Axitinib
(RITAVMQDGBJQJZ-FMIVXFBMSA-N)
Structure
- SMILES
- CNC(=O)c1ccccc1Sc1ccc2c(c1)[nH]nc2/C=C/c1ccccn1
- Type(s)
- Approved; Investigational
- ATC code(s)
- L01XE17
- Molecular Formula:
- C22H18N4OS
- Molecular Weight:
- 386.470
- Log P:
- 5.0300
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 95.97
- CAS Number(s):
- 319460-85-0; 319463-51-9
Synonym(s)
1.
Axitinib
2.
AG 013736
3.
AG-013736
4.
AG013736
5.
Inlyta
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Disease Progression | FAERS: 757 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 2 | Fatigue | FAERS: 360 | 19652060 | CTD OFFSIDES SIDER US FAERS |
| 3 | Dysphonia | FAERS: 220 | SIDER US FAERS | |
| 4 | Nausea | FAERS: 198 | SIDER US FAERS | |
| 5 | Weight decreased | FAERS: 178 | SIDER US FAERS | |
| 6 | Asthenia | FAERS: 155 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 7 | Renal Cell Carcinoma | FAERS: 154 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 8 | Malaise | FAERS: 139 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Headache | FAERS: 118 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 10 | Metastatic Renal Cell Carcinoma | FAERS: 113 Canada Vigilance: 6 | Canada Vigilance US FAERS | |
| 11 | Vomiting | FAERS: 112 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 12 | Constipation | FAERS: 99 | SIDER US FAERS | |
| 13 | Stomatitis | FAERS: 99 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 14 | Dehydration | FAERS: 87 | 19652060 | CTD SIDER US FAERS |
| 15 | Pain | FAERS: 85 | US FAERS | |
| 16 | Proteinuria | FAERS: 75 | SIDER US FAERS | |
| 17 | Dizziness | FAERS: 73 | SIDER US FAERS | |
| 18 | Arthralgia | FAERS: 72 | SIDER US FAERS | |
| 19 | Pneumonia | FAERS: 72 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 20 | Abdominal Pain | FAERS: 54 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 21 | Hypothyroidism | FAERS: 47 | SIDER US FAERS | |
| 22 | Back Pain | FAERS: 46 | US FAERS | |
| 23 | General physical health deterioration | FAERS: 41 | US FAERS | |
| 24 | Abdominal discomfort | FAERS: 39 | US FAERS | |
| 25 | Myalgia | FAERS: 39 | SIDER US FAERS | |
| 26 | Dysgeusia | FAERS: 38 | SIDER US FAERS | |
| 27 | Aphonia | FAERS: 35 | US FAERS | |
| 28 | Nephrotic Syndrome | FAERS: 34 | US FAERS | |
| 29 | Oral pain | FAERS: 34 | US FAERS | |
| 30 | Urinary tract infection | FAERS: 34 | US FAERS | |
| 31 | Cerebrovascular accident | FAERS: 31 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 32 | Oropharyngeal pain | FAERS: 30 | SIDER US FAERS | |
| 33 | Somnolence | FAERS: 30 | US FAERS | |
| 34 | Blood creatinine increased | FAERS: 29 | SIDER US FAERS | |
| 35 | Ascites | FAERS: 27 | US FAERS | |
| 36 | Myocardial Infarction | FAERS: 27 | SIDER US FAERS | |
| 37 | Chest Pain | FAERS: 26 | US FAERS | |
| 38 | Posterior reversible encephalopathy syndrome | FAERS: 26 | SIDER US FAERS | |
| 39 | Pruritus | FAERS: 26 | SIDER US FAERS | |
| 40 | Cholecystitis | FAERS: 25 | OFFSIDES US FAERS | |
| 41 | Epistaxis | FAERS: 25 | SIDER US FAERS | |
| 42 | Peripheral swelling | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Renal cancer metastatic | FAERS: 25 | US FAERS | |
| 44 | Dry skin | FAERS: 24 | SIDER US FAERS | |
| 45 | Infection | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Product use issue | FAERS: 24 | US FAERS | |
| 47 | Lower respiratory tract infection | FAERS: 23 | US FAERS | |
| 48 | Hypotension | FAERS: 22 | 19652060 | CTD US FAERS |
| 49 | Nasopharyngitis | FAERS: 21 | US FAERS | |
| 50 | Dyspepsia | FAERS: 20 | SIDER US FAERS | |
| 51 | Cerebral Infarction | FAERS: 18 | US FAERS | |
| 52 | Feeling abnormal | FAERS: 18 | US FAERS | |
| 53 | Product use in unapproved indication | FAERS: 18 | US FAERS | |
| 54 | Thrombocytopenia | FAERS: 18 | SIDER US FAERS | |
| 55 | Acute kidney injury | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Flatulence | FAERS: 17 | SIDER US FAERS | |
| 57 | Hyperkeratosis | FAERS: 17 | US FAERS | |
| 58 | Sepsis | FAERS: 17 | US FAERS | |
| 59 | Blood thyroid stimulating hormone increased | FAERS: 16 | SIDER US FAERS | |
| 60 | Memory impairment | FAERS: 16 | US FAERS | |
| 61 | Respiratory Failure | FAERS: 16 | US FAERS | |
| 62 | Disorientation | FAERS: 15 | US FAERS | |
| 63 | Erythema | FAERS: 15 | SIDER US FAERS | |
| 64 | Hypophagia | FAERS: 15 | US FAERS | |
| 65 | Pneumothorax | FAERS: 15 | OFFSIDES US FAERS | |
| 66 | Abasia | FAERS: 14 | US FAERS | |
| 67 | Amnesia | FAERS: 14 | US FAERS | |
| 68 | Bone pain | FAERS: 14 | US FAERS | |
| 69 | Drug dose omission | FAERS: 14 | US FAERS | |
| 70 | Limb discomfort | FAERS: 14 | US FAERS | |
| 71 | Blood glucose increased | FAERS: 13 | US FAERS | |
| 72 | Epilepsy | FAERS: 13 | US FAERS | |
| 73 | Pancreatitis | FAERS: 13 | US FAERS | |
| 74 | Visual Impairment | FAERS: 13 | US FAERS | |
| 75 | Alopecia | FAERS: 12 | SIDER US FAERS | |
| 76 | Dementia | FAERS: 12 | US FAERS | |
| 77 | Hypersensitivity | FAERS: 12 | US FAERS | |
| 78 | Ileus | FAERS: 12 | US FAERS | |
| 79 | Influenza | FAERS: 12 | US FAERS | |
| 80 | Musculoskeletal Pain | FAERS: 12 | US FAERS | |
| 81 | Pulmonary Embolism | FAERS: 12 | SIDER US FAERS | |
| 82 | Skin lesion | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 83 | Syncope | FAERS: 12 | US FAERS | |
| 84 | Thrombosis | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 85 | Atrial Fibrillation | FAERS: 11 | US FAERS | |
| 86 | Blindness | FAERS: 11 | US FAERS | |
| 87 | Blood lactate dehydrogenase increased | FAERS: 11 | US FAERS | |
| 88 | Burning sensation | FAERS: 11 | US FAERS | |
| 89 | Increased tendency to bruise | FAERS: 11 | US FAERS | |
| 90 | Joint swelling | FAERS: 11 | US FAERS | |
| 91 | Aphasia | FAERS: 10 | US FAERS | |
| 92 | Cellulitis | FAERS: 10 | US FAERS | |
| 93 | Chills | FAERS: 10 | US FAERS | |
| 94 | Fracture | FAERS: 10 | US FAERS | |
| 95 | Hypertensive crisis | FAERS: 10 | SIDER US FAERS | |
| 96 | Productive Cough | FAERS: 10 | US FAERS | |
| 97 | Therapy cessation | FAERS: 10 | US FAERS | |
| 98 | Tremor | FAERS: 10 | US FAERS | |
| 99 | Anxiety | FAERS: 9 | US FAERS | |
| 100 | Blood urea increased | FAERS: 9 | US FAERS | |
| 101 | Drug ineffective | FAERS: 9 | US FAERS | |
| 102 | Hypersomnia | FAERS: 9 | US FAERS | |
| 103 | White blood cell count decreased | FAERS: 9 | SIDER US FAERS | |
| 104 | Ageusia | FAERS: 8 | US FAERS | |
| 105 | Arthritis | FAERS: 8 | US FAERS | |
| 106 | Blood alkaline phosphatase increased | FAERS: 8 | SIDER US FAERS | |
| 107 | Chest discomfort | FAERS: 8 | US FAERS | |
| 108 | Cholelithiasis | FAERS: 8 | US FAERS | |
| 109 | Deafness | FAERS: 8 | US FAERS | |
| 110 | Gastritis | FAERS: 8 | US FAERS | |
| 111 | Neutropenia | FAERS: 8 | SIDER US FAERS | |
| 112 | Night sweats | FAERS: 8 | US FAERS | |
| 113 | Pneumatosis intestinalis | FAERS: 8 | US FAERS | |
| 114 | Protein urine present | FAERS: 8 | SIDER US FAERS | |
| 115 | Acute myocardial infarction | FAERS: 7 | SIDER US FAERS | |
| 116 | Asthma | FAERS: 7 | US FAERS | |
| 117 | Cancer Pain | FAERS: 7 | US FAERS | |
| 118 | Depressed mood | FAERS: 7 | US FAERS | |
| 119 | Gait inability | FAERS: 7 | US FAERS | |
| 120 | Leukoencephalopathy | FAERS: 7 | US FAERS | |
| 121 | Mental impairment | FAERS: 7 | US FAERS | |
| 122 | Pericardial effusion | FAERS: 7 | US FAERS | |
| 123 | Tachycardia | FAERS: 7 | US FAERS | |
| 124 | Throat irritation | FAERS: 7 | US FAERS | |
| 125 | Tongue blistering | FAERS: 7 | US FAERS | |
| 126 | Toxicity to various agents | FAERS: 7 | US FAERS | |
| 127 | Urinary Retention | FAERS: 7 | US FAERS | |
| 128 | Aspartate Aminotransferase Increased | FAERS: 6 | SIDER US FAERS | |
| 129 | Blood potassium increased | FAERS: 6 | US FAERS | |
| 130 | Bradycardia | FAERS: 6 | OFFSIDES US FAERS | |
| 131 | Depressed Level of Consciousness | FAERS: 6 | OFFSIDES US FAERS | |
| 132 | Diabetes Mellitus | FAERS: 6 | US FAERS | |
| 133 | Discomfort | FAERS: 6 | US FAERS | |
| 134 | Diverticulitis | FAERS: 6 | US FAERS | |
| 135 | Dysarthria | FAERS: 6 | US FAERS | |
| 136 | Hypogeusia | FAERS: 6 | US FAERS | |
| 137 | Hypokinesia | FAERS: 6 | US FAERS | |
| 138 | Inflammation | FAERS: 6 | US FAERS | |
| 139 | Intentional product misuse | FAERS: 6 | US FAERS | |
| 140 | Intestinal Obstruction | FAERS: 6 | US FAERS | |
| 141 | Lethargy | FAERS: 6 | US FAERS | |
| 142 | Musculoskeletal stiffness | FAERS: 6 | US FAERS | |
| 143 | Neck Pain | FAERS: 6 | US FAERS | |
| 144 | Palpitations | FAERS: 6 | US FAERS | |
| 145 | Skin Ulcer | FAERS: 6 | US FAERS | |
| 146 | Sudden death | FAERS: 6 | US FAERS | |
| 147 | Toothache | FAERS: 6 | US FAERS | |
| 148 | jaundice | FAERS: 6 | US FAERS | |
| 149 | Acne | FAERS: 5 | US FAERS | |
| 150 | Altered state of consciousness | FAERS: 5 | US FAERS | |
| 151 | Aphagia | FAERS: 5 | US FAERS | |
| 152 | Appendicitis | FAERS: 5 | US FAERS | |
| 153 | Asphyxia | FAERS: 5 | US FAERS | |
| 154 | Blood potassium decreased | FAERS: 5 | US FAERS | |
| 155 | Blood pressure fluctuation | FAERS: 5 | US FAERS | |
| 156 | Bronchopulmonary Aspergillosis | FAERS: 5 | US FAERS | |
| 157 | Chromaturia | FAERS: 5 | US FAERS | |
| 158 | Colitis | FAERS: 5 | US FAERS | |
| 159 | Cyst | FAERS: 5 | US FAERS | |
| 160 | Decreased immune responsiveness | FAERS: 5 | US FAERS | |
| 161 | Delirium | FAERS: 5 | US FAERS | |
| 162 | Disseminated Intravascular Coagulation | FAERS: 5 | US FAERS | |
| 163 | Eructation | FAERS: 5 | US FAERS | |
| 164 | Glossitis | FAERS: 5 | US FAERS | |
| 165 | Hemiparesis | FAERS: 5 | US FAERS | |
| 166 | Hernia | FAERS: 5 | US FAERS | |
| 167 | Intentional product use issue | FAERS: 5 | US FAERS | |
| 168 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 169 | Pneumonitis | FAERS: 5 | US FAERS | |
| 170 | Thyroiditis | FAERS: 5 | US FAERS | |
| 171 | Urticaria | FAERS: 5 | US FAERS | |
| 172 | Activities of daily living impaired | FAERS: 4 | US FAERS | |
| 173 | Adverse event | FAERS: 4 | US FAERS | |
| 174 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 175 | Blood cholesterol increased | FAERS: 4 | US FAERS | |
| 176 | Blood count abnormal | FAERS: 4 | US FAERS | |
| 177 | Blood glucose decreased | FAERS: 4 | US FAERS | |
| 178 | Cardiac Arrest | FAERS: 4 | US FAERS | |
| 179 | Cardiac dysfunction | FAERS: 4 | US FAERS | |
| 180 | Cholangitis | FAERS: 4 | US FAERS | |
| 181 | Clostridium difficile infection | FAERS: 4 | US FAERS | |
| 182 | Cold sweat | FAERS: 4 | US FAERS | |
| 183 | Enterocolitis | FAERS: 4 | US FAERS | |
| 184 | Hepatotoxicity | FAERS: 4 | US FAERS | |
| 185 | Hydronephrosis | FAERS: 4 | US FAERS | |
| 186 | Hyperthyroidism | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 187 | Lipase increased | FAERS: 4 | SIDER US FAERS | |
| 188 | Malignant neoplasm progression | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 189 | Mental status changes | FAERS: 4 | OFFSIDES US FAERS | |
| 190 | Nasal discomfort | FAERS: 4 | US FAERS | |
| 191 | Nervousness | FAERS: 4 | US FAERS | |
| 192 | Neutrophil count decreased | FAERS: 4 | US FAERS | |
| 193 | Nocturia | FAERS: 4 | US FAERS | |
| 194 | Pathological fracture | FAERS: 4 | US FAERS | |
| 195 | Pericarditis | FAERS: 4 | US FAERS | |
| 196 | Peritonitis | FAERS: 4 | US FAERS | |
| 197 | Pleurisy | FAERS: 4 | US FAERS | |
| 198 | Pleuritic pain | FAERS: 4 | US FAERS | |
| 199 | Respiratory distress | FAERS: 4 | US FAERS | |
| 200 | Septic Shock | FAERS: 4 | US FAERS | |
| 201 | Sinusitis | FAERS: 4 | US FAERS | |
| 202 | Skin irritation | FAERS: 4 | US FAERS | |
| 203 | Swelling | FAERS: 4 | US FAERS | |
| 204 | Thirst | FAERS: 4 | US FAERS | |
| 205 | Tuberculosis | FAERS: 4 | US FAERS | |
| 206 | Tumour haemorrhage | FAERS: 4 | US FAERS | |
| 207 | Unresponsive to stimuli | FAERS: 4 | US FAERS | |
| 208 | nervous system disorder | FAERS: 4 | SIDER US FAERS | |
| 209 | Acute Coronary Syndrome | FAERS: 3 | SIDER US FAERS | |
| 210 | Agitation | FAERS: 3 | US FAERS | |
| 211 | Anuria | FAERS: 3 | US FAERS | |
| 212 | Arthropathy | FAERS: 3 | US FAERS | |
| 213 | Blood glucose fluctuation | FAERS: 3 | US FAERS | |
| 214 | Blood sodium decreased | FAERS: 3 | US FAERS | |
| 215 | Blood triglycerides increased | FAERS: 3 | US FAERS | |
| 216 | Blood uric acid decreased | FAERS: 3 | US FAERS | |
| 217 | Blood urine present | FAERS: 3 | US FAERS | |
| 218 | Cataract | FAERS: 3 | US FAERS | |
| 219 | Central nervous system lesion | FAERS: 3 | US FAERS | |
| 220 | Cerebral disorder | FAERS: 3 | US FAERS | |
| 221 | Clostridium difficile colitis | FAERS: 3 | US FAERS | |
| 222 | Coronary Artery Disease | FAERS: 3 | US FAERS | |
| 223 | Deep Vein Thrombosis | FAERS: 3 | SIDER US FAERS | |
| 224 | Diabetic Foot | FAERS: 3 | US FAERS | |
| 225 | Disease recurrence | FAERS: 3 | US FAERS | |
| 226 | Duodenal Ulcer | FAERS: 3 | US FAERS | |
| 227 | Dysuria | FAERS: 3 | US FAERS | |
| 228 | Electrolyte imbalance | FAERS: 3 | US FAERS | |
| 229 | Eye pain | FAERS: 3 | US FAERS | |
| 230 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 231 | Gastroenteritis | FAERS: 3 | US FAERS | |
| 232 | Gastrointestinal perforation | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 233 | Gingival Recession | FAERS: 3 | US FAERS | |
| 234 | Glaucoma | FAERS: 3 | US FAERS | |
| 235 | Hypertensive Encephalopathy | FAERS: 3 | US FAERS | |
| 236 | Immune thrombocytopenic purpura | FAERS: 3 | US FAERS | |
| 237 | Intestinal Perforation | FAERS: 3 | US FAERS | |
| 238 | Intracranial Aneurysm | FAERS: 3 | US FAERS | |
| 239 | Limb injury | FAERS: 3 | US FAERS | |
| 240 | Loss of personal independence in daily activities | FAERS: 3 | US FAERS | |
| 241 | Meningitis | FAERS: 3 | US FAERS | |
| 242 | Monoplegia | FAERS: 3 | US FAERS | |
| 243 | Musculoskeletal chest pain | FAERS: 3 | US FAERS | |
| 244 | Neuralgia | FAERS: 3 | US FAERS | |
| 245 | Osteomyelitis | FAERS: 3 | US FAERS | |
| 246 | Pain of skin | FAERS: 3 | US FAERS | |
| 247 | Pancytopenia | FAERS: 3 | US FAERS | |
| 248 | Postrenal failure | FAERS: 3 | US FAERS | |
| 249 | Prerenal failure | FAERS: 3 | US FAERS | |
| 250 | Rash erythematous | FAERS: 3 | US FAERS | |
| 251 | Respiratory arrest | FAERS: 3 | US FAERS | |
| 252 | Restlessness | FAERS: 3 | US FAERS | |
| 253 | Sciatica | FAERS: 3 | US FAERS | |
| 254 | Senile dementia | FAERS: 3 | US FAERS | |
| 255 | Skin toxicity | FAERS: 3 | US FAERS | |
| 256 | Sluggishness | FAERS: 3 | US FAERS | |
| 257 | Tinnitus | FAERS: 3 | SIDER US FAERS | |
| 258 | Transaminases increased | FAERS: 3 | US FAERS | |
| 259 | Unevaluable event | FAERS: 3 | US FAERS | |
| 260 | Upper respiratory tract congestion | FAERS: 3 | US FAERS | |
| 261 | Abdominal symptom | FAERS: 2 | US FAERS | |
| 262 | Abscess | FAERS: 2 | US FAERS | |
| 263 | Alanine Aminotransferase Increased | FAERS: 2 | SIDER US FAERS | |
| 264 | Amylase increased | FAERS: 2 | SIDER US FAERS | |
| 265 | Anal Fistula | FAERS: 2 | SIDER US FAERS | |
| 266 | Anorectal discomfort | FAERS: 2 | US FAERS | |
| 267 | Aortic Aneurysm | FAERS: 2 | US FAERS | |
| 268 | Atelectasis | FAERS: 2 | US FAERS | |
| 269 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 270 | Back disorder | FAERS: 2 | US FAERS | |
| 271 | Bladder pain | FAERS: 2 | US FAERS | |
| 272 | Blood albumin decreased | FAERS: 2 | US FAERS | |
| 273 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 274 | Blood iron increased | FAERS: 2 | US FAERS | |
| 275 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 276 | Bronchitis | FAERS: 2 | US FAERS | |
| 277 | Bronchopneumonia | FAERS: 2 | US FAERS | |
| 278 | Cachexia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 279 | Cardiotoxicity | FAERS: 2 | 26259608 | CTD US FAERS |
| 280 | Choking | FAERS: 2 | US FAERS | |
| 281 | Completed Suicide | FAERS: 2 | US FAERS | |
| 282 | Cystitis | FAERS: 2 | US FAERS | |
| 283 | Device occlusion | FAERS: 2 | US FAERS | |
| 284 | Diabetes mellitus inadequate control | FAERS: 2 | US FAERS | |
| 285 | Diabetic Nephropathy | FAERS: 2 | US FAERS | |
| 286 | Diplegia | FAERS: 2 | US FAERS | |
| 287 | Diplopia | FAERS: 2 | US FAERS | |
| 288 | Ear discomfort | FAERS: 2 | US FAERS | |
| 289 | Ejection Fraction Decreased | FAERS: 2 | US FAERS | |
| 290 | Enteritis | FAERS: 2 | US FAERS | |
| 291 | Essential Hypertension | FAERS: 2 | US FAERS | |
| 292 | Expired product administered | FAERS: 2 | US FAERS | |
| 293 | Facial paralysis | FAERS: 2 | US FAERS | |
| 294 | Febrile Neutropenia | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 295 | Full blood count decreased | FAERS: 2 | US FAERS | |
| 296 | Gastric infection | FAERS: 2 | US FAERS | |
| 297 | Gastric ulcer | FAERS: 2 | US FAERS | |
| 298 | Gastrointestinal Pain | FAERS: 2 | SIDER US FAERS | |
| 299 | Gastrointestinal candidiasis | FAERS: 2 | US FAERS | |
| 300 | Gastrointestinal inflammation | FAERS: 2 | US FAERS | |
| 301 | Gingivitis | FAERS: 2 | US FAERS | |
| 302 | Head discomfort | FAERS: 2 | US FAERS | |
| 303 | Hemiplegia | FAERS: 2 | US FAERS | |
| 304 | Hydrocephalus | FAERS: 2 | US FAERS | |
| 305 | Incontinence | FAERS: 2 | US FAERS | |
| 306 | Increased upper airway secretion | FAERS: 2 | US FAERS | |
| 307 | Infarction | FAERS: 2 | US FAERS | |
| 308 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 309 | Intracranial mass | FAERS: 2 | US FAERS | |
| 310 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 311 | Laryngitis | FAERS: 2 | US FAERS | |
| 312 | Lung Abscess | FAERS: 2 | US FAERS | |
| 313 | Lymph nodes scan abnormal | FAERS: 2 | US FAERS | |
| 314 | Malnutrition | FAERS: 2 | SIDER US FAERS | |
| 315 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 316 | Metastasis | FAERS: 2 | US FAERS | |
| 317 | Metastatic pain | FAERS: 2 | US FAERS | |
| 318 | Muscle Fatigue | FAERS: 2 | US FAERS | |
| 319 | Muscle hypertrophy | FAERS: 2 | US FAERS | |
| 320 | Myositis | FAERS: 2 | US FAERS | |
| 321 | Nephrolithiasis | FAERS: 2 | US FAERS | |
| 322 | No adverse event | FAERS: 2 | US FAERS | |
| 323 | Ocular icterus | FAERS: 2 | US FAERS | |
| 324 | Onychalgia | FAERS: 2 | US FAERS | |
| 325 | Oral fungal infection | FAERS: 2 | US FAERS | |
| 326 | Pancreatic carcinoma | FAERS: 2 | US FAERS | |
| 327 | Performance status decreased | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 328 | Personality Change | FAERS: 2 | US FAERS | |
| 329 | Photophobia | FAERS: 2 | US FAERS | |
| 330 | Polyuria | FAERS: 2 | US FAERS | |
| 331 | Product dose omission | FAERS: 2 | US FAERS | |
| 332 | Prostatic pain | FAERS: 2 | US FAERS | |
| 333 | Protein total increased | FAERS: 2 | US FAERS | |
| 334 | Psychomotor skills impaired | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 335 | Pulmonary Infarction | FAERS: 2 | US FAERS | |
| 336 | Pulmonary thrombosis | FAERS: 2 | US FAERS | |
| 337 | Purulent discharge | FAERS: 2 | US FAERS | |
| 338 | Renal pain | FAERS: 2 | US FAERS | |
| 339 | Retching | FAERS: 2 | US FAERS | |
| 340 | Retinal Artery Occlusion | FAERS: 2 | US FAERS | |
| 341 | Retinal Vascular Disorder | FAERS: 2 | US FAERS | |
| 342 | Rhabdomyolysis | FAERS: 2 | US FAERS | |
| 343 | Sinus headache | FAERS: 2 | US FAERS | |
| 344 | Skin Induration | FAERS: 2 | US FAERS | |
| 345 | Skin Wrinkling | FAERS: 2 | US FAERS | |
| 346 | Slow response to stimuli | FAERS: 2 | US FAERS | |
| 347 | Temperature regulation disorder | FAERS: 2 | US FAERS | |
| 348 | Therapy change | FAERS: 2 | US FAERS | |
| 349 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 350 | Tooth Infection | FAERS: 2 | US FAERS | |
| 351 | Trismus | FAERS: 2 | US FAERS | |
| 352 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 353 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 354 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 355 | furuncle | FAERS: 2 | US FAERS | |
| 356 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 357 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 358 | Abdominal wall infection | FAERS: 1 | US FAERS | |
| 359 | Acute respiratory failure | FAERS: 1 | US FAERS | |
| 360 | Adenoid cystic carcinoma of salivary gland | FAERS: 1 | US FAERS | |
| 361 | Adrenocortical carcinoma | FAERS: 1 | US FAERS | |
| 362 | Amaurosis | FAERS: 1 | US FAERS | |
| 363 | Ammonia abnormal | FAERS: 1 | US FAERS | |
| 364 | Amyloidosis | FAERS: 1 | US FAERS | |
| 365 | Anal Fissure | FAERS: 1 | US FAERS | |
| 366 | Anal abscess | FAERS: 1 | US FAERS | |
| 367 | Anal erosion | FAERS: 1 | US FAERS | |
| 368 | Anastomotic Leak | FAERS: 1 | US FAERS | |
| 369 | Ankle Fracture | FAERS: 1 | US FAERS | |
| 370 | Anorectal infection | FAERS: 1 | US FAERS | |
| 371 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 372 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 373 | Arteriovenous fistula occlusion | FAERS: 1 | US FAERS | |
| 374 | Asterixis | FAERS: 1 | US FAERS | |
| 375 | Atypical mycobacterial pneumonia | FAERS: 1 | US FAERS | |
| 376 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 377 | Benign Prostatic Hyperplasia | FAERS: 1 | US FAERS | |
| 378 | Bladder Neoplasm | FAERS: 1 | US FAERS | |
| 379 | Blood catecholamines increased | FAERS: 1 | US FAERS | |
| 380 | Blood creatinine decreased | FAERS: 1 | US FAERS | |
| 381 | Blood lactate dehydrogenase abnormal | FAERS: 1 | US FAERS | |
| 382 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 383 | Blood thyroid stimulating hormone decreased | FAERS: 1 | US FAERS | |
| 384 | Blood urea nitrogen/creatinine ratio increased | FAERS: 1 | US FAERS | |
| 385 | Blood zinc decreased | FAERS: 1 | US FAERS | |
| 386 | Bone lesion | FAERS: 1 | US FAERS | |
| 387 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 388 | Brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 389 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 390 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 391 | Bronchopleural Fistula | FAERS: 1 | US FAERS | |
| 392 | Bronchospasm | FAERS: 1 | US FAERS | |
| 393 | Candidiasis | FAERS: 1 | US FAERS | |
| 394 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 395 | Carotid artery occlusion | FAERS: 1 | US FAERS | |
| 396 | Catarrh | FAERS: 1 | US FAERS | |
| 397 | Cell Death | FAERS: 1 | US FAERS | |
| 398 | Cell marker increased | FAERS: 1 | US FAERS | |
| 399 | Cerebral Thrombosis | FAERS: 1 | US FAERS | |
| 400 | Cerebral atrophy | FAERS: 1 | US FAERS | |
| 401 | Cerebral microhaemorrhage | FAERS: 1 | US FAERS | |
| 402 | Cerebrovascular Insufficiency | FAERS: 1 | US FAERS | |
| 403 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 404 | Cheilitis | FAERS: 1 | US FAERS | |
| 405 | Cholecystitis infective | FAERS: 1 | US FAERS | |
| 406 | Chronic gastritis | FAERS: 1 | US FAERS | |
| 407 | Clubbing | FAERS: 1 | US FAERS | |
| 408 | Compression fracture | FAERS: 1 | US FAERS | |
| 409 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 410 | Contrast media reaction | FAERS: 1 | US FAERS | |
| 411 | Coronary artery insufficiency | FAERS: 1 | US FAERS | |
| 412 | Cortisol decreased | FAERS: 1 | US FAERS | |
| 413 | Creatine urine increased | FAERS: 1 | US FAERS | |
| 414 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 415 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 416 | Dermatomyositis | FAERS: 1 | US FAERS | |
| 417 | Device breakage | FAERS: 1 | US FAERS | |
| 418 | Device related infection | FAERS: 1 | US FAERS | |
| 419 | Dialysis related complication | FAERS: 1 | US FAERS | |
| 420 | Diastolic hypertension | FAERS: 1 | US FAERS | |
| 421 | Drug Dependence | FAERS: 1 | US FAERS | |
| 422 | Drug level increased | FAERS: 1 | US FAERS | |
| 423 | Drug prescribing error | FAERS: 1 | OFFSIDES US FAERS | |
| 424 | Drug resistance | FAERS: 1 | US FAERS | |
| 425 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 426 | Duodenal perforation | FAERS: 1 | US FAERS | |
| 427 | Duodenal ulcer perforation | FAERS: 1 | US FAERS | |
| 428 | Dyschezia | FAERS: 1 | US FAERS | |
| 429 | Dysentery | FAERS: 1 | US FAERS | |
| 430 | Ear congestion | FAERS: 1 | US FAERS | |
| 431 | Electrolyte depletion | FAERS: 1 | US FAERS | |
| 432 | Embolic stroke | FAERS: 1 | US FAERS | |
| 433 | Emphysematous pyelonephritis | FAERS: 1 | US FAERS | |
| 434 | Encephalitis | FAERS: 1 | US FAERS | |
| 435 | Enterovesical Fistula | FAERS: 1 | US FAERS | |
| 436 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 437 | Erysipelas | FAERS: 1 | US FAERS | |
| 438 | Eschar | FAERS: 1 | US FAERS | |
| 439 | Escherichia infection | FAERS: 1 | US FAERS | |
| 440 | Extremity necrosis | FAERS: 1 | US FAERS | |
| 441 | Eye Infection | FAERS: 1 | US FAERS | |
| 442 | Eye inflammation | FAERS: 1 | US FAERS | |
| 443 | Eyelid irritation | FAERS: 1 | US FAERS | |
| 444 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 445 | Feeling Cold | FAERS: 1 | US FAERS | |
| 446 | Flank Pain | FAERS: 1 | US FAERS | |
| 447 | Food Allergy | FAERS: 1 | US FAERS | |
| 448 | Gastroenteritis norovirus | FAERS: 1 | US FAERS | |
| 449 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 450 | Gastrointestinal toxicity | FAERS: 1 | US FAERS | |
| 451 | Gastrointestinal viral infection | FAERS: 1 | US FAERS | |
| 452 | General physical condition abnormal | FAERS: 1 | US FAERS | |
| 453 | Genital erosion | FAERS: 1 | US FAERS | |
| 454 | Genital infection fungal | FAERS: 1 | US FAERS | |
| 455 | Glioblastoma Multiforme | FAERS: 1 | US FAERS | |
| 456 | Glycosuria | FAERS: 1 | US FAERS | |
| 457 | Gout | FAERS: 1 | US FAERS | |
| 458 | Granuloma | FAERS: 1 | US FAERS | |
| 459 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 460 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 461 | Hepatitis C | FAERS: 1 | US FAERS | |
| 462 | Hepatitis | FAERS: 1 | US FAERS | |
| 463 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 464 | Hernial eventration | FAERS: 1 | US FAERS | |
| 465 | Hunger | FAERS: 1 | US FAERS | |
| 466 | Hydrothorax | FAERS: 1 | US FAERS | |
| 467 | Hyperchlorhydria | FAERS: 1 | US FAERS | |
| 468 | Hypoxia | FAERS: 1 | US FAERS | |
| 469 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 470 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 471 | Incision site pain | FAERS: 1 | US FAERS | |
| 472 | Incoherent | FAERS: 1 | US FAERS | |
| 473 | Incorrect dose administered | FAERS: 1 | US FAERS | |
| 474 | Infected cyst | FAERS: 1 | US FAERS | |
| 475 | Infected seroma | FAERS: 1 | US FAERS | |
| 476 | Infectious pleural effusion | FAERS: 1 | US FAERS | |
| 477 | Insurance issue | FAERS: 1 | US FAERS | |
| 478 | Intervertebral Disc Degeneration | FAERS: 1 | US FAERS | |
| 479 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 480 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 481 | Joint stiffness | FAERS: 1 | US FAERS | |
| 482 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 483 | Laceration | FAERS: 1 | US FAERS | |
| 484 | Lactose Intolerance | FAERS: 1 | US FAERS | |
| 485 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 486 | Liver Abscess | FAERS: 1 | US FAERS | |
| 487 | Loose tooth | FAERS: 1 | US FAERS | |
| 488 | Lung perforation | FAERS: 1 | US FAERS | |
| 489 | Lymphangiosis carcinomatosa | FAERS: 1 | US FAERS | |
| 490 | Lymphoma | FAERS: 1 | US FAERS | |
| 491 | Mastication disorder | FAERS: 1 | US FAERS | |
| 492 | Mediastinitis | FAERS: 1 | US FAERS | |
| 493 | Medication residue present | FAERS: 1 | US FAERS | |
| 494 | Merycism | FAERS: 1 | US FAERS | |
| 495 | Mood swings | FAERS: 1 | US FAERS | |
| 496 | Mouth swelling | FAERS: 1 | US FAERS | |
| 497 | Muscle Spasticity | FAERS: 1 | US FAERS | |
| 498 | Myocardial necrosis | FAERS: 1 | US FAERS | |
| 499 | Myocarditis | FAERS: 1 | US FAERS | |
| 500 | Necrosis | FAERS: 1 | US FAERS | |
| 501 | Negativism | FAERS: 1 | US FAERS | |
| 502 | Noninfective gingivitis | FAERS: 1 | US FAERS | |
| 503 | Occult blood positive | FAERS: 1 | US FAERS | |
| 504 | Ocular Hypertension | FAERS: 1 | US FAERS | |
| 505 | Oliguria | FAERS: 1 | US FAERS | |
| 506 | Onychoclasis | FAERS: 1 | US FAERS | |
| 507 | Optic Neuritis | FAERS: 1 | US FAERS | |
| 508 | Oral candidiasis | FAERS: 1 | US FAERS | |
| 509 | Oral mucosal exfoliation | FAERS: 1 | US FAERS | |
| 510 | Osteomalacia | FAERS: 1 | US FAERS | |
| 511 | Osteonecrosis of Jaw | FAERS: 1 | US FAERS | |
| 512 | Pancreatic Enzymes Decreased | FAERS: 1 | US FAERS | |
| 513 | Pancreatic enlargement | FAERS: 1 | US FAERS | |
| 514 | Paranasal sinus hypersecretion | FAERS: 1 | US FAERS | |
| 515 | Paraneoplastic neurological syndrome | FAERS: 1 | US FAERS | |
| 516 | Paraparesis | FAERS: 1 | US FAERS | |
| 517 | Paraplegia | FAERS: 1 | US FAERS | |
| 518 | Paresis | FAERS: 1 | US FAERS | |
| 519 | Pelvic abscess | FAERS: 1 | US FAERS | |
| 520 | Penile swelling | FAERS: 1 | US FAERS | |
| 521 | Perineal infection | FAERS: 1 | US FAERS | |
| 522 | Phlebitis | FAERS: 1 | US FAERS | |
| 523 | Physical disability | FAERS: 1 | US FAERS | |
| 524 | Poisoning | FAERS: 1 | US FAERS | |
| 525 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 526 | Poor peripheral circulation | FAERS: 1 | US FAERS | |
| 527 | Portal Vein Thrombosis | FAERS: 1 | US FAERS | |
| 528 | Post procedural complication | FAERS: 1 | US FAERS | |
| 529 | Product contamination | FAERS: 1 | US FAERS | |
| 530 | Product prescribing issue | FAERS: 1 | US FAERS | |
| 531 | Product size issue | FAERS: 1 | US FAERS | |
| 532 | Product use complaint | FAERS: 1 | US FAERS | |
| 533 | Protein total decreased | FAERS: 1 | US FAERS | |
| 534 | Psoriasis | FAERS: 1 | US FAERS | |
| 535 | Pulmonary Fistula | FAERS: 1 | US FAERS | |
| 536 | Pulmonary congestion | FAERS: 1 | US FAERS | |
| 537 | Pulmonary radiation injury | FAERS: 1 | US FAERS | |
| 538 | Purpura | FAERS: 1 | US FAERS | |
| 539 | Pyoderma Gangrenosum | FAERS: 1 | US FAERS | |
| 540 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 541 | Radiation Pneumonitis | FAERS: 1 | US FAERS | |
| 542 | Renal cyst | FAERS: 1 | US FAERS | |
| 543 | Retinal Detachment | FAERS: 1 | US FAERS | |
| 544 | Retinal Vein Occlusion | FAERS: 1 | SIDER US FAERS | |
| 545 | Retinitis | FAERS: 1 | US FAERS | |
| 546 | Retroperitoneal abscess | FAERS: 1 | US FAERS | |
| 547 | Rheumatic disorder | FAERS: 1 | US FAERS | |
| 548 | Rheumatoid Arthritis | FAERS: 1 | US FAERS | |
| 549 | Rhinalgia | FAERS: 1 | US FAERS | |
| 550 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 551 | Scab | FAERS: 1 | US FAERS | |
| 552 | Schizophrenia | FAERS: 1 | US FAERS | |
| 553 | Secretion discharge | FAERS: 1 | US FAERS | |
| 554 | Sensitivity to weather change | FAERS: 1 | US FAERS | |
| 555 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 556 | Serratia sepsis | FAERS: 1 | US FAERS | |
| 557 | Shock | FAERS: 1 | US FAERS | |
| 558 | Shunt infection | FAERS: 1 | US FAERS | |
| 559 | Single functional kidney | FAERS: 1 | US FAERS | |
| 560 | Skin discomfort | FAERS: 1 | US FAERS | |
| 561 | Skin hypertrophy | FAERS: 1 | US FAERS | |
| 562 | Snoring | FAERS: 1 | US FAERS | |
| 563 | Sopor | FAERS: 1 | US FAERS | |
| 564 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 565 | Squamous cell carcinoma of skin | FAERS: 1 | US FAERS | |
| 566 | Squamous cell carcinoma | FAERS: 1 | US FAERS | |
| 567 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 568 | Status Epilepticus | FAERS: 1 | US FAERS | |
| 569 | Stroke in evolution | FAERS: 1 | US FAERS | |
| 570 | Stupor | FAERS: 1 | US FAERS | |
| 571 | Subcutaneous Abscess | FAERS: 1 | US FAERS | |
| 572 | Subileus | FAERS: 1 | OFFSIDES US FAERS | |
| 573 | Suicide attempt | FAERS: 1 | US FAERS | |
| 574 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 575 | Thermal burn | FAERS: 1 | US FAERS | |
| 576 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 577 | Thrombophlebitis | FAERS: 1 | US FAERS | |
| 578 | Time perception altered | FAERS: 1 | US FAERS | |
| 579 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 580 | Tongue spasm | FAERS: 1 | US FAERS | |
| 581 | Troponin I increased | FAERS: 1 | US FAERS | |
| 582 | Ulcer | FAERS: 1 | US FAERS | |
| 583 | Underweight | FAERS: 1 | US FAERS | |
| 584 | Urethral Obstruction | FAERS: 1 | US FAERS | |
| 585 | Urethritis | FAERS: 1 | US FAERS | |
| 586 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 587 | Urinary tract discomfort | FAERS: 1 | US FAERS | |
| 588 | Urinary tract obstruction | FAERS: 1 | US FAERS | |
| 589 | Uterine Prolapse | FAERS: 1 | US FAERS | |
| 590 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 591 | Ventricular hypertrophy | FAERS: 1 | US FAERS | |
| 592 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 593 | Vertigo | FAERS: 1 | US FAERS | |
| 594 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 595 | Vocal Cord Paralysis | FAERS: 1 | US FAERS | |
| 596 | Vulvovaginal swelling | FAERS: 1 | US FAERS | |
| 597 | Wound Complication | FAERS: 1 | US FAERS | |
| 598 | Wound Infection | FAERS: 1 | US FAERS | |
| 599 | effusion | FAERS: 1 | US FAERS | |
| 600 | muscle injury | FAERS: 1 | US FAERS | |
| 601 | treatment failure | FAERS: 1 | US FAERS | |
| 602 | Accidental overdose | OFFSIDES | ||
| 603 | Anal inflammation | OFFSIDES | ||
| 604 | Atrial tachycardia | OFFSIDES | ||
| 605 | Blood and lymphatic system disorders | SIDER | ||
| 606 | Blood creatine increased | OFFSIDES | ||
| 607 | Blood sodium | OFFSIDES | ||
| 608 | Cardiac enzymes increased | OFFSIDES | ||
| 609 | Chemical and Drug Induced Liver Injury | 22166485 | CTD | |
| 610 | Creatinine increased | SIDER | ||
| 611 | Dermatitis | SIDER | ||
| 612 | Diarrhea | 19652060 | CTD | |
| 613 | Drowsiness | OFFSIDES | ||
| 614 | Dyspnea | 19652060 | CTD | |
| 615 | Ear and labyrinth disorders | SIDER | ||
| 616 | Embolism | SIDER | ||
| 617 | Femoral artery occlusion | OFFSIDES | ||
| 618 | Heart Diseases | 22166485 | CTD | |
| 619 | Hepatic impairment | SIDER | ||
| 620 | Intentional drug misuse | OFFSIDES | ||
| 621 | Leukopenia | SIDER | ||
| 622 | Malignant ascites | OFFSIDES | ||
| 623 | Mononeuritis | OFFSIDES | ||
| 624 | Musculoskeletal discomfort | SIDER | ||
| 625 | PROTHROMBIN TIME | OFFSIDES | ||
| 626 | Renal Insufficiency | 22166485 | CTD | |
| 627 | Sinus bradycardia | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.