Clopidogrel
(FDEODCTUSIWGLK-RSAXXLAASA-N)
Structure
- SMILES
- OS(=O)(=O)O.COC(=O)[C@H](c1ccccc1Cl)N1CCc2c(C1)ccs2
- Molecular Formula:
- C16H18ClNO6S2
- Molecular Weight:
- 419.900
- Log P:
- 4.0398
- Hydrogen Bond Acceptor:
- 8
- Hydrogen Bond Donor:
- 2
- TPSA:
- 140.76
- CAS Number(s):
- 120202-66-6; 135046-48-9; 144077-07-6
Synonym(s)
1.
Clopidogrel
2.
Clopidogrel Besilate
3.
Clopidogrel Besylate
4.
Clopidogrel Bisulfate
5.
Clopidogrel Hydrochloride
6.
Clopidogrel Napadisilate
7.
Clopidogrel Sandoz
8.
Clopidogrel, (+)(S)-isomer
9.
Clopidogrel-Mepha
10.
Iscover
11.
PCR 4099
12.
PCR-4099
13.
Plavix
14.
SC 25989C
15.
SC 25990C
16.
SR 25989
17.
Clopidogrel Mepha
External Link(s)
| MeSH | D000077144 |
| PubChem Compound | 138753050 115366 24883467 |
| ChEBI | 3759 |
| CHEMBL | CHEMBL1083385 |
| KEGG | dr:D00769 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Cerebrovascular accident | FAERS: 332 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 2 | Myocardial Infarction | FAERS: 292 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 3 | Pain | FAERS: 220 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Drug ineffective | FAERS: 163 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 5 | Physical disability | FAERS: 157 | US FAERS | |
| 6 | Thrombosis | FAERS: 110 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Anhedonia | FAERS: 98 | US FAERS | |
| 8 | Asthenia | FAERS: 98 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Tension | FAERS: 95 | US FAERS | |
| 10 | Economic problem | FAERS: 91 | US FAERS | |
| 11 | Dizziness | FAERS: 89 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Psychological Trauma | FAERS: 87 | US FAERS | |
| 13 | Deformity | FAERS: 84 | US FAERS | |
| 14 | Headache | FAERS: 80 | US FAERS | |
| 15 | Atrial Fibrillation | FAERS: 79 | US FAERS | |
| 16 | Epistaxis | FAERS: 76 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 17 | Chest Pain | FAERS: 70 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 18 | Fatigue | FAERS: 70 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Pneumonia | FAERS: 70 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Pruritus | FAERS: 69 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 21 | Nausea | FAERS: 65 | US FAERS | |
| 22 | Malaise | FAERS: 51 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Arthralgia | FAERS: 44 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 24 | Urticaria | FAERS: 43 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 25 | Vomiting | FAERS: 43 | US FAERS | |
| 26 | Weight decreased | FAERS: 42 | US FAERS | |
| 27 | Deep Vein Thrombosis | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Thrombocytopenia | FAERS: 40 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 29 | Overdose | FAERS: 38 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 30 | Product quality issue | FAERS: 38 | US FAERS | |
| 31 | Feeling abnormal | FAERS: 37 | US FAERS | |
| 32 | Back Pain | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Unevaluable event | FAERS: 34 | US FAERS | |
| 34 | Myalgia | FAERS: 33 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 35 | Sepsis | FAERS: 33 | US FAERS | |
| 36 | Amnesia | FAERS: 31 | US FAERS | |
| 37 | Blindness | FAERS: 31 | US FAERS | |
| 38 | Thrombosis in device | FAERS: 30 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 39 | Adverse event | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 40 | Hypersensitivity | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Vascular occlusion | FAERS: 29 | US FAERS | |
| 42 | Drug resistance | FAERS: 27 | US FAERS | |
| 43 | Pulmonary Embolism | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Syncope | FAERS: 27 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Visual Impairment | FAERS: 27 | US FAERS | |
| 46 | Gastric ulcer | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 47 | Rhabdomyolysis | FAERS: 26 | US FAERS | |
| 48 | Chest discomfort | FAERS: 25 | US FAERS | |
| 49 | Abdominal Pain | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 50 | Drug dose omission | FAERS: 23 | US FAERS | |
| 51 | Hypotension | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 52 | Respiratory Failure | FAERS: 23 | US FAERS | |
| 53 | Abdominal discomfort | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Angina Pectoris | FAERS: 21 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Cardiac Arrest | FAERS: 21 | US FAERS | |
| 56 | Gastrointestinal ulcer | FAERS: 21 | US FAERS | |
| 57 | Macular degeneration | FAERS: 21 | US FAERS | |
| 58 | Dementia | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Dysgeusia | FAERS: 20 | US FAERS | |
| 60 | Ulcer | FAERS: 20 | US FAERS | |
| 61 | Urinary tract infection | FAERS: 20 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | jaundice | FAERS: 20 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 63 | Dyspepsia | FAERS: 19 | US FAERS | |
| 64 | Arthropathy | FAERS: 18 | US FAERS | |
| 65 | Purpura | FAERS: 18 | US FAERS | |
| 66 | Erythema | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 67 | Hemiplegia | FAERS: 17 | US FAERS | |
| 68 | Stent occlusion | FAERS: 17 | US FAERS | |
| 69 | Coronary Artery Disease | FAERS: 16 | US FAERS | |
| 70 | Gastritis | FAERS: 16 | US FAERS | |
| 71 | General physical health deterioration | FAERS: 16 | US FAERS | |
| 72 | Swelling | FAERS: 16 | US FAERS | |
| 73 | Aphasia | FAERS: 15 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 74 | Cerebral Infarction | FAERS: 15 | US FAERS | |
| 75 | No adverse event | FAERS: 15 | US FAERS | |
| 76 | Product substitution issue | FAERS: 15 | US FAERS | |
| 77 | Abasia | FAERS: 14 | US FAERS | |
| 78 | Anxiety | FAERS: 14 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 79 | Bradycardia | FAERS: 14 | US FAERS | |
| 80 | Diabetes Mellitus | FAERS: 14 | US FAERS | |
| 81 | Phlebitis | FAERS: 14 | US FAERS | |
| 82 | Constipation | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | In-stent coronary artery restenosis | FAERS: 13 | US FAERS | |
| 84 | Neutropenia | FAERS: 13 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 85 | Pancytopenia | FAERS: 13 | US FAERS | |
| 86 | Petechiae | FAERS: 13 | US FAERS | |
| 87 | Tremor | FAERS: 13 | US FAERS | |
| 88 | Wrong technique in drug usage process | FAERS: 13 | US FAERS | |
| 89 | Acute myocardial infarction | FAERS: 12 | US FAERS | |
| 90 | Alanine Aminotransferase Increased | FAERS: 12 | US FAERS | |
| 91 | Aspartate Aminotransferase Increased | FAERS: 12 | US FAERS | |
| 92 | Leukopenia | FAERS: 12 | US FAERS | |
| 93 | MYELODYSPLASTIC SYNDROME | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 94 | Medication Error | FAERS: 12 | US FAERS | |
| 95 | Memory impairment | FAERS: 12 | US FAERS | |
| 96 | Product counterfeit | FAERS: 12 | US FAERS | |
| 97 | Product taste abnormal | FAERS: 12 | US FAERS | |
| 98 | Suspected counterfeit product | FAERS: 12 | US FAERS | |
| 99 | Urinary Retention | FAERS: 12 | US FAERS | |
| 100 | White blood cell count decreased | FAERS: 12 | US FAERS | |
| 101 | Ageusia | FAERS: 11 | US FAERS | |
| 102 | Aneurysm | FAERS: 11 | US FAERS | |
| 103 | Arterial restenosis | FAERS: 11 | US FAERS | |
| 104 | Arthritis | FAERS: 11 | US FAERS | |
| 105 | Burning sensation | FAERS: 11 | US FAERS | |
| 106 | Carotid artery occlusion | FAERS: 11 | US FAERS | |
| 107 | Chills | FAERS: 11 | US FAERS | |
| 108 | Disability | FAERS: 11 | US FAERS | |
| 109 | Dysarthria | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 110 | Emotional distress | FAERS: 11 | US FAERS | |
| 111 | Increased tendency to bruise | FAERS: 11 | US FAERS | |
| 112 | Neck Pain | FAERS: 11 | US FAERS | |
| 113 | Somnolence | FAERS: 11 | US FAERS | |
| 114 | Acute Coronary Syndrome | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 115 | Agranulocytosis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Altered state of consciousness | FAERS: 10 | US FAERS | |
| 117 | Blood urine present | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 118 | Device occlusion | FAERS: 10 | US FAERS | |
| 119 | Disseminated Intravascular Coagulation | FAERS: 10 | US FAERS | |
| 120 | Hemiparesis | FAERS: 10 | US FAERS | |
| 121 | In-stent arterial restenosis | FAERS: 10 | US FAERS | |
| 122 | Musculoskeletal Pain | FAERS: 10 | US FAERS | |
| 123 | Skin Ulcer | FAERS: 10 | US FAERS | |
| 124 | Thrombocytopenic purpura | FAERS: 10 | US FAERS | |
| 125 | Blood creatine phosphokinase increased | FAERS: 9 | US FAERS | |
| 126 | Cardiac Death | FAERS: 9 | US FAERS | |
| 127 | Depressed Level of Consciousness | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Disorientation | FAERS: 9 | US FAERS | |
| 129 | Diverticulitis | FAERS: 9 | US FAERS | |
| 130 | Embolism | FAERS: 9 | US FAERS | |
| 131 | Intracranial Aneurysm | FAERS: 9 | US FAERS | |
| 132 | Joint swelling | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 133 | Lethargy | FAERS: 9 | US FAERS | |
| 134 | Lip swelling | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 135 | Oropharyngeal pain | FAERS: 9 | US FAERS | |
| 136 | Pancreatitis | FAERS: 9 | US FAERS | |
| 137 | Pulmonary Fibrosis | FAERS: 9 | US FAERS | |
| 138 | Aortic Aneurysm | FAERS: 8 | US FAERS | |
| 139 | Blood creatinine increased | FAERS: 8 | US FAERS | |
| 140 | Chromaturia | FAERS: 8 | US FAERS | |
| 141 | Deafness | FAERS: 8 | US FAERS | |
| 142 | Dehydration | FAERS: 8 | US FAERS | |
| 143 | Drug exposure during pregnancy | FAERS: 8 | US FAERS | |
| 144 | Ecchymosis | FAERS: 8 | US FAERS | |
| 145 | Gene Mutation | FAERS: 8 | US FAERS | |
| 146 | Infarction | FAERS: 8 | US FAERS | |
| 147 | Influenza | FAERS: 8 | US FAERS | |
| 148 | Insulin autoimmune syndrome | FAERS: 8 | US FAERS | |
| 149 | Musculoskeletal stiffness | FAERS: 8 | US FAERS | |
| 150 | Ocular icterus | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 152 | Platelet function test abnormal | FAERS: 8 | US FAERS | |
| 153 | Retinal Detachment | FAERS: 8 | US FAERS | |
| 154 | Tachycardia | FAERS: 8 | US FAERS | |
| 155 | Tinnitus | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 156 | Urinary Incontinence | FAERS: 8 | US FAERS | |
| 157 | Vascular stent thrombosis | FAERS: 8 | US FAERS | |
| 158 | Vertigo | FAERS: 8 | US FAERS | |
| 159 | Wheezing | FAERS: 8 | US FAERS | |
| 160 | Angioedema | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 161 | Back disorder | FAERS: 7 | US FAERS | |
| 162 | Dysphonia | FAERS: 7 | US FAERS | |
| 163 | Eye pain | FAERS: 7 | US FAERS | |
| 164 | Intestinal Obstruction | FAERS: 7 | US FAERS | |
| 165 | Joint injury | FAERS: 7 | US FAERS | |
| 166 | Medication residue | FAERS: 7 | US FAERS | |
| 167 | Nephrolithiasis | FAERS: 7 | US FAERS | |
| 168 | Oral pain | FAERS: 7 | US FAERS | |
| 169 | Pallor | FAERS: 7 | US FAERS | |
| 170 | Palpitations | FAERS: 7 | US FAERS | |
| 171 | Pancreatic carcinoma | FAERS: 7 | US FAERS | |
| 172 | Peripheral swelling | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 173 | Septic Shock | FAERS: 7 | US FAERS | |
| 174 | Sudden death | FAERS: 7 | US FAERS | |
| 175 | Throat irritation | FAERS: 7 | US FAERS | |
| 176 | Visual disturbance | FAERS: 7 | US FAERS | |
| 177 | Accidental overdose | FAERS: 6 | US FAERS | |
| 178 | Anorexia | FAERS: 6 | US FAERS | |
| 179 | Blood glucose increased | FAERS: 6 | US FAERS | |
| 180 | Choking | FAERS: 6 | US FAERS | |
| 181 | Cholestasis | FAERS: 6 | US FAERS | |
| 182 | Duodenal Ulcer | FAERS: 6 | US FAERS | |
| 183 | Ejection Fraction Decreased | FAERS: 6 | US FAERS | |
| 184 | Fracture | FAERS: 6 | US FAERS | |
| 185 | Impaired quality of life | FAERS: 6 | US FAERS | |
| 186 | Impaired work ability | FAERS: 6 | US FAERS | |
| 187 | Infection | FAERS: 6 | US FAERS | |
| 188 | Lymphadenopathy | FAERS: 6 | US FAERS | |
| 189 | Nervousness | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 190 | Post procedural complication | FAERS: 6 | US FAERS | |
| 191 | Prescribed overdose | FAERS: 6 | US FAERS | |
| 192 | Rebound effect | FAERS: 6 | US FAERS | |
| 193 | Sinusitis | FAERS: 6 | US FAERS | |
| 194 | Stevens-Johnson Syndrome | FAERS: 6 | US FAERS | |
| 195 | nervous system disorder | FAERS: 6 | US FAERS | |
| 196 | Acute kidney injury | FAERS: 5 | US FAERS | |
| 197 | Arteriosclerosis | FAERS: 5 | US FAERS | |
| 198 | Asthma | FAERS: 5 | US FAERS | |
| 199 | Bronchitis | FAERS: 5 | US FAERS | |
| 200 | Delirium | FAERS: 5 | US FAERS | |
| 201 | Feeling Cold | FAERS: 5 | US FAERS | |
| 202 | Flushing | FAERS: 5 | US FAERS | |
| 203 | Gangrene | FAERS: 5 | US FAERS | |
| 204 | Glaucoma | FAERS: 5 | US FAERS | |
| 205 | Hypokinesia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 206 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 207 | Nasopharyngitis | FAERS: 5 | US FAERS | |
| 208 | Peripheral arterial occlusive disease | FAERS: 5 | US FAERS | |
| 209 | Post procedural infection | FAERS: 5 | US FAERS | |
| 210 | Proteinuria | FAERS: 5 | US FAERS | |
| 211 | Serum Sickness | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 212 | Stress | FAERS: 5 | US FAERS | |
| 213 | Toxic Epidermal Necrolysis | FAERS: 5 | US FAERS | |
| 214 | Vascular rupture | FAERS: 5 | US FAERS | |
| 215 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 216 | Amyloidosis | FAERS: 4 | US FAERS | |
| 217 | Anaphylactic shock | FAERS: 4 | US FAERS | |
| 218 | Anosmia | FAERS: 4 | US FAERS | |
| 219 | Anti-insulin antibody increased | FAERS: 4 | US FAERS | |
| 220 | Basal cell carcinoma | FAERS: 4 | US FAERS | |
| 221 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 222 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 223 | Blood potassium increased | FAERS: 4 | US FAERS | |
| 224 | Blood urea increased | FAERS: 4 | US FAERS | |
| 225 | Cataract | FAERS: 4 | US FAERS | |
| 226 | Cellulitis | FAERS: 4 | US FAERS | |
| 227 | Colitis | FAERS: 4 | US FAERS | |
| 228 | Disease recurrence | FAERS: 4 | US FAERS | |
| 229 | Drug prescribing error | FAERS: 4 | US FAERS | |
| 230 | Duodenal ulcer perforation | FAERS: 4 | US FAERS | |
| 231 | Duodenitis | FAERS: 4 | US FAERS | |
| 232 | Eczema | FAERS: 4 | US FAERS | |
| 233 | Eosinophilia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 234 | Extra dose administered | FAERS: 4 | US FAERS | |
| 235 | Gamma-Glutamyltransferase Increased | FAERS: 4 | US FAERS | |
| 236 | Gastrointestinal erosion | FAERS: 4 | US FAERS | |
| 237 | Hepatitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 238 | Ileal ulcer | FAERS: 4 | US FAERS | |
| 239 | Laryngospasm | FAERS: 4 | US FAERS | |
| 240 | Medication residue present | FAERS: 4 | US FAERS | |
| 241 | Mental impairment | FAERS: 4 | US FAERS | |
| 242 | Mental status changes | FAERS: 4 | US FAERS | |
| 243 | Metastatic Neoplasm | FAERS: 4 | US FAERS | |
| 244 | Monoplegia | FAERS: 4 | US FAERS | |
| 245 | Musculoskeletal chest pain | FAERS: 4 | US FAERS | |
| 246 | Night sweats | FAERS: 4 | US FAERS | |
| 247 | Peptic Ulcer | FAERS: 4 | US FAERS | |
| 248 | Phlebitis deep | FAERS: 4 | US FAERS | |
| 249 | Polymyalgia Rheumatica | FAERS: 4 | US FAERS | |
| 250 | Quality of life decreased | FAERS: 4 | US FAERS | |
| 251 | Rash erythematous | FAERS: 4 | US FAERS | |
| 252 | Respiratory arrest | FAERS: 4 | US FAERS | |
| 253 | Respiratory distress | FAERS: 4 | US FAERS | |
| 254 | Stomatitis | FAERS: 4 | US FAERS | |
| 255 | Transaminases increased | FAERS: 4 | US FAERS | |
| 256 | Troponin increased | FAERS: 4 | US FAERS | |
| 257 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 258 | Venous thrombosis limb | FAERS: 4 | US FAERS | |
| 259 | Vitreous floaters | FAERS: 4 | US FAERS | |
| 260 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 261 | Alopecia | FAERS: 3 | US FAERS | |
| 262 | Aphagia | FAERS: 3 | US FAERS | |
| 263 | Arterial stenosis limb | FAERS: 3 | US FAERS | |
| 264 | Atrial Flutter | FAERS: 3 | US FAERS | |
| 265 | Blood amylase increased | FAERS: 3 | US FAERS | |
| 266 | Blood lactate dehydrogenase increased | FAERS: 3 | US FAERS | |
| 267 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 268 | Bone marrow depression | FAERS: 3 | US FAERS | |
| 269 | Brain Contusion | FAERS: 3 | US FAERS | |
| 270 | Cardiac Tamponade | FAERS: 3 | US FAERS | |
| 271 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 272 | Cholecystitis | FAERS: 3 | US FAERS | |
| 273 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 274 | Cholestatic liver injury | FAERS: 3 | US FAERS | |
| 275 | Coccidioidomycosis | FAERS: 3 | US FAERS | |
| 276 | Diplopia | FAERS: 3 | US FAERS | |
| 277 | Discomfort | FAERS: 3 | US FAERS | |
| 278 | Disease Progression | FAERS: 3 | US FAERS | |
| 279 | Diverticulum | FAERS: 3 | US FAERS | |
| 280 | Documented hypersensitivity to administered drug | FAERS: 3 | US FAERS | |
| 281 | Drug administration error | FAERS: 3 | US FAERS | |
| 282 | Dry skin | FAERS: 3 | US FAERS | |
| 283 | Dysuria | FAERS: 3 | US FAERS | |
| 284 | Embolic stroke | FAERS: 3 | US FAERS | |
| 285 | Erectile dysfunction | FAERS: 3 | US FAERS | |
| 286 | Febrile Neutropenia | FAERS: 3 | US FAERS | |
| 287 | Flatulence | FAERS: 3 | US FAERS | |
| 288 | Gastroenteritis | FAERS: 3 | US FAERS | |
| 289 | Gastrointestinal carcinoma | FAERS: 3 | US FAERS | |
| 290 | Gastrointestinal infection | FAERS: 3 | US FAERS | |
| 291 | Hernia | FAERS: 3 | US FAERS | |
| 292 | Hypophagia | FAERS: 3 | US FAERS | |
| 293 | Hypoxia | FAERS: 3 | US FAERS | |
| 294 | Immobile | FAERS: 3 | US FAERS | |
| 295 | Incorrect drug administration duration | FAERS: 3 | US FAERS | |
| 296 | Insulin C-peptide increased | FAERS: 3 | US FAERS | |
| 297 | Intentional product misuse | FAERS: 3 | US FAERS | |
| 298 | Laceration | FAERS: 3 | US FAERS | |
| 299 | Limb injury | FAERS: 3 | US FAERS | |
| 300 | Lipase increased | FAERS: 3 | US FAERS | |
| 301 | Mallory-Weiss Syndrome | FAERS: 3 | US FAERS | |
| 302 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 303 | Osteoporosis | FAERS: 3 | US FAERS | |
| 304 | Personality Change | FAERS: 3 | US FAERS | |
| 305 | Platelet aggregation decreased | FAERS: 3 | US FAERS | |
| 306 | Pneumothorax | FAERS: 3 | US FAERS | |
| 307 | Post procedural myocardial infarction | FAERS: 3 | US FAERS | |
| 308 | Presyncope | FAERS: 3 | US FAERS | |
| 309 | Product dispensing error | FAERS: 3 | US FAERS | |
| 310 | Product dose omission | FAERS: 3 | US FAERS | |
| 311 | Product physical issue | FAERS: 3 | US FAERS | |
| 312 | Product shape issue | FAERS: 3 | US FAERS | |
| 313 | Product size issue | FAERS: 3 | US FAERS | |
| 314 | Protein urine present | FAERS: 3 | US FAERS | |
| 315 | Pulmonary thrombosis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 316 | Renal pain | FAERS: 3 | US FAERS | |
| 317 | Restlessness | FAERS: 3 | US FAERS | |
| 318 | Skin irritation | FAERS: 3 | US FAERS | |
| 319 | Skin necrosis | FAERS: 3 | US FAERS | |
| 320 | Spinal column stenosis | FAERS: 3 | US FAERS | |
| 321 | Stroke in evolution | FAERS: 3 | US FAERS | |
| 322 | Temporal Arteritis | FAERS: 3 | US FAERS | |
| 323 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 324 | Thrombocytosis | FAERS: 3 | US FAERS | |
| 325 | Tooth Loss | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 326 | Vascular stent occlusion | FAERS: 3 | US FAERS | |
| 327 | Walking aid user | FAERS: 3 | US FAERS | |
| 328 | Wrong technique in product usage process | FAERS: 3 | US FAERS | |
| 329 | Abdominal tenderness | FAERS: 2 | US FAERS | |
| 330 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 331 | Angioplasty | FAERS: 2 | US FAERS | |
| 332 | Apathy | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 333 | Appendicitis | FAERS: 2 | US FAERS | |
| 334 | Ascites | FAERS: 2 | US FAERS | |
| 335 | Asphyxia | FAERS: 2 | US FAERS | |
| 336 | Asthenopia | FAERS: 2 | US FAERS | |
| 337 | Autoimmune hepatitis | FAERS: 2 | US FAERS | |
| 338 | Bedridden | FAERS: 2 | US FAERS | |
| 339 | Bladder Neoplasm | FAERS: 2 | US FAERS | |
| 340 | Bladder neoplasm surgery | FAERS: 2 | US FAERS | |
| 341 | Blood count abnormal | FAERS: 2 | US FAERS | |
| 342 | Blood iron decreased | FAERS: 2 | US FAERS | |
| 343 | Blood triglycerides increased | FAERS: 2 | US FAERS | |
| 344 | Blue Toe Syndrome | FAERS: 2 | US FAERS | |
| 345 | Breast cancer recurrent | FAERS: 2 | US FAERS | |
| 346 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 347 | Cataract operation | FAERS: 2 | US FAERS | |
| 348 | Catheter placement | FAERS: 2 | US FAERS | |
| 349 | Cauda Equina Syndrome | FAERS: 2 | US FAERS | |
| 350 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 351 | Cold sweat | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 352 | Counterfeit product administered | FAERS: 2 | US FAERS | |
| 353 | Creatinine renal clearance decreased | FAERS: 2 | US FAERS | |
| 354 | Crying | FAERS: 2 | US FAERS | |
| 355 | Cyanosis | FAERS: 2 | US FAERS | |
| 356 | Dark circles under eyes | FAERS: 2 | US FAERS | |
| 357 | Dental caries | FAERS: 2 | US FAERS | |
| 358 | Depressed mood | FAERS: 2 | US FAERS | |
| 359 | Diastolic dysfunction | FAERS: 2 | US FAERS | |
| 360 | Dieulafoy's vascular malformation | FAERS: 2 | US FAERS | |
| 361 | Diffuse alveolar damage | FAERS: 2 | US FAERS | |
| 362 | Dyslalia | FAERS: 2 | US FAERS | |
| 363 | Electroencephalogram abnormal | FAERS: 2 | US FAERS | |
| 364 | Electrolyte imbalance | FAERS: 2 | US FAERS | |
| 365 | Electromechanical dissociation | FAERS: 2 | US FAERS | |
| 366 | Endoscopy upper gastrointestinal tract abnormal | FAERS: 2 | US FAERS | |
| 367 | Eructation | FAERS: 2 | US FAERS | |
| 368 | Erythema Multiforme | FAERS: 2 | US FAERS | |
| 369 | Facial paralysis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 370 | Fibrin D dimer increased | FAERS: 2 | US FAERS | |
| 371 | Gait inability | FAERS: 2 | US FAERS | |
| 372 | Gastrointestinal Pain | FAERS: 2 | US FAERS | |
| 373 | Gastrointestinal perforation | FAERS: 2 | US FAERS | |
| 374 | Gingivitis | FAERS: 2 | US FAERS | |
| 375 | Glomerulonephritis | FAERS: 2 | US FAERS | |
| 376 | Gout | FAERS: 2 | US FAERS | |
| 377 | Heat Stroke | FAERS: 2 | US FAERS | |
| 378 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 379 | Histiocytosis haematophagic | FAERS: 2 | US FAERS | |
| 380 | Hunger | FAERS: 2 | US FAERS | |
| 381 | Hyperkeratosis | FAERS: 2 | US FAERS | |
| 382 | Hypertensive emergency | FAERS: 2 | US FAERS | |
| 383 | Ileus | FAERS: 2 | US FAERS | |
| 384 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 385 | Implantable defibrillator insertion | FAERS: 2 | US FAERS | |
| 386 | Incisional hernia | FAERS: 2 | US FAERS | |
| 387 | Incoherent | FAERS: 2 | US FAERS | |
| 388 | Incontinence | FAERS: 2 | US FAERS | |
| 389 | Incorrect storage of drug | FAERS: 2 | US FAERS | |
| 390 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 391 | Inflammation | FAERS: 2 | US FAERS | |
| 392 | Inhibitory drug interaction | FAERS: 2 | US FAERS | |
| 393 | Intestinal Perforation | FAERS: 2 | US FAERS | |
| 394 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 395 | Joint stiffness | FAERS: 2 | US FAERS | |
| 396 | Leukocytoclastic vasculitis | FAERS: 2 | US FAERS | |
| 397 | Limb discomfort | FAERS: 2 | US FAERS | |
| 398 | Lung Injury | FAERS: 2 | US FAERS | |
| 399 | Lung consolidation | FAERS: 2 | US FAERS | |
| 400 | Lymphoma | FAERS: 2 | US FAERS | |
| 401 | Malnutrition | FAERS: 2 | US FAERS | |
| 402 | Menorrhagia | FAERS: 2 | US FAERS | |
| 403 | Mood swings | FAERS: 2 | US FAERS | |
| 404 | Multiple Myeloma | FAERS: 2 | US FAERS | |
| 405 | Multiple allergies | FAERS: 2 | US FAERS | |
| 406 | Myositis | FAERS: 2 | US FAERS | |
| 407 | Nerve injury | FAERS: 2 | US FAERS | |
| 408 | Neutrophil count decreased | FAERS: 2 | US FAERS | |
| 409 | Nuchal Rigidity | FAERS: 2 | US FAERS | |
| 410 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 411 | Pain of skin | FAERS: 2 | US FAERS | |
| 412 | Paranoia | FAERS: 2 | US FAERS | |
| 413 | Paraplegia | FAERS: 2 | US FAERS | |
| 414 | Pemphigus | FAERS: 2 | US FAERS | |
| 415 | Pericardial effusion | FAERS: 2 | US FAERS | |
| 416 | Peritonitis | FAERS: 2 | US FAERS | |
| 417 | Photosensitivity allergic reaction | FAERS: 2 | US FAERS | |
| 418 | Platelet aggregation abnormal | FAERS: 2 | US FAERS | |
| 419 | Pneumonitis | FAERS: 2 | US FAERS | |
| 420 | Polyarthritis | FAERS: 2 | US FAERS | |
| 421 | Pregnancy | FAERS: 2 | US FAERS | |
| 422 | Product appearance confusion | FAERS: 2 | US FAERS | |
| 423 | Product solubility abnormal | FAERS: 2 | US FAERS | |
| 424 | Product use issue | FAERS: 2 | US FAERS | |
| 425 | Quadriparesis | FAERS: 2 | US FAERS | |
| 426 | Renal mass | FAERS: 2 | US FAERS | |
| 427 | Reocclusion | FAERS: 2 | US FAERS | |
| 428 | Respiratory tract infection fungal | FAERS: 2 | US FAERS | |
| 429 | Reticulocyte count increased | FAERS: 2 | US FAERS | |
| 430 | Retinal Vascular Disorder | FAERS: 2 | US FAERS | |
| 431 | Ruptured cerebral aneurysm | FAERS: 2 | US FAERS | |
| 432 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 433 | Shock | FAERS: 2 | US FAERS | |
| 434 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 435 | Skin lesion | FAERS: 2 | US FAERS | |
| 436 | Sneezing | FAERS: 2 | US FAERS | |
| 437 | Splenic Rupture | FAERS: 2 | US FAERS | |
| 438 | Subcutaneous Emphysema | FAERS: 2 | US FAERS | |
| 439 | Sudden Cardiac Death | FAERS: 2 | US FAERS | |
| 440 | Supraventricular tachycardia | FAERS: 2 | US FAERS | |
| 441 | Temperature intolerance | FAERS: 2 | US FAERS | |
| 442 | Therapeutic product ineffective for unapproved indication | FAERS: 2 | US FAERS | |
| 443 | Throat cancer | FAERS: 2 | US FAERS | |
| 444 | Tooth Infection | FAERS: 2 | US FAERS | |
| 445 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 446 | Upper respiratory tract congestion | FAERS: 2 | US FAERS | |
| 447 | Urethral Obstruction | FAERS: 2 | US FAERS | |
| 448 | Urine output increased | FAERS: 2 | US FAERS | |
| 449 | Vascular stenosis | FAERS: 2 | US FAERS | |
| 450 | Vasculitic rash | FAERS: 2 | US FAERS | |
| 451 | Vasculitis | FAERS: 2 | US FAERS | |
| 452 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 453 | Vessel perforation | FAERS: 2 | US FAERS | |
| 454 | Visual acuity reduced transiently | FAERS: 2 | US FAERS | |
| 455 | ADAMTS13 activity decreased | FAERS: 1 | US FAERS | |
| 456 | Abscess | FAERS: 1 | US FAERS | |
| 457 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 458 | Acne | FAERS: 1 | US FAERS | |
| 459 | Acquired gene mutation | FAERS: 1 | US FAERS | |
| 460 | Agitation | FAERS: 1 | US FAERS | |
| 461 | Akinesia | FAERS: 1 | US FAERS | |
| 462 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 463 | Alveolitis | FAERS: 1 | US FAERS | |
| 464 | Amaurosis | FAERS: 1 | US FAERS | |
| 465 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 466 | Anastomotic stenosis | FAERS: 1 | US FAERS | |
| 467 | Anastomotic ulcer | FAERS: 1 | US FAERS | |
| 468 | Anger | FAERS: 1 | US FAERS | |
| 469 | Angiodermatitis | FAERS: 1 | US FAERS | |
| 470 | Angiogram pulmonary abnormal | FAERS: 1 | US FAERS | |
| 471 | Anisocytosis | FAERS: 1 | US FAERS | |
| 472 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 473 | Anorectal discomfort | FAERS: 1 | US FAERS | |
| 474 | Aortic occlusion | FAERS: 1 | US FAERS | |
| 475 | Aphonia | FAERS: 1 | US FAERS | |
| 476 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 477 | Arterial bypass operation | FAERS: 1 | US FAERS | |
| 478 | Arterial therapeutic procedure | FAERS: 1 | US FAERS | |
| 479 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 480 | Aspergillosis | FAERS: 1 | US FAERS | |
| 481 | Aspiration pleural cavity abnormal | FAERS: 1 | US FAERS | |
| 482 | Autoimmune thrombocytopenia | FAERS: 1 | US FAERS | |
| 483 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 484 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 485 | Bioptic eye surgery | FAERS: 1 | US FAERS | |
| 486 | Bladder pain | FAERS: 1 | US FAERS | |
| 487 | Bladder prolapse | FAERS: 1 | US FAERS | |
| 488 | Blood alkaline phosphatase increased | FAERS: 1 | US FAERS | |
| 489 | Blood chloride increased | FAERS: 1 | US FAERS | |
| 490 | Blood cholesterol abnormal | FAERS: 1 | US FAERS | |
| 491 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 492 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 493 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 494 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 495 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 496 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 497 | Blood viscosity decreased | FAERS: 1 | US FAERS | |
| 498 | Bone density decreased | FAERS: 1 | US FAERS | |
| 499 | Bone pain | FAERS: 1 | US FAERS | |
| 500 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 501 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 502 | Bronchial secretion retention | FAERS: 1 | US FAERS | |
| 503 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 504 | Bronchoalveolar lavage abnormal | FAERS: 1 | US FAERS | |
| 505 | Bronchospasm | FAERS: 1 | US FAERS | |
| 506 | Carcinoma | FAERS: 1 | US FAERS | |
| 507 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 508 | Cardiac function test abnormal | FAERS: 1 | US FAERS | |
| 509 | Cardiac procedure complication | FAERS: 1 | US FAERS | |
| 510 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 511 | Carotid artery aneurysm | FAERS: 1 | US FAERS | |
| 512 | Cartilage injury | FAERS: 1 | US FAERS | |
| 513 | Cell marker increased | FAERS: 1 | US FAERS | |
| 514 | Central nervous system function test abnormal | FAERS: 1 | US FAERS | |
| 515 | Central nervous system lesion | FAERS: 1 | US FAERS | |
| 516 | Cerebral Palsy | FAERS: 1 | US FAERS | |
| 517 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 518 | Cerebrovascular Insufficiency | FAERS: 1 | US FAERS | |
| 519 | Choking sensation | FAERS: 1 | US FAERS | |
| 520 | Cholangiostomy | FAERS: 1 | US FAERS | |
| 521 | Cholangitis | FAERS: 1 | US FAERS | |
| 522 | Choroidal Detachment | FAERS: 1 | US FAERS | |
| 523 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 524 | Colectomy | FAERS: 1 | US FAERS | |
| 525 | Colitis erosive | FAERS: 1 | US FAERS | |
| 526 | Complement factor C3 decreased | FAERS: 1 | US FAERS | |
| 527 | Complement factor decreased | FAERS: 1 | US FAERS | |
| 528 | Completed Suicide | FAERS: 1 | US FAERS | |
| 529 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 530 | Contraindicated drug administered | FAERS: 1 | US FAERS | |
| 531 | Conversion disorder | FAERS: 1 | US FAERS | |
| 532 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 533 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 534 | Creatinine renal clearance increased | FAERS: 1 | US FAERS | |
| 535 | Cytopenia | FAERS: 1 | US FAERS | |
| 536 | Dermatitis | FAERS: 1 | US FAERS | |
| 537 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 538 | Device malfunction | FAERS: 1 | US FAERS | |
| 539 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 540 | Diabetic Nephropathy | FAERS: 1 | US FAERS | |
| 541 | Diplegia | FAERS: 1 | US FAERS | |
| 542 | Disease complication | FAERS: 1 | US FAERS | |
| 543 | Drug Dependence | FAERS: 1 | US FAERS | |
| 544 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 545 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 546 | Drug ineffective for unapproved indication | FAERS: 1 | US FAERS | |
| 547 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 548 | Drug metabolising enzyme decreased | FAERS: 1 | US FAERS | |
| 549 | Drug metabolising enzyme increased | FAERS: 1 | US FAERS | |
| 550 | Drug screen positive | FAERS: 1 | US FAERS | |
| 551 | Drug toxicity | FAERS: 1 | US FAERS | |
| 552 | Dysentery | FAERS: 1 | US FAERS | |
| 553 | Dysphemia | FAERS: 1 | US FAERS | |
| 554 | Dystonia | FAERS: 1 | US FAERS | |
| 555 | Ear discomfort | FAERS: 1 | US FAERS | |
| 556 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 557 | Emotional disorder | FAERS: 1 | US FAERS | |
| 558 | Endometrial disorder | FAERS: 1 | US FAERS | |
| 559 | Enterocolitis | FAERS: 1 | US FAERS | |
| 560 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 561 | Epicondylitis | FAERS: 1 | US FAERS | |
| 562 | Epidermolysis Bullosa | FAERS: 1 | US FAERS | |
| 563 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 564 | Epilepsy | FAERS: 1 | US FAERS | |
| 565 | Erysipelas | FAERS: 1 | US FAERS | |
| 566 | Euphoric mood | FAERS: 1 | US FAERS | |
| 567 | Expired product administered | FAERS: 1 | US FAERS | |
| 568 | Exsanguination | FAERS: 1 | US FAERS | |
| 569 | Eye laser surgery | FAERS: 1 | US FAERS | |
| 570 | Facial Pain | FAERS: 1 | US FAERS | |
| 571 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 572 | Feeding tube complication | FAERS: 1 | US FAERS | |
| 573 | Feeling jittery | FAERS: 1 | US FAERS | |
| 574 | Fibrin increased | FAERS: 1 | US FAERS | |
| 575 | Fixed drug eruption | FAERS: 1 | US FAERS | |
| 576 | Flank Pain | FAERS: 1 | US FAERS | |
| 577 | Fluid imbalance | FAERS: 1 | US FAERS | |
| 578 | Food Allergy | FAERS: 1 | US FAERS | |
| 579 | Foreign body aspiration | FAERS: 1 | US FAERS | |
| 580 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 581 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 582 | Gallbladder pain | FAERS: 1 | US FAERS | |
| 583 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 584 | Gastric infection | FAERS: 1 | US FAERS | |
| 585 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 586 | Gastrointestinal angiodysplasia haemorrhagic | FAERS: 1 | US FAERS | |
| 587 | Gastrointestinal endoscopic therapy | FAERS: 1 | US FAERS | |
| 588 | Gene mutation identification test positive | FAERS: 1 | US FAERS | |
| 589 | Glaucoma surgery | FAERS: 1 | US FAERS | |
| 590 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 591 | Glossitis | FAERS: 1 | US FAERS | |
| 592 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 593 | Granulomatosis with polyangiitis | FAERS: 1 | US FAERS | |
| 594 | Haptoglobin Decreased | FAERS: 1 | US FAERS | |
| 595 | Head discomfort | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 596 | Hearing disability | FAERS: 1 | US FAERS | |
| 597 | Hepatitis C | FAERS: 1 | US FAERS | |
| 598 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 599 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 600 | Hip swelling | FAERS: 1 | US FAERS | |
| 601 | Hostility | FAERS: 1 | US FAERS | |
| 602 | Hydrocephalus | FAERS: 1 | US FAERS | |
| 603 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 604 | Hyperpyrexia | FAERS: 1 | US FAERS | |
| 605 | Hypersomnia | FAERS: 1 | US FAERS | |
| 606 | Hypertensive heart disease | FAERS: 1 | US FAERS | |
| 607 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 608 | Hypertrophy of tongue papillae | FAERS: 1 | US FAERS | |
| 609 | Hyperventilation | FAERS: 1 | US FAERS | |
| 610 | Hypoaesthesia facial | FAERS: 1 | US FAERS | |
| 611 | Hypocoagulable state | FAERS: 1 | US FAERS | |
| 612 | Hyporeflexia | FAERS: 1 | US FAERS | |
| 613 | Hypoventilation | FAERS: 1 | US FAERS | |
| 614 | Hysterectomy | FAERS: 1 | US FAERS | |
| 615 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 616 | Iliac artery occlusion | FAERS: 1 | US FAERS | |
| 617 | Iliac artery stenosis | FAERS: 1 | US FAERS | |
| 618 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 619 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 620 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 621 | Incorrect route of drug administration | FAERS: 1 | US FAERS | |
| 622 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 623 | Infestation | FAERS: 1 | US FAERS | |
| 624 | Infrequent bowel movements | FAERS: 1 | US FAERS | |
| 625 | Initial insomnia | FAERS: 1 | US FAERS | |
| 626 | Injection site bruising | FAERS: 1 | US FAERS | |
| 627 | Insulin C-peptide decreased | FAERS: 1 | US FAERS | |
| 628 | Intercepted drug prescribing error | FAERS: 1 | US FAERS | |
| 629 | Intestinal resection | FAERS: 1 | US FAERS | |
| 630 | Iritis | FAERS: 1 | US FAERS | |
| 631 | Jejunal ulcer | FAERS: 1 | US FAERS | |
| 632 | Kernig's sign | FAERS: 1 | US FAERS | |
| 633 | Lack of spontaneous speech | FAERS: 1 | US FAERS | |
| 634 | Laryngitis | FAERS: 1 | US FAERS | |
| 635 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 636 | Leukocytosis | FAERS: 1 | US FAERS | |
| 637 | Ligament rupture | FAERS: 1 | US FAERS | |
| 638 | Limb crushing injury | FAERS: 1 | US FAERS | |
| 639 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 640 | Loss of personal independence in daily activities | FAERS: 1 | US FAERS | |
| 641 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 642 | Lower Urinary Tract Symptoms | FAERS: 1 | US FAERS | |
| 643 | Lupus-like syndrome | FAERS: 1 | US FAERS | |
| 644 | Lymphopenia | FAERS: 1 | US FAERS | |
| 645 | Macular detachment | FAERS: 1 | US FAERS | |
| 646 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 647 | Mastitis | FAERS: 1 | US FAERS | |
| 648 | Meningioma | FAERS: 1 | US FAERS | |
| 649 | Meniscus injury | FAERS: 1 | US FAERS | |
| 650 | Mesenteric arterial occlusion | FAERS: 1 | US FAERS | |
| 651 | Mesothelioma | FAERS: 1 | US FAERS | |
| 652 | Metastases to adrenals | FAERS: 1 | US FAERS | |
| 653 | Migraine with Aura | FAERS: 1 | US FAERS | |
| 654 | Mitral Valve Stenosis | FAERS: 1 | US FAERS | |
| 655 | Mixed liver injury | FAERS: 1 | US FAERS | |
| 656 | Mononeuropathy Multiplex | FAERS: 1 | US FAERS | |
| 657 | Monoparesis | FAERS: 1 | US FAERS | |
| 658 | Mouth swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 659 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 660 | Muscle tightness | FAERS: 1 | US FAERS | |
| 661 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 662 | Musculoskeletal discomfort | FAERS: 1 | US FAERS | |
| 663 | Mycosis Fungoides | FAERS: 1 | US FAERS | |
| 664 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 665 | Myopathy | FAERS: 1 | US FAERS | |
| 666 | Necrosis | FAERS: 1 | US FAERS | |
| 667 | Nephritis | FAERS: 1 | US FAERS | |
| 668 | Nephrocalcinosis | FAERS: 1 | US FAERS | |
| 669 | Nerve Root Compression | FAERS: 1 | US FAERS | |
| 670 | Neuritis | FAERS: 1 | US FAERS | |
| 671 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 672 | No adverse effect | FAERS: 1 | US FAERS | |
| 673 | Nocturia | FAERS: 1 | US FAERS | |
| 674 | Non-cardiac chest pain | FAERS: 1 | US FAERS | |
| 675 | Nuclear magnetic resonance imaging abdominal abnormal | FAERS: 1 | US FAERS | |
| 676 | Nystagmus | FAERS: 1 | US FAERS | |
| 677 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 678 | Ocular vascular disorder | FAERS: 1 | US FAERS | |
| 679 | Oculomucocutaneous syndrome | FAERS: 1 | US FAERS | |
| 680 | Oligospermia | FAERS: 1 | US FAERS | |
| 681 | Oliguria | FAERS: 1 | US FAERS | |
| 682 | Otitis Media | FAERS: 1 | US FAERS | |
| 683 | Overweight | FAERS: 1 | US FAERS | |
| 684 | Pancreatic Fistula | FAERS: 1 | US FAERS | |
| 685 | Panniculitis | FAERS: 1 | US FAERS | |
| 686 | Papule | FAERS: 1 | US FAERS | |
| 687 | Paresis | FAERS: 1 | US FAERS | |
| 688 | Pathological fracture | FAERS: 1 | US FAERS | |
| 689 | Pelvic mass | FAERS: 1 | US FAERS | |
| 690 | Peptic Ulcer Perforation | FAERS: 1 | US FAERS | |
| 691 | Perforated ulcer | FAERS: 1 | US FAERS | |
| 692 | Periarthritis | FAERS: 1 | US FAERS | |
| 693 | Peripheral nerve palsy | FAERS: 1 | US FAERS | |
| 694 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 695 | Pharyngitis | FAERS: 1 | US FAERS | |
| 696 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 697 | Phimosis | FAERS: 1 | US FAERS | |
| 698 | Photophobia | FAERS: 1 | US FAERS | |
| 699 | Platelet aggregation inhibition | FAERS: 1 | US FAERS | |
| 700 | Platelet aggregation | FAERS: 1 | US FAERS | |
| 701 | Pleural mesothelioma malignant recurrent | FAERS: 1 | US FAERS | |
| 702 | Pleurisy | FAERS: 1 | US FAERS | |
| 703 | Pleuritic pain | FAERS: 1 | US FAERS | |
| 704 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 705 | Pneumocystis jiroveci pneumonia | FAERS: 1 | US FAERS | |
| 706 | Poikilocytosis | FAERS: 1 | US FAERS | |
| 707 | Polyarteritis Nodosa | FAERS: 1 | US FAERS | |
| 708 | Polymyositis | FAERS: 1 | US FAERS | |
| 709 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 710 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 711 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 712 | Post procedural sepsis | FAERS: 1 | US FAERS | |
| 713 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 714 | Post-traumatic neck syndrome | FAERS: 1 | US FAERS | |
| 715 | Prerenal failure | FAERS: 1 | US FAERS | |
| 716 | Prescription form tampering | FAERS: 1 | US FAERS | |
| 717 | Primary amyloidosis | FAERS: 1 | US FAERS | |
| 718 | Procedural complication | FAERS: 1 | US FAERS | |
| 719 | Product administration error | FAERS: 1 | US FAERS | |
| 720 | Product availability issue | FAERS: 1 | US FAERS | |
| 721 | Product design issue | FAERS: 1 | US FAERS | |
| 722 | Product label issue | FAERS: 1 | US FAERS | |
| 723 | Product label on wrong product | FAERS: 1 | US FAERS | |
| 724 | Product supply issue | FAERS: 1 | US FAERS | |
| 725 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 726 | Prothrombin level decreased | FAERS: 1 | US FAERS | |
| 727 | Psoas Abscess | FAERS: 1 | US FAERS | |
| 728 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 729 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 730 | Pulmonary Valve Stenosis | FAERS: 1 | US FAERS | |
| 731 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 732 | Pulmonary granuloma | FAERS: 1 | US FAERS | |
| 733 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 734 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 735 | Pyomyositis | FAERS: 1 | US FAERS | |
| 736 | Quadriplegia | FAERS: 1 | US FAERS | |
| 737 | Radiation injury | FAERS: 1 | US FAERS | |
| 738 | Reaction to drug excipients | FAERS: 1 | US FAERS | |
| 739 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 740 | Recalled product administered | FAERS: 1 | US FAERS | |
| 741 | Rectal Prolapse | FAERS: 1 | US FAERS | |
| 742 | Red reflex abnormal | FAERS: 1 | US FAERS | |
| 743 | Renal artery occlusion | FAERS: 1 | US FAERS | |
| 744 | Renal cyst | FAERS: 1 | US FAERS | |
| 745 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 746 | Retinal aneurysm | FAERS: 1 | US FAERS | |
| 747 | Retinal infarction | FAERS: 1 | US FAERS | |
| 748 | Retinal vascular thrombosis | FAERS: 1 | US FAERS | |
| 749 | Retroperitoneal fibrosis | FAERS: 1 | US FAERS | |
| 750 | Right ventricular systolic pressure increased | FAERS: 1 | US FAERS | |
| 751 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 752 | Scab | FAERS: 1 | US FAERS | |
| 753 | Sciatica | FAERS: 1 | US FAERS | |
| 754 | Scleroderma | FAERS: 1 | US FAERS | |
| 755 | Screaming | FAERS: 1 | US FAERS | |
| 756 | Sedation complication | FAERS: 1 | US FAERS | |
| 757 | Senile dementia | FAERS: 1 | US FAERS | |
| 758 | Shunt aneurysm | FAERS: 1 | US FAERS | |
| 759 | Silent myocardial infarction | FAERS: 1 | US FAERS | |
| 760 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 761 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 762 | Sinus bradycardia | FAERS: 1 | US FAERS | |
| 763 | Sinus headache | FAERS: 1 | US FAERS | |
| 764 | Skin Erosion | FAERS: 1 | US FAERS | |
| 765 | Skin nodule | FAERS: 1 | US FAERS | |
| 766 | Sleep Paralysis | FAERS: 1 | US FAERS | |
| 767 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 768 | Slow response to stimuli | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 769 | Small cell lung cancer metastatic | FAERS: 1 | US FAERS | |
| 770 | Small intestine carcinoma | FAERS: 1 | US FAERS | |
| 771 | Spinal column injury | FAERS: 1 | US FAERS | |
| 772 | Spinal cord infection | FAERS: 1 | US FAERS | |
| 773 | Splenectomy | FAERS: 1 | US FAERS | |
| 774 | Splenomegaly | FAERS: 1 | US FAERS | |
| 775 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 776 | Staring | FAERS: 1 | US FAERS | |
| 777 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 778 | Stenosis | FAERS: 1 | US FAERS | |
| 779 | Stent malfunction | FAERS: 1 | US FAERS | |
| 780 | Subclavian artery embolism | FAERS: 1 | US FAERS | |
| 781 | Suicide attempt | FAERS: 1 | US FAERS | |
| 782 | Sunburn | FAERS: 1 | US FAERS | |
| 783 | Systemic mycosis | FAERS: 1 | US FAERS | |
| 784 | Tardive Dyskinesia | FAERS: 1 | US FAERS | |
| 785 | Teeth brittle | FAERS: 1 | US FAERS | |
| 786 | Tendon discomfort | FAERS: 1 | US FAERS | |
| 787 | Therapeutic procedure | FAERS: 1 | US FAERS | |
| 788 | Therapeutic response unexpected with drug substitution | FAERS: 1 | US FAERS | |
| 789 | Therapy non-responder | FAERS: 1 | US FAERS | |
| 790 | Therapy regimen changed | FAERS: 1 | US FAERS | |
| 791 | Thirst | FAERS: 1 | US FAERS | |
| 792 | Thoracotomy | FAERS: 1 | US FAERS | |
| 793 | Toothache | FAERS: 1 | US FAERS | |
| 794 | Trismus | FAERS: 1 | US FAERS | |
| 795 | Trousseau's syndrome | FAERS: 1 | US FAERS | |
| 796 | Tryptase increased | FAERS: 1 | US FAERS | |
| 797 | Tuberculosis | FAERS: 1 | US FAERS | |
| 798 | Ultrasound antenatal screen | FAERS: 1 | US FAERS | |
| 799 | Unemployment | FAERS: 1 | US FAERS | |
| 800 | Urinary bladder polyp | FAERS: 1 | US FAERS | |
| 801 | Urine protein/creatinine ratio abnormal | FAERS: 1 | US FAERS | |
| 802 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 803 | Uveitis | FAERS: 1 | US FAERS | |
| 804 | Vascular bypass dysfunction | FAERS: 1 | US FAERS | |
| 805 | Vascular graft complication | FAERS: 1 | US FAERS | |
| 806 | Vascular procedure complication | FAERS: 1 | US FAERS | |
| 807 | Vascular purpura | FAERS: 1 | US FAERS | |
| 808 | Vascular stent restenosis | FAERS: 1 | US FAERS | |
| 809 | Vascular stent stenosis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 810 | Venous Injury | FAERS: 1 | US FAERS | |
| 811 | Venous Thrombosis | FAERS: 1 | US FAERS | |
| 812 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 813 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 814 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 815 | Water Intoxication | FAERS: 1 | US FAERS | |
| 816 | Wheelchair user | FAERS: 1 | US FAERS | |
| 817 | Williams Syndrome | FAERS: 1 | US FAERS | |
| 818 | Wound Infection | FAERS: 1 | US FAERS | |
| 819 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 820 | colonoscopy | FAERS: 1 | US FAERS | |
| 821 | effusion | FAERS: 1 | US FAERS | |
| 822 | heart rate | FAERS: 1 | US FAERS | |
| 823 | Formication | Canada Vigilance: 1 | Canada Vigilance | |
| 824 | Gastric Dilatation | Canada Vigilance: 1 | Canada Vigilance | |
| 825 | Serum sickness-like reaction | Canada Vigilance: 1 | Canada Vigilance | |
| 826 | Therapeutic response changed | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.