFSIDES | ||
| 550 | Yawning | SIDER | ||
| 551 | carbuncle | OFFSIDES | ||
| 552 | effusion | OFFSIDES | ||
| 553 | fibroma | OFFSIDES | ||
| 554 | furuncle | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.