Amlodipine
(ZPBWCRDSRKPIDG-UHFFFAOYSA-N)
Structure
- SMILES
- OS(=O)(=O)c1ccccc1.NCCOCC1=C(C(=O)OCC)C(C(=C(N1)C)C(=O)OC)c1ccccc1Cl
- Molecular Formula:
- C26H31ClN2O8S
- Molecular Weight:
- 567.051
- Log P:
- 5.3095
- Hydrogen Bond Acceptor:
- 10
- Hydrogen Bond Donor:
- 3
- TPSA:
- 162.63
- CAS Number(s):
- 111470-99-6
Synonym(s)
1.
Amlodipine
2.
Amlodipine Besylate
3.
Amlodipine Maleate
4.
Amlodipine Maleate (1:1)
5.
Amlodipine, (+-)-Isomer
6.
Amlodipine, (+-)-Isomer, Maleate (1:1)
7.
Amlodipine, (R)-Isomer
8.
Amlodipine, (S)-Isomer, Maleate (1:1)
9.
Amlodis
10.
Amlor
11.
Astudal
12.
Istin
13.
Norvasc
External Link(s)
| MeSH | D017311 |
| PubChem Compound | 60496 11330522 |
| ChEBI | 2669 |
| CHEMBL | CHEMBL3207778 CHEMBL3193637 CHEMBL1200402 |
| KEGG | dr:D00615 |
| Therapeutic Target Database | D0H7WA |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 233 Canada Vigilance: 13 | Canada Vigilance US FAERS | |
| 2 | Dizziness | FAERS: 172 Canada Vigilance: 3 | Canada Vigilance OFFSIDES US FAERS | |
| 3 | Hypotension | FAERS: 162 | US FAERS | |
| 4 | Headache | FAERS: 140 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | Toxicity to various agents | FAERS: 109 | US FAERS | |
| 6 | Completed Suicide | FAERS: 103 | US FAERS | |
| 7 | Overdose | FAERS: 98 | US FAERS | |
| 8 | Malaise | FAERS: 96 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 9 | Nausea | FAERS: 95 | OFFSIDES US FAERS | |
| 10 | Peripheral swelling | FAERS: 94 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 11 | Blood pressure inadequately controlled | FAERS: 88 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 12 | Joint swelling | FAERS: 81 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 13 | Swelling | FAERS: 80 | US FAERS | |
| 14 | Fatigue | FAERS: 77 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 15 | Feeling abnormal | FAERS: 70 | US FAERS | |
| 16 | Palpitations | FAERS: 67 | US FAERS | |
| 17 | Pruritus | FAERS: 63 | US FAERS | |
| 18 | Product substitution issue | FAERS: 54 | US FAERS | |
| 19 | Suicide attempt | FAERS: 48 | US FAERS | |
| 20 | Asthenia | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Shock | FAERS: 43 | US FAERS | |
| 22 | Pain | FAERS: 42 | OFFSIDES US FAERS | |
| 23 | Vomiting | FAERS: 42 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 24 | Chest Pain | FAERS: 38 Canada Vigilance: 2 | Canada Vigilance OFFSIDES US FAERS | |
| 25 | Somnolence | FAERS: 38 | US FAERS | |
| 26 | Throat irritation | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Urticaria | FAERS: 37 | US FAERS | |
| 28 | Metabolic acidosis | FAERS: 36 | US FAERS | |
| 29 | Hypersensitivity | FAERS: 33 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 30 | Lethargy | FAERS: 32 | US FAERS | |
| 31 | Abdominal discomfort | FAERS: 30 | US FAERS | |
| 32 | Arthralgia | FAERS: 30 | US FAERS | |
| 33 | Tremor | FAERS: 30 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 34 | Cardiac Arrest | FAERS: 29 | US FAERS | |
| 35 | Myalgia | FAERS: 29 | US FAERS | |
| 36 | Flushing | FAERS: 28 | US FAERS | |
| 37 | Product solubility abnormal | FAERS: 28 | US FAERS | |
| 38 | Gingival Hyperplasia | FAERS: 26 | US FAERS | |
| 39 | Erythema | FAERS: 25 | OFFSIDES US FAERS | |
| 40 | Abdominal Pain | FAERS: 24 | OFFSIDES US FAERS | |
| 41 | Bradycardia | FAERS: 24 | US FAERS | |
| 42 | Tachycardia | FAERS: 24 | US FAERS | |
| 43 | Anxiety | FAERS: 23 | OFFSIDES US FAERS | |
| 44 | Product quality issue | FAERS: 23 | US FAERS | |
| 45 | Sinus Tachycardia | FAERS: 23 | US FAERS | |
| 46 | Choking | FAERS: 20 | US FAERS | |
| 47 | Blood pressure fluctuation | FAERS: 19 | US FAERS | |
| 48 | Burning sensation | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Constipation | FAERS: 19 | US FAERS | |
| 50 | Syncope | FAERS: 19 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 51 | Acute kidney injury | FAERS: 18 | US FAERS | |
| 52 | Alopecia | FAERS: 18 | US FAERS | |
| 53 | Visual Impairment | FAERS: 18 | US FAERS | |
| 54 | Chest discomfort | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Erectile dysfunction | FAERS: 16 | OFFSIDES US FAERS | |
| 56 | Tinnitus | FAERS: 16 | US FAERS | |
| 57 | Angioedema | FAERS: 15 | US FAERS | |
| 58 | Drug level increased | FAERS: 15 | US FAERS | |
| 59 | Hypoxia | FAERS: 15 | OFFSIDES US FAERS | |
| 60 | Nervousness | FAERS: 15 | US FAERS | |
| 61 | Dysgeusia | FAERS: 14 | US FAERS | |
| 62 | Oropharyngeal pain | FAERS: 14 | US FAERS | |
| 63 | Cerebrovascular accident | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 64 | Discomfort | FAERS: 13 | US FAERS | |
| 65 | Product taste abnormal | FAERS: 13 | US FAERS | |
| 66 | Respiratory Failure | FAERS: 13 | OFFSIDES US FAERS | |
| 67 | Diabetes Mellitus | FAERS: 12 | US FAERS | |
| 68 | Drug effect incomplete | FAERS: 12 | US FAERS | |
| 69 | Inflammation | FAERS: 12 | US FAERS | |
| 70 | Activities of daily living impaired | FAERS: 11 | US FAERS | |
| 71 | Back Pain | FAERS: 11 | US FAERS | |
| 72 | Disorientation | FAERS: 11 | US FAERS | |
| 73 | Dyspepsia | FAERS: 11 | US FAERS | |
| 74 | Purpura | FAERS: 11 | US FAERS | |
| 75 | Sinus bradycardia | FAERS: 11 | OFFSIDES US FAERS | |
| 76 | Accidental overdose | FAERS: 10 | US FAERS | |
| 77 | Acidosis | FAERS: 10 | US FAERS | |
| 78 | Anuria | FAERS: 10 | US FAERS | |
| 79 | Ascites | FAERS: 10 | US FAERS | |
| 80 | Gingivitis | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 81 | Intentional product misuse | FAERS: 10 | US FAERS | |
| 82 | Lip swelling | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Mental impairment | FAERS: 10 | US FAERS | |
| 84 | Oliguria | FAERS: 10 | OFFSIDES US FAERS | |
| 85 | Product physical issue | FAERS: 10 | US FAERS | |
| 86 | Angina Pectoris | FAERS: 9 | US FAERS | |
| 87 | Blood glucose increased | FAERS: 9 | US FAERS | |
| 88 | Depressed Level of Consciousness | FAERS: 9 | US FAERS | |
| 89 | Exposure via breast milk | FAERS: 9 | US FAERS | |
| 90 | Head discomfort | FAERS: 9 | US FAERS | |
| 91 | Pharmaceutical product complaint | FAERS: 9 | US FAERS | |
| 92 | Agitation | FAERS: 8 | US FAERS | |
| 93 | Blood creatinine increased | FAERS: 8 | US FAERS | |
| 94 | Dysphonia | FAERS: 8 | US FAERS | |
| 95 | Feeling Cold | FAERS: 8 | US FAERS | |
| 96 | Maternal exposure during breast feeding | FAERS: 8 | US FAERS | |
| 97 | Memory impairment | FAERS: 8 | US FAERS | |
| 98 | Neck Pain | FAERS: 8 | US FAERS | |
| 99 | Product use issue | FAERS: 8 | US FAERS | |
| 100 | Reaction to drug excipients | FAERS: 8 | US FAERS | |
| 101 | Atrial Fibrillation | FAERS: 7 | US FAERS | |
| 102 | Dehydration | FAERS: 7 | OFFSIDES US FAERS | |
| 103 | Dysarthria | FAERS: 7 | US FAERS | |
| 104 | Loss of personal independence in daily activities | FAERS: 7 | US FAERS | |
| 105 | Musculoskeletal stiffness | FAERS: 7 | US FAERS | |
| 106 | Nocturia | FAERS: 7 | US FAERS | |
| 107 | Presyncope | FAERS: 7 | US FAERS | |
| 108 | Rhabdomyolysis | FAERS: 7 | OFFSIDES US FAERS | |
| 109 | Therapeutic response unexpected with drug substitution | FAERS: 7 | US FAERS | |
| 110 | Unresponsive to stimuli | FAERS: 7 | US FAERS | |
| 111 | Vertigo | FAERS: 7 | US FAERS | |
| 112 | Wheezing | FAERS: 7 | US FAERS | |
| 113 | Adverse event | FAERS: 6 | US FAERS | |
| 114 | Anger | FAERS: 6 | US FAERS | |
| 115 | Blood potassium decreased | FAERS: 6 | US FAERS | |
| 116 | Blood urine present | FAERS: 6 | US FAERS | |
| 117 | Cold sweat | FAERS: 6 | US FAERS | |
| 118 | Coma scale abnormal | FAERS: 6 | US FAERS | |
| 119 | Distributive shock | FAERS: 6 | US FAERS | |
| 120 | Drug ineffective for unapproved indication | FAERS: 6 | US FAERS | |
| 121 | Ear discomfort | FAERS: 6 | US FAERS | |
| 122 | Eczema | FAERS: 6 | OFFSIDES US FAERS | |
| 123 | Nephrolithiasis | FAERS: 6 | OFFSIDES US FAERS | |
| 124 | Product size issue | FAERS: 6 | US FAERS | |
| 125 | Product use complaint | FAERS: 6 | US FAERS | |
| 126 | Skin Ulcer | FAERS: 6 | US FAERS | |
| 127 | Thirst | FAERS: 6 | US FAERS | |
| 128 | Urinary Retention | FAERS: 6 | US FAERS | |
| 129 | Wrong technique in product usage process | FAERS: 6 | US FAERS | |
| 130 | Abasia | FAERS: 5 | OFFSIDES US FAERS | |
| 131 | Accidental exposure to product by child | FAERS: 5 | US FAERS | |
| 132 | Amnesia | FAERS: 5 | OFFSIDES US FAERS | |
| 133 | Blood creatine phosphokinase increased | FAERS: 5 | OFFSIDES US FAERS | |
| 134 | Cardiac dysfunction | FAERS: 5 | US FAERS | |
| 135 | Depressed mood | FAERS: 5 | US FAERS | |
| 136 | Drug dispensing error | FAERS: 5 | US FAERS | |
| 137 | Drug exposure during pregnancy | FAERS: 5 | US FAERS | |
| 138 | Dry skin | FAERS: 5 | OFFSIDES US FAERS | |
| 139 | Dysuria | FAERS: 5 | US FAERS | |
| 140 | Epistaxis | FAERS: 5 | OFFSIDES US FAERS | |
| 141 | Foreign body in respiratory tract | FAERS: 5 | US FAERS | |
| 142 | Hypertensive crisis | FAERS: 5 | US FAERS | |
| 143 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 144 | Lichen Planus | FAERS: 5 | US FAERS | |
| 145 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 146 | Myocardial Infarction | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 147 | Night sweats | FAERS: 5 | US FAERS | |
| 148 | No adverse event | FAERS: 5 | US FAERS | |
| 149 | Polyuria | FAERS: 5 | US FAERS | |
| 150 | Product coating issue | FAERS: 5 | US FAERS | |
| 151 | Respiratory arrest | FAERS: 5 | US FAERS | |
| 152 | Respiratory distress | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Weight decreased | FAERS: 5 | US FAERS | |
| 154 | Acute respiratory failure | FAERS: 4 | US FAERS | |
| 155 | Alanine Aminotransferase Increased | FAERS: 4 | OFFSIDES US FAERS | |
| 156 | Altered state of consciousness | FAERS: 4 | US FAERS | |
| 157 | Anaphylactic shock | FAERS: 4 | US FAERS | |
| 158 | Arthritis | FAERS: 4 | OFFSIDES US FAERS | |
| 159 | Blindness | FAERS: 4 | US FAERS | |
| 160 | Drug level above therapeutic | FAERS: 4 | US FAERS | |
| 161 | Dystonia | FAERS: 4 | US FAERS | |
| 162 | Eructation | FAERS: 4 | US FAERS | |
| 163 | Extra dose administered | FAERS: 4 | US FAERS | |
| 164 | Eye pain | FAERS: 4 | US FAERS | |
| 165 | Feeling jittery | FAERS: 4 | US FAERS | |
| 166 | Flatulence | FAERS: 4 | OFFSIDES US FAERS | |
| 167 | Gingival Hypertrophy | FAERS: 4 | US FAERS | |
| 168 | Leukocytosis | FAERS: 4 | US FAERS | |
| 169 | Limb discomfort | FAERS: 4 | OFFSIDES US FAERS | |
| 170 | Osteoporosis | FAERS: 4 | OFFSIDES US FAERS | |
| 171 | Pemphigus | FAERS: 4 | US FAERS | |
| 172 | Personality Change | FAERS: 4 | US FAERS | |
| 173 | Product shape issue | FAERS: 4 | US FAERS | |
| 174 | Product use in unapproved indication | FAERS: 4 | US FAERS | |
| 175 | Proteinuria | FAERS: 4 | US FAERS | |
| 176 | Sepsis | FAERS: 4 | US FAERS | |
| 177 | Sneezing | FAERS: 4 | US FAERS | |
| 178 | Stevens-Johnson Syndrome | FAERS: 4 | US FAERS | |
| 179 | Stress | FAERS: 4 | US FAERS | |
| 180 | Troponin increased | FAERS: 4 | US FAERS | |
| 181 | Unevaluable event | FAERS: 4 | US FAERS | |
| 182 | Urine ketone body present | FAERS: 4 | US FAERS | |
| 183 | Vitreous floaters | FAERS: 4 | US FAERS | |
| 184 | Agranulocytosis | FAERS: 3 | US FAERS | |
| 185 | Aspartate Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 186 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 187 | Blepharospasm | FAERS: 3 | US FAERS | |
| 188 | Blood pH decreased | FAERS: 3 | US FAERS | |
| 189 | Cardiac Flutter | FAERS: 3 | US FAERS | |
| 190 | Cellulitis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 191 | Choking sensation | FAERS: 3 | OFFSIDES US FAERS | |
| 192 | Dissociation | FAERS: 3 | US FAERS | |
| 193 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 194 | Drug toxicity | FAERS: 3 | US FAERS | |
| 195 | Emotional disorder | FAERS: 3 | US FAERS | |
| 196 | Formication | FAERS: 3 | US FAERS | |
| 197 | Gastritis | FAERS: 3 | US FAERS | |
| 198 | Joint injury | FAERS: 3 | US FAERS | |
| 199 | Leukocytoclastic vasculitis | FAERS: 3 | US FAERS | |
| 200 | Limb injury | FAERS: 3 | US FAERS | |
| 201 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 202 | Maternal exposure during pregnancy | FAERS: 3 | US FAERS | |
| 203 | Mental status changes | FAERS: 3 | OFFSIDES US FAERS | |
| 204 | Muscle tightness | FAERS: 3 | US FAERS | |
| 205 | Musculoskeletal discomfort | FAERS: 3 | OFFSIDES US FAERS | |
| 206 | Noninfective gingivitis | FAERS: 3 | US FAERS | |
| 207 | Pallor | FAERS: 3 | US FAERS | |
| 208 | Pancreatic carcinoma | FAERS: 3 | US FAERS | |
| 209 | Pericardial effusion | FAERS: 3 | OFFSIDES US FAERS | |
| 210 | Poisoning | FAERS: 3 | US FAERS | |
| 211 | Pseudolymphoma | FAERS: 3 | US FAERS | |
| 212 | Psoriasis | FAERS: 3 | US FAERS | |
| 213 | Tablet physical issue | FAERS: 3 | US FAERS | |
| 214 | Tooth Loss | FAERS: 3 | US FAERS | |
| 215 | Toxic Epidermal Necrolysis | FAERS: 3 | US FAERS | |
| 216 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 217 | jaundice | FAERS: 3 | US FAERS | |
| 218 | Abnormal weight gain | FAERS: 2 | US FAERS | |
| 219 | Acne | FAERS: 2 | US FAERS | |
| 220 | Akathisia | FAERS: 2 | US FAERS | |
| 221 | Allergic reaction to excipient | FAERS: 2 | US FAERS | |
| 222 | Apallic syndrome | FAERS: 2 | US FAERS | |
| 223 | Apathy | FAERS: 2 | US FAERS | |
| 224 | Aphonia | FAERS: 2 | OFFSIDES US FAERS | |
| 225 | Arteriosclerosis | FAERS: 2 | OFFSIDES US FAERS | |
| 226 | Blood aldosterone decreased | FAERS: 2 | US FAERS | |
| 227 | Blood creatine increased | FAERS: 2 | US FAERS | |
| 228 | Blood parathyroid hormone increased | FAERS: 2 | US FAERS | |
| 229 | Blood sodium decreased | FAERS: 2 | US FAERS | |
| 230 | Blood urea increased | FAERS: 2 | US FAERS | |
| 231 | Bronchitis | FAERS: 2 | OFFSIDES US FAERS | |
| 232 | Capillaritis | FAERS: 2 | US FAERS | |
| 233 | Capillary Leak Syndrome | FAERS: 2 | US FAERS | |
| 234 | Cardiomegaly | FAERS: 2 | US FAERS | |
| 235 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 236 | Cholestasis | FAERS: 2 | US FAERS | |
| 237 | Cholestatic liver injury | FAERS: 2 | US FAERS | |
| 238 | Chromaturia | FAERS: 2 | US FAERS | |
| 239 | Circumstance or information capable of leading to medication error | FAERS: 2 | US FAERS | |
| 240 | Coronary Artery Disease | FAERS: 2 | US FAERS | |
| 241 | Disseminated intravascular coagulation in newborn | FAERS: 2 | US FAERS | |
| 242 | Diverticulitis | FAERS: 2 | US FAERS | |
| 243 | Drug administration error | FAERS: 2 | US FAERS | |
| 244 | Drug dose omission | FAERS: 2 | US FAERS | |
| 245 | Drug level decreased | FAERS: 2 | US FAERS | |
| 246 | Duodenogastric Reflux | FAERS: 2 | US FAERS | |
| 247 | Dyschezia | FAERS: 2 | US FAERS | |
| 248 | Ecchymosis | FAERS: 2 | US FAERS | |
| 249 | Economic problem | FAERS: 2 | US FAERS | |
| 250 | Exophthalmos | FAERS: 2 | US FAERS | |
| 251 | Eye Infection | FAERS: 2 | US FAERS | |
| 252 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 253 | Food Allergy | FAERS: 2 | OFFSIDES US FAERS | |
| 254 | Hemiplegia | FAERS: 2 | US FAERS | |
| 255 | Hepatitis | FAERS: 2 | US FAERS | |
| 256 | Hypokinesia | FAERS: 2 | US FAERS | |
| 257 | Hypoperfusion | FAERS: 2 | US FAERS | |
| 258 | Impatience | FAERS: 2 | US FAERS | |
| 259 | Infection | FAERS: 2 | OFFSIDES US FAERS | |
| 260 | Intentional drug misuse | FAERS: 2 | US FAERS | |
| 261 | Intentional self-injury | FAERS: 2 | OFFSIDES US FAERS | |
| 262 | Intestinal Obstruction | FAERS: 2 | US FAERS | |
| 263 | Loose tooth | FAERS: 2 | US FAERS | |
| 264 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 265 | Medication Error | FAERS: 2 | US FAERS | |
| 266 | Morbid thoughts | FAERS: 2 | OFFSIDES US FAERS | |
| 267 | Mouth swelling | FAERS: 2 | US FAERS | |
| 268 | Multiple allergies | FAERS: 2 | US FAERS | |
| 269 | Muscle strain | FAERS: 2 | US FAERS | |
| 270 | Pancytopenia | FAERS: 2 | US FAERS | |
| 271 | Paranoia | FAERS: 2 | US FAERS | |
| 272 | Pelvic Pain | FAERS: 2 | US FAERS | |
| 273 | Periodontitis | FAERS: 2 | US FAERS | |
| 274 | Peritoneal effluent leukocyte count increased | FAERS: 2 | US FAERS | |
| 275 | Petechiae | FAERS: 2 | US FAERS | |
| 276 | Polyhydramnios | FAERS: 2 | US FAERS | |
| 277 | Product complaint | FAERS: 2 | US FAERS | |
| 278 | Product formulation issue | FAERS: 2 | US FAERS | |
| 279 | Productive Cough | FAERS: 2 | US FAERS | |
| 280 | Psychiatric symptom | FAERS: 2 | US FAERS | |
| 281 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 282 | Rales | FAERS: 2 | US FAERS | |
| 283 | Rash erythematous | FAERS: 2 | US FAERS | |
| 284 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 285 | Rectal spasm | FAERS: 2 | US FAERS | |
| 286 | Renal pain | FAERS: 2 | US FAERS | |
| 287 | Renin decreased | FAERS: 2 | US FAERS | |
| 288 | Renin increased | FAERS: 2 | US FAERS | |
| 289 | Restlessness | FAERS: 2 | US FAERS | |
| 290 | Retching | FAERS: 2 | US FAERS | |
| 291 | Rhonchi | FAERS: 2 | US FAERS | |
| 292 | Rosacea | FAERS: 2 | US FAERS | |
| 293 | Scab | FAERS: 2 | OFFSIDES US FAERS | |
| 294 | Sexual Dysfunction | FAERS: 2 | US FAERS | |
| 295 | Skin reaction | FAERS: 2 | US FAERS | |
| 296 | Stomatitis | FAERS: 2 | US FAERS | |
| 297 | Toothache | FAERS: 2 | US FAERS | |
| 298 | Torticollis | FAERS: 2 | US FAERS | |
| 299 | Traumatic Brain Injury | FAERS: 2 | US FAERS | |
| 300 | Traumatic liver injury | FAERS: 2 | US FAERS | |
| 301 | Urethral Stenosis | FAERS: 2 | US FAERS | |
| 302 | Vascular resistance systemic decreased | FAERS: 2 | US FAERS | |
| 303 | Vulvovaginal burning sensation | FAERS: 2 | US FAERS | |
| 304 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 305 | Wrong drug administered | FAERS: 2 | US FAERS | |
| 306 | Abnormal sleep-related event | FAERS: 1 | US FAERS | |
| 307 | Accidental exposure to product | FAERS: 1 | US FAERS | |
| 308 | Accidental exposure | FAERS: 1 | US FAERS | |
| 309 | Acute Lung Injury | FAERS: 1 | US FAERS | |
| 310 | Acute cutaneous lupus erythematosus | FAERS: 1 | US FAERS | |
| 311 | Alcohol interaction | FAERS: 1 | US FAERS | |
| 312 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 313 | Ankylosing spondylitis | FAERS: 1 | US FAERS | |
| 314 | Aphagia | FAERS: 1 | OFFSIDES US FAERS | |
| 315 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 316 | Apparent death | FAERS: 1 | US FAERS | |
| 317 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 318 | Arthropathy | FAERS: 1 | US FAERS | |
| 319 | Asthma | FAERS: 1 | US FAERS | |
| 320 | Atelectasis | FAERS: 1 | US FAERS | |
| 321 | Base excess decreased | FAERS: 1 | US FAERS | |
| 322 | Bedridden | FAERS: 1 | OFFSIDES US FAERS | |
| 323 | Bladder pain | FAERS: 1 | US FAERS | |
| 324 | Bleeding time shortened | FAERS: 1 | US FAERS | |
| 325 | Blood blister | FAERS: 1 | US FAERS | |
| 326 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 327 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 328 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 329 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 330 | Blood magnesium decreased | FAERS: 1 | US FAERS | |
| 331 | Blood testosterone increased | FAERS: 1 | US FAERS | |
| 332 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 333 | Bone pain | FAERS: 1 | US FAERS | |
| 334 | Brain Death | FAERS: 1 | US FAERS | |
| 335 | Brain stem syndrome | FAERS: 1 | US FAERS | |
| 336 | Bronchial Hyperreactivity | FAERS: 1 | US FAERS | |
| 337 | Bruxism | FAERS: 1 | US FAERS | |
| 338 | Carcinoembryonic antigen increased | FAERS: 1 | US FAERS | |
| 339 | Carcinogenicity | FAERS: 1 | US FAERS | |
| 340 | Cerebellar infarction | FAERS: 1 | US FAERS | |
| 341 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 342 | Cerebral disorder | FAERS: 1 | US FAERS | |
| 343 | Cerebral hypoperfusion | FAERS: 1 | US FAERS | |
| 344 | Chills | FAERS: 1 | US FAERS | |
| 345 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 346 | Chronic pigmented purpura | FAERS: 1 | US FAERS | |
| 347 | Coagulation time shortened | FAERS: 1 | US FAERS | |
| 348 | Congenital cystic kidney disease | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 349 | Contact lens intolerance | FAERS: 1 | US FAERS | |
| 350 | Creatinine renal clearance decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 351 | Cyst | FAERS: 1 | US FAERS | |
| 352 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 353 | Cytomegalovirus enterocolitis | FAERS: 1 | US FAERS | |
| 354 | Deafness | FAERS: 1 | US FAERS | |
| 355 | Delirium | FAERS: 1 | US FAERS | |
| 356 | Dementia | FAERS: 1 | US FAERS | |
| 357 | Demyelination | FAERS: 1 | OFFSIDES US FAERS | |
| 358 | Diabetes mellitus inadequate control | FAERS: 1 | OFFSIDES US FAERS | |
| 359 | Diplopia | FAERS: 1 | US FAERS | |
| 360 | Disease recurrence | FAERS: 1 | US FAERS | |
| 361 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 362 | Dysplasia | FAERS: 1 | US FAERS | |
| 363 | Ear congestion | FAERS: 1 | US FAERS | |
| 364 | Ejection Fraction Decreased | FAERS: 1 | US FAERS | |
| 365 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 366 | Emotional distress | FAERS: 1 | US FAERS | |
| 367 | Endoscopy upper gastrointestinal tract abnormal | FAERS: 1 | US FAERS | |
| 368 | Enzyme abnormality | FAERS: 1 | US FAERS | |
| 369 | Eosinophilic Pneumonia | FAERS: 1 | US FAERS | |
| 370 | Essential Hypertension | FAERS: 1 | US FAERS | |
| 371 | Expired product administered | FAERS: 1 | US FAERS | |
| 372 | Eye irritation | FAERS: 1 | US FAERS | |
| 373 | Eyelids pruritus | FAERS: 1 | US FAERS | |
| 374 | Facial Neuralgia | FAERS: 1 | US FAERS | |
| 375 | Flat affect | FAERS: 1 | US FAERS | |
| 376 | Fluid overload | FAERS: 1 | OFFSIDES US FAERS | |
| 377 | Gait inability | FAERS: 1 | US FAERS | |
| 378 | Gastric Fistula | FAERS: 1 | US FAERS | |
| 379 | Gastric ulcer helicobacter | FAERS: 1 | US FAERS | |
| 380 | Gastric ulcer | FAERS: 1 | OFFSIDES US FAERS | |
| 381 | Gastrointestinal hypomotility | FAERS: 1 | US FAERS | |
| 382 | Gastrointestinal motility disorder | FAERS: 1 | OFFSIDES US FAERS | |
| 383 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 384 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 385 | Gingival Atrophy | FAERS: 1 | US FAERS | |
| 386 | Gingival Recession | FAERS: 1 | US FAERS | |
| 387 | Gingival erythema | FAERS: 1 | US FAERS | |
| 388 | Gout | FAERS: 1 | US FAERS | |
| 389 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 390 | Hepatotoxicity | FAERS: 1 | US FAERS | |
| 391 | Hernia | FAERS: 1 | US FAERS | |
| 392 | Hordeolum | FAERS: 1 | US FAERS | |
| 393 | Hostility | FAERS: 1 | US FAERS | |
| 394 | Hunger | FAERS: 1 | US FAERS | |
| 395 | Hyperdynamic left ventricle | FAERS: 1 | US FAERS | |
| 396 | Hypersomnia | FAERS: 1 | US FAERS | |
| 397 | Hypohidrosis | FAERS: 1 | US FAERS | |
| 398 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 399 | Idiopathic angioedema | FAERS: 1 | US FAERS | |
| 400 | Idiopathic urticaria | FAERS: 1 | US FAERS | |
| 401 | Impaired driving ability | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 402 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 403 | Incision site abscess | FAERS: 1 | US FAERS | |
| 404 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 405 | Initial insomnia | FAERS: 1 | US FAERS | |
| 406 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 407 | Joint stiffness | FAERS: 1 | OFFSIDES US FAERS | |
| 408 | Labile blood pressure | FAERS: 1 | OFFSIDES US FAERS | |
| 409 | Leukopenia | FAERS: 1 | US FAERS | |
| 410 | Libido disorder | FAERS: 1 | US FAERS | |
| 411 | Live Birth | FAERS: 1 | US FAERS | |
| 412 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 413 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 414 | Lyme Disease | FAERS: 1 | US FAERS | |
| 415 | Lymphoma | FAERS: 1 | US FAERS | |
| 416 | Macular degeneration | FAERS: 1 | US FAERS | |
| 417 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 418 | Micturition frequency decreased | FAERS: 1 | US FAERS | |
| 419 | Middle insomnia | FAERS: 1 | US FAERS | |
| 420 | Moaning | FAERS: 1 | US FAERS | |
| 421 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 422 | Multiple drug overdose intentional | FAERS: 1 | US FAERS | |
| 423 | Muscle hypertrophy | FAERS: 1 | US FAERS | |
| 424 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 425 | Myopia | FAERS: 1 | OFFSIDES US FAERS | |
| 426 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 427 | Necrosis | FAERS: 1 | US FAERS | |
| 428 | Nephrectomy | FAERS: 1 | US FAERS | |
| 429 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 430 | Nerve injury | FAERS: 1 | US FAERS | |
| 431 | Neuritis | FAERS: 1 | US FAERS | |
| 432 | Onychoclasis | FAERS: 1 | US FAERS | |
| 433 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 434 | Oral mucosal hypertrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 435 | Oral pain | FAERS: 1 | US FAERS | |
| 436 | Oropharyngeal blistering | FAERS: 1 | US FAERS | |
| 437 | Oropharyngeal discomfort | FAERS: 1 | US FAERS | |
| 438 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 439 | PO2 increased | FAERS: 1 | US FAERS | |
| 440 | Pain of skin | FAERS: 1 | US FAERS | |
| 441 | Parotitis | FAERS: 1 | US FAERS | |
| 442 | Pharmaceutical product counterfeit | FAERS: 1 | US FAERS | |
| 443 | Phlebitis | FAERS: 1 | US FAERS | |
| 444 | Photophobia | FAERS: 1 | US FAERS | |
| 445 | Pneumatosis intestinalis | FAERS: 1 | US FAERS | |
| 446 | Pneumonia | FAERS: 1 | US FAERS | |
| 447 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 448 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 449 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 450 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 451 | Product counterfeit | FAERS: 1 | US FAERS | |
| 452 | Product dispensing error | FAERS: 1 | US FAERS | |
| 453 | Product dose omission | FAERS: 1 | US FAERS | |
| 454 | Product friable | FAERS: 1 | US FAERS | |
| 455 | Product label issue | FAERS: 1 | US FAERS | |
| 456 | Product name confusion | FAERS: 1 | US FAERS | |
| 457 | Product residue present | FAERS: 1 | US FAERS | |
| 458 | Prostate cancer recurrent | FAERS: 1 | US FAERS | |
| 459 | Pseudobulbar Palsy | FAERS: 1 | US FAERS | |
| 460 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 461 | Pyogenic granuloma | FAERS: 1 | US FAERS | |
| 462 | Quality of life decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 463 | Recalled product administered | FAERS: 1 | US FAERS | |
| 464 | Reflux gastritis | FAERS: 1 | US FAERS | |
| 465 | Refusal of treatment by relative | FAERS: 1 | US FAERS | |
| 466 | Renal cyst | FAERS: 1 | US FAERS | |
| 467 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 468 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 469 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 470 | Sciatica | FAERS: 1 | US FAERS | |
| 471 | Secretion discharge | FAERS: 1 | US FAERS | |
| 472 | Sinus headache | FAERS: 1 | US FAERS | |
| 473 | Sinus pain | FAERS: 1 | US FAERS | |
| 474 | Skin Erosion | FAERS: 1 | US FAERS | |
| 475 | Skin hypertrophy | FAERS: 1 | OFFSIDES US FAERS | |
| 476 | Skin irritation | FAERS: 1 | US FAERS | |
| 477 | Skin lesion | FAERS: 1 | OFFSIDES US FAERS | |
| 478 | Slow response to stimuli | FAERS: 1 | US FAERS | |
| 479 | Sunburn | FAERS: 1 | US FAERS | |
| 480 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 481 | Tablet issue | FAERS: 1 | US FAERS | |
| 482 | Therapeutic product effect incomplete | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 483 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 484 | Thermal burn | FAERS: 1 | US FAERS | |
| 485 | Thrombocytopenia | FAERS: 1 | US FAERS | |
| 486 | Thrombosis | FAERS: 1 | US FAERS | |
| 487 | Tinea cruris | FAERS: 1 | US FAERS | |
| 488 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 489 | Toxicologic test abnormal | FAERS: 1 | US FAERS | |
| 490 | Trigeminal Neuralgia | FAERS: 1 | US FAERS | |
| 491 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 492 | Upper respiratory tract irritation | FAERS: 1 | US FAERS | |
| 493 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 494 | Urge Incontinence | FAERS: 1 | US FAERS | |
| 495 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 496 | Vasodilation procedure | FAERS: 1 | US FAERS | |
| 497 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 498 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 499 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 500 | Withdrawal hypertension | FAERS: 1 | US FAERS | |
| 501 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 502 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 503 | furuncle | FAERS: 1 | US FAERS | |
| 504 | muscle injury | FAERS: 1 | US FAERS | |
| 505 | nervous system disorder | FAERS: 1 | US FAERS | |
| 506 | Abnormal vision | OFFSIDES | ||
| 507 | Adenoma | OFFSIDES | ||
| 508 | Alveolitis | OFFSIDES | ||
| 509 | Anorexia | OFFSIDES | ||
| 510 | Aspergillosis | OFFSIDES | ||
| 511 | Bile duct cancer stage III | OFFSIDES | ||
| 512 | Biliary dilatation | OFFSIDES | ||
| 513 | Blood Glucose | OFFSIDES | ||
| 514 | Blood albumin decreased | OFFSIDES | ||
| 515 | Blood cholesterol | OFFSIDES | ||
| 516 | Blood glucose decreased | OFFSIDES | ||
| 517 | Blood immunoglobulin A decreased | OFFSIDES | ||
| 518 | Blood sodium abnormal | OFFSIDES | ||
| 519 | Blood sodium | OFFSIDES | ||
| 520 | Blood urea abnormal | OFFSIDES | ||
| 521 | Blood uric acid | OFFSIDES | ||
| 522 | Blurred vision | OFFSIDES | ||
| 523 | Brain natriuretic peptide decreased | OFFSIDES | ||
| 524 | Brain scan abnormal | OFFSIDES | ||
| 525 | Bronchoalveolar Lavage | OFFSIDES | ||
| 526 | Cardiac asthma | OFFSIDES | ||
| 527 | Cerebral atrophy | OFFSIDES | ||
| 528 | Cholangiolitis | OFFSIDES | ||
| 529 | Choroidal Detachment | OFFSIDES | ||
| 530 | Chronic Fatigue Syndrome | OFFSIDES | ||
| 531 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 532 | Clumsiness | OFFSIDES | ||
| 533 | Compression fracture | OFFSIDES | ||
| 534 | Confabulation | OFFSIDES | ||
| 535 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 536 | Dental prosthesis placement | OFFSIDES | ||
| 537 | Diabetes | OFFSIDES | ||
| 538 | Diabetic Nephropathy | OFFSIDES | ||
| 539 | Diarrhea | OFFSIDES | ||
| 540 | Diastolic dysfunction | OFFSIDES | ||
| 541 | Differential white blood cell count abnormal | OFFSIDES | ||
| 542 | Diffuse Large B-Cell Lymphoma | OFFSIDES | ||
| 543 | Ectropion | OFFSIDES | ||
| 544 | Ejection fraction abnormal | OFFSIDES | ||
| 545 | Endocarditis | OFFSIDES | ||
| 546 | Endodontic procedure | OFFSIDES | ||
| 547 | Endothelin abnormal | OFFSIDES | ||
| 548 | Erosive gastritis | OFFSIDES | ||
| 549 | Esophageal Stenosis | OFFSIDES | ||
| 550 | Excoriation | OFFSIDES | ||
| 551 | Femoral artery occlusion | OFFSIDES | ||
| 552 | Filariasis | OFFSIDES | ||
| 553 | Gamma-Glutamyltransferase Increased | OFFSIDES | ||
| 554 | Gastric Dilatation | OFFSIDES | ||
| 555 | Gastrinoma | OFFSIDES | ||
| 556 | Glaucoma | OFFSIDES | ||
| 557 | Granulocytosis | OFFSIDES | ||
| 558 | Hemiparesis | OFFSIDES | ||
| 559 | Hepatic vein stenosis | OFFSIDES | ||
| 560 | Hip surgery | OFFSIDES | ||
| 561 | Hyperkeratosis | OFFSIDES | ||
| 562 | Hyperpigmentation | OFFSIDES | ||
| 563 | Immunosuppressant drug level decreased | OFFSIDES | ||
| 564 | Impaired gastric emptying | OFFSIDES | ||
| 565 | Infusion site mobility decreased | OFFSIDES | ||
| 566 | Interleukin-2 receptor increased | OFFSIDES | ||
| 567 | Joint Instability | OFFSIDES | ||
| 568 | Joint Range of Motion Decreased | OFFSIDES | ||
| 569 | Joint warmth | OFFSIDES | ||
| 570 | Keratitis sicca | OFFSIDES | ||
| 571 | Kidney Failure | OFFSIDES | ||
| 572 | Lactose Intolerance | OFFSIDES | ||
| 573 | Leishmaniasis | OFFSIDES | ||
| 574 | Lung infection pseudomonal | OFFSIDES | ||
| 575 | Malignant neoplasm progression | OFFSIDES | ||
| 576 | Mallory-Weiss Syndrome | OFFSIDES | ||
| 577 | Meningioma | OFFSIDES | ||
| 578 | Muscle Weakness | OFFSIDES | ||
| 579 | Mycosis Fungoides | OFFSIDES | ||
| 580 | Myoglobin blood increased | OFFSIDES | ||
| 581 | Nephrogenic Fibrosing Dermopathy | OFFSIDES | ||
| 582 | Open reduction of fracture | OFFSIDES | ||
| 583 | Open wound | OFFSIDES | ||
| 584 | Oral infection | OFFSIDES | ||
| 585 | Osteomyelitis | OFFSIDES | ||
| 586 | Osteopenia | OFFSIDES | ||
| 587 | Panel-reactive antibody increased | OFFSIDES | ||
| 588 | Peripheral arterial occlusive disease | OFFSIDES | ||
| 589 | Pharyngeal swelling | Canada Vigilance: 1 | Canada Vigilance | |
| 590 | Pharyngolaryngeal Pain | OFFSIDES | ||
| 591 | Post procedural cellulitis | OFFSIDES | ||
| 592 | Postoperative fever | OFFSIDES | ||
| 593 | Prolapse repair | OFFSIDES | ||
| 594 | Psychotic disorder due to a general medical condition | OFFSIDES | ||
| 595 | Pulmonary Hypertension | OFFSIDES | ||
| 596 | Pulmonary thrombosis | OFFSIDES | ||
| 597 | Rectal Prolapse | OFFSIDES | ||
| 598 | Renal artery occlusion | OFFSIDES | ||
| 599 | Renal tubular necrosis | OFFSIDES | ||
| 600 | Retinal Artery Occlusion | OFFSIDES | ||
| 601 | Rhinorrhea | OFFSIDES | ||
| 602 | Sarcoidosis | OFFSIDES | ||
| 603 | Schizophrenia | OFFSIDES | ||
| 604 | Scleroderma | OFFSIDES | ||
| 605 | Scotoma | OFFSIDES | ||
| 606 | Septic Shock | OFFSIDES | ||
| 607 | Shoulder Pain | OFFSIDES | ||
| 608 | Skin Induration | OFFSIDES | ||
| 609 | Skin neoplasm excision | OFFSIDES | ||
| 610 | Skin tightness | OFFSIDES | ||
| 611 | Subcutaneous nodule | OFFSIDES | ||
| 612 | Tendinitis | OFFSIDES | ||
| 613 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 614 | Transfusion Reaction | OFFSIDES | ||
| 615 | Upper respiratory tract inflammation | OFFSIDES | ||
| 616 | Ureterostomy site discomfort | OFFSIDES | ||
| 617 | Vitreous Detachment | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.