sofosbuvir-velpatasvir drug combination
(HCOFYZXVHCYVAU-OTBOHSEESA-N)
Structure
- SMILES
- CC(OC(=O)[C@@H](N[P@](=O)(Oc1ccccc1)OC[C@H]1O[C@H]([C@]([C@@H]1O)(C)F)n1ccc(=O)[nH]c1=O)C)C.COC[C@H]1C[C@H](N(C1)C(=O)[C@@H](c1ccccc1)NC(=O)OC)c1ncc([nH]1)c1ccc2c(c1)COc1c2cc2ccc3c(c2c1)nc([nH]3)[C@@H]1CC[C@@H](N1C(=O)[C@H](C(C)C)NC(=O)OC)C
- Molecular Formula:
- C71H83FN11O17P
- Molecular Weight:
- 1412.450
- Log P:
- 10.4365
- Hydrogen Bond Acceptor:
- 25
- Hydrogen Bond Donor:
- 7
- TPSA:
- 361.09
- CAS Number(s):
- N/A
Synonym(s)
1.
sofosbuvir-velpatasvir drug combination
2.
Epclusa
3.
sofosbuvir velpatasvir drug combination
4.
sofosbuvir, velpatasvir drug combination
External Link(s)
| MeSH | C000611331 |
| PubChem Compound | 91885554 |
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Fatigue | FAERS: 1373 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 2 | Headache | FAERS: 1123 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 3 | Nausea | FAERS: 550 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 4 | Drug dose omission | FAERS: 181 | US FAERS | |
| 5 | Dyspepsia | FAERS: 119 | US FAERS | |
| 6 | Dizziness | FAERS: 110 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Vomiting | FAERS: 100 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 8 | Abdominal discomfort | FAERS: 99 | US FAERS | |
| 9 | Pruritus | FAERS: 85 | US FAERS | |
| 10 | Arthralgia | FAERS: 78 | US FAERS | |
| 11 | Constipation | FAERS: 75 | US FAERS | |
| 12 | Pain | FAERS: 73 | US FAERS | |
| 13 | Alopecia | FAERS: 66 | US FAERS | |
| 14 | Drug ineffective | FAERS: 59 Canada Vigilance: 8 | Canada Vigilance US FAERS | |
| 15 | Product dose omission | FAERS: 58 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 16 | Dry skin | FAERS: 56 | US FAERS | |
| 17 | Asthenia | FAERS: 55 | US FAERS | |
| 18 | Memory impairment | FAERS: 53 | US FAERS | |
| 19 | Anxiety | FAERS: 48 | US FAERS | |
| 20 | Abdominal Pain | FAERS: 46 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 21 | Hepatitis C | FAERS: 44 Canada Vigilance: 7 | Canada Vigilance US FAERS | |
| 22 | Somnolence | FAERS: 44 | US FAERS | |
| 23 | Myalgia | FAERS: 43 | US FAERS | |
| 24 | treatment failure | FAERS: 41 Canada Vigilance: 14 | Canada Vigilance US FAERS | |
| 25 | Back Pain | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 26 | Feeling abnormal | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 27 | Intentional dose omission | FAERS: 39 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Nasopharyngitis | FAERS: 39 | US FAERS | |
| 29 | Maternal exposure during pregnancy | FAERS: 32 | US FAERS | |
| 30 | Peripheral swelling | FAERS: 32 | US FAERS | |
| 31 | Weight decreased | FAERS: 30 | US FAERS | |
| 32 | Wrong technique in product usage process | FAERS: 29 | US FAERS | |
| 33 | Intentional product use issue | FAERS: 27 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 34 | Chest Pain | FAERS: 26 | US FAERS | |
| 35 | Flatulence | FAERS: 25 | US FAERS | |
| 36 | Therapy cessation | FAERS: 25 | US FAERS | |
| 37 | Oropharyngeal pain | FAERS: 24 | US FAERS | |
| 38 | Pneumonia | FAERS: 24 Canada Vigilance: 4 | Canada Vigilance US FAERS | |
| 39 | Product use issue | FAERS: 23 | US FAERS | |
| 40 | Tremor | FAERS: 22 | US FAERS | |
| 41 | Malaise | FAERS: 20 | US FAERS | |
| 42 | Chills | FAERS: 19 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Dehydration | FAERS: 19 | US FAERS | |
| 44 | Dysgeusia | FAERS: 18 | US FAERS | |
| 45 | Product use complaint | FAERS: 17 | US FAERS | |
| 46 | Joint swelling | FAERS: 15 | US FAERS | |
| 47 | Night sweats | FAERS: 15 | US FAERS | |
| 48 | Pancreatitis | FAERS: 15 | US FAERS | |
| 49 | Thirst | FAERS: 15 | US FAERS | |
| 50 | Amnesia | FAERS: 14 | US FAERS | |
| 51 | Hypersensitivity | FAERS: 14 | US FAERS | |
| 52 | Bone pain | FAERS: 13 | US FAERS | |
| 53 | Extra dose administered | FAERS: 13 | US FAERS | |
| 54 | Initial insomnia | FAERS: 13 | US FAERS | |
| 55 | Neck Pain | FAERS: 13 | US FAERS | |
| 56 | Overdose | FAERS: 13 | US FAERS | |
| 57 | Tinnitus | FAERS: 13 | US FAERS | |
| 58 | Influenza | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 59 | Insurance issue | FAERS: 12 | US FAERS | |
| 60 | Urinary tract infection | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 61 | Bronchitis | FAERS: 11 | US FAERS | |
| 62 | Chromaturia | FAERS: 11 | US FAERS | |
| 63 | Epistaxis | FAERS: 11 | US FAERS | |
| 64 | Genotype drug resistance test positive | FAERS: 11 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 65 | Inappropriate schedule of drug administration | FAERS: 11 | US FAERS | |
| 66 | Infection | FAERS: 11 | US FAERS | |
| 67 | Palpitations | FAERS: 11 | US FAERS | |
| 68 | Sinusitis | FAERS: 11 | US FAERS | |
| 69 | Ascites | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 70 | Hypersomnia | FAERS: 10 | US FAERS | |
| 71 | Photophobia | FAERS: 10 | US FAERS | |
| 72 | Pulmonary congestion | FAERS: 10 | US FAERS | |
| 73 | Musculoskeletal Pain | FAERS: 9 | US FAERS | |
| 74 | Stress | FAERS: 9 | US FAERS | |
| 75 | Urticaria | FAERS: 9 | US FAERS | |
| 76 | Acne | FAERS: 8 | US FAERS | |
| 77 | Agitation | FAERS: 8 | US FAERS | |
| 78 | Blood creatinine increased | FAERS: 8 | US FAERS | |
| 79 | Hepatitis C virus test positive | FAERS: 8 | US FAERS | |
| 80 | Mood swings | FAERS: 8 | US FAERS | |
| 81 | Rash erythematous | FAERS: 8 | US FAERS | |
| 82 | Swelling | FAERS: 8 | US FAERS | |
| 83 | Accidental overdose | FAERS: 7 | US FAERS | |
| 84 | Blood glucose increased | FAERS: 7 | US FAERS | |
| 85 | Hunger | FAERS: 7 | US FAERS | |
| 86 | Incorrect drug administration duration | FAERS: 7 | US FAERS | |
| 87 | Product distribution issue | FAERS: 7 | US FAERS | |
| 88 | Toothache | FAERS: 7 | US FAERS | |
| 89 | Blood glucose decreased | FAERS: 6 | US FAERS | |
| 90 | Disorientation | FAERS: 6 | US FAERS | |
| 91 | Erythema | FAERS: 6 | US FAERS | |
| 92 | Facial paralysis | FAERS: 6 | US FAERS | |
| 93 | Feeling Cold | FAERS: 6 | US FAERS | |
| 94 | Impaired work ability | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Lethargy | FAERS: 6 | US FAERS | |
| 96 | Loss of personal independence in daily activities | FAERS: 6 | US FAERS | |
| 97 | Middle insomnia | FAERS: 6 | US FAERS | |
| 98 | Nervousness | FAERS: 6 | US FAERS | |
| 99 | Product storage error | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Stomatitis | FAERS: 6 | US FAERS | |
| 101 | Syncope | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 102 | Unevaluable event | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 103 | Visual Impairment | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 104 | Angioedema | FAERS: 5 | US FAERS | |
| 105 | Bradycardia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 106 | Cardiac Arrest | FAERS: 5 | US FAERS | |
| 107 | Cerebrovascular accident | FAERS: 5 | US FAERS | |
| 108 | Chest discomfort | FAERS: 5 | US FAERS | |
| 109 | Discomfort | FAERS: 5 | US FAERS | |
| 110 | Dysuria | FAERS: 5 | US FAERS | |
| 111 | Emotional disorder | FAERS: 5 | US FAERS | |
| 112 | Exposure via body fluid | FAERS: 5 | US FAERS | |
| 113 | Gout | FAERS: 5 | US FAERS | |
| 114 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 115 | Multiple allergies | FAERS: 5 | US FAERS | |
| 116 | Myocardial Infarction | FAERS: 5 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 117 | Product packaging quantity issue | FAERS: 5 | US FAERS | |
| 118 | Skin Ulcer | FAERS: 5 | US FAERS | |
| 119 | Sluggishness | FAERS: 5 | US FAERS | |
| 120 | Therapy non-responder | FAERS: 5 | US FAERS | |
| 121 | White blood cell count decreased | FAERS: 5 | US FAERS | |
| 122 | Acute kidney injury | FAERS: 4 | US FAERS | |
| 123 | Alanine Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 124 | Arthritis | FAERS: 4 | US FAERS | |
| 125 | Aspartate Aminotransferase Increased | FAERS: 4 | US FAERS | |
| 126 | Burning sensation | FAERS: 4 | US FAERS | |
| 127 | Crying | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 128 | Cystitis | FAERS: 4 | US FAERS | |
| 129 | Depressed mood | FAERS: 4 | US FAERS | |
| 130 | Eye pain | FAERS: 4 | US FAERS | |
| 131 | Flushing | FAERS: 4 | US FAERS | |
| 132 | Hepatomegaly | FAERS: 4 | US FAERS | |
| 133 | Hypotension | FAERS: 4 | US FAERS | |
| 134 | Muscle strain | FAERS: 4 | US FAERS | |
| 135 | Musculoskeletal chest pain | FAERS: 4 | US FAERS | |
| 136 | Nephrolithiasis | FAERS: 4 | US FAERS | |
| 137 | Oral pain | FAERS: 4 | US FAERS | |
| 138 | Poor quality sleep | FAERS: 4 | US FAERS | |
| 139 | Product size issue | FAERS: 4 | US FAERS | |
| 140 | Renal pain | FAERS: 4 | US FAERS | |
| 141 | Restlessness | FAERS: 4 | US FAERS | |
| 142 | Sepsis | FAERS: 4 | US FAERS | |
| 143 | Thrombosis | FAERS: 4 | US FAERS | |
| 144 | Tooth Extraction | FAERS: 4 | US FAERS | |
| 145 | Ulcer | FAERS: 4 | US FAERS | |
| 146 | Vertigo | FAERS: 4 | US FAERS | |
| 147 | Viral load increased | FAERS: 4 | US FAERS | |
| 148 | Wheezing | FAERS: 4 | US FAERS | |
| 149 | Ageusia | FAERS: 3 | US FAERS | |
| 150 | Anger | FAERS: 3 | US FAERS | |
| 151 | Aphasia | FAERS: 3 | US FAERS | |
| 152 | Arthropod bite | FAERS: 3 | US FAERS | |
| 153 | Blindness | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 154 | Blood creatine phosphokinase increased | FAERS: 3 | US FAERS | |
| 155 | Blood potassium decreased | FAERS: 3 | US FAERS | |
| 156 | Blood potassium increased | FAERS: 3 | US FAERS | |
| 157 | Dental caries | FAERS: 3 | US FAERS | |
| 158 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 159 | Diabetes Mellitus | FAERS: 3 | US FAERS | |
| 160 | Drug dispensing error | FAERS: 3 | US FAERS | |
| 161 | Eructation | FAERS: 3 | US FAERS | |
| 162 | Feeling jittery | FAERS: 3 | US FAERS | |
| 163 | Flank Pain | FAERS: 3 | US FAERS | |
| 164 | Folliculitis | FAERS: 3 | US FAERS | |
| 165 | Gait inability | FAERS: 3 | US FAERS | |
| 166 | Hernia | FAERS: 3 | US FAERS | |
| 167 | Inappropriate schedule of product administration | FAERS: 3 | US FAERS | |
| 168 | Increased tendency to bruise | FAERS: 3 | US FAERS | |
| 169 | Irritable Bowel Syndrome | FAERS: 3 | US FAERS | |
| 170 | Joint stiffness | FAERS: 3 | US FAERS | |
| 171 | Lower respiratory tract infection | FAERS: 3 | US FAERS | |
| 172 | Musculoskeletal stiffness | FAERS: 3 | US FAERS | |
| 173 | Nephrotic Syndrome | FAERS: 3 | US FAERS | |
| 174 | Neutropenia | FAERS: 3 | US FAERS | |
| 175 | Pharyngitis | FAERS: 3 | US FAERS | |
| 176 | Portal Vein Thrombosis | FAERS: 3 | US FAERS | |
| 177 | Product dispensing error | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 178 | Product physical issue | FAERS: 3 | US FAERS | |
| 179 | Product quality issue | FAERS: 3 | US FAERS | |
| 180 | Productive Cough | FAERS: 3 | US FAERS | |
| 181 | Psoriasis | FAERS: 3 | US FAERS | |
| 182 | Respiratory tract congestion | FAERS: 3 | US FAERS | |
| 183 | Retching | FAERS: 3 | US FAERS | |
| 184 | Rhabdomyolysis | FAERS: 3 | US FAERS | |
| 185 | Sinus headache | FAERS: 3 | US FAERS | |
| 186 | Skin irritation | FAERS: 3 | US FAERS | |
| 187 | Therapeutic response unexpected | FAERS: 3 | US FAERS | |
| 188 | Throat irritation | FAERS: 3 | US FAERS | |
| 189 | Viral upper respiratory tract infection | FAERS: 3 | US FAERS | |
| 190 | Wrong schedule | FAERS: 3 | US FAERS | |
| 191 | Abdominal rigidity | FAERS: 2 | US FAERS | |
| 192 | Abscess | FAERS: 2 | US FAERS | |
| 193 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 194 | Acute psychosis | FAERS: 2 | US FAERS | |
| 195 | Ammonia increased | FAERS: 2 | US FAERS | |
| 196 | Animal bite | FAERS: 2 | US FAERS | |
| 197 | Apathy | FAERS: 2 | US FAERS | |
| 198 | Arrhythmogenic Right Ventricular Dysplasia | FAERS: 2 | US FAERS | |
| 199 | Arthropathy | FAERS: 2 | US FAERS | |
| 200 | Asthma | FAERS: 2 | US FAERS | |
| 201 | Atrial Fibrillation | FAERS: 2 | US FAERS | |
| 202 | Atrial Flutter | FAERS: 2 | US FAERS | |
| 203 | Atrial tachycardia | FAERS: 2 | US FAERS | |
| 204 | Back disorder | FAERS: 2 | US FAERS | |
| 205 | Blepharitis | FAERS: 2 | US FAERS | |
| 206 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 207 | Blood glucose abnormal | FAERS: 2 | US FAERS | |
| 208 | Blood urea increased | FAERS: 2 | US FAERS | |
| 209 | Blood urine present | FAERS: 2 | US FAERS | |
| 210 | Bowel movement irregularity | FAERS: 2 | US FAERS | |
| 211 | Cellulitis | FAERS: 2 | US FAERS | |
| 212 | Cholangiocarcinoma | FAERS: 2 | US FAERS | |
| 213 | Cholelithiasis | FAERS: 2 | US FAERS | |
| 214 | Chronic gastritis | FAERS: 2 | US FAERS | |
| 215 | Clostridium difficile colitis | FAERS: 2 | US FAERS | |
| 216 | Clostridium difficile infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 217 | Cold sweat | FAERS: 2 | US FAERS | |
| 218 | Colitis | FAERS: 2 | US FAERS | |
| 219 | Conjunctivitis | FAERS: 2 | US FAERS | |
| 220 | Contraindicated product administered | FAERS: 2 | US FAERS | |
| 221 | Deformity | FAERS: 2 | US FAERS | |
| 222 | Drug abuse | FAERS: 2 | US FAERS | |
| 223 | Erectile dysfunction | FAERS: 2 | US FAERS | |
| 224 | Eye irritation | FAERS: 2 | US FAERS | |
| 225 | Feeling of body temperature change | FAERS: 2 | US FAERS | |
| 226 | Fibromyalgia | FAERS: 2 | US FAERS | |
| 227 | Formication | FAERS: 2 | US FAERS | |
| 228 | Gastritis | FAERS: 2 | US FAERS | |
| 229 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 230 | Hepatic Encephalopathy | FAERS: 2 | US FAERS | |
| 231 | Hepatitis B | FAERS: 2 | US FAERS | |
| 232 | Hepatitis C RNA increased | FAERS: 2 | US FAERS | |
| 233 | Hernia pain | FAERS: 2 | US FAERS | |
| 234 | Hordeolum | FAERS: 2 | US FAERS | |
| 235 | Hypertensive crisis | FAERS: 2 | US FAERS | |
| 236 | Hyperthyroidism | FAERS: 2 | US FAERS | |
| 237 | Inability to afford medication | FAERS: 2 | US FAERS | |
| 238 | Laceration | FAERS: 2 | US FAERS | |
| 239 | Leukopenia | FAERS: 2 | US FAERS | |
| 240 | Lip swelling | FAERS: 2 | US FAERS | |
| 241 | Lipase increased | FAERS: 2 | US FAERS | |
| 242 | Manufacturing product shipping issue | FAERS: 2 | US FAERS | |
| 243 | Musculoskeletal discomfort | FAERS: 2 | US FAERS | |
| 244 | Neuralgia | FAERS: 2 | US FAERS | |
| 245 | Nipple pain | FAERS: 2 | US FAERS | |
| 246 | Paranoia | FAERS: 2 | US FAERS | |
| 247 | Post procedural complication | FAERS: 2 | US FAERS | |
| 248 | Presyncope | FAERS: 2 | US FAERS | |
| 249 | Product availability issue | FAERS: 2 | US FAERS | |
| 250 | Product communication issue | FAERS: 2 | US FAERS | |
| 251 | Product difficult to swallow | FAERS: 2 | US FAERS | |
| 252 | Product supply issue | FAERS: 2 | US FAERS | |
| 253 | Respiratory Failure | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 254 | Schizophrenia | FAERS: 2 | US FAERS | |
| 255 | Sciatica | FAERS: 2 | US FAERS | |
| 256 | Shock | FAERS: 2 | US FAERS | |
| 257 | Skin reaction | FAERS: 2 | US FAERS | |
| 258 | Sneezing | FAERS: 2 | US FAERS | |
| 259 | Suicide attempt | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 260 | Thermal burn | FAERS: 2 | US FAERS | |
| 261 | Thrombocytopenia | FAERS: 2 | US FAERS | |
| 262 | Tongue blistering | FAERS: 2 | US FAERS | |
| 263 | Unresponsive to stimuli | FAERS: 2 | US FAERS | |
| 264 | Upper-airway cough syndrome | FAERS: 2 | US FAERS | |
| 265 | Urinary Incontinence | FAERS: 2 | US FAERS | |
| 266 | Ventricular Fibrillation | FAERS: 2 | US FAERS | |
| 267 | Ventricular Flutter | FAERS: 2 | US FAERS | |
| 268 | Vitreous floaters | FAERS: 2 | US FAERS | |
| 269 | colonoscopy | FAERS: 2 | US FAERS | |
| 270 | furuncle | FAERS: 2 | US FAERS | |
| 271 | Acute cardiac event | FAERS: 1 | US FAERS | |
| 272 | Acute myocardial infarction | FAERS: 1 | US FAERS | |
| 273 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 274 | Adjustment disorder with depressed mood | FAERS: 1 | US FAERS | |
| 275 | Adverse event | FAERS: 1 | US FAERS | |
| 276 | Agitated depression | FAERS: 1 | US FAERS | |
| 277 | Alcohol abuse | FAERS: 1 | US FAERS | |
| 278 | Ammonia abnormal | FAERS: 1 | US FAERS | |
| 279 | Amyotrophic Lateral Sclerosis | FAERS: 1 | US FAERS | |
| 280 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 281 | Angina Pectoris | FAERS: 1 | US FAERS | |
| 282 | Anorectal swelling | FAERS: 1 | US FAERS | |
| 283 | Aortic Valve Stenosis | FAERS: 1 | US FAERS | |
| 284 | Aphonia | FAERS: 1 | US FAERS | |
| 285 | Apparent death | FAERS: 1 | US FAERS | |
| 286 | Asthenopia | FAERS: 1 | US FAERS | |
| 287 | Atypical pneumonia | FAERS: 1 | US FAERS | |
| 288 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 289 | Autoimmune uveitis | FAERS: 1 | US FAERS | |
| 290 | Basal cell carcinoma | FAERS: 1 | US FAERS | |
| 291 | Bedridden | FAERS: 1 | US FAERS | |
| 292 | Biliary Colic | FAERS: 1 | US FAERS | |
| 293 | Blood albumin decreased | FAERS: 1 | US FAERS | |
| 294 | Blood bilirubin unconjugated increased | FAERS: 1 | US FAERS | |
| 295 | Blood creatine abnormal | FAERS: 1 | US FAERS | |
| 296 | Blood iron decreased | FAERS: 1 | US FAERS | |
| 297 | Blood iron increased | FAERS: 1 | US FAERS | |
| 298 | Blood pressure fluctuation | FAERS: 1 | US FAERS | |
| 299 | Blood triglycerides increased | FAERS: 1 | US FAERS | |
| 300 | Breast tenderness | FAERS: 1 | US FAERS | |
| 301 | Bronchiectasis | FAERS: 1 | US FAERS | |
| 302 | Bruxism | FAERS: 1 | US FAERS | |
| 303 | Bursitis | FAERS: 1 | US FAERS | |
| 304 | Carbon Monoxide Poisoning | FAERS: 1 | US FAERS | |
| 305 | Cardiac Flutter | FAERS: 1 | US FAERS | |
| 306 | Cardiac discomfort | FAERS: 1 | US FAERS | |
| 307 | Cataract | FAERS: 1 | US FAERS | |
| 308 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 309 | Choking | FAERS: 1 | US FAERS | |
| 310 | Cholestasis | FAERS: 1 | US FAERS | |
| 311 | Choreoathetosis | FAERS: 1 | US FAERS | |
| 312 | Chronic Fatigue Syndrome | FAERS: 1 | US FAERS | |
| 313 | Circumstance or information capable of leading to medication error | FAERS: 1 | US FAERS | |
| 314 | Clumsiness | FAERS: 1 | US FAERS | |
| 315 | Colonoscopy abnormal | FAERS: 1 | US FAERS | |
| 316 | Contraindicated product prescribed | FAERS: 1 | US FAERS | |
| 317 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 318 | Deafness | FAERS: 1 | US FAERS | |
| 319 | Death of relative | FAERS: 1 | US FAERS | |
| 320 | Dementia | FAERS: 1 | US FAERS | |
| 321 | Diastolic hypertension | FAERS: 1 | US FAERS | |
| 322 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 323 | Diplopia | FAERS: 1 | US FAERS | |
| 324 | Disease complication | FAERS: 1 | US FAERS | |
| 325 | Diverticulitis | FAERS: 1 | US FAERS | |
| 326 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 327 | Drug screen positive | FAERS: 1 | US FAERS | |
| 328 | Duodenal Ulcer | FAERS: 1 | US FAERS | |
| 329 | Dyschezia | FAERS: 1 | US FAERS | |
| 330 | Dysphonia | FAERS: 1 | US FAERS | |
| 331 | Economic problem | FAERS: 1 | US FAERS | |
| 332 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 333 | Eczema | FAERS: 1 | US FAERS | |
| 334 | Electrolyte imbalance | FAERS: 1 | US FAERS | |
| 335 | Encephalitis | FAERS: 1 | US FAERS | |
| 336 | Enuresis | FAERS: 1 | US FAERS | |
| 337 | Epilepsy | FAERS: 1 | US FAERS | |
| 338 | Escherichia infection | FAERS: 1 | US FAERS | |
| 339 | Excoriation | FAERS: 1 | US FAERS | |
| 340 | Exposure to toxic agent | FAERS: 1 | US FAERS | |
| 341 | Exposure via breast milk | FAERS: 1 | US FAERS | |
| 342 | Eyelid margin crusting | FAERS: 1 | US FAERS | |
| 343 | Facial Paresis | FAERS: 1 | US FAERS | |
| 344 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 345 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 346 | Gastrectomy | FAERS: 1 | US FAERS | |
| 347 | Gastric Bypass | FAERS: 1 | US FAERS | |
| 348 | Gastric infection | FAERS: 1 | US FAERS | |
| 349 | Gastric pH decreased | FAERS: 1 | US FAERS | |
| 350 | Gastrointestinal Pain | FAERS: 1 | US FAERS | |
| 351 | Gastrointestinal motility disorder | FAERS: 1 | US FAERS | |
| 352 | Gastrointestinal ulcer | FAERS: 1 | US FAERS | |
| 353 | Gastrostomy | FAERS: 1 | US FAERS | |
| 354 | Gene Mutation | FAERS: 1 | US FAERS | |
| 355 | Gene mutation identification test positive | FAERS: 1 | US FAERS | |
| 356 | Gingivitis | FAERS: 1 | US FAERS | |
| 357 | Glaucoma | FAERS: 1 | US FAERS | |
| 358 | Hallucinations, mixed | FAERS: 1 | US FAERS | |
| 359 | Head discomfort | FAERS: 1 | US FAERS | |
| 360 | Head titubation | FAERS: 1 | US FAERS | |
| 361 | Heat Exhaustion | FAERS: 1 | US FAERS | |
| 362 | Heat illness | FAERS: 1 | US FAERS | |
| 363 | Hemiparesis | FAERS: 1 | US FAERS | |
| 364 | Hepatitis A | FAERS: 1 | US FAERS | |
| 365 | Hepatitis | FAERS: 1 | US FAERS | |
| 366 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 367 | Hip surgery | FAERS: 1 | US FAERS | |
| 368 | Hyperosmolar state | FAERS: 1 | US FAERS | |
| 369 | Hypokinesia | FAERS: 1 | US FAERS | |
| 370 | Hypophagia | FAERS: 1 | US FAERS | |
| 371 | Hypopharyngeal Cancer | FAERS: 1 | US FAERS | |
| 372 | Hypothyroidism | FAERS: 1 | US FAERS | |
| 373 | Hypotrichosis | FAERS: 1 | US FAERS | |
| 374 | Ileus | FAERS: 1 | US FAERS | |
| 375 | Illness anxiety disorder | FAERS: 1 | US FAERS | |
| 376 | Immune Reconstitution Inflammatory Syndrome | FAERS: 1 | US FAERS | |
| 377 | Incorrect product administration duration | FAERS: 1 | US FAERS | |
| 378 | Inflammation | FAERS: 1 | US FAERS | |
| 379 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 380 | Intra-abdominal fluid collection | FAERS: 1 | US FAERS | |
| 381 | Joint injury | FAERS: 1 | US FAERS | |
| 382 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 383 | Laryngitis | FAERS: 1 | US FAERS | |
| 384 | Laziness | FAERS: 1 | US FAERS | |
| 385 | Leukoencephalopathy | FAERS: 1 | US FAERS | |
| 386 | Limb discomfort | FAERS: 1 | US FAERS | |
| 387 | Limb injury | FAERS: 1 | US FAERS | |
| 388 | Lip erythema | FAERS: 1 | US FAERS | |
| 389 | Lip exfoliation | FAERS: 1 | US FAERS | |
| 390 | Liver carcinoma ruptured | FAERS: 1 | US FAERS | |
| 391 | Lower respiratory tract congestion | FAERS: 1 | US FAERS | |
| 392 | Lymphadenopathy | FAERS: 1 | US FAERS | |
| 393 | Lymphangitis | FAERS: 1 | US FAERS | |
| 394 | Lymphocytosis | FAERS: 1 | US FAERS | |
| 395 | Maternal exposure before pregnancy | FAERS: 1 | US FAERS | |
| 396 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 397 | Maxillofacial operation | FAERS: 1 | US FAERS | |
| 398 | Mechanical ventilation | FAERS: 1 | US FAERS | |
| 399 | Medication Error | FAERS: 1 | US FAERS | |
| 400 | Meningeal repair | FAERS: 1 | US FAERS | |
| 401 | Menopause | FAERS: 1 | US FAERS | |
| 402 | Mental impairment | FAERS: 1 | US FAERS | |
| 403 | Mental status changes | FAERS: 1 | US FAERS | |
| 404 | Mouth swelling | FAERS: 1 | US FAERS | |
| 405 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 406 | Muscle tightness | FAERS: 1 | US FAERS | |
| 407 | Muscular Dystrophy | FAERS: 1 | US FAERS | |
| 408 | Myasthenia Gravis | FAERS: 1 | US FAERS | |
| 409 | Mydriasis | FAERS: 1 | US FAERS | |
| 410 | Myocarditis | FAERS: 1 | US FAERS | |
| 411 | Myositis | FAERS: 1 | US FAERS | |
| 412 | Nail cuticle fissure | FAERS: 1 | US FAERS | |
| 413 | Nail pigmentation | FAERS: 1 | US FAERS | |
| 414 | Nerve injury | FAERS: 1 | US FAERS | |
| 415 | Neurodermatitis | FAERS: 1 | US FAERS | |
| 416 | No adverse event | FAERS: 1 | US FAERS | |
| 417 | Nodule | FAERS: 1 | US FAERS | |
| 418 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 419 | Ocular icterus | FAERS: 1 | US FAERS | |
| 420 | Onychalgia | FAERS: 1 | US FAERS | |
| 421 | Onychoclasis | FAERS: 1 | US FAERS | |
| 422 | Ophthalmoplegia | FAERS: 1 | US FAERS | |
| 423 | Orchitis | FAERS: 1 | US FAERS | |
| 424 | Osteogenesis Imperfecta | FAERS: 1 | US FAERS | |
| 425 | Pain of skin | FAERS: 1 | US FAERS | |
| 426 | Pallor | FAERS: 1 | US FAERS | |
| 427 | Pancreaticoduodenectomy | FAERS: 1 | US FAERS | |
| 428 | Pancytopenia | FAERS: 1 | US FAERS | |
| 429 | Paternal exposure during pregnancy | FAERS: 1 | US FAERS | |
| 430 | Penile blister | FAERS: 1 | US FAERS | |
| 431 | Pericarditis | FAERS: 1 | US FAERS | |
| 432 | Peripheral arthritis | FAERS: 1 | US FAERS | |
| 433 | Peritonitis | FAERS: 1 | US FAERS | |
| 434 | Physical assault | FAERS: 1 | US FAERS | |
| 435 | Pneumonitis | FAERS: 1 | US FAERS | |
| 436 | Portal Hypertension | FAERS: 1 | US FAERS | |
| 437 | Post procedural infection | FAERS: 1 | US FAERS | |
| 438 | Pregnancy | FAERS: 1 | US FAERS | |
| 439 | Product complaint | FAERS: 1 | US FAERS | |
| 440 | Product container issue | FAERS: 1 | US FAERS | |
| 441 | Product packaging issue | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 442 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 443 | Protein urine present | FAERS: 1 | US FAERS | |
| 444 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 445 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 446 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 447 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 448 | Pulmonary thrombosis | FAERS: 1 | US FAERS | |
| 449 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 450 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 451 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 452 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 453 | Scab | FAERS: 1 | US FAERS | |
| 454 | Secretion discharge | FAERS: 1 | US FAERS | |
| 455 | Septic Shock | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 456 | Serotonin Syndrome | FAERS: 1 | US FAERS | |
| 457 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 458 | Skin laceration | FAERS: 1 | US FAERS | |
| 459 | Skin tightness | FAERS: 1 | US FAERS | |
| 460 | Somnambulism | FAERS: 1 | US FAERS | |
| 461 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 462 | Sudden death | FAERS: 1 | US FAERS | |
| 463 | Sunburn | FAERS: 1 | US FAERS | |
| 464 | Symptom recurrence | FAERS: 1 | US FAERS | |
| 465 | Tattoo | FAERS: 1 | US FAERS | |
| 466 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 467 | Tension Headache | FAERS: 1 | US FAERS | |
| 468 | Tension | FAERS: 1 | US FAERS | |
| 469 | Thyroid hormones increased | FAERS: 1 | US FAERS | |
| 470 | Tinea Pedis | FAERS: 1 | US FAERS | |
| 471 | Tongue discomfort | FAERS: 1 | US FAERS | |
| 472 | Tonsillitis | FAERS: 1 | US FAERS | |
| 473 | Tooth Infection | FAERS: 1 | US FAERS | |
| 474 | Tooth Loss | FAERS: 1 | US FAERS | |
| 475 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 476 | Transaminases increased | FAERS: 1 | US FAERS | |
| 477 | Underweight | FAERS: 1 | US FAERS | |
| 478 | Urinary Retention | FAERS: 1 | US FAERS | |
| 479 | Urine flow decreased | FAERS: 1 | US FAERS | |
| 480 | Urine output increased | FAERS: 1 | US FAERS | |
| 481 | Vaginal Discharge | FAERS: 1 | US FAERS | |
| 482 | Vascular rupture | FAERS: 1 | US FAERS | |
| 483 | Vasculitis | FAERS: 1 | US FAERS | |
| 484 | Viral load decreased | FAERS: 1 | US FAERS | |
| 485 | Vitiligo | FAERS: 1 | US FAERS | |
| 486 | Vulvovaginal discomfort | FAERS: 1 | US FAERS | |
| 487 | Vulvovaginal dryness | FAERS: 1 | US FAERS | |
| 488 | Vulvovaginal mycotic infection | FAERS: 1 | US FAERS | |
| 489 | Waist circumference increased | FAERS: 1 | US FAERS | |
| 490 | Walking aid user | FAERS: 1 | US FAERS | |
| 491 | Walking distance test abnormal | FAERS: 1 | US FAERS | |
| 492 | Wound Infection | FAERS: 1 | US FAERS | |
| 493 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 494 | Wrong patient received medication | FAERS: 1 | US FAERS | |
| 495 | X-ray dental abnormal | FAERS: 1 | US FAERS | |
| 496 | gallbladder neoplasm | FAERS: 1 | US FAERS | |
| 497 | intensive care | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 498 | jaundice | FAERS: 1 | US FAERS | |
| 499 | nervous system disorder | FAERS: 1 | US FAERS | |
| 500 | Wrong dose | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.