Epoprostenol
(LMHIPJMTZHDKEW-XQYLJSSYSA-M)
Structure
- SMILES
- CCCCC[C@@H](/C=C/[C@H]1[C@H](O)C[C@H]2[C@@H]1C/C(=C/CCCC(=O)[O-])/O2)O.[Na+]
- Molecular Formula:
- C20H31NaO5
- Molecular Weight:
- 374.447
- Log P:
- 2.0738
- Hydrogen Bond Acceptor:
- 5
- Hydrogen Bond Donor:
- 2
- TPSA:
- 89.82
- CAS Number(s):
- 61849-14-7
Synonym(s)
1.
Epoprostenol
2.
Prostacyclin
3.
Prostaglandin I2
4.
Epoprostanol
5.
Epoprostenol Sodium
6.
Epoprostenol Sodium Salt, (5Z,9alpha,11alpha,13E,15S)-Isomer
7.
Flolan
8.
Prostaglandin I(2)
9.
Veletri
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Nausea | FAERS: 232 | US FAERS | |
| 2 | Headache | FAERS: 231 | US FAERS | |
| 3 | Pneumonia | FAERS: 152 | US FAERS | |
| 4 | Flushing | FAERS: 120 | US FAERS | |
| 5 | Vomiting | FAERS: 119 | US FAERS | |
| 6 | Malaise | FAERS: 110 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 7 | Device related infection | FAERS: 109 | US FAERS | |
| 8 | Pulmonary arterial hypertension | FAERS: 107 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 9 | Dizziness | FAERS: 85 | US FAERS | |
| 10 | Catheter site erythema | FAERS: 81 | US FAERS | |
| 11 | Chest Pain | FAERS: 80 | US FAERS | |
| 12 | Fatigue | FAERS: 80 | US FAERS | |
| 13 | Hypotension | FAERS: 80 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 14 | Asthenia | FAERS: 77 | US FAERS | |
| 15 | Pain | FAERS: 70 | US FAERS | |
| 16 | Ascites | FAERS: 65 | US FAERS | |
| 17 | Right ventricular failure | FAERS: 59 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 18 | Abdominal Pain | FAERS: 55 | US FAERS | |
| 19 | Sepsis | FAERS: 54 | US FAERS | |
| 20 | Catheter site pain | FAERS: 53 | US FAERS | |
| 21 | Pulmonary Hypertension | FAERS: 53 | US FAERS | |
| 22 | Catheter management | FAERS: 51 | US FAERS | |
| 23 | Nasopharyngitis | FAERS: 51 | US FAERS | |
| 24 | Weight decreased | FAERS: 48 | US FAERS | |
| 25 | Catheter site pruritus | FAERS: 47 | US FAERS | |
| 26 | Palpitations | FAERS: 46 | US FAERS | |
| 27 | Back Pain | FAERS: 45 | US FAERS | |
| 28 | Dehydration | FAERS: 45 | US FAERS | |
| 29 | Disease Progression | FAERS: 45 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 30 | Medical device complication | FAERS: 45 | US FAERS | |
| 31 | Fluid overload | FAERS: 43 | US FAERS | |
| 32 | Infection | FAERS: 42 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 33 | Arthralgia | FAERS: 41 | US FAERS | |
| 34 | Hypoxia | FAERS: 41 | US FAERS | |
| 35 | Catheter site infection | FAERS: 39 | US FAERS | |
| 36 | Syncope | FAERS: 38 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 37 | Erythema | FAERS: 37 | US FAERS | |
| 38 | Catheter placement | FAERS: 36 | US FAERS | |
| 39 | Device leakage | FAERS: 36 | US FAERS | |
| 40 | Feeling abnormal | FAERS: 34 | US FAERS | |
| 41 | Urinary tract infection | FAERS: 34 | US FAERS | |
| 42 | Drug dose omission | FAERS: 33 | US FAERS | |
| 43 | Device infusion issue | FAERS: 32 | US FAERS | |
| 44 | Device occlusion | FAERS: 32 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 45 | Device dislocation | FAERS: 31 | US FAERS | |
| 46 | Hyperthyroidism | FAERS: 31 | US FAERS | |
| 47 | Swelling | FAERS: 31 | US FAERS | |
| 48 | Drug administration error | FAERS: 30 | US FAERS | |
| 49 | Sinusitis | FAERS: 30 | US FAERS | |
| 50 | Device breakage | FAERS: 29 | US FAERS | |
| 51 | Catheter site discharge | FAERS: 28 | US FAERS | |
| 52 | Catheter site swelling | FAERS: 28 | US FAERS | |
| 53 | Cellulitis | FAERS: 28 | US FAERS | |
| 54 | Epistaxis | FAERS: 28 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 55 | Abdominal discomfort | FAERS: 26 | US FAERS | |
| 56 | Atrial Fibrillation | FAERS: 25 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 57 | Musculoskeletal Pain | FAERS: 25 | US FAERS | |
| 58 | Pharmaceutical product complaint | FAERS: 25 | US FAERS | |
| 59 | Tachycardia | FAERS: 25 | US FAERS | |
| 60 | Respiratory Failure | FAERS: 24 | US FAERS | |
| 61 | Thrombocytopenia | FAERS: 24 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 62 | Adverse event | FAERS: 23 | US FAERS | |
| 63 | Cardiac Arrest | FAERS: 23 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 64 | Peripheral swelling | FAERS: 23 | US FAERS | |
| 65 | Constipation | FAERS: 22 | US FAERS | |
| 66 | Therapy cessation | FAERS: 22 | US FAERS | |
| 67 | Anxiety | FAERS: 21 | US FAERS | |
| 68 | Bronchitis | FAERS: 21 | US FAERS | |
| 69 | Complication associated with device | FAERS: 21 | US FAERS | |
| 70 | Catheter site inflammation | FAERS: 20 | US FAERS | |
| 71 | Mental status changes | FAERS: 20 | US FAERS | |
| 72 | Chest discomfort | FAERS: 19 | US FAERS | |
| 73 | Chills | FAERS: 19 | US FAERS | |
| 74 | Device alarm issue | FAERS: 19 | US FAERS | |
| 75 | Pruritus | FAERS: 19 | US FAERS | |
| 76 | Device malfunction | FAERS: 18 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 77 | Incorrect route of drug administration | FAERS: 18 | US FAERS | |
| 78 | Influenza | FAERS: 18 | US FAERS | |
| 79 | Alopecia | FAERS: 16 | US FAERS | |
| 80 | Myalgia | FAERS: 16 | US FAERS | |
| 81 | Pancytopenia | FAERS: 15 | US FAERS | |
| 82 | Paracentesis | FAERS: 15 | US FAERS | |
| 83 | Product use issue | FAERS: 15 | US FAERS | |
| 84 | Pulmonary arterial pressure increased | FAERS: 15 | US FAERS | |
| 85 | Respiratory distress | FAERS: 15 | US FAERS | |
| 86 | Bone pain | FAERS: 14 | US FAERS | |
| 87 | Catheter related complication | FAERS: 14 | US FAERS | |
| 88 | Clostridium difficile infection | FAERS: 14 | US FAERS | |
| 89 | Device damage | FAERS: 14 | US FAERS | |
| 90 | Incorrect route of product administration | FAERS: 14 | US FAERS | |
| 91 | Thrombosis in device | FAERS: 14 | US FAERS | |
| 92 | Blood count abnormal | FAERS: 13 | US FAERS | |
| 93 | Cerebrovascular accident | FAERS: 13 | US FAERS | |
| 94 | Limb discomfort | FAERS: 13 | US FAERS | |
| 95 | Pneumothorax | FAERS: 13 | US FAERS | |
| 96 | Product quality issue | FAERS: 13 | US FAERS | |
| 97 | Thrombosis | FAERS: 13 | US FAERS | |
| 98 | Dysgeusia | FAERS: 12 | US FAERS | |
| 99 | Eosinophilia | FAERS: 12 | US FAERS | |
| 100 | Infusion site erythema | FAERS: 12 | US FAERS | |
| 101 | Septic Shock | FAERS: 12 | US FAERS | |
| 102 | Transplant | FAERS: 12 | US FAERS | |
| 103 | Tremor | FAERS: 12 | US FAERS | |
| 104 | Acute kidney injury | FAERS: 11 | US FAERS | |
| 105 | Burning sensation | FAERS: 11 | US FAERS | |
| 106 | Catheter site rash | FAERS: 11 | US FAERS | |
| 107 | Central venous catheter removal | FAERS: 11 | US FAERS | |
| 108 | Neck Pain | FAERS: 11 | US FAERS | |
| 109 | Overdose | FAERS: 11 | US FAERS | |
| 110 | Pancreatitis | FAERS: 11 | US FAERS | |
| 111 | Pericardial effusion | FAERS: 11 | US FAERS | |
| 112 | Unevaluable event | FAERS: 11 | US FAERS | |
| 113 | Wheezing | FAERS: 11 | US FAERS | |
| 114 | Drug ineffective | FAERS: 10 | US FAERS | |
| 115 | General physical health deterioration | FAERS: 10 | US FAERS | |
| 116 | Pulmonary Embolism | FAERS: 10 | US FAERS | |
| 117 | Skin irritation | FAERS: 10 | US FAERS | |
| 118 | Splenomegaly | FAERS: 10 | US FAERS | |
| 119 | Blood potassium decreased | FAERS: 9 | US FAERS | |
| 120 | Catheter site vesicles | FAERS: 9 | US FAERS | |
| 121 | Medication Error | FAERS: 9 | US FAERS | |
| 122 | Night sweats | FAERS: 9 | US FAERS | |
| 123 | Oxygen consumption increased | FAERS: 9 | US FAERS | |
| 124 | Pallor | FAERS: 9 | US FAERS | |
| 125 | Shock | FAERS: 9 | US FAERS | |
| 126 | Somnolence | FAERS: 9 | US FAERS | |
| 127 | Urticaria | FAERS: 9 | US FAERS | |
| 128 | Dry skin | FAERS: 8 | US FAERS | |
| 129 | Gout | FAERS: 8 | US FAERS | |
| 130 | Infusion site pain | FAERS: 8 | US FAERS | |
| 131 | Lethargy | FAERS: 8 | US FAERS | |
| 132 | Malnutrition | FAERS: 8 | US FAERS | |
| 133 | Memory impairment | FAERS: 8 | US FAERS | |
| 134 | Myocardial Infarction | FAERS: 8 | US FAERS | |
| 135 | Nervousness | FAERS: 8 | US FAERS | |
| 136 | Product deposit | FAERS: 8 | US FAERS | |
| 137 | Product preparation error | FAERS: 8 | US FAERS | |
| 138 | Productive Cough | FAERS: 8 | US FAERS | |
| 139 | Ammonia increased | FAERS: 7 | US FAERS | |
| 140 | Application site pruritus | FAERS: 7 | US FAERS | |
| 141 | Cataract | FAERS: 7 | US FAERS | |
| 142 | Delirium | FAERS: 7 | US FAERS | |
| 143 | Device connection issue | FAERS: 7 | US FAERS | |
| 144 | Device use error | FAERS: 7 | US FAERS | |
| 145 | Dyspepsia | FAERS: 7 | US FAERS | |
| 146 | Infusion site infection | FAERS: 7 | US FAERS | |
| 147 | Joint swelling | FAERS: 7 | US FAERS | |
| 148 | Lower respiratory tract infection | FAERS: 7 | US FAERS | |
| 149 | Nephrolithiasis | FAERS: 7 | US FAERS | |
| 150 | Pregnancy | FAERS: 7 | US FAERS | |
| 151 | Rash erythematous | FAERS: 7 | US FAERS | |
| 152 | Respiratory arrest | FAERS: 7 | US FAERS | |
| 153 | Retching | FAERS: 7 | US FAERS | |
| 154 | Unresponsive to stimuli | FAERS: 7 | US FAERS | |
| 155 | Application site erythema | FAERS: 6 | US FAERS | |
| 156 | Asthma | FAERS: 6 | US FAERS | |
| 157 | Blood iron decreased | FAERS: 6 | US FAERS | |
| 158 | Blood sodium decreased | FAERS: 6 | US FAERS | |
| 159 | Cardiomegaly | FAERS: 6 | US FAERS | |
| 160 | Catheter site related reaction | FAERS: 6 | US FAERS | |
| 161 | Concomitant disease aggravated | FAERS: 6 | US FAERS | |
| 162 | Diabetes Mellitus | FAERS: 6 | US FAERS | |
| 163 | Disease complication | FAERS: 6 | US FAERS | |
| 164 | Dysentery | FAERS: 6 | US FAERS | |
| 165 | Gastric infection | FAERS: 6 | US FAERS | |
| 166 | Hypersensitivity | FAERS: 6 | US FAERS | |
| 167 | Hypersplenism | FAERS: 6 | US FAERS | |
| 168 | Infusion site pruritus | FAERS: 6 | US FAERS | |
| 169 | Platelet Transfusion | FAERS: 6 | US FAERS | |
| 170 | Post procedural complication | FAERS: 6 | US FAERS | |
| 171 | Skin Ulcer | FAERS: 6 | US FAERS | |
| 172 | Sudden death | FAERS: 6 | US FAERS | |
| 173 | Therapy change | FAERS: 6 | US FAERS | |
| 174 | Anuria | FAERS: 5 | US FAERS | |
| 175 | Application site rash | FAERS: 5 | US FAERS | |
| 176 | Blood glucose decreased | FAERS: 5 | US FAERS | |
| 177 | Blood thyroid stimulating hormone decreased | FAERS: 5 | US FAERS | |
| 178 | Catheter site scab | FAERS: 5 | US FAERS | |
| 179 | Cyanosis | FAERS: 5 | US FAERS | |
| 180 | Cystitis | FAERS: 5 | US FAERS | |
| 181 | Drug administered to patient of inappropriate age | FAERS: 5 | US FAERS | |
| 182 | Emergency Care | FAERS: 5 | US FAERS | |
| 183 | Gait inability | FAERS: 5 | US FAERS | |
| 184 | Gastrointestinal infection | FAERS: 5 | US FAERS | |
| 185 | Hypopituitarism | FAERS: 5 | US FAERS | |
| 186 | Hypothyroidism | FAERS: 5 | US FAERS | |
| 187 | Incorrect dose administered | FAERS: 5 | US FAERS | |
| 188 | Inflammation | FAERS: 5 | US FAERS | |
| 189 | Infusion site swelling | FAERS: 5 | US FAERS | |
| 190 | Live Birth | FAERS: 5 | US FAERS | |
| 191 | Loss of personal independence in daily activities | FAERS: 5 | US FAERS | |
| 192 | Lymphadenopathy | FAERS: 5 | US FAERS | |
| 193 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 194 | Medical device change | FAERS: 5 | US FAERS | |
| 195 | Micrococcus infection | FAERS: 5 | US FAERS | |
| 196 | Muscle strain | FAERS: 5 | US FAERS | |
| 197 | Muscle tightness | FAERS: 5 | US FAERS | |
| 198 | Presyncope | FAERS: 5 | US FAERS | |
| 199 | Procedural complication | FAERS: 5 | US FAERS | |
| 200 | Product use in unapproved indication | FAERS: 5 | US FAERS | |
| 201 | Scleroderma | FAERS: 5 | US FAERS | |
| 202 | Skin reaction | FAERS: 5 | US FAERS | |
| 203 | Supraventricular tachycardia | FAERS: 5 | US FAERS | |
| 204 | Therapeutic procedure | FAERS: 5 | US FAERS | |
| 205 | Throat irritation | FAERS: 5 | US FAERS | |
| 206 | Thyroiditis | FAERS: 5 | US FAERS | |
| 207 | Tooth Infection | FAERS: 5 | US FAERS | |
| 208 | Vascular device infection | FAERS: 5 | US FAERS | |
| 209 | White blood cell count decreased | FAERS: 5 | US FAERS | |
| 210 | Amnesia | FAERS: 4 | US FAERS | |
| 211 | Angina Pectoris | FAERS: 4 | US FAERS | |
| 212 | Application site discharge | FAERS: 4 | US FAERS | |
| 213 | Application site hypersensitivity | FAERS: 4 | US FAERS | |
| 214 | Atelectasis | FAERS: 4 | US FAERS | |
| 215 | Blood glucose increased | FAERS: 4 | US FAERS | |
| 216 | Blood pressure fluctuation | FAERS: 4 | US FAERS | |
| 217 | Bowel movement irregularity | FAERS: 4 | US FAERS | |
| 218 | Cardiac ablation | FAERS: 4 | US FAERS | |
| 219 | Cataract operation | FAERS: 4 | US FAERS | |
| 220 | Catheter site cellulitis | FAERS: 4 | US FAERS | |
| 221 | Catheter site dermatitis | FAERS: 4 | US FAERS | |
| 222 | Catheter site irritation | FAERS: 4 | US FAERS | |
| 223 | Chemotherapy | FAERS: 4 | US FAERS | |
| 224 | Crying | FAERS: 4 | US FAERS | |
| 225 | Cyst | FAERS: 4 | US FAERS | |
| 226 | Deep Vein Thrombosis | FAERS: 4 | US FAERS | |
| 227 | Device Failure | FAERS: 4 | US FAERS | |
| 228 | Discomfort | FAERS: 4 | US FAERS | |
| 229 | Drug exposure during pregnancy | FAERS: 4 | US FAERS | |
| 230 | Ear discomfort | FAERS: 4 | US FAERS | |
| 231 | Electrolyte imbalance | FAERS: 4 | US FAERS | |
| 232 | Embolism | FAERS: 4 | US FAERS | |
| 233 | Eye Infection | FAERS: 4 | US FAERS | |
| 234 | Eye irritation | FAERS: 4 | US FAERS | |
| 235 | Eye pain | FAERS: 4 | US FAERS | |
| 236 | Hepatic Infection | FAERS: 4 | US FAERS | |
| 237 | Incoherent | FAERS: 4 | US FAERS | |
| 238 | Intentional device misuse | FAERS: 4 | US FAERS | |
| 239 | Laceration | FAERS: 4 | US FAERS | |
| 240 | Leukocytoclastic vasculitis | FAERS: 4 | US FAERS | |
| 241 | Liver transplant rejection | FAERS: 4 | US FAERS | |
| 242 | Oxygen saturation abnormal | FAERS: 4 | US FAERS | |
| 243 | Pain management | FAERS: 4 | US FAERS | |
| 244 | Papule | FAERS: 4 | US FAERS | |
| 245 | Pharyngitis | FAERS: 4 | US FAERS | |
| 246 | Photophobia | FAERS: 4 | US FAERS | |
| 247 | Polyuria | FAERS: 4 | US FAERS | |
| 248 | Pulmonary endarterectomy | FAERS: 4 | US FAERS | |
| 249 | Rhinalgia | FAERS: 4 | US FAERS | |
| 250 | Secretion discharge | FAERS: 4 | US FAERS | |
| 251 | Suicide attempt | FAERS: 4 | US FAERS | |
| 252 | Terminal state | FAERS: 4 | US FAERS | |
| 253 | Therapeutic response unexpected | FAERS: 4 | US FAERS | |
| 254 | Thyroidectomy | FAERS: 4 | US FAERS | |
| 255 | Urinary Incontinence | FAERS: 4 | US FAERS | |
| 256 | Abdominal cavity drainage | FAERS: 3 | US FAERS | |
| 257 | Accidental overdose | FAERS: 3 | US FAERS | |
| 258 | Acute respiratory failure | FAERS: 3 | US FAERS | |
| 259 | Application site irritation | FAERS: 3 | US FAERS | |
| 260 | Application site reaction | FAERS: 3 | US FAERS | |
| 261 | Atrial Flutter | FAERS: 3 | US FAERS | |
| 262 | Blister rupture | FAERS: 3 | US FAERS | |
| 263 | Blood chloride increased | FAERS: 3 | US FAERS | |
| 264 | Blood glucose fluctuation | FAERS: 3 | US FAERS | |
| 265 | Blood sodium abnormal | FAERS: 3 | US FAERS | |
| 266 | Blood urine present | FAERS: 3 | US FAERS | |
| 267 | Bradycardia | FAERS: 3 | US FAERS | |
| 268 | Brain natriuretic peptide increased | FAERS: 3 | US FAERS | |
| 269 | Catheter related infection | FAERS: 3 | US FAERS | |
| 270 | Central line infection | FAERS: 3 | US FAERS | |
| 271 | Cholecystitis | FAERS: 3 | US FAERS | |
| 272 | Cholelithiasis | FAERS: 3 | US FAERS | |
| 273 | Deafness | FAERS: 3 | US FAERS | |
| 274 | Dementia | FAERS: 3 | US FAERS | |
| 275 | Depressed Level of Consciousness | FAERS: 3 | US FAERS | |
| 276 | Dermatitis | FAERS: 3 | US FAERS | |
| 277 | Device component issue | FAERS: 3 | US FAERS | |
| 278 | Device defective | FAERS: 3 | US FAERS | |
| 279 | Disorientation | FAERS: 3 | US FAERS | |
| 280 | Diverticulitis | FAERS: 3 | US FAERS | |
| 281 | Drooling | FAERS: 3 | US FAERS | |
| 282 | Drug titration error | FAERS: 3 | US FAERS | |
| 283 | Eczema | FAERS: 3 | US FAERS | |
| 284 | Emergency care examination | FAERS: 3 | US FAERS | |
| 285 | Endocarditis | FAERS: 3 | US FAERS | |
| 286 | Extracorporeal Membrane Oxygenation | FAERS: 3 | US FAERS | |
| 287 | First bite syndrome | FAERS: 3 | US FAERS | |
| 288 | Flatulence | FAERS: 3 | US FAERS | |
| 289 | Food Poisoning | FAERS: 3 | US FAERS | |
| 290 | Hernia | FAERS: 3 | US FAERS | |
| 291 | Hip surgery | FAERS: 3 | US FAERS | |
| 292 | Hypercapnia | FAERS: 3 | US FAERS | |
| 293 | Incorrect dose administered by device | FAERS: 3 | US FAERS | |
| 294 | Infusion Site Extravasation | FAERS: 3 | US FAERS | |
| 295 | Injection site vesicles | FAERS: 3 | US FAERS | |
| 296 | Livedo Reticularis | FAERS: 3 | US FAERS | |
| 297 | Oropharyngeal pain | FAERS: 3 | US FAERS | |
| 298 | Product dose omission | FAERS: 3 | US FAERS | |
| 299 | Pulmonary congestion | FAERS: 3 | US FAERS | |
| 300 | Pulmonary vein occlusion | FAERS: 3 | US FAERS | |
| 301 | Scab | FAERS: 3 | US FAERS | |
| 302 | Serratia sepsis | FAERS: 3 | US FAERS | |
| 303 | Silent thyroiditis | FAERS: 3 | US FAERS | |
| 304 | Sneezing | FAERS: 3 | US FAERS | |
| 305 | Staphylococcus test positive | FAERS: 3 | US FAERS | |
| 306 | Stomatitis | FAERS: 3 | US FAERS | |
| 307 | Therapy non-responder | FAERS: 3 | US FAERS | |
| 308 | Thyroid stimulating immunoglobulin increased | FAERS: 3 | US FAERS | |
| 309 | Tinnitus | FAERS: 3 | US FAERS | |
| 310 | Upper-airway cough syndrome | FAERS: 3 | US FAERS | |
| 311 | Abscess | FAERS: 2 | US FAERS | |
| 312 | Accidental exposure to product | FAERS: 2 | US FAERS | |
| 313 | Activities of daily living impaired | FAERS: 2 | US FAERS | |
| 314 | Agranulocytosis | FAERS: 2 | US FAERS | |
| 315 | Angioplasty | FAERS: 2 | US FAERS | |
| 316 | Aphonia | FAERS: 2 | US FAERS | |
| 317 | Appendicitis | FAERS: 2 | US FAERS | |
| 318 | Application site inflammation | FAERS: 2 | US FAERS | |
| 319 | Arthritis | FAERS: 2 | US FAERS | |
| 320 | Bladder Neoplasm | FAERS: 2 | US FAERS | |
| 321 | Blood creatine phosphokinase increased | FAERS: 2 | US FAERS | |
| 322 | Blood electrolytes decreased | FAERS: 2 | US FAERS | |
| 323 | Blood magnesium abnormal | FAERS: 2 | US FAERS | |
| 324 | Blood magnesium decreased | FAERS: 2 | US FAERS | |
| 325 | Bronchospasm | FAERS: 2 | US FAERS | |
| 326 | Cachexia | FAERS: 2 | US FAERS | |
| 327 | Cardiac valve vegetation | FAERS: 2 | US FAERS | |
| 328 | Catheter culture positive | FAERS: 2 | US FAERS | |
| 329 | Catheter site injury | FAERS: 2 | US FAERS | |
| 330 | Cerebral Infarction | FAERS: 2 | US FAERS | |
| 331 | Cholangitis | FAERS: 2 | US FAERS | |
| 332 | Chromaturia | FAERS: 2 | US FAERS | |
| 333 | Chronic respiratory failure | FAERS: 2 | US FAERS | |
| 334 | Clostridium test positive | FAERS: 2 | US FAERS | |
| 335 | Colitis | FAERS: 2 | US FAERS | |
| 336 | Concomitant disease progression | FAERS: 2 | US FAERS | |
| 337 | Cor pulmonale | FAERS: 2 | US FAERS | |
| 338 | Croup infectious | FAERS: 2 | US FAERS | |
| 339 | Depressed mood | FAERS: 2 | US FAERS | |
| 340 | Device related thrombosis | FAERS: 2 | US FAERS | |
| 341 | Disease recurrence | FAERS: 2 | US FAERS | |
| 342 | Endarterectomy | FAERS: 2 | US FAERS | |
| 343 | Endoscopic Retrograde Cholangiopancreatography | FAERS: 2 | US FAERS | |
| 344 | Escherichia infection | FAERS: 2 | US FAERS | |
| 345 | Exposure via skin contact | FAERS: 2 | US FAERS | |
| 346 | Extravasation | FAERS: 2 | US FAERS | |
| 347 | Feeling Cold | FAERS: 2 | US FAERS | |
| 348 | Gastritis | FAERS: 2 | US FAERS | |
| 349 | Gastroenteritis norovirus | FAERS: 2 | US FAERS | |
| 350 | Gastroenteritis | FAERS: 2 | US FAERS | |
| 351 | General physical condition abnormal | FAERS: 2 | US FAERS | |
| 352 | Hemiparesis | FAERS: 2 | US FAERS | |
| 353 | Hepatitis | FAERS: 2 | US FAERS | |
| 354 | Hepatomegaly | FAERS: 2 | US FAERS | |
| 355 | Hospice Care | FAERS: 2 | US FAERS | |
| 356 | Incorrect drug administration rate | FAERS: 2 | US FAERS | |
| 357 | Incorrect product storage | FAERS: 2 | US FAERS | |
| 358 | Infusion site rash | FAERS: 2 | US FAERS | |
| 359 | Infusion site warmth | FAERS: 2 | US FAERS | |
| 360 | Injection site pain | FAERS: 2 | US FAERS | |
| 361 | Irritable Bowel Syndrome | FAERS: 2 | US FAERS | |
| 362 | Joint injury | FAERS: 2 | US FAERS | |
| 363 | Joint stiffness | FAERS: 2 | US FAERS | |
| 364 | Leukocytosis | FAERS: 2 | US FAERS | |
| 365 | Limb injury | FAERS: 2 | US FAERS | |
| 366 | Macular degeneration | FAERS: 2 | US FAERS | |
| 367 | Mastectomy | FAERS: 2 | US FAERS | |
| 368 | Mechanical ventilation | FAERS: 2 | US FAERS | |
| 369 | Micrococcal sepsis | FAERS: 2 | US FAERS | |
| 370 | Multiple Sclerosis | FAERS: 2 | US FAERS | |
| 371 | Multiple allergies | FAERS: 2 | US FAERS | |
| 372 | Myocardial necrosis marker increased | FAERS: 2 | US FAERS | |
| 373 | Neuralgia | FAERS: 2 | US FAERS | |
| 374 | Neutropenia | FAERS: 2 | US FAERS | |
| 375 | Osteomyelitis | FAERS: 2 | US FAERS | |
| 376 | Pain of skin | FAERS: 2 | US FAERS | |
| 377 | Palliative Care | FAERS: 2 | US FAERS | |
| 378 | Palpable purpura | FAERS: 2 | US FAERS | |
| 379 | Paranasal sinus discomfort | FAERS: 2 | US FAERS | |
| 380 | Peritonitis | FAERS: 2 | US FAERS | |
| 381 | Pleurisy | FAERS: 2 | US FAERS | |
| 382 | Portal Hypertension | FAERS: 2 | US FAERS | |
| 383 | Portal hypertensive gastropathy | FAERS: 2 | US FAERS | |
| 384 | Procedural hypotension | FAERS: 2 | US FAERS | |
| 385 | Pseudomonas test positive | FAERS: 2 | US FAERS | |
| 386 | Psoriasis | FAERS: 2 | US FAERS | |
| 387 | Rectal Prolapse | FAERS: 2 | US FAERS | |
| 388 | Sinus headache | FAERS: 2 | US FAERS | |
| 389 | Skin weeping | FAERS: 2 | US FAERS | |
| 390 | Sleep Talking | FAERS: 2 | US FAERS | |
| 391 | Slow speech | FAERS: 2 | US FAERS | |
| 392 | Tooth Extraction | FAERS: 2 | US FAERS | |
| 393 | Transplant evaluation | FAERS: 2 | US FAERS | |
| 394 | Troponin increased | FAERS: 2 | US FAERS | |
| 395 | Vascular occlusion | FAERS: 2 | US FAERS | |
| 396 | Venous Thrombosis | FAERS: 2 | US FAERS | |
| 397 | Visual Impairment | FAERS: 2 | US FAERS | |
| 398 | Walking distance test abnormal | FAERS: 2 | US FAERS | |
| 399 | Wound Infection | FAERS: 2 | US FAERS | |
| 400 | Wrong technique in product usage process | FAERS: 2 | US FAERS | |
| 401 | colonoscopy | FAERS: 2 | US FAERS | |
| 402 | Abdominal tenderness | FAERS: 1 | US FAERS | |
| 403 | Acanthosis | FAERS: 1 | US FAERS | |
| 404 | Acidosis | FAERS: 1 | US FAERS | |
| 405 | Acute right ventricular failure | FAERS: 1 | US FAERS | |
| 406 | Administration site cellulitis | FAERS: 1 | US FAERS | |
| 407 | Administration site pruritus | FAERS: 1 | US FAERS | |
| 408 | Ageusia | FAERS: 1 | US FAERS | |
| 409 | Agitation | FAERS: 1 | US FAERS | |
| 410 | Alanine Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 411 | Alcohol rehabilitation | FAERS: 1 | US FAERS | |
| 412 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 413 | Altered state of consciousness | FAERS: 1 | US FAERS | |
| 414 | Anti-neutrophil cytoplasmic antibody positive vasculitis | FAERS: 1 | US FAERS | |
| 415 | Anti-thyroid antibody positive | FAERS: 1 | US FAERS | |
| 416 | Antibiotic therapy | FAERS: 1 | US FAERS | |
| 417 | Aphthous Stomatitis | FAERS: 1 | US FAERS | |
| 418 | Application site pain | FAERS: 1 | US FAERS | |
| 419 | Application site vesicles | FAERS: 1 | US FAERS | |
| 420 | Arterial thrombosis | FAERS: 1 | US FAERS | |
| 421 | Arteriosclerosis | FAERS: 1 | US FAERS | |
| 422 | Arthropathy | FAERS: 1 | US FAERS | |
| 423 | Arthropod bite | FAERS: 1 | US FAERS | |
| 424 | Aspartate Aminotransferase Increased | FAERS: 1 | US FAERS | |
| 425 | Auricular swelling | FAERS: 1 | US FAERS | |
| 426 | Autoimmune hepatitis | FAERS: 1 | US FAERS | |
| 427 | Autoimmune thrombocytopenia | FAERS: 1 | US FAERS | |
| 428 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 429 | Bacterial sepsis | FAERS: 1 | US FAERS | |
| 430 | Bacterial test positive | FAERS: 1 | US FAERS | |
| 431 | Bed rest | FAERS: 1 | US FAERS | |
| 432 | Benign neoplasm of scrotum | FAERS: 1 | US FAERS | |
| 433 | Biliary cirrhosis | FAERS: 1 | US FAERS | |
| 434 | Biopsy thyroid gland abnormal | FAERS: 1 | US FAERS | |
| 435 | Bladder neck suspension | FAERS: 1 | US FAERS | |
| 436 | Blood cortisol decreased | FAERS: 1 | US FAERS | |
| 437 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 438 | Blood glucose abnormal | FAERS: 1 | US FAERS | |
| 439 | Blood immunoglobulin E increased | FAERS: 1 | US FAERS | |
| 440 | Blood osmolarity decreased | FAERS: 1 | US FAERS | |
| 441 | Blood potassium increased | FAERS: 1 | US FAERS | |
| 442 | Bone marrow reticulin fibrosis | FAERS: 1 | US FAERS | |
| 443 | Brain Death | FAERS: 1 | US FAERS | |
| 444 | Bronchial Obstruction | FAERS: 1 | US FAERS | |
| 445 | Bronchopneumonia | FAERS: 1 | US FAERS | |
| 446 | Bronchoscopy | FAERS: 1 | US FAERS | |
| 447 | Butterfly rash | FAERS: 1 | US FAERS | |
| 448 | C-reactive protein decreased | FAERS: 1 | US FAERS | |
| 449 | Candida test positive | FAERS: 1 | US FAERS | |
| 450 | Carbon dioxide increased | FAERS: 1 | US FAERS | |
| 451 | Cardiac Output | FAERS: 1 | US FAERS | |
| 452 | Cardiac Tamponade | FAERS: 1 | US FAERS | |
| 453 | Cardiovascular insufficiency | FAERS: 1 | US FAERS | |
| 454 | Catheter sepsis | FAERS: 1 | US FAERS | |
| 455 | Catheter site abscess | FAERS: 1 | US FAERS | |
| 456 | Catheter site extravasation | FAERS: 1 | US FAERS | |
| 457 | Catheter site hypersensitivity | FAERS: 1 | US FAERS | |
| 458 | Catheter site induration | FAERS: 1 | US FAERS | |
| 459 | Catheter site pustule | FAERS: 1 | US FAERS | |
| 460 | Catheter site scar | FAERS: 1 | US FAERS | |
| 461 | Catheter site urticaria | FAERS: 1 | US FAERS | |
| 462 | Catheter site warmth | FAERS: 1 | US FAERS | |
| 463 | Choking | FAERS: 1 | US FAERS | |
| 464 | Clostridium difficile colitis | FAERS: 1 | US FAERS | |
| 465 | Cold sweat | FAERS: 1 | US FAERS | |
| 466 | Colectomy | FAERS: 1 | US FAERS | |
| 467 | Complications of transplant surgery | FAERS: 1 | US FAERS | |
| 468 | Compression fracture | FAERS: 1 | US FAERS | |
| 469 | Contraceptive implant | FAERS: 1 | US FAERS | |
| 470 | Coronary angioplasty | FAERS: 1 | US FAERS | |
| 471 | Culture positive | FAERS: 1 | US FAERS | |
| 472 | Culture tissue specimen positive | FAERS: 1 | US FAERS | |
| 473 | Culture urine positive | FAERS: 1 | US FAERS | |
| 474 | Cyst removal | FAERS: 1 | US FAERS | |
| 475 | Cytology | FAERS: 1 | US FAERS | |
| 476 | Device adhesion issue | FAERS: 1 | US FAERS | |
| 477 | Device battery issue | FAERS: 1 | US FAERS | |
| 478 | Device deposit issue | FAERS: 1 | US FAERS | |
| 479 | Device related sepsis | FAERS: 1 | US FAERS | |
| 480 | Diabetic Ketoacidosis | FAERS: 1 | US FAERS | |
| 481 | Dialysis device insertion | FAERS: 1 | US FAERS | |
| 482 | Dieulafoy's vascular malformation | FAERS: 1 | US FAERS | |
| 483 | Diffuse Large B-Cell Lymphoma | FAERS: 1 | US FAERS | |
| 484 | Diplopia | FAERS: 1 | US FAERS | |
| 485 | Disease risk factor | FAERS: 1 | US FAERS | |
| 486 | Drug Dependence | FAERS: 1 | US FAERS | |
| 487 | Drug dispensing error | FAERS: 1 | US FAERS | |
| 488 | Drug effect incomplete | FAERS: 1 | US FAERS | |
| 489 | Drug therapy enhancement | FAERS: 1 | US FAERS | |
| 490 | Drug withdrawal syndrome | FAERS: 1 | US FAERS | |
| 491 | Dry gangrene | FAERS: 1 | US FAERS | |
| 492 | Dysgraphia | FAERS: 1 | US FAERS | |
| 493 | Dysphonia | FAERS: 1 | US FAERS | |
| 494 | Dysuria | FAERS: 1 | US FAERS | |
| 495 | Ear congestion | FAERS: 1 | US FAERS | |
| 496 | Echocardiogram abnormal | FAERS: 1 | US FAERS | |
| 497 | Ectopic Pregnancy | FAERS: 1 | US FAERS | |
| 498 | Electroencephalogram abnormal | FAERS: 1 | US FAERS | |
| 499 | Electromechanical dissociation | FAERS: 1 | US FAERS | |
| 500 | Endometrial hypertrophy | FAERS: 1 | US FAERS | |
| 501 | Endoscopic retrograde cholangiopancreatography abnormal | FAERS: 1 | US FAERS | |
| 502 | Enterobiasis | FAERS: 1 | US FAERS | |
| 503 | Enterocolitis | FAERS: 1 | US FAERS | |
| 504 | Epididymitis | FAERS: 1 | US FAERS | |
| 505 | Expired product administered | FAERS: 1 | US FAERS | |
| 506 | Exposure via inhalation | FAERS: 1 | US FAERS | |
| 507 | Eye inflammation | FAERS: 1 | US FAERS | |
| 508 | Facial Pain | FAERS: 1 | US FAERS | |
| 509 | Failure to Thrive | FAERS: 1 | US FAERS | |
| 510 | Febrile Neutropenia | FAERS: 1 | US FAERS | |
| 511 | Feeling jittery | FAERS: 1 | US FAERS | |
| 512 | Fibromyalgia | FAERS: 1 | US FAERS | |
| 513 | Flank Pain | FAERS: 1 | US FAERS | |
| 514 | Frustration tolerance decreased | FAERS: 1 | US FAERS | |
| 515 | Full blood count abnormal | FAERS: 1 | US FAERS | |
| 516 | Gangrene | FAERS: 1 | US FAERS | |
| 517 | Gastrostomy failure | FAERS: 1 | US FAERS | |
| 518 | Gastrostomy | FAERS: 1 | US FAERS | |
| 519 | Granulocyte count decreased | FAERS: 1 | US FAERS | |
| 520 | Guillain-Barre Syndrome | FAERS: 1 | US FAERS | |
| 521 | Hepatic Encephalopathy | FAERS: 1 | US FAERS | |
| 522 | Hepatic congestion | FAERS: 1 | US FAERS | |
| 523 | Hepatorenal Syndrome | FAERS: 1 | US FAERS | |
| 524 | Hepatosplenomegaly | FAERS: 1 | US FAERS | |
| 525 | Hydronephrosis | FAERS: 1 | US FAERS | |
| 526 | Hypersomnia | FAERS: 1 | US FAERS | |
| 527 | Hyperventilation | FAERS: 1 | US FAERS | |
| 528 | Hypophagia | FAERS: 1 | US FAERS | |
| 529 | Hypophysitis | FAERS: 1 | US FAERS | |
| 530 | Hysterectomy | FAERS: 1 | US FAERS | |
| 531 | Impetigo | FAERS: 1 | US FAERS | |
| 532 | Inappropriate schedule of drug administration | FAERS: 1 | US FAERS | |
| 533 | Inappropriate schedule of product administration | FAERS: 1 | US FAERS | |
| 534 | Incision site erythema | FAERS: 1 | US FAERS | |
| 535 | Incision site inflammation | FAERS: 1 | US FAERS | |
| 536 | Increased upper airway secretion | FAERS: 1 | US FAERS | |
| 537 | Infectious Mononucleosis | FAERS: 1 | US FAERS | |
| 538 | Infectious colitis | FAERS: 1 | US FAERS | |
| 539 | Infectious peritonitis | FAERS: 1 | US FAERS | |
| 540 | Infusion site dermatitis | FAERS: 1 | US FAERS | |
| 541 | Infusion site inflammation | FAERS: 1 | US FAERS | |
| 542 | Infusion site reaction | FAERS: 1 | US FAERS | |
| 543 | Injection site discharge | FAERS: 1 | US FAERS | |
| 544 | Injection site erythema | FAERS: 1 | US FAERS | |
| 545 | Injection site irritation | FAERS: 1 | US FAERS | |
| 546 | Injection site mass | FAERS: 1 | US FAERS | |
| 547 | Insertion of ambulatory peritoneal catheter | FAERS: 1 | US FAERS | |
| 548 | Intentional drug misuse | FAERS: 1 | US FAERS | |
| 549 | Intentional product use issue | FAERS: 1 | US FAERS | |
| 550 | Intentional self-injury | FAERS: 1 | US FAERS | |
| 551 | Intervertebral disc disorder | FAERS: 1 | US FAERS | |
| 552 | Intestinal Obstruction | FAERS: 1 | US FAERS | |
| 553 | Intestinal Perforation | FAERS: 1 | US FAERS | |
| 554 | Invasive Ductal Breast Carcinoma | FAERS: 1 | US FAERS | |
| 555 | Investigation abnormal | FAERS: 1 | US FAERS | |
| 556 | Joint warmth | FAERS: 1 | US FAERS | |
| 557 | Labile blood pressure | FAERS: 1 | US FAERS | |
| 558 | Large intestinal polypectomy | FAERS: 1 | US FAERS | |
| 559 | Large intestine perforation | FAERS: 1 | US FAERS | |
| 560 | Laryngitis | FAERS: 1 | US FAERS | |
| 561 | Leukopenia | FAERS: 1 | US FAERS | |
| 562 | Limb operation | FAERS: 1 | US FAERS | |
| 563 | Liquid product physical issue | FAERS: 1 | US FAERS | |
| 564 | Localised intraabdominal fluid collection | FAERS: 1 | US FAERS | |
| 565 | Low birth weight baby | FAERS: 1 | US FAERS | |
| 566 | Lung Injury | FAERS: 1 | US FAERS | |
| 567 | Lung consolidation | FAERS: 1 | US FAERS | |
| 568 | Lung transplant rejection | FAERS: 1 | US FAERS | |
| 569 | Lymphocytic infiltration | FAERS: 1 | US FAERS | |
| 570 | MYELODYSPLASTIC SYNDROME | FAERS: 1 | US FAERS | |
| 571 | Mallory-Weiss Syndrome | FAERS: 1 | US FAERS | |
| 572 | Medical device removal | FAERS: 1 | US FAERS | |
| 573 | Megakaryocytes increased | FAERS: 1 | US FAERS | |
| 574 | Menorrhagia | FAERS: 1 | US FAERS | |
| 575 | Metabolic acidosis | FAERS: 1 | US FAERS | |
| 576 | Metastasis | FAERS: 1 | US FAERS | |
| 577 | Miliaria | FAERS: 1 | US FAERS | |
| 578 | Multiple sclerosis relapse | FAERS: 1 | US FAERS | |
| 579 | Musculoskeletal chest pain | FAERS: 1 | US FAERS | |
| 580 | Musculoskeletal stiffness | FAERS: 1 | US FAERS | |
| 581 | Mydriasis | FAERS: 1 | US FAERS | |
| 582 | Myelofibrosis | FAERS: 1 | US FAERS | |
| 583 | N-terminal prohormone brain natriuretic peptide increased | FAERS: 1 | US FAERS | |
| 584 | Nasal discomfort | FAERS: 1 | US FAERS | |
| 585 | Nocturia | FAERS: 1 | US FAERS | |
| 586 | Nonspecific reaction | FAERS: 1 | US FAERS | |
| 587 | Obstruction | FAERS: 1 | US FAERS | |
| 588 | Occupational exposure to product | FAERS: 1 | US FAERS | |
| 589 | Oliguria | FAERS: 1 | US FAERS | |
| 590 | Onychalgia | FAERS: 1 | US FAERS | |
| 591 | Oral pain | FAERS: 1 | US FAERS | |
| 592 | Orchitis | FAERS: 1 | US FAERS | |
| 593 | Otitis Media | FAERS: 1 | US FAERS | |
| 594 | Oxygen consumption decreased | FAERS: 1 | US FAERS | |
| 595 | Oxygen supplementation | FAERS: 1 | US FAERS | |
| 596 | PCO2 increased | FAERS: 1 | US FAERS | |
| 597 | Pancreatic Cyst | FAERS: 1 | US FAERS | |
| 598 | Pancreatic carcinoma | FAERS: 1 | US FAERS | |
| 599 | Parathyroidectomy | FAERS: 1 | US FAERS | |
| 600 | Parenteral Nutrition | FAERS: 1 | US FAERS | |
| 601 | Patent ductus arteriosus | FAERS: 1 | US FAERS | |
| 602 | Pathogen resistance | FAERS: 1 | US FAERS | |
| 603 | Pelvic mass | FAERS: 1 | US FAERS | |
| 604 | Pemphigus | FAERS: 1 | US FAERS | |
| 605 | Phlebitis | FAERS: 1 | US FAERS | |
| 606 | Pituitary enlargement | FAERS: 1 | US FAERS | |
| 607 | Pneumoperitoneum | FAERS: 1 | US FAERS | |
| 608 | Polydipsia | FAERS: 1 | US FAERS | |
| 609 | Polyserositis | FAERS: 1 | US FAERS | |
| 610 | Post-Traumatic Stress Disorder | FAERS: 1 | US FAERS | |
| 611 | Preoperative Care | FAERS: 1 | US FAERS | |
| 612 | Product administration error | FAERS: 1 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 613 | Product container issue | FAERS: 1 | US FAERS | |
| 614 | Product dosage form confusion | FAERS: 1 | US FAERS | |
| 615 | Product measured potency issue | FAERS: 1 | US FAERS | |
| 616 | Product storage error | FAERS: 1 | US FAERS | |
| 617 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 618 | Pseudomonal sepsis | FAERS: 1 | US FAERS | |
| 619 | Pulmonary Fibrosis | FAERS: 1 | US FAERS | |
| 620 | Pulmonary arterial pressure decreased | FAERS: 1 | US FAERS | |
| 621 | Pulmonary pain | FAERS: 1 | US FAERS | |
| 622 | Pulmonary vascular disorder | FAERS: 1 | US FAERS | |
| 623 | Purulent discharge | FAERS: 1 | US FAERS | |
| 624 | Pyonephrosis | FAERS: 1 | US FAERS | |
| 625 | Quality of life decreased | FAERS: 1 | US FAERS | |
| 626 | Rales | FAERS: 1 | US FAERS | |
| 627 | Rebound effect | FAERS: 1 | US FAERS | |
| 628 | Rectal laceration postoperative | FAERS: 1 | US FAERS | |
| 629 | Rehabilitation therapy | FAERS: 1 | US FAERS | |
| 630 | Respiratory tract congestion | FAERS: 1 | US FAERS | |
| 631 | Respiratory tract irritation | FAERS: 1 | US FAERS | |
| 632 | Restless Legs Syndrome | FAERS: 1 | US FAERS | |
| 633 | Restlessness | FAERS: 1 | US FAERS | |
| 634 | Rhinophyma | FAERS: 1 | US FAERS | |
| 635 | Rhinovirus infection | FAERS: 1 | US FAERS | |
| 636 | Right Ventricular Dysfunction | FAERS: 1 | US FAERS | |
| 637 | Right Ventricular Hypertrophy | FAERS: 1 | US FAERS | |
| 638 | Right ventricle outflow tract obstruction | FAERS: 1 | US FAERS | |
| 639 | Rotator cuff syndrome | FAERS: 1 | US FAERS | |
| 640 | Sclerodactylia | FAERS: 1 | US FAERS | |
| 641 | Seizure like phenomena | FAERS: 1 | US FAERS | |
| 642 | Septic embolus | FAERS: 1 | US FAERS | |
| 643 | Shunt infection | FAERS: 1 | US FAERS | |
| 644 | Sinus Tachycardia | FAERS: 1 | US FAERS | |
| 645 | Skin discomfort | FAERS: 1 | US FAERS | |
| 646 | Skin lesion | FAERS: 1 | US FAERS | |
| 647 | Sluggishness | FAERS: 1 | US FAERS | |
| 648 | Soft tissue swelling | FAERS: 1 | US FAERS | |
| 649 | Spinal column injury | FAERS: 1 | US FAERS | |
| 650 | Spleen palpable | FAERS: 1 | US FAERS | |
| 651 | Splenectomy | FAERS: 1 | US FAERS | |
| 652 | Stem cell transplant | FAERS: 1 | US FAERS | |
| 653 | Sudden infant death syndrome | FAERS: 1 | US FAERS | |
| 654 | Supportive care | FAERS: 1 | US FAERS | |
| 655 | Suture insertion | FAERS: 1 | US FAERS | |
| 656 | Suture related complication | FAERS: 1 | US FAERS | |
| 657 | Suture rupture | FAERS: 1 | US FAERS | |
| 658 | Systemic Inflammatory Response Syndrome | FAERS: 1 | US FAERS | |
| 659 | Systemic Scleroderma | FAERS: 1 | US FAERS | |
| 660 | Therapeutic product ineffective | FAERS: 1 | US FAERS | |
| 661 | Thermal burn | FAERS: 1 | US FAERS | |
| 662 | Tongue spasm | FAERS: 1 | US FAERS | |
| 663 | Toothache | FAERS: 1 | US FAERS | |
| 664 | Toxicity to various agents | FAERS: 1 | US FAERS | |
| 665 | Trichorrhexis | FAERS: 1 | US FAERS | |
| 666 | Trismus | FAERS: 1 | US FAERS | |
| 667 | Ulcer | FAERS: 1 | US FAERS | |
| 668 | Umbilical hernia | FAERS: 1 | US FAERS | |
| 669 | Unevaluable investigation | FAERS: 1 | US FAERS | |
| 670 | Unhealthy diet | FAERS: 1 | US FAERS | |
| 671 | Urinary Retention | FAERS: 1 | US FAERS | |
| 672 | Urine osmolarity increased | FAERS: 1 | US FAERS | |
| 673 | Uterine Cancer | FAERS: 1 | US FAERS | |
| 674 | Uterine Polyp | FAERS: 1 | US FAERS | |
| 675 | Uterine contractions during pregnancy | FAERS: 1 | US FAERS | |
| 676 | Uterine dilation and evacuation | FAERS: 1 | US FAERS | |
| 677 | Vascular Access Complication | FAERS: 1 | US FAERS | |
| 678 | Vasculitic rash | FAERS: 1 | US FAERS | |
| 679 | Vasopressive therapy | FAERS: 1 | US FAERS | |
| 680 | Ventricular arrhythmia | FAERS: 1 | US FAERS | |
| 681 | Vessel perforation | FAERS: 1 | US FAERS | |
| 682 | Wound closure | FAERS: 1 | US FAERS | |
| 683 | Wound healing normal | FAERS: 1 | US FAERS | |
| 684 | diagnostic procedure | FAERS: 1 | US FAERS | |
| 685 | jaundice | FAERS: 1 | US FAERS | |
| 686 | nervous system disorder | FAERS: 1 | US FAERS | |
| 687 | skin abrasion | FAERS: 1 | US FAERS | |
| 688 | treatment failure | FAERS: 1 | US FAERS | |
| 689 | Duodenal Ulcer | Canada Vigilance: 1 | Canada Vigilance |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120234
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.