Loratadine
(JCCNYMKQOSZNPW-UHFFFAOYSA-N)
Structure
- SMILES
- CCOC(=O)N1CCC(=C2c3ccc(cc3CCc3c2nccc3)Cl)CC1
- Type(s)
- Approved; Investigational
- ATC code(s)
- R06AX13
- Molecular Formula:
- C22H23ClN2O2
- Molecular Weight:
- 382.883
- Log P:
- 4.8257
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 0
- TPSA:
- 42.43
- CAS Number(s):
- 79794-75-5
Synonym(s)
1.
Loratadine
2.
4-(8-Chloro-5,6-dihydro-11H-benzo(5,6)cyclohepta(1,2-b)pyridin-11-ylidene)-1-piperidinecarboxylic Acid Ethyl Ester
3.
Alavert
4.
Claritin
5.
Clarium
6.
Sch-29851
7.
Sch 29851
8.
Sch29851
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug ineffective | FAERS: 4675 Canada Vigilance: 36 | Canada Vigilance OFFSIDES US FAERS | |
| 2 | Overdose | FAERS: 906 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Product use issue | FAERS: 716 | US FAERS | |
| 4 | Accidental overdose | FAERS: 603 | US FAERS | |
| 5 | Accidental exposure to product by child | FAERS: 543 | US FAERS | |
| 6 | Somnolence | FAERS: 519 Canada Vigilance: 3 | Canada Vigilance SIDER US FAERS | |
| 7 | Expired product administered | FAERS: 486 | US FAERS | |
| 8 | Extra dose administered | FAERS: 463 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Drug effect incomplete | FAERS: 459 | US FAERS | |
| 10 | Product use in unapproved indication | FAERS: 293 | US FAERS | |
| 11 | Dizziness | FAERS: 274 Canada Vigilance: 7 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 12 | Headache | FAERS: 274 Canada Vigilance: 3 | 10400480 | CTD SIDER Canada Vigilance US FAERS |
| 13 | Therapeutic response unexpected | FAERS: 264 | US FAERS | |
| 14 | Drug ineffective for unapproved indication | FAERS: 234 | US FAERS | |
| 15 | No adverse event | FAERS: 185 | US FAERS | |
| 16 | Nausea | FAERS: 183 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 17 | Inappropriate schedule of drug administration | FAERS: 181 | US FAERS | |
| 18 | Incorrect dose administered | FAERS: 179 | US FAERS | |
| 19 | Feeling abnormal | FAERS: 177 | SIDER US FAERS | |
| 20 | Hypersensitivity | FAERS: 170 Canada Vigilance: 3 | 8891761 | CTD Canada Vigilance US FAERS |
| 21 | Fatigue | FAERS: 165 Canada Vigilance: 5 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 22 | Drug effect delayed | FAERS: 125 | US FAERS | |
| 23 | Malaise | FAERS: 118 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 24 | Drug administered to patient of inappropriate age | FAERS: 116 | US FAERS | |
| 25 | Pruritus | FAERS: 112 | US FAERS | |
| 26 | Sneezing | FAERS: 110 | US FAERS | |
| 27 | Wrong technique in product usage process | FAERS: 109 | US FAERS | |
| 28 | Circumstance or information capable of leading to medication error | FAERS: 105 | US FAERS | |
| 29 | Vomiting | FAERS: 101 | SIDER US FAERS | |
| 30 | Expired drug administered | FAERS: 97 | US FAERS | |
| 31 | Urticaria | FAERS: 95 | 2568013 10188144 | CTD US FAERS |
| 32 | Palpitations | FAERS: 94 Canada Vigilance: 5 | Canada Vigilance SIDER US FAERS | |
| 33 | Abdominal discomfort | FAERS: 92 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 34 | Unevaluable event | FAERS: 86 | OFFSIDES US FAERS | |
| 35 | Nervousness | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 36 | Dysgeusia | FAERS: 76 | SIDER US FAERS | |
| 37 | Epistaxis | FAERS: 69 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 38 | Asthenia | FAERS: 65 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 39 | Anxiety | FAERS: 64 | OFFSIDES US FAERS | |
| 40 | Throat irritation | FAERS: 60 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 41 | Product taste abnormal | FAERS: 55 | US FAERS | |
| 42 | Failure of child resistant mechanism for pharmaceutical product | FAERS: 50 | US FAERS | |
| 43 | Tremor | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 44 | Patient dissatisfaction with treatment | FAERS: 45 | US FAERS | |
| 45 | Product quality issue | FAERS: 45 | US FAERS | |
| 46 | Constipation | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 47 | Oropharyngeal pain | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 48 | Therapeutic product ineffective | FAERS: 44 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 49 | Erythema | FAERS: 43 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 50 | Drug prescribing error | FAERS: 42 | US FAERS | |
| 51 | Drug effective for unapproved indication | FAERS: 41 | US FAERS | |
| 52 | Pain | FAERS: 41 | OFFSIDES SIDER US FAERS | |
| 53 | Product packaging issue | FAERS: 39 | US FAERS | |
| 54 | Accidental exposure to product | FAERS: 37 | US FAERS | |
| 55 | Therapeutic response changed | FAERS: 36 | US FAERS | |
| 56 | Adverse event | FAERS: 35 | OFFSIDES US FAERS | |
| 57 | Poor quality drug administered | FAERS: 35 | OFFSIDES US FAERS | |
| 58 | Feeling jittery | FAERS: 34 | US FAERS | |
| 59 | Drug administration error | FAERS: 33 | US FAERS | |
| 60 | Wrong technique in drug usage process | FAERS: 32 | US FAERS | |
| 61 | Crying | FAERS: 31 | US FAERS | |
| 62 | Medication Error | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 63 | Poor quality sleep | FAERS: 31 | US FAERS | |
| 64 | Chest Pain | FAERS: 29 | OFFSIDES SIDER US FAERS | |
| 65 | Product package associated injury | FAERS: 29 | US FAERS | |
| 66 | Product prescribing issue | FAERS: 29 | US FAERS | |
| 67 | Product physical issue | FAERS: 28 | US FAERS | |
| 68 | Lip swelling | FAERS: 27 | US FAERS | |
| 69 | Product use complaint | FAERS: 25 | US FAERS | |
| 70 | Blood glucose increased | FAERS: 24 | US FAERS | |
| 71 | Chills | FAERS: 24 | US FAERS | |
| 72 | Head discomfort | FAERS: 24 | US FAERS | |
| 73 | Tachycardia | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 74 | Abdominal Pain | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 75 | Dysphonia | FAERS: 23 | US FAERS | |
| 76 | Back Pain | FAERS: 22 | US FAERS | |
| 77 | Chest discomfort | FAERS: 22 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 78 | Retching | FAERS: 21 | US FAERS | |
| 79 | Burning sensation | FAERS: 20 | US FAERS | |
| 80 | Inappropriate Prescribing | FAERS: 20 | US FAERS | |
| 81 | Visual Impairment | FAERS: 20 | US FAERS | |
| 82 | Intentional product misuse | FAERS: 19 | US FAERS | |
| 83 | Lethargy | FAERS: 19 | SIDER US FAERS | |
| 84 | Agitation | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 85 | Epilepsy | FAERS: 18 | US FAERS | |
| 86 | Myalgia | FAERS: 18 | SIDER US FAERS | |
| 87 | Tinnitus | FAERS: 18 | SIDER US FAERS | |
| 88 | Wrong drug administered | FAERS: 18 | US FAERS | |
| 89 | Arthralgia | FAERS: 17 | US FAERS | |
| 90 | Eye irritation | FAERS: 17 | US FAERS | |
| 91 | Urinary Retention | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 92 | Vertigo | FAERS: 17 | US FAERS | |
| 93 | Hypotension | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 94 | Product tampering | FAERS: 16 | US FAERS | |
| 95 | Therapeutic product effect incomplete | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 96 | Wheezing | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 97 | Asthma | FAERS: 15 | 9196086 | CTD OFFSIDES US FAERS |
| 98 | Dry skin | FAERS: 15 | US FAERS | |
| 99 | Nasal discomfort | FAERS: 15 | US FAERS | |
| 100 | Pharmaceutical product complaint | FAERS: 15 | US FAERS | |
| 101 | Thirst | FAERS: 15 | US FAERS | |
| 102 | Eye pain | FAERS: 14 | US FAERS | |
| 103 | Peripheral swelling | FAERS: 14 | US FAERS | |
| 104 | Productive Cough | FAERS: 14 | OFFSIDES US FAERS | |
| 105 | Sinusitis | FAERS: 14 | OFFSIDES US FAERS | |
| 106 | Dysuria | FAERS: 13 | US FAERS | |
| 107 | Hypersomnia | FAERS: 13 | US FAERS | |
| 108 | Nasopharyngitis | FAERS: 13 | OFFSIDES US FAERS | |
| 109 | Rash erythematous | FAERS: 13 | US FAERS | |
| 110 | Restlessness | FAERS: 13 | US FAERS | |
| 111 | Syncope | FAERS: 13 | 12698686 | CTD SIDER US FAERS |
| 112 | Amnesia | FAERS: 12 | OFFSIDES US FAERS | |
| 113 | Discomfort | FAERS: 12 | SIDER US FAERS | |
| 114 | Flatulence | FAERS: 12 | US FAERS | |
| 115 | Intentional product use issue | FAERS: 12 | US FAERS | |
| 116 | Product label issue | FAERS: 12 | US FAERS | |
| 117 | Product lot number issue | FAERS: 12 | US FAERS | |
| 118 | Sinus headache | FAERS: 12 | US FAERS | |
| 119 | Anger | FAERS: 11 | US FAERS | |
| 120 | Dehydration | FAERS: 11 | OFFSIDES US FAERS | |
| 121 | Dyspepsia | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 122 | Ear discomfort | FAERS: 11 | OFFSIDES US FAERS | |
| 123 | Maternal exposure during pregnancy | FAERS: 11 | US FAERS | |
| 124 | Middle insomnia | FAERS: 11 | US FAERS | |
| 125 | Multiple allergies | FAERS: 11 | OFFSIDES US FAERS | |
| 126 | Poor quality product administered | FAERS: 11 | US FAERS | |
| 127 | Product substitution issue | FAERS: 11 | US FAERS | |
| 128 | Alopecia | FAERS: 10 | OFFSIDES SIDER US FAERS | |
| 129 | Autoimmune hepatitis | FAERS: 10 | US FAERS | |
| 130 | Feeling Cold | FAERS: 10 | US FAERS | |
| 131 | Flushing | FAERS: 10 | US FAERS | |
| 132 | Glaucoma | FAERS: 10 | OFFSIDES US FAERS | |
| 133 | Product blister packaging issue | FAERS: 10 | US FAERS | |
| 134 | Product closure removal difficult | FAERS: 10 | US FAERS | |
| 135 | Product size issue | FAERS: 10 | US FAERS | |
| 136 | Product solubility abnormal | FAERS: 10 | US FAERS | |
| 137 | Regurgitation | FAERS: 10 | US FAERS | |
| 138 | jaundice | FAERS: 10 | US FAERS | |
| 139 | Anaphylactic shock | FAERS: 9 | SIDER US FAERS | |
| 140 | Cholestasis | FAERS: 9 | US FAERS | |
| 141 | Cold sweat | FAERS: 9 | US FAERS | |
| 142 | Paranoia | FAERS: 9 | US FAERS | |
| 143 | Prescribed overdose | FAERS: 9 | US FAERS | |
| 144 | Ageusia | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 145 | Alanine Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 146 | Aspartate Aminotransferase Increased | FAERS: 8 | US FAERS | |
| 147 | Atrial Fibrillation | FAERS: 8 | US FAERS | |
| 148 | Blood alkaline phosphatase increased | FAERS: 8 | US FAERS | |
| 149 | Cerebrovascular accident | FAERS: 8 | US FAERS | |
| 150 | Choking | FAERS: 8 | US FAERS | |
| 151 | Depressed mood | FAERS: 8 | OFFSIDES US FAERS | |
| 152 | Euphoric mood | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 153 | Inappropriate schedule of product administration | FAERS: 8 | US FAERS | |
| 154 | Joint swelling | FAERS: 8 | US FAERS | |
| 155 | Product commingling | FAERS: 8 | US FAERS | |
| 156 | Swelling | FAERS: 8 | US FAERS | |
| 157 | Therapeutic product ineffective for unapproved indication | FAERS: 8 | US FAERS | |
| 158 | Upper-airway cough syndrome | FAERS: 8 | US FAERS | |
| 159 | Deafness | FAERS: 7 | OFFSIDES US FAERS | |
| 160 | Drug effect variable | FAERS: 7 | US FAERS | |
| 161 | Drug screen positive | FAERS: 7 | US FAERS | |
| 162 | Incorrect drug administration duration | FAERS: 7 | US FAERS | |
| 163 | Nasal pruritus | FAERS: 7 | US FAERS | |
| 164 | Product label confusion | FAERS: 7 | US FAERS | |
| 165 | Reaction to drug excipients | FAERS: 7 | US FAERS | |
| 166 | Respiratory tract congestion | FAERS: 7 | OFFSIDES US FAERS | |
| 167 | Therapeutic response delayed | FAERS: 7 | US FAERS | |
| 168 | Wrong dose | FAERS: 7 | US FAERS | |
| 169 | Accidental drug intake by child | FAERS: 6 | US FAERS | |
| 170 | Angina Pectoris | FAERS: 6 | US FAERS | |
| 171 | Anorexia | FAERS: 6 | US FAERS | |
| 172 | Drug resistance | FAERS: 6 | US FAERS | |
| 173 | Dysphemia | FAERS: 6 | US FAERS | |
| 174 | Eczema | FAERS: 6 | OFFSIDES US FAERS | |
| 175 | Gamma-Glutamyltransferase Increased | FAERS: 6 | US FAERS | |
| 176 | Initial insomnia | FAERS: 6 | US FAERS | |
| 177 | Intercepted drug prescribing error | FAERS: 6 | US FAERS | |
| 178 | Memory impairment | FAERS: 6 | US FAERS | |
| 179 | Mood swings | FAERS: 6 | US FAERS | |
| 180 | Musculoskeletal stiffness | FAERS: 6 | OFFSIDES US FAERS | |
| 181 | Product physical consistency issue | FAERS: 6 | US FAERS | |
| 182 | Supraventricular tachycardia | FAERS: 6 | US FAERS | |
| 183 | Therapeutic product effect decreased | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 184 | White blood cell count decreased | FAERS: 6 | US FAERS | |
| 185 | Anosmia | FAERS: 5 | US FAERS | |
| 186 | Blood creatine phosphokinase increased | FAERS: 5 | OFFSIDES US FAERS | |
| 187 | Blood pressure fluctuation | FAERS: 5 | US FAERS | |
| 188 | Chromaturia | FAERS: 5 | SIDER US FAERS | |
| 189 | Disease recurrence | FAERS: 5 | US FAERS | |
| 190 | Drug Dependence | FAERS: 5 | US FAERS | |
| 191 | Drug label confusion | FAERS: 5 | US FAERS | |
| 192 | Dysarthria | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 193 | Exposure during breast feeding | FAERS: 5 | US FAERS | |
| 194 | Foaming at mouth | FAERS: 5 | OFFSIDES US FAERS | |
| 195 | Glossitis | FAERS: 5 | US FAERS | |
| 196 | Hepatitis | FAERS: 5 | US FAERS | |
| 197 | Incorrect product storage | FAERS: 5 | US FAERS | |
| 198 | Incorrect route of drug administration | FAERS: 5 | US FAERS | |
| 199 | Increased upper airway secretion | FAERS: 5 | US FAERS | |
| 200 | Limb discomfort | FAERS: 5 | US FAERS | |
| 201 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 202 | Pallor | FAERS: 5 | US FAERS | |
| 203 | Paranasal sinus discomfort | FAERS: 5 | US FAERS | |
| 204 | Photophobia | FAERS: 5 | US FAERS | |
| 205 | Screaming | FAERS: 5 | US FAERS | |
| 206 | Stress | FAERS: 5 | US FAERS | |
| 207 | Upper respiratory tract congestion | FAERS: 5 | US FAERS | |
| 208 | Urinary Incontinence | FAERS: 5 | US FAERS | |
| 209 | Visual disturbance | FAERS: 5 | OFFSIDES US FAERS | |
| 210 | Breast Feeding | FAERS: 4 | US FAERS | |
| 211 | Bronchitis | FAERS: 4 | OFFSIDES US FAERS | |
| 212 | Conversion disorder | FAERS: 4 | US FAERS | |
| 213 | Diplopia | FAERS: 4 | US FAERS | |
| 214 | Disorientation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 215 | Drug dose omission | FAERS: 4 | OFFSIDES US FAERS | |
| 216 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 217 | Drug withdrawal syndrome | FAERS: 4 | US FAERS | |
| 218 | Emotional disorder | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 219 | Formication | FAERS: 4 | US FAERS | |
| 220 | Impaired driving ability | FAERS: 4 | OFFSIDES US FAERS | |
| 221 | Incorrect product administration duration | FAERS: 4 | US FAERS | |
| 222 | Intercepted medication error | FAERS: 4 | US FAERS | |
| 223 | Loose tooth | FAERS: 4 | US FAERS | |
| 224 | Musculoskeletal Pain | FAERS: 4 | US FAERS | |
| 225 | Myocardial Infarction | FAERS: 4 | US FAERS | |
| 226 | Ocular discomfort | FAERS: 4 | US FAERS | |
| 227 | Oral pain | FAERS: 4 | US FAERS | |
| 228 | Oral pruritus | FAERS: 4 | US FAERS | |
| 229 | Oropharyngeal discomfort | FAERS: 4 | US FAERS | |
| 230 | Personality Change | FAERS: 4 | US FAERS | |
| 231 | Pneumonia | FAERS: 4 | US FAERS | |
| 232 | Pre-existing condition improved | FAERS: 4 | US FAERS | |
| 233 | Presyncope | FAERS: 4 | US FAERS | |
| 234 | Product container seal issue | FAERS: 4 | US FAERS | |
| 235 | Product contamination microbial | FAERS: 4 | US FAERS | |
| 236 | Product friable | FAERS: 4 | US FAERS | |
| 237 | Product packaging difficult to open | FAERS: 4 | US FAERS | |
| 238 | Product prescribing error | FAERS: 4 | US FAERS | |
| 239 | Renal pain | FAERS: 4 | US FAERS | |
| 240 | Shock | FAERS: 4 | SIDER US FAERS | |
| 241 | Sinus Tachycardia | FAERS: 4 | US FAERS | |
| 242 | Sluggishness | FAERS: 4 | US FAERS | |
| 243 | Snoring | FAERS: 4 | OFFSIDES US FAERS | |
| 244 | Stomatitis | FAERS: 4 | US FAERS | |
| 245 | Suicide attempt | FAERS: 4 | US FAERS | |
| 246 | Therapeutic product effective for unapproved indication | FAERS: 4 | US FAERS | |
| 247 | Tooth Loss | FAERS: 4 | US FAERS | |
| 248 | Toothache | FAERS: 4 | US FAERS | |
| 249 | Abasia | FAERS: 3 | US FAERS | |
| 250 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 251 | Angioedema | FAERS: 3 | 10188144 12829880 | CTD SIDER US FAERS |
| 252 | Aphonia | FAERS: 3 | US FAERS | |
| 253 | Asthenopia | FAERS: 3 | US FAERS | |
| 254 | Blindness | FAERS: 3 | US FAERS | |
| 255 | Bone pain | FAERS: 3 | OFFSIDES US FAERS | |
| 256 | Bradycardia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 257 | Cardiac Flutter | FAERS: 3 | OFFSIDES US FAERS | |
| 258 | Cardiotoxicity | FAERS: 3 | US FAERS | |
| 259 | Conjunctivitis | FAERS: 3 | US FAERS | |
| 260 | Contraindicated product administered | FAERS: 3 | US FAERS | |
| 261 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 262 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 263 | Disease Progression | FAERS: 3 | US FAERS | |
| 264 | Drug abuse | FAERS: 3 | US FAERS | |
| 265 | Dystonia | FAERS: 3 | US FAERS | |
| 266 | Ear congestion | FAERS: 3 | US FAERS | |
| 267 | Epigastric discomfort | FAERS: 3 | US FAERS | |
| 268 | Eructation | FAERS: 3 | US FAERS | |
| 269 | Facial Pain | FAERS: 3 | US FAERS | |
| 270 | Fixed eruption | FAERS: 3 | US FAERS | |
| 271 | Foreign body in respiratory tract | FAERS: 3 | US FAERS | |
| 272 | Gingival Hypertrophy | FAERS: 3 | US FAERS | |
| 273 | Hunger | FAERS: 3 | US FAERS | |
| 274 | Hypoaesthesia facial | FAERS: 3 | US FAERS | |
| 275 | Impaired work ability | FAERS: 3 | US FAERS | |
| 276 | Incoherent | FAERS: 3 | US FAERS | |
| 277 | Intercepted drug administration error | FAERS: 3 | US FAERS | |
| 278 | Leukopenia | FAERS: 3 | US FAERS | |
| 279 | Medication residue present | FAERS: 3 | US FAERS | |
| 280 | Metrorrhagia | FAERS: 3 | US FAERS | |
| 281 | Muscle tightness | FAERS: 3 | US FAERS | |
| 282 | Musculoskeletal discomfort | FAERS: 3 | OFFSIDES SIDER US FAERS | |
| 283 | Neck Pain | FAERS: 3 | US FAERS | |
| 284 | Neutropenia | FAERS: 3 | US FAERS | |
| 285 | Night sweats | FAERS: 3 | US FAERS | |
| 286 | Oropharyngeal blistering | FAERS: 3 | US FAERS | |
| 287 | Paranasal sinus hypersecretion | FAERS: 3 | US FAERS | |
| 288 | Pharyngolaryngeal Pain | FAERS: 3 | OFFSIDES US FAERS | |
| 289 | Product administration error | FAERS: 3 | US FAERS | |
| 290 | Product container issue | FAERS: 3 | US FAERS | |
| 291 | Product contamination | FAERS: 3 | US FAERS | |
| 292 | Product formulation issue | FAERS: 3 | US FAERS | |
| 293 | Purpura | FAERS: 3 | US FAERS | |
| 294 | Scab | FAERS: 3 | US FAERS | |
| 295 | Somnambulism | FAERS: 3 | US FAERS | |
| 296 | Thermal burn | FAERS: 3 | US FAERS | |
| 297 | Tongue blistering | FAERS: 3 | US FAERS | |
| 298 | Trismus | FAERS: 3 | US FAERS | |
| 299 | Unresponsive to stimuli | FAERS: 3 | US FAERS | |
| 300 | Weight decreased | FAERS: 3 | US FAERS | |
| 301 | nervous system disorder | FAERS: 3 | SIDER US FAERS | |
| 302 | Acute myocardial infarction | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 303 | Allergic reaction to excipient | FAERS: 2 | US FAERS | |
| 304 | Allergy to chemicals | FAERS: 2 | US FAERS | |
| 305 | Blood glucose decreased | FAERS: 2 | OFFSIDES US FAERS | |
| 306 | Breast tenderness | FAERS: 2 | US FAERS | |
| 307 | Bronchospasm | FAERS: 2 | US FAERS | |
| 308 | Bruxism | FAERS: 2 | OFFSIDES US FAERS | |
| 309 | Cataract | FAERS: 2 | OFFSIDES US FAERS | |
| 310 | Cellulitis | FAERS: 2 | OFFSIDES US FAERS | |
| 311 | Cheilitis | FAERS: 2 | US FAERS | |
| 312 | Choking sensation | FAERS: 2 | OFFSIDES US FAERS | |
| 313 | Circumstance or information capable of leading to device use error | FAERS: 2 | US FAERS | |
| 314 | Contraindicated drug administered | FAERS: 2 | US FAERS | |
| 315 | Cyanosis | FAERS: 2 | US FAERS | |
| 316 | Device ineffective | FAERS: 2 | US FAERS | |
| 317 | Drug Tolerance | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 318 | Drug exposure via breast milk | FAERS: 2 | US FAERS | |
| 319 | Drug level increased | FAERS: 2 | US FAERS | |
| 320 | Hepatitis A | FAERS: 2 | US FAERS | |
| 321 | Hepatitis C | FAERS: 2 | OFFSIDES US FAERS | |
| 322 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 323 | Hyperchlorhydria | FAERS: 2 | US FAERS | |
| 324 | Incorrect drug administration rate | FAERS: 2 | US FAERS | |
| 325 | Increased viscosity of upper respiratory secretion | FAERS: 2 | US FAERS | |
| 326 | Influenza | FAERS: 2 | US FAERS | |
| 327 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 328 | Laryngospasm | FAERS: 2 | US FAERS | |
| 329 | Lipoma | FAERS: 2 | US FAERS | |
| 330 | Loss of personal independence in daily activities | FAERS: 2 | US FAERS | |
| 331 | Metastasis | FAERS: 2 | US FAERS | |
| 332 | Mouth swelling | FAERS: 2 | US FAERS | |
| 333 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 334 | Nasal inflammation | FAERS: 2 | US FAERS | |
| 335 | Onychoclasis | FAERS: 2 | US FAERS | |
| 336 | Optic Neuritis | FAERS: 2 | OFFSIDES US FAERS | |
| 337 | Pain of skin | FAERS: 2 | US FAERS | |
| 338 | Patient uncooperative | FAERS: 2 | US FAERS | |
| 339 | Poisoning | FAERS: 2 | US FAERS | |
| 340 | Prescribed underdose | FAERS: 2 | US FAERS | |
| 341 | Product administered to patient of inappropriate age | FAERS: 2 | US FAERS | |
| 342 | Product expiration date issue | FAERS: 2 | US FAERS | |
| 343 | Product packaging quantity issue | FAERS: 2 | US FAERS | |
| 344 | Product shape issue | FAERS: 2 | US FAERS | |
| 345 | Product storage error | FAERS: 2 | US FAERS | |
| 346 | Pulmonary congestion | FAERS: 2 | US FAERS | |
| 347 | Pulmonary pain | FAERS: 2 | US FAERS | |
| 348 | Reaction to excipient | FAERS: 2 | US FAERS | |
| 349 | Reaction to food additive | FAERS: 2 | US FAERS | |
| 350 | Refusal of treatment by relative | FAERS: 2 | US FAERS | |
| 351 | Renal tubular necrosis | FAERS: 2 | US FAERS | |
| 352 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 353 | Respiratory distress | FAERS: 2 | US FAERS | |
| 354 | Restless Legs Syndrome | FAERS: 2 | US FAERS | |
| 355 | Retinal Detachment | FAERS: 2 | US FAERS | |
| 356 | Rhinitis | FAERS: 2 | US FAERS | |
| 357 | Secretion discharge | FAERS: 2 | US FAERS | |
| 358 | Sinus Arrhythmia | FAERS: 2 | US FAERS | |
| 359 | Sinus bradycardia | FAERS: 2 | OFFSIDES US FAERS | |
| 360 | Sinus pain | FAERS: 2 | US FAERS | |
| 361 | Skin irritation | FAERS: 2 | US FAERS | |
| 362 | Skin reaction | FAERS: 2 | US FAERS | |
| 363 | Stupor | FAERS: 2 | US FAERS | |
| 364 | Tablet physical issue | FAERS: 2 | US FAERS | |
| 365 | Thrombosis | FAERS: 2 | US FAERS | |
| 366 | Tongue discomfort | FAERS: 2 | US FAERS | |
| 367 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 368 | Urine flow decreased | FAERS: 2 | US FAERS | |
| 369 | Urine output increased | FAERS: 2 | US FAERS | |
| 370 | Vascular rupture | FAERS: 2 | OFFSIDES US FAERS | |
| 371 | Viral upper respiratory tract infection | FAERS: 2 | OFFSIDES US FAERS | |
| 372 | Yawning | FAERS: 2 | US FAERS | |
| 373 | Abdominal rigidity | FAERS: 1 | US FAERS | |
| 374 | Acne | FAERS: 1 | OFFSIDES US FAERS | |
| 375 | Acute kidney injury | FAERS: 1 | 14558336 | CTD US FAERS |
| 376 | Agraphia | FAERS: 1 | US FAERS | |
| 377 | Allergic sinusitis | FAERS: 1 | US FAERS | |
| 378 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 379 | Anaphylactoid Reaction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 380 | Anorgasmia | FAERS: 1 | OFFSIDES US FAERS | |
| 381 | Apathy | FAERS: 1 | US FAERS | |
| 382 | Aphagia | FAERS: 1 | US FAERS | |
| 383 | Aphasia | FAERS: 1 | US FAERS | |
| 384 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 385 | Apparent death | FAERS: 1 | US FAERS | |
| 386 | Arthritis | FAERS: 1 | OFFSIDES US FAERS | |
| 387 | Arthropathy | FAERS: 1 | OFFSIDES US FAERS | |
| 388 | Arthropod sting | FAERS: 1 | US FAERS | |
| 389 | Asphyxia | FAERS: 1 | US FAERS | |
| 390 | Atrial Flutter | FAERS: 1 | US FAERS | |
| 391 | Aura | FAERS: 1 | OFFSIDES US FAERS | |
| 392 | Bedridden | FAERS: 1 | US FAERS | |
| 393 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 394 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 395 | Blood magnesium increased | FAERS: 1 | US FAERS | |
| 396 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 397 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 398 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 399 | Blood sodium increased | FAERS: 1 | US FAERS | |
| 400 | Blood viscosity abnormal | FAERS: 1 | US FAERS | |
| 401 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 402 | Bradyphrenia | FAERS: 1 | US FAERS | |
| 403 | Breathing-related sleep disorder | FAERS: 1 | US FAERS | |
| 404 | Bulimia Nervosa | FAERS: 1 | US FAERS | |
| 405 | Cardiomegaly | FAERS: 1 | US FAERS | |
| 406 | Cluster Headache | FAERS: 1 | US FAERS | |
| 407 | Coagulation factor VIII level decreased | FAERS: 1 | US FAERS | |
| 408 | Coating in mouth | FAERS: 1 | US FAERS | |
| 409 | Completed Suicide | FAERS: 1 | US FAERS | |
| 410 | Cystitis | FAERS: 1 | US FAERS | |
| 411 | Dark circles under eyes | FAERS: 1 | US FAERS | |
| 412 | Delirium | FAERS: 1 | US FAERS | |
| 413 | Dental caries | FAERS: 1 | US FAERS | |
| 414 | Dental discomfort | FAERS: 1 | US FAERS | |
| 415 | Dependence | FAERS: 1 | OFFSIDES US FAERS | |
| 416 | Dermatitis | FAERS: 1 | SIDER US FAERS | |
| 417 | Device malfunction | FAERS: 1 | US FAERS | |
| 418 | Disability | FAERS: 1 | US FAERS | |
| 419 | Dissociation | FAERS: 1 | US FAERS | |
| 420 | Diverticulum | FAERS: 1 | US FAERS | |
| 421 | Drooling | FAERS: 1 | US FAERS | |
| 422 | Drug abuser | FAERS: 1 | US FAERS | |
| 423 | Drug exposure before pregnancy | FAERS: 1 | US FAERS | |
| 424 | Drug screen false positive | FAERS: 1 | US FAERS | |
| 425 | Drug toxicity | FAERS: 1 | OFFSIDES US FAERS | |
| 426 | Duodenal Obstruction | FAERS: 1 | US FAERS | |
| 427 | Electrocardiogram ST segment abnormal | FAERS: 1 | US FAERS | |
| 428 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 429 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 430 | Emergency Care | FAERS: 1 | US FAERS | |
| 431 | Emotional distress | FAERS: 1 | OFFSIDES US FAERS | |
| 432 | Erectile dysfunction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 433 | Erythema Multiforme | FAERS: 1 | OFFSIDES US FAERS | |
| 434 | Exposure to unspecified agent | FAERS: 1 | US FAERS | |
| 435 | Exposure via direct contact | FAERS: 1 | US FAERS | |
| 436 | Eye inflammation | FAERS: 1 | US FAERS | |
| 437 | Eyelid Function Disorder | FAERS: 1 | US FAERS | |
| 438 | Facial paralysis | FAERS: 1 | US FAERS | |
| 439 | False negative investigation result | FAERS: 1 | US FAERS | |
| 440 | Feeding disorder of infancy OR early childhood | FAERS: 1 | US FAERS | |
| 441 | Fibromyalgia | FAERS: 1 | OFFSIDES US FAERS | |
| 442 | Flank Pain | FAERS: 1 | US FAERS | |
| 443 | Food Allergy | FAERS: 1 | US FAERS | |
| 444 | Food craving | FAERS: 1 | US FAERS | |
| 445 | Foreign travel | FAERS: 1 | US FAERS | |
| 446 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 447 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 448 | Gastric pH increased | FAERS: 1 | US FAERS | |
| 449 | Gastrointestinal infection | FAERS: 1 | US FAERS | |
| 450 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 451 | Gaze palsy | FAERS: 1 | US FAERS | |
| 452 | Genital pain | FAERS: 1 | US FAERS | |
| 453 | Gingival blister | FAERS: 1 | US FAERS | |
| 454 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 455 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 456 | Grip strength decreased | FAERS: 1 | US FAERS | |
| 457 | Growth retardation | FAERS: 1 | US FAERS | |
| 458 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 459 | Heart valve calcification | FAERS: 1 | US FAERS | |
| 460 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 461 | Heat illness | FAERS: 1 | US FAERS | |
| 462 | Hepatitis B surface antibody negative | FAERS: 1 | US FAERS | |
| 463 | Hepatitis B | FAERS: 1 | US FAERS | |
| 464 | Hepatomegaly | FAERS: 1 | US FAERS | |
| 465 | Histamine abnormal | FAERS: 1 | US FAERS | |
| 466 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 467 | Hypertensive crisis | FAERS: 1 | US FAERS | |
| 468 | Hypervigilance | FAERS: 1 | US FAERS | |
| 469 | Hypogeusia | FAERS: 1 | US FAERS | |
| 470 | Hypotonic-hyporesponsive episode | FAERS: 1 | US FAERS | |
| 471 | Hypoventilation | FAERS: 1 | US FAERS | |
| 472 | Incorrect product dosage form administered | FAERS: 1 | US FAERS | |
| 473 | Increased bronchial secretion | FAERS: 1 | OFFSIDES US FAERS | |
| 474 | Infection | FAERS: 1 | US FAERS | |
| 475 | Inflammation | FAERS: 1 | US FAERS | |
| 476 | Intentional drug misuse | FAERS: 1 | OFFSIDES US FAERS | |
| 477 | Intentional misuse | FAERS: 1 | US FAERS | |
| 478 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 479 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 480 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 481 | Intraocular pressure test abnormal | FAERS: 1 | US FAERS | |
| 482 | Joint stiffness | FAERS: 1 | US FAERS | |
| 483 | Lactose Intolerance | FAERS: 1 | OFFSIDES US FAERS | |
| 484 | Lagophthalmos | FAERS: 1 | US FAERS | |
| 485 | Laryngitis | FAERS: 1 | US FAERS | |
| 486 | Long QT Syndrome | FAERS: 1 | 12698686 15792261 | CTD US FAERS |
| 487 | Lymphocyte count increased | FAERS: 1 | US FAERS | |
| 488 | Macular degeneration | FAERS: 1 | US FAERS | |
| 489 | Maternal exposure during breast feeding | FAERS: 1 | US FAERS | |
| 490 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 491 | Medical device discomfort | FAERS: 1 | US FAERS | |
| 492 | Medical device site discomfort | FAERS: 1 | US FAERS | |
| 493 | Medication overuse headache | FAERS: 1 | US FAERS | |
| 494 | Mental impairment | FAERS: 1 | OFFSIDES US FAERS | |
| 495 | Monoplegia | FAERS: 1 | US FAERS | |
| 496 | Multiple Myeloma | FAERS: 1 | US FAERS | |
| 497 | Multiple drug overdose | FAERS: 1 | US FAERS | |
| 498 | Muscle Cramp | FAERS: 1 | US FAERS | |
| 499 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 500 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 501 | Mydriasis | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 502 | Nephrolithiasis | FAERS: 1 | US FAERS | |
| 503 | Neuralgia | FAERS: 1 | OFFSIDES US FAERS | |
| 504 | Neutrophil count decreased | FAERS: 1 | OFFSIDES US FAERS | |
| 505 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 506 | Obstruction | FAERS: 1 | US FAERS | |
| 507 | Ocular icterus | FAERS: 1 | US FAERS | |
| 508 | Oculogyric crisis | FAERS: 1 | US FAERS | |
| 509 | Open wound | FAERS: 1 | US FAERS | |
| 510 | Oppositional Defiant Disorder | FAERS: 1 | US FAERS | |
| 511 | Oral mucosal erythema | FAERS: 1 | US FAERS | |
| 512 | Oral pustule | FAERS: 1 | US FAERS | |
| 513 | Otitis Externa | FAERS: 1 | US FAERS | |
| 514 | Otitis Media | FAERS: 1 | US FAERS | |
| 515 | Pancreatitis | FAERS: 1 | US FAERS | |
| 516 | Papule | FAERS: 1 | US FAERS | |
| 517 | Paranasal sinus hyposecretion | FAERS: 1 | US FAERS | |
| 518 | Penile Infection | FAERS: 1 | US FAERS | |
| 519 | Penile swelling | FAERS: 1 | US FAERS | |
| 520 | Pharyngeal swelling | FAERS: 1 | US FAERS | |
| 521 | Phimosis | FAERS: 1 | US FAERS | |
| 522 | Phonological Disorder | FAERS: 1 | US FAERS | |
| 523 | Physical product label issue | FAERS: 1 | US FAERS | |
| 524 | Piloerection | FAERS: 1 | US FAERS | |
| 525 | Platelet count abnormal | FAERS: 1 | US FAERS | |
| 526 | Polymyalgia Rheumatica | FAERS: 1 | US FAERS | |
| 527 | Polyuria | FAERS: 1 | US FAERS | |
| 528 | Post procedural complication | FAERS: 1 | US FAERS | |
| 529 | Pregnancy | FAERS: 1 | US FAERS | |
| 530 | Priapism | FAERS: 1 | US FAERS | |
| 531 | Product availability issue | FAERS: 1 | US FAERS | |
| 532 | Product barcode issue | FAERS: 1 | US FAERS | |
| 533 | Product dose omission | FAERS: 1 | US FAERS | |
| 534 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 535 | Product name confusion | FAERS: 1 | US FAERS | |
| 536 | Product quality control issue | FAERS: 1 | US FAERS | |
| 537 | Product selection error | FAERS: 1 | US FAERS | |
| 538 | Product substitution | FAERS: 1 | US FAERS | |
| 539 | Product used for unknown indication | FAERS: 1 | US FAERS | |
| 540 | Prostate examination abnormal | FAERS: 1 | US FAERS | |
| 541 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 542 | Reaction to preservatives | FAERS: 1 | US FAERS | |
| 543 | Retinal Artery Occlusion | FAERS: 1 | US FAERS | |
| 544 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 545 | Rhinalgia | FAERS: 1 | US FAERS | |
| 546 | Rhonchi | FAERS: 1 | US FAERS | |
| 547 | Rosacea | FAERS: 1 | US FAERS | |
| 548 | Salivary gland pain | FAERS: 1 | US FAERS | |
| 549 | School refusal | FAERS: 1 | US FAERS | |
| 550 | Self Mutilation | FAERS: 1 | US FAERS | |
| 551 | Sight disability | FAERS: 1 | US FAERS | |
| 552 | Sinusitis noninfective | FAERS: 1 | US FAERS | |
| 553 | Sjogren's Syndrome | FAERS: 1 | US FAERS | |
| 554 | Skin Erosion | FAERS: 1 | US FAERS | |
| 555 | Skin test positive | FAERS: 1 | US FAERS | |
| 556 | Sleep Talking | FAERS: 1 | OFFSIDES US FAERS | |
| 557 | Spondylitis | FAERS: 1 | US FAERS | |
| 558 | Spontaneous penile erection | FAERS: 1 | US FAERS | |
| 559 | Sputum retention | FAERS: 1 | US FAERS | |
| 560 | Status Asthmaticus | FAERS: 1 | US FAERS | |
| 561 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 562 | Strabismus | FAERS: 1 | US FAERS | |
| 563 | Sudden death | FAERS: 1 | US FAERS | |
| 564 | Sudden onset of sleep | FAERS: 1 | US FAERS | |
| 565 | Sunburn | FAERS: 1 | US FAERS | |
| 566 | Superficial injury of eye | FAERS: 1 | US FAERS | |
| 567 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 568 | Tablet issue | FAERS: 1 | US FAERS | |
| 569 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 570 | Tension Headache | FAERS: 1 | US FAERS | |
| 571 | Tension | FAERS: 1 | SIDER US FAERS | |
| 572 | Therapy cessation | FAERS: 1 | US FAERS | |
| 573 | Therapy non-responder | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 574 | Therapy partial responder | FAERS: 1 | US FAERS | |
| 575 | Throat clearing | FAERS: 1 | US FAERS | |
| 576 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 577 | Tongue exfoliation | FAERS: 1 | US FAERS | |
| 578 | Transaminases increased | FAERS: 1 | US FAERS | |
| 579 | Type III immune complex mediated reaction | FAERS: 1 | US FAERS | |
| 580 | Upper respiratory tract inflammation | FAERS: 1 | US FAERS | |
| 581 | Urinary bladder polyp | FAERS: 1 | US FAERS | |
| 582 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 583 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 584 | VIIth nerve paralysis | FAERS: 1 | US FAERS | |
| 585 | Vasculitis | FAERS: 1 | US FAERS | |
| 586 | Ventricular Fibrillation | FAERS: 1 | OFFSIDES US FAERS | |
| 587 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 588 | Vulvovaginal pain | FAERS: 1 | US FAERS | |
| 589 | Vulvovaginal pruritus | FAERS: 1 | US FAERS | |
| 590 | White blood cell count abnormal | FAERS: 1 | US FAERS | |
| 591 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 592 | Wrong product administered | FAERS: 1 | US FAERS | |
| 593 | Xanthopsia | FAERS: 1 | US FAERS | |
| 594 | furuncle | FAERS: 1 | US FAERS | |
| 595 | prostatitis | FAERS: 1 | US FAERS | |
| 596 | treatment failure | FAERS: 1 | US FAERS | |
| 597 | Abdominal strangulated hernia | OFFSIDES | ||
| 598 | Abdominal tenderness | OFFSIDES | ||
| 599 | Abuse | OFFSIDES | ||
| 600 | Acid reflux | OFFSIDES | ||
| 601 | Acquired macroglossia | OFFSIDES | ||
| 602 | Acute Coronary Syndrome | OFFSIDES | ||
| 603 | Acute bronchitis | OFFSIDES | ||
| 604 | Acute psychosis | OFFSIDES | ||
| 605 | Alcohol consumption | OFFSIDES | ||
| 606 | Anhidrosis | OFFSIDES | ||
| 607 | Ankle Fracture | OFFSIDES | ||
| 608 | Ankylosing spondylitis | OFFSIDES | ||
| 609 | Arteriosclerosis | OFFSIDES | ||
| 610 | Arthroscopy | OFFSIDES | ||
| 611 | Aseptic Meningitis | OFFSIDES | ||
| 612 | Ataxia | OFFSIDES | ||
| 613 | Atrial tachycardia | OFFSIDES | ||
| 614 | Automatism | OFFSIDES | ||
| 615 | Benign Prostatic Hyperplasia | OFFSIDES | ||
| 616 | Bile Duct Stenosis | OFFSIDES | ||
| 617 | Biliary Dyskinesia | OFFSIDES | ||
| 618 | Biliary dilatation | OFFSIDES | ||
| 619 | Bipolar Disorder | OFFSIDES | ||
| 620 | Bipolar I disorder | OFFSIDES | ||
| 621 | Blighted ovum | OFFSIDES | ||
| 622 | Blood Glucose | OFFSIDES | ||
| 623 | Blood cholesterol | OFFSIDES | ||
| 624 | Blood folate increased | OFFSIDES | ||
| 625 | Blood pressure orthostatic decreased | OFFSIDES | ||
| 626 | Blood thyroid stimulating hormone | OFFSIDES | ||
| 627 | Blood triglycerides increased | OFFSIDES | ||
| 628 | Blurred vision | OFFSIDES | ||
| 629 | Brain scan abnormal | OFFSIDES | ||
| 630 | Breast cosmetic surgery | OFFSIDES | ||
| 631 | Bronchiectasis | OFFSIDES | ||
| 632 | Bursitis | OFFSIDES | ||
| 633 | Capillary Leak Syndrome | OFFSIDES | ||
| 634 | Cardioactive drug level increased | OFFSIDES | ||
| 635 | Cataract operation | OFFSIDES | ||
| 636 | Catheter site pain | OFFSIDES | ||
| 637 | Cerebellar infarction | OFFSIDES | ||
| 638 | Cerebral disorder | OFFSIDES | ||
| 639 | Cerebral perfusion pressure decreased | OFFSIDES | ||
| 640 | Chemical and Drug Induced Liver Injury | 23956101 | CTD | |
| 641 | Cholangiolitis | OFFSIDES | ||
| 642 | Chondromalacia | OFFSIDES | ||
| 643 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 644 | Colonic fistula | OFFSIDES | ||
| 645 | Confabulation | OFFSIDES | ||
| 646 | Congenital tricuspid valve incompetence | OFFSIDES | ||
| 647 | Conjunctival deposit | OFFSIDES | ||
| 648 | Coronary artery reocclusion | OFFSIDES | ||
| 649 | Cyst | OFFSIDES | ||
| 650 | Demyelination | OFFSIDES | ||
| 651 | Dental abscess | OFFSIDES | ||
| 652 | Dermoid Cyst | OFFSIDES | ||
| 653 | Diabetes | OFFSIDES | ||
| 654 | Diabetes mellitus inadequate control | OFFSIDES | ||
| 655 | Diabetic Retinopathy | OFFSIDES | ||
| 656 | Diarrhea | OFFSIDES | ||
| 657 | Diffuse panbronchiolitis | OFFSIDES | ||
| 658 | Diverticulitis | OFFSIDES | ||
| 659 | Diverticulosis | OFFSIDES | ||
| 660 | Drowsiness | OFFSIDES SIDER | ||
| 661 | Drug withdrawal headache | OFFSIDES | ||
| 662 | Dysgraphia | OFFSIDES | ||
| 663 | Economic problem | OFFSIDES | ||
| 664 | Ejection Fraction Decreased | OFFSIDES | ||
| 665 | Electrocardiogram ST-T change | OFFSIDES | ||
| 666 | Eyelid margin crusting | OFFSIDES | ||
| 667 | Facial Neuralgia | OFFSIDES | ||
| 668 | Facial rash | SIDER | ||
| 669 | Fatty Liver | OFFSIDES | ||
| 670 | Fungus culture positive | OFFSIDES | ||
| 671 | Gambling | OFFSIDES | ||
| 672 | Gastric ulcer | OFFSIDES | ||
| 673 | Gastritis | SIDER | ||
| 674 | Gastroenteritis | OFFSIDES | ||
| 675 | Gastrointestinal Pain | SIDER | ||
| 676 | General physical health deterioration | OFFSIDES | ||
| 677 | Global Amnesia | OFFSIDES | ||
| 678 | Hemiparesis | OFFSIDES | ||
| 679 | Hemiplegia | OFFSIDES | ||
| 680 | Hepatosplenomegaly | OFFSIDES | ||
| 681 | Hereditary cerebral degeneration | OFFSIDES | ||
| 682 | Hyperkinesia | SIDER | ||
| 683 | Hypertrophic Cardiomyopathy | OFFSIDES | ||
| 684 | Hypospadias | 16407038 | CTD | |
| 685 | Hypoxia | OFFSIDES | ||
| 686 | Immune reconstitution syndrome | OFFSIDES | ||
| 687 | Immunosuppression | OFFSIDES | ||
| 688 | Impaired gastric emptying | OFFSIDES | ||
| 689 | Incontinence | OFFSIDES | ||
| 690 | Infusion site mobility decreased | OFFSIDES | ||
| 691 | Injection site dermatitis | OFFSIDES | ||
| 692 | Injection site erythema | OFFSIDES | ||
| 693 | Injection site pruritus | OFFSIDES | ||
| 694 | Injection site vesicles | OFFSIDES | ||
| 695 | Intention tremor | OFFSIDES | ||
| 696 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 697 | Intervertebral disc disorder | OFFSIDES | ||
| 698 | Intestinal Perforation | OFFSIDES | ||
| 699 | Joint injury | OFFSIDES | ||
| 700 | Kidney Failure | OFFSIDES | ||
| 701 | Ligament injury | OFFSIDES | ||
| 702 | Myoglobin blood increased | OFFSIDES | ||
| 703 | Nasal sinus drainage | OFFSIDES | ||
| 704 | Nephritis, Interstitial | 14558336 | CTD | |
| 705 | Nervous tension | OFFSIDES | ||
| 706 | Neuroleptic Malignant Syndrome | OFFSIDES | ||
| 707 | Nodule | OFFSIDES | ||
| 708 | Nystagmus | OFFSIDES | ||
| 709 | Occult blood positive | OFFSIDES | ||
| 710 | Optic Atrophy | OFFSIDES | ||
| 711 | Optic Disc Edema | OFFSIDES | ||
| 712 | Osteogenesis Imperfecta | OFFSIDES | ||
| 713 | Osteomyelitis | OFFSIDES | ||
| 714 | Osteoporosis | OFFSIDES | ||
| 715 | Overweight | OFFSIDES | ||
| 716 | Panic Disorder | OFFSIDES | ||
| 717 | Parotid gland inflammation | OFFSIDES | ||
| 718 | Patellofemoral Pain Syndrome | OFFSIDES | ||
| 719 | Pericardial effusion | OFFSIDES | ||
| 720 | Periodontitis | OFFSIDES | ||
| 721 | Peripheral arterial occlusive disease | OFFSIDES | ||
| 722 | Peritoneal lesion | OFFSIDES | ||
| 723 | Pharyngitis | SIDER | ||
| 724 | Phlebitis | OFFSIDES | ||
| 725 | Polyneuropathy | OFFSIDES | ||
| 726 | Portal Hypertension | OFFSIDES | ||
| 727 | Proctitis herpes | OFFSIDES | ||
| 728 | Protein total increased | OFFSIDES | ||
| 729 | Psoriasis | OFFSIDES | ||
| 730 | Pulmonary Hypertension | OFFSIDES | ||
| 731 | QRS axis abnormal | OFFSIDES | ||
| 732 | Quadriparesis | OFFSIDES | ||
| 733 | Rectal polyp | OFFSIDES | ||
| 734 | Renal cyst | OFFSIDES | ||
| 735 | Respiratory Failure | OFFSIDES | ||
| 736 | Reticulocytosis | OFFSIDES | ||
| 737 | Retinal vascular occlusion | OFFSIDES | ||
| 738 | Rhinitis, Allergic, Perennial | 15119752 | CTD | |
| 739 | Rhinorrhea | OFFSIDES | ||
| 740 | Sacroiliitis | OFFSIDES | ||
| 741 | Scleroderma | OFFSIDES | ||
| 742 | Skeletal injury | OFFSIDES | ||
| 743 | Skin tightness | OFFSIDES | ||
| 744 | Sleep Wake Disorders | 7649340 | CTD | |
| 745 | Small intestine carcinoma | OFFSIDES | ||
| 746 | Spondylosis | OFFSIDES | ||
| 747 | Stomach ache | SIDER | ||
| 748 | Stress at work | OFFSIDES | ||
| 749 | Synovitis | OFFSIDES | ||
| 750 | Tachycardia, Ventricular | 7517624 12056995 | CTD | |
| 751 | Tardive Dyskinesia | OFFSIDES | ||
| 752 | Tendinitis | OFFSIDES | ||
| 753 | Thymoma | OFFSIDES | ||
| 754 | Torsades de Pointes | 12698686 15792261 20455340 | CTD | |
| 755 | Trisomy 21 | OFFSIDES | ||
| 756 | Tuberous Sclerosis | OFFSIDES | ||
| 757 | Vitreous Detachment | OFFSIDES | ||
| 758 | Walking aid user | OFFSIDES | ||
| 759 | Weight Gain | OFFSIDES | ||
| 760 | Wound Infection | OFFSIDES | ||
| 761 | colonoscopy | OFFSIDES | ||
| 762 | muscle injury | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120329
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.