Lopinavir
(KJHKTHWMRKYKJE-SUGCFTRWSA-N)
Structure
- SMILES
- O=C(N[C@H]([C@H](C[C@H](Cc1ccccc1)NC(=O)[C@@H](N1CCCNC1=O)C(C)C)O)Cc1ccccc1)COc1c(C)cccc1C
- Type(s)
- Approved
- ATC code(s)
- J05AR10
- Molecular Formula:
- C37H48N4O5
- Molecular Weight:
- 628.801
- Log P:
- 5.3766
- Hydrogen Bond Acceptor:
- 9
- Hydrogen Bond Donor:
- 4
- TPSA:
- 120
- CAS Number(s):
- 192725-17-0
Synonym(s)
1.
Lopinavir
2.
A-157378.0
3.
ABT 378
4.
ABT-378
5.
N-(4-(((2,6-dimethylphenoxy)acetyl)amino)-3-hydroxy-5-phenyl-1-(phenylmethyl)pentyl)tetrahydro-alpha-(1-methylethyl)-2-oxo-1(2H)-pydrimidineacetamide
6.
A 157378.0
7.
A157378.0
8.
ABT378
External Link(s)
Adverse Drug Event(s)
| Name | Number of Reports | Reference(s) | Data Source | |
|---|---|---|---|---|
| 1 | Drug exposure during pregnancy | FAERS: 61 | US FAERS | |
| 2 | Nausea | FAERS: 35 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 3 | Unevaluable event | FAERS: 34 | US FAERS | |
| 4 | Vomiting | FAERS: 29 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 5 | Drug dose omission | FAERS: 26 | US FAERS | |
| 6 | Pneumonia | FAERS: 20 Canada Vigilance: 3 | Canada Vigilance US FAERS | |
| 7 | Weight decreased | FAERS: 18 | US FAERS | |
| 8 | Malaise | FAERS: 14 | US FAERS | |
| 9 | Drug resistance | FAERS: 12 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 10 | Asthenia | FAERS: 11 | US FAERS | |
| 11 | Headache | FAERS: 11 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 12 | Medication Error | FAERS: 11 | US FAERS | |
| 13 | Blood cholesterol increased | FAERS: 10 | US FAERS | |
| 14 | Fatigue | FAERS: 10 Canada Vigilance: 1 | Canada Vigilance OFFSIDES US FAERS | |
| 15 | Incorrect dose administered | FAERS: 10 | US FAERS | |
| 16 | Polydactyly | FAERS: 10 | US FAERS | |
| 17 | Blood triglycerides increased | FAERS: 9 | OFFSIDES US FAERS | |
| 18 | Cachexia | FAERS: 9 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 19 | Drug dispensing error | FAERS: 8 | US FAERS | |
| 20 | General physical health deterioration | FAERS: 8 | OFFSIDES US FAERS | |
| 21 | Lymphoma | FAERS: 8 | US FAERS | |
| 22 | Septic Shock | FAERS: 8 | US FAERS | |
| 23 | Trisomy 21 | FAERS: 8 | OFFSIDES US FAERS | |
| 24 | Abdominal Pain | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 25 | Anxiety | FAERS: 7 | US FAERS | |
| 26 | Cerebrovascular accident | FAERS: 7 | US FAERS | |
| 27 | Completed Suicide | FAERS: 7 | US FAERS | |
| 28 | Epistaxis | FAERS: 7 | US FAERS | |
| 29 | Lymphadenopathy | FAERS: 7 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 30 | Dizziness | FAERS: 6 | US FAERS | |
| 31 | Drug administration error | FAERS: 6 | US FAERS | |
| 32 | Drug ineffective | FAERS: 6 | US FAERS | |
| 33 | Hepatitis C | FAERS: 6 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 34 | Myocardial Infarction | FAERS: 6 | US FAERS | |
| 35 | Nasopharyngitis | FAERS: 6 | US FAERS | |
| 36 | Neonatal disorder | FAERS: 6 | US FAERS | |
| 37 | Overdose | FAERS: 6 | US FAERS | |
| 38 | Pancreatitis | FAERS: 6 | US FAERS | |
| 39 | Acquired Immunodeficiency Syndrome | FAERS: 5 | US FAERS | |
| 40 | Back Pain | FAERS: 5 | US FAERS | |
| 41 | Cerebellar Hypoplasia | FAERS: 5 | US FAERS | |
| 42 | Hepatitis | FAERS: 5 | US FAERS | |
| 43 | Hypoplastic Left Heart Syndrome | FAERS: 5 | US FAERS | |
| 44 | Inappropriate schedule of drug administration | FAERS: 5 | US FAERS | |
| 45 | Maternal exposure during pregnancy | FAERS: 5 | US FAERS | |
| 46 | Medication residue | FAERS: 5 | US FAERS | |
| 47 | Respiratory Failure | FAERS: 5 | US FAERS | |
| 48 | Sepsis | FAERS: 5 | US FAERS | |
| 49 | Suicide attempt | FAERS: 5 | US FAERS | |
| 50 | Testicular mass | FAERS: 5 | US FAERS | |
| 51 | Toxoplasmosis | FAERS: 5 | US FAERS | |
| 52 | Uveitis | FAERS: 5 | US FAERS | |
| 53 | Abscess | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 54 | Antibiotic Prophylaxis | FAERS: 4 | US FAERS | |
| 55 | Arthralgia | FAERS: 4 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 56 | Congenital cystic lung | FAERS: 4 | US FAERS | |
| 57 | Dehydration | FAERS: 4 | US FAERS | |
| 58 | Diabetes Mellitus | FAERS: 4 | US FAERS | |
| 59 | Feeling abnormal | FAERS: 4 | US FAERS | |
| 60 | Gastroduodenitis | FAERS: 4 | US FAERS | |
| 61 | Inflammation | FAERS: 4 | US FAERS | |
| 62 | Metastatic bronchial carcinoma | FAERS: 4 | US FAERS | |
| 63 | Pulmonary Embolism | FAERS: 4 | US FAERS | |
| 64 | Tuberculosis | FAERS: 4 | US FAERS | |
| 65 | nervous system disorder | FAERS: 4 | US FAERS | |
| 66 | Accidental overdose | FAERS: 3 | US FAERS | |
| 67 | Alanine Aminotransferase Increased | FAERS: 3 | US FAERS | |
| 68 | Anal Fistula | FAERS: 3 | US FAERS | |
| 69 | Anorexia | FAERS: 3 | US FAERS | |
| 70 | Atrial Fibrillation | FAERS: 3 | US FAERS | |
| 71 | Atrioventricular Block | FAERS: 3 | US FAERS | |
| 72 | Breech Presentation | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 73 | Cerebral ventricle dilatation | FAERS: 3 | OFFSIDES US FAERS | |
| 74 | Chest Pain | FAERS: 3 | US FAERS | |
| 75 | Chills | FAERS: 3 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 76 | Congenital hydronephrosis | FAERS: 3 | US FAERS | |
| 77 | Congenital inguinal hernia | FAERS: 3 | US FAERS | |
| 78 | Cytolytic hepatitis | FAERS: 3 | US FAERS | |
| 79 | Cytomegalovirus chorioretinitis | FAERS: 3 | US FAERS | |
| 80 | Diabetes mellitus inadequate control | FAERS: 3 | US FAERS | |
| 81 | Dysplasia | FAERS: 3 | US FAERS | |
| 82 | Electrocardiogram abnormal | FAERS: 3 | US FAERS | |
| 83 | Guillain-Barre Syndrome | FAERS: 3 | US FAERS | |
| 84 | Hemiparesis | FAERS: 3 | OFFSIDES US FAERS | |
| 85 | Hemiplegia | FAERS: 3 | US FAERS | |
| 86 | Hydrocephalus | FAERS: 3 | US FAERS | |
| 87 | Hypotension | FAERS: 3 | US FAERS | |
| 88 | Influenza | FAERS: 3 | US FAERS | |
| 89 | Lipodystrophy acquired | FAERS: 3 | OFFSIDES US FAERS | |
| 90 | Lipoma | FAERS: 3 | US FAERS | |
| 91 | Memory impairment | FAERS: 3 | US FAERS | |
| 92 | Nephrolithiasis | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 93 | Nocturia | FAERS: 3 | US FAERS | |
| 94 | Pain | FAERS: 3 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 95 | Paranoia | FAERS: 3 | US FAERS | |
| 96 | Pneumocystis jiroveci pneumonia | FAERS: 3 | OFFSIDES US FAERS | |
| 97 | Pneumothorax | FAERS: 3 | OFFSIDES US FAERS | |
| 98 | Polyhydramnios | FAERS: 3 | US FAERS | |
| 99 | Pruritus | FAERS: 3 | US FAERS | |
| 100 | Restlessness | FAERS: 3 | US FAERS | |
| 101 | Skin lesion | FAERS: 3 | US FAERS | |
| 102 | Somnolence | FAERS: 3 | US FAERS | |
| 103 | Stillbirth | FAERS: 3 | US FAERS | |
| 104 | Thrombocytopenia | FAERS: 3 | US FAERS | |
| 105 | Thrombosis | FAERS: 3 | US FAERS | |
| 106 | Viral load increased | FAERS: 3 | US FAERS | |
| 107 | Abdominal discomfort | FAERS: 2 | US FAERS | |
| 108 | Accidental exposure | FAERS: 2 | US FAERS | |
| 109 | Actinic keratosis | FAERS: 2 | US FAERS | |
| 110 | Acute myocardial infarction | FAERS: 2 | OFFSIDES US FAERS | |
| 111 | Alopecia | FAERS: 2 | US FAERS | |
| 112 | Altered state of consciousness | FAERS: 2 | US FAERS | |
| 113 | Aphonia | FAERS: 2 | US FAERS | |
| 114 | Appendicitis | FAERS: 2 | US FAERS | |
| 115 | Ascites | FAERS: 2 | US FAERS | |
| 116 | Aspartate Aminotransferase Increased | FAERS: 2 | US FAERS | |
| 117 | Ataxia | FAERS: 2 | US FAERS | |
| 118 | Bicytopenia | FAERS: 2 | US FAERS | |
| 119 | Blindness | FAERS: 2 | US FAERS | |
| 120 | Blood potassium increased | FAERS: 2 | US FAERS | |
| 121 | Bradycardia | FAERS: 2 | US FAERS | |
| 122 | Brain Death | FAERS: 2 | US FAERS | |
| 123 | Burning sensation | FAERS: 2 | US FAERS | |
| 124 | CD4 lymphocytes abnormal | FAERS: 2 | US FAERS | |
| 125 | Caudal Regression Syndrome | FAERS: 2 | US FAERS | |
| 126 | Cellulitis | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 127 | Cerebral atrophy | FAERS: 2 | US FAERS | |
| 128 | Choking | FAERS: 2 | US FAERS | |
| 129 | Constipation | FAERS: 2 | US FAERS | |
| 130 | Deafness | FAERS: 2 | US FAERS | |
| 131 | Dental discomfort | FAERS: 2 | US FAERS | |
| 132 | Diplopia | FAERS: 2 | OFFSIDES US FAERS | |
| 133 | Disseminated Intravascular Coagulation | FAERS: 2 | US FAERS | |
| 134 | Double ureter | FAERS: 2 | US FAERS | |
| 135 | Drug level increased | FAERS: 2 | US FAERS | |
| 136 | Drug prescribing error | FAERS: 2 | US FAERS | |
| 137 | Dysmorphism | FAERS: 2 | US FAERS | |
| 138 | Empyema | FAERS: 2 | US FAERS | |
| 139 | Encephalitis | FAERS: 2 | US FAERS | |
| 140 | Epididymitis | FAERS: 2 | US FAERS | |
| 141 | Escherichia urinary tract infection | FAERS: 2 | US FAERS | |
| 142 | Failure to Thrive | FAERS: 2 | US FAERS | |
| 143 | Flatulence | FAERS: 2 | US FAERS | |
| 144 | Flushing | FAERS: 2 | US FAERS | |
| 145 | Gastroenteritis | FAERS: 2 Canada Vigilance: 2 | Canada Vigilance US FAERS | |
| 146 | Gastrointestinal infection | FAERS: 2 | US FAERS | |
| 147 | Gastrointestinal inflammation | FAERS: 2 | US FAERS | |
| 148 | Genital Herpes | FAERS: 2 | US FAERS | |
| 149 | Gestational Diabetes | FAERS: 2 | US FAERS | |
| 150 | HIV Wasting Syndrome | FAERS: 2 | US FAERS | |
| 151 | Hepatotoxicity | FAERS: 2 | US FAERS | |
| 152 | Hip Dysplasia | FAERS: 2 | US FAERS | |
| 153 | Histoplasmosis | FAERS: 2 | OFFSIDES US FAERS | |
| 154 | Hydronephrosis | FAERS: 2 | US FAERS | |
| 155 | Hypersensitivity | FAERS: 2 | US FAERS | |
| 156 | Hypophagia | FAERS: 2 | US FAERS | |
| 157 | Immature respiratory system | FAERS: 2 | US FAERS | |
| 158 | Immune reconstitution syndrome | FAERS: 2 | OFFSIDES US FAERS | |
| 159 | Infection | FAERS: 2 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 160 | Intercepted drug dispensing error | FAERS: 2 | US FAERS | |
| 161 | Laceration | FAERS: 2 | US FAERS | |
| 162 | Low set ears | FAERS: 2 | US FAERS | |
| 163 | MYELODYSPLASTIC SYNDROME | FAERS: 2 | US FAERS | |
| 164 | Metrorrhagia | FAERS: 2 | US FAERS | |
| 165 | Multifocal motor neuropathy | FAERS: 2 | US FAERS | |
| 166 | Multiple Myeloma | FAERS: 2 | US FAERS | |
| 167 | Muscle Rigidity | FAERS: 2 | US FAERS | |
| 168 | Musculoskeletal Pain | FAERS: 2 | US FAERS | |
| 169 | Myocarditis | FAERS: 2 | US FAERS | |
| 170 | Night sweats | FAERS: 2 | US FAERS | |
| 171 | Optic Neuritis | FAERS: 2 | US FAERS | |
| 172 | Oral candidiasis | FAERS: 2 | US FAERS | |
| 173 | Otitis Media | FAERS: 2 | US FAERS | |
| 174 | Palpitations | FAERS: 2 | US FAERS | |
| 175 | Pancytopenia | FAERS: 2 | US FAERS | |
| 176 | Patent ductus arteriosus | FAERS: 2 | US FAERS | |
| 177 | Petechiae | FAERS: 2 | US FAERS | |
| 178 | Pharmaceutical product complaint | FAERS: 2 | US FAERS | |
| 179 | Photophobia | FAERS: 2 | US FAERS | |
| 180 | Placental Insufficiency | FAERS: 2 | US FAERS | |
| 181 | Proteinuria | FAERS: 2 | US FAERS | |
| 182 | Psoas Abscess | FAERS: 2 | US FAERS | |
| 183 | Purulent discharge | FAERS: 2 | US FAERS | |
| 184 | Pyelectasia | FAERS: 2 | US FAERS | |
| 185 | Rhabdomyolysis | FAERS: 2 | OFFSIDES US FAERS | |
| 186 | Sinusitis | FAERS: 2 | OFFSIDES US FAERS | |
| 187 | Strabismus | FAERS: 2 | US FAERS | |
| 188 | Sudden death | FAERS: 2 | US FAERS | |
| 189 | Syncope | FAERS: 2 | US FAERS | |
| 190 | Synovitis | FAERS: 2 | US FAERS | |
| 191 | Systemic Inflammatory Response Syndrome | FAERS: 2 | US FAERS | |
| 192 | Tachycardia | FAERS: 2 | US FAERS | |
| 193 | Thermal burn | FAERS: 2 | US FAERS | |
| 194 | Thrombophlebitis | FAERS: 2 | US FAERS | |
| 195 | Toxic Epidermal Necrolysis | FAERS: 2 | US FAERS | |
| 196 | Toxicity to various agents | FAERS: 2 | US FAERS | |
| 197 | Umbilical hernia | FAERS: 2 | US FAERS | |
| 198 | Underweight | FAERS: 2 | US FAERS | |
| 199 | Wrong technique in drug usage process | FAERS: 2 | US FAERS | |
| 200 | jaundice | FAERS: 2 | US FAERS | |
| 201 | Abdominal Infection | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 202 | Acidosis | FAERS: 1 | OFFSIDES US FAERS | |
| 203 | Activities of daily living impaired | FAERS: 1 | US FAERS | |
| 204 | Acute psychosis | FAERS: 1 | US FAERS | |
| 205 | Adenocarcinoma | FAERS: 1 | US FAERS | |
| 206 | Adverse event | FAERS: 1 | US FAERS | |
| 207 | Agitation | FAERS: 1 | US FAERS | |
| 208 | Alcohol withdrawal syndrome | FAERS: 1 | US FAERS | |
| 209 | Anencephaly | FAERS: 1 | US FAERS | |
| 210 | Arthritis | FAERS: 1 | US FAERS | |
| 211 | Arthropathy | FAERS: 1 | US FAERS | |
| 212 | Ascites infection | FAERS: 1 | US FAERS | |
| 213 | Atrioventricular Septal Defect | FAERS: 1 | OFFSIDES US FAERS | |
| 214 | Autoimmune thyroiditis | FAERS: 1 | US FAERS | |
| 215 | Autosomal chromosome anomaly | FAERS: 1 | US FAERS | |
| 216 | Bipolar Disorder | FAERS: 1 | 16368918 | CTD US FAERS |
| 217 | Blood creatine phosphokinase increased | FAERS: 1 | US FAERS | |
| 218 | Blood creatinine increased | FAERS: 1 | US FAERS | |
| 219 | Blood glucose increased | FAERS: 1 | US FAERS | |
| 220 | Blood lactate dehydrogenase increased | FAERS: 1 | US FAERS | |
| 221 | Blood sodium decreased | FAERS: 1 | US FAERS | |
| 222 | Body fat disorder | FAERS: 1 | US FAERS | |
| 223 | Bone pain | FAERS: 1 | OFFSIDES US FAERS | |
| 224 | Bowel movement irregularity | FAERS: 1 | US FAERS | |
| 225 | Bronchitis | FAERS: 1 | US FAERS | |
| 226 | CD4 Lymphocytes Decreased | FAERS: 1 | US FAERS | |
| 227 | Cardiac Arrest | FAERS: 1 | US FAERS | |
| 228 | Cardiac ventricular disorder | FAERS: 1 | US FAERS | |
| 229 | Catarrh | FAERS: 1 | US FAERS | |
| 230 | Cerebral Infarction | FAERS: 1 | US FAERS | |
| 231 | Cerebral dysgenesis | FAERS: 1 | US FAERS | |
| 232 | Cervical dysplasia | FAERS: 1 | US FAERS | |
| 233 | Cervix carcinoma | FAERS: 1 | US FAERS | |
| 234 | Cholelithiasis | FAERS: 1 | US FAERS | |
| 235 | Clostridium colitis | FAERS: 1 | US FAERS | |
| 236 | Congenital Hydrocephalus | FAERS: 1 | US FAERS | |
| 237 | Congenital tricuspid valve incompetence | FAERS: 1 | US FAERS | |
| 238 | Congenital urinary tract obstruction | FAERS: 1 | US FAERS | |
| 239 | Conjunctivitis | FAERS: 1 | US FAERS | |
| 240 | Coronary Artery Disease | FAERS: 1 | US FAERS | |
| 241 | Creatinine renal clearance decreased | FAERS: 1 | US FAERS | |
| 242 | Cytomegalovirus test | FAERS: 1 | US FAERS | |
| 243 | Depressed Level of Consciousness | FAERS: 1 | US FAERS | |
| 244 | Device breakage | FAERS: 1 | US FAERS | |
| 245 | Diverticular perforation | FAERS: 1 | US FAERS | |
| 246 | Drug Dependence | FAERS: 1 | US FAERS | |
| 247 | Drug screen positive | FAERS: 1 | US FAERS | |
| 248 | Dysgeusia | FAERS: 1 | US FAERS | |
| 249 | Dyspepsia | FAERS: 1 | US FAERS | |
| 250 | Dystonia | FAERS: 1 | US FAERS | |
| 251 | Ear congestion | FAERS: 1 | US FAERS | |
| 252 | Emotional distress | FAERS: 1 | US FAERS | |
| 253 | Endometrial Hyperplasia | FAERS: 1 | US FAERS | |
| 254 | Erectile dysfunction | FAERS: 1 | US FAERS | |
| 255 | Erythema | FAERS: 1 | US FAERS | |
| 256 | Exophthalmos | FAERS: 1 | US FAERS | |
| 257 | Expired product administered | FAERS: 1 | US FAERS | |
| 258 | Febrile Neutropenia | FAERS: 1 | OFFSIDES US FAERS | |
| 259 | Full blood count decreased | FAERS: 1 | US FAERS | |
| 260 | Gamma-Glutamyltransferase Increased | FAERS: 1 | US FAERS | |
| 261 | Gastric Dilatation | FAERS: 1 | US FAERS | |
| 262 | Gastric infection | FAERS: 1 | US FAERS | |
| 263 | Germ Cell Cancer | FAERS: 1 | US FAERS | |
| 264 | Gluten sensitivity | FAERS: 1 | US FAERS | |
| 265 | Granuloma | FAERS: 1 | US FAERS | |
| 266 | HELLP Syndrome | FAERS: 1 | US FAERS | |
| 267 | Hepatic Encephalopathy | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 268 | Hepatitis B positive | FAERS: 1 | OFFSIDES US FAERS | |
| 269 | Hepatitis B | FAERS: 1 | US FAERS | |
| 270 | Hepatosplenomegaly | FAERS: 1 | OFFSIDES US FAERS | |
| 271 | Hernia | FAERS: 1 | US FAERS | |
| 272 | Hypoxia | FAERS: 1 | US FAERS | |
| 273 | Impaired gastric emptying | FAERS: 1 | US FAERS | |
| 274 | Incontinence | FAERS: 1 | OFFSIDES US FAERS | |
| 275 | Intentional product misuse | FAERS: 1 | US FAERS | |
| 276 | Intracranial Aneurysm | FAERS: 1 | US FAERS | |
| 277 | Iridocyclitis | FAERS: 1 | US FAERS | |
| 278 | Ketoacidosis | FAERS: 1 | US FAERS | |
| 279 | Laryngeal discomfort | FAERS: 1 | US FAERS | |
| 280 | Leukocytosis | FAERS: 1 | US FAERS | |
| 281 | Leukoencephalopathy | FAERS: 1 | OFFSIDES US FAERS | |
| 282 | Lipids abnormal | FAERS: 1 | OFFSIDES US FAERS | |
| 283 | Lipohypertrophy | FAERS: 1 | US FAERS | |
| 284 | Lobar Pneumonia | FAERS: 1 | US FAERS | |
| 285 | Low birth weight baby | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 286 | Low density lipoprotein increased | FAERS: 1 | US FAERS | |
| 287 | Lower respiratory tract infection | FAERS: 1 | US FAERS | |
| 288 | Lymph Node Tuberculosis | FAERS: 1 | US FAERS | |
| 289 | Lymphogranuloma Venereum | FAERS: 1 | US FAERS | |
| 290 | Malignant neoplasm progression | FAERS: 1 | US FAERS | |
| 291 | Medication residue present | FAERS: 1 | US FAERS | |
| 292 | Meningomyelocele | FAERS: 1 | US FAERS | |
| 293 | Mental status changes | FAERS: 1 | US FAERS | |
| 294 | Metaplasia | FAERS: 1 | US FAERS | |
| 295 | Metastasis | FAERS: 1 | US FAERS | |
| 296 | Metastatic Neoplasm | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 297 | Mucosal erosion | FAERS: 1 | US FAERS | |
| 298 | Multi-organ disorder | FAERS: 1 | US FAERS | |
| 299 | Muscle Fatigue | FAERS: 1 | US FAERS | |
| 300 | Muscle abscess | FAERS: 1 | US FAERS | |
| 301 | Myalgia | FAERS: 1 | US FAERS | |
| 302 | Myoclonus | FAERS: 1 | US FAERS | |
| 303 | Nephritis | FAERS: 1 | US FAERS | |
| 304 | Nipple pain | FAERS: 1 | US FAERS | |
| 305 | Obesity surgery | FAERS: 1 | US FAERS | |
| 306 | Optic Nerve Hypoplasia | FAERS: 1 | US FAERS | |
| 307 | Oropharyngeal pain | FAERS: 1 | US FAERS | |
| 308 | Osteoporosis | FAERS: 1 | OFFSIDES US FAERS | |
| 309 | Peritonitis | FAERS: 1 | US FAERS | |
| 310 | Pneumonitis | FAERS: 1 | US FAERS | |
| 311 | Polyneuropathy | FAERS: 1 | US FAERS | |
| 312 | Portal Hypertension | FAERS: 1 | OFFSIDES US FAERS | |
| 313 | Post procedural infection | FAERS: 1 | US FAERS | |
| 314 | Product physical consistency issue | FAERS: 1 | US FAERS | |
| 315 | Product quality issue | FAERS: 1 | US FAERS | |
| 316 | Product residue present | FAERS: 1 | US FAERS | |
| 317 | Product taste abnormal | FAERS: 1 | US FAERS | |
| 318 | Productive Cough | FAERS: 1 | US FAERS | |
| 319 | Prothrombin time abnormal | FAERS: 1 | US FAERS | |
| 320 | Psychiatric symptom | FAERS: 1 | US FAERS | |
| 321 | Pulmonary Hypertension | FAERS: 1 | OFFSIDES US FAERS | |
| 322 | Quadriparesis | FAERS: 1 | US FAERS | |
| 323 | Respiratory arrest | FAERS: 1 | US FAERS | |
| 324 | Respiratory distress | FAERS: 1 | US FAERS | |
| 325 | Retinal pigment epitheliopathy | FAERS: 1 | US FAERS | |
| 326 | Sarcoidosis | FAERS: 1 | US FAERS | |
| 327 | Sexual Dysfunction | FAERS: 1 | US FAERS | |
| 328 | Shock | FAERS: 1 | US FAERS | |
| 329 | Sick Sinus Syndrome | FAERS: 1 | US FAERS | |
| 330 | Skin Induration | FAERS: 1 | US FAERS | |
| 331 | Skin Papilloma | FAERS: 1 | US FAERS | |
| 332 | Skin reaction | FAERS: 1 | US FAERS | |
| 333 | Sluggishness | FAERS: 1 | US FAERS | |
| 334 | Spina Bifida Occulta | FAERS: 1 | US FAERS | |
| 335 | Spina Bifida | FAERS: 1 | US FAERS | |
| 336 | Spinal column stenosis | FAERS: 1 | US FAERS | |
| 337 | Splenomegaly | FAERS: 1 | US FAERS | |
| 338 | Stress at work | FAERS: 1 | US FAERS | |
| 339 | Subileus | FAERS: 1 | US FAERS | |
| 340 | Swelling | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 341 | Tablet issue | FAERS: 1 | US FAERS | |
| 342 | Tachyarrhythmia | FAERS: 1 | US FAERS | |
| 343 | Terminal state | FAERS: 1 | US FAERS | |
| 344 | Therapeutic response unexpected | FAERS: 1 | US FAERS | |
| 345 | Therapy cessation | FAERS: 1 | US FAERS | |
| 346 | Throat cancer | FAERS: 1 | US FAERS | |
| 347 | Thrombectomy | FAERS: 1 | US FAERS | |
| 348 | Thrombocytopenic purpura | FAERS: 1 | US FAERS | |
| 349 | Tooth Extraction | FAERS: 1 Canada Vigilance: 1 | Canada Vigilance US FAERS | |
| 350 | Tooth Loss | FAERS: 1 | US FAERS | |
| 351 | Transaminases abnormal | FAERS: 1 | US FAERS | |
| 352 | Transaminases increased | FAERS: 1 | OFFSIDES US FAERS | |
| 353 | Tremor | FAERS: 1 | US FAERS | |
| 354 | Urinary tract infection | FAERS: 1 | US FAERS | |
| 355 | Urticaria | FAERS: 1 | US FAERS | |
| 356 | Visual disturbance | FAERS: 1 | US FAERS | |
| 357 | Wrong drug administered | FAERS: 1 | US FAERS | |
| 358 | Acquired Protein S Deficiency | OFFSIDES | ||
| 359 | Acute respiratory failure | OFFSIDES | ||
| 360 | Agraphia | OFFSIDES | ||
| 361 | Aortic embolus | OFFSIDES | ||
| 362 | Blepharoptosis | OFFSIDES | ||
| 363 | Blood HIV RNA | OFFSIDES | ||
| 364 | Blood immunoglobulin A increased | OFFSIDES | ||
| 365 | Blood immunoglobulin G increased | OFFSIDES | ||
| 366 | Blood immunoglobulin M | OFFSIDES | ||
| 367 | Blood phosphorus decreased | OFFSIDES | ||
| 368 | Bone infarction | OFFSIDES | ||
| 369 | Bone marrow toxicity | OFFSIDES | ||
| 370 | Brain stem syndrome | OFFSIDES | ||
| 371 | Bruxism | OFFSIDES | ||
| 372 | CD4 lymphocytes increased | OFFSIDES | ||
| 373 | Catatonia | OFFSIDES | ||
| 374 | Central nervous system lesion | OFFSIDES | ||
| 375 | Chemical and Drug Induced Liver Injury | 23956101 24014644 | CTD | |
| 376 | Concomitant disease aggravated | Canada Vigilance: 1 | Canada Vigilance | |
| 377 | Congenital hepatobiliary anomaly | OFFSIDES | ||
| 378 | Congenital nystagmus | OFFSIDES | ||
| 379 | Consciousness fluctuating | OFFSIDES | ||
| 380 | Demyelination | OFFSIDES | ||
| 381 | Depressed mood | OFFSIDES | ||
| 382 | Drowsiness | OFFSIDES | ||
| 383 | Electrocardiogram QRS complex | OFFSIDES | ||
| 384 | Electromechanical dissociation | OFFSIDES | ||
| 385 | Euphoric mood | OFFSIDES | ||
| 386 | Fanconi Syndrome | 14689363 | CTD OFFSIDES | |
| 387 | Fanconi like syndrome | 16773419 | CTD | |
| 388 | Fatty Liver | OFFSIDES | ||
| 389 | Gaze palsy | OFFSIDES | ||
| 390 | Genotype drug resistance test positive | OFFSIDES | ||
| 391 | HIV Infections | 17378895 17461719 19908326 | CTD | |
| 392 | HIV-Associated Lipodystrophy Syndrome | 18230615 | CTD | |
| 393 | Hepatic displacement | OFFSIDES | ||
| 394 | Hyperreflexia | OFFSIDES | ||
| 395 | Hypervigilance | OFFSIDES | ||
| 396 | Hypokinesia | OFFSIDES | ||
| 397 | Hyporeflexia | OFFSIDES | ||
| 398 | Infusion site mobility decreased | OFFSIDES | ||
| 399 | Kidney Failure | OFFSIDES | ||
| 400 | Meconium Aspiration Syndrome | Canada Vigilance: 1 | Canada Vigilance | |
| 401 | Microcephaly | OFFSIDES | ||
| 402 | Mitochondrial toxicity | OFFSIDES | ||
| 403 | Monoparesis | OFFSIDES | ||
| 404 | Motor retardation | OFFSIDES | ||
| 405 | Myasthenia Gravis | OFFSIDES | ||
| 406 | Mycobacterium Infections | 21442799 | CTD | |
| 407 | Necrotising granulomatous lymphadenitis | OFFSIDES | ||
| 408 | Neutropenia | 17378895 | CTD | |
| 409 | Nodular regenerative hyperplasia | OFFSIDES | ||
| 410 | Ophthalmoplegia | OFFSIDES | ||
| 411 | Parkinsonian Disorders | 19908326 | CTD | |
| 412 | Pathological fracture | Canada Vigilance: 1 | Canada Vigilance | |
| 413 | Polyuria | OFFSIDES | ||
| 414 | Portal Vein Thrombosis | OFFSIDES | ||
| 415 | Portal hypertensive gastropathy | OFFSIDES | ||
| 416 | Psoriasis | OFFSIDES | ||
| 417 | Renal Insufficiency | 16773419 | CTD | |
| 418 | Renal tubular necrosis | OFFSIDES | ||
| 419 | Retinitis | OFFSIDES | ||
| 420 | Salmonella | OFFSIDES | ||
| 421 | Skin laceration | Canada Vigilance: 1 | Canada Vigilance | |
| 422 | Status Epilepticus | 20851280 | CTD | |
| 423 | Therapeutic product effect decreased | Canada Vigilance: 1 | Canada Vigilance | |
| 424 | Thoracic vertebral fracture | OFFSIDES | ||
| 425 | Unresponsive to stimuli | Canada Vigilance: 1 | Canada Vigilance | |
| 426 | VIIth nerve paralysis | OFFSIDES | ||
| 427 | treatment failure | OFFSIDES |
Powered by :
Page last updated at 2020-05-25 10:01:57 (Asia/Shanghai) | You are visitor No. 120236
Copyright © 2019-2020 Laboratory of Molecular Modeling and Design, Shanghai Key Laboratory of New Drug Design, School of Pharmacy, East China University of Science and Technology. All rights reserved.