Atenolol
(METKIMKYRPQLGS-UHFFFAOYSA-N)
Structure
- SMILES
- OC(COc1ccc(cc1)CC(=O)N)CNC(C)C
- Type(s)
- Approved
- ATC code(s)
- C07AB03; C07BB03; C07CB03; C07CB53; C07DB01; C07FB03
- Molecular Formula:
- C14H22N2O3
- Molecular Weight:
- 266.336
- Log P:
- 1.5433
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 3
- TPSA:
- 84.58
- CAS Number(s):
- 29122-68-7; 60966-51-0
Synonym(s)
1.
Atenolol
2.
ICI-66082
3.
Tenormin
4.
Tenormine
5.
ICI 66082
6.
ICI66082
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Bradycardia | FAERS: 198 Canada Vigilance: 5 |
1765616
2161850 2205704 2564991 2798550 2859811 2895129 2895577 2904753 3434760 3513515 3594959 3751021 6352272 6707926 6753891 12531464 12841816 15304417 15681710 18072119 18613249 18957387 20865460 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 2 | Drug ineffective | FAERS: 140 Canada Vigilance: 14 | Canada Vigilance OFFSIDES US FAERS | |
| 3 | Dizziness | FAERS: 132 Canada Vigilance: 8 | 2188798 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 4 | Syncope | FAERS: 95 Canada Vigilance: 5 | CTD SIDER Canada Vigilance US FAERS | |
| 5 | Malaise | FAERS: 81 Canada Vigilance: 4 | Canada Vigilance SIDER US FAERS | |
| 6 | Product substitution issue | FAERS: 76 Canada Vigilance: 17 | Canada Vigilance US FAERS | |
| 7 | Asthenia | FAERS: 75 Canada Vigilance: 4 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 8 | Palpitations | FAERS: 75 Canada Vigilance: 6 | Canada Vigilance SIDER US FAERS | |
| 9 | Fatigue | FAERS: 64 Canada Vigilance: 6 | 2895577 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 10 | Headache | FAERS: 64 Canada Vigilance: 9 | 2895577 8617705 | CTD SIDER Canada Vigilance US FAERS |
| 11 | Hypotension | FAERS: 64 Canada Vigilance: 1 | CTD SIDER Canada Vigilance US FAERS | |
| 12 | Nausea | FAERS: 58 Canada Vigilance: 11 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 13 | Feeling abnormal | FAERS: 50 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 14 | Pharmaceutical product complaint | FAERS: 49 | US FAERS | |
| 15 | Sinus bradycardia | FAERS: 44 | OFFSIDES US FAERS | |
| 16 | Anxiety | FAERS: 40 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 17 | Chest Pain | FAERS: 37 Canada Vigilance: 4 | 2912410 | CTD OFFSIDES SIDER Canada Vigilance US FAERS |
| 18 | Vertigo | FAERS: 32 | SIDER US FAERS | |
| 19 | Alopecia | FAERS: 31 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 20 | Chest discomfort | FAERS: 27 | US FAERS | |
| 21 | Medication Error | FAERS: 27 | US FAERS | |
| 22 | Tinnitus | FAERS: 27 | SIDER US FAERS | |
| 23 | Overdose | FAERS: 26 | US FAERS | |
| 24 | Pruritus | FAERS: 25 | SIDER US FAERS | |
| 25 | Abdominal discomfort | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 26 | Atrial Fibrillation | FAERS: 23 | 7106148 | CTD SIDER US FAERS |
| 27 | Product quality issue | FAERS: 23 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 28 | Hypersensitivity | FAERS: 22 | US FAERS | |
| 29 | Suicide attempt | FAERS: 21 | US FAERS | |
| 30 | Tremor | FAERS: 21 Canada Vigilance: 1 | 6487471 | CTD Canada Vigilance US FAERS |
| 31 | Vomiting | FAERS: 20 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 32 | Agitation | FAERS: 19 | US FAERS | |
| 33 | Blood pressure inadequately controlled | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Tachycardia | FAERS: 17 Canada Vigilance: 1 |
113217
789082 2575990 2897299 3010692 4094621 6103674 6258838 6299641 9863652 10556671 10638917 15175557 17420778 | CTD SIDER Canada Vigilance US FAERS |
| 35 | Pain | FAERS: 16 | 16099101 16595566 | CTD SIDER US FAERS |
| 36 | Myocardial Infarction | FAERS: 15 Canada Vigilance: 2 | 3585391 15681710 | CTD SIDER Canada Vigilance US FAERS |
| 37 | Atrioventricular Block | FAERS: 14 | 11229299 | CTD OFFSIDES SIDER US FAERS |
| 38 | Joint swelling | FAERS: 14 | US FAERS | |
| 39 | Completed Suicide | FAERS: 13 | US FAERS | |
| 40 | Drug exposure during pregnancy | FAERS: 13 | US FAERS | |
| 41 | Epistaxis | FAERS: 13 | OFFSIDES SIDER US FAERS | |
| 42 | Presyncope | FAERS: 13 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 43 | Therapeutic response unexpected with drug substitution | FAERS: 13 | US FAERS | |
| 44 | Wrong technique in product usage process | FAERS: 13 | US FAERS | |
| 45 | Toxicity to various agents | FAERS: 12 | US FAERS | |
| 46 | Somnolence | FAERS: 11 Canada Vigilance: 2 | Canada Vigilance SIDER US FAERS | |
| 47 | Asthma | FAERS: 10 | US FAERS | |
| 48 | Drug dispensing error | FAERS: 10 | US FAERS | |
| 49 | Hypertensive crisis | FAERS: 10 | US FAERS | |
| 50 | Visual Impairment | FAERS: 10 | SIDER US FAERS | |
| 51 | Arthralgia | FAERS: 9 | US FAERS | |
| 52 | Cerebrovascular accident | FAERS: 9 | US FAERS | |
| 53 | Drug dose omission | FAERS: 9 | US FAERS | |
| 54 | Feeling Cold | FAERS: 9 | US FAERS | |
| 55 | Incorrect dose administered | FAERS: 9 | OFFSIDES US FAERS | |
| 56 | Limb discomfort | FAERS: 9 | US FAERS | |
| 57 | Nervousness | FAERS: 9 | SIDER US FAERS | |
| 58 | Reaction to drug excipients | FAERS: 9 | US FAERS | |
| 59 | Urticaria | FAERS: 9 | US FAERS | |
| 60 | Weight decreased | FAERS: 9 | US FAERS | |
| 61 | Adverse event | FAERS: 8 | OFFSIDES US FAERS | |
| 62 | Cardiac Arrest | FAERS: 8 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 63 | Drug abuse | FAERS: 8 | US FAERS | |
| 64 | Dyspepsia | FAERS: 8 | OFFSIDES SIDER US FAERS | |
| 65 | Hepatotoxicity | FAERS: 8 | OFFSIDES US FAERS | |
| 66 | Lethargy | FAERS: 8 Canada Vigilance: 2 | Canada Vigilance OFFSIDES SIDER US FAERS | |
| 67 | Myalgia | FAERS: 8 | US FAERS | |
| 68 | Pneumonia | FAERS: 8 | US FAERS | |
| 69 | Swelling | FAERS: 8 | US FAERS | |
| 70 | Urinary Retention | FAERS: 8 | US FAERS | |
| 71 | Abdominal Pain | FAERS: 7 Canada Vigilance: 5 | Canada Vigilance OFFSIDES US FAERS | |
| 72 | Burning sensation | FAERS: 7 | US FAERS | |
| 73 | Cardiac Flutter | FAERS: 7 | US FAERS | |
| 74 | Constipation | FAERS: 7 | SIDER US FAERS | |
| 75 | Intentional self-injury | FAERS: 7 | US FAERS | |
| 76 | Product use issue | FAERS: 7 | US FAERS | |
| 77 | Unevaluable event | FAERS: 7 | OFFSIDES US FAERS | |
| 78 | nervous system disorder | FAERS: 7 | US FAERS | |
| 79 | Altered state of consciousness | FAERS: 6 | US FAERS | |
| 80 | Cholestasis | FAERS: 6 | 2773903 | CTD SIDER US FAERS |
| 81 | Discomfort | FAERS: 6 | SIDER US FAERS | |
| 82 | Disorientation | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 83 | Inflammation | FAERS: 6 | US FAERS | |
| 84 | Middle insomnia | FAERS: 6 | US FAERS | |
| 85 | Paroxysmal atrioventricular block | FAERS: 6 | US FAERS | |
| 86 | Peripheral swelling | FAERS: 6 | US FAERS | |
| 87 | Blood glucose increased | FAERS: 5 | US FAERS | |
| 88 | Blood pressure fluctuation | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 89 | Cataract | FAERS: 5 | OFFSIDES US FAERS | |
| 90 | Dehydration | FAERS: 5 | OFFSIDES US FAERS | |
| 91 | Depression suicidal | FAERS: 5 | US FAERS | |
| 92 | Dysgeusia | FAERS: 5 | OFFSIDES US FAERS | |
| 93 | Erectile dysfunction | FAERS: 5 | OFFSIDES SIDER US FAERS | |
| 94 | Erythema | FAERS: 5 | 2602249 | CTD OFFSIDES US FAERS |
| 95 | Feeling jittery | FAERS: 5 | US FAERS | |
| 96 | Flatulence | FAERS: 5 | OFFSIDES US FAERS | |
| 97 | Flushing | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 98 | Intentional drug misuse | FAERS: 5 | US FAERS | |
| 99 | Labile blood pressure | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 100 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 101 | Memory impairment | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 102 | Musculoskeletal discomfort | FAERS: 5 | US FAERS | |
| 103 | Neonatal disorder | FAERS: 5 | US FAERS | |
| 104 | Retroperitoneal fibrosis | FAERS: 5 | US FAERS | |
| 105 | Sopor | FAERS: 5 | US FAERS | |
| 106 | Therapy non-responder | FAERS: 5 | US FAERS | |
| 107 | Thrombocytopenia | FAERS: 5 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 108 | Wheezing | FAERS: 5 | SIDER US FAERS | |
| 109 | Wrong technique in drug usage process | FAERS: 5 | OFFSIDES US FAERS | |
| 110 | Accidental exposure to product by child | FAERS: 4 | US FAERS | |
| 111 | Acute myocardial infarction | FAERS: 4 | OFFSIDES US FAERS | |
| 112 | Amnesia | FAERS: 4 | SIDER US FAERS | |
| 113 | Angina Pectoris | FAERS: 4 | CTD US FAERS | |
| 114 | Anorexia | FAERS: 4 | 2602249 3115369 | CTD SIDER US FAERS |
| 115 | Back Pain | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 116 | Blood potassium increased | FAERS: 4 | OFFSIDES US FAERS | |
| 117 | Chills | FAERS: 4 | US FAERS | |
| 118 | Choking sensation | FAERS: 4 | OFFSIDES US FAERS | |
| 119 | Cold sweat | FAERS: 4 | US FAERS | |
| 120 | Cyanosis | FAERS: 4 | US FAERS | |
| 121 | Depressed Level of Consciousness | FAERS: 4 | US FAERS | |
| 122 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 123 | Drug effect incomplete | FAERS: 4 | US FAERS | |
| 124 | Drug exposure via breast milk | FAERS: 4 | US FAERS | |
| 125 | Dysphonia | FAERS: 4 | OFFSIDES US FAERS | |
| 126 | Emotional disorder | FAERS: 4 | US FAERS | |
| 127 | Intentional product use issue | FAERS: 4 | US FAERS | |
| 128 | Lupus-like syndrome | FAERS: 4 | US FAERS | |
| 129 | Lymphadenopathy | FAERS: 4 | US FAERS | |
| 130 | Psoriasis | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 131 | Retinal Detachment | FAERS: 4 | US FAERS | |
| 132 | Stevens-Johnson Syndrome | FAERS: 4 | US FAERS | |
| 133 | Throat irritation | FAERS: 4 | US FAERS | |
| 134 | Ventricular Fibrillation | FAERS: 4 | 4079442 | CTD US FAERS |
| 135 | jaundice | FAERS: 4 | 2602249 | CTD US FAERS |
| 136 | Abasia | FAERS: 3 | US FAERS | |
| 137 | Accidental exposure to product | FAERS: 3 | US FAERS | |
| 138 | Activities of daily living impaired | FAERS: 3 | US FAERS | |
| 139 | Amylase increased | FAERS: 3 | US FAERS | |
| 140 | Aphonia | FAERS: 3 | OFFSIDES US FAERS | |
| 141 | Apparent death | FAERS: 3 | US FAERS | |
| 142 | Aspartate Aminotransferase Increased | FAERS: 3 | SIDER US FAERS | |
| 143 | Blepharospasm | FAERS: 3 | US FAERS | |
| 144 | Brain natriuretic peptide increased | FAERS: 3 | US FAERS | |
| 145 | Bronchospasm | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 146 | Carbohydrate antigen 19-9 increased | FAERS: 3 | US FAERS | |
| 147 | Cardiomegaly | FAERS: 3 | 15969258 | CTD SIDER US FAERS |
| 148 | Choking | FAERS: 3 | OFFSIDES US FAERS | |
| 149 | Drug ineffective for unapproved indication | FAERS: 3 | US FAERS | |
| 150 | Drug level increased | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 151 | Drug toxicity | FAERS: 3 | OFFSIDES US FAERS | |
| 152 | Dry skin | FAERS: 3 | US FAERS | |
| 153 | Dysarthria | FAERS: 3 | US FAERS | |
| 154 | Ear discomfort | FAERS: 3 | US FAERS | |
| 155 | Eczema | FAERS: 3 | US FAERS | |
| 156 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 157 | Encapsulating Peritoneal Sclerosis | FAERS: 3 | US FAERS | |
| 158 | Glaucoma | FAERS: 3 | US FAERS | |
| 159 | Heart sounds abnormal | FAERS: 3 | US FAERS | |
| 160 | Impaired work ability | FAERS: 3 | US FAERS | |
| 161 | Intercepted drug dispensing error | FAERS: 3 | US FAERS | |
| 162 | Lip swelling | FAERS: 3 | US FAERS | |
| 163 | Long QT Syndrome | FAERS: 3 | 2220552 6861446 15028050 | CTD US FAERS |
| 164 | Multiple allergies | FAERS: 3 | US FAERS | |
| 165 | Peripheral nerve palsy | FAERS: 3 | US FAERS | |
| 166 | Poisoning | FAERS: 3 | US FAERS | |
| 167 | Prescribed underdose | FAERS: 3 | US FAERS | |
| 168 | Respiratory distress | FAERS: 3 | SIDER US FAERS | |
| 169 | Sexual Dysfunction | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 170 | Sick Sinus Syndrome | FAERS: 3 | SIDER US FAERS | |
| 171 | Stress | FAERS: 3 | US FAERS | |
| 172 | Supraventricular tachycardia | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance SIDER US FAERS | |
| 173 | Withdrawal hypertension | FAERS: 3 | US FAERS | |
| 174 | Wrong drug administered | FAERS: 3 | US FAERS | |
| 175 | Accidental overdose | FAERS: 2 | US FAERS | |
| 176 | Acute kidney injury | FAERS: 2 | 9640485 | CTD US FAERS |
| 177 | Alanine Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 178 | Allergic reaction to excipient | FAERS: 2 | US FAERS | |
| 179 | Anger | FAERS: 2 | US FAERS | |
| 180 | Ankle Fracture | FAERS: 2 | US FAERS | |
| 181 | Arterial bypass operation | FAERS: 2 | US FAERS | |
| 182 | Arterial graft | FAERS: 2 | US FAERS | |
| 183 | Arteriosclerosis Obliterans | FAERS: 2 | US FAERS | |
| 184 | Arthritis | FAERS: 2 | OFFSIDES US FAERS | |
| 185 | Ascites | FAERS: 2 | US FAERS | |
| 186 | Asphyxia | FAERS: 2 | US FAERS | |
| 187 | Ataxia | FAERS: 2 | SIDER US FAERS | |
| 188 | Atrial Flutter | FAERS: 2 | SIDER US FAERS | |
| 189 | Blood cholesterol increased | FAERS: 2 | US FAERS | |
| 190 | Blood glucose decreased | FAERS: 2 | US FAERS | |
| 191 | Blood potassium decreased | FAERS: 2 | US FAERS | |
| 192 | Blood triglycerides increased | FAERS: 2 | OFFSIDES US FAERS | |
| 193 | Blood trypsin increased | FAERS: 2 | US FAERS | |
| 194 | Bone pain | FAERS: 2 | US FAERS | |
| 195 | Bradyphrenia | FAERS: 2 | US FAERS | |
| 196 | Chromaturia | FAERS: 2 | US FAERS | |
| 197 | Complications of maternal exposure to therapeutic drugs | FAERS: 2 | US FAERS | |
| 198 | Crying | FAERS: 2 | US FAERS | |
| 199 | Dementia | FAERS: 2 | US FAERS | |
| 200 | Dental caries | FAERS: 2 | US FAERS | |
| 201 | Disease recurrence | FAERS: 2 | US FAERS | |
| 202 | Drug administration error | FAERS: 2 | US FAERS | |
| 203 | Dysuria | FAERS: 2 | US FAERS | |
| 204 | Economic problem | FAERS: 2 | US FAERS | |
| 205 | Expired drug administered | FAERS: 2 | US FAERS | |
| 206 | Exposure during breast feeding | FAERS: 2 | US FAERS | |
| 207 | Gait inability | FAERS: 2 | US FAERS | |
| 208 | Gluten sensitivity | FAERS: 2 | US FAERS | |
| 209 | Gout | FAERS: 2 | OFFSIDES US FAERS | |
| 210 | Growth retardation | FAERS: 2 | US FAERS | |
| 211 | Head discomfort | FAERS: 2 | US FAERS | |
| 212 | Hepatic necrosis | FAERS: 2 | US FAERS | |
| 213 | Hernia | FAERS: 2 | US FAERS | |
| 214 | Hypophagia | FAERS: 2 | OFFSIDES US FAERS | |
| 215 | Hypospadias | FAERS: 2 | US FAERS | |
| 216 | Infectious Mononucleosis | FAERS: 2 | US FAERS | |
| 217 | Intentional dose omission | FAERS: 2 | US FAERS | |
| 218 | Intentional product misuse | FAERS: 2 | US FAERS | |
| 219 | Joint stiffness | FAERS: 2 | OFFSIDES US FAERS | |
| 220 | Labyrinthitis | FAERS: 2 | US FAERS | |
| 221 | Lipase increased | FAERS: 2 | US FAERS | |
| 222 | Liver transplant rejection | FAERS: 2 | US FAERS | |
| 223 | Manufacturing materials issue | FAERS: 2 | US FAERS | |
| 224 | Metabolic acidosis | FAERS: 2 | US FAERS | |
| 225 | Mood swings | FAERS: 2 | SIDER US FAERS | |
| 226 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 227 | Neck Pain | FAERS: 2 | US FAERS | |
| 228 | Nephrectomy | FAERS: 2 | US FAERS | |
| 229 | Nerve injury | FAERS: 2 | US FAERS | |
| 230 | No adverse event | FAERS: 2 | US FAERS | |
| 231 | Ocular icterus | FAERS: 2 | US FAERS | |
| 232 | Oliguria | FAERS: 2 | US FAERS | |
| 233 | Orthostatic intolerance | FAERS: 2 | US FAERS | |
| 234 | Ototoxicity | FAERS: 2 | US FAERS | |
| 235 | Pallor | FAERS: 2 | US FAERS | |
| 236 | Photophobia | FAERS: 2 | US FAERS | |
| 237 | Photosensitivity allergic reaction | FAERS: 2 | US FAERS | |
| 238 | Pityriasis Rosea | FAERS: 2 | US FAERS | |
| 239 | Poor sucking reflex | FAERS: 2 | US FAERS | |
| 240 | Product dispensing error | FAERS: 2 | US FAERS | |
| 241 | Product measured potency issue | FAERS: 2 | US FAERS | |
| 242 | Product use in unapproved indication | FAERS: 2 | US FAERS | |
| 243 | Pulmonary Valve Stenosis | FAERS: 2 | US FAERS | |
| 244 | Pyelocaliectasis | FAERS: 2 | US FAERS | |
| 245 | Rebound effect | FAERS: 2 | US FAERS | |
| 246 | Renal artery stent placement | FAERS: 2 | US FAERS | |
| 247 | Respiratory arrest | FAERS: 2 | US FAERS | |
| 248 | Sclerosing encapsulating peritonitis | FAERS: 2 | US FAERS | |
| 249 | Shock | FAERS: 2 | SIDER US FAERS | |
| 250 | Sinusitis | FAERS: 2 | OFFSIDES US FAERS | |
| 251 | Sluggishness | FAERS: 2 | US FAERS | |
| 252 | Sneezing | FAERS: 2 | US FAERS | |
| 253 | Spinal column stenosis | FAERS: 2 | US FAERS | |
| 254 | Spinal shock | FAERS: 2 | US FAERS | |
| 255 | Transaminases increased | FAERS: 2 | US FAERS | |
| 256 | Urinary tract infection | FAERS: 2 | US FAERS | |
| 257 | Vasculitis | FAERS: 2 | US FAERS | |
| 258 | Venous stenosis | FAERS: 2 | US FAERS | |
| 259 | Visual disturbance | FAERS: 2 | SIDER US FAERS | |
| 260 | White blood cell count decreased | FAERS: 2 | US FAERS | |
| 261 | treatment failure | FAERS: 2 | US FAERS | |
| 262 | Abdominal adhesions | FAERS: 1 | OFFSIDES US FAERS | |
| 263 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 264 | Accidental drug intake by child | FAERS: 1 | US FAERS | |
| 265 | Accidental exposure | FAERS: 1 | US FAERS | |
| 266 | Acne | FAERS: 1 | US FAERS | |
| 267 | Adams-Stokes Syndrome | FAERS: 1 | US FAERS | |
| 268 | Allergy to chemicals | FAERS: 1 | US FAERS | |
| 269 | Anaphylactic shock | FAERS: 1 | US FAERS | |
| 270 | Anaphylactoid Reaction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 271 | Aneurysm | FAERS: 1 | US FAERS | |
| 272 | Anhedonia | FAERS: 1 | US FAERS | |
| 273 | Anorexia Nervosa | FAERS: 1 | US FAERS | |
| 274 | Anorgasmia | FAERS: 1 | US FAERS | |
| 275 | Anosmia | FAERS: 1 | US FAERS | |
| 276 | Anticholinergic Syndrome | FAERS: 1 | OFFSIDES US FAERS | |
| 277 | Antinuclear antibody increased | FAERS: 1 | SIDER US FAERS | |
| 278 | Aphasia | FAERS: 1 | US FAERS | |
| 279 | Arthropathy | FAERS: 1 | US FAERS | |
| 280 | Aura | FAERS: 1 | US FAERS | |
| 281 | Autosomal chromosome anomaly | FAERS: 1 | US FAERS | |
| 282 | Band sensation | FAERS: 1 | US FAERS | |
| 283 | Bilirubin conjugated increased | FAERS: 1 | US FAERS | |
| 284 | Bladder pain | FAERS: 1 | US FAERS | |
| 285 | Blood creatinine increased | FAERS: 1 | OFFSIDES US FAERS | |
| 286 | Blood gases abnormal | FAERS: 1 | US FAERS | |
| 287 | Blood pressure immeasurable | FAERS: 1 | US FAERS | |
| 288 | Blood pressure orthostatic abnormal | FAERS: 1 | US FAERS | |
| 289 | Blood thyroid stimulating hormone increased | FAERS: 1 | US FAERS | |
| 290 | Body height below normal | FAERS: 1 | US FAERS | |
| 291 | Brain Hypoxia | FAERS: 1 | US FAERS | |
| 292 | Breast Cyst | FAERS: 1 | US FAERS | |
| 293 | Breast tenderness | FAERS: 1 | US FAERS | |
| 294 | Cardiotoxicity | FAERS: 1 | US FAERS | |
| 295 | Carnitine increased | FAERS: 1 | US FAERS | |
| 296 | Carpal Tunnel Syndrome | FAERS: 1 | US FAERS | |
| 297 | Catheter related complication | FAERS: 1 | US FAERS | |
| 298 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 299 | Chloasma | FAERS: 1 | US FAERS | |
| 300 | Clostridium difficile infection | FAERS: 1 | US FAERS | |
| 301 | Cluster Headache | FAERS: 1 | US FAERS | |
| 302 | Coronary Artery Disease | FAERS: 1 | 7257500 15911902 | CTD US FAERS |
| 303 | Counterfeit drug administered | FAERS: 1 | US FAERS | |
| 304 | Deafness | FAERS: 1 | US FAERS | |
| 305 | Deep Vein Thrombosis | FAERS: 1 | US FAERS | |
| 306 | Depressed mood | FAERS: 1 | US FAERS | |
| 307 | Diplegia | FAERS: 1 | US FAERS | |
| 308 | Disease complication | FAERS: 1 | US FAERS | |
| 309 | Dissociative disorder | FAERS: 1 | US FAERS | |
| 310 | Diverticulitis | FAERS: 1 | US FAERS | |
| 311 | Drooling | FAERS: 1 | US FAERS | |
| 312 | Drug effect variable | FAERS: 1 | US FAERS | |
| 313 | Drug prescribing error | FAERS: 1 | US FAERS | |
| 314 | Drug screen positive | FAERS: 1 | US FAERS | |
| 315 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 316 | Electrocardiogram PQ interval prolonged | FAERS: 1 | US FAERS | |
| 317 | Emotional distress | FAERS: 1 | US FAERS | |
| 318 | Epicondylitis | FAERS: 1 | US FAERS | |
| 319 | Epigastric discomfort | FAERS: 1 | US FAERS | |
| 320 | Epilepsy | FAERS: 1 | US FAERS | |
| 321 | Erythema Multiforme | FAERS: 1 | OFFSIDES US FAERS | |
| 322 | Expired product administered | FAERS: 1 | US FAERS | |
| 323 | Extra dose administered | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 324 | Eye pain | FAERS: 1 | US FAERS | |
| 325 | Facial Pain | FAERS: 1 | US FAERS | |
| 326 | Fatty acid deficiency | FAERS: 1 | US FAERS | |
| 327 | Female Orgasmic Disorder | FAERS: 1 | US FAERS | |
| 328 | Foreign body in respiratory tract | FAERS: 1 | US FAERS | |
| 329 | Formication | FAERS: 1 | US FAERS | |
| 330 | Frustration | FAERS: 1 | OFFSIDES US FAERS | |
| 331 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 332 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 333 | Gastric pH increased | FAERS: 1 | US FAERS | |
| 334 | Gastritis | FAERS: 1 | US FAERS | |
| 335 | General physical health deterioration | FAERS: 1 | US FAERS | |
| 336 | General symptom | FAERS: 1 | US FAERS | |
| 337 | Graft dysfunction | FAERS: 1 | US FAERS | |
| 338 | Guttate psoriasis | FAERS: 1 | US FAERS | |
| 339 | Haptoglobin Decreased | FAERS: 1 | US FAERS | |
| 340 | Heat illness | FAERS: 1 | US FAERS | |
| 341 | Hepatic cancer stage IV | FAERS: 1 | US FAERS | |
| 342 | Hepatitis C positive | FAERS: 1 | US FAERS | |
| 343 | Hepatitis | FAERS: 1 | US FAERS | |
| 344 | Hypermetabolism | FAERS: 1 | US FAERS | |
| 345 | Hyperreflexia | FAERS: 1 | OFFSIDES US FAERS | |
| 346 | Hypersomnia | FAERS: 1 | US FAERS | |
| 347 | Hyperthyroidism | FAERS: 1 | US FAERS | |
| 348 | Hypothermia neonatal | FAERS: 1 | US FAERS | |
| 349 | Ileus | FAERS: 1 | US FAERS | |
| 350 | Impaired driving ability | FAERS: 1 | US FAERS | |
| 351 | Inadequate analgesia | FAERS: 1 | US FAERS | |
| 352 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 353 | Incoherent | FAERS: 1 | US FAERS | |
| 354 | Incorrect drug dosage form administered | FAERS: 1 | US FAERS | |
| 355 | Infarction | FAERS: 1 | 22391854 | CTD SIDER US FAERS |
| 356 | Influenza | FAERS: 1 | US FAERS | |
| 357 | Intentional misuse | FAERS: 1 | US FAERS | |
| 358 | Irritable Bowel Syndrome | FAERS: 1 | US FAERS | |
| 359 | Latex allergy | FAERS: 1 | US FAERS | |
| 360 | Loss of proprioception | FAERS: 1 | US FAERS | |
| 361 | Lymphoid tissue hyperplasia | FAERS: 1 | US FAERS | |
| 362 | Malabsorption | FAERS: 1 | US FAERS | |
| 363 | Malignant Hypertension | FAERS: 1 | US FAERS | |
| 364 | Manufacturing product shipping issue | FAERS: 1 | US FAERS | |
| 365 | Maternal exposure timing unspecified | FAERS: 1 | US FAERS | |
| 366 | Medical device complication | FAERS: 1 | US FAERS | |
| 367 | Meningioma | FAERS: 1 | US FAERS | |
| 368 | Menorrhagia | FAERS: 1 | US FAERS | |
| 369 | Metanephrine urine increased | FAERS: 1 | US FAERS | |
| 370 | Migraine with Aura | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 371 | Morbid thoughts | FAERS: 1 | US FAERS | |
| 372 | Muscle strain | FAERS: 1 | OFFSIDES US FAERS | |
| 373 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 374 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 375 | Mydriasis | FAERS: 1 | US FAERS | |
| 376 | Nasal pruritus | FAERS: 1 | US FAERS | |
| 377 | Nasopharyngitis | FAERS: 1 | US FAERS | |
| 378 | Nephrolithiasis | FAERS: 1 | OFFSIDES US FAERS | |
| 379 | Nephrosclerosis | FAERS: 1 | US FAERS | |
| 380 | Night sweats | FAERS: 1 | US FAERS | |
| 381 | No adverse effect | FAERS: 1 | US FAERS | |
| 382 | Ocular discomfort | FAERS: 1 | US FAERS | |
| 383 | Oculomucocutaneous syndrome | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 384 | Onychoclasis | FAERS: 1 | US FAERS | |
| 385 | Orthostatic hypertension | FAERS: 1 | US FAERS | |
| 386 | PROTHROMBIN TIME | FAERS: 1 | US FAERS | |
| 387 | Pancreatic enzymes increased | FAERS: 1 | US FAERS | |
| 388 | Panic Disorder | FAERS: 1 | US FAERS | |
| 389 | Paraplegia | FAERS: 1 | US FAERS | |
| 390 | Parenteral Nutrition | FAERS: 1 | US FAERS | |
| 391 | Performance status decreased | FAERS: 1 | US FAERS | |
| 392 | Personality Change | FAERS: 1 | US FAERS | |
| 393 | Pharyngolaryngeal Pain | FAERS: 1 | US FAERS | |
| 394 | Physical disability | FAERS: 1 | US FAERS | |
| 395 | Placental Insufficiency | FAERS: 1 | US FAERS | |
| 396 | Pneumonitis | FAERS: 1 | US FAERS | |
| 397 | Polyuria | FAERS: 1 | OFFSIDES US FAERS | |
| 398 | Poor peripheral circulation | FAERS: 1 | OFFSIDES US FAERS | |
| 399 | Poor quality drug administered | FAERS: 1 | US FAERS | |
| 400 | Poor quality sleep | FAERS: 1 | US FAERS | |
| 401 | Post procedural complication | FAERS: 1 | OFFSIDES US FAERS | |
| 402 | Product administration error | FAERS: 1 | US FAERS | |
| 403 | Product coating issue | FAERS: 1 | US FAERS | |
| 404 | Product compounding quality issue | FAERS: 1 | US FAERS | |
| 405 | Product dose omission | FAERS: 1 | US FAERS | |
| 406 | Product identification number issue | FAERS: 1 | US FAERS | |
| 407 | Product intolerance | FAERS: 1 | US FAERS | |
| 408 | Product label issue | FAERS: 1 | US FAERS | |
| 409 | Product outer packaging issue | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 410 | Product shape issue | FAERS: 1 | US FAERS | |
| 411 | Product solubility abnormal | FAERS: 1 | US FAERS | |
| 412 | Product storage error | FAERS: 1 | US FAERS | |
| 413 | Product tampering | FAERS: 1 | US FAERS | |
| 414 | Pseudolymphoma | FAERS: 1 | US FAERS | |
| 415 | Pulmonary Embolism | FAERS: 1 | US FAERS | |
| 416 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 417 | Pulmonary Hypertension | FAERS: 1 | US FAERS | |
| 418 | Pulmonary congestion | FAERS: 1 | OFFSIDES US FAERS | |
| 419 | Pustular psoriasis | FAERS: 1 | US FAERS | |
| 420 | Pyelonephritis | FAERS: 1 | US FAERS | |
| 421 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 422 | Reaction to excipient | FAERS: 1 | US FAERS | |
| 423 | Reaction to food additive | FAERS: 1 | US FAERS | |
| 424 | Renal cyst | FAERS: 1 | OFFSIDES US FAERS | |
| 425 | Respiratory Depression | FAERS: 1 | US FAERS | |
| 426 | Respiratory Failure | FAERS: 1 | US FAERS | |
| 427 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 428 | Restlessness | FAERS: 1 | US FAERS | |
| 429 | Retching | FAERS: 1 | US FAERS | |
| 430 | Right ventricular failure | FAERS: 1 | US FAERS | |
| 431 | Schizophrenia | FAERS: 1 | US FAERS | |
| 432 | Sciatica | FAERS: 1 | US FAERS | |
| 433 | Sensation of blood flow | FAERS: 1 | US FAERS | |
| 434 | Sepsis | FAERS: 1 | US FAERS | |
| 435 | Similar reaction on previous exposure to drug | FAERS: 1 | US FAERS | |
| 436 | Sinoatrial Block | FAERS: 1 | US FAERS | |
| 437 | Sinus Arrhythmia | FAERS: 1 | US FAERS | |
| 438 | Skin Ulcer | FAERS: 1 | US FAERS | |
| 439 | Skin reaction | FAERS: 1 | US FAERS | |
| 440 | Sleep disorder due to general medical condition, insomnia type | FAERS: 1 | US FAERS | |
| 441 | Staphylococcus test positive | FAERS: 1 | US FAERS | |
| 442 | Stomatitis | FAERS: 1 | US FAERS | |
| 443 | Suspected counterfeit product | FAERS: 1 | US FAERS | |
| 444 | Symptom masked | FAERS: 1 | US FAERS | |
| 445 | Temperature intolerance | FAERS: 1 | US FAERS | |
| 446 | Tension Headache | FAERS: 1 | US FAERS | |
| 447 | Tension | FAERS: 1 | SIDER US FAERS | |
| 448 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 449 | Therapeutic response changed | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 450 | Therapy cessation | FAERS: 1 | US FAERS | |
| 451 | Thirst | FAERS: 1 | US FAERS | |
| 452 | Thrombosis | FAERS: 1 | 6814675 | CTD US FAERS |
| 453 | Tongue blistering | FAERS: 1 | US FAERS | |
| 454 | Torticollis | FAERS: 1 | US FAERS | |
| 455 | Toxic Epidermal Necrolysis | FAERS: 1 | US FAERS | |
| 456 | Transcription medication error | FAERS: 1 | US FAERS | |
| 457 | Unresponsive to stimuli | FAERS: 1 | US FAERS | |
| 458 | Upper-airway cough syndrome | FAERS: 1 | US FAERS | |
| 459 | Urethritis noninfective | FAERS: 1 | US FAERS | |
| 460 | Urinary Incontinence | FAERS: 1 | US FAERS | |
| 461 | Urinary Tract Pain | FAERS: 1 | US FAERS | |
| 462 | Vascular rupture | FAERS: 1 | US FAERS | |
| 463 | Vasospasm | FAERS: 1 | US FAERS | |
| 464 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 465 | Vitamin D Deficiency | FAERS: 1 | US FAERS | |
| 466 | Vitreous floaters | FAERS: 1 | US FAERS | |
| 467 | Wrong patient received product | FAERS: 1 | US FAERS | |
| 468 | ANA increased | SIDER | ||
| 469 | Ache | SIDER | ||
| 470 | Acid reflux | OFFSIDES | ||
| 471 | Acidosis | OFFSIDES | ||
| 472 | Actinic keratosis | OFFSIDES | ||
| 473 | Acute psychosis | Canada Vigilance: 1 | Canada Vigilance | |
| 474 | Agranulocytosis | SIDER | ||
| 475 | Alopecia reversible | SIDER | ||
| 476 | Animal bite | OFFSIDES | ||
| 477 | Anti-erythropoietin antibody positive | OFFSIDES | ||
| 478 | Anxiety Disorders | 7977897 | CTD | |
| 479 | Aortic Aneurysm | OFFSIDES | ||
| 480 | Arterial thrombosis | SIDER | ||
| 481 | Arteriosclerosis | OFFSIDES | ||
| 482 | Asbestosis | OFFSIDES | ||
| 483 | Automatism | OFFSIDES | ||
| 484 | Basal cell carcinoma | OFFSIDES | ||
| 485 | Bedridden | OFFSIDES | ||
| 486 | Bipolar Disorder | 1932412 | CTD | |
| 487 | Bladder spasm | OFFSIDES | ||
| 488 | Blood Glucose | OFFSIDES | ||
| 489 | Blood amylase increased | OFFSIDES | ||
| 490 | Blood bicarbonate | OFFSIDES | ||
| 491 | Blood cholesterol | OFFSIDES | ||
| 492 | Blood creatine phosphokinase increased | OFFSIDES | ||
| 493 | Blood erythropoietin increased | OFFSIDES | ||
| 494 | Blood glucose fluctuation | OFFSIDES | ||
| 495 | Blood iron decreased | OFFSIDES | ||
| 496 | Blood phosphorus increased | OFFSIDES | ||
| 497 | Blood sodium | OFFSIDES | ||
| 498 | Blood testosterone decreased | OFFSIDES | ||
| 499 | Blood urea increased | OFFSIDES | ||
| 500 | Blurred vision | OFFSIDES | ||
| 501 | Body Temperature | OFFSIDES | ||
| 502 | Breast Diseases | 16595566 | CTD | |
| 503 | Bursitis | OFFSIDES | ||
| 504 | Cardiac enzymes increased | OFFSIDES | ||
| 505 | Cardiomyopathy, Dilated | 9623012 | CTD | |
| 506 | Carotid artery occlusion | OFFSIDES | ||
| 507 | Catatonia | SIDER | ||
| 508 | Catheter site related reaction | OFFSIDES | ||
| 509 | Cerebral Arteriosclerosis | OFFSIDES | ||
| 510 | Chemical and Drug Induced Liver Injury | 2602249 2773903 | CTD | |
| 511 | Chemotherapeutic drug level increased | OFFSIDES | ||
| 512 | Cholecystitis infective | OFFSIDES | ||
| 513 | Chronic Obstructive Airway Disease | OFFSIDES | ||
| 514 | Chronic left ventricular failure | OFFSIDES | ||
| 515 | Colonic Neoplasms | 17369603 | CTD | |
| 516 | Confabulation | OFFSIDES | ||
| 517 | Conjunctival cyst | OFFSIDES | ||
| 518 | Corneal Scar | OFFSIDES | ||
| 519 | Delirium | 3142623 | CTD | |
| 520 | Dengue Fever | OFFSIDES | ||
| 521 | Dependent Personality Disorder | OFFSIDES | ||
| 522 | Depressive disorder | 15911902 16569807 16991025 | CTD | |
| 523 | Dermatitis | SIDER | ||
| 524 | Diabetes | OFFSIDES | ||
| 525 | Diarrhea | OFFSIDES | ||
| 526 | Disorders of Excessive Somnolence | 3665616 | CTD | |
| 527 | Disturbance in sexual arousal | SIDER | ||
| 528 | Diverticulum | OFFSIDES | ||
| 529 | Drowsiness | SIDER | ||
| 530 | Drug Eruptions | 17659030 | CTD | |
| 531 | Drug Overdose | 3751021 17692760 | CTD | |
| 532 | Drug level below therapeutic | OFFSIDES | ||
| 533 | Duodenitis | OFFSIDES | ||
| 534 | Edema | 3115369 | CTD | |
| 535 | Ejection Fraction Decreased | OFFSIDES | ||
| 536 | Electrocardiogram poor R-wave progression | OFFSIDES | ||
| 537 | Exanthema | 1378155 2442551 | CTD | |
| 538 | Facial Neuralgia | OFFSIDES | ||
| 539 | Fatty Liver | OFFSIDES | ||
| 540 | Fibromyalgia | OFFSIDES | ||
| 541 | Fistula discharge | OFFSIDES | ||
| 542 | Fixed eruption | Canada Vigilance: 1 | Canada Vigilance | |
| 543 | Gastric ulcer | OFFSIDES | ||
| 544 | Glasgow coma scale | OFFSIDES | ||
| 545 | Heart Block | 1764831 6434029 | CTD | |
| 546 | Heart Diseases | 8607134 12745125 | CTD | |
| 547 | Heart failure | CTD | ||
| 548 | Hemiparesis | OFFSIDES | ||
| 549 | Hyperemia | 15326083 | CTD | |
| 550 | Hyperkalemia | 8606734 | CTD | |
| 551 | Hyperkeratosis | OFFSIDES | ||
| 552 | Hyperparathyroidism | OFFSIDES | ||
| 553 | Hypertriglyceridemia | 1981077 | CTD | |
| 554 | Hypoalphalipoproteinemias | 1981077 | CTD | |
| 555 | Hypokalemia | CTD | ||
| 556 | Hypokinesia | Canada Vigilance: 1 | Canada Vigilance | |
| 557 | Hypotension, Orthostatic | 3578348 | CTD | |
| 558 | Hypoxia | OFFSIDES | ||
| 559 | Infection | OFFSIDES | ||
| 560 | Injection site nodule | OFFSIDES | ||
| 561 | Intention tremor | OFFSIDES | ||
| 562 | Intermittent Claudication | SIDER | ||
| 563 | Intervertebral Disc Degeneration | OFFSIDES | ||
| 564 | Iron Overload | OFFSIDES | ||
| 565 | Joint injury | OFFSIDES | ||
| 566 | Kidney Diseases | 16428940 | CTD | |
| 567 | Kidney Failure | OFFSIDES | ||
| 568 | Laryngospasm | SIDER | ||
| 569 | Left Ventricular Hypertrophy | OFFSIDES | ||
| 570 | Leukoaraiosis | OFFSIDES | ||
| 571 | Leukoencephalopathy | OFFSIDES | ||
| 572 | Leukopenia | Canada Vigilance: 1 | Canada Vigilance | |
| 573 | Lightheadedness | SIDER | ||
| 574 | Lipase | OFFSIDES | ||
| 575 | Marfan Syndrome | 19430350 | CTD | |
| 576 | Memory Disorders | 2084652 8942269 | CTD | |
| 577 | Mental status changes | OFFSIDES | ||
| 578 | Migraine Disorders | 2334086 | CTD | |
| 579 | Multiple Myeloma | OFFSIDES | ||
| 580 | Muscle Fatigue | OFFSIDES | ||
| 581 | Myocardial Ischemia | 1837320 9591892 | CTD | |
| 582 | Myocardial reinfarction | SIDER | ||
| 583 | Myoclonus | 11160978 | CTD | |
| 584 | Neutropenic colitis | OFFSIDES | ||
| 585 | Neutropenic sepsis | OFFSIDES | ||
| 586 | Nocturia | Canada Vigilance: 1 | Canada Vigilance OFFSIDES | |
| 587 | Occult blood positive | OFFSIDES | ||
| 588 | Ocular vascular disorder | OFFSIDES | ||
| 589 | Oral pruritus | OFFSIDES | ||
| 590 | Oropharyngeal discomfort | SIDER | ||
| 591 | Oropharyngeal pain | OFFSIDES SIDER | ||
| 592 | Orthopnea | OFFSIDES | ||
| 593 | Osteopenia | OFFSIDES | ||
| 594 | Pancreatitis | OFFSIDES | ||
| 595 | Parotitis | OFFSIDES | ||
| 596 | Pedal pulse decreased | OFFSIDES | ||
| 597 | Postoperative Complications | 3434760 | CTD | |
| 598 | Prescribed overdose | OFFSIDES | ||
| 599 | Prinzmetal's variant angina | 17692760 | CTD | |
| 600 | Prostate examination abnormal | OFFSIDES | ||
| 601 | Proteinuria | 3115369 | CTD | |
| 602 | Psoriasis flare-up | SIDER | ||
| 603 | Purpura | Canada Vigilance: 1 | Canada Vigilance SIDER | |
| 604 | Rash erythematous | SIDER | ||
| 605 | Raynaud Disease | 6109 | CTD | |
| 606 | Regurgitation | SIDER | ||
| 607 | Renal Artery Obstruction | 6814675 | CTD | |
| 608 | Renal Insufficiency | 2602249 8606734 | CTD | |
| 609 | Renal pain | Canada Vigilance: 1 | Canada Vigilance | |
| 610 | Renal tubular necrosis | OFFSIDES | ||
| 611 | Retinogram abnormal | OFFSIDES | ||
| 612 | Rhinorrhea | OFFSIDES | ||
| 613 | Seizures | 448389 1893924 | CTD | |
| 614 | Septic Shock | OFFSIDES | ||
| 615 | Shock, Cardiogenic | 1764831 | CTD | |
| 616 | Shoulder Pain | OFFSIDES | ||
| 617 | Sinus operation | OFFSIDES | ||
| 618 | Skin lesion | Canada Vigilance: 1 | Canada Vigilance | |
| 619 | Sleep Initiation and Maintenance Disorders | 16595566 | CTD | |
| 620 | Sleep Wake Disorders | 4054195 | CTD | |
| 621 | Spinal Cord Ischemia | 18597977 | CTD | |
| 622 | Spondylolisthesis | OFFSIDES | ||
| 623 | Staring | OFFSIDES | ||
| 624 | Status Asthmaticus | SIDER | ||
| 625 | Substance Withdrawal Syndrome | 2794101 6487471 7977897 | CTD | |
| 626 | Superficial Thrombophlebitis | OFFSIDES | ||
| 627 | Sweating | SIDER | ||
| 628 | Synovial Cyst | OFFSIDES | ||
| 629 | Systolic hypertension | SIDER | ||
| 630 | Tachycardia, Ventricular | 1973400 | CTD | |
| 631 | Therapeutic reaction time decreased | OFFSIDES | ||
| 632 | Thrombocytopenic purpura | SIDER | ||
| 633 | Thyroid Hormone Resistance Syndrome | 9349583 | CTD | |
| 634 | Troponin increased | OFFSIDES | ||
| 635 | Ulcer | OFFSIDES | ||
| 636 | Vascular purpura | SIDER | ||
| 637 | Vasculitis, Leukocytoclastic, Cutaneous | 2523289 17659030 | CTD | |
| 638 | Ventricular Dysfunction, Left | 3354350 7692166 9141231 | CTD | |
| 639 | Ventricular Remodeling | 12743001 | CTD | |
| 640 | Viral labyrinthitis | OFFSIDES | ||
| 641 | Vitamin B 12 Deficiency | OFFSIDES | ||
| 642 | Vulvovaginal discomfort | OFFSIDES | ||
| 643 | Weight Gain | 1928808 | CTD OFFSIDES | |
| 644 | Xerostomia | 18293168 | CTD | |
| 645 | effusion | OFFSIDES | ||
| 646 | furuncle | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.