Amiodarone
(ITPDYQOUSLNIHG-UHFFFAOYSA-N)
Structure
- SMILES
- CCCCc1oc2c(c1C(=O)c1cc(I)c(c(c1)I)OCCN(CC)CC)cccc2.Cl
- Molecular Formula:
- C25H30ClI2NO3
- Molecular Weight:
- 681.773
- Log P:
- 7.7382
- Hydrogen Bond Acceptor:
- 4
- Hydrogen Bond Donor:
- 1
- TPSA:
- 42.68
- CAS Number(s):
- 19774-82-4
Synonym(s)
1.
Amiodarone
2.
Amiobeta
3.
Amiodarex
4.
Amiodarona
5.
Amiodarone Hydrochloride
6.
Amiohexal
7.
Aratac
8.
Braxan
9.
Corbionax
10.
Cordarex
11.
Cordarone
12.
Kordaron
13.
L-3428
14.
Ortacrone
15.
Rytmarone
16.
SKF 33134-A
17.
Tachydaron
18.
Trangorex
19.
Hydrochloride, Amiodarone
20.
L 3428
21.
L3428
22.
SKF 33134 A
23.
SKF 33134A
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Hyperthyroidism | FAERS: 235 Canada Vigilance: 21 | Canada Vigilance US FAERS | |
| 2 | Pulmonary toxicity | FAERS: 188 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Pulmonary Fibrosis | FAERS: 174 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 4 | Hypothyroidism | FAERS: 131 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 5 | Asthenia | FAERS: 101 | US FAERS | |
| 6 | Pneumonia | FAERS: 100 | US FAERS | |
| 7 | Fatigue | FAERS: 99 | US FAERS | |
| 8 | Dizziness | FAERS: 91 | US FAERS | |
| 9 | Respiratory Failure | FAERS: 86 | US FAERS | |
| 10 | Blindness | FAERS: 83 | US FAERS | |
| 11 | Atrial Fibrillation | FAERS: 81 | US FAERS | |
| 12 | Tremor | FAERS: 67 | US FAERS | |
| 13 | Drug ineffective | FAERS: 65 Canada Vigilance: 5 | Canada Vigilance US FAERS | |
| 14 | Thyroiditis | FAERS: 57 | US FAERS | |
| 15 | Hypotension | FAERS: 56 | US FAERS | |
| 16 | Bradycardia | FAERS: 55 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 17 | Drug toxicity | FAERS: 53 | US FAERS | |
| 18 | Toxicity to various agents | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Pneumonitis | FAERS: 49 | US FAERS | |
| 20 | Nausea | FAERS: 47 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 21 | Weight decreased | FAERS: 46 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 22 | Phlebitis | FAERS: 41 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 23 | Cardiac Arrest | FAERS: 39 | US FAERS | |
| 24 | Extravasation | FAERS: 35 | US FAERS | |
| 25 | Restlessness | FAERS: 30 | US FAERS | |
| 26 | Keratopathy | FAERS: 29 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Product use in unapproved indication | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 28 | Visual Impairment | FAERS: 28 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 29 | Vomiting | FAERS: 27 | US FAERS | |
| 30 | Headache | FAERS: 26 | US FAERS | |
| 31 | Infusion site phlebitis | FAERS: 26 | US FAERS | |
| 32 | Nervousness | FAERS: 26 | US FAERS | |
| 33 | Syncope | FAERS: 26 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 34 | Wheezing | FAERS: 26 | US FAERS | |
| 35 | Malaise | FAERS: 25 | US FAERS | |
| 36 | Ventricular Fibrillation | FAERS: 25 | US FAERS | |
| 37 | Aspartate Aminotransferase Increased | FAERS: 24 | US FAERS | |
| 38 | Chest Pain | FAERS: 24 | US FAERS | |
| 39 | Hypoxia | FAERS: 24 | US FAERS | |
| 40 | Palpitations | FAERS: 24 | US FAERS | |
| 41 | Hepatotoxicity | FAERS: 23 | US FAERS | |
| 42 | Lymphoid tissue hyperplasia | FAERS: 23 | US FAERS | |
| 43 | Tachycardia | FAERS: 23 | US FAERS | |
| 44 | Alopecia | FAERS: 22 | US FAERS | |
| 45 | Anxiety | FAERS: 22 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 46 | Atrial Flutter | FAERS: 22 | US FAERS | |
| 47 | Blood creatinine increased | FAERS: 21 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 48 | Pericardial effusion | FAERS: 20 | US FAERS | |
| 49 | Agitation | FAERS: 18 | US FAERS | |
| 50 | Erythema | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 51 | Alanine Aminotransferase Increased | FAERS: 17 | US FAERS | |
| 52 | Dysgeusia | FAERS: 17 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 53 | Pain | FAERS: 17 | US FAERS | |
| 54 | Myocardial Infarction | FAERS: 16 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Pulmonary Hypertension | FAERS: 16 | US FAERS | |
| 56 | Shock | FAERS: 16 | US FAERS | |
| 57 | Abdominal Pain | FAERS: 15 | US FAERS | |
| 58 | Anorexia | FAERS: 15 | US FAERS | |
| 59 | Ascites | FAERS: 15 | US FAERS | |
| 60 | Constipation | FAERS: 15 | US FAERS | |
| 61 | Optic Neuropathy | FAERS: 15 | US FAERS | |
| 62 | Sinus bradycardia | FAERS: 15 | US FAERS | |
| 63 | Blood creatine phosphokinase increased | FAERS: 14 | US FAERS | |
| 64 | Medication Error | FAERS: 13 | US FAERS | |
| 65 | Sepsis | FAERS: 13 | US FAERS | |
| 66 | Ataxia | FAERS: 11 | US FAERS | |
| 67 | Cardiomegaly | FAERS: 11 | US FAERS | |
| 68 | General physical health deterioration | FAERS: 11 | US FAERS | |
| 69 | Infection | FAERS: 11 | US FAERS | |
| 70 | Loss of personal independence in daily activities | FAERS: 11 | US FAERS | |
| 71 | Blood thyroid stimulating hormone increased | FAERS: 10 | US FAERS | |
| 72 | Cell marker increased | FAERS: 10 | US FAERS | |
| 73 | Chills | FAERS: 10 | US FAERS | |
| 74 | Corneal Opacity | FAERS: 10 | US FAERS | |
| 75 | Ejection Fraction Decreased | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 76 | Hypersensitivity | FAERS: 10 | US FAERS | |
| 77 | Pancytopenia | FAERS: 10 | US FAERS | |
| 78 | Productive Cough | FAERS: 10 | US FAERS | |
| 79 | Pruritus | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 80 | Therapy non-responder | FAERS: 10 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 81 | nervous system disorder | FAERS: 10 | US FAERS | |
| 82 | Acute Coronary Syndrome | FAERS: 9 | US FAERS | |
| 83 | Acute Lung Injury | FAERS: 9 | US FAERS | |
| 84 | Acute kidney injury | FAERS: 9 | US FAERS | |
| 85 | Acute respiratory failure | FAERS: 9 | US FAERS | |
| 86 | Blood alkaline phosphatase increased | FAERS: 9 | US FAERS | |
| 87 | Device pacing issue | FAERS: 9 | US FAERS | |
| 88 | Drug level increased | FAERS: 9 | US FAERS | |
| 89 | Eosinophilic Pneumonia | FAERS: 9 | US FAERS | |
| 90 | Feeling abnormal | FAERS: 9 | US FAERS | |
| 91 | Infusion Site Extravasation | FAERS: 9 | US FAERS | |
| 92 | Unresponsive to stimuli | FAERS: 9 | US FAERS | |
| 93 | Urticaria | FAERS: 9 | US FAERS | |
| 94 | Amnesia | FAERS: 8 | US FAERS | |
| 95 | Back Pain | FAERS: 8 | US FAERS | |
| 96 | Chest discomfort | FAERS: 8 | US FAERS | |
| 97 | Cholestasis | FAERS: 8 | US FAERS | |
| 98 | Disease recurrence | FAERS: 8 | US FAERS | |
| 99 | Ileus | FAERS: 8 | US FAERS | |
| 100 | Lung Injury | FAERS: 8 | US FAERS | |
| 101 | Overdose | FAERS: 8 | US FAERS | |
| 102 | Pallor | FAERS: 8 | US FAERS | |
| 103 | Pharmaceutical product complaint | FAERS: 8 | US FAERS | |
| 104 | Respiratory arrest | FAERS: 8 | US FAERS | |
| 105 | Thrombosis | FAERS: 8 | US FAERS | |
| 106 | jaundice | FAERS: 8 | US FAERS | |
| 107 | Abasia | FAERS: 7 | US FAERS | |
| 108 | Acute myocardial infarction | FAERS: 7 | US FAERS | |
| 109 | Aspergillosis | FAERS: 7 | US FAERS | |
| 110 | Blood thyroid stimulating hormone decreased | FAERS: 7 | US FAERS | |
| 111 | Candidiasis | FAERS: 7 | US FAERS | |
| 112 | Cataract | FAERS: 7 | US FAERS | |
| 113 | Diffuse alveolar damage | FAERS: 7 | US FAERS | |
| 114 | Drug administration error | FAERS: 7 | US FAERS | |
| 115 | Epistaxis | FAERS: 7 | US FAERS | |
| 116 | Hepatic Encephalopathy | FAERS: 7 | US FAERS | |
| 117 | Inflammation | FAERS: 7 | US FAERS | |
| 118 | Injection site erythema | FAERS: 7 | US FAERS | |
| 119 | Injection site extravasation | FAERS: 7 | US FAERS | |
| 120 | Injection site pain | FAERS: 7 | US FAERS | |
| 121 | Lethargy | FAERS: 7 | US FAERS | |
| 122 | Long QT Syndrome | FAERS: 7 | US FAERS | |
| 123 | Muscle tightness | FAERS: 7 | US FAERS | |
| 124 | Procedural complication | FAERS: 7 | US FAERS | |
| 125 | Rales | FAERS: 7 | US FAERS | |
| 126 | Respiratory distress | FAERS: 7 | US FAERS | |
| 127 | Somnolence | FAERS: 7 | US FAERS | |
| 128 | Vertigo | FAERS: 7 | US FAERS | |
| 129 | Alveolitis | FAERS: 6 | US FAERS | |
| 130 | Blood potassium increased | FAERS: 6 | US FAERS | |
| 131 | Burning sensation | FAERS: 6 | US FAERS | |
| 132 | Cardiac Tamponade | FAERS: 6 | US FAERS | |
| 133 | Cerebrovascular accident | FAERS: 6 | US FAERS | |
| 134 | Cyanosis | FAERS: 6 | US FAERS | |
| 135 | Essential Tremor | FAERS: 6 | US FAERS | |
| 136 | Joint swelling | FAERS: 6 | US FAERS | |
| 137 | Jugular vein distension | FAERS: 6 | US FAERS | |
| 138 | Optic Atrophy | FAERS: 6 | US FAERS | |
| 139 | Oxygen supplementation | FAERS: 6 | US FAERS | |
| 140 | Pneumothorax | FAERS: 6 | US FAERS | |
| 141 | Pulmonary function test decreased | FAERS: 6 | US FAERS | |
| 142 | Septic Shock | FAERS: 6 | US FAERS | |
| 143 | Skin necrosis | FAERS: 6 | US FAERS | |
| 144 | Suicide attempt | FAERS: 6 | US FAERS | |
| 145 | Swelling | FAERS: 6 | US FAERS | |
| 146 | Temperature intolerance | FAERS: 6 | US FAERS | |
| 147 | Transaminases increased | FAERS: 6 | US FAERS | |
| 148 | Ventricular arrhythmia | FAERS: 6 | US FAERS | |
| 149 | Accidental overdose | FAERS: 5 | US FAERS | |
| 150 | Activities of daily living impaired | FAERS: 5 | US FAERS | |
| 151 | Ageusia | FAERS: 5 | US FAERS | |
| 152 | Asthma | FAERS: 5 | US FAERS | |
| 153 | Atrioventricular Block | FAERS: 5 | US FAERS | |
| 154 | Bone marrow granuloma | FAERS: 5 | US FAERS | |
| 155 | Cachexia | FAERS: 5 | US FAERS | |
| 156 | Delirium | FAERS: 5 | US FAERS | |
| 157 | Deposit eye | FAERS: 5 | US FAERS | |
| 158 | Dysphonia | FAERS: 5 | US FAERS | |
| 159 | Granuloma | FAERS: 5 | US FAERS | |
| 160 | Injection site phlebitis | FAERS: 5 | US FAERS | |
| 161 | Injection site warmth | FAERS: 5 | US FAERS | |
| 162 | Liver scan abnormal | FAERS: 5 | US FAERS | |
| 163 | Lupus-like syndrome | FAERS: 5 | US FAERS | |
| 164 | Musculoskeletal Pain | FAERS: 5 | US FAERS | |
| 165 | Musculoskeletal discomfort | FAERS: 5 | US FAERS | |
| 166 | Myoclonus | FAERS: 5 | US FAERS | |
| 167 | Optic Neuritis | FAERS: 5 | US FAERS | |
| 168 | Sick Sinus Syndrome | FAERS: 5 | US FAERS | |
| 169 | Supraventricular tachycardia | FAERS: 5 | US FAERS | |
| 170 | Thrombocytopenia | FAERS: 5 | US FAERS | |
| 171 | Thrombophlebitis | FAERS: 5 | US FAERS | |
| 172 | Urinary tract infection | FAERS: 5 | US FAERS | |
| 173 | treatment failure | FAERS: 5 | US FAERS | |
| 174 | Abdominal discomfort | FAERS: 4 | US FAERS | |
| 175 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 176 | Arthralgia | FAERS: 4 | US FAERS | |
| 177 | Atrial tachycardia | FAERS: 4 | US FAERS | |
| 178 | Cellulitis | FAERS: 4 | US FAERS | |
| 179 | Discomfort | FAERS: 4 | US FAERS | |
| 180 | Disorientation | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 181 | Drug ineffective for unapproved indication | FAERS: 4 | US FAERS | |
| 182 | Hepatitis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 183 | Hypophagia | FAERS: 4 | US FAERS | |
| 184 | Implantable defibrillator malfunction | FAERS: 4 | US FAERS | |
| 185 | Incorrect dose administered | FAERS: 4 | US FAERS | |
| 186 | Infusion site erythema | FAERS: 4 | US FAERS | |
| 187 | Injection Site Reaction | FAERS: 4 | US FAERS | |
| 188 | Kounis Syndrome | FAERS: 4 | US FAERS | |
| 189 | Maternal exposure during pregnancy | FAERS: 4 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 190 | Memory impairment | FAERS: 4 | US FAERS | |
| 191 | Myopathy | FAERS: 4 | US FAERS | |
| 192 | Pancreatitis | FAERS: 4 | US FAERS | |
| 193 | Photophobia | FAERS: 4 | US FAERS | |
| 194 | Pleurisy | FAERS: 4 | US FAERS | |
| 195 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 196 | Pulmonary congestion | FAERS: 4 | US FAERS | |
| 197 | Retching | FAERS: 4 | US FAERS | |
| 198 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 199 | Sudden death | FAERS: 4 | US FAERS | |
| 200 | Tinnitus | FAERS: 4 | US FAERS | |
| 201 | Toxic Epidermal Necrolysis | FAERS: 4 | US FAERS | |
| 202 | Vitreous floaters | FAERS: 4 | US FAERS | |
| 203 | Anosmia | FAERS: 3 | US FAERS | |
| 204 | Anti-thyroid antibody positive | FAERS: 3 | US FAERS | |
| 205 | Aortic Aneurysm | FAERS: 3 | US FAERS | |
| 206 | Asterixis | FAERS: 3 | US FAERS | |
| 207 | Blood albumin decreased | FAERS: 3 | US FAERS | |
| 208 | Blood lactate dehydrogenase increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 209 | Blood pH increased | FAERS: 3 | US FAERS | |
| 210 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 211 | Brain natriuretic peptide increased | FAERS: 3 | US FAERS | |
| 212 | Bronchitis | FAERS: 3 | US FAERS | |
| 213 | Bronchopneumonia | FAERS: 3 | US FAERS | |
| 214 | Bronchospasm | FAERS: 3 | US FAERS | |
| 215 | Cholecystitis | FAERS: 3 | US FAERS | |
| 216 | Depression suicidal | FAERS: 3 | US FAERS | |
| 217 | Device malfunction | FAERS: 3 | US FAERS | |
| 218 | Diplopia | FAERS: 3 | US FAERS | |
| 219 | Disseminated Intravascular Coagulation | FAERS: 3 | US FAERS | |
| 220 | Drug abuse | FAERS: 3 | US FAERS | |
| 221 | Drug prescribing error | FAERS: 3 | US FAERS | |
| 222 | Endovenous ablation | FAERS: 3 | US FAERS | |
| 223 | Failure to Thrive | FAERS: 3 | US FAERS | |
| 224 | Feeling Cold | FAERS: 3 | US FAERS | |
| 225 | Fluid overload | FAERS: 3 | US FAERS | |
| 226 | Flushing | FAERS: 3 | US FAERS | |
| 227 | Gait inability | FAERS: 3 | US FAERS | |
| 228 | Gallop rhythm present | FAERS: 3 | US FAERS | |
| 229 | Gamma-Glutamyltransferase Increased | FAERS: 3 | US FAERS | |
| 230 | Intestinal Obstruction | FAERS: 3 | US FAERS | |
| 231 | Intestinal Perforation | FAERS: 3 | US FAERS | |
| 232 | Leukocytosis | FAERS: 3 | US FAERS | |
| 233 | Limb discomfort | FAERS: 3 | US FAERS | |
| 234 | Lung consolidation | FAERS: 3 | US FAERS | |
| 235 | Mental impairment | FAERS: 3 | US FAERS | |
| 236 | Necrosis | FAERS: 3 | US FAERS | |
| 237 | Neonatal disorder | FAERS: 3 | US FAERS | |
| 238 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 239 | Pericarditis | FAERS: 3 | US FAERS | |
| 240 | Pleuritic pain | FAERS: 3 | US FAERS | |
| 241 | Poisoning | FAERS: 3 | US FAERS | |
| 242 | Post procedural complication | FAERS: 3 | US FAERS | |
| 243 | Presyncope | FAERS: 3 | US FAERS | |
| 244 | Product substitution issue | FAERS: 3 | US FAERS | |
| 245 | Product use issue | FAERS: 3 | US FAERS | |
| 246 | Radiculopathy | FAERS: 3 | US FAERS | |
| 247 | Restrictive pulmonary disease | FAERS: 3 | US FAERS | |
| 248 | Right ventricular failure | FAERS: 3 | US FAERS | |
| 249 | Sarcoidosis | FAERS: 3 | US FAERS | |
| 250 | Skin reaction | FAERS: 3 | US FAERS | |
| 251 | Sudden Cardiac Death | FAERS: 3 | US FAERS | |
| 252 | Throat irritation | FAERS: 3 | US FAERS | |
| 253 | Urinary Incontinence | FAERS: 3 | US FAERS | |
| 254 | Urinary Retention | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 255 | Ventricular Dysfunction | FAERS: 3 | US FAERS | |
| 256 | Walking aid user | FAERS: 3 | US FAERS | |
| 257 | White blood cell count decreased | FAERS: 3 | US FAERS | |
| 258 | Accessory cardiac pathway | FAERS: 2 | US FAERS | |
| 259 | Adenocarcinoma | FAERS: 2 | US FAERS | |
| 260 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 261 | Apathy | FAERS: 2 | US FAERS | |
| 262 | Atelectasis | FAERS: 2 | US FAERS | |
| 263 | Autoantibody positive | FAERS: 2 | US FAERS | |
| 264 | Basal cell carcinoma | FAERS: 2 | US FAERS | |
| 265 | Blood glucose increased | FAERS: 2 | US FAERS | |
| 266 | Blood immunoglobulin A increased | FAERS: 2 | US FAERS | |
| 267 | Blood immunoglobulin G decreased | FAERS: 2 | US FAERS | |
| 268 | Blood pressure immeasurable | FAERS: 2 | US FAERS | |
| 269 | Blood thyroid stimulating hormone abnormal | FAERS: 2 | US FAERS | |
| 270 | Blood urea increased | FAERS: 2 | US FAERS | |
| 271 | Bronchiectasis | FAERS: 2 | US FAERS | |
| 272 | Carcinoembryonic antigen increased | FAERS: 2 | US FAERS | |
| 273 | Cardiac Death | FAERS: 2 | US FAERS | |
| 274 | Cerebellar Ataxia | FAERS: 2 | US FAERS | |
| 275 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 276 | Cerebral Thrombosis | FAERS: 2 | US FAERS | |
| 277 | Chronic respiratory failure | FAERS: 2 | US FAERS | |
| 278 | Corneal dystrophy | FAERS: 2 | US FAERS | |
| 279 | Corneal pigmentation | FAERS: 2 | US FAERS | |
| 280 | Deep Vein Thrombosis | FAERS: 2 | US FAERS | |
| 281 | Depressed Level of Consciousness | FAERS: 2 | US FAERS | |
| 282 | Depressed mood | FAERS: 2 | US FAERS | |
| 283 | Device related infection | FAERS: 2 | US FAERS | |
| 284 | Diabetes Mellitus | FAERS: 2 | US FAERS | |
| 285 | Diverticulitis | FAERS: 2 | US FAERS | |
| 286 | Drug effect incomplete | FAERS: 2 | US FAERS | |
| 287 | Drug level above therapeutic | FAERS: 2 | US FAERS | |
| 288 | Electrocardiogram delta waves abnormal | FAERS: 2 | US FAERS | |
| 289 | Electrocardiogram poor R-wave progression | FAERS: 2 | US FAERS | |
| 290 | Elevated pacing threshold | FAERS: 2 | US FAERS | |
| 291 | Eosinophilia | FAERS: 2 | US FAERS | |
| 292 | Exophthalmos | FAERS: 2 | US FAERS | |
| 293 | Eye irritation | FAERS: 2 | US FAERS | |
| 294 | Eye pain | FAERS: 2 | US FAERS | |
| 295 | Fibrosis | FAERS: 2 | US FAERS | |
| 296 | Flatulence | FAERS: 2 | US FAERS | |
| 297 | Fracture | FAERS: 2 | US FAERS | |
| 298 | Gastritis | FAERS: 2 | US FAERS | |
| 299 | Gastrointestinal hypomotility | FAERS: 2 | US FAERS | |
| 300 | Grip strength decreased | FAERS: 2 | US FAERS | |
| 301 | Guillain-Barre Syndrome | FAERS: 2 | US FAERS | |
| 302 | Head titubation | FAERS: 2 | US FAERS | |
| 303 | Hepatic congestion | FAERS: 2 | US FAERS | |
| 304 | Hepatic necrosis | FAERS: 2 | US FAERS | |
| 305 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 306 | Hepatosplenomegaly | FAERS: 2 | US FAERS | |
| 307 | Hilar lymphadenopathy | FAERS: 2 | US FAERS | |
| 308 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 309 | Hypoperfusion | FAERS: 2 | US FAERS | |
| 310 | Hyporeflexia | FAERS: 2 | US FAERS | |
| 311 | Idiopathic Pulmonary Fibrosis | FAERS: 2 | US FAERS | |
| 312 | Impaired driving ability | FAERS: 2 | US FAERS | |
| 313 | Incorrect route of drug administration | FAERS: 2 | US FAERS | |
| 314 | Influenza | FAERS: 2 | US FAERS | |
| 315 | Infusion site bruising | FAERS: 2 | US FAERS | |
| 316 | Infusion site pain | FAERS: 2 | US FAERS | |
| 317 | Infusion site swelling | FAERS: 2 | US FAERS | |
| 318 | Injection site discharge | FAERS: 2 | US FAERS | |
| 319 | Injection site necrosis | FAERS: 2 | US FAERS | |
| 320 | Injection site thrombosis | FAERS: 2 | US FAERS | |
| 321 | Iodine uptake increased | FAERS: 2 | US FAERS | |
| 322 | Leukopenia | FAERS: 2 | US FAERS | |
| 323 | Lip swelling | FAERS: 2 | US FAERS | |
| 324 | Lipoma | FAERS: 2 | US FAERS | |
| 325 | Low density lipoprotein increased | FAERS: 2 | US FAERS | |
| 326 | Lower respiratory tract infection | FAERS: 2 | US FAERS | |
| 327 | Lumbar radiculopathy | FAERS: 2 | US FAERS | |
| 328 | Lymphadenopathy | FAERS: 2 | US FAERS | |
| 329 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 330 | Malignant neoplasm of ampulla of Vater | FAERS: 2 | US FAERS | |
| 331 | Mental status changes | FAERS: 2 | US FAERS | |
| 332 | Mouth swelling | FAERS: 2 | US FAERS | |
| 333 | Multi-organ disorder | FAERS: 2 | US FAERS | |
| 334 | Multiple Myeloma | FAERS: 2 | US FAERS | |
| 335 | Myalgia | FAERS: 2 | US FAERS | |
| 336 | Myocardial fibrosis | FAERS: 2 | US FAERS | |
| 337 | Nasopharyngitis | FAERS: 2 | US FAERS | |
| 338 | Night sweats | FAERS: 2 | US FAERS | |
| 339 | No adverse event | FAERS: 2 | US FAERS | |
| 340 | Nystagmus | FAERS: 2 | US FAERS | |
| 341 | Ocular icterus | FAERS: 2 | US FAERS | |
| 342 | Optic nerve cupping | FAERS: 2 | US FAERS | |
| 343 | Peripheral swelling | FAERS: 2 | US FAERS | |
| 344 | Poor quality sleep | FAERS: 2 | US FAERS | |
| 345 | Product quality issue | FAERS: 2 | US FAERS | |
| 346 | Product taste abnormal | FAERS: 2 | US FAERS | |
| 347 | Rash erythematous | FAERS: 2 | US FAERS | |
| 348 | Reaction to drug excipients | FAERS: 2 | US FAERS | |
| 349 | Respiratory Paralysis | FAERS: 2 | US FAERS | |
| 350 | Retinal pigment epitheliopathy | FAERS: 2 | US FAERS | |
| 351 | Sinus Tachycardia | FAERS: 2 | US FAERS | |
| 352 | Sneezing | FAERS: 2 | US FAERS | |
| 353 | Splenomegaly | FAERS: 2 | US FAERS | |
| 354 | Stress | FAERS: 2 | US FAERS | |
| 355 | Tachyarrhythmia | FAERS: 2 | US FAERS | |
| 356 | Therapy cessation | FAERS: 2 | US FAERS | |
| 357 | Thermal burn | FAERS: 2 | US FAERS | |
| 358 | Thyroid hormones increased | FAERS: 2 | US FAERS | |
| 359 | Thyrotoxic periodic paralysis | FAERS: 2 | US FAERS | |
| 360 | Trismus | FAERS: 2 | US FAERS | |
| 361 | Unevaluable event | FAERS: 2 | US FAERS | |
| 362 | Vasoplegia syndrome | FAERS: 2 | US FAERS | |
| 363 | Ventricular dyssynchrony | FAERS: 2 | US FAERS | |
| 364 | Ventricular hypertrophy | FAERS: 2 | US FAERS | |
| 365 | Visual disturbance | FAERS: 2 | US FAERS | |
| 366 | Weaning failure | FAERS: 2 | US FAERS | |
| 367 | Xerosis | FAERS: 2 | US FAERS | |
| 368 | Abdominal Abscess | FAERS: 1 | US FAERS | |
| 369 | Abdominal symptom | FAERS: 1 | US FAERS | |
| 370 | Accelerated Idioventricular Rhythm | FAERS: 1 | US FAERS | |
| 371 | Acidosis | FAERS: 1 | US FAERS | |
| 372 | Acute psychosis | FAERS: 1 | US FAERS | |
| 373 | Adverse event | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 374 | Agranulocytosis | FAERS: 1 | US FAERS | |
| 375 | Akathisia | FAERS: 1 | US FAERS | |
| 376 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 377 | Altered visual depth perception | FAERS: 1 | US FAERS | |
| 378 | Amaurosis | FAERS: 1 | US FAERS | |
| 379 | Ammonia increased | FAERS: 1 | US FAERS | |
| 380 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 381 | Anaphylactoid Reaction | FAERS: 1 | US FAERS | |
| 382 | Anger | FAERS: 1 | US FAERS | |
| 383 | Angiodysplasia | FAERS: 1 | US FAERS | |
| 384 | Angioedema | FAERS: 1 | US FAERS | |
| 385 | Angiogram pulmonary abnormal | FAERS: 1 | US FAERS | |
| 386 | Antibody test abnormal | FAERS: 1 | US FAERS | |
| 387 | Antibody test positive | FAERS: 1 | US FAERS | |
| 388 | Aortic valve calcification | FAERS: 1 | US FAERS | |
| 389 | Aphagia | FAERS: 1 | US FAERS | |
| 390 | Aphasia | FAERS: 1 | US FAERS | |
| 391 | Aspergillus test positive | FAERS: 1 | US FAERS | |
| 392 | Astigmatism | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 393 | Atrial conduction time prolongation | FAERS: 1 | US FAERS | |
| 394 | Atrial thrombosis | FAERS: 1 | US FAERS | |
| 395 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 396 | Axonal neuropathy | FAERS: 1 | US FAERS | |
| 397 | Back disorder | FAERS: 1 | US FAERS | |
| 398 | Belligerence | FAERS: 1 | US FAERS | |
| 399 | Benign neoplasm of bladder | FAERS: 1 | US FAERS | |
| 400 | Biliary Colic | FAERS: 1 | US FAERS | |
| 401 | Biliary dyspepsia | FAERS: 1 | US FAERS | |
| 402 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 403 | Biopsy bone marrow abnormal | FAERS: 1 | US FAERS | |
| 404 | Blood albumin increased | FAERS: 1 | US FAERS | |
| 405 | Blood aldosterone increased | FAERS: 1 | US FAERS | |
| 406 | Blood blister | FAERS: 1 | US FAERS | |
| 407 | Blood cholesterol increased | FAERS: 1 | US FAERS | |
| 408 | Blood creatine phosphokinase MB increased | FAERS: 1 | US FAERS | |
| 409 | Blood follicle stimulating hormone increased | FAERS: 1 | US FAERS | |
| 410 | Blood glucose decreased | FAERS: 1 | US FAERS | |
| 411 | Blood glucose fluctuation | FAERS: 1 | US FAERS | |
| 412 | Blood pH decreased | FAERS: 1 | US FAERS | |
| 413 | Blood parathyroid hormone increased | FAERS: 1 | US FAERS | |
| 414 | Blood potassium abnormal | FAERS: 1 | US FAERS | |
| 415 | Blood pressure inadequately controlled | FAERS: 1 | US FAERS | |
| 416 | Blood testosterone decreased | FAERS: 1 | US FAERS | |
| 417 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 418 | Blood urine present | FAERS: 1 | US FAERS | |
| 419 | Bronchiolitis | FAERS: 1 | US FAERS | |
| 420 | Bronchoscopy abnormal | FAERS: 1 | US FAERS | |
| 421 | Bulimia Nervosa | FAERS: 1 | US FAERS | |
| 422 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 423 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 424 | Cardiac dysfunction | FAERS: 1 | US FAERS | |
| 425 | Cardiac infection | FAERS: 1 | US FAERS | |
| 426 | Cardiac sarcoidosis | FAERS: 1 | US FAERS | |
| 427 | Cardiac stress test abnormal | FAERS: 1 | US FAERS | |
| 428 | Cerebral artery occlusion | FAERS: 1 | US FAERS | |
| 429 | Cerebral ataxia | FAERS: 1 | US FAERS | |
| 430 | Chlamydia serology | FAERS: 1 | US FAERS | |
| 431 | Chromaturia | FAERS: 1 | US FAERS | |
| 432 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 433 | Chronic sinusitis | FAERS: 1 | US FAERS | |
| 434 | Completed Suicide | FAERS: 1 | US FAERS | |
| 435 | Congenital Hypothyroidism | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 436 | Congenital nystagmus | FAERS: 1 | US FAERS | |
| 437 | Cornea verticillata | FAERS: 1 | US FAERS | |
| 438 | Corneal cyst | FAERS: 1 | US FAERS | |
| 439 | Corneal lesion | FAERS: 1 | US FAERS | |
| 440 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 441 | Crying | FAERS: 1 | US FAERS | |
| 442 | Cyst | FAERS: 1 | US FAERS | |
| 443 | Cytolytic hepatitis | FAERS: 1 | US FAERS | |
| 444 | Deafness | FAERS: 1 | US FAERS | |
| 445 | Dehydration | FAERS: 1 | US FAERS | |
| 446 | Dementia | FAERS: 1 | US FAERS | |
| 447 | Device infusion issue | FAERS: 1 | US FAERS | |
| 448 | Diabetes Insipidus | FAERS: 1 | US FAERS | |
| 449 | Diabetes mellitus inadequate control | FAERS: 1 | US FAERS | |
| 450 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 451 | Disease Progression | FAERS: 1 | US FAERS | |
| 452 | Documented hypersensitivity to administered drug | FAERS: 1 | US FAERS | |
| 453 | Drug Dependence | FAERS: 1 | US FAERS | |
| 454 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 455 | Drug effective for unapproved indication | FAERS: 1 | US FAERS | |
| 456 | Drug exposure during pregnancy | FAERS: 1 | US FAERS | |
| 457 | Drug level below therapeutic | FAERS: 1 | US FAERS | |
| 458 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 459 | Dry skin | FAERS: 1 | US FAERS | |
| 460 | Dysarthria | FAERS: 1 | US FAERS | |
| 461 | Dyscalculia | FAERS: 1 | US FAERS | |
| 462 | Dysgraphia | FAERS: 1 | US FAERS | |
| 463 | Dyspepsia | FAERS: 1 | US FAERS | |
| 464 | Ecchymosis | FAERS: 1 | US FAERS | |
| 465 | Ejection fraction abnormal | FAERS: 1 | US FAERS | |
| 466 | Electrocardiogram abnormal | FAERS: 1 | US FAERS | |
| 467 | Electrocardiogram repolarisation abnormality | FAERS: 1 | US FAERS | |
| 468 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 469 | Epididymal tenderness | FAERS: 1 | US FAERS | |
| 470 | Epididymitis | FAERS: 1 | US FAERS | |
| 471 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 472 | Eructation | FAERS: 1 | US FAERS | |
| 473 | Erythema Multiforme | FAERS: 1 | US FAERS | |
| 474 | Expired drug administered | FAERS: 1 | US FAERS | |
| 475 | Familial Tremor | FAERS: 1 | US FAERS | |
| 476 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 477 | Feeling jittery | FAERS: 1 | US FAERS | |
| 478 | Feeling of body temperature change | FAERS: 1 | US FAERS | |
| 479 | Fibrin D dimer increased | FAERS: 1 | US FAERS | |
| 480 | Food aversion | FAERS: 1 | US FAERS | |
| 481 | Gene Mutation | FAERS: 1 | US FAERS | |
| 482 | Glaucoma | FAERS: 1 | US FAERS | |
| 483 | Glomerulonephritis | FAERS: 1 | US FAERS | |
| 484 | Glutamate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 485 | Gout | FAERS: 1 | US FAERS | |
| 486 | Haematotoxicity | FAERS: 1 | US FAERS | |
| 487 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 488 | Hemiplegia | FAERS: 1 | US FAERS | |
| 489 | Heparin-induced thrombocytopenia | FAERS: 1 | US FAERS | |
| 490 | Hyperkinesia | FAERS: 1 | US FAERS | |
| 491 | Hyperparathyroidism | FAERS: 1 | US FAERS | |
| 492 | Hyperplasia | FAERS: 1 | US FAERS | |
| 493 | Hypertrophic Cardiomyopathy | FAERS: 1 | US FAERS | |
| 494 | Hypogonadism | FAERS: 1 | US FAERS | |
| 495 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 496 | Hypoventilation | FAERS: 1 | US FAERS | |
| 497 | Iatrogenic injury | FAERS: 1 | US FAERS | |
| 498 | Immobile | FAERS: 1 | US FAERS | |
| 499 | Immunosuppressant drug level increased | FAERS: 1 | US FAERS | |
| 500 | Immunosuppression | FAERS: 1 | US FAERS | |
| 501 | Impaired quality of life | FAERS: 1 | US FAERS | |
| 502 | Impaired reasoning | FAERS: 1 | US FAERS | |
| 503 | Implantable defibrillator insertion | FAERS: 1 | US FAERS | |
| 504 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 505 | Incorrect drug administration duration | FAERS: 1 | US FAERS | |
| 506 | Incorrect drug administration rate | FAERS: 1 | US FAERS | |
| 507 | Infusion site dermatitis | FAERS: 1 | US FAERS | |
| 508 | Infusion site mass | FAERS: 1 | US FAERS | |
| 509 | Infusion site necrosis | FAERS: 1 | US FAERS | |
| 510 | Infusion site rash | FAERS: 1 | US FAERS | |
| 511 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 512 | Injection site dermatitis | FAERS: 1 | US FAERS | |
| 513 | Injection site infection | FAERS: 1 | US FAERS | |
| 514 | Injection site vesicles | FAERS: 1 | US FAERS | |
| 515 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 516 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 517 | Intercepted medication error | FAERS: 1 | US FAERS | |
| 518 | Interleukin level increased | FAERS: 1 | US FAERS | |
| 519 | Intubation complication | FAERS: 1 | US FAERS | |
| 520 | Iritis | FAERS: 1 | US FAERS | |
| 521 | Iron deficiency | FAERS: 1 | US FAERS | |
| 522 | Joint Range of Motion Decreased | FAERS: 1 | US FAERS | |
| 523 | Keratitis | FAERS: 1 | US FAERS | |
| 524 | Keratoconus | FAERS: 1 | US FAERS | |
| 525 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 526 | Left Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 527 | Left atrial dilatation | FAERS: 1 | US FAERS | |
| 528 | Leukocytoclastic vasculitis | FAERS: 1 | US FAERS | |
| 529 | Lipase increased | FAERS: 1 | US FAERS | |
| 530 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 531 | Loss of visual contrast sensitivity | FAERS: 1 | US FAERS | |
| 532 | Lung Abscess | FAERS: 1 | US FAERS | |
| 533 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 534 | Lymphoma | FAERS: 1 | US FAERS | |
| 535 | Macular degeneration | FAERS: 1 | US FAERS | |
| 536 | Malnutrition | FAERS: 1 | US FAERS | |
| 537 | Mastitis | FAERS: 1 | US FAERS | |
| 538 | Meningitis | FAERS: 1 | US FAERS | |
| 539 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 540 | Mood swings | FAERS: 1 | US FAERS | |
| 541 | Mouth Breathing | FAERS: 1 | US FAERS | |
| 542 | Mucosal pigmentation | FAERS: 1 | US FAERS | |
| 543 | Muscle Rigidity | FAERS: 1 | US FAERS | |
| 544 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 545 | Mydriasis | FAERS: 1 | US FAERS | |
| 546 | Myocarditis | FAERS: 1 | US FAERS | |
| 547 | Myosclerosis | FAERS: 1 | US FAERS | |
| 548 | Myotonia | FAERS: 1 | US FAERS | |
| 549 | Neck Pain | FAERS: 1 | US FAERS | |
| 550 | Neonatal hypotension | FAERS: 1 | US FAERS | |
| 551 | Neonatal multi-organ failure | FAERS: 1 | US FAERS | |
| 552 | Nerve injury | FAERS: 1 | US FAERS | |
| 553 | Neuroleptic Malignant Syndrome | FAERS: 1 | US FAERS | |
| 554 | Neutropenic sepsis | FAERS: 1 | US FAERS | |
| 555 | Neutrophil Pelger-Huet anomaly present | FAERS: 1 | US FAERS | |
| 556 | No reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 557 | Nodule | FAERS: 1 | US FAERS | |
| 558 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 559 | Obesity | FAERS: 1 | US FAERS | |
| 560 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 561 | Oliguria | FAERS: 1 | US FAERS | |
| 562 | Osteomyelitis | FAERS: 1 | US FAERS | |
| 563 | Oxygen saturation abnormal | FAERS: 1 | US FAERS | |
| 564 | PCO2 decreased | FAERS: 1 | US FAERS | |
| 565 | PO2 decreased | FAERS: 1 | US FAERS | |
| 566 | Pacemaker complication | FAERS: 1 | US FAERS | |
| 567 | Pain of skin | FAERS: 1 | US FAERS | |
| 568 | Palpable purpura | FAERS: 1 | US FAERS | |
| 569 | Pancreatic Neoplasm | FAERS: 1 | US FAERS | |
| 570 | Paranoia | FAERS: 1 | US FAERS | |
| 571 | Paresis | FAERS: 1 | US FAERS | |
| 572 | Pemphigus | FAERS: 1 | US FAERS | |
| 573 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 574 | Photodermatosis | FAERS: 1 | US FAERS | |
| 575 | Pneumocystis jiroveci pneumonia | FAERS: 1 | US FAERS | |
| 576 | Pneumonia herpes viral | FAERS: 1 | US FAERS | |
| 577 | Pneumopericardium | FAERS: 1 | US FAERS | |
| 578 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 579 | Polydipsia | FAERS: 1 | US FAERS | |
| 580 | Polyuria | FAERS: 1 | US FAERS | |
| 581 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 582 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 583 | Postpericardiotomy Syndrome | FAERS: 1 | US FAERS | |
| 584 | Pregnancy | FAERS: 1 | US FAERS | |
| 585 | Primary Hypothyroidism | FAERS: 1 | US FAERS | |
| 586 | Primary hypogonadism | FAERS: 1 | US FAERS | |
| 587 | Product container issue | FAERS: 1 | US FAERS | |
| 588 | Product residue present | FAERS: 1 | US FAERS | |
| 589 | Proteinuria | FAERS: 1 | US FAERS | |
| 590 | Psychomotor skills impaired | FAERS: 1 | US FAERS | |
| 591 | Pulmonary Infarction | FAERS: 1 | US FAERS | |
| 592 | Pulmonary granuloma | FAERS: 1 | US FAERS | |
| 593 | Pulmonary sepsis | FAERS: 1 | US FAERS | |
| 594 | Pulmonary vascular resistance abnormality | FAERS: 1 | US FAERS | |
| 595 | Punctate keratitis | FAERS: 1 | US FAERS | |
| 596 | Purple glove syndrome | FAERS: 1 | US FAERS | |
| 597 | Purpura | FAERS: 1 | US FAERS | |
| 598 | Purulent discharge | FAERS: 1 | US FAERS | |
| 599 | QRS axis abnormal | FAERS: 1 | US FAERS | |
| 600 | Quadriplegia | FAERS: 1 | US FAERS | |
| 601 | Renal Cell Carcinoma | FAERS: 1 | US FAERS | |
| 602 | Renal failure neonatal | FAERS: 1 | US FAERS | |
| 603 | Renal tubular necrosis | FAERS: 1 | US FAERS | |
| 604 | Renin increased | FAERS: 1 | US FAERS | |
| 605 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 606 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 607 | Rhabdomyolysis | FAERS: 1 | US FAERS | |
| 608 | Scotoma | FAERS: 1 | US FAERS | |
| 609 | Screaming | FAERS: 1 | US FAERS | |
| 610 | Secondary hypothyroidism | FAERS: 1 | US FAERS | |
| 611 | Serositis | FAERS: 1 | US FAERS | |
| 612 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 613 | Skin irritation | FAERS: 1 | US FAERS | |
| 614 | Skin lesion | FAERS: 1 | US FAERS | |
| 615 | Skin toxicity | FAERS: 1 | US FAERS | |
| 616 | Spleen palpable | FAERS: 1 | US FAERS | |
| 617 | Sputum culture positive | FAERS: 1 | US FAERS | |
| 618 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 619 | Staring | FAERS: 1 | US FAERS | |
| 620 | Steatohepatitis | FAERS: 1 | US FAERS | |
| 621 | Stevens-Johnson Syndrome | FAERS: 1 | US FAERS | |
| 622 | Stupor | FAERS: 1 | US FAERS | |
| 623 | Subcutaneous Emphysema | FAERS: 1 | US FAERS | |
| 624 | Sunburn | FAERS: 1 | US FAERS | |
| 625 | Superinfection | FAERS: 1 | US FAERS | |
| 626 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 627 | Systolic dysfunction | FAERS: 1 | US FAERS | |
| 628 | Tetany | FAERS: 1 | US FAERS | |
| 629 | Thyroglobulin increased | FAERS: 1 | US FAERS | |
| 630 | Thyroidectomy | FAERS: 1 | US FAERS | |
| 631 | Tracheobronchitis | FAERS: 1 | US FAERS | |
| 632 | Tri-iodothyronine free decreased | FAERS: 1 | US FAERS | |
| 633 | Urinary hesitation | FAERS: 1 | US FAERS | |
| 634 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 635 | Urine output increased | FAERS: 1 | US FAERS | |
| 636 | Vascular occlusion | FAERS: 1 | US FAERS | |
| 637 | Vasculitis | FAERS: 1 | US FAERS | |
| 638 | Ventricular hypokinesia | FAERS: 1 | US FAERS | |
| 639 | Vitreous Detachment | FAERS: 1 | US FAERS | |
| 640 | Withdrawal of life support | FAERS: 1 | US FAERS | |
| 641 | Wrong technique in drug usage process | FAERS: 1 | US FAERS | |
| 642 | Administration site extravasation | Canada Vigilance: 1 | Canada Vigilance | |
| 643 | Hypertrichosis | Canada Vigilance: 1 | Canada Vigilance | |
| 644 | Hypertrophy | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.